From 40c66b174197c3cb212dcb10cca33bd52cb733fe Mon Sep 17 00:00:00 2001 From: Peter Steinberger Date: Sat, 13 Dec 2025 18:09:59 +0000 Subject: [PATCH] chore(webchat): refresh bundled assets --- .../Resources/WebChat/webchat.bundle.js | 16250 ++++++++-------- 1 file changed, 8227 insertions(+), 8023 deletions(-) diff --git a/apps/macos/Sources/Clawdis/Resources/WebChat/webchat.bundle.js b/apps/macos/Sources/Clawdis/Resources/WebChat/webchat.bundle.js index 225ecd899ef..ed66cac5c7f 100644 --- a/apps/macos/Sources/Clawdis/Resources/WebChat/webchat.bundle.js +++ b/apps/macos/Sources/Clawdis/Resources/WebChat/webchat.bundle.js @@ -361,7 +361,7 @@ var init_agent = __esmMin((() => { } } if (partial && partial.role === "assistant" && partial.content.length > 0) { - const onlyEmpty = !partial.content.some((c$7) => c$7.type === "thinking" && c$7.thinking.trim().length > 0 || c$7.type === "text" && c$7.text.trim().length > 0 || c$7.type === "toolCall" && c$7.name.trim().length > 0); + const onlyEmpty = !partial.content.some((c$6) => c$6.type === "thinking" && c$6.thinking.trim().length > 0 || c$6.type === "text" && c$6.text.trim().length > 0 || c$6.type === "toolCall" && c$6.name.trim().length > 0); if (!onlyEmpty) { this.appendMessage(partial); } else { @@ -437,7 +437,7 @@ var init_agent = __esmMin((() => { //#endregion //#region node_modules/@lit/reactive-element/css-tag.js -var t$5, e$8, s$4, o$9, n$7, r$8, i$5, S$3, c$5; +var t$5, e$8, s$4, o$9, n$7, r$7, i$5, S$3, c$4; var init_css_tag = __esmMin((() => { t$5 = globalThis, e$8 = t$5.ShadowRoot && (void 0 === t$5.ShadyCSS || t$5.ShadyCSS.nativeShadow) && "adoptedStyleSheets" in Document.prototype && "replace" in CSSStyleSheet.prototype, s$4 = Symbol(), o$9 = new WeakMap(); n$7 = class { @@ -458,7 +458,7 @@ var init_css_tag = __esmMin((() => { return this.cssText; } }; - r$8 = (t$6) => new n$7("string" == typeof t$6 ? t$6 : t$6 + "", void 0, s$4), i$5 = (t$6, ...e$10) => { + r$7 = (t$6) => new n$7("string" == typeof t$6 ? t$6 : t$6 + "", void 0, s$4), i$5 = (t$6, ...e$10) => { const o$10 = 1 === t$6.length ? t$6[0] : e$10.reduce(((e$11, s$5, o$11) => e$11 + ((t$7) => { if (!0 === t$7._$cssResult$) return t$7.cssText; if ("number" == typeof t$7) return t$7; @@ -471,19 +471,19 @@ var init_css_tag = __esmMin((() => { const o$11 = document.createElement("style"), n$9 = t$5.litNonce; void 0 !== n$9 && o$11.setAttribute("nonce", n$9), o$11.textContent = e$10.cssText, s$5.appendChild(o$11); } - }, c$5 = e$8 ? (t$6) => t$6 : (t$6) => t$6 instanceof CSSStyleSheet ? ((t$7) => { + }, c$4 = e$8 ? (t$6) => t$6 : (t$6) => t$6 instanceof CSSStyleSheet ? ((t$7) => { let e$10 = ""; for (const s$5 of t$7.cssRules) e$10 += s$5.cssText; - return r$8(e$10); + return r$7(e$10); })(t$6) : t$6; })); //#endregion //#region node_modules/@lit/reactive-element/reactive-element.js -var i$6, e$9, h$4, r$9, o$8, n$8, a$1, c$6, l$2, p$2, d$4, u$1, f, b$2, y$1; +var i$6, e$9, h$4, r$8, o$8, n$8, a$1, c$5, l$2, p$2, d$3, u$1, f, b$2, y$1; var init_reactive_element = __esmMin((() => { init_css_tag(); - ({is: i$6, defineProperty: e$9, getOwnPropertyDescriptor: h$4, getOwnPropertyNames: r$9, getOwnPropertySymbols: o$8, getPrototypeOf: n$8} = Object), a$1 = globalThis, c$6 = a$1.trustedTypes, l$2 = c$6 ? c$6.emptyScript : "", p$2 = a$1.reactiveElementPolyfillSupport, d$4 = (t$6, s$5) => t$6, u$1 = { + ({is: i$6, defineProperty: e$9, getOwnPropertyDescriptor: h$4, getOwnPropertyNames: r$8, getOwnPropertySymbols: o$8, getPrototypeOf: n$8} = Object), a$1 = globalThis, c$5 = a$1.trustedTypes, l$2 = c$5 ? c$5.emptyScript : "", p$2 = a$1.reactiveElementPolyfillSupport, d$3 = (t$6, s$5) => t$6, u$1 = { toAttribute(t$6, s$5) { switch (s$5) { case Boolean: @@ -535,7 +535,7 @@ var init_reactive_element = __esmMin((() => { } } static getPropertyDescriptor(t$6, s$5, i$7) { - const { get: e$10, set: r$10 } = h$4(this.prototype, t$6) ?? { + const { get: e$10, set: r$9 } = h$4(this.prototype, t$6) ?? { get() { return this[s$5]; }, @@ -547,7 +547,7 @@ var init_reactive_element = __esmMin((() => { get: e$10, set(s$6) { const h$5 = e$10?.call(this); - r$10?.call(this, s$6), this.requestUpdate(t$6, h$5, i$7); + r$9?.call(this, s$6), this.requestUpdate(t$6, h$5, i$7); }, configurable: !0, enumerable: !0 @@ -557,14 +557,14 @@ var init_reactive_element = __esmMin((() => { return this.elementProperties.get(t$6) ?? b$2; } static _$Ei() { - if (this.hasOwnProperty(d$4("elementProperties"))) return; + if (this.hasOwnProperty(d$3("elementProperties"))) return; const t$6 = n$8(this); t$6.finalize(), void 0 !== t$6.l && (this.l = [...t$6.l]), this.elementProperties = new Map(t$6.elementProperties); } static finalize() { - if (this.hasOwnProperty(d$4("finalized"))) return; - if (this.finalized = !0, this._$Ei(), this.hasOwnProperty(d$4("properties"))) { - const t$7 = this.properties, s$5 = [...r$9(t$7), ...o$8(t$7)]; + if (this.hasOwnProperty(d$3("finalized"))) return; + if (this.finalized = !0, this._$Ei(), this.hasOwnProperty(d$3("properties"))) { + const t$7 = this.properties, s$5 = [...r$8(t$7), ...o$8(t$7)]; for (const i$7 of s$5) this.createProperty(i$7, t$7[i$7]); } const t$6 = this[Symbol.metadata]; @@ -583,8 +583,8 @@ var init_reactive_element = __esmMin((() => { const i$7 = []; if (Array.isArray(s$5)) { const e$10 = new Set(s$5.flat(1 / 0).reverse()); - for (const s$6 of e$10) i$7.unshift(c$5(s$6)); - } else void 0 !== s$5 && i$7.push(c$5(s$5)); + for (const s$6 of e$10) i$7.unshift(c$4(s$6)); + } else void 0 !== s$5 && i$7.push(c$4(s$5)); return i$7; } static _$Eu(t$6, s$5) { @@ -634,8 +634,8 @@ var init_reactive_element = __esmMin((() => { if (void 0 !== e$10 && this._$Em !== e$10) { const t$7 = i$7.getPropertyOptions(e$10), h$5 = "function" == typeof t$7.converter ? { fromAttribute: t$7.converter } : void 0 !== t$7.converter?.fromAttribute ? t$7.converter : u$1; this._$Em = e$10; - const r$10 = h$5.fromAttribute(s$5, t$7.type); - this[e$10] = r$10 ?? this._$Ej?.get(e$10) ?? r$10, this._$Em = null; + const r$9 = h$5.fromAttribute(s$5, t$7.type); + this[e$10] = r$9 ?? this._$Ej?.get(e$10) ?? r$9, this._$Em = null; } } requestUpdate(t$6, s$5, i$7) { @@ -646,8 +646,8 @@ var init_reactive_element = __esmMin((() => { } !1 === this.isUpdatePending && (this._$ES = this._$EP()); } - C(t$6, s$5, { useDefault: i$7, reflect: e$10, wrapped: h$5 }, r$10) { - i$7 && !(this._$Ej ??= new Map()).has(t$6) && (this._$Ej.set(t$6, r$10 ?? s$5 ?? this[t$6]), !0 !== h$5 || void 0 !== r$10) || (this._$AL.has(t$6) || (this.hasUpdated || i$7 || (s$5 = void 0), this._$AL.set(t$6, s$5)), !0 === e$10 && this._$Em !== t$6 && (this._$Eq ??= new Set()).add(t$6)); + C(t$6, s$5, { useDefault: i$7, reflect: e$10, wrapped: h$5 }, r$9) { + i$7 && !(this._$Ej ??= new Map()).has(t$6) && (this._$Ej.set(t$6, r$9 ?? s$5 ?? this[t$6]), !0 !== h$5 || void 0 !== r$9) || (this._$AL.has(t$6) || (this.hasUpdated || i$7 || (s$5 = void 0), this._$AL.set(t$6, s$5)), !0 === e$10 && this._$Em !== t$6 && (this._$Eq ??= new Set()).add(t$6)); } async _$EP() { this.isUpdatePending = !0; @@ -706,7 +706,7 @@ var init_reactive_element = __esmMin((() => { updated(t$6) {} firstUpdated(t$6) {} }; - y$1.elementStyles = [], y$1.shadowRootOptions = { mode: "open" }, y$1[d$4("elementProperties")] = new Map(), y$1[d$4("finalized")] = new Map(), p$2?.({ ReactiveElement: y$1 }), (a$1.reactiveElementVersions ??= []).push("2.1.1"); + y$1.elementStyles = [], y$1.shadowRootOptions = { mode: "open" }, y$1[d$3("elementProperties")] = new Map(), y$1[d$3("finalized")] = new Map(), p$2?.({ ReactiveElement: y$1 }), (a$1.reactiveElementVersions ??= []).push("2.1.1"); })); //#endregion @@ -718,80 +718,80 @@ function P$1(t$6, i$7) { function S$2(t$6, i$7, s$5 = t$6, e$10) { if (i$7 === T$2) return i$7; let h$5 = void 0 !== e$10 ? s$5._$Co?.[e$10] : s$5._$Cl; - const o$10 = c$4(i$7) ? void 0 : i$7._$litDirective$; + const o$10 = c$3(i$7) ? void 0 : i$7._$litDirective$; return h$5?.constructor !== o$10 && (h$5?._$AO?.(!1), void 0 === o$10 ? h$5 = void 0 : (h$5 = new o$10(t$6), h$5._$AT(t$6, s$5, e$10)), void 0 !== e$10 ? (s$5._$Co ??= [])[e$10] = h$5 : s$5._$Cl = h$5), void 0 !== h$5 && (i$7 = S$2(t$6, h$5._$AS(t$6, i$7.values), h$5, e$10)), i$7; } -var t$4, i$4, s$3, e$7, h$3, o$7, n$6, r$7, l$1, c$4, a, u$3, d$3, f$3, v$2, _$1, m$2, p$1, g, $$2, y$2, x, b$1, w$1, T$2, E$1, A, C$1, V$1, N$1, M$2, R, k$1, H, I$1, L$1, z$1, Z, j$1, B$1; +var t$4, i$4, s$3, e$7, h$3, o$7, n$6, r$6, l$1, c$3, a, u$3, d$2, f$3, v$2, _$1, m$2, p$1, g, $$2, y$2, x, b$1, w$1, T$2, E$1, A, C$1, V$1, N$1, M$2, R, k$1, H, I$1, L$1, z$1, Z, j$1, B$1; var init_lit_html = __esmMin((() => { - t$4 = globalThis, i$4 = t$4.trustedTypes, s$3 = i$4 ? i$4.createPolicy("lit-html", { createHTML: (t$6) => t$6 }) : void 0, e$7 = "$lit$", h$3 = `lit$${Math.random().toFixed(9).slice(2)}$`, o$7 = "?" + h$3, n$6 = `<${o$7}>`, r$7 = document, l$1 = () => r$7.createComment(""), c$4 = (t$6) => null === t$6 || "object" != typeof t$6 && "function" != typeof t$6, a = Array.isArray, u$3 = (t$6) => a(t$6) || "function" == typeof t$6?.[Symbol.iterator], d$3 = "[ \n\f\r]", f$3 = /<(?:(!--|\/[^a-zA-Z])|(\/?[a-zA-Z][^>\s]*)|(\/?$))/g, v$2 = /-->/g, _$1 = />/g, m$2 = RegExp(`>|${d$3}(?:([^\\s"'>=/]+)(${d$3}*=${d$3}*(?:[^ \t\n\f\r"'\`<>=]|("|')|))|$)`, "g"), p$1 = /'/g, g = /"/g, $$2 = /^(?:script|style|textarea|title)$/i, y$2 = (t$6) => (i$7, ...s$5) => ({ + t$4 = globalThis, i$4 = t$4.trustedTypes, s$3 = i$4 ? i$4.createPolicy("lit-html", { createHTML: (t$6) => t$6 }) : void 0, e$7 = "$lit$", h$3 = `lit$${Math.random().toFixed(9).slice(2)}$`, o$7 = "?" + h$3, n$6 = `<${o$7}>`, r$6 = document, l$1 = () => r$6.createComment(""), c$3 = (t$6) => null === t$6 || "object" != typeof t$6 && "function" != typeof t$6, a = Array.isArray, u$3 = (t$6) => a(t$6) || "function" == typeof t$6?.[Symbol.iterator], d$2 = "[ \n\f\r]", f$3 = /<(?:(!--|\/[^a-zA-Z])|(\/?[a-zA-Z][^>\s]*)|(\/?$))/g, v$2 = /-->/g, _$1 = />/g, m$2 = RegExp(`>|${d$2}(?:([^\\s"'>=/]+)(${d$2}*=${d$2}*(?:[^ \t\n\f\r"'\`<>=]|("|')|))|$)`, "g"), p$1 = /'/g, g = /"/g, $$2 = /^(?:script|style|textarea|title)$/i, y$2 = (t$6) => (i$7, ...s$5) => ({ _$litType$: t$6, strings: i$7, values: s$5 - }), x = y$2(1), b$1 = y$2(2), w$1 = y$2(3), T$2 = Symbol.for("lit-noChange"), E$1 = Symbol.for("lit-nothing"), A = new WeakMap(), C$1 = r$7.createTreeWalker(r$7, 129); + }), x = y$2(1), b$1 = y$2(2), w$1 = y$2(3), T$2 = Symbol.for("lit-noChange"), E$1 = Symbol.for("lit-nothing"), A = new WeakMap(), C$1 = r$6.createTreeWalker(r$6, 129); V$1 = (t$6, i$7) => { const s$5 = t$6.length - 1, o$10 = []; - let r$10, l$3 = 2 === i$7 ? "" : 3 === i$7 ? "" : "", c$7 = f$3; + let r$9, l$3 = 2 === i$7 ? "" : 3 === i$7 ? "" : "", c$6 = f$3; for (let i$8 = 0; i$8 < s$5; i$8++) { const s$6 = t$6[i$8]; - let a$2, u$4, d$5 = -1, y$3 = 0; - for (; y$3 < s$6.length && (c$7.lastIndex = y$3, u$4 = c$7.exec(s$6), null !== u$4);) y$3 = c$7.lastIndex, c$7 === f$3 ? "!--" === u$4[1] ? c$7 = v$2 : void 0 !== u$4[1] ? c$7 = _$1 : void 0 !== u$4[2] ? ($$2.test(u$4[2]) && (r$10 = RegExp("" === u$4[0] ? (c$7 = r$10 ?? f$3, d$5 = -1) : void 0 === u$4[1] ? d$5 = -2 : (d$5 = c$7.lastIndex - u$4[2].length, a$2 = u$4[1], c$7 = void 0 === u$4[3] ? m$2 : "\"" === u$4[3] ? g : p$1) : c$7 === g || c$7 === p$1 ? c$7 = m$2 : c$7 === v$2 || c$7 === _$1 ? c$7 = f$3 : (c$7 = m$2, r$10 = void 0); - const x$2 = c$7 === m$2 && t$6[i$8 + 1].startsWith("/>") ? " " : ""; - l$3 += c$7 === f$3 ? s$6 + n$6 : d$5 >= 0 ? (o$10.push(a$2), s$6.slice(0, d$5) + e$7 + s$6.slice(d$5) + h$3 + x$2) : s$6 + h$3 + (-2 === d$5 ? i$8 : x$2); + let a$2, u$4, d$4 = -1, y$3 = 0; + for (; y$3 < s$6.length && (c$6.lastIndex = y$3, u$4 = c$6.exec(s$6), null !== u$4);) y$3 = c$6.lastIndex, c$6 === f$3 ? "!--" === u$4[1] ? c$6 = v$2 : void 0 !== u$4[1] ? c$6 = _$1 : void 0 !== u$4[2] ? ($$2.test(u$4[2]) && (r$9 = RegExp("" === u$4[0] ? (c$6 = r$9 ?? f$3, d$4 = -1) : void 0 === u$4[1] ? d$4 = -2 : (d$4 = c$6.lastIndex - u$4[2].length, a$2 = u$4[1], c$6 = void 0 === u$4[3] ? m$2 : "\"" === u$4[3] ? g : p$1) : c$6 === g || c$6 === p$1 ? c$6 = m$2 : c$6 === v$2 || c$6 === _$1 ? c$6 = f$3 : (c$6 = m$2, r$9 = void 0); + const x$2 = c$6 === m$2 && t$6[i$8 + 1].startsWith("/>") ? " " : ""; + l$3 += c$6 === f$3 ? s$6 + n$6 : d$4 >= 0 ? (o$10.push(a$2), s$6.slice(0, d$4) + e$7 + s$6.slice(d$4) + h$3 + x$2) : s$6 + h$3 + (-2 === d$4 ? i$8 : x$2); } return [P$1(t$6, l$3 + (t$6[s$5] || "") + (2 === i$7 ? "" : 3 === i$7 ? "" : "")), o$10]; }; N$1 = class N$1 { constructor({ strings: t$6, _$litType$: s$5 }, n$9) { - let r$10; + let r$9; this.parts = []; - let c$7 = 0, a$2 = 0; - const u$4 = t$6.length - 1, d$5 = this.parts, [f$4, v$3] = V$1(t$6, s$5); + let c$6 = 0, a$2 = 0; + const u$4 = t$6.length - 1, d$4 = this.parts, [f$4, v$3] = V$1(t$6, s$5); if (this.el = N$1.createElement(f$4, n$9), C$1.currentNode = this.el.content, 2 === s$5 || 3 === s$5) { const t$7 = this.el.content.firstChild; t$7.replaceWith(...t$7.childNodes); } - for (; null !== (r$10 = C$1.nextNode()) && d$5.length < u$4;) { - if (1 === r$10.nodeType) { - if (r$10.hasAttributes()) for (const t$7 of r$10.getAttributeNames()) if (t$7.endsWith(e$7)) { - const i$7 = v$3[a$2++], s$6 = r$10.getAttribute(t$7).split(h$3), e$10 = /([.?@])?(.*)/.exec(i$7); - d$5.push({ + for (; null !== (r$9 = C$1.nextNode()) && d$4.length < u$4;) { + if (1 === r$9.nodeType) { + if (r$9.hasAttributes()) for (const t$7 of r$9.getAttributeNames()) if (t$7.endsWith(e$7)) { + const i$7 = v$3[a$2++], s$6 = r$9.getAttribute(t$7).split(h$3), e$10 = /([.?@])?(.*)/.exec(i$7); + d$4.push({ type: 1, - index: c$7, + index: c$6, name: e$10[2], strings: s$6, ctor: "." === e$10[1] ? H : "?" === e$10[1] ? I$1 : "@" === e$10[1] ? L$1 : k$1 - }), r$10.removeAttribute(t$7); - } else t$7.startsWith(h$3) && (d$5.push({ + }), r$9.removeAttribute(t$7); + } else t$7.startsWith(h$3) && (d$4.push({ type: 6, - index: c$7 - }), r$10.removeAttribute(t$7)); - if ($$2.test(r$10.tagName)) { - const t$7 = r$10.textContent.split(h$3), s$6 = t$7.length - 1; + index: c$6 + }), r$9.removeAttribute(t$7)); + if ($$2.test(r$9.tagName)) { + const t$7 = r$9.textContent.split(h$3), s$6 = t$7.length - 1; if (s$6 > 0) { - r$10.textContent = i$4 ? i$4.emptyScript : ""; - for (let i$7 = 0; i$7 < s$6; i$7++) r$10.append(t$7[i$7], l$1()), C$1.nextNode(), d$5.push({ + r$9.textContent = i$4 ? i$4.emptyScript : ""; + for (let i$7 = 0; i$7 < s$6; i$7++) r$9.append(t$7[i$7], l$1()), C$1.nextNode(), d$4.push({ type: 2, - index: ++c$7 + index: ++c$6 }); - r$10.append(t$7[s$6], l$1()); + r$9.append(t$7[s$6], l$1()); } } - } else if (8 === r$10.nodeType) if (r$10.data === o$7) d$5.push({ + } else if (8 === r$9.nodeType) if (r$9.data === o$7) d$4.push({ type: 2, - index: c$7 + index: c$6 }); else { let t$7 = -1; - for (; -1 !== (t$7 = r$10.data.indexOf(h$3, t$7 + 1));) d$5.push({ + for (; -1 !== (t$7 = r$9.data.indexOf(h$3, t$7 + 1));) d$4.push({ type: 7, - index: c$7 + index: c$6 }), t$7 += h$3.length - 1; } - c$7++; + c$6++; } } static createElement(t$6, i$7) { - const s$5 = r$7.createElement("template"); + const s$5 = r$6.createElement("template"); return s$5.innerHTML = t$6, s$5; } }; @@ -806,7 +806,7 @@ var init_lit_html = __esmMin((() => { return this._$AM._$AU; } u(t$6) { - const { el: { content: i$7 }, parts: s$5 } = this._$AD, e$10 = (t$6?.creationScope ?? r$7).importNode(i$7, !0); + const { el: { content: i$7 }, parts: s$5 } = this._$AD, e$10 = (t$6?.creationScope ?? r$6).importNode(i$7, !0); C$1.currentNode = e$10; let h$5 = C$1.nextNode(), o$10 = 0, n$9 = 0, l$3 = s$5[0]; for (; void 0 !== l$3;) { @@ -816,7 +816,7 @@ var init_lit_html = __esmMin((() => { } o$10 !== l$3?.index && (h$5 = C$1.nextNode(), o$10++); } - return C$1.currentNode = r$7, e$10; + return C$1.currentNode = r$6, e$10; } p(t$6) { let i$7 = 0; @@ -842,7 +842,7 @@ var init_lit_html = __esmMin((() => { return this._$AB; } _$AI(t$6, i$7 = this) { - t$6 = S$2(this, t$6, i$7), c$4(t$6) ? t$6 === E$1 || null == t$6 || "" === t$6 ? (this._$AH !== E$1 && this._$AR(), this._$AH = E$1) : t$6 !== this._$AH && t$6 !== T$2 && this._(t$6) : void 0 !== t$6._$litType$ ? this.$(t$6) : void 0 !== t$6.nodeType ? this.T(t$6) : u$3(t$6) ? this.k(t$6) : this._(t$6); + t$6 = S$2(this, t$6, i$7), c$3(t$6) ? t$6 === E$1 || null == t$6 || "" === t$6 ? (this._$AH !== E$1 && this._$AR(), this._$AH = E$1) : t$6 !== this._$AH && t$6 !== T$2 && this._(t$6) : void 0 !== t$6._$litType$ ? this.$(t$6) : void 0 !== t$6.nodeType ? this.T(t$6) : u$3(t$6) ? this.k(t$6) : this._(t$6); } O(t$6) { return this._$AA.parentNode.insertBefore(t$6, this._$AB); @@ -851,7 +851,7 @@ var init_lit_html = __esmMin((() => { this._$AH !== t$6 && (this._$AR(), this._$AH = this.O(t$6)); } _(t$6) { - this._$AH !== E$1 && c$4(this._$AH) ? this._$AA.nextSibling.data = t$6 : this.T(r$7.createTextNode(t$6)), this._$AH = t$6; + this._$AH !== E$1 && c$3(this._$AH) ? this._$AA.nextSibling.data = t$6 : this.T(r$6.createTextNode(t$6)), this._$AH = t$6; } $(t$6) { const { values: i$7, _$litType$: s$5 } = t$6, e$10 = "number" == typeof s$5 ? this._$AC(t$6) : (void 0 === s$5.el && (s$5.el = N$1.createElement(P$1(s$5.h, s$5.h[0]), this.options)), s$5); @@ -895,11 +895,11 @@ var init_lit_html = __esmMin((() => { _$AI(t$6, i$7 = this, s$5, e$10) { const h$5 = this.strings; let o$10 = !1; - if (void 0 === h$5) t$6 = S$2(this, t$6, i$7, 0), o$10 = !c$4(t$6) || t$6 !== this._$AH && t$6 !== T$2, o$10 && (this._$AH = t$6); + if (void 0 === h$5) t$6 = S$2(this, t$6, i$7, 0), o$10 = !c$3(t$6) || t$6 !== this._$AH && t$6 !== T$2, o$10 && (this._$AH = t$6); else { const e$11 = t$6; - let n$9, r$10; - for (t$6 = h$5[0], n$9 = 0; n$9 < h$5.length - 1; n$9++) r$10 = S$2(this, e$11[s$5 + n$9], i$7, n$9), r$10 === T$2 && (r$10 = this._$AH[n$9]), o$10 ||= !c$4(r$10) || r$10 !== this._$AH[n$9], r$10 === E$1 ? t$6 = E$1 : t$6 !== E$1 && (t$6 += (r$10 ?? "") + h$5[n$9 + 1]), this._$AH[n$9] = r$10; + let n$9, r$9; + for (t$6 = h$5[0], n$9 = 0; n$9 < h$5.length - 1; n$9++) r$9 = S$2(this, e$11[s$5 + n$9], i$7, n$9), r$9 === T$2 && (r$9 = this._$AH[n$9]), o$10 ||= !c$3(r$9) || r$9 !== this._$AH[n$9], r$9 === E$1 ? t$6 = E$1 : t$6 !== E$1 && (t$6 += (r$9 ?? "") + h$5[n$9 + 1]), this._$AH[n$9] = r$9; } o$10 && !e$10 && this.j(t$6); } @@ -993,8 +993,8 @@ var init_lit_element = __esmMin((() => { return this.renderOptions.renderBefore ??= t$6.firstChild, t$6; } update(t$6) { - const r$10 = this.render(); - this.hasUpdated || (this.renderOptions.isConnected = this.isConnected), super.update(t$6), this._$Do = B$1(r$10, this.renderRoot, this.renderOptions); + const r$9 = this.render(); + this.hasUpdated || (this.renderOptions.isConnected = this.isConnected), super.update(t$6), this._$Do = B$1(r$9, this.renderRoot, this.renderOptions); } connectedCallback() { super.connectedCallback(), this._$Do?.setConnected(!0); @@ -1010,8 +1010,8 @@ var init_lit_element = __esmMin((() => { o$6 = s$2.litElementPolyfillSupport; o$6?.({ LitElement: i }); n$5 = { - _$AK: (t$6, e$10, r$10) => { - t$6._$AK(e$10, r$10); + _$AK: (t$6, e$10, r$9) => { + t$6._$AK(e$10, r$9); }, _$AL: (t$6) => t$6._$AL }; @@ -1036,25 +1036,25 @@ var init_lit = __esmMin((() => { //#endregion //#region node_modules/lit-html/directive-helpers.js -var t$3, i$3, n$4, e$6, l, d$2, c$3, f$2, r$6, s, v$1, u$2, m$1, p, M$1, h$2; +var t$3, i$3, n$4, e$6, l, d$1, c$2, f$2, r$5, s, v$1, u$2, m$1, p, M$1, h$2; var init_directive_helpers = __esmMin((() => { init_lit_html(); ({I: t$3} = Z), i$3 = (o$10) => null === o$10 || "object" != typeof o$10 && "function" != typeof o$10, n$4 = { HTML: 1, SVG: 2, MATHML: 3 - }, e$6 = (o$10, t$6) => void 0 === t$6 ? void 0 !== o$10?._$litType$ : o$10?._$litType$ === t$6, l = (o$10) => null != o$10?._$litType$?.h, d$2 = (o$10) => void 0 !== o$10?._$litDirective$, c$3 = (o$10) => o$10?._$litDirective$, f$2 = (o$10) => void 0 === o$10.strings, r$6 = () => document.createComment(""), s = (o$10, i$7, n$9) => { + }, e$6 = (o$10, t$6) => void 0 === t$6 ? void 0 !== o$10?._$litType$ : o$10?._$litType$ === t$6, l = (o$10) => null != o$10?._$litType$?.h, d$1 = (o$10) => void 0 !== o$10?._$litDirective$, c$2 = (o$10) => o$10?._$litDirective$, f$2 = (o$10) => void 0 === o$10.strings, r$5 = () => document.createComment(""), s = (o$10, i$7, n$9) => { const e$10 = o$10._$AA.parentNode, l$3 = void 0 === i$7 ? o$10._$AB : i$7._$AA; if (void 0 === n$9) { - const i$8 = e$10.insertBefore(r$6(), l$3), d$5 = e$10.insertBefore(r$6(), l$3); - n$9 = new t$3(i$8, d$5, o$10, o$10.options); + const i$8 = e$10.insertBefore(r$5(), l$3), d$4 = e$10.insertBefore(r$5(), l$3); + n$9 = new t$3(i$8, d$4, o$10, o$10.options); } else { - const t$6 = n$9._$AB.nextSibling, i$8 = n$9._$AM, d$5 = i$8 !== o$10; - if (d$5) { + const t$6 = n$9._$AB.nextSibling, i$8 = n$9._$AM, d$4 = i$8 !== o$10; + if (d$4) { let t$7; n$9._$AQ?.(o$10), n$9._$AM = o$10, void 0 !== n$9._$AP && (t$7 = o$10._$AU) !== i$8._$AU && n$9._$AP(t$7); } - if (t$6 !== l$3 || d$5) { + if (t$6 !== l$3 || d$4) { let o$11 = n$9._$AA; for (; o$11 !== t$6;) { const t$7 = o$11.nextSibling; @@ -1105,15 +1105,15 @@ var init_directive = __esmMin((() => { //#endregion //#region node_modules/lit-html/async-directive.js function h$1(i$7) { - void 0 !== this._$AN ? (o$4(this), this._$AM = i$7, r$5(this)) : this._$AM = i$7; + void 0 !== this._$AN ? (o$4(this), this._$AM = i$7, r$4(this)) : this._$AM = i$7; } function n$3(i$7, t$6 = !1, e$10 = 0) { - const r$10 = this._$AH, h$5 = this._$AN; - if (void 0 !== h$5 && 0 !== h$5.size) if (t$6) if (Array.isArray(r$10)) for (let i$8 = e$10; i$8 < r$10.length; i$8++) s$1(r$10[i$8], !1), o$4(r$10[i$8]); - else null != r$10 && (s$1(r$10, !1), o$4(r$10)); + const r$9 = this._$AH, h$5 = this._$AN; + if (void 0 !== h$5 && 0 !== h$5.size) if (t$6) if (Array.isArray(r$9)) for (let i$8 = e$10; i$8 < r$9.length; i$8++) s$1(r$9[i$8], !1), o$4(r$9[i$8]); + else null != r$9 && (s$1(r$9, !1), o$4(r$9)); else s$1(this, i$7); } -var s$1, o$4, r$5, c$2, f$1; +var s$1, o$4, r$4, c$1, f$1; var init_async_directive = __esmMin((() => { init_directive_helpers(); init_directive(); @@ -1128,15 +1128,15 @@ var init_async_directive = __esmMin((() => { if (void 0 === (t$6 = i$7._$AM)) break; e$10 = t$6._$AN, e$10.delete(i$7), i$7 = t$6; } while (0 === e$10?.size); - }, r$5 = (i$7) => { + }, r$4 = (i$7) => { for (let t$6; t$6 = i$7._$AM; i$7 = t$6) { let e$10 = t$6._$AN; if (void 0 === e$10) t$6._$AN = e$10 = new Set(); else if (e$10.has(i$7)) break; - e$10.add(i$7), c$2(t$6); + e$10.add(i$7), c$1(t$6); } }; - c$2 = (i$7) => { + c$1 = (i$7) => { i$7.type == t$1.CHILD && (i$7._$AP ??= n$3, i$7._$AQ ??= h$1); }; f$1 = class extends i$2 { @@ -1144,7 +1144,7 @@ var init_async_directive = __esmMin((() => { super(...arguments), this._$AN = void 0; } _$AT(i$7, t$6, e$10) { - super._$AT(i$7, t$6, e$10), r$5(this), this.isConnected = i$7._$AU; + super._$AT(i$7, t$6, e$10), r$4(this), this.isConnected = i$7._$AU; } _$AO(i$7, t$6 = !0) { i$7 !== this.isConnected && (this.isConnected = i$7, i$7 ? this.reconnected?.() : this.disconnected?.()), t$6 && (s$1(this, i$7), o$4(this)); @@ -1276,12 +1276,12 @@ var init_custom_element = __esmMin((() => { //#endregion //#region node_modules/@lit/reactive-element/decorators/property.js function n$1(t$6) { - return (e$10, o$10) => "object" == typeof o$10 ? r$4(t$6, e$10, o$10) : ((t$7, e$11, o$11) => { - const r$10 = e$11.hasOwnProperty(o$11); - return e$11.constructor.createProperty(o$11, t$7), r$10 ? Object.getOwnPropertyDescriptor(e$11, o$11) : void 0; + return (e$10, o$10) => "object" == typeof o$10 ? r$3(t$6, e$10, o$10) : ((t$7, e$11, o$11) => { + const r$9 = e$11.hasOwnProperty(o$11); + return e$11.constructor.createProperty(o$11, t$7), r$9 ? Object.getOwnPropertyDescriptor(e$11, o$11) : void 0; })(t$6, e$10, o$10); } -var o$2, r$4; +var o$2, r$3; var init_property = __esmMin((() => { init_reactive_element(); o$2 = { @@ -1290,15 +1290,15 @@ var init_property = __esmMin((() => { converter: u$1, reflect: !1, hasChanged: f - }, r$4 = (t$6 = o$2, e$10, r$10) => { - const { kind: n$9, metadata: i$7 } = r$10; + }, r$3 = (t$6 = o$2, e$10, r$9) => { + const { kind: n$9, metadata: i$7 } = r$9; let s$5 = globalThis.litPropertyMetadata.get(i$7); - if (void 0 === s$5 && globalThis.litPropertyMetadata.set(i$7, s$5 = new Map()), "setter" === n$9 && ((t$6 = Object.create(t$6)).wrapped = !0), s$5.set(r$10.name, t$6), "accessor" === n$9) { - const { name: o$10 } = r$10; + if (void 0 === s$5 && globalThis.litPropertyMetadata.set(i$7, s$5 = new Map()), "setter" === n$9 && ((t$6 = Object.create(t$6)).wrapped = !0), s$5.set(r$9.name, t$6), "accessor" === n$9) { + const { name: o$10 } = r$9; return { - set(r$11) { + set(r$10) { const n$10 = e$10.get.call(this); - e$10.set.call(this, r$11), this.requestUpdate(o$10, n$10, t$6); + e$10.set.call(this, r$10), this.requestUpdate(o$10, n$10, t$6); }, init(e$11) { return void 0 !== e$11 && this.C(o$10, void 0, t$6, e$11), e$11; @@ -1306,10 +1306,10 @@ var init_property = __esmMin((() => { }; } if ("setter" === n$9) { - const { name: o$10 } = r$10; - return function(r$11) { + const { name: o$10 } = r$9; + return function(r$10) { const n$10 = this[o$10]; - e$10.call(this, r$11), this.requestUpdate(o$10, n$10, t$6); + e$10.call(this, r$10), this.requestUpdate(o$10, n$10, t$6); }; } throw Error("Unsupported decorator location: " + n$9); @@ -1322,9 +1322,9 @@ var init_property = __esmMin((() => { * @license * Copyright 2017 Google LLC * SPDX-License-Identifier: BSD-3-Clause -*/ function r(r$10) { +*/ function r(r$9) { return n$1({ - ...r$10, + ...r$9, state: !0, attribute: !1 }); @@ -1342,8 +1342,8 @@ var init_state = __esmMin((() => { */ function t$2(t$6) { return (n$9, o$10) => { - const c$7 = "function" == typeof n$9 ? n$9 : n$9[o$10]; - Object.assign(c$7, t$6); + const c$6 = "function" == typeof n$9 ? n$9 : n$9[o$10]; + Object.assign(c$6, t$6); }; } var init_event_options = __esmMin((() => {})); @@ -1352,7 +1352,7 @@ var init_event_options = __esmMin((() => {})); //#region node_modules/@lit/reactive-element/decorators/base.js var e$4; var init_base$1 = __esmMin((() => { - e$4 = (e$10, t$6, c$7) => (c$7.configurable = !0, c$7.enumerable = !0, Reflect.decorate && "object" != typeof t$6 && Object.defineProperty(e$10, t$6, c$7), c$7); + e$4 = (e$10, t$6, c$6) => (c$6.configurable = !0, c$6.enumerable = !0, Reflect.decorate && "object" != typeof t$6 && Object.defineProperty(e$10, t$6, c$6), c$6); })); //#endregion @@ -1361,11 +1361,11 @@ var init_base$1 = __esmMin((() => { * @license * Copyright 2017 Google LLC * SPDX-License-Identifier: BSD-3-Clause -*/ function e$1(e$10, r$10) { +*/ function e$1(e$10, r$9) { return (n$9, s$5, i$7) => { const o$10 = (t$6) => t$6.renderRoot?.querySelector(e$10) ?? null; - if (r$10) { - const { get: e$11, set: r$11 } = "object" == typeof s$5 ? n$9 : i$7 ?? (() => { + if (r$9) { + const { get: e$11, set: r$10 } = "object" == typeof s$5 ? n$9 : i$7 ?? (() => { const t$6 = Symbol(); return { get() { @@ -1378,7 +1378,7 @@ var init_base$1 = __esmMin((() => { })(); return e$4(n$9, s$5, { get() { let t$6 = e$11.call(this); - return void 0 === t$6 && (t$6 = o$10(this), (null !== t$6 || this.hasUpdated) && r$11.call(this, t$6)), t$6; + return void 0 === t$6 && (t$6 = o$10(this), (null !== t$6 || this.hasUpdated) && r$10.call(this, t$6)), t$6; } }); } return e$4(n$9, s$5, { get() { @@ -1392,9 +1392,9 @@ var init_query = __esmMin((() => { //#endregion //#region node_modules/@lit/reactive-element/decorators/query-all.js -function r$3(r$10) { +function r$2(r$9) { return (n$9, o$10) => e$4(n$9, o$10, { get() { - return (this.renderRoot ?? (e$5 ??= document.createDocumentFragment())).querySelectorAll(r$10); + return (this.renderRoot ?? (e$5 ??= document.createDocumentFragment())).querySelectorAll(r$9); } }); } var e$5; @@ -1410,9 +1410,9 @@ var init_query_all = __esmMin((() => { * Copyright 2017 Google LLC * SPDX-License-Identifier: BSD-3-Clause */ -function r$2(r$10) { +function r$1(r$9) { return (n$9, e$10) => e$4(n$9, e$10, { async get() { - return await this.updateComplete, this.renderRoot?.querySelector(r$10) ?? null; + return await this.updateComplete, this.renderRoot?.querySelector(r$9) ?? null; } }); } var init_query_async = __esmMin((() => { @@ -1427,9 +1427,9 @@ var init_query_async = __esmMin((() => { * SPDX-License-Identifier: BSD-3-Clause */ function o$1(o$10) { return (e$10, n$9) => { - const { slot: r$10, selector: s$5 } = o$10 ?? {}, c$7 = "slot" + (r$10 ? `[name=${r$10}]` : ":not([name])"); + const { slot: r$9, selector: s$5 } = o$10 ?? {}, c$6 = "slot" + (r$9 ? `[name=${r$9}]` : ":not([name])"); return e$4(e$10, n$9, { get() { - const t$6 = this.renderRoot?.querySelector(c$7), e$11 = t$6?.assignedElements(o$10) ?? []; + const t$6 = this.renderRoot?.querySelector(c$6), e$11 = t$6?.assignedElements(o$10) ?? []; return void 0 === s$5 ? e$11 : e$11.filter(((t$7) => t$7.matches(s$5))); } }); }; @@ -1445,9 +1445,9 @@ var init_query_assigned_elements = __esmMin((() => { * Copyright 2017 Google LLC * SPDX-License-Identifier: BSD-3-Clause */ function n$2(n$9) { - return (o$10, r$10) => { + return (o$10, r$9) => { const { slot: e$10 } = n$9 ?? {}, s$5 = "slot" + (e$10 ? `[name=${e$10}]` : ":not([name])"); - return e$4(o$10, r$10, { get() { + return e$4(o$10, r$9, { get() { const t$6 = this.renderRoot?.querySelector(s$5); return t$6?.assignedNodes(n$9) ?? []; } }); @@ -1506,8 +1506,8 @@ var init_chunk_LQJYWU4O = __esmMin((() => { } }; for (let i$7 = 0, len = classnames.length; i$7 < len; i$7++) { - const c$7 = classnames[i$7]; - if (c$7 !== null && c$7 !== void 0) buildClassString(c$7); + const c$6 = classnames[i$7]; + if (c$6 !== null && c$6 !== void 0) buildClassString(c$6); } return classList.length > 0 ? removeExtraSpaces(classList.join(" ")) : void 0; }; @@ -1634,7 +1634,7 @@ var init_chunk_RZF76H2U = __esmMin((() => { ...configProp }; const base = extend?.base ? cx(extend.base, options?.base) : options?.base; - const variants$1 = extend?.variants && !isEmptyObject(extend.variants) ? mergeObjects(variantsProps, extend.variants) : variantsProps; + const variants = extend?.variants && !isEmptyObject(extend.variants) ? mergeObjects(variantsProps, extend.variants) : variantsProps; const defaultVariants = extend?.defaultVariants && !isEmptyObject(extend.defaultVariants) ? { ...extend.defaultVariants, ...defaultVariantsProps @@ -1651,7 +1651,7 @@ var init_chunk_RZF76H2U = __esmMin((() => { const slots = isExtendedSlotsEmpty ? componentSlots : joinObjects({ ...extend?.slots }, isEmptyObject(componentSlots) ? { base: options?.base } : componentSlots); const compoundVariants = isEmptyObject(extend?.compoundVariants) ? compoundVariantsProps : flatMergeArrays(extend?.compoundVariants, compoundVariantsProps); const component = (props) => { - if (isEmptyObject(variants$1) && isEmptyObject(slotProps) && isExtendedSlotsEmpty) { + if (isEmptyObject(variants) && isEmptyObject(slotProps) && isExtendedSlotsEmpty) { return cn$1(base, props?.class, props?.className)(config); } if (compoundVariants && !Array.isArray(compoundVariants)) { @@ -1660,7 +1660,7 @@ var init_chunk_RZF76H2U = __esmMin((() => { if (compoundSlots && !Array.isArray(compoundSlots)) { throw new TypeError(`The "compoundSlots" prop must be an array. Received: ${typeof compoundSlots}`); } - const getVariantValue = (variant, vrs = variants$1, _slotKey = null, slotProps2 = null) => { + const getVariantValue = (variant, vrs = variants, _slotKey = null, slotProps2 = null) => { const variantObj = vrs[variant]; if (!variantObj || isEmptyObject(variantObj)) { return null; @@ -1677,20 +1677,20 @@ var init_chunk_RZF76H2U = __esmMin((() => { return value; }; const getVariantClassNames = () => { - if (!variants$1) return null; - const keys$1 = Object.keys(variants$1); + if (!variants) return null; + const keys$1 = Object.keys(variants); const result = []; for (let i$7 = 0; i$7 < keys$1.length; i$7++) { - const value = getVariantValue(keys$1[i$7], variants$1); + const value = getVariantValue(keys$1[i$7], variants); if (value) result.push(value); } return result; }; const getVariantClassNamesBySlotKey = (slotKey, slotProps2) => { - if (!variants$1 || typeof variants$1 !== "object") return null; + if (!variants || typeof variants !== "object") return null; const result = []; - for (const variant in variants$1) { - const variantValue = getVariantValue(variant, variants$1, slotKey, slotProps2); + for (const variant in variants) { + const variantValue = getVariantValue(variant, variants, slotKey, slotProps2); const value = slotKey === "base" && typeof variantValue === "string" ? variantValue : variantValue && variantValue[slotKey]; if (value) result.push(value); } @@ -1800,14 +1800,14 @@ var init_chunk_RZF76H2U = __esmMin((() => { return cn$1(base, getVariantClassNames(), getCompoundVariantsValue(compoundVariants), props?.class, props?.className)(config); }; const getVariantKeys = () => { - if (!variants$1 || typeof variants$1 !== "object") return; - return Object.keys(variants$1); + if (!variants || typeof variants !== "object") return; + return Object.keys(variants); }; component.variantKeys = getVariantKeys(); component.extend = extend; component.base = base; component.slots = slots; - component.variants = variants$1; + component.variants = variants; component.defaultVariants = defaultVariants; component.compoundSlots = compoundSlots; component.compoundVariants = compoundVariants; @@ -4187,13 +4187,13 @@ var init_unsafe_html$1 = __esmMin((() => { constructor(i$7) { if (super(i$7), this.it = E$1, i$7.type !== t$1.CHILD) throw Error(this.constructor.directiveName + "() can only be used in child bindings"); } - render(r$10) { - if (r$10 === E$1 || null == r$10) return this._t = void 0, this.it = r$10; - if (r$10 === T$2) return r$10; - if ("string" != typeof r$10) throw Error(this.constructor.directiveName + "() called with a non-string value"); - if (r$10 === this.it) return this._t; - this.it = r$10; - const s$5 = [r$10]; + render(r$9) { + if (r$9 === E$1 || null == r$9) return this._t = void 0, this.it = r$9; + if (r$9 === T$2) return r$9; + if ("string" != typeof r$9) throw Error(this.constructor.directiveName + "() called with a non-string value"); + if (r$9 === this.it) return this._t; + this.it = r$9; + const s$5 = [r$9]; return s$5.raw = s$5, this._t = { _$litType$: this.constructor.resultType, strings: s$5, @@ -4327,18 +4327,6 @@ var init_a_arrow_down = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/a-arrow-up.js -var AArrowUp; -var init_a_arrow_up = __esmMin((() => { - AArrowUp = [ - ["path", { d: "m14 11 4-4 4 4" }], - ["path", { d: "M18 16V7" }], - ["path", { d: "m2 16 4.039-9.69a.5.5 0 0 1 .923 0L11 16" }], - ["path", { d: "M3.304 13h6.392" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/a-large-small.js var ALargeSmall; @@ -4351,6 +4339,18 @@ var init_a_large_small = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/a-arrow-up.js +var AArrowUp; +var init_a_arrow_up = __esmMin((() => { + AArrowUp = [ + ["path", { d: "m14 11 4-4 4 4" }], + ["path", { d: "M18 16V7" }], + ["path", { d: "m2 16 4.039-9.69a.5.5 0 0 1 .923 0L11 16" }], + ["path", { d: "M3.304 13h6.392" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/accessibility.js var Accessibility; @@ -4630,29 +4630,6 @@ var init_align_horizontal_distribute_end = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/align-horizontal-justify-center.js -var AlignHorizontalJustifyCenter; -var init_align_horizontal_justify_center = __esmMin((() => { - AlignHorizontalJustifyCenter = [ - ["rect", { - width: "6", - height: "14", - x: "2", - y: "5", - rx: "2" - }], - ["rect", { - width: "6", - height: "10", - x: "16", - y: "7", - rx: "2" - }], - ["path", { d: "M12 2v20" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/align-horizontal-distribute-start.js var AlignHorizontalDistributeStart; @@ -4677,6 +4654,29 @@ var init_align_horizontal_distribute_start = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/align-horizontal-justify-center.js +var AlignHorizontalJustifyCenter; +var init_align_horizontal_justify_center = __esmMin((() => { + AlignHorizontalJustifyCenter = [ + ["rect", { + width: "6", + height: "14", + x: "2", + y: "5", + rx: "2" + }], + ["rect", { + width: "6", + height: "10", + x: "16", + y: "7", + rx: "2" + }], + ["path", { d: "M12 2v20" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/align-horizontal-justify-end.js var AlignHorizontalJustifyEnd; @@ -4700,23 +4700,6 @@ var init_align_horizontal_justify_end = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/align-horizontal-space-around.js -var AlignHorizontalSpaceAround; -var init_align_horizontal_space_around = __esmMin((() => { - AlignHorizontalSpaceAround = [ - ["rect", { - width: "6", - height: "10", - x: "9", - y: "7", - rx: "2" - }], - ["path", { d: "M4 22V2" }], - ["path", { d: "M20 22V2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/align-horizontal-justify-start.js var AlignHorizontalJustifyStart; @@ -4740,6 +4723,23 @@ var init_align_horizontal_justify_start = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/align-horizontal-space-around.js +var AlignHorizontalSpaceAround; +var init_align_horizontal_space_around = __esmMin((() => { + AlignHorizontalSpaceAround = [ + ["rect", { + width: "6", + height: "10", + x: "9", + y: "7", + rx: "2" + }], + ["path", { d: "M4 22V2" }], + ["path", { d: "M20 22V2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/align-horizontal-space-between.js var AlignHorizontalSpaceBetween; @@ -5024,13 +5024,6 @@ var init_ampersand = __esmMin((() => { Ampersand = [["path", { d: "M16 12h3" }], ["path", { d: "M17.5 12a8 8 0 0 1-8 8A4.5 4.5 0 0 1 5 15.5c0-6 8-4 8-8.5a3 3 0 1 0-6 0c0 3 2.5 8.5 12 13" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/ampersands.js -var Ampersands; -var init_ampersands = __esmMin((() => { - Ampersands = [["path", { d: "M10 17c-5-3-7-7-7-9a2 2 0 0 1 4 0c0 2.5-5 2.5-5 6 0 1.7 1.3 3 3 3 2.8 0 5-2.2 5-5" }], ["path", { d: "M22 17c-5-3-7-7-7-9a2 2 0 0 1 4 0c0 2.5-5 2.5-5 6 0 1.7 1.3 3 3 3 2.8 0 5-2.2 5-5" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/amphora.js var Amphora; @@ -5045,6 +5038,13 @@ var init_amphora = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/ampersands.js +var Ampersands; +var init_ampersands = __esmMin((() => { + Ampersands = [["path", { d: "M10 17c-5-3-7-7-7-9a2 2 0 0 1 4 0c0 2.5-5 2.5-5 6 0 1.7 1.3 3 3 3 2.8 0 5-2.2 5-5" }], ["path", { d: "M22 17c-5-3-7-7-7-9a2 2 0 0 1 4 0c0 2.5-5 2.5-5 6 0 1.7 1.3 3 3 3 2.8 0 5-2.2 5-5" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/anchor.js var Anchor$1; @@ -5159,6 +5159,13 @@ var init_app_window_mac = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/apple.js +var Apple; +var init_apple = __esmMin((() => { + Apple = [["path", { d: "M12 6.528V3a1 1 0 0 1 1-1h0" }], ["path", { d: "M18.237 21A15 15 0 0 0 22 11a6 6 0 0 0-10-4.472A6 6 0 0 0 2 11a15.1 15.1 0 0 0 3.763 10 3 3 0 0 0 3.648.648 5.5 5.5 0 0 1 5.178 0A3 3 0 0 0 18.237 21" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/app-window.js var AppWindow; @@ -5177,13 +5184,6 @@ var init_app_window = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/apple.js -var Apple; -var init_apple = __esmMin((() => { - Apple = [["path", { d: "M12 6.528V3a1 1 0 0 1 1-1h0" }], ["path", { d: "M18.237 21A15 15 0 0 0 22 11a6 6 0 0 0-10-4.472A6 6 0 0 0 2 11a15.1 15.1 0 0 0 3.763 10 3 3 0 0 0 3.648.648 5.5 5.5 0 0 1 5.178 0A3 3 0 0 0 18.237 21" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/archive-restore.js var ArchiveRestore; @@ -5238,13 +5238,6 @@ var init_archive = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/arrow-big-down-dash.js -var ArrowBigDownDash; -var init_arrow_big_down_dash = __esmMin((() => { - ArrowBigDownDash = [["path", { d: "M15 11a1 1 0 0 0 1 1h2.939a1 1 0 0 1 .75 1.811l-6.835 6.836a1.207 1.207 0 0 1-1.707 0L4.31 13.81a1 1 0 0 1 .75-1.811H8a1 1 0 0 0 1-1V9a1 1 0 0 1 1-1h4a1 1 0 0 1 1 1z" }], ["path", { d: "M9 4h6" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/armchair.js var Armchair; @@ -5257,6 +5250,13 @@ var init_armchair = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/arrow-big-down-dash.js +var ArrowBigDownDash; +var init_arrow_big_down_dash = __esmMin((() => { + ArrowBigDownDash = [["path", { d: "M15 11a1 1 0 0 0 1 1h2.939a1 1 0 0 1 .75 1.811l-6.835 6.836a1.207 1.207 0 0 1-1.707 0L4.31 13.81a1 1 0 0 1 .75-1.811H8a1 1 0 0 0 1-1V9a1 1 0 0 1 1-1h4a1 1 0 0 1 1 1z" }], ["path", { d: "M9 4h6" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/arrow-big-down.js var ArrowBigDown; @@ -5433,19 +5433,6 @@ var init_arrow_down_up = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/arrow-down-z-a.js -var ArrowDownZA; -var init_arrow_down_z_a = __esmMin((() => { - ArrowDownZA = [ - ["path", { d: "m3 16 4 4 4-4" }], - ["path", { d: "M7 4v16" }], - ["path", { d: "M15 4h5l-5 6h5" }], - ["path", { d: "M15 20v-3.5a2.5 2.5 0 0 1 5 0V20" }], - ["path", { d: "M20 18h-5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/arrow-down-wide-narrow.js var ArrowDownWideNarrow; @@ -5460,10 +5447,16 @@ var init_arrow_down_wide_narrow = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/arrow-down.js -var ArrowDown; -var init_arrow_down = __esmMin((() => { - ArrowDown = [["path", { d: "M12 5v14" }], ["path", { d: "m19 12-7 7-7-7" }]]; +//#region node_modules/lucide/dist/esm/icons/arrow-down-z-a.js +var ArrowDownZA; +var init_arrow_down_z_a = __esmMin((() => { + ArrowDownZA = [ + ["path", { d: "m3 16 4 4 4-4" }], + ["path", { d: "M7 4v16" }], + ["path", { d: "M15 4h5l-5 6h5" }], + ["path", { d: "M15 20v-3.5a2.5 2.5 0 0 1 5 0V20" }], + ["path", { d: "M20 18h-5" }] + ]; })); //#endregion @@ -5477,6 +5470,13 @@ var init_arrow_left_from_line = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/arrow-down.js +var ArrowDown; +var init_arrow_down = __esmMin((() => { + ArrowDown = [["path", { d: "M12 5v14" }], ["path", { d: "m19 12-7 7-7-7" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/arrow-left-right.js var ArrowLeftRight; @@ -5708,19 +5708,6 @@ var init_arrow_up = __esmMin((() => { ArrowUp = [["path", { d: "m5 12 7-7 7 7" }], ["path", { d: "M12 19V5" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/arrows-up-from-line.js -var ArrowsUpFromLine; -var init_arrows_up_from_line = __esmMin((() => { - ArrowsUpFromLine = [ - ["path", { d: "m4 6 3-3 3 3" }], - ["path", { d: "M7 17V3" }], - ["path", { d: "m14 6 3-3 3 3" }], - ["path", { d: "M17 17V3" }], - ["path", { d: "M4 21h16" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/asterisk.js var Asterisk; @@ -5733,14 +5720,16 @@ var init_asterisk = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/at-sign.js -var AtSign; -var init_at_sign = __esmMin((() => { - AtSign = [["circle", { - cx: "12", - cy: "12", - r: "4" - }], ["path", { d: "M16 8v5a3 3 0 0 0 6 0v-1a10 10 0 1 0-4 8" }]]; +//#region node_modules/lucide/dist/esm/icons/arrows-up-from-line.js +var ArrowsUpFromLine; +var init_arrows_up_from_line = __esmMin((() => { + ArrowsUpFromLine = [ + ["path", { d: "m4 6 3-3 3 3" }], + ["path", { d: "M7 17V3" }], + ["path", { d: "m14 6 3-3 3 3" }], + ["path", { d: "M17 17V3" }], + ["path", { d: "M4 21h16" }] + ]; })); //#endregion @@ -5758,6 +5747,17 @@ var init_atom = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/at-sign.js +var AtSign; +var init_at_sign = __esmMin((() => { + AtSign = [["circle", { + cx: "12", + cy: "12", + r: "4" + }], ["path", { d: "M16 8v5a3 3 0 0 0 6 0v-1a10 10 0 1 0-4 8" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/audio-lines.js var AudioLines; @@ -5834,17 +5834,6 @@ var init_backpack = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/badge-cent.js -var BadgeCent; -var init_badge_cent = __esmMin((() => { - BadgeCent = [ - ["path", { d: "M3.85 8.62a4 4 0 0 1 4.78-4.77 4 4 0 0 1 6.74 0 4 4 0 0 1 4.78 4.78 4 4 0 0 1 0 6.74 4 4 0 0 1-4.77 4.78 4 4 0 0 1-6.75 0 4 4 0 0 1-4.78-4.77 4 4 0 0 1 0-6.76Z" }], - ["path", { d: "M12 7v10" }], - ["path", { d: "M15.4 10a4 4 0 1 0 0 4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/badge-alert.js var BadgeAlert; @@ -5866,6 +5855,17 @@ var init_badge_alert = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/badge-cent.js +var BadgeCent; +var init_badge_cent = __esmMin((() => { + BadgeCent = [ + ["path", { d: "M3.85 8.62a4 4 0 0 1 4.78-4.77 4 4 0 0 1 6.74 0 4 4 0 0 1 4.78 4.78 4 4 0 0 1 0 6.74 4 4 0 0 1-4.77 4.78 4 4 0 0 1-6.75 0 4 4 0 0 1-4.78-4.77 4 4 0 0 1 0-6.76Z" }], + ["path", { d: "M12 7v10" }], + ["path", { d: "M15.4 10a4 4 0 1 0 0 4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/badge-check.js var BadgeCheck; @@ -5895,6 +5895,18 @@ var init_badge_euro = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/badge-indian-rupee.js +var BadgeIndianRupee; +var init_badge_indian_rupee = __esmMin((() => { + BadgeIndianRupee = [ + ["path", { d: "M3.85 8.62a4 4 0 0 1 4.78-4.77 4 4 0 0 1 6.74 0 4 4 0 0 1 4.78 4.78 4 4 0 0 1 0 6.74 4 4 0 0 1-4.77 4.78 4 4 0 0 1-6.75 0 4 4 0 0 1-4.78-4.77 4 4 0 0 1 0-6.76Z" }], + ["path", { d: "M8 8h8" }], + ["path", { d: "M8 12h8" }], + ["path", { d: "m13 17-5-1h1a4 4 0 0 0 0-8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/badge-info.js var BadgeInfo; @@ -5916,18 +5928,6 @@ var init_badge_info = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/badge-indian-rupee.js -var BadgeIndianRupee; -var init_badge_indian_rupee = __esmMin((() => { - BadgeIndianRupee = [ - ["path", { d: "M3.85 8.62a4 4 0 0 1 4.78-4.77 4 4 0 0 1 6.74 0 4 4 0 0 1 4.78 4.78 4 4 0 0 1 0 6.74 4 4 0 0 1-4.77 4.78 4 4 0 0 1-6.75 0 4 4 0 0 1-4.78-4.77 4 4 0 0 1 0-6.76Z" }], - ["path", { d: "M8 8h8" }], - ["path", { d: "M8 12h8" }], - ["path", { d: "m13 17-5-1h1a4 4 0 0 0 0-8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/badge-japanese-yen.js var BadgeJapaneseYen; @@ -6114,6 +6114,17 @@ var init_ban = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/balloon.js +var Balloon; +var init_balloon = __esmMin((() => { + Balloon = [ + ["path", { d: "M12 16v1a2 2 0 0 0 2 2h1a2 2 0 0 1 2 2v1" }], + ["path", { d: "M12 6a2 2 0 0 1 2 2" }], + ["path", { d: "M18 8c0 4-3.5 8-6 8s-6-4-6-8a6 6 0 0 1 12 0" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/banana.js var Banana; @@ -6430,18 +6441,6 @@ var init_bed_single = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/bed.js -var Bed; -var init_bed = __esmMin((() => { - Bed = [ - ["path", { d: "M2 4v16" }], - ["path", { d: "M2 8h18a2 2 0 0 1 2 2v10" }], - ["path", { d: "M2 17h20" }], - ["path", { d: "M6 8v9" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/beef.js var Beef; @@ -6457,6 +6456,18 @@ var init_beef = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/bed.js +var Bed; +var init_bed = __esmMin((() => { + Bed = [ + ["path", { d: "M2 4v16" }], + ["path", { d: "M2 8h18a2 2 0 0 1 2 2v10" }], + ["path", { d: "M2 17h20" }], + ["path", { d: "M6 8v9" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/beer-off.js var BeerOff; @@ -6710,20 +6721,6 @@ var init_bike = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/binoculars.js -var Binoculars; -var init_binoculars = __esmMin((() => { - Binoculars = [ - ["path", { d: "M10 10h4" }], - ["path", { d: "M19 7V4a1 1 0 0 0-1-1h-2a1 1 0 0 0-1 1v3" }], - ["path", { d: "M20 21a2 2 0 0 0 2-2v-3.851c0-1.39-2-2.962-2-4.829V8a1 1 0 0 0-1-1h-4a1 1 0 0 0-1 1v11a2 2 0 0 0 2 2z" }], - ["path", { d: "M 22 16 L 2 16" }], - ["path", { d: "M4 21a2 2 0 0 1-2-2v-3.851c0-1.39 2-2.962 2-4.829V8a1 1 0 0 1 1-1h4a1 1 0 0 1 1 1v11a2 2 0 0 1-2 2z" }], - ["path", { d: "M9 7V4a1 1 0 0 0-1-1H6a1 1 0 0 0-1 1v3" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/binary.js var Binary; @@ -6750,6 +6747,20 @@ var init_binary = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/binoculars.js +var Binoculars; +var init_binoculars = __esmMin((() => { + Binoculars = [ + ["path", { d: "M10 10h4" }], + ["path", { d: "M19 7V4a1 1 0 0 0-1-1h-2a1 1 0 0 0-1 1v3" }], + ["path", { d: "M20 21a2 2 0 0 0 2-2v-3.851c0-1.39-2-2.962-2-4.829V8a1 1 0 0 0-1-1h-4a1 1 0 0 0-1 1v11a2 2 0 0 0 2 2z" }], + ["path", { d: "M 22 16 L 2 16" }], + ["path", { d: "M4 21a2 2 0 0 1-2-2v-3.851c0-1.39 2-2.962 2-4.829V8a1 1 0 0 1 1-1h4a1 1 0 0 1 1 1v11a2 2 0 0 1-2 2z" }], + ["path", { d: "M9 7V4a1 1 0 0 0-1-1H6a1 1 0 0 0-1 1v3" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/biohazard.js var Biohazard; @@ -6786,6 +6797,24 @@ var init_bird = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/birdhouse.js +var Birdhouse; +var init_birdhouse = __esmMin((() => { + Birdhouse = [ + ["path", { d: "M12 18v4" }], + ["path", { d: "m17 18 1.956-11.468" }], + ["path", { d: "m3 8 7.82-5.615a2 2 0 0 1 2.36 0L21 8" }], + ["path", { d: "M4 18h16" }], + ["path", { d: "M7 18 5.044 6.532" }], + ["circle", { + cx: "12", + cy: "10", + r: "2" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/bitcoin.js var Bitcoin; @@ -6808,24 +6837,6 @@ var init_blend = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/birdhouse.js -var Birdhouse; -var init_birdhouse = __esmMin((() => { - Birdhouse = [ - ["path", { d: "M12 18v4" }], - ["path", { d: "m17 18 1.956-11.468" }], - ["path", { d: "m3 8 7.82-5.615a2 2 0 0 1 2.36 0L21 8" }], - ["path", { d: "M4 18h16" }], - ["path", { d: "M7 18 5.044 6.532" }], - ["circle", { - cx: "12", - cy: "10", - r: "2" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/blinds.js var Blinds; @@ -7300,6 +7311,13 @@ var init_bookmark_plus = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/bookmark.js +var Bookmark; +var init_bookmark = __esmMin((() => { + Bookmark = [["path", { d: "m19 21-7-4-7 4V5a2 2 0 0 1 2-2h10a2 2 0 0 1 2 2v16z" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/bookmark-x.js var BookmarkX; @@ -7311,13 +7329,6 @@ var init_bookmark_x = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/bookmark.js -var Bookmark; -var init_bookmark = __esmMin((() => { - Bookmark = [["path", { d: "m19 21-7-4-7 4V5a2 2 0 0 1 2-2h10a2 2 0 0 1 2 2v16z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/boom-box.js var BoomBox; @@ -7653,19 +7664,6 @@ var init_briefcase_medical = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/briefcase.js -var Briefcase; -var init_briefcase = __esmMin((() => { - Briefcase = [["path", { d: "M16 20V4a2 2 0 0 0-2-2h-4a2 2 0 0 0-2 2v16" }], ["rect", { - width: "20", - height: "14", - x: "2", - y: "6", - rx: "2" - }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/bring-to-front.js var BringToFront; @@ -7683,14 +7681,27 @@ var init_bring_to_front = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/briefcase.js +var Briefcase; +var init_briefcase = __esmMin((() => { + Briefcase = [["path", { d: "M16 20V4a2 2 0 0 0-2-2h-4a2 2 0 0 0-2 2v16" }], ["rect", { + width: "20", + height: "14", + x: "2", + y: "6", + rx: "2" + }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/brush-cleaning.js var BrushCleaning; var init_brush_cleaning = __esmMin((() => { BrushCleaning = [ ["path", { d: "m16 22-1-4" }], - ["path", { d: "M19 13.99a1 1 0 0 0 1-1V12a2 2 0 0 0-2-2h-3a1 1 0 0 1-1-1V4a2 2 0 0 0-4 0v5a1 1 0 0 1-1 1H6a2 2 0 0 0-2 2v.99a1 1 0 0 0 1 1" }], - ["path", { d: "M5 14h14l1.973 6.767A1 1 0 0 1 20 22H4a1 1 0 0 1-.973-1.233z" }], + ["path", { d: "M19 14a1 1 0 0 0 1-1v-1a2 2 0 0 0-2-2h-3a1 1 0 0 1-1-1V4a2 2 0 0 0-4 0v5a1 1 0 0 1-1 1H6a2 2 0 0 0-2 2v1a1 1 0 0 0 1 1" }], + ["path", { d: "M19 14H5l-1.973 6.767A1 1 0 0 0 4 22h16a1 1 0 0 0 .973-1.233z" }], ["path", { d: "m8 22 1-4" }] ]; })); @@ -7706,6 +7717,24 @@ var init_brush = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/bug-off.js +var BugOff; +var init_bug_off = __esmMin((() => { + BugOff = [ + ["path", { d: "M12 20v-8" }], + ["path", { d: "M14.12 3.88 16 2" }], + ["path", { d: "M15 7.13V6a3 3 0 0 0-5.14-2.1L8 2" }], + ["path", { d: "M18 12.34V11a4 4 0 0 0-4-4h-1.3" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M21 5a4 4 0 0 1-3.55 3.97" }], + ["path", { d: "M22 13h-3.34" }], + ["path", { d: "M3 21a4 4 0 0 1 3.81-4" }], + ["path", { d: "M6 13H2" }], + ["path", { d: "M7.7 7.7A4 4 0 0 0 6 11v3a6 6 0 0 0 11.13 3.13" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/bubbles.js var Bubbles; @@ -7730,24 +7759,6 @@ var init_bubbles = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/bug-off.js -var BugOff; -var init_bug_off = __esmMin((() => { - BugOff = [ - ["path", { d: "M12 20v-8" }], - ["path", { d: "M14.12 3.88 16 2" }], - ["path", { d: "M15 7.13V6a3 3 0 0 0-5.14-2.1L8 2" }], - ["path", { d: "M18 12.34V11a4 4 0 0 0-4-4h-1.3" }], - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M21 5a4 4 0 0 1-3.55 3.97" }], - ["path", { d: "M22 13h-3.34" }], - ["path", { d: "M3 21a4 4 0 0 1 3.81-4" }], - ["path", { d: "M6 13H2" }], - ["path", { d: "M7.7 7.7A4 4 0 0 0 6 11v3a6 6 0 0 0 11.13 3.13" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/bug-play.js var BugPlay; @@ -7797,6 +7808,29 @@ var init_building_2 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/bus-front.js +var BusFront; +var init_bus_front = __esmMin((() => { + BusFront = [ + ["path", { d: "M4 6 2 7" }], + ["path", { d: "M10 6h4" }], + ["path", { d: "m22 7-2-1" }], + ["rect", { + width: "16", + height: "16", + x: "4", + y: "3", + rx: "2" + }], + ["path", { d: "M4 11h16" }], + ["path", { d: "M8 15h.01" }], + ["path", { d: "M16 15h.01" }], + ["path", { d: "M6 19v2" }], + ["path", { d: "M18 21v-2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/building.js var Building; @@ -7822,29 +7856,6 @@ var init_building = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/bus-front.js -var BusFront; -var init_bus_front = __esmMin((() => { - BusFront = [ - ["path", { d: "M4 6 2 7" }], - ["path", { d: "M10 6h4" }], - ["path", { d: "m22 7-2-1" }], - ["rect", { - width: "16", - height: "16", - x: "4", - y: "3", - rx: "2" - }], - ["path", { d: "M4 11h16" }], - ["path", { d: "M8 15h.01" }], - ["path", { d: "M16 15h.01" }], - ["path", { d: "M6 19v2" }], - ["path", { d: "M18 21v-2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/bus.js var Bus; @@ -8118,19 +8129,6 @@ var init_calendar_days = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/calendar-fold.js -var CalendarFold; -var init_calendar_fold = __esmMin((() => { - CalendarFold = [ - ["path", { d: "M3 20a2 2 0 0 0 2 2h10a2.4 2.4 0 0 0 1.706-.706l3.588-3.588A2.4 2.4 0 0 0 21 16V6a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2z" }], - ["path", { d: "M15 22v-5a1 1 0 0 1 1-1h5" }], - ["path", { d: "M8 2v4" }], - ["path", { d: "M16 2v4" }], - ["path", { d: "M3 10h18" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/calendar-heart.js var CalendarHeart; @@ -8145,15 +8143,15 @@ var init_calendar_heart = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/calendar-minus.js -var CalendarMinus; -var init_calendar_minus = __esmMin((() => { - CalendarMinus = [ - ["path", { d: "M16 19h6" }], +//#region node_modules/lucide/dist/esm/icons/calendar-fold.js +var CalendarFold; +var init_calendar_fold = __esmMin((() => { + CalendarFold = [ + ["path", { d: "M3 20a2 2 0 0 0 2 2h10a2.4 2.4 0 0 0 1.706-.706l3.588-3.588A2.4 2.4 0 0 0 21 16V6a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2z" }], + ["path", { d: "M15 22v-5a1 1 0 0 1 1-1h5" }], + ["path", { d: "M8 2v4" }], ["path", { d: "M16 2v4" }], - ["path", { d: "M21 15V6a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h8.5" }], - ["path", { d: "M3 10h18" }], - ["path", { d: "M8 2v4" }] + ["path", { d: "M3 10h18" }] ]; })); @@ -8176,6 +8174,19 @@ var init_calendar_minus_2 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/calendar-minus.js +var CalendarMinus; +var init_calendar_minus = __esmMin((() => { + CalendarMinus = [ + ["path", { d: "M16 19h6" }], + ["path", { d: "M16 2v4" }], + ["path", { d: "M21 15V6a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h8.5" }], + ["path", { d: "M3 10h18" }], + ["path", { d: "M8 2v4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/calendar-off.js var CalendarOff; @@ -8403,27 +8414,6 @@ var init_candy_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/cannabis.js -var Cannabis; -var init_cannabis = __esmMin((() => { - Cannabis = [["path", { d: "M12 22v-4" }], ["path", { d: "M7 12c-1.5 0-4.5 1.5-5 3 3.5 1.5 6 1 6 1-1.5 1.5-2 3.5-2 5 2.5 0 4.5-1.5 6-3 1.5 1.5 3.5 3 6 3 0-1.5-.5-3.5-2-5 0 0 2.5.5 6-1-.5-1.5-3.5-3-5-3 1.5-1 4-4 4-6-2.5 0-5.5 1.5-7 3 0-2.5-.5-5-2-7-1.5 2-2 4.5-2 7-1.5-1.5-4.5-3-7-3 0 2 2.5 5 4 6" }]]; -})); - -//#endregion -//#region node_modules/lucide/dist/esm/icons/captions-off.js -var CaptionsOff; -var init_captions_off = __esmMin((() => { - CaptionsOff = [ - ["path", { d: "M10.5 5H19a2 2 0 0 1 2 2v8.5" }], - ["path", { d: "M17 11h-.5" }], - ["path", { d: "M19 19H5a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2" }], - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M7 11h4" }], - ["path", { d: "M7 15h2.5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/candy.js var Candy; @@ -8437,6 +8427,27 @@ var init_candy = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cannabis-off.js +var CannabisOff; +var init_cannabis_off = __esmMin((() => { + CannabisOff = [ + ["path", { d: "M12 22v-4c1.5 1.5 3.5 3 6 3 0-1.5-.5-3.5-2-5" }], + ["path", { d: "M13.988 8.327C13.902 6.054 13.365 3.82 12 2a9.3 9.3 0 0 0-1.445 2.9" }], + ["path", { d: "M17.375 11.725C18.882 10.53 21 7.841 21 6c-2.324 0-5.08 1.296-6.662 2.684" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M21.024 15.378A15 15 0 0 0 22 15c-.426-1.279-2.67-2.557-4.25-2.907" }], + ["path", { d: "M6.995 6.992C5.714 6.4 4.29 6 3 6c0 2 2.5 5 4 6-1.5 0-4.5 1.5-5 3 3.5 1.5 6 1 6 1-1.5 1.5-2 3.5-2 5 2.5 0 4.5-1.5 6-3" }] + ]; +})); + +//#endregion +//#region node_modules/lucide/dist/esm/icons/cannabis.js +var Cannabis; +var init_cannabis = __esmMin((() => { + Cannabis = [["path", { d: "M12 22v-4" }], ["path", { d: "M7 12c-1.5 0-4.5 1.5-5 3 3.5 1.5 6 1 6 1-1.5 1.5-2 3.5-2 5 2.5 0 4.5-1.5 6-3 1.5 1.5 3.5 3 6 3 0-1.5-.5-3.5-2-5 0 0 2.5.5 6-1-.5-1.5-3.5-3-5-3 1.5-1 4-4 4-6-2.5 0-5.5 1.5-7 3 0-2.5-.5-5-2-7-1.5 2-2 4.5-2 7-1.5-1.5-4.5-3-7-3 0 2 2.5 5 4 6" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/captions.js var Captions; @@ -8451,6 +8462,20 @@ var init_captions = __esmMin((() => { }], ["path", { d: "M7 15h4M15 15h2M7 11h2M13 11h4" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/captions-off.js +var CaptionsOff; +var init_captions_off = __esmMin((() => { + CaptionsOff = [ + ["path", { d: "M10.5 5H19a2 2 0 0 1 2 2v8.5" }], + ["path", { d: "M17 11h-.5" }], + ["path", { d: "M19 19H5a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M7 11h4" }], + ["path", { d: "M7 15h2.5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/car-front.js var CarFront; @@ -8492,6 +8517,22 @@ var init_car_taxi_front = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/caravan.js +var Caravan; +var init_caravan = __esmMin((() => { + Caravan = [ + ["path", { d: "M18 19V9a4 4 0 0 0-4-4H6a4 4 0 0 0-4 4v8a2 2 0 0 0 2 2h2" }], + ["path", { d: "M2 9h3a1 1 0 0 1 1 1v2a1 1 0 0 1-1 1H2" }], + ["path", { d: "M22 17v1a1 1 0 0 1-1 1H10v-9a1 1 0 0 1 1-1h2a1 1 0 0 1 1 1v9" }], + ["circle", { + cx: "8", + cy: "19", + r: "2" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/car.js var Car; @@ -8513,18 +8554,13 @@ var init_car = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/caravan.js -var Caravan; -var init_caravan = __esmMin((() => { - Caravan = [ - ["path", { d: "M18 19V9a4 4 0 0 0-4-4H6a4 4 0 0 0-4 4v8a2 2 0 0 0 2 2h2" }], - ["path", { d: "M2 9h3a1 1 0 0 1 1 1v2a1 1 0 0 1-1 1H2" }], - ["path", { d: "M22 17v1a1 1 0 0 1-1 1H10v-9a1 1 0 0 1 1-1h2a1 1 0 0 1 1 1v9" }], - ["circle", { - cx: "8", - cy: "19", - r: "2" - }] +//#region node_modules/lucide/dist/esm/icons/carrot.js +var Carrot; +var init_carrot = __esmMin((() => { + Carrot = [ + ["path", { d: "M2.27 21.7s9.87-3.5 12.73-6.36a4.5 4.5 0 0 0-6.36-6.37C5.77 11.84 2.27 21.7 2.27 21.7zM8.64 14l-2.05-2.04M15.34 15l-2.46-2.46" }], + ["path", { d: "M22 9s-1.33-2-3.5-2C16.86 7 15 9 15 9s1.33 2 3.5 2S22 9 22 9z" }], + ["path", { d: "M15 2s-2 1.33-2 3.5S15 9 15 9s2-1.84 2-3.5C17 3.33 15 2 15 2z" }] ]; })); @@ -8546,17 +8582,6 @@ var init_card_sim = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/carrot.js -var Carrot; -var init_carrot = __esmMin((() => { - Carrot = [ - ["path", { d: "M2.27 21.7s9.87-3.5 12.73-6.36a4.5 4.5 0 0 0-6.36-6.37C5.77 11.84 2.27 21.7 2.27 21.7zM8.64 14l-2.05-2.04M15.34 15l-2.46-2.46" }], - ["path", { d: "M22 9s-1.33-2-3.5-2C16.86 7 15 9 15 9s1.33 2 3.5 2S22 9 22 9z" }], - ["path", { d: "M15 2s-2 1.33-2 3.5S15 9 15 9s2-1.84 2-3.5C17 3.33 15 2 15 2z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/case-lower.js var CaseLower; @@ -8604,6 +8629,23 @@ var init_case_upper = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cast.js +var Cast; +var init_cast = __esmMin((() => { + Cast = [ + ["path", { d: "M2 8V6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2h-6" }], + ["path", { d: "M2 12a9 9 0 0 1 8 8" }], + ["path", { d: "M2 16a5 5 0 0 1 4 4" }], + ["line", { + x1: "2", + x2: "2.01", + y1: "20", + y2: "20" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/cassette-tape.js var CassetteTape; @@ -8631,23 +8673,6 @@ var init_cassette_tape = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/cast.js -var Cast; -var init_cast = __esmMin((() => { - Cast = [ - ["path", { d: "M2 8V6a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v12a2 2 0 0 1-2 2h-6" }], - ["path", { d: "M2 12a9 9 0 0 1 8 8" }], - ["path", { d: "M2 16a5 5 0 0 1 4 4" }], - ["line", { - x1: "2", - x2: "2.01", - y1: "20", - y2: "20" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/castle.js var Castle; @@ -8830,18 +8855,6 @@ var init_chart_column_big = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/chart-column-increasing.js -var ChartColumnIncreasing; -var init_chart_column_increasing = __esmMin((() => { - ChartColumnIncreasing = [ - ["path", { d: "M13 17V9" }], - ["path", { d: "M18 17V5" }], - ["path", { d: "M3 3v16a2 2 0 0 0 2 2h16" }], - ["path", { d: "M8 17v-3" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/chart-column-decreasing.js var ChartColumnDecreasing; @@ -8854,6 +8867,18 @@ var init_chart_column_decreasing = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/chart-column-increasing.js +var ChartColumnIncreasing; +var init_chart_column_increasing = __esmMin((() => { + ChartColumnIncreasing = [ + ["path", { d: "M13 17V9" }], + ["path", { d: "M18 17V5" }], + ["path", { d: "M3 3v16a2 2 0 0 0 2 2h16" }], + ["path", { d: "M8 17v-3" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/chart-column-stacked.js var ChartColumnStacked; @@ -9080,18 +9105,6 @@ var init_chef_hat = __esmMin((() => { ChefHat = [["path", { d: "M17 21a1 1 0 0 0 1-1v-5.35c0-.457.316-.844.727-1.041a4 4 0 0 0-2.134-7.589 5 5 0 0 0-9.186 0 4 4 0 0 0-2.134 7.588c.411.198.727.585.727 1.041V20a1 1 0 0 0 1 1Z" }], ["path", { d: "M6 17h12" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/cherry.js -var Cherry; -var init_cherry = __esmMin((() => { - Cherry = [ - ["path", { d: "M2 17a5 5 0 0 0 10 0c0-2.76-2.5-5-5-3-2.5-2-5 .24-5 3Z" }], - ["path", { d: "M12 17a5 5 0 0 0 10 0c0-2.76-2.5-5-5-3-2.5-2-5 .24-5 3Z" }], - ["path", { d: "M7 14c3.22-2.91 4.29-8.75 5-12 1.66 2.38 4.94 9 5 12" }], - ["path", { d: "M22 9c-4.29 0-7.14-2.33-10-7 5.71 0 10 4.67 10 7Z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/chess-bishop.js var ChessBishop; @@ -9104,6 +9117,18 @@ var init_chess_bishop = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cherry.js +var Cherry; +var init_cherry = __esmMin((() => { + Cherry = [ + ["path", { d: "M2 17a5 5 0 0 0 10 0c0-2.76-2.5-5-5-3-2.5-2-5 .24-5 3Z" }], + ["path", { d: "M12 17a5 5 0 0 0 10 0c0-2.76-2.5-5-5-3-2.5-2-5 .24-5 3Z" }], + ["path", { d: "M7 14c3.22-2.91 4.29-8.75 5-12 1.66 2.38 4.94 9 5 12" }], + ["path", { d: "M22 9c-4.29 0-7.14-2.33-10-7 5.71 0 10 4.67 10 7Z" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/chess-king.js var ChessKing; @@ -9174,6 +9199,13 @@ var init_chess_queen = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/chevron-down.js +var ChevronDown; +var init_chevron_down = __esmMin((() => { + ChevronDown = [["path", { d: "m6 9 6 6 6-6" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/chess-rook.js var ChessRook; @@ -9189,13 +9221,6 @@ var init_chess_rook = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/chevron-down.js -var ChevronDown; -var init_chevron_down = __esmMin((() => { - ChevronDown = [["path", { d: "m6 9 6 6 6-6" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/chevron-first.js var ChevronFirst; @@ -9293,13 +9318,6 @@ var init_chevrons_up_down = __esmMin((() => { ChevronsUpDown = [["path", { d: "m7 15 5 5 5-5" }], ["path", { d: "m7 9 5-5 5 5" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/chevrons-up.js -var ChevronsUp; -var init_chevrons_up = __esmMin((() => { - ChevronsUp = [["path", { d: "m17 11-5-5-5 5" }], ["path", { d: "m17 18-5-5-5 5" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/chromium.js var Chromium; @@ -9334,6 +9352,13 @@ var init_church = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/chevrons-up.js +var ChevronsUp; +var init_chevrons_up = __esmMin((() => { + ChevronsUp = [["path", { d: "m17 11-5-5-5 5" }], ["path", { d: "m17 18-5-5-5 5" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/cigarette-off.js var CigaretteOff; @@ -9416,17 +9441,6 @@ var init_circle_arrow_left = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-arrow-out-down-left.js -var CircleArrowOutDownLeft; -var init_circle_arrow_out_down_left = __esmMin((() => { - CircleArrowOutDownLeft = [ - ["path", { d: "M2 12a10 10 0 1 1 10 10" }], - ["path", { d: "m2 22 10-10" }], - ["path", { d: "M8 22H2v-6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-arrow-out-down-right.js var CircleArrowOutDownRight; @@ -9438,6 +9452,17 @@ var init_circle_arrow_out_down_right = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-arrow-out-down-left.js +var CircleArrowOutDownLeft; +var init_circle_arrow_out_down_left = __esmMin((() => { + CircleArrowOutDownLeft = [ + ["path", { d: "M2 12a10 10 0 1 1 10 10" }], + ["path", { d: "m2 22 10-10" }], + ["path", { d: "M8 22H2v-6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-arrow-out-up-left.js var CircleArrowOutUpLeft; @@ -9475,6 +9500,13 @@ var init_circle_arrow_right = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-check-big.js +var CircleCheckBig; +var init_circle_check_big = __esmMin((() => { + CircleCheckBig = [["path", { d: "M21.801 10A10 10 0 1 1 17 3.335" }], ["path", { d: "m9 11 3 3L22 4" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-arrow-up.js var CircleArrowUp; @@ -9490,13 +9522,6 @@ var init_circle_arrow_up = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-check-big.js -var CircleCheckBig; -var init_circle_check_big = __esmMin((() => { - CircleCheckBig = [["path", { d: "M21.801 10A10 10 0 1 1 17 3.335" }], ["path", { d: "m9 11 3 3L22 4" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-check.js var CircleCheck; @@ -9530,17 +9555,6 @@ var init_circle_chevron_left = __esmMin((() => { }], ["path", { d: "m14 16-4-4 4-4" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-chevron-right.js -var CircleChevronRight; -var init_circle_chevron_right = __esmMin((() => { - CircleChevronRight = [["circle", { - cx: "12", - cy: "12", - r: "10" - }], ["path", { d: "m10 8 4 4-4 4" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-chevron-up.js var CircleChevronUp; @@ -9552,6 +9566,17 @@ var init_circle_chevron_up = __esmMin((() => { }], ["path", { d: "m8 14 4-4 4 4" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-chevron-right.js +var CircleChevronRight; +var init_circle_chevron_right = __esmMin((() => { + CircleChevronRight = [["circle", { + cx: "12", + cy: "12", + r: "10" + }], ["path", { d: "m10 8 4 4-4 4" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-dashed.js var CircleDashed; @@ -9599,21 +9624,6 @@ var init_circle_divide = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-dollar-sign.js -var CircleDollarSign; -var init_circle_dollar_sign = __esmMin((() => { - CircleDollarSign = [ - ["circle", { - cx: "12", - cy: "12", - r: "10" - }], - ["path", { d: "M16 8h-6a2 2 0 1 0 0 4h4a2 2 0 1 1 0 4H8" }], - ["path", { d: "M12 18V6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-dot-dashed.js var CircleDotDashed; @@ -9635,6 +9645,21 @@ var init_circle_dot_dashed = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-dollar-sign.js +var CircleDollarSign; +var init_circle_dollar_sign = __esmMin((() => { + CircleDollarSign = [ + ["circle", { + cx: "12", + cy: "12", + r: "10" + }], + ["path", { d: "M16 8h-6a2 2 0 1 0 0 4h4a2 2 0 1 1 0 4H8" }], + ["path", { d: "M12 18V6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-dot.js var CircleDot; @@ -9814,6 +9839,44 @@ var init_circle_percent = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-pile.js +var CirclePile; +var init_circle_pile = __esmMin((() => { + CirclePile = [ + ["circle", { + cx: "12", + cy: "19", + r: "2" + }], + ["circle", { + cx: "12", + cy: "5", + r: "2" + }], + ["circle", { + cx: "16", + cy: "12", + r: "2" + }], + ["circle", { + cx: "20", + cy: "19", + r: "2" + }], + ["circle", { + cx: "4", + cy: "19", + r: "2" + }], + ["circle", { + cx: "8", + cy: "12", + r: "2" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-play.js var CirclePlay; @@ -9825,21 +9888,6 @@ var init_circle_play = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-plus.js -var CirclePlus; -var init_circle_plus = __esmMin((() => { - CirclePlus = [ - ["circle", { - cx: "12", - cy: "12", - r: "10" - }], - ["path", { d: "M8 12h8" }], - ["path", { d: "M12 8v8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-pound-sterling.js var CirclePoundSterling; @@ -9856,6 +9904,21 @@ var init_circle_pound_sterling = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-plus.js +var CirclePlus; +var init_circle_plus = __esmMin((() => { + CirclePlus = [ + ["circle", { + cx: "12", + cy: "12", + r: "10" + }], + ["path", { d: "M8 12h8" }], + ["path", { d: "M12 8v8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-power.js var CirclePower; @@ -9952,25 +10015,6 @@ var init_circle_stop = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/circle-user-round.js -var CircleUserRound; -var init_circle_user_round = __esmMin((() => { - CircleUserRound = [ - ["path", { d: "M18 20a6 6 0 0 0-12 0" }], - ["circle", { - cx: "12", - cy: "10", - r: "4" - }], - ["circle", { - cx: "12", - cy: "12", - r: "10" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/circle-user.js var CircleUser; @@ -9990,6 +10034,25 @@ var init_circle_user = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/circle-user-round.js +var CircleUserRound; +var init_circle_user_round = __esmMin((() => { + CircleUserRound = [ + ["path", { d: "M18 20a6 6 0 0 0-12 0" }], + ["circle", { + cx: "12", + cy: "10", + r: "4" + }], + ["circle", { + cx: "12", + cy: "12", + r: "10" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/circle-x.js var CircleX; @@ -10128,6 +10191,24 @@ var init_clipboard_copy = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/clipboard-minus.js +var ClipboardMinus; +var init_clipboard_minus = __esmMin((() => { + ClipboardMinus = [ + ["rect", { + width: "8", + height: "4", + x: "8", + y: "2", + rx: "1", + ry: "1" + }], + ["path", { d: "M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2" }], + ["path", { d: "M9 14h6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/clipboard-list.js var ClipboardList; @@ -10168,24 +10249,6 @@ var init_clipboard_paste = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/clipboard-minus.js -var ClipboardMinus; -var init_clipboard_minus = __esmMin((() => { - ClipboardMinus = [ - ["rect", { - width: "8", - height: "4", - x: "8", - y: "2", - rx: "1", - ry: "1" - }], - ["path", { d: "M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2" }], - ["path", { d: "M9 14h6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/clipboard-pen-line.js var ClipboardPenLine; @@ -10262,20 +10325,6 @@ var init_clipboard_type = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/clipboard.js -var Clipboard; -var init_clipboard = __esmMin((() => { - Clipboard = [["rect", { - width: "8", - height: "4", - x: "8", - y: "2", - rx: "1", - ry: "1" - }], ["path", { d: "M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/clipboard-x.js var ClipboardX; @@ -10295,6 +10344,20 @@ var init_clipboard_x = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/clipboard.js +var Clipboard; +var init_clipboard = __esmMin((() => { + Clipboard = [["rect", { + width: "8", + height: "4", + x: "8", + y: "2", + rx: "1", + ry: "1" + }], ["path", { d: "M16 4h2a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2h2" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/clock-1.js var Clock1; @@ -10317,6 +10380,17 @@ var init_clock_10 = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/clock-11.js +var Clock11; +var init_clock_11 = __esmMin((() => { + Clock11 = [["path", { d: "M12 6v6l-2-4" }], ["circle", { + cx: "12", + cy: "12", + r: "10" + }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/clock-12.js var Clock12; @@ -10350,17 +10424,6 @@ var init_clock_3 = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/clock-11.js -var Clock11; -var init_clock_11 = __esmMin((() => { - Clock11 = [["path", { d: "M12 6v6l-2-4" }], ["circle", { - cx: "12", - cy: "12", - r: "10" - }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/clock-4.js var Clock4; @@ -10511,6 +10574,17 @@ var init_clock = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cloud-alert.js +var CloudAlert; +var init_cloud_alert = __esmMin((() => { + CloudAlert = [ + ["path", { d: "M12 12v4" }], + ["path", { d: "M12 20h.01" }], + ["path", { d: "M17 18h.5a1 1 0 0 0 0-9h-1.79A7 7 0 1 0 7 17.708" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/closed-caption.js var ClosedCaption; @@ -10528,17 +10602,6 @@ var init_closed_caption = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/cloud-alert.js -var CloudAlert; -var init_cloud_alert = __esmMin((() => { - CloudAlert = [ - ["path", { d: "M12 12v4" }], - ["path", { d: "M12 20h.01" }], - ["path", { d: "M17 18h.5a1 1 0 0 0 0-9h-1.79A7 7 0 1 0 7 17.708" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/cloud-check.js var CloudCheck; @@ -10547,13 +10610,13 @@ var init_cloud_check = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/cloud-download.js -var CloudDownload; -var init_cloud_download = __esmMin((() => { - CloudDownload = [ - ["path", { d: "M12 13v8l-4-4" }], - ["path", { d: "m12 21 4-4" }], - ["path", { d: "M4.393 15.269A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.436 8.284" }] +//#region node_modules/lucide/dist/esm/icons/cloud-backup.js +var CloudBackup; +var init_cloud_backup = __esmMin((() => { + CloudBackup = [ + ["path", { d: "M21 15.251A4.5 4.5 0 0 0 17.5 8h-1.79A7 7 0 1 0 3 13.607" }], + ["path", { d: "M7 11v4h4" }], + ["path", { d: "M8 19a5 5 0 0 0 9-3 4.5 4.5 0 0 0-4.5-4.5 4.82 4.82 0 0 0-3.41 1.41L7 15" }] ]; })); @@ -10574,6 +10637,17 @@ var init_cloud_cog = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cloud-download.js +var CloudDownload; +var init_cloud_download = __esmMin((() => { + CloudDownload = [ + ["path", { d: "M12 13v8l-4-4" }], + ["path", { d: "m12 21 4-4" }], + ["path", { d: "M4.393 15.269A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.436 8.284" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/cloud-drizzle.js var CloudDrizzle; @@ -10676,21 +10750,6 @@ var init_cloud_rain = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/cloud-snow.js -var CloudSnow; -var init_cloud_snow = __esmMin((() => { - CloudSnow = [ - ["path", { d: "M4 14.899A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.5 8.242" }], - ["path", { d: "M8 15h.01" }], - ["path", { d: "M8 19h.01" }], - ["path", { d: "M12 17h.01" }], - ["path", { d: "M12 21h.01" }], - ["path", { d: "M16 15h.01" }], - ["path", { d: "M16 19h.01" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/cloud-sun-rain.js var CloudSunRain; @@ -10707,6 +10766,21 @@ var init_cloud_sun_rain = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cloud-snow.js +var CloudSnow; +var init_cloud_snow = __esmMin((() => { + CloudSnow = [ + ["path", { d: "M4 14.899A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.5 8.242" }], + ["path", { d: "M8 15h.01" }], + ["path", { d: "M8 19h.01" }], + ["path", { d: "M12 17h.01" }], + ["path", { d: "M12 21h.01" }], + ["path", { d: "M16 15h.01" }], + ["path", { d: "M16 19h.01" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/cloud-sun.js var CloudSun; @@ -10722,13 +10796,15 @@ var init_cloud_sun = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/cloud-upload.js -var CloudUpload; -var init_cloud_upload = __esmMin((() => { - CloudUpload = [ - ["path", { d: "M12 13v8" }], - ["path", { d: "M4 14.899A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.5 8.242" }], - ["path", { d: "m8 17 4-4 4 4" }] +//#region node_modules/lucide/dist/esm/icons/cloud-sync.js +var CloudSync; +var init_cloud_sync = __esmMin((() => { + CloudSync = [ + ["path", { d: "m17 18-1.535 1.605a5 5 0 0 1-8-1.5" }], + ["path", { d: "M17 22v-4h-4" }], + ["path", { d: "M20.996 15.251A4.5 4.5 0 0 0 17.495 8h-1.79a7 7 0 1 0-12.709 5.607" }], + ["path", { d: "M7 10v4h4" }], + ["path", { d: "m7 14 1.535-1.605a5 5 0 0 1 8 1.5" }] ]; })); @@ -10746,6 +10822,17 @@ var init_cloudy = __esmMin((() => { Cloudy = [["path", { d: "M17.5 21H9a7 7 0 1 1 6.71-9h1.79a4.5 4.5 0 1 1 0 9Z" }], ["path", { d: "M22 10a3 3 0 0 0-3-3h-2.207a5.502 5.502 0 0 0-10.702.5" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/cloud-upload.js +var CloudUpload; +var init_cloud_upload = __esmMin((() => { + CloudUpload = [ + ["path", { d: "M12 13v8" }], + ["path", { d: "M4 14.899A7 7 0 1 1 15.71 8h1.79a4.5 4.5 0 0 1 2.5 8.242" }], + ["path", { d: "m8 17 4-4 4 4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/clover.js var Clover; @@ -10882,6 +10969,19 @@ var init_coins = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/columns-2.js +var Columns2; +var init_columns_2 = __esmMin((() => { + Columns2 = [["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], ["path", { d: "M12 3v18" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/columns-3-cog.js var Columns3Cog; @@ -10906,19 +11006,6 @@ var init_columns_3_cog = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/columns-2.js -var Columns2; -var init_columns_2 = __esmMin((() => { - Columns2 = [["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], ["path", { d: "M12 3v18" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/columns-3.js var Columns3; @@ -11081,17 +11168,17 @@ var init_construction = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/contact-round.js -var ContactRound; -var init_contact_round = __esmMin((() => { - ContactRound = [ +//#region node_modules/lucide/dist/esm/icons/contact.js +var Contact; +var init_contact = __esmMin((() => { + Contact = [ ["path", { d: "M16 2v2" }], - ["path", { d: "M17.915 22a6 6 0 0 0-12 0" }], + ["path", { d: "M7 22v-2a2 2 0 0 1 2-2h6a2 2 0 0 1 2 2v2" }], ["path", { d: "M8 2v2" }], ["circle", { cx: "12", - cy: "12", - r: "4" + cy: "11", + r: "3" }], ["rect", { x: "3", @@ -11104,17 +11191,17 @@ var init_contact_round = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/contact.js -var Contact; -var init_contact = __esmMin((() => { - Contact = [ +//#region node_modules/lucide/dist/esm/icons/contact-round.js +var ContactRound; +var init_contact_round = __esmMin((() => { + ContactRound = [ ["path", { d: "M16 2v2" }], - ["path", { d: "M7 22v-2a2 2 0 0 1 2-2h6a2 2 0 0 1 2 2v2" }], + ["path", { d: "M17.915 22a6 6 0 0 0-12 0" }], ["path", { d: "M8 2v2" }], ["circle", { cx: "12", - cy: "11", - r: "3" + cy: "12", + r: "4" }], ["rect", { x: "3", @@ -11312,17 +11399,6 @@ var init_copy = __esmMin((() => { }], ["path", { d: "M4 16c-1.1 0-2-.9-2-2V4c0-1.1.9-2 2-2h10c1.1 0 2 .9 2 2" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/copyright.js -var Copyright; -var init_copyright = __esmMin((() => { - Copyright = [["circle", { - cx: "12", - cy: "12", - r: "10" - }], ["path", { d: "M14.83 14.83a4 4 0 1 1 0-5.66" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/copyleft.js var Copyleft; @@ -11334,6 +11410,17 @@ var init_copyleft = __esmMin((() => { }], ["path", { d: "M9.17 14.83a4 4 0 1 0 0-5.66" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/copyright.js +var Copyright; +var init_copyright = __esmMin((() => { + Copyright = [["circle", { + cx: "12", + cy: "12", + r: "10" + }], ["path", { d: "M14.83 14.83a4 4 0 1 1 0-5.66" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/corner-down-left.js var CornerDownLeft; @@ -11383,6 +11470,13 @@ var init_corner_up_left = __esmMin((() => { CornerUpLeft = [["path", { d: "M20 20v-7a4 4 0 0 0-4-4H4" }], ["path", { d: "M9 14 4 9l5-5" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/corner-up-right.js +var CornerUpRight; +var init_corner_up_right = __esmMin((() => { + CornerUpRight = [["path", { d: "m15 14 5-5-5-5" }], ["path", { d: "M4 20v-7a4 4 0 0 1 4-4h12" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/cpu.js var Cpu; @@ -11450,13 +11544,6 @@ var init_credit_card = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/corner-up-right.js -var CornerUpRight; -var init_corner_up_right = __esmMin((() => { - CornerUpRight = [["path", { d: "m15 14 5-5-5-5" }], ["path", { d: "M4 20v-7a4 4 0 0 1 4-4h12" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/croissant.js var Croissant; @@ -11652,6 +11739,24 @@ var init_database_zap = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/decimals-arrow-left.js +var DecimalsArrowLeft; +var init_decimals_arrow_left = __esmMin((() => { + DecimalsArrowLeft = [ + ["path", { d: "m13 21-3-3 3-3" }], + ["path", { d: "M20 18H10" }], + ["path", { d: "M3 11h.01" }], + ["rect", { + x: "6", + y: "3", + width: "5", + height: "8", + rx: "2.5" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/database.js var Database; @@ -11669,20 +11774,13 @@ var init_database = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/decimals-arrow-left.js -var DecimalsArrowLeft; -var init_decimals_arrow_left = __esmMin((() => { - DecimalsArrowLeft = [ - ["path", { d: "m13 21-3-3 3-3" }], - ["path", { d: "M20 18H10" }], - ["path", { d: "M3 11h.01" }], - ["rect", { - x: "6", - y: "3", - width: "5", - height: "8", - rx: "2.5" - }] +//#region node_modules/lucide/dist/esm/icons/delete.js +var Delete$2; +var init_delete = __esmMin((() => { + Delete$2 = [ + ["path", { d: "M10 5a2 2 0 0 0-1.344.519l-6.328 5.74a1 1 0 0 0 0 1.481l6.328 5.741A2 2 0 0 0 10 19h10a2 2 0 0 0 2-2V7a2 2 0 0 0-2-2z" }], + ["path", { d: "m12 9 6 6" }], + ["path", { d: "m18 9-6 6" }] ]; })); @@ -11711,17 +11809,6 @@ var init_decimals_arrow_right = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/delete.js -var Delete$2; -var init_delete = __esmMin((() => { - Delete$2 = [ - ["path", { d: "M10 5a2 2 0 0 0-1.344.519l-6.328 5.74a1 1 0 0 0 0 1.481l6.328 5.741A2 2 0 0 0 10 19h10a2 2 0 0 0 2-2V7a2 2 0 0 0-2-2z" }], - ["path", { d: "m12 9 6 6" }], - ["path", { d: "m18 9-6 6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/dessert.js var Dessert; @@ -11765,6 +11852,17 @@ var init_diamond_minus = __esmMin((() => { DiamondMinus = [["path", { d: "M2.7 10.3a2.41 2.41 0 0 0 0 3.41l7.59 7.59a2.41 2.41 0 0 0 3.41 0l7.59-7.59a2.41 2.41 0 0 0 0-3.41L13.7 2.71a2.41 2.41 0 0 0-3.41 0z" }], ["path", { d: "M8 12h8" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/diamond-plus.js +var DiamondPlus; +var init_diamond_plus = __esmMin((() => { + DiamondPlus = [ + ["path", { d: "M12 8v8" }], + ["path", { d: "M2.7 10.3a2.41 2.41 0 0 0 0 3.41l7.59 7.59a2.41 2.41 0 0 0 3.41 0l7.59-7.59a2.41 2.41 0 0 0 0-3.41L13.7 2.71a2.41 2.41 0 0 0-3.41 0z" }], + ["path", { d: "M8 12h8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/diamond-percent.js var DiamondPercent; @@ -11777,17 +11875,6 @@ var init_diamond_percent = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/diamond-plus.js -var DiamondPlus; -var init_diamond_plus = __esmMin((() => { - DiamondPlus = [ - ["path", { d: "M12 8v8" }], - ["path", { d: "M2.7 10.3a2.41 2.41 0 0 0 0 3.41l7.59 7.59a2.41 2.41 0 0 0 3.41 0l7.59-7.59a2.41 2.41 0 0 0 0-3.41L13.7 2.71a2.41 2.41 0 0 0-3.41 0z" }], - ["path", { d: "M8 12h8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/diamond.js var Diamond; @@ -11846,26 +11933,6 @@ var init_dice_3 = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/dice-4.js -var Dice4; -var init_dice_4 = __esmMin((() => { - Dice4 = [ - ["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2", - ry: "2" - }], - ["path", { d: "M16 8h.01" }], - ["path", { d: "M8 8h.01" }], - ["path", { d: "M8 16h.01" }], - ["path", { d: "M16 16h.01" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/dice-5.js var Dice5; @@ -11887,6 +11954,26 @@ var init_dice_5 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/dice-4.js +var Dice4; +var init_dice_4 = __esmMin((() => { + Dice4 = [ + ["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2", + ry: "2" + }], + ["path", { d: "M16 8h.01" }], + ["path", { d: "M8 8h.01" }], + ["path", { d: "M8 16h.01" }], + ["path", { d: "M16 16h.01" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/dice-6.js var Dice6; @@ -11980,6 +12067,21 @@ var init_disc_3 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/disc.js +var Disc; +var init_disc = __esmMin((() => { + Disc = [["circle", { + cx: "12", + cy: "12", + r: "10" + }], ["circle", { + cx: "12", + cy: "12", + r: "2" + }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/disc-album.js var DiscAlbum; @@ -12001,21 +12103,6 @@ var init_disc_album = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/disc.js -var Disc; -var init_disc = __esmMin((() => { - Disc = [["circle", { - cx: "12", - cy: "12", - r: "10" - }], ["circle", { - cx: "12", - cy: "12", - r: "2" - }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/divide.js var Divide; @@ -12292,13 +12379,6 @@ var init_droplet_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/droplet.js -var Droplet; -var init_droplet = __esmMin((() => { - Droplet = [["path", { d: "M12 22a7 7 0 0 0 7-7c0-2-1-3.9-3-5.5s-3.5-4-4-6.5c-.5 2.5-2 4.9-4 6.5C6 11.1 5 13 5 15a7 7 0 0 0 7 7z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/droplets.js var Droplets; @@ -12306,6 +12386,13 @@ var init_droplets = __esmMin((() => { Droplets = [["path", { d: "M7 16.3c2.2 0 4-1.83 4-4.05 0-1.16-.57-2.26-1.71-3.19S7.29 6.75 7 5.3c-.29 1.45-1.14 2.84-2.29 3.76S3 11.1 3 12.25c0 2.22 1.8 4.05 4 4.05z" }], ["path", { d: "M12.56 6.6A10.97 10.97 0 0 0 14 3.02c.5 2.5 2 4.9 4 6.5s3 3.5 3 5.5a6.98 6.98 0 0 1-11.91 4.97" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/droplet.js +var Droplet; +var init_droplet = __esmMin((() => { + Droplet = [["path", { d: "M12 22a7 7 0 0 0 7-7c0-2-1-3.9-3-5.5s-3.5-4-4-6.5c-.5 2.5-2 4.9-4 6.5C6 11.1 5 13 5 15a7 7 0 0 0 7 7z" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/drum.js var Drum; @@ -12333,19 +12420,6 @@ var init_drumstick = __esmMin((() => { Drumstick = [["path", { d: "M15.4 15.63a7.875 6 135 1 1 6.23-6.23 4.5 3.43 135 0 0-6.23 6.23" }], ["path", { d: "m8.29 12.71-2.6 2.6a2.5 2.5 0 1 0-1.65 4.65A2.5 2.5 0 1 0 8.7 18.3l2.59-2.59" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/dumbbell.js -var Dumbbell; -var init_dumbbell = __esmMin((() => { - Dumbbell = [ - ["path", { d: "M17.596 12.768a2 2 0 1 0 2.829-2.829l-1.768-1.767a2 2 0 0 0 2.828-2.829l-2.828-2.828a2 2 0 0 0-2.829 2.828l-1.767-1.768a2 2 0 1 0-2.829 2.829z" }], - ["path", { d: "m2.5 21.5 1.4-1.4" }], - ["path", { d: "m20.1 3.9 1.4-1.4" }], - ["path", { d: "M5.343 21.485a2 2 0 1 0 2.829-2.828l1.767 1.768a2 2 0 1 0 2.829-2.829l-6.364-6.364a2 2 0 1 0-2.829 2.829l1.768 1.767a2 2 0 0 0-2.828 2.829z" }], - ["path", { d: "m9.6 14.4 4.8-4.8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/ear-off.js var EarOff; @@ -12364,6 +12438,19 @@ var init_ear_off = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/dumbbell.js +var Dumbbell; +var init_dumbbell = __esmMin((() => { + Dumbbell = [ + ["path", { d: "M17.596 12.768a2 2 0 1 0 2.829-2.829l-1.768-1.767a2 2 0 0 0 2.828-2.829l-2.828-2.828a2 2 0 0 0-2.829 2.828l-1.767-1.768a2 2 0 1 0-2.829 2.829z" }], + ["path", { d: "m2.5 21.5 1.4-1.4" }], + ["path", { d: "m20.1 3.9 1.4-1.4" }], + ["path", { d: "M5.343 21.485a2 2 0 1 0 2.829-2.828l1.767 1.768a2 2 0 1 0 2.829-2.829l-6.364-6.364a2 2 0 1 0-2.829 2.829l1.768 1.767a2 2 0 0 0-2.828 2.829z" }], + ["path", { d: "m9.6 14.4 4.8-4.8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/ear.js var Ear; @@ -12709,6 +12796,19 @@ var init_fence = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/figma.js +var Figma; +var init_figma = __esmMin((() => { + Figma = [ + ["path", { d: "M5 5.5A3.5 3.5 0 0 1 8.5 2H12v7H8.5A3.5 3.5 0 0 1 5 5.5z" }], + ["path", { d: "M12 2h3.5a3.5 3.5 0 1 1 0 7H12V2z" }], + ["path", { d: "M12 12.5a3.5 3.5 0 1 1 7 0 3.5 3.5 0 1 1-7 0z" }], + ["path", { d: "M5 19.5A3.5 3.5 0 0 1 8.5 16H12v3.5a3.5 3.5 0 1 1-7 0z" }], + ["path", { d: "M5 12.5A3.5 3.5 0 0 1 8.5 9H12v7H8.5A3.5 3.5 0 0 1 5 12.5z" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/ferris-wheel.js var FerrisWheel; @@ -12730,19 +12830,6 @@ var init_ferris_wheel = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/figma.js -var Figma; -var init_figma = __esmMin((() => { - Figma = [ - ["path", { d: "M5 5.5A3.5 3.5 0 0 1 8.5 2H12v7H8.5A3.5 3.5 0 0 1 5 5.5z" }], - ["path", { d: "M12 2h3.5a3.5 3.5 0 1 1 0 7H12V2z" }], - ["path", { d: "M12 12.5a3.5 3.5 0 1 1 7 0 3.5 3.5 0 1 1-7 0z" }], - ["path", { d: "M5 19.5A3.5 3.5 0 0 1 8.5 16H12v3.5a3.5 3.5 0 1 1-7 0z" }], - ["path", { d: "M5 12.5A3.5 3.5 0 0 1 8.5 9H12v7H8.5A3.5 3.5 0 0 1 5 12.5z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/file-archive.js var FileArchive; @@ -12913,18 +13000,6 @@ var init_file_clock = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/file-code.js -var FileCode; -var init_file_code = __esmMin((() => { - FileCode = [ - ["path", { d: "M6 22a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.704.706l3.588 3.588A2.4 2.4 0 0 1 20 8v12a2 2 0 0 1-2 2z" }], - ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], - ["path", { d: "M10 12.5 8 15l2 2.5" }], - ["path", { d: "m14 12.5 2 2.5-2 2.5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/file-code-corner.js var FileCodeCorner; @@ -12937,6 +13012,18 @@ var init_file_code_corner = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/file-code.js +var FileCode; +var init_file_code = __esmMin((() => { + FileCode = [ + ["path", { d: "M6 22a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.704.706l3.588 3.588A2.4 2.4 0 0 1 20 8v12a2 2 0 0 1-2 2z" }], + ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], + ["path", { d: "M10 12.5 8 15l2 2.5" }], + ["path", { d: "m14 12.5 2 2.5-2 2.5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/file-cog.js var FileCog; @@ -13121,6 +13208,18 @@ var init_file_minus = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/file-output.js +var FileOutput; +var init_file_output = __esmMin((() => { + FileOutput = [ + ["path", { d: "M4.226 20.925A2 2 0 0 0 6 22h12a2 2 0 0 0 2-2V8a2.4 2.4 0 0 0-.706-1.706l-3.588-3.588A2.4 2.4 0 0 0 14 2H6a2 2 0 0 0-2 2v3.127" }], + ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], + ["path", { d: "m5 11-3 3" }], + ["path", { d: "m5 17-3-3h10" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/file-music.js var FileMusic; @@ -13137,18 +13236,6 @@ var init_file_music = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/file-output.js -var FileOutput; -var init_file_output = __esmMin((() => { - FileOutput = [ - ["path", { d: "M4.226 20.925A2 2 0 0 0 6 22h12a2 2 0 0 0 2-2V8a2.4 2.4 0 0 0-.706-1.706l-3.588-3.588A2.4 2.4 0 0 0 14 2H6a2 2 0 0 0-2 2v3.127" }], - ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], - ["path", { d: "m5 11-3 3" }], - ["path", { d: "m5 17-3-3h10" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/file-pen-line.js var FilePenLine; @@ -13182,18 +13269,6 @@ var init_file_play = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/file-plus-corner.js -var FilePlusCorner; -var init_file_plus_corner = __esmMin((() => { - FilePlusCorner = [ - ["path", { d: "M11.35 22H6a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.706.706l3.588 3.588A2.4 2.4 0 0 1 20 8v5.35" }], - ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], - ["path", { d: "M14 19h6" }], - ["path", { d: "M17 16v6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/file-plus.js var FilePlus; @@ -13206,6 +13281,18 @@ var init_file_plus = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/file-plus-corner.js +var FilePlusCorner; +var init_file_plus_corner = __esmMin((() => { + FilePlusCorner = [ + ["path", { d: "M11.35 22H6a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.706.706l3.588 3.588A2.4 2.4 0 0 1 20 8v5.35" }], + ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], + ["path", { d: "M14 19h6" }], + ["path", { d: "M17 16v6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/file-question-mark.js var FileQuestionMark; @@ -13247,6 +13334,19 @@ var init_file_search_corner = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/file-signal.js +var FileSignal; +var init_file_signal = __esmMin((() => { + FileSignal = [ + ["path", { d: "M6 22a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.704.706l3.588 3.588A2.4 2.4 0 0 1 20 8v12a2 2 0 0 1-2 2z" }], + ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], + ["path", { d: "M8 15h.01" }], + ["path", { d: "M11.5 13.5a2.5 2.5 0 0 1 0 3" }], + ["path", { d: "M15 12a5 5 0 0 1 0 6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/file-search.js var FileSearch; @@ -13263,19 +13363,6 @@ var init_file_search = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/file-signal.js -var FileSignal; -var init_file_signal = __esmMin((() => { - FileSignal = [ - ["path", { d: "M6 22a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h8a2.4 2.4 0 0 1 1.704.706l3.588 3.588A2.4 2.4 0 0 1 20 8v12a2 2 0 0 1-2 2z" }], - ["path", { d: "M14 2v5a1 1 0 0 0 1 1h5" }], - ["path", { d: "M8 15h.01" }], - ["path", { d: "M11.5 13.5a2.5 2.5 0 0 1 0 3" }], - ["path", { d: "M15 12a5 5 0 0 1 0 6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/file-sliders.js var FileSliders; @@ -13548,6 +13635,21 @@ var init_fish_symbol = __esmMin((() => { FishSymbol = [["path", { d: "M2 16s9-15 20-4C11 23 2 8 2 8" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/fishing-hook.js +var FishingHook; +var init_fishing_hook = __esmMin((() => { + FishingHook = [ + ["path", { d: "m17.586 11.414-5.93 5.93a1 1 0 0 1-8-8l3.137-3.137a.707.707 0 0 1 1.207.5V10" }], + ["path", { d: "M20.414 8.586 22 7" }], + ["circle", { + cx: "19", + cy: "10", + r: "2" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/fish.js var Fish; @@ -13895,17 +13997,6 @@ var init_folder_cog = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/folder-dot.js -var FolderDot; -var init_folder_dot = __esmMin((() => { - FolderDot = [["path", { d: "M4 20h16a2 2 0 0 0 2-2V8a2 2 0 0 0-2-2h-7.93a2 2 0 0 1-1.66-.9l-.82-1.2A2 2 0 0 0 7.93 3H4a2 2 0 0 0-2 2v13c0 1.1.9 2 2 2Z" }], ["circle", { - cx: "12", - cy: "13", - r: "1" - }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/folder-down.js var FolderDown; @@ -13917,6 +14008,17 @@ var init_folder_down = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/folder-dot.js +var FolderDot; +var init_folder_dot = __esmMin((() => { + FolderDot = [["path", { d: "M4 20h16a2 2 0 0 0 2-2V8a2 2 0 0 0-2-2h-7.93a2 2 0 0 1-1.66-.9l-.82-1.2A2 2 0 0 0 7.93 3H4a2 2 0 0 0-2 2v13c0 1.1.9 2 2 2Z" }], ["circle", { + cx: "12", + cy: "13", + r: "1" + }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/folder-git-2.js var FolderGit2; @@ -13937,6 +14039,13 @@ var init_folder_git_2 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/folder-heart.js +var FolderHeart; +var init_folder_heart = __esmMin((() => { + FolderHeart = [["path", { d: "M10.638 20H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h3.9a2 2 0 0 1 1.69.9l.81 1.2a2 2 0 0 0 1.67.9H20a2 2 0 0 1 2 2v3.417" }], ["path", { d: "M14.62 18.8A2.25 2.25 0 1 1 18 15.836a2.25 2.25 0 1 1 3.38 2.966l-2.626 2.856a.998.998 0 0 1-1.507 0z" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/folder-git.js var FolderGit; @@ -13953,13 +14062,6 @@ var init_folder_git = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/folder-heart.js -var FolderHeart; -var init_folder_heart = __esmMin((() => { - FolderHeart = [["path", { d: "M10.638 20H4a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h3.9a2 2 0 0 1 1.69.9l.81 1.2a2 2 0 0 0 1.67.9H20a2 2 0 0 1 2 2v3.417" }], ["path", { d: "M14.62 18.8A2.25 2.25 0 1 1 18 15.836a2.25 2.25 0 1 1 3.38 2.966l-2.626 2.856a.998.998 0 0 1-1.507 0z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/folder-input.js var FolderInput; @@ -14158,17 +14260,6 @@ var init_folder_up = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/folder-x.js -var FolderX; -var init_folder_x = __esmMin((() => { - FolderX = [ - ["path", { d: "M20 20a2 2 0 0 0 2-2V8a2 2 0 0 0-2-2h-7.9a2 2 0 0 1-1.69-.9L9.6 3.9A2 2 0 0 0 7.93 3H4a2 2 0 0 0-2 2v13a2 2 0 0 0 2 2Z" }], - ["path", { d: "m9.5 10.5 5 5" }], - ["path", { d: "m14.5 10.5-5 5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/folder.js var Folder$1; @@ -14183,6 +14274,17 @@ var init_folders = __esmMin((() => { Folders = [["path", { d: "M20 5a2 2 0 0 1 2 2v7a2 2 0 0 1-2 2H9a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h2.5a1.5 1.5 0 0 1 1.2.6l.6.8a1.5 1.5 0 0 0 1.2.6z" }], ["path", { d: "M3 8.268a2 2 0 0 0-1 1.738V19a2 2 0 0 0 2 2h11a2 2 0 0 0 1.732-1" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/folder-x.js +var FolderX; +var init_folder_x = __esmMin((() => { + FolderX = [ + ["path", { d: "M20 20a2 2 0 0 0 2-2V8a2 2 0 0 0-2-2h-7.9a2 2 0 0 1-1.69-.9L9.6 3.9A2 2 0 0 0 7.93 3H4a2 2 0 0 0-2 2v13a2 2 0 0 0 2 2Z" }], + ["path", { d: "m9.5 10.5 5 5" }], + ["path", { d: "m14.5 10.5-5 5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/footprints.js var Footprints; @@ -14285,6 +14387,18 @@ var init_framer = __esmMin((() => { Framer = [["path", { d: "M5 16V9h14V2H5l14 14h-7m-7 0 7 7v-7m-7 0h7" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/fuel.js +var Fuel; +var init_fuel = __esmMin((() => { + Fuel = [ + ["path", { d: "M14 13h2a2 2 0 0 1 2 2v2a2 2 0 0 0 4 0v-6.998a2 2 0 0 0-.59-1.42L18 5" }], + ["path", { d: "M14 21V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v16" }], + ["path", { d: "M2 21h13" }], + ["path", { d: "M3 9h11" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/frown.js var Frown; @@ -14311,18 +14425,6 @@ var init_frown = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/fuel.js -var Fuel; -var init_fuel = __esmMin((() => { - Fuel = [ - ["path", { d: "M14 13h2a2 2 0 0 1 2 2v2a2 2 0 0 0 4 0v-6.998a2 2 0 0 0-.59-1.42L18 5" }], - ["path", { d: "M14 21V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v16" }], - ["path", { d: "M2 21h13" }], - ["path", { d: "M3 9h11" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/fullscreen.js var Fullscreen; @@ -14542,13 +14644,6 @@ var init_gamepad = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/gauge.js -var Gauge; -var init_gauge = __esmMin((() => { - Gauge = [["path", { d: "m12 14 4-4" }], ["path", { d: "M3.34 19a10 10 0 1 1 17.32 0" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/gavel.js var Gavel; @@ -14562,6 +14657,13 @@ var init_gavel = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/gauge.js +var Gauge; +var init_gauge = __esmMin((() => { + Gauge = [["path", { d: "m12 14 4-4" }], ["path", { d: "M3.34 19a10 10 0 1 1 17.32 0" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/gem.js var Gem; @@ -14886,23 +14988,6 @@ var init_git_pull_request_create_arrow = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/git-pull-request-create.js -var GitPullRequestCreate; -var init_git_pull_request_create = __esmMin((() => { - GitPullRequestCreate = [ - ["circle", { - cx: "6", - cy: "6", - r: "3" - }], - ["path", { d: "M6 9v12" }], - ["path", { d: "M13 6h3a2 2 0 0 1 2 2v3" }], - ["path", { d: "M18 15v6" }], - ["path", { d: "M21 18h-6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/git-pull-request-draft.js var GitPullRequestDraft; @@ -14930,10 +15015,20 @@ var init_git_pull_request_draft = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/gitlab.js -var Gitlab; -var init_gitlab = __esmMin((() => { - Gitlab = [["path", { d: "m22 13.29-3.33-10a.42.42 0 0 0-.14-.18.38.38 0 0 0-.22-.11.39.39 0 0 0-.23.07.42.42 0 0 0-.14.18l-2.26 6.67H8.32L6.1 3.26a.42.42 0 0 0-.1-.18.38.38 0 0 0-.26-.08.39.39 0 0 0-.23.07.42.42 0 0 0-.14.18L2 13.29a.74.74 0 0 0 .27.83L12 21l9.69-6.88a.71.71 0 0 0 .31-.83Z" }]]; +//#region node_modules/lucide/dist/esm/icons/git-pull-request-create.js +var GitPullRequestCreate; +var init_git_pull_request_create = __esmMin((() => { + GitPullRequestCreate = [ + ["circle", { + cx: "6", + cy: "6", + r: "3" + }], + ["path", { d: "M6 9v12" }], + ["path", { d: "M13 6h3a2 2 0 0 1 2 2v3" }], + ["path", { d: "M18 15v6" }], + ["path", { d: "M21 18h-6" }] + ]; })); //#endregion @@ -14961,13 +15056,6 @@ var init_git_pull_request = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/glass-water.js -var GlassWater; -var init_glass_water = __esmMin((() => { - GlassWater = [["path", { d: "M5.116 4.104A1 1 0 0 1 6.11 3h11.78a1 1 0 0 1 .994 1.105L17.19 20.21A2 2 0 0 1 15.2 22H8.8a2 2 0 0 1-2-1.79z" }], ["path", { d: "M6 12a5 5 0 0 1 6 0 5 5 0 0 0 6 0" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/github.js var Github; @@ -14975,6 +15063,20 @@ var init_github = __esmMin((() => { Github = [["path", { d: "M15 22v-4a4.8 4.8 0 0 0-1-3.5c3 0 6-2 6-5.5.08-1.25-.27-2.48-1-3.5.28-1.15.28-2.35 0-3.5 0 0-1 0-3 1.5-2.64-.5-5.36-.5-8 0C6 2 5 2 5 2c-.3 1.15-.3 2.35 0 3.5A5.403 5.403 0 0 0 4 9c0 3.5 3 5.5 6 5.5-.39.49-.68 1.05-.85 1.65-.17.6-.22 1.23-.15 1.85v4" }], ["path", { d: "M9 18c-4.51 2-5-2-7-2" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/gitlab.js +var Gitlab; +var init_gitlab = __esmMin((() => { + Gitlab = [["path", { d: "m22 13.29-3.33-10a.42.42 0 0 0-.14-.18.38.38 0 0 0-.22-.11.39.39 0 0 0-.23.07.42.42 0 0 0-.14.18l-2.26 6.67H8.32L6.1 3.26a.42.42 0 0 0-.1-.18.38.38 0 0 0-.26-.08.39.39 0 0 0-.23.07.42.42 0 0 0-.14.18L2 13.29a.74.74 0 0 0 .27.83L12 21l9.69-6.88a.71.71 0 0 0 .31-.83Z" }]]; +})); + +//#endregion +//#region node_modules/lucide/dist/esm/icons/glass-water.js +var GlassWater; +var init_glass_water = __esmMin((() => { + GlassWater = [["path", { d: "M5.116 4.104A1 1 0 0 1 6.11 3h11.78a1 1 0 0 1 .994 1.105L17.19 20.21A2 2 0 0 1 15.2 22H8.8a2 2 0 0 1-2-1.79z" }], ["path", { d: "M6 12a5 5 0 0 1 6 0 5 5 0 0 0 6 0" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/glasses.js var Glasses; @@ -15040,6 +15142,17 @@ var init_goal = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/graduation-cap.js +var GraduationCap; +var init_graduation_cap = __esmMin((() => { + GraduationCap = [ + ["path", { d: "M21.42 10.922a1 1 0 0 0-.019-1.838L12.83 5.18a2 2 0 0 0-1.66 0L2.6 9.08a1 1 0 0 0 0 1.832l8.57 3.908a2 2 0 0 0 1.66 0z" }], + ["path", { d: "M22 10v6" }], + ["path", { d: "M6 12.5V16a6 3 0 0 0 12 0v-3.5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/gpu.js var Gpu; @@ -15061,17 +15174,6 @@ var init_gpu = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/graduation-cap.js -var GraduationCap; -var init_graduation_cap = __esmMin((() => { - GraduationCap = [ - ["path", { d: "M21.42 10.922a1 1 0 0 0-.019-1.838L12.83 5.18a2 2 0 0 0-1.66 0L2.6 9.08a1 1 0 0 0 0 1.832l8.57 3.908a2 2 0 0 0 1.66 0z" }], - ["path", { d: "M22 10v6" }], - ["path", { d: "M6 12.5V16a6 3 0 0 0 12 0v-3.5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/grape.js var Grape; @@ -15151,12 +15253,13 @@ var init_grid_2x2_x = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/grid-2x2.js -var Grid2x2; -var init_grid_2x2 = __esmMin((() => { - Grid2x2 = [ - ["path", { d: "M12 3v18" }], +//#region node_modules/lucide/dist/esm/icons/grid-3x2.js +var Grid3x2; +var init_grid_3x2 = __esmMin((() => { + Grid3x2 = [ + ["path", { d: "M15 3v18" }], ["path", { d: "M3 12h18" }], + ["path", { d: "M9 3v18" }], ["rect", { x: "3", y: "3", @@ -15168,13 +15271,12 @@ var init_grid_2x2 = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/grid-3x2.js -var Grid3x2; -var init_grid_3x2 = __esmMin((() => { - Grid3x2 = [ - ["path", { d: "M15 3v18" }], +//#region node_modules/lucide/dist/esm/icons/grid-2x2.js +var Grid2x2; +var init_grid_2x2 = __esmMin((() => { + Grid2x2 = [ + ["path", { d: "M12 3v18" }], ["path", { d: "M3 12h18" }], - ["path", { d: "M9 3v18" }], ["rect", { x: "3", y: "3", @@ -15242,44 +15344,6 @@ var init_grip_horizontal = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/grip-vertical.js -var GripVertical; -var init_grip_vertical = __esmMin((() => { - GripVertical = [ - ["circle", { - cx: "9", - cy: "12", - r: "1" - }], - ["circle", { - cx: "9", - cy: "5", - r: "1" - }], - ["circle", { - cx: "9", - cy: "19", - r: "1" - }], - ["circle", { - cx: "15", - cy: "12", - r: "1" - }], - ["circle", { - cx: "15", - cy: "5", - r: "1" - }], - ["circle", { - cx: "15", - cy: "19", - r: "1" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/grip.js var Grip; @@ -15333,6 +15397,44 @@ var init_grip = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/grip-vertical.js +var GripVertical; +var init_grip_vertical = __esmMin((() => { + GripVertical = [ + ["circle", { + cx: "9", + cy: "12", + r: "1" + }], + ["circle", { + cx: "9", + cy: "5", + r: "1" + }], + ["circle", { + cx: "9", + cy: "19", + r: "1" + }], + ["circle", { + cx: "15", + cy: "12", + r: "1" + }], + ["circle", { + cx: "15", + cy: "5", + r: "1" + }], + ["circle", { + cx: "15", + cy: "19", + r: "1" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/group.js var Group; @@ -15406,18 +15508,6 @@ var init_hammer = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/hand-fist.js -var HandFist; -var init_hand_fist = __esmMin((() => { - HandFist = [ - ["path", { d: "M12.035 17.012a3 3 0 0 0-3-3l-.311-.002a.72.72 0 0 1-.505-1.229l1.195-1.195A2 2 0 0 1 10.828 11H12a2 2 0 0 0 0-4H9.243a3 3 0 0 0-2.122.879l-2.707 2.707A4.83 4.83 0 0 0 3 14a8 8 0 0 0 8 8h2a8 8 0 0 0 8-8V7a2 2 0 1 0-4 0v2a2 2 0 1 0 4 0" }], - ["path", { d: "M13.888 9.662A2 2 0 0 0 17 8V5A2 2 0 1 0 13 5" }], - ["path", { d: "M9 5A2 2 0 1 0 5 5V10" }], - ["path", { d: "M9 7V4A2 2 0 1 1 13 4V7.268" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/hand-coins.js var HandCoins; @@ -15440,15 +15530,14 @@ var init_hand_coins = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/hand-grab.js -var HandGrab; -var init_hand_grab = __esmMin((() => { - HandGrab = [ - ["path", { d: "M18 11.5V9a2 2 0 0 0-2-2a2 2 0 0 0-2 2v1.4" }], - ["path", { d: "M14 10V8a2 2 0 0 0-2-2a2 2 0 0 0-2 2v2" }], - ["path", { d: "M10 9.9V9a2 2 0 0 0-2-2a2 2 0 0 0-2 2v5" }], - ["path", { d: "M6 14a2 2 0 0 0-2-2a2 2 0 0 0-2 2" }], - ["path", { d: "M18 11a2 2 0 1 1 4 0v3a8 8 0 0 1-8 8h-4a8 8 0 0 1-8-8 2 2 0 1 1 4 0" }] +//#region node_modules/lucide/dist/esm/icons/hand-fist.js +var HandFist; +var init_hand_fist = __esmMin((() => { + HandFist = [ + ["path", { d: "M12.035 17.012a3 3 0 0 0-3-3l-.311-.002a.72.72 0 0 1-.505-1.229l1.195-1.195A2 2 0 0 1 10.828 11H12a2 2 0 0 0 0-4H9.243a3 3 0 0 0-2.122.879l-2.707 2.707A4.83 4.83 0 0 0 3 14a8 8 0 0 0 8 8h2a8 8 0 0 0 8-8V7a2 2 0 1 0-4 0v2a2 2 0 1 0 4 0" }], + ["path", { d: "M13.888 9.662A2 2 0 0 0 17 8V5A2 2 0 1 0 13 5" }], + ["path", { d: "M9 5A2 2 0 1 0 5 5V10" }], + ["path", { d: "M9 7V4A2 2 0 1 1 13 4V7.268" }] ]; })); @@ -15464,6 +15553,19 @@ var init_hand_heart = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/hand-grab.js +var HandGrab; +var init_hand_grab = __esmMin((() => { + HandGrab = [ + ["path", { d: "M18 11.5V9a2 2 0 0 0-2-2a2 2 0 0 0-2 2v1.4" }], + ["path", { d: "M14 10V8a2 2 0 0 0-2-2a2 2 0 0 0-2 2v2" }], + ["path", { d: "M10 9.9V9a2 2 0 0 0-2-2a2 2 0 0 0-2 2v5" }], + ["path", { d: "M6 14a2 2 0 0 0-2-2a2 2 0 0 0-2 2" }], + ["path", { d: "M18 11a2 2 0 1 1 4 0v3a8 8 0 0 1-8 8h-4a8 8 0 0 1-8-8 2 2 0 1 1 4 0" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/hand-helping.js var HandHelping; @@ -15669,13 +15771,6 @@ var init_hat_glasses = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/hdmi-port.js -var HdmiPort; -var init_hdmi_port = __esmMin((() => { - HdmiPort = [["path", { d: "M22 9a1 1 0 0 0-1-1H3a1 1 0 0 0-1 1v4a1 1 0 0 0 1 1h1l2 2h12l2-2h1a1 1 0 0 0 1-1Z" }], ["path", { d: "M7.5 12h9" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/haze.js var Haze; @@ -15692,6 +15787,32 @@ var init_haze = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/hd.js +var Hd; +var init_hd = __esmMin((() => { + Hd = [ + ["path", { d: "M10 12H6" }], + ["path", { d: "M10 15V9" }], + ["path", { d: "M14 14.5a.5.5 0 0 0 .5.5h1a2.5 2.5 0 0 0 2.5-2.5v-1A2.5 2.5 0 0 0 15.5 9h-1a.5.5 0 0 0-.5.5z" }], + ["path", { d: "M6 15V9" }], + ["rect", { + x: "2", + y: "5", + width: "20", + height: "14", + rx: "2" + }] + ]; +})); + +//#endregion +//#region node_modules/lucide/dist/esm/icons/hdmi-port.js +var HdmiPort; +var init_hdmi_port = __esmMin((() => { + HdmiPort = [["path", { d: "M22 9a1 1 0 0 0-1-1H3a1 1 0 0 0-1 1v4a1 1 0 0 0 1 1h1l2 2h12l2-2h1a1 1 0 0 0 1-1Z" }], ["path", { d: "M7.5 12h9" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/heading-1.js var Heading1; @@ -15742,6 +15863,19 @@ var init_heading_4 = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/heading-5.js +var Heading5; +var init_heading_5 = __esmMin((() => { + Heading5 = [ + ["path", { d: "M4 12h8" }], + ["path", { d: "M4 18V6" }], + ["path", { d: "M12 18V6" }], + ["path", { d: "M17 13v-3h4" }], + ["path", { d: "M17 17.7c.4.2.8.3 1.3.3 1.5 0 2.7-1.1 2.7-2.5S19.8 13 18.3 13H17" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/heading-6.js var Heading6; @@ -15759,19 +15893,6 @@ var init_heading_6 = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/heading-5.js -var Heading5; -var init_heading_5 = __esmMin((() => { - Heading5 = [ - ["path", { d: "M4 12h8" }], - ["path", { d: "M4 18V6" }], - ["path", { d: "M12 18V6" }], - ["path", { d: "M17 13v-3h4" }], - ["path", { d: "M17 17.7c.4.2.8.3 1.3.3 1.5 0 2.7-1.1 2.7-2.5S19.8 13 18.3 13H17" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/heading.js var Heading; @@ -15783,6 +15904,13 @@ var init_heading = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/headphones.js +var Headphones; +var init_headphones = __esmMin((() => { + Headphones = [["path", { d: "M3 14h3a2 2 0 0 1 2 2v3a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-7a9 9 0 0 1 18 0v7a2 2 0 0 1-2 2h-1a2 2 0 0 1-2-2v-3a2 2 0 0 1 2-2h3" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/headphone-off.js var HeadphoneOff; @@ -15796,13 +15924,6 @@ var init_headphone_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/headphones.js -var Headphones; -var init_headphones = __esmMin((() => { - Headphones = [["path", { d: "M3 14h3a2 2 0 0 1 2 2v3a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-7a9 9 0 0 1 18 0v7a2 2 0 0 1-2 2h-1a2 2 0 0 1-2-2v-3a2 2 0 0 1 2-2h3" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/headset.js var Headset; @@ -15824,13 +15945,6 @@ var init_heart_handshake = __esmMin((() => { HeartHandshake = [["path", { d: "M19.414 14.414C21 12.828 22 11.5 22 9.5a5.5 5.5 0 0 0-9.591-3.676.6.6 0 0 1-.818.001A5.5 5.5 0 0 0 2 9.5c0 2.3 1.5 4 3 5.5l5.535 5.362a2 2 0 0 0 2.879.052 2.12 2.12 0 0 0-.004-3 2.124 2.124 0 1 0 3-3 2.124 2.124 0 0 0 3.004 0 2 2 0 0 0 0-2.828l-1.881-1.882a2.41 2.41 0 0 0-3.409 0l-1.71 1.71a2 2 0 0 1-2.828 0 2 2 0 0 1 0-2.828l2.823-2.762" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/heart-minus.js -var HeartMinus; -var init_heart_minus = __esmMin((() => { - HeartMinus = [["path", { d: "m14.876 18.99-1.368 1.323a2 2 0 0 1-3 .019L5 15c-1.5-1.5-3-3.2-3-5.5a5.5 5.5 0 0 1 9.591-3.676.56.56 0 0 0 .818 0A5.49 5.49 0 0 1 22 9.5a5.2 5.2 0 0 1-.244 1.572" }], ["path", { d: "M15 15h6" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/heart-off.js var HeartOff; @@ -15842,6 +15956,13 @@ var init_heart_off = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/heart-minus.js +var HeartMinus; +var init_heart_minus = __esmMin((() => { + HeartMinus = [["path", { d: "m14.876 18.99-1.368 1.323a2 2 0 0 1-3 .019L5 15c-1.5-1.5-3-3.2-3-5.5a5.5 5.5 0 0 1 9.591-3.676.56.56 0 0 0 .818 0A5.49 5.49 0 0 1 22 9.5a5.2 5.2 0 0 1-.244 1.572" }], ["path", { d: "M15 15h6" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/heart-plus.js var HeartPlus; @@ -16008,6 +16129,13 @@ var init_hourglass = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/house-heart.js +var HouseHeart; +var init_house_heart = __esmMin((() => { + HouseHeart = [["path", { d: "M8.62 13.8A2.25 2.25 0 1 1 12 10.836a2.25 2.25 0 1 1 3.38 2.966l-2.626 2.856a.998.998 0 0 1-1.507 0z" }], ["path", { d: "M3 10a2 2 0 0 1 .709-1.528l7-6a2 2 0 0 1 2.582 0l7 6A2 2 0 0 1 21 10v9a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2z" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/house-plug.js var HousePlug; @@ -16020,13 +16148,6 @@ var init_house_plug = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/house-heart.js -var HouseHeart; -var init_house_heart = __esmMin((() => { - HouseHeart = [["path", { d: "M8.62 13.8A2.25 2.25 0 1 1 12 10.836a2.25 2.25 0 1 1 3.38 2.966l-2.626 2.856a.998.998 0 0 1-1.507 0z" }], ["path", { d: "M3 10a2 2 0 0 1 .709-1.528l7-6a2 2 0 0 1 2.582 0l7 6A2 2 0 0 1 21 10v9a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/house-plus.js var HousePlus; @@ -16333,13 +16454,6 @@ var init_indian_rupee = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/infinity.js -var Infinity$1; -var init_infinity = __esmMin((() => { - Infinity$1 = [["path", { d: "M6 16c5 0 7-8 12-8a4 4 0 0 1 0 8c-5 0-7-8-12-8a4 4 0 1 0 0 8" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/info.js var Info; @@ -16355,6 +16469,13 @@ var init_info = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/infinity.js +var Infinity$1; +var init_infinity = __esmMin((() => { + Infinity$1 = [["path", { d: "M6 16c5 0 7-8 12-8a4 4 0 0 1 0 8c-5 0-7-8-12-8a4 4 0 1 0 0 8" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/inspection-panel.js var InspectionPanel; @@ -16430,13 +16551,6 @@ var init_iteration_ccw = __esmMin((() => { IterationCcw = [["path", { d: "m16 14 4 4-4 4" }], ["path", { d: "M20 10a8 8 0 1 0-8 8h8" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/iteration-cw.js -var IterationCw; -var init_iteration_cw = __esmMin((() => { - IterationCw = [["path", { d: "M4 10a8 8 0 1 1 8 8H4" }], ["path", { d: "m8 22-4-4 4-4" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/japanese-yen.js var JapaneseYen; @@ -16464,6 +16578,13 @@ var init_joystick = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/iteration-cw.js +var IterationCw; +var init_iteration_cw = __esmMin((() => { + IterationCw = [["path", { d: "M4 10a8 8 0 1 1 8 8H4" }], ["path", { d: "m8 22-4-4 4-4" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/kanban.js var Kanban; @@ -16510,21 +16631,6 @@ var init_key_square = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/key.js -var Key; -var init_key = __esmMin((() => { - Key = [ - ["path", { d: "m15.5 7.5 2.3 2.3a1 1 0 0 0 1.4 0l2.1-2.1a1 1 0 0 0 0-1.4L19 4" }], - ["path", { d: "m21 2-9.6 9.6" }], - ["circle", { - cx: "7.5", - cy: "15.5", - r: "5.5" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/keyboard-music.js var KeyboardMusic; @@ -16548,6 +16654,21 @@ var init_keyboard_music = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/key.js +var Key; +var init_key = __esmMin((() => { + Key = [ + ["path", { d: "m15.5 7.5 2.3 2.3a1 1 0 0 0 1.4 0l2.1-2.1a1 1 0 0 0 0-1.4L19 4" }], + ["path", { d: "m21 2-9.6 9.6" }], + ["circle", { + cx: "7.5", + cy: "15.5", + r: "5.5" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/keyboard-off.js var KeyboardOff; @@ -16645,6 +16766,17 @@ var init_lamp_wall_up = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/lamp.js +var Lamp; +var init_lamp = __esmMin((() => { + Lamp = [ + ["path", { d: "M12 12v6" }], + ["path", { d: "M4.077 10.615A1 1 0 0 0 5 12h14a1 1 0 0 0 .923-1.385l-3.077-7.384A2 2 0 0 0 15 2H9a2 2 0 0 0-1.846 1.23Z" }], + ["path", { d: "M8 20a2 2 0 0 1 2-2h4a2 2 0 0 1 2 2v1a1 1 0 0 1-1 1H9a1 1 0 0 1-1-1z" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/land-plot.js var LandPlot; @@ -16657,17 +16789,6 @@ var init_land_plot = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/lamp.js -var Lamp; -var init_lamp = __esmMin((() => { - Lamp = [ - ["path", { d: "M12 12v6" }], - ["path", { d: "M4.077 10.615A1 1 0 0 0 5 12h14a1 1 0 0 0 .923-1.385l-3.077-7.384A2 2 0 0 0 15 2H9a2 2 0 0 0-1.846 1.23Z" }], - ["path", { d: "M8 20a2 2 0 0 1 2-2h4a2 2 0 0 1 2 2v1a1 1 0 0 1-1 1H9a1 1 0 0 1-1-1z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/landmark.js var Landmark; @@ -16739,21 +16860,6 @@ var init_laptop = __esmMin((() => { Laptop = [["path", { d: "M18 5a2 2 0 0 1 2 2v8.526a2 2 0 0 0 .212.897l1.068 2.127a1 1 0 0 1-.9 1.45H3.62a1 1 0 0 1-.9-1.45l1.068-2.127A2 2 0 0 0 4 15.526V7a2 2 0 0 1 2-2z" }], ["path", { d: "M20.054 15.987H3.946" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/lasso.js -var Lasso; -var init_lasso = __esmMin((() => { - Lasso = [ - ["path", { d: "M3.704 14.467A10 8 0 0 1 2 10a10 8 0 0 1 20 0 10 8 0 0 1-10 8 10 8 0 0 1-5.181-1.158" }], - ["path", { d: "M7 22a5 5 0 0 1-2-3.994" }], - ["circle", { - cx: "5", - cy: "16", - r: "2" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/lasso-select.js var LassoSelect; @@ -16793,6 +16899,21 @@ var init_laugh = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/lasso.js +var Lasso; +var init_lasso = __esmMin((() => { + Lasso = [ + ["path", { d: "M3.704 14.467A10 8 0 0 1 2 10a10 8 0 0 1 20 0 10 8 0 0 1-10 8 10 8 0 0 1-5.181-1.158" }], + ["path", { d: "M7 22a5 5 0 0 1-2-3.994" }], + ["circle", { + cx: "5", + cy: "16", + r: "2" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/layers-2.js var Layers2; @@ -16800,6 +16921,19 @@ var init_layers_2 = __esmMin((() => { Layers2 = [["path", { d: "M13 13.74a2 2 0 0 1-2 0L2.5 8.87a1 1 0 0 1 0-1.74L11 2.26a2 2 0 0 1 2 0l8.5 4.87a1 1 0 0 1 0 1.74z" }], ["path", { d: "m20 14.285 1.5.845a1 1 0 0 1 0 1.74L13 21.74a2 2 0 0 1-2 0l-8.5-4.87a1 1 0 0 1 0-1.74l1.5-.845" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/layers-plus.js +var LayersPlus; +var init_layers_plus = __esmMin((() => { + LayersPlus = [ + ["path", { d: "M12.83 2.18a2 2 0 0 0-1.66 0L2.6 6.08a1 1 0 0 0 0 1.83l8.58 3.91a2 2 0 0 0 .83.18 2 2 0 0 0 .83-.18l8.58-3.9a1 1 0 0 0 0-1.831z" }], + ["path", { d: "M16 17h6" }], + ["path", { d: "M19 14v6" }], + ["path", { d: "M2 12a1 1 0 0 0 .58.91l8.6 3.91a2 2 0 0 0 .825.178" }], + ["path", { d: "M2 17a1 1 0 0 0 .58.91l8.6 3.91a2 2 0 0 0 1.65 0l2.116-.962" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/layers.js var Layers; @@ -16883,32 +17017,6 @@ var init_layout_grid = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/layout-list.js -var LayoutList; -var init_layout_list = __esmMin((() => { - LayoutList = [ - ["rect", { - width: "7", - height: "7", - x: "3", - y: "3", - rx: "1" - }], - ["rect", { - width: "7", - height: "7", - x: "3", - y: "14", - rx: "1" - }], - ["path", { d: "M14 4h7" }], - ["path", { d: "M14 9h7" }], - ["path", { d: "M14 15h7" }], - ["path", { d: "M14 20h7" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/layout-panel-left.js var LayoutPanelLeft; @@ -16938,6 +17046,32 @@ var init_layout_panel_left = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/layout-list.js +var LayoutList; +var init_layout_list = __esmMin((() => { + LayoutList = [ + ["rect", { + width: "7", + height: "7", + x: "3", + y: "3", + rx: "1" + }], + ["rect", { + width: "7", + height: "7", + x: "3", + y: "14", + rx: "1" + }], + ["path", { d: "M14 4h7" }], + ["path", { d: "M14 9h7" }], + ["path", { d: "M14 15h7" }], + ["path", { d: "M14 20h7" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/layout-panel-top.js var LayoutPanelTop; @@ -17167,6 +17301,18 @@ var init_link = __esmMin((() => { Link = [["path", { d: "M10 13a5 5 0 0 0 7.54.54l3-3a5 5 0 0 0-7.07-7.07l-1.72 1.71" }], ["path", { d: "M14 11a5 5 0 0 0-7.54-.54l-3 3a5 5 0 0 0 7.07 7.07l1.71-1.71" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/list-check.js +var ListCheck; +var init_list_check = __esmMin((() => { + ListCheck = [ + ["path", { d: "M16 5H3" }], + ["path", { d: "M16 12H3" }], + ["path", { d: "M11 19H3" }], + ["path", { d: "m15 18 2 2 4-4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/linkedin.js var Linkedin; @@ -17187,18 +17333,6 @@ var init_linkedin = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/list-check.js -var ListCheck; -var init_list_check = __esmMin((() => { - ListCheck = [ - ["path", { d: "M16 5H3" }], - ["path", { d: "M16 12H3" }], - ["path", { d: "M11 19H3" }], - ["path", { d: "m15 18 2 2 4-4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/list-checks.js var ListChecks; @@ -17341,6 +17475,19 @@ var init_list_music = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/list-plus.js +var ListPlus; +var init_list_plus = __esmMin((() => { + ListPlus = [ + ["path", { d: "M16 5H3" }], + ["path", { d: "M11 12H3" }], + ["path", { d: "M16 19H3" }], + ["path", { d: "M18 9v6" }], + ["path", { d: "M21 12h-6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/list-ordered.js var ListOrdered; @@ -17356,15 +17503,15 @@ var init_list_ordered = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/list-plus.js -var ListPlus; -var init_list_plus = __esmMin((() => { - ListPlus = [ - ["path", { d: "M16 5H3" }], - ["path", { d: "M11 12H3" }], - ["path", { d: "M16 19H3" }], - ["path", { d: "M18 9v6" }], - ["path", { d: "M21 12h-6" }] +//#region node_modules/lucide/dist/esm/icons/list-start.js +var ListStart; +var init_list_start = __esmMin((() => { + ListStart = [ + ["path", { d: "M3 5h6" }], + ["path", { d: "M3 12h13" }], + ["path", { d: "M3 19h13" }], + ["path", { d: "m16 8-3-3 3-3" }], + ["path", { d: "M21 19V7a2 2 0 0 0-2-2h-6" }] ]; })); @@ -17381,19 +17528,6 @@ var init_list_restart = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/list-start.js -var ListStart; -var init_list_start = __esmMin((() => { - ListStart = [ - ["path", { d: "M3 5h6" }], - ["path", { d: "M3 12h13" }], - ["path", { d: "M3 19h13" }], - ["path", { d: "m16 8-3-3 3-3" }], - ["path", { d: "M21 19V7a2 2 0 0 0-2-2h-6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/list-todo.js var ListTodo; @@ -17438,19 +17572,6 @@ var init_list_video = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/list-x.js -var ListX; -var init_list_x = __esmMin((() => { - ListX = [ - ["path", { d: "M16 5H3" }], - ["path", { d: "M11 12H3" }], - ["path", { d: "M16 19H3" }], - ["path", { d: "m15.5 9.5 5 5" }], - ["path", { d: "m20.5 9.5-5 5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/list.js var List; @@ -17465,6 +17586,19 @@ var init_list = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/list-x.js +var ListX; +var init_list_x = __esmMin((() => { + ListX = [ + ["path", { d: "M16 5H3" }], + ["path", { d: "M11 12H3" }], + ["path", { d: "M16 19H3" }], + ["path", { d: "m15.5 9.5 5 5" }], + ["path", { d: "m20.5 9.5-5 5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/loader-circle.js var LoaderCircle; @@ -17504,21 +17638,6 @@ var init_loader = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/locate-off.js -var LocateOff; -var init_locate_off = __esmMin((() => { - LocateOff = [ - ["path", { d: "M12 19v3" }], - ["path", { d: "M12 2v3" }], - ["path", { d: "M18.89 13.24a7 7 0 0 0-8.13-8.13" }], - ["path", { d: "M19 12h3" }], - ["path", { d: "M2 12h3" }], - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M7.05 7.05a7 7 0 0 0 9.9 9.9" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/locate-fixed.js var LocateFixed; @@ -17561,6 +17680,21 @@ var init_locate_fixed = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/locate-off.js +var LocateOff; +var init_locate_off = __esmMin((() => { + LocateOff = [ + ["path", { d: "M12 19v3" }], + ["path", { d: "M12 2v3" }], + ["path", { d: "M18.89 13.24a7 7 0 0 0-8.13-8.13" }], + ["path", { d: "M19 12h3" }], + ["path", { d: "M2 12h3" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M7.05 7.05a7 7 0 0 0 9.9 9.9" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/locate.js var Locate; @@ -17640,20 +17774,6 @@ var init_lock_keyhole = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/lock-open.js -var LockOpen; -var init_lock_open = __esmMin((() => { - LockOpen = [["rect", { - width: "18", - height: "11", - x: "3", - y: "11", - rx: "2", - ry: "2" - }], ["path", { d: "M7 11V7a5 5 0 0 1 9.9-1" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/lock.js var Lock; @@ -17669,14 +17789,17 @@ var init_lock = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/log-out.js -var LogOut; -var init_log_out = __esmMin((() => { - LogOut = [ - ["path", { d: "m16 17 5-5-5-5" }], - ["path", { d: "M21 12H9" }], - ["path", { d: "M9 21H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h4" }] - ]; +//#region node_modules/lucide/dist/esm/icons/lock-open.js +var LockOpen; +var init_lock_open = __esmMin((() => { + LockOpen = [["rect", { + width: "18", + height: "11", + x: "3", + y: "11", + rx: "2", + ry: "2" + }], ["path", { d: "M7 11V7a5 5 0 0 1 9.9-1" }]]; })); //#endregion @@ -17690,6 +17813,17 @@ var init_log_in = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/log-out.js +var LogOut; +var init_log_out = __esmMin((() => { + LogOut = [ + ["path", { d: "m16 17 5-5-5-5" }], + ["path", { d: "M21 12H9" }], + ["path", { d: "M9 21H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/logs.js var Logs; @@ -17722,6 +17856,17 @@ var init_lollipop = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/magnet.js +var Magnet; +var init_magnet = __esmMin((() => { + Magnet = [ + ["path", { d: "m12 15 4 4" }], + ["path", { d: "M2.352 10.648a1.205 1.205 0 0 0 0 1.704l2.296 2.296a1.205 1.205 0 0 0 1.704 0l6.029-6.029a1 1 0 1 1 3 3l-6.029 6.029a1.205 1.205 0 0 0 0 1.704l2.296 2.296a1.205 1.205 0 0 0 1.704 0l6.365-6.367A1 1 0 0 0 8.716 4.282z" }], + ["path", { d: "m5 8 4 4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/luggage.js var Luggage; @@ -17743,17 +17888,6 @@ var init_luggage = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/magnet.js -var Magnet; -var init_magnet = __esmMin((() => { - Magnet = [ - ["path", { d: "m12 15 4 4" }], - ["path", { d: "M2.352 10.648a1.205 1.205 0 0 0 0 1.704l2.296 2.296a1.205 1.205 0 0 0 1.704 0l6.029-6.029a1 1 0 1 1 3 3l-6.029 6.029a1.205 1.205 0 0 0 0 1.704l2.296 2.296a1.205 1.205 0 0 0 1.704 0l6.365-6.367A1 1 0 0 0 8.716 4.282z" }], - ["path", { d: "m5 8 4 4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/mail-check.js var MailCheck; @@ -17895,6 +18029,13 @@ var init_mails = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/map-pin-check-inside.js +var MapPinCheckInside; +var init_map_pin_check_inside = __esmMin((() => { + MapPinCheckInside = [["path", { d: "M20 10c0 4.993-5.539 10.193-7.399 11.799a1 1 0 0 1-1.202 0C9.539 20.193 4 14.993 4 10a8 8 0 0 1 16 0" }], ["path", { d: "m9 10 2 2 4-4" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/map-minus.js var MapMinus; @@ -17907,13 +18048,6 @@ var init_map_minus = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/map-pin-check-inside.js -var MapPinCheckInside; -var init_map_pin_check_inside = __esmMin((() => { - MapPinCheckInside = [["path", { d: "M20 10c0 4.993-5.539 10.193-7.399 11.799a1 1 0 0 1-1.202 0C9.539 20.193 4 14.993 4 10a8 8 0 0 1 16 0" }], ["path", { d: "m9 10 2 2 4-4" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/map-pin-check.js var MapPinCheck; @@ -17980,21 +18114,6 @@ var init_map_pin_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/map-pin-pen.js -var MapPinPen; -var init_map_pin_pen = __esmMin((() => { - MapPinPen = [ - ["path", { d: "M17.97 9.304A8 8 0 0 0 2 10c0 4.69 4.887 9.562 7.022 11.468" }], - ["path", { d: "M21.378 16.626a1 1 0 0 0-3.004-3.004l-4.01 4.012a2 2 0 0 0-.506.854l-.837 2.87a.5.5 0 0 0 .62.62l2.87-.837a2 2 0 0 0 .854-.506z" }], - ["circle", { - cx: "10", - cy: "10", - r: "3" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/map-pin-plus-inside.js var MapPinPlusInside; @@ -18007,13 +18126,17 @@ var init_map_pin_plus_inside = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/map-pin-x-inside.js -var MapPinXInside; -var init_map_pin_x_inside = __esmMin((() => { - MapPinXInside = [ - ["path", { d: "M20 10c0 4.993-5.539 10.193-7.399 11.799a1 1 0 0 1-1.202 0C9.539 20.193 4 14.993 4 10a8 8 0 0 1 16 0" }], - ["path", { d: "m14.5 7.5-5 5" }], - ["path", { d: "m9.5 7.5 5 5" }] +//#region node_modules/lucide/dist/esm/icons/map-pin-pen.js +var MapPinPen; +var init_map_pin_pen = __esmMin((() => { + MapPinPen = [ + ["path", { d: "M17.97 9.304A8 8 0 0 0 2 10c0 4.69 4.887 9.562 7.022 11.468" }], + ["path", { d: "M21.378 16.626a1 1 0 0 0-3.004-3.004l-4.01 4.012a2 2 0 0 0-.506.854l-.837 2.87a.5.5 0 0 0 .62.62l2.87-.837a2 2 0 0 0 .854-.506z" }], + ["circle", { + cx: "10", + cy: "10", + r: "3" + }] ]; })); @@ -18033,6 +18156,17 @@ var init_map_pin_plus = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/map-pin-x-inside.js +var MapPinXInside; +var init_map_pin_x_inside = __esmMin((() => { + MapPinXInside = [ + ["path", { d: "M20 10c0 4.993-5.539 10.193-7.399 11.799a1 1 0 0 1-1.202 0C9.539 20.193 4 14.993 4 10a8 8 0 0 1 16 0" }], + ["path", { d: "m14.5 7.5-5 5" }], + ["path", { d: "m9.5 7.5 5 5" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/map-pin-x.js var MapPinX; @@ -18099,21 +18233,6 @@ var init_map = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/mars.js -var Mars; -var init_mars = __esmMin((() => { - Mars = [ - ["path", { d: "M16 3h5v5" }], - ["path", { d: "m21 3-6.75 6.75" }], - ["circle", { - cx: "10", - cy: "14", - r: "6" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/mars-stroke.js var MarsStroke; @@ -18130,6 +18249,21 @@ var init_mars_stroke = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/mars.js +var Mars; +var init_mars = __esmMin((() => { + Mars = [ + ["path", { d: "M16 3h5v5" }], + ["path", { d: "m21 3-6.75 6.75" }], + ["circle", { + cx: "10", + cy: "14", + r: "6" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/martini.js var Martini; @@ -18165,6 +18299,19 @@ var init_maximize = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/megaphone-off.js +var MegaphoneOff; +var init_megaphone_off = __esmMin((() => { + MegaphoneOff = [ + ["path", { d: "M11.636 6A13 13 0 0 0 19.4 3.2 1 1 0 0 1 21 4v11.344" }], + ["path", { d: "M14.378 14.357A13 13 0 0 0 11 14H5a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h1" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M6 14a12 12 0 0 0 2.4 7.2 2 2 0 0 0 3.2-2.4A8 8 0 0 1 10 14" }], + ["path", { d: "M8 8v6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/medal.js var Medal; @@ -18183,19 +18330,6 @@ var init_medal = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/megaphone-off.js -var MegaphoneOff; -var init_megaphone_off = __esmMin((() => { - MegaphoneOff = [ - ["path", { d: "M11.636 6A13 13 0 0 0 19.4 3.2 1 1 0 0 1 21 4v11.344" }], - ["path", { d: "M14.378 14.357A13 13 0 0 0 11 14H5a2 2 0 0 1-2-2V8a2 2 0 0 1 2-2h1" }], - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M6 14a12 12 0 0 0 2.4 7.2 2 2 0 0 0 3.2-2.4A8 8 0 0 1 10 14" }], - ["path", { d: "M8 8v6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/megaphone.js var Megaphone; @@ -18243,15 +18377,23 @@ var init_meh = __esmMin((() => { var MemoryStick; var init_memory_stick = __esmMin((() => { MemoryStick = [ - ["path", { d: "M6 19v-3" }], - ["path", { d: "M10 19v-3" }], - ["path", { d: "M14 19v-3" }], - ["path", { d: "M18 19v-3" }], - ["path", { d: "M8 11V9" }], - ["path", { d: "M16 11V9" }], - ["path", { d: "M12 11V9" }], - ["path", { d: "M2 15h20" }], - ["path", { d: "M2 7a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2v1.1a2 2 0 0 0 0 3.837V17a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2v-5.1a2 2 0 0 0 0-3.837Z" }] + ["path", { d: "M12 12v-2" }], + ["path", { d: "M12 18v-2" }], + ["path", { d: "M16 12v-2" }], + ["path", { d: "M16 18v-2" }], + ["path", { d: "M2 11h1.5" }], + ["path", { d: "M20 18v-2" }], + ["path", { d: "M20.5 11H22" }], + ["path", { d: "M4 18v-2" }], + ["path", { d: "M8 12v-2" }], + ["path", { d: "M8 18v-2" }], + ["rect", { + x: "2", + y: "6", + width: "20", + height: "10", + rx: "2" + }] ]; })); @@ -18311,6 +18453,17 @@ var init_message_circle_heart = __esmMin((() => { MessageCircleHeart = [["path", { d: "M2.992 16.342a2 2 0 0 1 .094 1.167l-1.065 3.29a1 1 0 0 0 1.236 1.168l3.413-.998a2 2 0 0 1 1.099.092 10 10 0 1 0-4.777-4.719" }], ["path", { d: "M7.828 13.07A3 3 0 0 1 12 8.764a3 3 0 0 1 5.004 2.224 3 3 0 0 1-.832 2.083l-3.447 3.62a1 1 0 0 1-1.45-.001z" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/message-circle-off.js +var MessageCircleOff; +var init_message_circle_off = __esmMin((() => { + MessageCircleOff = [ + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M4.93 4.929a10 10 0 0 0-1.938 11.412 2 2 0 0 1 .094 1.167l-1.065 3.29a1 1 0 0 0 1.236 1.168l3.413-.998a2 2 0 0 1 1.099.092 10 10 0 0 0 11.302-1.989" }], + ["path", { d: "M8.35 2.69A10 10 0 0 1 21.3 15.65" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/message-circle-more.js var MessageCircleMore; @@ -18324,13 +18477,13 @@ var init_message_circle_more = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/message-circle-off.js -var MessageCircleOff; -var init_message_circle_off = __esmMin((() => { - MessageCircleOff = [ - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M4.93 4.929a10 10 0 0 0-1.938 11.412 2 2 0 0 1 .094 1.167l-1.065 3.29a1 1 0 0 0 1.236 1.168l3.413-.998a2 2 0 0 1 1.099.092 10 10 0 0 0 11.302-1.989" }], - ["path", { d: "M8.35 2.69A10 10 0 0 1 21.3 15.65" }] +//#region node_modules/lucide/dist/esm/icons/message-circle-question-mark.js +var MessageCircleQuestionMark; +var init_message_circle_question_mark = __esmMin((() => { + MessageCircleQuestionMark = [ + ["path", { d: "M2.992 16.342a2 2 0 0 1 .094 1.167l-1.065 3.29a1 1 0 0 0 1.236 1.168l3.413-.998a2 2 0 0 1 1.099.092 10 10 0 1 0-4.777-4.719" }], + ["path", { d: "M9.09 9a3 3 0 0 1 5.83 1c0 2-3 3-3 3" }], + ["path", { d: "M12 17h.01" }] ]; })); @@ -18345,17 +18498,6 @@ var init_message_circle_plus = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/message-circle-question-mark.js -var MessageCircleQuestionMark; -var init_message_circle_question_mark = __esmMin((() => { - MessageCircleQuestionMark = [ - ["path", { d: "M2.992 16.342a2 2 0 0 1 .094 1.167l-1.065 3.29a1 1 0 0 0 1.236 1.168l3.413-.998a2 2 0 0 1 1.099.092 10 10 0 1 0-4.777-4.719" }], - ["path", { d: "M9.09 9a3 3 0 0 1 5.83 1c0 2-3 3-3 3" }], - ["path", { d: "M12 17h.01" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/message-circle-reply.js var MessageCircleReply; @@ -18520,17 +18662,6 @@ var init_message_square_quote = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/message-square-reply.js -var MessageSquareReply; -var init_message_square_reply = __esmMin((() => { - MessageSquareReply = [ - ["path", { d: "M22 17a2 2 0 0 1-2 2H6.828a2 2 0 0 0-1.414.586l-2.202 2.202A.71.71 0 0 1 2 21.286V5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2z" }], - ["path", { d: "m10 8-3 3 3 3" }], - ["path", { d: "M17 14v-1a2 2 0 0 0-2-2H7" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/message-square-share.js var MessageSquareShare; @@ -18542,6 +18673,17 @@ var init_message_square_share = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/message-square-reply.js +var MessageSquareReply; +var init_message_square_reply = __esmMin((() => { + MessageSquareReply = [ + ["path", { d: "M22 17a2 2 0 0 1-2 2H6.828a2 2 0 0 0-1.414.586l-2.202 2.202A.71.71 0 0 1 2 21.286V5a2 2 0 0 1 2-2h16a2 2 0 0 1 2 2z" }], + ["path", { d: "m10 8-3 3 3 3" }], + ["path", { d: "M17 14v-1a2 2 0 0 0-2-2H7" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/message-square-text.js var MessageSquareText; @@ -18636,25 +18778,6 @@ var init_mic = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/microchip.js -var Microchip; -var init_microchip = __esmMin((() => { - Microchip = [ - ["path", { d: "M18 12h2" }], - ["path", { d: "M18 16h2" }], - ["path", { d: "M18 20h2" }], - ["path", { d: "M18 4h2" }], - ["path", { d: "M18 8h2" }], - ["path", { d: "M4 12h2" }], - ["path", { d: "M4 16h2" }], - ["path", { d: "M4 20h2" }], - ["path", { d: "M4 4h2" }], - ["path", { d: "M4 8h2" }], - ["path", { d: "M8 2a2 2 0 0 0-2 2v16a2 2 0 0 0 2 2h8a2 2 0 0 0 2-2V4a2 2 0 0 0-2-2h-1.5c-.276 0-.494.227-.562.495a2 2 0 0 1-3.876 0C9.994 2.227 9.776 2 9.5 2z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/microscope.js var Microscope; @@ -18670,13 +18793,26 @@ var init_microscope = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/milestone.js -var Milestone; -var init_milestone = __esmMin((() => { - Milestone = [ - ["path", { d: "M12 13v8" }], - ["path", { d: "M12 3v3" }], - ["path", { d: "M4 6a1 1 0 0 0-1 1v5a1 1 0 0 0 1 1h13a2 2 0 0 0 1.152-.365l3.424-2.317a1 1 0 0 0 0-1.635l-3.424-2.318A2 2 0 0 0 17 6z" }] +//#region node_modules/lucide/dist/esm/icons/microchip.js +var Microchip; +var init_microchip = __esmMin((() => { + Microchip = [ + ["path", { d: "M10 12h4" }], + ["path", { d: "M10 17h4" }], + ["path", { d: "M10 7h4" }], + ["path", { d: "M18 12h2" }], + ["path", { d: "M18 18h2" }], + ["path", { d: "M18 6h2" }], + ["path", { d: "M4 12h2" }], + ["path", { d: "M4 18h2" }], + ["path", { d: "M4 6h2" }], + ["rect", { + x: "6", + y: "2", + width: "12", + height: "20", + rx: "2" + }] ]; })); @@ -18705,6 +18841,17 @@ var init_microwave = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/milestone.js +var Milestone; +var init_milestone = __esmMin((() => { + Milestone = [ + ["path", { d: "M12 13v8" }], + ["path", { d: "M12 3v3" }], + ["path", { d: "M4 6a1 1 0 0 0-1 1v5a1 1 0 0 0 1 1h13a2 2 0 0 0 1.152-.365l3.424-2.317a1 1 0 0 0 0-1.635l-3.424-2.318A2 2 0 0 0 17 6z" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/milk-off.js var MilkOff; @@ -18993,25 +19140,6 @@ var init_monitor_up = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/monitor-x.js -var MonitorX; -var init_monitor_x = __esmMin((() => { - MonitorX = [ - ["path", { d: "m14.5 12.5-5-5" }], - ["path", { d: "m9.5 12.5 5-5" }], - ["rect", { - width: "20", - height: "14", - x: "2", - y: "3", - rx: "2" - }], - ["path", { d: "M12 17v4" }], - ["path", { d: "M8 21h8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/monitor.js var Monitor; @@ -19039,6 +19167,25 @@ var init_monitor = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/monitor-x.js +var MonitorX; +var init_monitor_x = __esmMin((() => { + MonitorX = [ + ["path", { d: "m14.5 12.5-5-5" }], + ["path", { d: "m9.5 12.5 5-5" }], + ["rect", { + width: "20", + height: "14", + x: "2", + y: "3", + rx: "2" + }], + ["path", { d: "M12 17v4" }], + ["path", { d: "M8 21h8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/moon-star.js var MoonStar; @@ -19171,13 +19318,14 @@ var init_mouse = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/move-diagonal.js -var MoveDiagonal; -var init_move_diagonal = __esmMin((() => { - MoveDiagonal = [ - ["path", { d: "M11 19H5v-6" }], - ["path", { d: "M13 5h6v6" }], - ["path", { d: "M19 5 5 19" }] +//#region node_modules/lucide/dist/esm/icons/move-3d.js +var Move3d; +var init_move_3d = __esmMin((() => { + Move3d = [ + ["path", { d: "M5 3v16h16" }], + ["path", { d: "m5 19 6-6" }], + ["path", { d: "m2 6 3-3 3 3" }], + ["path", { d: "m18 16 3 3-3 3" }] ]; })); @@ -19192,18 +19340,6 @@ var init_move_diagonal_2 = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/move-3d.js -var Move3d; -var init_move_3d = __esmMin((() => { - Move3d = [ - ["path", { d: "M5 3v16h16" }], - ["path", { d: "m5 19 6-6" }], - ["path", { d: "m2 6 3-3 3 3" }], - ["path", { d: "m18 16 3 3-3 3" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/move-down-left.js var MoveDownLeft; @@ -19211,6 +19347,17 @@ var init_move_down_left = __esmMin((() => { MoveDownLeft = [["path", { d: "M11 19H5V13" }], ["path", { d: "M19 5L5 19" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/move-diagonal.js +var MoveDiagonal; +var init_move_diagonal = __esmMin((() => { + MoveDiagonal = [ + ["path", { d: "M11 19H5v-6" }], + ["path", { d: "M13 5h6v6" }], + ["path", { d: "M19 5 5 19" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/move-down-right.js var MoveDownRight; @@ -19225,13 +19372,6 @@ var init_move_down = __esmMin((() => { MoveDown = [["path", { d: "M8 18L12 22L16 18" }], ["path", { d: "M12 2V22" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/move-left.js -var MoveLeft; -var init_move_left = __esmMin((() => { - MoveLeft = [["path", { d: "M6 8L2 12L6 16" }], ["path", { d: "M2 12H22" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/move-horizontal.js var MoveHorizontal; @@ -19243,6 +19383,13 @@ var init_move_horizontal = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/move-left.js +var MoveLeft; +var init_move_left = __esmMin((() => { + MoveLeft = [["path", { d: "M6 8L2 12L6 16" }], ["path", { d: "M2 12H22" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/move-right.js var MoveRight; @@ -19357,13 +19504,6 @@ var init_music = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/navigation-2.js -var Navigation2; -var init_navigation_2 = __esmMin((() => { - Navigation2 = [["polygon", { points: "12 2 19 21 12 17 5 21 12 2" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/navigation-2-off.js var Navigation2Off; @@ -19380,6 +19520,13 @@ var init_navigation_2_off = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/navigation-2.js +var Navigation2; +var init_navigation_2 = __esmMin((() => { + Navigation2 = [["polygon", { points: "12 2 19 21 12 17 5 21 12 2" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/navigation-off.js var NavigationOff; @@ -19580,24 +19727,6 @@ var init_notepad_text_dashed = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/nut-off.js -var NutOff; -var init_nut_off = __esmMin((() => { - NutOff = [ - ["path", { d: "M12 4V2" }], - ["path", { d: "M5 10v4a7.004 7.004 0 0 0 5.277 6.787c.412.104.802.292 1.102.592L12 22l.621-.621c.3-.3.69-.488 1.102-.592a7.01 7.01 0 0 0 4.125-2.939" }], - ["path", { d: "M19 10v3.343" }], - ["path", { d: "M12 12c-1.349-.573-1.905-1.005-2.5-2-.546.902-1.048 1.353-2.5 2-1.018-.644-1.46-1.08-2-2-1.028.71-1.69.918-3 1 1.081-1.048 1.757-2.03 2-3 .194-.776.84-1.551 1.79-2.21m11.654 5.997c.887-.457 1.28-.891 1.556-1.787 1.032.916 1.683 1.157 3 1-1.297-1.036-1.758-2.03-2-3-.5-2-4-4-8-4-.74 0-1.461.068-2.15.192" }], - ["line", { - x1: "2", - x2: "22", - y1: "2", - y2: "22" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/notepad-text.js var NotepadText; @@ -19619,6 +19748,24 @@ var init_notepad_text = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/nut-off.js +var NutOff; +var init_nut_off = __esmMin((() => { + NutOff = [ + ["path", { d: "M12 4V2" }], + ["path", { d: "M5 10v4a7.004 7.004 0 0 0 5.277 6.787c.412.104.802.292 1.102.592L12 22l.621-.621c.3-.3.69-.488 1.102-.592a7.01 7.01 0 0 0 4.125-2.939" }], + ["path", { d: "M19 10v3.343" }], + ["path", { d: "M12 12c-1.349-.573-1.905-1.005-2.5-2-.546.902-1.048 1.353-2.5 2-1.018-.644-1.46-1.08-2-2-1.028.71-1.69.918-3 1 1.081-1.048 1.757-2.03 2-3 .194-.776.84-1.551 1.79-2.21m11.654 5.997c.887-.457 1.28-.891 1.556-1.787 1.032.916 1.683 1.157 3 1-1.297-1.036-1.758-2.03-2-3-.5-2-4-4-8-4-.74 0-1.461.068-2.15.192" }], + ["line", { + x1: "2", + x2: "22", + y1: "2", + y2: "22" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/nut.js var Nut; @@ -19863,10 +20010,10 @@ var init_package = __esmMin((() => { var PaintBucket; var init_paint_bucket = __esmMin((() => { PaintBucket = [ - ["path", { d: "m19 11-8-8-8.6 8.6a2 2 0 0 0 0 2.8l5.2 5.2c.8.8 2 .8 2.8 0L19 11Z" }], - ["path", { d: "m5 2 5 5" }], - ["path", { d: "M2 13h15" }], - ["path", { d: "M22 20a2 2 0 1 1-4 0c0-1.6 1.7-2.4 2-4 .3 1.6 2 2.4 2 4Z" }] + ["path", { d: "M19 12H2" }], + ["path", { d: "M21.145 18.38A3.34 3.34 0 0 1 20 16.5a3.3 3.3 0 0 1-1.145 1.88c-.575.46-.855 1.02-.855 1.595A2 2 0 0 0 20 22a2 2 0 0 0 2-2.025c0-.58-.285-1.13-.855-1.595" }], + ["path", { d: "m6 2 5 5" }], + ["path", { d: "m8.5 4.5 2.148-2.148a1.205 1.205 0 0 1 1.704 0l7.296 7.296a1.205 1.205 0 0 1 0 1.704l-7.592 7.592a3.615 3.615 0 0 1-5.112 0l-3.888-3.888a3.615 3.615 0 0 1 0-5.112L5.67 7.33" }] ]; })); @@ -19905,17 +20052,6 @@ var init_paintbrush_vertical = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/paintbrush.js -var Paintbrush; -var init_paintbrush = __esmMin((() => { - Paintbrush = [ - ["path", { d: "m14.622 17.897-10.68-2.913" }], - ["path", { d: "M18.376 2.622a1 1 0 1 1 3.002 3.002L17.36 9.643a.5.5 0 0 0 0 .707l.944.944a2.41 2.41 0 0 1 0 3.408l-.944.944a.5.5 0 0 1-.707 0L8.354 7.348a.5.5 0 0 1 0-.707l.944-.944a2.41 2.41 0 0 1 3.408 0l.944.944a.5.5 0 0 0 .707 0z" }], - ["path", { d: "M9 8c-1.804 2.71-3.97 3.46-6.583 3.948a.507.507 0 0 0-.302.819l7.32 8.883a1 1 0 0 0 1.185.204C12.735 20.405 16 16.792 16 15" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/palette.js var Palette; @@ -19949,6 +20085,17 @@ var init_palette = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/paintbrush.js +var Paintbrush; +var init_paintbrush = __esmMin((() => { + Paintbrush = [ + ["path", { d: "m14.622 17.897-10.68-2.913" }], + ["path", { d: "M18.376 2.622a1 1 0 1 1 3.002 3.002L17.36 9.643a.5.5 0 0 0 0 .707l.944.944a2.41 2.41 0 0 1 0 3.408l-.944.944a.5.5 0 0 1-.707 0L8.354 7.348a.5.5 0 0 1 0-.707l.944-.944a2.41 2.41 0 0 1 3.408 0l.944.944a.5.5 0 0 0 .707 0z" }], + ["path", { d: "M9 8c-1.804 2.71-3.97 3.46-6.583 3.948a.507.507 0 0 0-.302.819l7.32 8.883a1 1 0 0 0 1.185.204C12.735 20.405 16 16.792 16 15" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/panda.js var Panda; @@ -19999,19 +20146,6 @@ var init_panel_bottom_dashed = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/panel-bottom.js -var PanelBottom; -var init_panel_bottom = __esmMin((() => { - PanelBottom = [["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], ["path", { d: "M3 15h18" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/panel-bottom-open.js var PanelBottomOpen; @@ -20029,6 +20163,19 @@ var init_panel_bottom_open = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/panel-bottom.js +var PanelBottom; +var init_panel_bottom = __esmMin((() => { + PanelBottom = [["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], ["path", { d: "M3 15h18" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/panel-left-close.js var PanelLeftClose; @@ -20135,6 +20282,25 @@ var init_panel_right_close = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/panel-right-dashed.js +var PanelRightDashed; +var init_panel_right_dashed = __esmMin((() => { + PanelRightDashed = [ + ["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], + ["path", { d: "M15 14v1" }], + ["path", { d: "M15 19v2" }], + ["path", { d: "M15 3v2" }], + ["path", { d: "M15 9v1" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/panel-right-open.js var PanelRightOpen; @@ -20153,22 +20319,16 @@ var init_panel_right_open = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/panel-right-dashed.js -var PanelRightDashed; -var init_panel_right_dashed = __esmMin((() => { - PanelRightDashed = [ - ["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], - ["path", { d: "M15 14v1" }], - ["path", { d: "M15 19v2" }], - ["path", { d: "M15 3v2" }], - ["path", { d: "M15 9v1" }] - ]; +//#region node_modules/lucide/dist/esm/icons/panel-right.js +var PanelRight; +var init_panel_right = __esmMin((() => { + PanelRight = [["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], ["path", { d: "M15 3v18" }]]; })); //#endregion @@ -20194,19 +20354,6 @@ var init_panel_top_bottom_dashed = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/panel-right.js -var PanelRight; -var init_panel_right = __esmMin((() => { - PanelRight = [["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], ["path", { d: "M15 3v18" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/panel-top-close.js var PanelTopClose; @@ -20481,18 +20628,6 @@ var init_pencil_line = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/pencil-off.js -var PencilOff; -var init_pencil_off = __esmMin((() => { - PencilOff = [ - ["path", { d: "m10 10-6.157 6.162a2 2 0 0 0-.5.833l-1.322 4.36a.5.5 0 0 0 .622.624l4.358-1.323a2 2 0 0 0 .83-.5L14 13.982" }], - ["path", { d: "m12.829 7.172 4.359-4.346a1 1 0 1 1 3.986 3.986l-4.353 4.353" }], - ["path", { d: "m15 5 4 4" }], - ["path", { d: "m2 2 20 20" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/pencil-ruler.js var PencilRuler; @@ -20507,6 +20642,18 @@ var init_pencil_ruler = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/pencil-off.js +var PencilOff; +var init_pencil_off = __esmMin((() => { + PencilOff = [ + ["path", { d: "m10 10-6.157 6.162a2 2 0 0 0-.5.833l-1.322 4.36a.5.5 0 0 0 .622.624l4.358-1.323a2 2 0 0 0 .83-.5L14 13.982" }], + ["path", { d: "m12.829 7.172 4.359-4.346a1 1 0 1 1 3.986 3.986l-4.353 4.353" }], + ["path", { d: "m15 5 4 4" }], + ["path", { d: "m2 2 20 20" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/pencil.js var Pencil; @@ -20521,6 +20668,22 @@ var init_pentagon = __esmMin((() => { Pentagon = [["path", { d: "M10.83 2.38a2 2 0 0 1 2.34 0l8 5.74a2 2 0 0 1 .73 2.25l-3.04 9.26a2 2 0 0 1-1.9 1.37H7.04a2 2 0 0 1-1.9-1.37L2.1 10.37a2 2 0 0 1 .73-2.25z" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/person-standing.js +var PersonStanding; +var init_person_standing = __esmMin((() => { + PersonStanding = [ + ["circle", { + cx: "12", + cy: "5", + r: "1" + }], + ["path", { d: "m9 20 3-6 3 6" }], + ["path", { d: "m6 8 6 2 6-2" }], + ["path", { d: "M12 10v4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/percent.js var Percent; @@ -20545,22 +20708,6 @@ var init_percent = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/person-standing.js -var PersonStanding; -var init_person_standing = __esmMin((() => { - PersonStanding = [ - ["circle", { - cx: "12", - cy: "5", - r: "1" - }], - ["path", { d: "m9 20 3-6 3 6" }], - ["path", { d: "m6 8 6 2 6-2" }], - ["path", { d: "M12 10v4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/philippine-peso.js var PhilippinePeso; @@ -20638,13 +20785,6 @@ var init_phone_outgoing = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/phone.js -var Phone; -var init_phone = __esmMin((() => { - Phone = [["path", { d: "M13.832 16.568a1 1 0 0 0 1.213-.303l.355-.465A2 2 0 0 1 17 15h3a2 2 0 0 1 2 2v3a2 2 0 0 1-2 2A18 18 0 0 1 2 4a2 2 0 0 1 2-2h3a2 2 0 0 1 2 2v3a2 2 0 0 1-.8 1.6l-.468.351a1 1 0 0 0-.292 1.233 14 14 0 0 0 6.392 6.384" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/pi.js var Pi; @@ -20661,6 +20801,13 @@ var init_pi = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/phone.js +var Phone; +var init_phone = __esmMin((() => { + Phone = [["path", { d: "M13.832 16.568a1 1 0 0 0 1.213-.303l.355-.465A2 2 0 0 1 17 15h3a2 2 0 0 1 2 2v3a2 2 0 0 1-2 2A18 18 0 0 1 2 4a2 2 0 0 1 2-2h3a2 2 0 0 1 2 2v3a2 2 0 0 1-.8 1.6l-.468.351a1 1 0 0 0-.292 1.233 14 14 0 0 0 6.392 6.384" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/piano.js var Piano; @@ -20743,17 +20890,6 @@ var init_pilcrow_left = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/pilcrow.js -var Pilcrow; -var init_pilcrow = __esmMin((() => { - Pilcrow = [ - ["path", { d: "M13 4v16" }], - ["path", { d: "M17 4v16" }], - ["path", { d: "M19 4H9.5a4.5 4.5 0 0 0 0 9H13" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/pilcrow-right.js var PilcrowRight; @@ -20767,6 +20903,17 @@ var init_pilcrow_right = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/pilcrow.js +var Pilcrow; +var init_pilcrow = __esmMin((() => { + Pilcrow = [ + ["path", { d: "M13 4v16" }], + ["path", { d: "M17 4v16" }], + ["path", { d: "M19 4H9.5a4.5 4.5 0 0 0 0 9H13" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/pill-bottle.js var PillBottle; @@ -20810,17 +20957,6 @@ var init_pin = __esmMin((() => { Pin = [["path", { d: "M12 17v5" }], ["path", { d: "M9 10.76a2 2 0 0 1-1.11 1.79l-1.78.9A2 2 0 0 0 5 15.24V16a1 1 0 0 0 1 1h12a1 1 0 0 0 1-1v-.76a2 2 0 0 0-1.11-1.79l-1.78-.9A2 2 0 0 1 15 10.76V7a1 1 0 0 1 1-1 2 2 0 0 0 0-4H8a2 2 0 0 0 0 4 1 1 0 0 1 1 1z" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/pipette.js -var Pipette; -var init_pipette = __esmMin((() => { - Pipette = [ - ["path", { d: "m12 9-8.414 8.414A2 2 0 0 0 3 18.828v1.344a2 2 0 0 1-.586 1.414A2 2 0 0 1 3.828 21h1.344a2 2 0 0 0 1.414-.586L15 12" }], - ["path", { d: "m18 9 .4.4a1 1 0 1 1-3 3l-3.8-3.8a1 1 0 1 1 3-3l.4.4 3.4-3.4a1 1 0 1 1 3 3z" }], - ["path", { d: "m2 22 .414-.414" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/pizza.js var Pizza; @@ -20834,6 +20970,17 @@ var init_pizza = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/pipette.js +var Pipette; +var init_pipette = __esmMin((() => { + Pipette = [ + ["path", { d: "m12 9-8.414 8.414A2 2 0 0 0 3 18.828v1.344a2 2 0 0 1-.586 1.414A2 2 0 0 1 3.828 21h1.344a2 2 0 0 0 1.414-.586L15 12" }], + ["path", { d: "m18 9 .4.4a1 1 0 1 1-3 3l-3.8-3.8a1 1 0 1 1 3-3l.4.4 3.4-3.4a1 1 0 1 1 3 3z" }], + ["path", { d: "m2 22 .414-.414" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/plane-landing.js var PlaneLanding; @@ -21024,17 +21171,6 @@ var init_power = __esmMin((() => { Power = [["path", { d: "M12 2v10" }], ["path", { d: "M18.4 6.6a9 9 0 1 1-12.77.04" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/presentation.js -var Presentation; -var init_presentation = __esmMin((() => { - Presentation = [ - ["path", { d: "M2 3h20" }], - ["path", { d: "M21 3v11a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V3" }], - ["path", { d: "m7 21 5-5 5 5" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/printer-check.js var PrinterCheck; @@ -21048,20 +21184,13 @@ var init_printer_check = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/projector.js -var Projector; -var init_projector = __esmMin((() => { - Projector = [ - ["path", { d: "M5 7 3 5" }], - ["path", { d: "M9 6V3" }], - ["path", { d: "m13 7 2-2" }], - ["circle", { - cx: "9", - cy: "13", - r: "3" - }], - ["path", { d: "M11.83 12H20a2 2 0 0 1 2 2v4a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2v-4a2 2 0 0 1 2-2h2.17" }], - ["path", { d: "M16 16h2" }] +//#region node_modules/lucide/dist/esm/icons/presentation.js +var Presentation; +var init_presentation = __esmMin((() => { + Presentation = [ + ["path", { d: "M2 3h20" }], + ["path", { d: "M21 3v11a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V3" }], + ["path", { d: "m7 21 5-5 5 5" }] ]; })); @@ -21099,6 +21228,24 @@ var init_proportions = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/projector.js +var Projector; +var init_projector = __esmMin((() => { + Projector = [ + ["path", { d: "M5 7 3 5" }], + ["path", { d: "M9 6V3" }], + ["path", { d: "m13 7 2-2" }], + ["circle", { + cx: "9", + cy: "13", + r: "3" + }], + ["path", { d: "M11.83 12H20a2 2 0 0 1 2 2v4a2 2 0 0 1-2 2H4a2 2 0 0 1-2-2v-4a2 2 0 0 1 2-2h2.17" }], + ["path", { d: "M16 16h2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/puzzle.js var Puzzle; @@ -21228,6 +21375,25 @@ var init_radio_receiver = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/radio-tower.js +var RadioTower; +var init_radio_tower = __esmMin((() => { + RadioTower = [ + ["path", { d: "M4.9 16.1C1 12.2 1 5.8 4.9 1.9" }], + ["path", { d: "M7.8 4.7a6.14 6.14 0 0 0-.8 7.5" }], + ["circle", { + cx: "12", + cy: "9", + r: "2" + }], + ["path", { d: "M16.2 4.8c2 2 2.26 5.11.8 7.47" }], + ["path", { d: "M19.1 1.9a9.96 9.96 0 0 1 0 14.1" }], + ["path", { d: "M9.5 18h5" }], + ["path", { d: "m8 22 4-11 4 11" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/radio.js var Radio; @@ -21265,25 +21431,6 @@ var init_radius = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/radio-tower.js -var RadioTower; -var init_radio_tower = __esmMin((() => { - RadioTower = [ - ["path", { d: "M4.9 16.1C1 12.2 1 5.8 4.9 1.9" }], - ["path", { d: "M7.8 4.7a6.14 6.14 0 0 0-.8 7.5" }], - ["circle", { - cx: "12", - cy: "9", - r: "2" - }], - ["path", { d: "M16.2 4.8c2 2 2.26 5.11.8 7.47" }], - ["path", { d: "M19.1 1.9a9.96 9.96 0 0 1 0 14.1" }], - ["path", { d: "M9.5 18h5" }], - ["path", { d: "m8 22 4-11 4 11" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/rail-symbol.js var RailSymbol; @@ -21349,17 +21496,6 @@ var init_receipt_cent = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/receipt-euro.js -var ReceiptEuro; -var init_receipt_euro = __esmMin((() => { - ReceiptEuro = [ - ["path", { d: "M4 2v20l2-1 2 1 2-1 2 1 2-1 2 1 2-1 2 1V2l-2 1-2-1-2 1-2-1-2 1-2-1-2 1Z" }], - ["path", { d: "M8 12h5" }], - ["path", { d: "M16 9.5a4 4 0 1 0 0 5.2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/receipt-indian-rupee.js var ReceiptIndianRupee; @@ -21372,6 +21508,17 @@ var init_receipt_indian_rupee = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/receipt-euro.js +var ReceiptEuro; +var init_receipt_euro = __esmMin((() => { + ReceiptEuro = [ + ["path", { d: "M4 2v20l2-1 2 1 2-1 2 1 2-1 2 1 2-1 2 1V2l-2 1-2-1-2 1-2-1-2 1-2-1-2 1Z" }], + ["path", { d: "M8 12h5" }], + ["path", { d: "M16 9.5a4 4 0 1 0 0 5.2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/receipt-japanese-yen.js var ReceiptJapaneseYen; @@ -21782,6 +21929,21 @@ var init_rocket = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/roller-coaster.js +var RollerCoaster; +var init_roller_coaster = __esmMin((() => { + RollerCoaster = [ + ["path", { d: "M6 19V5" }], + ["path", { d: "M10 19V6.8" }], + ["path", { d: "M14 19v-7.8" }], + ["path", { d: "M18 5v4" }], + ["path", { d: "M18 19v-6" }], + ["path", { d: "M22 19V9" }], + ["path", { d: "M2 19V9a4 4 0 0 1 4-4c2 0 4 1.33 6 4s4 4 6 4a4 4 0 1 0-3-6.65" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/rocking-chair.js var RockingChair; @@ -21804,21 +21966,6 @@ var init_rocking_chair = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/roller-coaster.js -var RollerCoaster; -var init_roller_coaster = __esmMin((() => { - RollerCoaster = [ - ["path", { d: "M6 19V5" }], - ["path", { d: "M10 19V6.8" }], - ["path", { d: "M14 19v-7.8" }], - ["path", { d: "M18 5v4" }], - ["path", { d: "M18 19v-6" }], - ["path", { d: "M22 19V9" }], - ["path", { d: "M2 19V9a4 4 0 0 1 4-4c2 0 4 1.33 6 4s4 4 6 4a4 4 0 1 0-3-6.65" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/rose.js var Rose; @@ -21847,17 +21994,6 @@ var init_rotate_3d = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/rotate-ccw-square.js -var RotateCcwSquare; -var init_rotate_ccw_square = __esmMin((() => { - RotateCcwSquare = [ - ["path", { d: "M20 9V7a2 2 0 0 0-2-2h-6" }], - ["path", { d: "m15 2-3 3 3 3" }], - ["path", { d: "M20 13v5a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2h2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/rotate-ccw-key.js var RotateCcwKey; @@ -21875,6 +22011,17 @@ var init_rotate_ccw_key = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/rotate-ccw-square.js +var RotateCcwSquare; +var init_rotate_ccw_square = __esmMin((() => { + RotateCcwSquare = [ + ["path", { d: "M20 9V7a2 2 0 0 0-2-2h-6" }], + ["path", { d: "m15 2-3 3 3 3" }], + ["path", { d: "M20 13v5a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2V7a2 2 0 0 1 2-2h2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/rotate-ccw.js var RotateCcw; @@ -21923,6 +22070,26 @@ var init_route_off = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/router.js +var Router; +var init_router = __esmMin((() => { + Router = [ + ["rect", { + width: "20", + height: "8", + x: "2", + y: "14", + rx: "2" + }], + ["path", { d: "M6.01 18H6" }], + ["path", { d: "M10.01 18H10" }], + ["path", { d: "M15 10v4" }], + ["path", { d: "M17.84 7.17a4 4 0 0 0-5.66 0" }], + ["path", { d: "M20.66 4.34a8 8 0 0 0-11.31 0" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/route.js var Route; @@ -21955,26 +22122,6 @@ var init_rows_2 = __esmMin((() => { }], ["path", { d: "M3 12h18" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/router.js -var Router; -var init_router = __esmMin((() => { - Router = [ - ["rect", { - width: "20", - height: "8", - x: "2", - y: "14", - rx: "2" - }], - ["path", { d: "M6.01 18H6" }], - ["path", { d: "M10.01 18H10" }], - ["path", { d: "M15 10v4" }], - ["path", { d: "M17.84 7.17a4 4 0 0 0-5.66 0" }], - ["path", { d: "M20.66 4.34a8 8 0 0 0-11.31 0" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/rows-3.js var Rows3; @@ -22263,6 +22410,21 @@ var init_scan_eye = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/scan-face.js +var ScanFace; +var init_scan_face = __esmMin((() => { + ScanFace = [ + ["path", { d: "M3 7V5a2 2 0 0 1 2-2h2" }], + ["path", { d: "M17 3h2a2 2 0 0 1 2 2v2" }], + ["path", { d: "M21 17v2a2 2 0 0 1-2 2h-2" }], + ["path", { d: "M7 21H5a2 2 0 0 1-2-2v-2" }], + ["path", { d: "M8 14s1.5 2 4 2 4-2 4-2" }], + ["path", { d: "M9 9h.01" }], + ["path", { d: "M15 9h.01" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/scan-heart.js var ScanHeart; @@ -22277,17 +22439,15 @@ var init_scan_heart = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/scan-face.js -var ScanFace; -var init_scan_face = __esmMin((() => { - ScanFace = [ +//#region node_modules/lucide/dist/esm/icons/scan-line.js +var ScanLine; +var init_scan_line = __esmMin((() => { + ScanLine = [ ["path", { d: "M3 7V5a2 2 0 0 1 2-2h2" }], ["path", { d: "M17 3h2a2 2 0 0 1 2 2v2" }], ["path", { d: "M21 17v2a2 2 0 0 1-2 2h-2" }], ["path", { d: "M7 21H5a2 2 0 0 1-2-2v-2" }], - ["path", { d: "M8 14s1.5 2 4 2 4-2 4-2" }], - ["path", { d: "M9 9h.01" }], - ["path", { d: "M15 9h.01" }] + ["path", { d: "M7 12h10" }] ]; })); @@ -22313,19 +22473,6 @@ var init_scan_qr_code = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/scan-line.js -var ScanLine; -var init_scan_line = __esmMin((() => { - ScanLine = [ - ["path", { d: "M3 7V5a2 2 0 0 1 2-2h2" }], - ["path", { d: "M17 3h2a2 2 0 0 1 2 2v2" }], - ["path", { d: "M21 17v2a2 2 0 0 1-2 2h-2" }], - ["path", { d: "M7 21H5a2 2 0 0 1-2-2v-2" }], - ["path", { d: "M7 12h10" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/scan-search.js var ScanSearch; @@ -22479,6 +22626,13 @@ var init_screen_share = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/scroll.js +var Scroll; +var init_scroll = __esmMin((() => { + Scroll = [["path", { d: "M19 17V5a2 2 0 0 0-2-2H4" }], ["path", { d: "M8 21h12a2 2 0 0 0 2-2v-1a1 1 0 0 0-1-1H11a1 1 0 0 0-1 1v1a2 2 0 1 1-4 0V5a2 2 0 1 0-4 0v2a1 1 0 0 0 1 1h3" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/scroll-text.js var ScrollText; @@ -22492,10 +22646,19 @@ var init_scroll_text = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/scroll.js -var Scroll; -var init_scroll = __esmMin((() => { - Scroll = [["path", { d: "M19 17V5a2 2 0 0 0-2-2H4" }], ["path", { d: "M8 21h12a2 2 0 0 0 2-2v-1a1 1 0 0 0-1-1H11a1 1 0 0 0-1 1v1a2 2 0 1 1-4 0V5a2 2 0 1 0-4 0v2a1 1 0 0 0 1 1h3" }]]; +//#region node_modules/lucide/dist/esm/icons/search-alert.js +var SearchAlert; +var init_search_alert = __esmMin((() => { + SearchAlert = [ + ["circle", { + cx: "11", + cy: "11", + r: "8" + }], + ["path", { d: "m21 21-4.3-4.3" }], + ["path", { d: "M11 7v4" }], + ["path", { d: "M11 15h.01" }] + ]; })); //#endregion @@ -22627,17 +22790,6 @@ var init_separator_horizontal = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/separator-vertical.js -var SeparatorVertical; -var init_separator_vertical = __esmMin((() => { - SeparatorVertical = [ - ["path", { d: "M12 3v18" }], - ["path", { d: "m16 16 4-4-4-4" }], - ["path", { d: "m8 8-4 4 4 4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/server-cog.js var ServerCog; @@ -22658,6 +22810,17 @@ var init_server_cog = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/separator-vertical.js +var SeparatorVertical; +var init_separator_vertical = __esmMin((() => { + SeparatorVertical = [ + ["path", { d: "M12 3v18" }], + ["path", { d: "m16 16 4-4-4-4" }], + ["path", { d: "m8 8-4 4 4 4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/server-crash.js var ServerCrash; @@ -22866,13 +23029,6 @@ var init_shell = __esmMin((() => { Shell = [["path", { d: "M14 11a2 2 0 1 1-4 0 4 4 0 0 1 8 0 6 6 0 0 1-12 0 8 8 0 0 1 16 0 10 10 0 1 1-20 0 11.93 11.93 0 0 1 2.42-7.22 2 2 0 1 1 3.16 2.44" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/shield-ban.js -var ShieldBan; -var init_shield_ban = __esmMin((() => { - ShieldBan = [["path", { d: "M20 13c0 5-3.5 7.5-7.66 8.95a1 1 0 0 1-.67-.01C7.5 20.5 4 18 4 13V6a1 1 0 0 1 1-1c2 0 4.5-1.2 6.24-2.72a1.17 1.17 0 0 1 1.52 0C14.51 3.81 17 5 19 5a1 1 0 0 1 1 1z" }], ["path", { d: "m4.243 5.21 14.39 12.472" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/shield-alert.js var ShieldAlert; @@ -22884,6 +23040,13 @@ var init_shield_alert = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/shield-ban.js +var ShieldBan; +var init_shield_ban = __esmMin((() => { + ShieldBan = [["path", { d: "M20 13c0 5-3.5 7.5-7.66 8.95a1 1 0 0 1-.67-.01C7.5 20.5 4 18 4 13V6a1 1 0 0 1 1-1c2 0 4.5-1.2 6.24-2.72a1.17 1.17 0 0 1 1.52 0C14.51 3.81 17 5 19 5a1 1 0 0 1 1 1z" }], ["path", { d: "m4.243 5.21 14.39 12.472" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/shield-check.js var ShieldCheck; @@ -23022,13 +23185,6 @@ var init_ship = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/shirt.js -var Shirt; -var init_shirt = __esmMin((() => { - Shirt = [["path", { d: "M20.38 3.46 16 2a4 4 0 0 1-8 0L3.62 3.46a2 2 0 0 0-1.34 2.23l.58 3.47a1 1 0 0 0 .99.84H6v10c0 1.1.9 2 2 2h8a2 2 0 0 0 2-2V10h2.15a1 1 0 0 0 .99-.84l.58-3.47a2 2 0 0 0-1.34-2.23z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/shopping-bag.js var ShoppingBag; @@ -23041,18 +23197,10 @@ var init_shopping_bag = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/shopping-basket.js -var ShoppingBasket; -var init_shopping_basket = __esmMin((() => { - ShoppingBasket = [ - ["path", { d: "m15 11-1 9" }], - ["path", { d: "m19 11-4-7" }], - ["path", { d: "M2 11h20" }], - ["path", { d: "m3.5 11 1.6 7.4a2 2 0 0 0 2 1.6h9.8a2 2 0 0 0 2-1.6l1.7-7.4" }], - ["path", { d: "M4.5 15.5h15" }], - ["path", { d: "m5 11 4-7" }], - ["path", { d: "m9 11 1 9" }] - ]; +//#region node_modules/lucide/dist/esm/icons/shirt.js +var Shirt; +var init_shirt = __esmMin((() => { + Shirt = [["path", { d: "M20.38 3.46 16 2a4 4 0 0 1-8 0L3.62 3.46a2 2 0 0 0-1.34 2.23l.58 3.47a1 1 0 0 0 .99.84H6v10c0 1.1.9 2 2 2h8a2 2 0 0 0 2-2V10h2.15a1 1 0 0 0 .99-.84l.58-3.47a2 2 0 0 0-1.34-2.23z" }]]; })); //#endregion @@ -23074,6 +23222,21 @@ var init_shopping_cart = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/shopping-basket.js +var ShoppingBasket; +var init_shopping_basket = __esmMin((() => { + ShoppingBasket = [ + ["path", { d: "m15 11-1 9" }], + ["path", { d: "m19 11-4-7" }], + ["path", { d: "M2 11h20" }], + ["path", { d: "m3.5 11 1.6 7.4a2 2 0 0 0 2 1.6h9.8a2 2 0 0 0 2-1.6l1.7-7.4" }], + ["path", { d: "M4.5 15.5h15" }], + ["path", { d: "m5 11 4-7" }], + ["path", { d: "m9 11 1 9" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/shovel.js var Shovel; @@ -23243,6 +23406,17 @@ var init_signpost_big = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/signpost.js +var Signpost; +var init_signpost = __esmMin((() => { + Signpost = [ + ["path", { d: "M12 13v8" }], + ["path", { d: "M12 3v3" }], + ["path", { d: "M18 6a2 2 0 0 1 1.387.56l2.307 2.22a1 1 0 0 1 0 1.44l-2.307 2.22A2 2 0 0 1 18 13H6a2 2 0 0 1-1.387-.56l-2.306-2.22a1 1 0 0 1 0-1.44l2.306-2.22A2 2 0 0 1 6 6z" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/siren.js var Siren; @@ -23266,17 +23440,6 @@ var init_skip_back = __esmMin((() => { SkipBack = [["path", { d: "M17.971 4.285A2 2 0 0 1 21 6v12a2 2 0 0 1-3.029 1.715l-9.997-5.998a2 2 0 0 1-.003-3.432z" }], ["path", { d: "M3 20V4" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/signpost.js -var Signpost; -var init_signpost = __esmMin((() => { - Signpost = [ - ["path", { d: "M12 13v8" }], - ["path", { d: "M12 3v3" }], - ["path", { d: "M18 6a2 2 0 0 1 1.387.56l2.307 2.22a1 1 0 0 1 0 1.44l-2.307 2.22A2 2 0 0 1 18 13H6a2 2 0 0 1-1.387-.56l-2.306-2.22a1 1 0 0 1 0-1.44l2.306-2.22A2 2 0 0 1 6 6z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/skip-forward.js var SkipForward; @@ -23537,19 +23700,6 @@ var init_soap_dispenser_droplet = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/sofa.js -var Sofa; -var init_sofa = __esmMin((() => { - Sofa = [ - ["path", { d: "M20 9V6a2 2 0 0 0-2-2H6a2 2 0 0 0-2 2v3" }], - ["path", { d: "M2 16a2 2 0 0 0 2 2h16a2 2 0 0 0 2-2v-5a2 2 0 0 0-4 0v1.5a.5.5 0 0 1-.5.5h-11a.5.5 0 0 1-.5-.5V11a2 2 0 0 0-4 0z" }], - ["path", { d: "M4 18v2" }], - ["path", { d: "M20 18v2" }], - ["path", { d: "M12 4v9" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/solar-panel.js var SolarPanel; @@ -23565,6 +23715,19 @@ var init_solar_panel = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/sofa.js +var Sofa; +var init_sofa = __esmMin((() => { + Sofa = [ + ["path", { d: "M20 9V6a2 2 0 0 0-2-2H6a2 2 0 0 0-2 2v3" }], + ["path", { d: "M2 16a2 2 0 0 0 2 2h16a2 2 0 0 0 2-2v-5a2 2 0 0 0-4 0v1.5a.5.5 0 0 1-.5.5h-11a.5.5 0 0 1-.5-.5V11a2 2 0 0 0-4 0z" }], + ["path", { d: "M4 18v2" }], + ["path", { d: "M20 18v2" }], + ["path", { d: "M12 4v9" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/soup.js var Soup; @@ -23593,6 +23756,13 @@ var init_spade = __esmMin((() => { Spade = [["path", { d: "M12 18v4" }], ["path", { d: "M2 14.499a5.5 5.5 0 0 0 9.591 3.675.6.6 0 0 1 .818.001A5.5 5.5 0 0 0 22 14.5c0-2.29-1.5-4-3-5.5l-5.492-5.312a2 2 0 0 0-3-.02L5 8.999c-1.5 1.5-3 3.2-3 5.5" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/sparkle.js +var Sparkle; +var init_sparkle = __esmMin((() => { + Sparkle = [["path", { d: "M11.017 2.814a1 1 0 0 1 1.966 0l1.051 5.558a2 2 0 0 0 1.594 1.594l5.558 1.051a1 1 0 0 1 0 1.966l-5.558 1.051a2 2 0 0 0-1.594 1.594l-1.051 5.558a1 1 0 0 1-1.966 0l-1.051-5.558a2 2 0 0 0-1.594-1.594l-5.558-1.051a1 1 0 0 1 0-1.966l5.558-1.051a2 2 0 0 0 1.594-1.594z" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/sparkles.js var Sparkles; @@ -23609,6 +23779,17 @@ var init_sparkles = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/speech.js +var Speech; +var init_speech = __esmMin((() => { + Speech = [ + ["path", { d: "M8.8 20v-4.1l1.9.2a2.3 2.3 0 0 0 2.164-2.1V8.3A5.37 5.37 0 0 0 2 8.25c0 2.8.656 3.054 1 4.55a5.77 5.77 0 0 1 .029 2.758L2 20" }], + ["path", { d: "M19.8 17.8a7.5 7.5 0 0 0 .003-10.603" }], + ["path", { d: "M17 15a3.5 3.5 0 0 0-.025-4.975" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/speaker.js var Speaker; @@ -23631,24 +23812,6 @@ var init_speaker = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/sparkle.js -var Sparkle; -var init_sparkle = __esmMin((() => { - Sparkle = [["path", { d: "M11.017 2.814a1 1 0 0 1 1.966 0l1.051 5.558a2 2 0 0 0 1.594 1.594l5.558 1.051a1 1 0 0 1 0 1.966l-5.558 1.051a2 2 0 0 0-1.594 1.594l-1.051 5.558a1 1 0 0 1-1.966 0l-1.051-5.558a2 2 0 0 0-1.594-1.594l-5.558-1.051a1 1 0 0 1 0-1.966l5.558-1.051a2 2 0 0 0 1.594-1.594z" }]]; -})); - -//#endregion -//#region node_modules/lucide/dist/esm/icons/speech.js -var Speech; -var init_speech = __esmMin((() => { - Speech = [ - ["path", { d: "M8.8 20v-4.1l1.9.2a2.3 2.3 0 0 0 2.164-2.1V8.3A5.37 5.37 0 0 0 2 8.25c0 2.8.656 3.054 1 4.55a5.77 5.77 0 0 1 .029 2.758L2 20" }], - ["path", { d: "M19.8 17.8a7.5 7.5 0 0 0 .003-10.603" }], - ["path", { d: "M17 15a3.5 3.5 0 0 0-.025-4.975" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/spell-check-2.js var SpellCheck2; @@ -23717,18 +23880,6 @@ var init_spool = __esmMin((() => { Spool = [["path", { d: "M17 13.44 4.442 17.082A2 2 0 0 0 4.982 21H19a2 2 0 0 0 .558-3.921l-1.115-.32A2 2 0 0 1 17 14.837V7.66" }], ["path", { d: "m7 10.56 12.558-3.642A2 2 0 0 0 19.018 3H5a2 2 0 0 0-.558 3.921l1.115.32A2 2 0 0 1 7 9.163v7.178" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/split.js -var Split; -var init_split = __esmMin((() => { - Split = [ - ["path", { d: "M16 3h5v5" }], - ["path", { d: "M8 3H3v5" }], - ["path", { d: "M12 22v-8.3a4 4 0 0 0-1.172-2.872L3 3" }], - ["path", { d: "m15 9 6-6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/spotlight.js var Spotlight; @@ -23742,6 +23893,18 @@ var init_spotlight = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/split.js +var Split; +var init_split = __esmMin((() => { + Split = [ + ["path", { d: "M16 3h5v5" }], + ["path", { d: "M8 3H3v5" }], + ["path", { d: "M12 22v-8.3a4 4 0 0 0-1.172-2.872L3 3" }], + ["path", { d: "m15 9 6-6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/spray-can.js var SprayCan; @@ -24057,13 +24220,6 @@ var init_square_bottom_dashed_scissors = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-check-big.js -var SquareCheckBig; -var init_square_check_big = __esmMin((() => { - SquareCheckBig = [["path", { d: "M21 10.656V19a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h12.344" }], ["path", { d: "m9 11 3 3L22 4" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/square-chart-gantt.js var SquareChartGantt; @@ -24082,6 +24238,13 @@ var init_square_chart_gantt = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-check-big.js +var SquareCheckBig; +var init_square_check_big = __esmMin((() => { + SquareCheckBig = [["path", { d: "M21 10.656V19a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h12.344" }], ["path", { d: "m9 11 3 3L22 4" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-check.js var SquareCheck; @@ -24177,6 +24340,17 @@ var init_square_dashed_bottom_code = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-dashed-bottom.js +var SquareDashedBottom; +var init_square_dashed_bottom = __esmMin((() => { + SquareDashedBottom = [ + ["path", { d: "M5 21a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h14a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2" }], + ["path", { d: "M9 21h1" }], + ["path", { d: "M14 21h1" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-dashed-kanban.js var SquareDashedKanban; @@ -24200,6 +24374,23 @@ var init_square_dashed_kanban = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-dashed-top-solid.js +var SquareDashedTopSolid; +var init_square_dashed_top_solid = __esmMin((() => { + SquareDashedTopSolid = [ + ["path", { d: "M14 21h1" }], + ["path", { d: "M21 14v1" }], + ["path", { d: "M21 19a2 2 0 0 1-2 2" }], + ["path", { d: "M21 9v1" }], + ["path", { d: "M3 14v1" }], + ["path", { d: "M3 5a2 2 0 0 1 2-2h14a2 2 0 0 1 2 2" }], + ["path", { d: "M3 9v1" }], + ["path", { d: "M5 21a2 2 0 0 1-2-2" }], + ["path", { d: "M9 21h1" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-dashed-mouse-pointer.js var SquareDashedMousePointer; @@ -24218,34 +24409,6 @@ var init_square_dashed_mouse_pointer = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-dashed-bottom.js -var SquareDashedBottom; -var init_square_dashed_bottom = __esmMin((() => { - SquareDashedBottom = [ - ["path", { d: "M5 21a2 2 0 0 1-2-2V5a2 2 0 0 1 2-2h14a2 2 0 0 1 2 2v14a2 2 0 0 1-2 2" }], - ["path", { d: "M9 21h1" }], - ["path", { d: "M14 21h1" }] - ]; -})); - -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-dashed-top-solid.js -var SquareDashedTopSolid; -var init_square_dashed_top_solid = __esmMin((() => { - SquareDashedTopSolid = [ - ["path", { d: "M14 21h1" }], - ["path", { d: "M21 14v1" }], - ["path", { d: "M21 19a2 2 0 0 1-2 2" }], - ["path", { d: "M21 9v1" }], - ["path", { d: "M3 14v1" }], - ["path", { d: "M3 5a2 2 0 0 1 2-2h14a2 2 0 0 1 2 2" }], - ["path", { d: "M3 9v1" }], - ["path", { d: "M5 21a2 2 0 0 1-2-2" }], - ["path", { d: "M9 21h1" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/square-dashed.js var SquareDashed; @@ -24317,6 +24480,23 @@ var init_square_dot = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-equal.js +var SquareEqual; +var init_square_equal = __esmMin((() => { + SquareEqual = [ + ["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], + ["path", { d: "M7 10h10" }], + ["path", { d: "M7 14h10" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-function.js var SquareFunction; @@ -24335,23 +24515,6 @@ var init_square_function = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-equal.js -var SquareEqual; -var init_square_equal = __esmMin((() => { - SquareEqual = [ - ["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], - ["path", { d: "M7 10h10" }], - ["path", { d: "M7 14h10" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/square-kanban.js var SquareKanban; @@ -24499,24 +24662,6 @@ var init_square_pen = __esmMin((() => { SquarePen = [["path", { d: "M12 3H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2v-7" }], ["path", { d: "M18.375 2.625a1 1 0 0 1 3 3l-9.013 9.014a2 2 0 0 1-.853.505l-2.873.84a.5.5 0 0 1-.62-.62l.84-2.873a2 2 0 0 1 .506-.852z" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-percent.js -var SquarePercent; -var init_square_percent = __esmMin((() => { - SquarePercent = [ - ["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], - ["path", { d: "m15 9-6 6" }], - ["path", { d: "M9 9h.01" }], - ["path", { d: "M15 15h.01" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/square-pi.js var SquarePi; @@ -24535,6 +24680,24 @@ var init_square_pi = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-percent.js +var SquarePercent; +var init_square_percent = __esmMin((() => { + SquarePercent = [ + ["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], + ["path", { d: "m15 9-6 6" }], + ["path", { d: "M9 9h.01" }], + ["path", { d: "M15 15h.01" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-pilcrow.js var SquarePilcrow; @@ -24663,19 +24826,6 @@ var init_square_scissors = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/square-sigma.js -var SquareSigma; -var init_square_sigma = __esmMin((() => { - SquareSigma = [["rect", { - width: "18", - height: "18", - x: "3", - y: "3", - rx: "2" - }], ["path", { d: "M16 8.9V7H8l4 5-4 5h8v-1.9" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/square-slash.js var SquareSlash; @@ -24694,6 +24844,19 @@ var init_square_slash = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/square-sigma.js +var SquareSigma; +var init_square_sigma = __esmMin((() => { + SquareSigma = [["rect", { + width: "18", + height: "18", + x: "3", + y: "3", + rx: "2" + }], ["path", { d: "M16 8.9V7H8l4 5-4 5h8v-1.9" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/square-split-horizontal.js var SquareSplitHorizontal; @@ -24892,20 +25055,6 @@ var init_squares_exclude = __esmMin((() => { SquaresExclude = [["path", { d: "M16 12v2a2 2 0 0 1-2 2H9a1 1 0 0 0-1 1v3a2 2 0 0 0 2 2h10a2 2 0 0 0 2-2V10a2 2 0 0 0-2-2h0" }], ["path", { d: "M4 16a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h10a2 2 0 0 1 2 2v3a1 1 0 0 1-1 1h-5a2 2 0 0 0-2 2v2" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/squares-subtract.js -var SquaresSubtract; -var init_squares_subtract = __esmMin((() => { - SquaresSubtract = [ - ["path", { d: "M10 22a2 2 0 0 1-2-2" }], - ["path", { d: "M16 22h-2" }], - ["path", { d: "M16 4a2 2 0 0 0-2-2H4a2 2 0 0 0-2 2v10a2 2 0 0 0 2 2h3a1 1 0 0 0 1-1v-5a2 2 0 0 1 2-2h5a1 1 0 0 0 1-1z" }], - ["path", { d: "M20 8a2 2 0 0 1 2 2" }], - ["path", { d: "M22 14v2" }], - ["path", { d: "M22 20a2 2 0 0 1-2 2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/squares-intersect.js var SquaresIntersect; @@ -24925,6 +25074,20 @@ var init_squares_intersect = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/squares-subtract.js +var SquaresSubtract; +var init_squares_subtract = __esmMin((() => { + SquaresSubtract = [ + ["path", { d: "M10 22a2 2 0 0 1-2-2" }], + ["path", { d: "M16 22h-2" }], + ["path", { d: "M16 4a2 2 0 0 0-2-2H4a2 2 0 0 0-2 2v10a2 2 0 0 0 2 2h3a1 1 0 0 0 1-1v-5a2 2 0 0 1 2-2h5a1 1 0 0 0 1-1z" }], + ["path", { d: "M20 8a2 2 0 0 1 2 2" }], + ["path", { d: "M22 14v2" }], + ["path", { d: "M22 20a2 2 0 0 1-2 2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/squares-unite.js var SquaresUnite; @@ -24932,6 +25095,13 @@ var init_squares_unite = __esmMin((() => { SquaresUnite = [["path", { d: "M4 16a2 2 0 0 1-2-2V4a2 2 0 0 1 2-2h10a2 2 0 0 1 2 2v3a1 1 0 0 0 1 1h3a2 2 0 0 1 2 2v10a2 2 0 0 1-2 2H10a2 2 0 0 1-2-2v-3a1 1 0 0 0-1-1z" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/squircle.js +var Squircle; +var init_squircle = __esmMin((() => { + Squircle = [["path", { d: "M12 3c7.2 0 9 1.8 9 9s-1.8 9-9 9-9-1.8-9-9 1.8-9 9-9" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/squircle-dashed.js var SquircleDashed; @@ -24961,10 +25131,10 @@ var init_squirrel = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/squircle.js -var Squircle; -var init_squircle = __esmMin((() => { - Squircle = [["path", { d: "M12 3c7.2 0 9 1.8 9 9s-1.8 9-9 9-9-1.8-9-9 1.8-9 9-9" }]]; +//#region node_modules/lucide/dist/esm/icons/star-half.js +var StarHalf; +var init_star_half = __esmMin((() => { + StarHalf = [["path", { d: "M12 18.338a2.1 2.1 0 0 0-.987.244L6.396 21.01a.53.53 0 0 1-.77-.56l.881-5.139a2.12 2.12 0 0 0-.611-1.879L2.16 9.795a.53.53 0 0 1 .294-.906l5.165-.755a2.12 2.12 0 0 0 1.597-1.16l2.309-4.679A.53.53 0 0 1 12 2" }]]; })); //#endregion @@ -24978,13 +25148,6 @@ var init_stamp = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/star-half.js -var StarHalf; -var init_star_half = __esmMin((() => { - StarHalf = [["path", { d: "M12 18.338a2.1 2.1 0 0 0-.987.244L6.396 21.01a.53.53 0 0 1-.77-.56l.881-5.139a2.12 2.12 0 0 0-.611-1.879L2.16 9.795a.53.53 0 0 1 .294-.906l5.165-.755a2.12 2.12 0 0 0 1.597-1.16l2.309-4.679A.53.53 0 0 1 12 2" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/star-off.js var StarOff; @@ -25059,6 +25222,28 @@ var init_sticky_note = __esmMin((() => { StickyNote = [["path", { d: "M21 9a2.4 2.4 0 0 0-.706-1.706l-3.588-3.588A2.4 2.4 0 0 0 15 3H5a2 2 0 0 0-2 2v14a2 2 0 0 0 2 2h14a2 2 0 0 0 2-2z" }], ["path", { d: "M15 3v5a1 1 0 0 0 1 1h5" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/stone.js +var Stone; +var init_stone = __esmMin((() => { + Stone = [ + ["path", { d: "M11.264 2.205A4 4 0 0 0 6.42 4.211l-4 8a4 4 0 0 0 1.359 5.117l6 4a4 4 0 0 0 4.438 0l6-4a4 4 0 0 0 1.576-4.592l-2-6a4 4 0 0 0-2.53-2.53z" }], + ["path", { d: "M11.99 22 14 12l7.822 3.184" }], + ["path", { d: "M14 12 8.47 2.302" }] + ]; +})); + +//#endregion +//#region node_modules/lucide/dist/esm/icons/store.js +var Store$1; +var init_store$1 = __esmMin((() => { + Store$1 = [ + ["path", { d: "M15 21v-5a1 1 0 0 0-1-1h-4a1 1 0 0 0-1 1v5" }], + ["path", { d: "M17.774 10.31a1.12 1.12 0 0 0-1.549 0 2.5 2.5 0 0 1-3.451 0 1.12 1.12 0 0 0-1.548 0 2.5 2.5 0 0 1-3.452 0 1.12 1.12 0 0 0-1.549 0 2.5 2.5 0 0 1-3.77-3.248l2.889-4.184A2 2 0 0 1 7 2h10a2 2 0 0 1 1.653.873l2.895 4.192a2.5 2.5 0 0 1-3.774 3.244" }], + ["path", { d: "M4 10.95V19a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2v-8.05" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/stretch-horizontal.js var StretchHorizontal; @@ -25078,17 +25263,6 @@ var init_stretch_horizontal = __esmMin((() => { }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/store.js -var Store$1; -var init_store$1 = __esmMin((() => { - Store$1 = [ - ["path", { d: "M15 21v-5a1 1 0 0 0-1-1h-4a1 1 0 0 0-1 1v5" }], - ["path", { d: "M17.774 10.31a1.12 1.12 0 0 0-1.549 0 2.5 2.5 0 0 1-3.451 0 1.12 1.12 0 0 0-1.548 0 2.5 2.5 0 0 1-3.452 0 1.12 1.12 0 0 0-1.549 0 2.5 2.5 0 0 1-3.77-3.248l2.889-4.184A2 2 0 0 1 7 2h10a2 2 0 0 1 1.653.873l2.895 4.192a2.5 2.5 0 0 1-3.774 3.244" }], - ["path", { d: "M4 10.95V19a2 2 0 0 0 2 2h12a2 2 0 0 0 2-2v-8.05" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/stretch-vertical.js var StretchVertical; @@ -25135,27 +25309,6 @@ var init_subscript = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/sun-medium.js -var SunMedium; -var init_sun_medium = __esmMin((() => { - SunMedium = [ - ["circle", { - cx: "12", - cy: "12", - r: "4" - }], - ["path", { d: "M12 3v1" }], - ["path", { d: "M12 20v1" }], - ["path", { d: "M3 12h1" }], - ["path", { d: "M20 12h1" }], - ["path", { d: "m18.364 5.636-.707.707" }], - ["path", { d: "m6.343 17.657-.707.707" }], - ["path", { d: "m5.636 5.636.707.707" }], - ["path", { d: "m17.657 17.657.707.707" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/sun-dim.js var SunDim; @@ -25177,6 +25330,40 @@ var init_sun_dim = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/sun-medium.js +var SunMedium; +var init_sun_medium = __esmMin((() => { + SunMedium = [ + ["circle", { + cx: "12", + cy: "12", + r: "4" + }], + ["path", { d: "M12 3v1" }], + ["path", { d: "M12 20v1" }], + ["path", { d: "M3 12h1" }], + ["path", { d: "M20 12h1" }], + ["path", { d: "m18.364 5.636-.707.707" }], + ["path", { d: "m6.343 17.657-.707.707" }], + ["path", { d: "m5.636 5.636.707.707" }], + ["path", { d: "m17.657 17.657.707.707" }] + ]; +})); + +//#endregion +//#region node_modules/lucide/dist/esm/icons/sun-moon.js +var SunMoon; +var init_sun_moon = __esmMin((() => { + SunMoon = [ + ["path", { d: "M12 2v2" }], + ["path", { d: "M14.837 16.385a6 6 0 1 1-7.223-7.222c.624-.147.97.66.715 1.248a4 4 0 0 0 5.26 5.259c.589-.255 1.396.09 1.248.715" }], + ["path", { d: "M16 12a4 4 0 0 0-4-4" }], + ["path", { d: "m19 5-1.256 1.256" }], + ["path", { d: "M20 12h2" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/sun-snow.js var SunSnow; @@ -25196,19 +25383,6 @@ var init_sun_snow = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/sun-moon.js -var SunMoon; -var init_sun_moon = __esmMin((() => { - SunMoon = [ - ["path", { d: "M12 2v2" }], - ["path", { d: "M14.837 16.385a6 6 0 1 1-7.223-7.222c.624-.147.97.66.715 1.248a4 4 0 0 0 5.26 5.259c.589-.255 1.396.09 1.248.715" }], - ["path", { d: "M16 12a4 4 0 0 0-4-4" }], - ["path", { d: "m19 5-1.256 1.256" }], - ["path", { d: "M20 12h2" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/sun.js var Sun; @@ -25553,6 +25727,18 @@ var init_tablet = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/tag.js +var Tag; +var init_tag = __esmMin((() => { + Tag = [["path", { d: "M12.586 2.586A2 2 0 0 0 11.172 2H4a2 2 0 0 0-2 2v7.172a2 2 0 0 0 .586 1.414l8.704 8.704a2.426 2.426 0 0 0 3.42 0l6.58-6.58a2.426 2.426 0 0 0 0-3.42z" }], ["circle", { + cx: "7.5", + cy: "7.5", + r: ".5", + fill: "currentColor" + }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/tablets.js var Tablets; @@ -25573,18 +25759,6 @@ var init_tablets = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/tag.js -var Tag; -var init_tag = __esmMin((() => { - Tag = [["path", { d: "M12.586 2.586A2 2 0 0 0 11.172 2H4a2 2 0 0 0-2 2v7.172a2 2 0 0 0 .586 1.414l8.704 8.704a2.426 2.426 0 0 0 3.42 0l6.58-6.58a2.426 2.426 0 0 0 0-3.42z" }], ["circle", { - cx: "7.5", - cy: "7.5", - r: ".5", - fill: "currentColor" - }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/tags.js var Tags; @@ -25798,17 +25972,6 @@ var init_text_align_center = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/text-align-end.js -var TextAlignEnd; -var init_text_align_end = __esmMin((() => { - TextAlignEnd = [ - ["path", { d: "M21 5H3" }], - ["path", { d: "M21 12H9" }], - ["path", { d: "M21 19H7" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/text-align-justify.js var TextAlignJustify; @@ -25821,13 +25984,13 @@ var init_text_align_justify = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/text-align-start.js -var TextAlignStart; -var init_text_align_start = __esmMin((() => { - TextAlignStart = [ +//#region node_modules/lucide/dist/esm/icons/text-align-end.js +var TextAlignEnd; +var init_text_align_end = __esmMin((() => { + TextAlignEnd = [ ["path", { d: "M21 5H3" }], - ["path", { d: "M15 12H3" }], - ["path", { d: "M17 19H3" }] + ["path", { d: "M21 12H9" }], + ["path", { d: "M21 19H7" }] ]; })); @@ -25844,6 +26007,17 @@ var init_text_cursor_input = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/text-align-start.js +var TextAlignStart; +var init_text_align_start = __esmMin((() => { + TextAlignStart = [ + ["path", { d: "M21 5H3" }], + ["path", { d: "M15 12H3" }], + ["path", { d: "M17 19H3" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/text-cursor.js var TextCursor; @@ -25990,14 +26164,14 @@ var init_thermometer = __esmMin((() => { //#region node_modules/lucide/dist/esm/icons/thumbs-down.js var ThumbsDown; var init_thumbs_down = __esmMin((() => { - ThumbsDown = [["path", { d: "M17 14V2" }], ["path", { d: "M9 18.12 10 14H4.17a2 2 0 0 1-1.92-2.56l2.33-8A2 2 0 0 1 6.5 2H20a2 2 0 0 1 2 2v8a2 2 0 0 1-2 2h-2.76a2 2 0 0 0-1.79 1.11L12 22a3.13 3.13 0 0 1-3-3.88Z" }]]; + ThumbsDown = [["path", { d: "M9 18.12 10 14H4.17a2 2 0 0 1-1.92-2.56l2.33-8A2 2 0 0 1 6.5 2H20a2 2 0 0 1 2 2v8a2 2 0 0 1-2 2h-2.76a2 2 0 0 0-1.79 1.11L12 22a3.13 3.13 0 0 1-3-3.88Z" }], ["path", { d: "M17 14V2" }]]; })); //#endregion //#region node_modules/lucide/dist/esm/icons/thumbs-up.js var ThumbsUp; var init_thumbs_up = __esmMin((() => { - ThumbsUp = [["path", { d: "M7 10v12" }], ["path", { d: "M15 5.88 14 10h5.83a2 2 0 0 1 1.92 2.56l-2.33 8A2 2 0 0 1 17.5 22H4a2 2 0 0 1-2-2v-8a2 2 0 0 1 2-2h2.76a2 2 0 0 0 1.79-1.11L12 2a3.13 3.13 0 0 1 3 3.88Z" }]]; + ThumbsUp = [["path", { d: "M15 5.88 14 10h5.83a2 2 0 0 1 1.92 2.56l-2.33 8A2 2 0 0 1 17.5 22H4a2 2 0 0 1-2-2v-8a2 2 0 0 1 2-2h2.76a2 2 0 0 0 1.79-1.11L12 2a3.13 3.13 0 0 1 3 3.88Z" }], ["path", { d: "M7 10v12" }]]; })); //#endregion @@ -26074,7 +26248,7 @@ var init_tickets_plane = __esmMin((() => { TicketsPlane = [ ["path", { d: "M10.5 17h1.227a2 2 0 0 0 1.345-.52L18 12" }], ["path", { d: "m12 13.5 3.75.5" }], - ["path", { d: "m4.5 8 10.58-5.06a1 1 0 0 1 1.342.488L18.5 8" }], + ["path", { d: "m3.173 8.18 11-5a2 2 0 0 1 2.647.993L18.56 8" }], ["path", { d: "M6 10V8" }], ["path", { d: "M6 14v1" }], ["path", { d: "M6 19v2" }], @@ -26093,7 +26267,7 @@ var init_tickets_plane = __esmMin((() => { var Tickets; var init_tickets = __esmMin((() => { Tickets = [ - ["path", { d: "m4.5 8 10.58-5.06a1 1 0 0 1 1.342.488L18.5 8" }], + ["path", { d: "m3.173 8.18 11-5a2 2 0 0 1 2.647.993L18.56 8" }], ["path", { d: "M6 10V8" }], ["path", { d: "M6 14v1" }], ["path", { d: "M6 19v2" }], @@ -26158,11 +26332,11 @@ var init_timer = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/toggle-left.js -var ToggleLeft; -var init_toggle_left = __esmMin((() => { - ToggleLeft = [["circle", { - cx: "9", +//#region node_modules/lucide/dist/esm/icons/toggle-right.js +var ToggleRight; +var init_toggle_right = __esmMin((() => { + ToggleRight = [["circle", { + cx: "15", cy: "12", r: "3" }], ["rect", { @@ -26175,11 +26349,11 @@ var init_toggle_left = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/toggle-right.js -var ToggleRight; -var init_toggle_right = __esmMin((() => { - ToggleRight = [["circle", { - cx: "15", +//#region node_modules/lucide/dist/esm/icons/toggle-left.js +var ToggleLeft; +var init_toggle_left = __esmMin((() => { + ToggleLeft = [["circle", { + cx: "9", cy: "12", r: "3" }], ["rect", { @@ -26198,18 +26372,6 @@ var init_toilet = __esmMin((() => { Toilet = [["path", { d: "M7 12h13a1 1 0 0 1 1 1 5 5 0 0 1-5 5h-.598a.5.5 0 0 0-.424.765l1.544 2.47a.5.5 0 0 1-.424.765H5.402a.5.5 0 0 1-.424-.765L7 18" }], ["path", { d: "M8 18a5 5 0 0 1-5-5V4a2 2 0 0 1 2-2h8a2 2 0 0 1 2 2v8" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/tool-case.js -var ToolCase; -var init_tool_case = __esmMin((() => { - ToolCase = [ - ["path", { d: "M10 15h4" }], - ["path", { d: "m14.817 10.995-.971-1.45 1.034-1.232a2 2 0 0 0-2.025-3.238l-1.82.364L9.91 3.885a2 2 0 0 0-3.625.748L6.141 6.55l-1.725.426a2 2 0 0 0-.19 3.756l.657.27" }], - ["path", { d: "m18.822 10.995 2.26-5.38a1 1 0 0 0-.557-1.318L16.954 2.9a1 1 0 0 0-1.281.533l-.924 2.122" }], - ["path", { d: "M4 12.006A1 1 0 0 1 4.994 11H19a1 1 0 0 1 1 1v7a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2z" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/tornado.js var Tornado; @@ -26224,16 +26386,14 @@ var init_tornado = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/touchpad-off.js -var TouchpadOff; -var init_touchpad_off = __esmMin((() => { - TouchpadOff = [ - ["path", { d: "M12 20v-6" }], - ["path", { d: "M19.656 14H22" }], - ["path", { d: "M2 14h12" }], - ["path", { d: "m2 2 20 20" }], - ["path", { d: "M20 20H4a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2" }], - ["path", { d: "M9.656 4H20a2 2 0 0 1 2 2v10.344" }] +//#region node_modules/lucide/dist/esm/icons/tool-case.js +var ToolCase; +var init_tool_case = __esmMin((() => { + ToolCase = [ + ["path", { d: "M10 15h4" }], + ["path", { d: "m14.817 10.995-.971-1.45 1.034-1.232a2 2 0 0 0-2.025-3.238l-1.82.364L9.91 3.885a2 2 0 0 0-3.625.748L6.141 6.55l-1.725.426a2 2 0 0 0-.19 3.756l.657.27" }], + ["path", { d: "m18.822 10.995 2.26-5.38a1 1 0 0 0-.557-1.318L16.954 2.9a1 1 0 0 0-1.281.533l-.924 2.122" }], + ["path", { d: "M4 12.006A1 1 0 0 1 4.994 11H19a1 1 0 0 1 1 1v7a2 2 0 0 1-2 2H6a2 2 0 0 1-2-2z" }] ]; })); @@ -26254,6 +26414,20 @@ var init_torus = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/touchpad-off.js +var TouchpadOff; +var init_touchpad_off = __esmMin((() => { + TouchpadOff = [ + ["path", { d: "M12 20v-6" }], + ["path", { d: "M19.656 14H22" }], + ["path", { d: "M2 14h12" }], + ["path", { d: "m2 2 20 20" }], + ["path", { d: "M20 20H4a2 2 0 0 1-2-2V6a2 2 0 0 1 2-2" }], + ["path", { d: "M9.656 4H20a2 2 0 0 1 2 2v10.344" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/touchpad.js var Touchpad; @@ -26534,13 +26708,6 @@ var init_trending_up_down = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/trending-up.js -var TrendingUp; -var init_trending_up = __esmMin((() => { - TrendingUp = [["path", { d: "M16 7h6v6" }], ["path", { d: "m22 7-8.5 8.5-5-5L2 17" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/triangle-alert.js var TriangleAlert; @@ -26552,6 +26719,13 @@ var init_triangle_alert = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/trending-up.js +var TrendingUp; +var init_trending_up = __esmMin((() => { + TrendingUp = [["path", { d: "M16 7h6v6" }], ["path", { d: "m22 7-8.5 8.5-5-5L2 17" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/triangle-dashed.js var TriangleDashed; @@ -26576,20 +26750,6 @@ var init_triangle_right = __esmMin((() => { TriangleRight = [["path", { d: "M22 18a2 2 0 0 1-2 2H3c-1.1 0-1.3-.6-.4-1.3L20.4 4.3c.9-.7 1.6-.4 1.6.7Z" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/trophy.js -var Trophy; -var init_trophy = __esmMin((() => { - Trophy = [ - ["path", { d: "M10 14.66v1.626a2 2 0 0 1-.976 1.696A5 5 0 0 0 7 21.978" }], - ["path", { d: "M14 14.66v1.626a2 2 0 0 0 .976 1.696A5 5 0 0 1 17 21.978" }], - ["path", { d: "M18 9h1.5a1 1 0 0 0 0-5H18" }], - ["path", { d: "M4 22h16" }], - ["path", { d: "M6 9a6 6 0 0 0 12 0V3a1 1 0 0 0-1-1H7a1 1 0 0 0-1 1z" }], - ["path", { d: "M6 9H4.5a1 1 0 0 1 0-5H6" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/triangle.js var Triangle; @@ -26620,6 +26780,20 @@ var init_truck_electric = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/trophy.js +var Trophy; +var init_trophy = __esmMin((() => { + Trophy = [ + ["path", { d: "M10 14.66v1.626a2 2 0 0 1-.976 1.696A5 5 0 0 0 7 21.978" }], + ["path", { d: "M14 14.66v1.626a2 2 0 0 0 .976 1.696A5 5 0 0 1 17 21.978" }], + ["path", { d: "M18 9h1.5a1 1 0 0 0 0-5H18" }], + ["path", { d: "M4 22h16" }], + ["path", { d: "M6 9a6 6 0 0 0 12 0V3a1 1 0 0 0-1-1H7a1 1 0 0 0-1 1z" }], + ["path", { d: "M6 9H4.5a1 1 0 0 1 0-5H6" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/truck.js var Truck; @@ -26641,17 +26815,6 @@ var init_truck = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/turkish-lira.js -var TurkishLira; -var init_turkish_lira = __esmMin((() => { - TurkishLira = [ - ["path", { d: "M15 4 5 9" }], - ["path", { d: "m15 8.5-10 5" }], - ["path", { d: "M18 12a9 9 0 0 1-9 9V3" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/turntable.js var Turntable; @@ -26674,6 +26837,17 @@ var init_turntable = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/turkish-lira.js +var TurkishLira; +var init_turkish_lira = __esmMin((() => { + TurkishLira = [ + ["path", { d: "M15 4 5 9" }], + ["path", { d: "m15 8.5-10 5" }], + ["path", { d: "M18 12a9 9 0 0 1-9 9V3" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/turtle.js var Turtle; @@ -26826,22 +27000,6 @@ var init_undo = __esmMin((() => { Undo = [["path", { d: "M3 7v6h6" }], ["path", { d: "M21 17a9 9 0 0 0-9-9 9 9 0 0 0-6 2.3L3 13" }]]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/unfold-horizontal.js -var UnfoldHorizontal; -var init_unfold_horizontal = __esmMin((() => { - UnfoldHorizontal = [ - ["path", { d: "M16 12h6" }], - ["path", { d: "M8 12H2" }], - ["path", { d: "M12 2v2" }], - ["path", { d: "M12 8v2" }], - ["path", { d: "M12 14v2" }], - ["path", { d: "M12 20v2" }], - ["path", { d: "m19 15 3-3-3-3" }], - ["path", { d: "m5 9-3 3 3 3" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/unfold-vertical.js var UnfoldVertical; @@ -26858,6 +27016,22 @@ var init_unfold_vertical = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/unfold-horizontal.js +var UnfoldHorizontal; +var init_unfold_horizontal = __esmMin((() => { + UnfoldHorizontal = [ + ["path", { d: "M16 12h6" }], + ["path", { d: "M8 12H2" }], + ["path", { d: "M12 2v2" }], + ["path", { d: "M12 8v2" }], + ["path", { d: "M12 14v2" }], + ["path", { d: "M12 20v2" }], + ["path", { d: "m19 15 3-3-3-3" }], + ["path", { d: "m5 9-3 3 3 3" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/ungroup.js var Ungroup; @@ -26937,17 +27111,6 @@ var init_unlink = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/upload.js -var Upload; -var init_upload = __esmMin((() => { - Upload = [ - ["path", { d: "M12 3v12" }], - ["path", { d: "m17 8-5-5-5 5" }], - ["path", { d: "M21 15v4a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-4" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/unplug.js var Unplug; @@ -26962,6 +27125,17 @@ var init_unplug = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/upload.js +var Upload; +var init_upload = __esmMin((() => { + Upload = [ + ["path", { d: "M12 3v12" }], + ["path", { d: "m17 8-5-5-5 5" }], + ["path", { d: "M21 15v4a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-4" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/usb.js var Usb; @@ -26985,6 +27159,21 @@ var init_usb = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/user-check.js +var UserCheck; +var init_user_check = __esmMin((() => { + UserCheck = [ + ["path", { d: "m16 11 2 2 4-4" }], + ["path", { d: "M16 21v-2a4 4 0 0 0-4-4H6a4 4 0 0 0-4 4v2" }], + ["circle", { + cx: "9", + cy: "7", + r: "4" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/user-cog.js var UserCog; @@ -27012,21 +27201,6 @@ var init_user_cog = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/user-check.js -var UserCheck; -var init_user_check = __esmMin((() => { - UserCheck = [ - ["path", { d: "m16 11 2 2 4-4" }], - ["path", { d: "M16 21v-2a4 4 0 0 0-4-4H6a4 4 0 0 0-4 4v2" }], - ["circle", { - cx: "9", - cy: "7", - r: "4" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/user-lock.js var UserLock; @@ -27245,6 +27419,21 @@ var init_user_round = __esmMin((() => { }], ["path", { d: "M20 21a8 8 0 0 0-16 0" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/user-star.js +var UserStar; +var init_user_star = __esmMin((() => { + UserStar = [ + ["path", { d: "M16.051 12.616a1 1 0 0 1 1.909.024l.737 1.452a1 1 0 0 0 .737.535l1.634.256a1 1 0 0 1 .588 1.806l-1.172 1.168a1 1 0 0 0-.282.866l.259 1.613a1 1 0 0 1-1.541 1.134l-1.465-.75a1 1 0 0 0-.912 0l-1.465.75a1 1 0 0 1-1.539-1.133l.258-1.613a1 1 0 0 0-.282-.866l-1.156-1.153a1 1 0 0 1 .572-1.822l1.633-.256a1 1 0 0 0 .737-.535z" }], + ["path", { d: "M8 15H7a4 4 0 0 0-4 4v2" }], + ["circle", { + cx: "10", + cy: "7", + r: "4" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/user-search.js var UserSearch; @@ -27265,21 +27454,6 @@ var init_user_search = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/user-star.js -var UserStar; -var init_user_star = __esmMin((() => { - UserStar = [ - ["path", { d: "M16.051 12.616a1 1 0 0 1 1.909.024l.737 1.452a1 1 0 0 0 .737.535l1.634.256a1 1 0 0 1 .588 1.806l-1.172 1.168a1 1 0 0 0-.282.866l.259 1.613a1 1 0 0 1-1.541 1.134l-1.465-.75a1 1 0 0 0-.912 0l-1.465.75a1 1 0 0 1-1.539-1.133l.258-1.613a1 1 0 0 0-.282-.866l-1.156-1.153a1 1 0 0 1 .572-1.822l1.633-.256a1 1 0 0 0 .737-.535z" }], - ["path", { d: "M8 15H7a4 4 0 0 0-4 4v2" }], - ["circle", { - cx: "10", - cy: "7", - r: "4" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/user-x.js var UserX; @@ -27407,6 +27581,28 @@ var init_van = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/variable.js +var Variable; +var init_variable = __esmMin((() => { + Variable = [ + ["path", { d: "M8 21s-4-3-4-9 4-9 4-9" }], + ["path", { d: "M16 3s4 3 4 9-4 9-4 9" }], + ["line", { + x1: "15", + x2: "9", + y1: "9", + y2: "15" + }], + ["line", { + x1: "9", + x2: "15", + y1: "9", + y2: "15" + }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/vault.js var Vault; @@ -27455,28 +27651,6 @@ var init_vault = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/variable.js -var Variable; -var init_variable = __esmMin((() => { - Variable = [ - ["path", { d: "M8 21s-4-3-4-9 4-9 4-9" }], - ["path", { d: "M16 3s4 3 4 9-4 9-4 9" }], - ["line", { - x1: "15", - x2: "9", - y1: "9", - y2: "15" - }], - ["line", { - x1: "9", - x2: "15", - y1: "9", - y2: "15" - }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/vector-square.js var VectorSquare; @@ -27630,6 +27804,22 @@ var init_video = __esmMin((() => { }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/view.js +var View; +var init_view = __esmMin((() => { + View = [ + ["path", { d: "M21 17v2a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-2" }], + ["path", { d: "M21 7V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v2" }], + ["circle", { + cx: "12", + cy: "12", + r: "1" + }], + ["path", { d: "M18.944 12.33a1 1 0 0 0 0-.66 7.5 7.5 0 0 0-13.888 0 1 1 0 0 0 0 .66 7.5 7.5 0 0 0 13.888 0" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/videotape.js var Videotape; @@ -27657,22 +27847,6 @@ var init_videotape = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/view.js -var View; -var init_view = __esmMin((() => { - View = [ - ["path", { d: "M21 17v2a2 2 0 0 1-2 2H5a2 2 0 0 1-2-2v-2" }], - ["path", { d: "M21 7V5a2 2 0 0 0-2-2H5a2 2 0 0 0-2 2v2" }], - ["circle", { - cx: "12", - cy: "12", - r: "1" - }], - ["path", { d: "M18.944 12.33a1 1 0 0 0 0-.66 7.5 7.5 0 0 0-13.888 0 1 1 0 0 0 0 .66 7.5 7.5 0 0 0 13.888 0" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/volleyball.js var Volleyball; @@ -28037,17 +28211,6 @@ var init_webhook_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/webhook.js -var Webhook; -var init_webhook = __esmMin((() => { - Webhook = [ - ["path", { d: "M18 16.98h-5.99c-1.1 0-1.95.94-2.48 1.9A4 4 0 0 1 2 17c.01-.7.2-1.4.57-2" }], - ["path", { d: "m6 17 3.13-5.78c.53-.97.1-2.18-.5-3.1a4 4 0 1 1 6.89-4.06" }], - ["path", { d: "m12 6 3.13 5.73C15.66 12.7 16.9 13 18 13a4 4 0 0 1 0 8" }] - ]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/weight-tilde.js var WeightTilde; @@ -28063,6 +28226,17 @@ var init_weight_tilde = __esmMin((() => { ]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/webhook.js +var Webhook; +var init_webhook = __esmMin((() => { + Webhook = [ + ["path", { d: "M18 16.98h-5.99c-1.1 0-1.95.94-2.48 1.9A4 4 0 0 1 2 17c.01-.7.2-1.4.57-2" }], + ["path", { d: "m6 17 3.13-5.78c.53-.97.1-2.18-.5-3.1a4 4 0 1 1 6.89-4.06" }], + ["path", { d: "m12 6 3.13 5.73C15.66 12.7 16.9 13 18 13a4 4 0 0 1 0 8" }] + ]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/weight.js var Weight; @@ -28331,6 +28505,13 @@ var init_wrench = __esmMin((() => { Wrench = [["path", { d: "M14.7 6.3a1 1 0 0 0 0 1.4l1.6 1.6a1 1 0 0 0 1.4 0l3.106-3.105c.32-.322.863-.22.983.218a6 6 0 0 1-8.259 7.057l-7.91 7.91a1 1 0 0 1-2.999-3l7.91-7.91a6 6 0 0 1 7.057-8.259c.438.12.54.662.219.984z" }]]; })); +//#endregion +//#region node_modules/lucide/dist/esm/icons/x.js +var X; +var init_x = __esmMin((() => { + X = [["path", { d: "M18 6 6 18" }], ["path", { d: "m6 6 12 12" }]]; +})); + //#endregion //#region node_modules/lucide/dist/esm/icons/youtube.js var Youtube; @@ -28339,10 +28520,10 @@ var init_youtube = __esmMin((() => { })); //#endregion -//#region node_modules/lucide/dist/esm/icons/x.js -var X; -var init_x = __esmMin((() => { - X = [["path", { d: "M18 6 6 18" }], ["path", { d: "m6 6 12 12" }]]; +//#region node_modules/lucide/dist/esm/icons/zap.js +var Zap; +var init_zap = __esmMin((() => { + Zap = [["path", { d: "M4 14a1 1 0 0 1-.78-1.63l9.9-10.2a.5.5 0 0 1 .86.46l-1.92 6.02A1 1 0 0 0 13 10h7a1 1 0 0 1 .78 1.63l-9.9 10.2a.5.5 0 0 1-.86-.46l1.92-6.02A1 1 0 0 0 11 14z" }]]; })); //#endregion @@ -28357,13 +28538,6 @@ var init_zap_off = __esmMin((() => { ]; })); -//#endregion -//#region node_modules/lucide/dist/esm/icons/zap.js -var Zap; -var init_zap = __esmMin((() => { - Zap = [["path", { d: "M4 14a1 1 0 0 1-.78-1.63l9.9-10.2a.5.5 0 0 1 .86.46l-1.92 6.02A1 1 0 0 0 13 10h7a1 1 0 0 1 .78 1.63l-9.9 10.2a.5.5 0 0 1-.86-.46l1.92-6.02A1 1 0 0 0 11 14z" }]]; -})); - //#endregion //#region node_modules/lucide/dist/esm/icons/zoom-in.js var ZoomIn; @@ -28587,6 +28761,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ BadgeTurkishLira: () => BadgeTurkishLira, BadgeX: () => BadgeX, BaggageClaim: () => BaggageClaim, + Balloon: () => Balloon, Ban: () => Ban, Banana: () => Banana, Bandage: () => Bandage, @@ -28751,6 +28926,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ CandyCane: () => CandyCane, CandyOff: () => CandyOff, Cannabis: () => Cannabis, + CannabisOff: () => CannabisOff, Captions: () => Captions, CaptionsOff: () => CaptionsOff, Car: () => Car, @@ -28866,6 +29042,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ CircleParkingOff: () => CircleParkingOff, CirclePause: () => CirclePause, CirclePercent: () => CirclePercent, + CirclePile: () => CirclePile, CirclePlay: () => CirclePlay, CirclePlus: () => CirclePlus, CirclePoundSterling: () => CirclePoundSterling, @@ -28919,6 +29096,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ ClosedCaption: () => ClosedCaption, Cloud: () => Cloud, CloudAlert: () => CloudAlert, + CloudBackup: () => CloudBackup, CloudCheck: () => CloudCheck, CloudCog: () => CloudCog, CloudDownload: () => CloudDownload, @@ -28934,6 +29112,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ CloudSnow: () => CloudSnow, CloudSun: () => CloudSun, CloudSunRain: () => CloudSunRain, + CloudSync: () => CloudSync, CloudUpload: () => CloudUpload, Cloudy: () => Cloudy, Clover: () => Clover, @@ -29175,6 +29354,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ Fish: () => Fish, FishOff: () => FishOff, FishSymbol: () => FishSymbol, + FishingHook: () => FishingHook, Flag: () => Flag, FlagOff: () => FlagOff, FlagTriangleLeft: () => FlagTriangleLeft, @@ -29327,6 +29507,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ Hash: () => Hash, HatGlasses: () => HatGlasses, Haze: () => Haze, + Hd: () => Hd, HdmiPort: () => HdmiPort, Heading: () => Heading, Heading1: () => Heading1, @@ -29423,6 +29604,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ Layers: () => Layers, Layers2: () => Layers2, Layers3: () => Layers, + LayersPlus: () => LayersPlus, Layout: () => PanelsTopLeft, LayoutDashboard: () => LayoutDashboard, LayoutGrid: () => LayoutGrid, @@ -29882,6 +30064,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ Scroll: () => Scroll, ScrollText: () => ScrollText, Search: () => Search, + SearchAlert: () => SearchAlert, SearchCheck: () => SearchCheck, SearchCode: () => SearchCode, SearchSlash: () => SearchSlash, @@ -30068,6 +30251,7 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ Stethoscope: () => Stethoscope, Sticker: () => Sticker, StickyNote: () => StickyNote, + Stone: () => Stone, StopCircle: () => CircleStop, Store: () => Store$1, StretchHorizontal: () => StretchHorizontal, @@ -30323,8 +30507,8 @@ var iconsAndAliases_exports = /* @__PURE__ */ __export({ }); var init_iconsAndAliases = __esmMin((() => { init_a_arrow_down(); - init_a_arrow_up(); init_a_large_small(); + init_a_arrow_up(); init_accessibility(); init_activity(); init_air_vent(); @@ -30342,11 +30526,11 @@ var init_iconsAndAliases = __esmMin((() => { init_align_end_vertical(); init_align_horizontal_distribute_center(); init_align_horizontal_distribute_end(); - init_align_horizontal_justify_center(); init_align_horizontal_distribute_start(); + init_align_horizontal_justify_center(); init_align_horizontal_justify_end(); - init_align_horizontal_space_around(); init_align_horizontal_justify_start(); + init_align_horizontal_space_around(); init_align_horizontal_space_between(); init_align_start_horizontal(); init_align_start_vertical(); @@ -30360,8 +30544,8 @@ var init_iconsAndAliases = __esmMin((() => { init_align_vertical_space_between(); init_ambulance(); init_ampersand(); - init_ampersands(); init_amphora(); + init_ampersands(); init_anchor(); init_angry(); init_annoyed(); @@ -30369,13 +30553,13 @@ var init_iconsAndAliases = __esmMin((() => { init_anvil(); init_aperture(); init_app_window_mac(); - init_app_window(); init_apple(); + init_app_window(); init_archive_restore(); init_archive_x(); init_archive(); - init_arrow_big_down_dash(); init_armchair(); + init_arrow_big_down_dash(); init_arrow_big_down(); init_arrow_big_left_dash(); init_arrow_big_left(); @@ -30393,10 +30577,10 @@ var init_iconsAndAliases = __esmMin((() => { init_arrow_down_to_dot(); init_arrow_down_to_line(); init_arrow_down_up(); - init_arrow_down_z_a(); init_arrow_down_wide_narrow(); - init_arrow_down(); + init_arrow_down_z_a(); init_arrow_left_from_line(); + init_arrow_down(); init_arrow_left_right(); init_arrow_left_to_line(); init_arrow_left(); @@ -30417,10 +30601,10 @@ var init_iconsAndAliases = __esmMin((() => { init_arrow_up_wide_narrow(); init_arrow_up_z_a(); init_arrow_up(); - init_arrows_up_from_line(); init_asterisk(); - init_at_sign(); + init_arrows_up_from_line(); init_atom(); + init_at_sign(); init_audio_lines(); init_audio_waveform(); init_award(); @@ -30428,13 +30612,13 @@ var init_iconsAndAliases = __esmMin((() => { init_axis_3d(); init_baby(); init_backpack(); - init_badge_cent(); init_badge_alert(); + init_badge_cent(); init_badge_check(); init_badge_dollar_sign(); init_badge_euro(); - init_badge_info(); init_badge_indian_rupee(); + init_badge_info(); init_badge_japanese_yen(); init_badge_minus(); init_badge_percent(); @@ -30448,6 +30632,7 @@ var init_iconsAndAliases = __esmMin((() => { init_badge(); init_baggage_claim(); init_ban(); + init_balloon(); init_banana(); init_bandage(); init_banknote_arrow_down(); @@ -30470,8 +30655,8 @@ var init_iconsAndAliases = __esmMin((() => { init_bean(); init_bed_double(); init_bed_single(); - init_bed(); init_beef(); + init_bed(); init_beer_off(); init_beer(); init_bell_dot(); @@ -30487,13 +30672,13 @@ var init_iconsAndAliases = __esmMin((() => { init_between_vertical_start(); init_biceps_flexed(); init_bike(); - init_binoculars(); init_binary(); + init_binoculars(); init_biohazard(); init_bird(); + init_birdhouse(); init_bitcoin(); init_blend(); - init_birdhouse(); init_blinds(); init_blocks(); init_bluetooth_connected(); @@ -30533,8 +30718,8 @@ var init_iconsAndAliases = __esmMin((() => { init_bookmark_check(); init_bookmark_minus(); init_bookmark_plus(); - init_bookmark_x(); init_bookmark(); + init_bookmark_x(); init_boom_box(); init_bot_message_square(); init_bot_off(); @@ -30554,17 +30739,17 @@ var init_iconsAndAliases = __esmMin((() => { init_briefcase_business(); init_briefcase_conveyor_belt(); init_briefcase_medical(); - init_briefcase(); init_bring_to_front(); + init_briefcase(); init_brush_cleaning(); init_brush(); - init_bubbles(); init_bug_off(); + init_bubbles(); init_bug_play(); init_bug(); init_building_2(); - init_building(); init_bus_front(); + init_building(); init_bus(); init_cable_car(); init_cable(); @@ -30579,10 +30764,10 @@ var init_iconsAndAliases = __esmMin((() => { init_calendar_clock(); init_calendar_cog(); init_calendar_days(); - init_calendar_fold(); init_calendar_heart(); - init_calendar_minus(); + init_calendar_fold(); init_calendar_minus_2(); + init_calendar_minus(); init_calendar_off(); init_calendar_plus_2(); init_calendar_plus(); @@ -30597,21 +30782,22 @@ var init_iconsAndAliases = __esmMin((() => { init_camera(); init_candy_cane(); init_candy_off(); - init_cannabis(); - init_captions_off(); init_candy(); + init_cannabis_off(); + init_cannabis(); init_captions(); + init_captions_off(); init_car_front(); init_car_taxi_front(); - init_car(); init_caravan(); - init_card_sim(); + init_car(); init_carrot(); + init_card_sim(); init_case_lower(); init_case_sensitive(); init_case_upper(); - init_cassette_tape(); init_cast(); + init_cassette_tape(); init_castle(); init_cat(); init_cctv(); @@ -30623,8 +30809,8 @@ var init_iconsAndAliases = __esmMin((() => { init_chart_bar(); init_chart_candlestick(); init_chart_column_big(); - init_chart_column_increasing(); init_chart_column_decreasing(); + init_chart_column_increasing(); init_chart_column_stacked(); init_chart_column(); init_chart_gantt(); @@ -30642,14 +30828,14 @@ var init_iconsAndAliases = __esmMin((() => { init_check_line(); init_check(); init_chef_hat(); - init_cherry(); init_chess_bishop(); + init_cherry(); init_chess_king(); init_chess_knight(); init_chess_pawn(); init_chess_queen(); - init_chess_rook(); init_chevron_down(); + init_chess_rook(); init_chevron_first(); init_chevron_last(); init_chevron_left(); @@ -30663,30 +30849,30 @@ var init_iconsAndAliases = __esmMin((() => { init_chevrons_right_left(); init_chevrons_right(); init_chevrons_up_down(); - init_chevrons_up(); init_chromium(); init_church(); + init_chevrons_up(); init_cigarette_off(); init_cigarette(); init_circle_alert(); init_circle_arrow_down(); init_circle_arrow_left(); - init_circle_arrow_out_down_left(); init_circle_arrow_out_down_right(); + init_circle_arrow_out_down_left(); init_circle_arrow_out_up_left(); init_circle_arrow_out_up_right(); init_circle_arrow_right(); - init_circle_arrow_up(); init_circle_check_big(); + init_circle_arrow_up(); init_circle_check(); init_circle_chevron_down(); init_circle_chevron_left(); - init_circle_chevron_right(); init_circle_chevron_up(); + init_circle_chevron_right(); init_circle_dashed(); init_circle_divide(); - init_circle_dollar_sign(); init_circle_dot_dashed(); + init_circle_dollar_sign(); init_circle_dot(); init_circle_ellipsis(); init_circle_equal(); @@ -30699,9 +30885,10 @@ var init_iconsAndAliases = __esmMin((() => { init_circle_parking(); init_circle_pause(); init_circle_percent(); + init_circle_pile(); init_circle_play(); - init_circle_plus(); init_circle_pound_sterling(); + init_circle_plus(); init_circle_power(); init_circle_question_mark(); init_circle_slash_2(); @@ -30709,8 +30896,8 @@ var init_iconsAndAliases = __esmMin((() => { init_circle_small(); init_circle_star(); init_circle_stop(); - init_circle_user_round(); init_circle_user(); + init_circle_user_round(); init_circle_x(); init_circle(); init_circuit_board(); @@ -30719,21 +30906,21 @@ var init_iconsAndAliases = __esmMin((() => { init_clipboard_check(); init_clipboard_clock(); init_clipboard_copy(); + init_clipboard_minus(); init_clipboard_list(); init_clipboard_paste(); - init_clipboard_minus(); init_clipboard_pen_line(); init_clipboard_pen(); init_clipboard_plus(); init_clipboard_type(); - init_clipboard(); init_clipboard_x(); + init_clipboard(); init_clock_1(); init_clock_10(); + init_clock_11(); init_clock_12(); init_clock_2(); init_clock_3(); - init_clock_11(); init_clock_4(); init_clock_5(); init_clock_6(); @@ -30747,11 +30934,12 @@ var init_iconsAndAliases = __esmMin((() => { init_clock_fading(); init_clock_plus(); init_clock(); - init_closed_caption(); init_cloud_alert(); + init_closed_caption(); init_cloud_check(); - init_cloud_download(); + init_cloud_backup(); init_cloud_cog(); + init_cloud_download(); init_cloud_drizzle(); init_cloud_fog(); init_cloud_hail(); @@ -30761,12 +30949,13 @@ var init_iconsAndAliases = __esmMin((() => { init_cloud_off(); init_cloud_rain_wind(); init_cloud_rain(); - init_cloud_snow(); init_cloud_sun_rain(); + init_cloud_snow(); init_cloud_sun(); - init_cloud_upload(); + init_cloud_sync(); init_cloud(); init_cloudy(); + init_cloud_upload(); init_clover(); init_club(); init_code_xml(); @@ -30776,8 +30965,8 @@ var init_iconsAndAliases = __esmMin((() => { init_coffee(); init_cog(); init_coins(); - init_columns_3_cog(); init_columns_2(); + init_columns_3_cog(); init_columns_3(); init_columns_4(); init_combine(); @@ -30788,8 +30977,8 @@ var init_iconsAndAliases = __esmMin((() => { init_concierge_bell(); init_cone(); init_construction(); - init_contact_round(); init_contact(); + init_contact_round(); init_container(); init_contrast(); init_cookie(); @@ -30800,8 +30989,8 @@ var init_iconsAndAliases = __esmMin((() => { init_copy_slash(); init_copy_x(); init_copy(); - init_copyright(); init_copyleft(); + init_copyright(); init_corner_down_left(); init_corner_down_right(); init_corner_left_down(); @@ -30809,10 +30998,10 @@ var init_iconsAndAliases = __esmMin((() => { init_corner_right_down(); init_corner_right_up(); init_corner_up_left(); + init_corner_up_right(); init_cpu(); init_creative_commons(); init_credit_card(); - init_corner_up_right(); init_croissant(); init_crop(); init_cross(); @@ -30825,28 +31014,28 @@ var init_iconsAndAliases = __esmMin((() => { init_dam(); init_database_backup(); init_database_zap(); - init_database(); init_decimals_arrow_left(); - init_decimals_arrow_right(); + init_database(); init_delete(); + init_decimals_arrow_right(); init_dessert(); init_diameter(); init_diamond_minus(); - init_diamond_percent(); init_diamond_plus(); + init_diamond_percent(); init_diamond(); init_dice_1(); init_dice_2(); init_dice_3(); - init_dice_4(); init_dice_5(); + init_dice_4(); init_dice_6(); init_dices(); init_diff(); init_disc_2(); init_disc_3(); - init_disc_album(); init_disc(); + init_disc_album(); init_divide(); init_dna_off(); init_dna(); @@ -30865,12 +31054,12 @@ var init_iconsAndAliases = __esmMin((() => { init_drill(); init_drone(); init_droplet_off(); - init_droplet(); init_droplets(); + init_droplet(); init_drum(); init_drumstick(); - init_dumbbell(); init_ear_off(); + init_dumbbell(); init_ear(); init_earth_lock(); init_earth(); @@ -30898,8 +31087,8 @@ var init_iconsAndAliases = __esmMin((() => { init_fast_forward(); init_feather(); init_fence(); - init_ferris_wheel(); init_figma(); + init_ferris_wheel(); init_file_archive(); init_file_axis_3d(); init_file_badge(); @@ -30913,8 +31102,8 @@ var init_iconsAndAliases = __esmMin((() => { init_file_check_corner(); init_file_check(); init_file_clock(); - init_file_code(); init_file_code_corner(); + init_file_code(); init_file_cog(); init_file_diff(); init_file_digit(); @@ -30928,18 +31117,18 @@ var init_iconsAndAliases = __esmMin((() => { init_file_lock(); init_file_minus_corner(); init_file_minus(); - init_file_music(); init_file_output(); + init_file_music(); init_file_pen_line(); init_file_pen(); init_file_play(); - init_file_plus_corner(); init_file_plus(); + init_file_plus_corner(); init_file_question_mark(); init_file_scan(); init_file_search_corner(); - init_file_search(); init_file_signal(); + init_file_search(); init_file_sliders(); init_file_spreadsheet(); init_file_stack(); @@ -30961,6 +31150,7 @@ var init_iconsAndAliases = __esmMin((() => { init_fire_extinguisher(); init_fish_off(); init_fish_symbol(); + init_fishing_hook(); init_fish(); init_flag_off(); init_flag_triangle_left(); @@ -30988,11 +31178,11 @@ var init_iconsAndAliases = __esmMin((() => { init_folder_closed(); init_folder_code(); init_folder_cog(); - init_folder_dot(); init_folder_down(); + init_folder_dot(); init_folder_git_2(); - init_folder_git(); init_folder_heart(); + init_folder_git(); init_folder_input(); init_folder_kanban(); init_folder_key(); @@ -31010,17 +31200,17 @@ var init_iconsAndAliases = __esmMin((() => { init_folder_sync(); init_folder_tree(); init_folder_up(); - init_folder_x(); init_folder(); init_folders(); + init_folder_x(); init_footprints(); init_forklift(); init_form(); init_forward(); init_frame(); init_framer(); - init_frown(); init_fuel(); + init_frown(); init_fullscreen(); init_funnel_plus(); init_funnel_x(); @@ -31033,8 +31223,8 @@ var init_iconsAndAliases = __esmMin((() => { init_gamepad_2(); init_gamepad_directional(); init_gamepad(); - init_gauge(); init_gavel(); + init_gauge(); init_gem(); init_georgian_lari(); init_ghost(); @@ -31052,37 +31242,37 @@ var init_iconsAndAliases = __esmMin((() => { init_git_pull_request_arrow(); init_git_pull_request_closed(); init_git_pull_request_create_arrow(); - init_git_pull_request_create(); init_git_pull_request_draft(); - init_gitlab(); + init_git_pull_request_create(); init_git_pull_request(); - init_glass_water(); init_github(); + init_gitlab(); + init_glass_water(); init_glasses(); init_globe_lock(); init_globe(); init_goal(); - init_gpu(); init_graduation_cap(); + init_gpu(); init_grape(); init_grid_2x2_check(); init_grid_2x2_plus(); init_grid_2x2_x(); - init_grid_2x2(); init_grid_3x2(); + init_grid_2x2(); init_grid_3x3(); init_grip_horizontal(); - init_grip_vertical(); init_grip(); + init_grip_vertical(); init_group(); init_guitar(); init_ham(); init_hamburger(); init_hammer(); - init_hand_fist(); init_hand_coins(); - init_hand_grab(); + init_hand_fist(); init_hand_heart(); + init_hand_grab(); init_hand_helping(); init_hand_metal(); init_hand_platter(); @@ -31095,22 +31285,23 @@ var init_iconsAndAliases = __esmMin((() => { init_hard_hat(); init_hash(); init_hat_glasses(); - init_hdmi_port(); init_haze(); + init_hd(); + init_hdmi_port(); init_heading_1(); init_heading_2(); init_heading_3(); init_heading_4(); - init_heading_6(); init_heading_5(); + init_heading_6(); init_heading(); - init_headphone_off(); init_headphones(); + init_headphone_off(); init_headset(); init_heart_crack(); init_heart_handshake(); - init_heart_minus(); init_heart_off(); + init_heart_minus(); init_heart_plus(); init_heart_pulse(); init_heart(); @@ -31124,8 +31315,8 @@ var init_iconsAndAliases = __esmMin((() => { init_hospital(); init_hotel(); init_hourglass(); - init_house_plug(); init_house_heart(); + init_house_plug(); init_house_plus(); init_house_wifi(); init_house(); @@ -31145,21 +31336,21 @@ var init_iconsAndAliases = __esmMin((() => { init_import(); init_inbox(); init_indian_rupee(); - init_infinity(); init_info(); + init_infinity(); init_inspection_panel(); init_instagram(); init_italic(); init_iteration_ccw(); - init_iteration_cw(); init_japanese_yen(); init_joystick(); + init_iteration_cw(); init_kanban(); init_kayak(); init_key_round(); init_key_square(); - init_key(); init_keyboard_music(); + init_key(); init_keyboard_off(); init_keyboard(); init_lamp_ceiling(); @@ -31167,22 +31358,23 @@ var init_iconsAndAliases = __esmMin((() => { init_lamp_floor(); init_lamp_wall_down(); init_lamp_wall_up(); - init_land_plot(); init_lamp(); + init_land_plot(); init_landmark(); init_languages(); init_laptop_minimal_check(); init_laptop_minimal(); init_laptop(); - init_lasso(); init_lasso_select(); init_laugh(); + init_lasso(); init_layers_2(); + init_layers_plus(); init_layers(); init_layout_dashboard(); init_layout_grid(); - init_layout_list(); init_layout_panel_left(); + init_layout_list(); init_layout_panel_top(); init_layout_template(); init_leaf(); @@ -31198,8 +31390,8 @@ var init_iconsAndAliases = __esmMin((() => { init_link_2_off(); init_link_2(); init_link(); - init_linkedin(); init_list_check(); + init_linkedin(); init_list_checks(); init_list_chevrons_down_up(); init_list_chevrons_up_down(); @@ -31211,31 +31403,31 @@ var init_iconsAndAliases = __esmMin((() => { init_list_indent_increase(); init_list_minus(); init_list_music(); - init_list_ordered(); init_list_plus(); - init_list_restart(); + init_list_ordered(); init_list_start(); + init_list_restart(); init_list_todo(); init_list_tree(); init_list_video(); - init_list_x(); init_list(); + init_list_x(); init_loader_circle(); init_loader_pinwheel(); init_loader(); - init_locate_off(); init_locate_fixed(); + init_locate_off(); init_locate(); init_lock_keyhole_open(); init_lock_keyhole(); - init_lock_open(); init_lock(); - init_log_out(); + init_lock_open(); init_log_in(); + init_log_out(); init_logs(); init_lollipop(); - init_luggage(); init_magnet(); + init_luggage(); init_mail_check(); init_mail_minus(); init_mail_open(); @@ -31247,29 +31439,29 @@ var init_iconsAndAliases = __esmMin((() => { init_mail(); init_mailbox(); init_mails(); - init_map_minus(); init_map_pin_check_inside(); + init_map_minus(); init_map_pin_check(); init_map_pin_house(); init_map_pin_minus_inside(); init_map_pin_minus(); init_map_pin_off(); - init_map_pin_pen(); init_map_pin_plus_inside(); - init_map_pin_x_inside(); + init_map_pin_pen(); init_map_pin_plus(); + init_map_pin_x_inside(); init_map_pin_x(); init_map_pin(); init_map_pinned(); init_map_plus(); init_map(); - init_mars(); init_mars_stroke(); + init_mars(); init_martini(); init_maximize_2(); init_maximize(); - init_medal(); init_megaphone_off(); + init_medal(); init_megaphone(); init_meh(); init_memory_stick(); @@ -31278,10 +31470,10 @@ var init_iconsAndAliases = __esmMin((() => { init_message_circle_code(); init_message_circle_dashed(); init_message_circle_heart(); - init_message_circle_more(); init_message_circle_off(); - init_message_circle_plus(); + init_message_circle_more(); init_message_circle_question_mark(); + init_message_circle_plus(); init_message_circle_reply(); init_message_circle_warning(); init_message_circle_x(); @@ -31296,8 +31488,8 @@ var init_iconsAndAliases = __esmMin((() => { init_message_square_off(); init_message_square_plus(); init_message_square_quote(); - init_message_square_reply(); init_message_square_share(); + init_message_square_reply(); init_message_square_text(); init_message_square_warning(); init_message_square_x(); @@ -31306,10 +31498,10 @@ var init_iconsAndAliases = __esmMin((() => { init_mic_off(); init_mic_vocal(); init_mic(); - init_microchip(); init_microscope(); - init_milestone(); + init_microchip(); init_microwave(); + init_milestone(); init_milk_off(); init_milk(); init_minimize_2(); @@ -31327,8 +31519,8 @@ var init_iconsAndAliases = __esmMin((() => { init_monitor_speaker(); init_monitor_stop(); init_monitor_up(); - init_monitor_x(); init_monitor(); + init_monitor_x(); init_moon_star(); init_moon(); init_motorbike(); @@ -31341,14 +31533,14 @@ var init_iconsAndAliases = __esmMin((() => { init_mouse_pointer_click(); init_mouse_pointer(); init_mouse(); - init_move_diagonal(); - init_move_diagonal_2(); init_move_3d(); + init_move_diagonal_2(); init_move_down_left(); + init_move_diagonal(); init_move_down_right(); init_move_down(); - init_move_left(); init_move_horizontal(); + init_move_left(); init_move_right(); init_move_up_left(); init_move_up_right(); @@ -31359,8 +31551,8 @@ var init_iconsAndAliases = __esmMin((() => { init_music_3(); init_music_4(); init_music(); - init_navigation_2(); init_navigation_2_off(); + init_navigation_2(); init_navigation_off(); init_navigation(); init_network(); @@ -31372,8 +31564,8 @@ var init_iconsAndAliases = __esmMin((() => { init_notebook_text(); init_notebook(); init_notepad_text_dashed(); - init_nut_off(); init_notepad_text(); + init_nut_off(); init_nut(); init_octagon_alert(); init_octagon_minus(); @@ -31395,23 +31587,23 @@ var init_iconsAndAliases = __esmMin((() => { init_paint_bucket(); init_paint_roller(); init_paintbrush_vertical(); - init_paintbrush(); init_palette(); + init_paintbrush(); init_panda(); init_panel_bottom_close(); init_panel_bottom_dashed(); - init_panel_bottom(); init_panel_bottom_open(); + init_panel_bottom(); init_panel_left_close(); init_panel_left_dashed(); init_panel_left_open(); init_panel_left_right_dashed(); init_panel_left(); init_panel_right_close(); - init_panel_right_open(); init_panel_right_dashed(); - init_panel_top_bottom_dashed(); + init_panel_right_open(); init_panel_right(); + init_panel_top_bottom_dashed(); init_panel_top_close(); init_panel_top_dashed(); init_panel_top_open(); @@ -31431,12 +31623,12 @@ var init_iconsAndAliases = __esmMin((() => { init_pen_tool(); init_pen(); init_pencil_line(); - init_pencil_off(); init_pencil_ruler(); + init_pencil_off(); init_pencil(); init_pentagon(); - init_percent(); init_person_standing(); + init_percent(); init_philippine_peso(); init_phone_call(); init_phone_forwarded(); @@ -31444,22 +31636,22 @@ var init_iconsAndAliases = __esmMin((() => { init_phone_missed(); init_phone_off(); init_phone_outgoing(); - init_phone(); init_pi(); + init_phone(); init_piano(); init_pickaxe(); init_picture_in_picture_2(); init_picture_in_picture(); init_piggy_bank(); init_pilcrow_left(); - init_pilcrow(); init_pilcrow_right(); + init_pilcrow(); init_pill_bottle(); init_pill(); init_pin_off(); init_pin(); - init_pipette(); init_pizza(); + init_pipette(); init_plane_landing(); init_plane_takeoff(); init_plane(); @@ -31478,11 +31670,11 @@ var init_iconsAndAliases = __esmMin((() => { init_pound_sterling(); init_power_off(); init_power(); - init_presentation(); init_printer_check(); - init_projector(); + init_presentation(); init_printer(); init_proportions(); + init_projector(); init_puzzle(); init_pyramid(); init_qr_code(); @@ -31492,16 +31684,16 @@ var init_iconsAndAliases = __esmMin((() => { init_radiation(); init_radical(); init_radio_receiver(); + init_radio_tower(); init_radio(); init_radius(); - init_radio_tower(); init_rail_symbol(); init_rainbow(); init_rat(); init_ratio(); init_receipt_cent(); - init_receipt_euro(); init_receipt_indian_rupee(); + init_receipt_euro(); init_receipt_japanese_yen(); init_receipt_pound_sterling(); init_receipt_russian_ruble(); @@ -31535,19 +31727,19 @@ var init_iconsAndAliases = __esmMin((() => { init_rewind(); init_ribbon(); init_rocket(); - init_rocking_chair(); init_roller_coaster(); + init_rocking_chair(); init_rose(); init_rotate_3d(); - init_rotate_ccw_square(); init_rotate_ccw_key(); + init_rotate_ccw_square(); init_rotate_ccw(); init_rotate_cw_square(); init_rotate_cw(); init_route_off(); + init_router(); init_route(); init_rows_2(); - init_router(); init_rows_3(); init_rows_4(); init_rss(); @@ -31568,10 +31760,10 @@ var init_iconsAndAliases = __esmMin((() => { init_scaling(); init_scan_barcode(); init_scan_eye(); - init_scan_heart(); init_scan_face(); - init_scan_qr_code(); + init_scan_heart(); init_scan_line(); + init_scan_qr_code(); init_scan_search(); init_scan_text(); init_scan(); @@ -31581,8 +31773,9 @@ var init_iconsAndAliases = __esmMin((() => { init_scooter(); init_screen_share_off(); init_screen_share(); - init_scroll_text(); init_scroll(); + init_scroll_text(); + init_search_alert(); init_search_check(); init_search_code(); init_search_slash(); @@ -31593,8 +31786,8 @@ var init_iconsAndAliases = __esmMin((() => { init_send_to_back(); init_send(); init_separator_horizontal(); - init_separator_vertical(); init_server_cog(); + init_separator_vertical(); init_server_crash(); init_server_off(); init_server(); @@ -31605,8 +31798,8 @@ var init_iconsAndAliases = __esmMin((() => { init_share(); init_sheet(); init_shell(); - init_shield_ban(); init_shield_alert(); + init_shield_ban(); init_shield_check(); init_shield_ellipsis(); init_shield_half(); @@ -31619,10 +31812,10 @@ var init_iconsAndAliases = __esmMin((() => { init_shield(); init_ship_wheel(); init_ship(); - init_shirt(); init_shopping_bag(); - init_shopping_basket(); + init_shirt(); init_shopping_cart(); + init_shopping_basket(); init_shovel(); init_shower_head(); init_shredder(); @@ -31638,9 +31831,9 @@ var init_iconsAndAliases = __esmMin((() => { init_signal(); init_signature(); init_signpost_big(); + init_signpost(); init_siren(); init_skip_back(); - init_signpost(); init_skip_forward(); init_skull(); init_slack(); @@ -31656,22 +31849,22 @@ var init_iconsAndAliases = __esmMin((() => { init_snail(); init_snowflake(); init_soap_dispenser_droplet(); - init_sofa(); init_solar_panel(); + init_sofa(); init_soup(); init_space(); init_spade(); - init_sparkles(); - init_speaker(); init_sparkle(); + init_sparkles(); init_speech(); + init_speaker(); init_spell_check_2(); init_spell_check(); init_spline_pointer(); init_spline(); init_spool(); - init_split(); init_spotlight(); + init_split(); init_spray_can(); init_sprout(); init_square_activity(); @@ -31689,8 +31882,8 @@ var init_iconsAndAliases = __esmMin((() => { init_square_arrow_up(); init_square_asterisk(); init_square_bottom_dashed_scissors(); - init_square_check_big(); init_square_chart_gantt(); + init_square_check_big(); init_square_check(); init_square_chevron_down(); init_square_chevron_left(); @@ -31698,15 +31891,15 @@ var init_iconsAndAliases = __esmMin((() => { init_square_chevron_up(); init_square_code(); init_square_dashed_bottom_code(); - init_square_dashed_kanban(); - init_square_dashed_mouse_pointer(); init_square_dashed_bottom(); + init_square_dashed_kanban(); init_square_dashed_top_solid(); + init_square_dashed_mouse_pointer(); init_square_dashed(); init_square_divide(); init_square_dot(); - init_square_function(); init_square_equal(); + init_square_function(); init_square_kanban(); init_square_library(); init_square_m(); @@ -31717,8 +31910,8 @@ var init_iconsAndAliases = __esmMin((() => { init_square_parking(); init_square_pause(); init_square_pen(); - init_square_percent(); init_square_pi(); + init_square_percent(); init_square_pilcrow(); init_square_play(); init_square_plus(); @@ -31726,8 +31919,8 @@ var init_iconsAndAliases = __esmMin((() => { init_square_radical(); init_square_round_corner(); init_square_scissors(); - init_square_sigma(); init_square_slash(); + init_square_sigma(); init_square_split_horizontal(); init_square_split_vertical(); init_square_square(); @@ -31740,14 +31933,14 @@ var init_iconsAndAliases = __esmMin((() => { init_square_x(); init_square(); init_squares_exclude(); - init_squares_subtract(); init_squares_intersect(); + init_squares_subtract(); init_squares_unite(); + init_squircle(); init_squircle_dashed(); init_squirrel(); - init_squircle(); - init_stamp(); init_star_half(); + init_stamp(); init_star_off(); init_star(); init_step_back(); @@ -31755,15 +31948,16 @@ var init_iconsAndAliases = __esmMin((() => { init_stethoscope(); init_sticker(); init_sticky_note(); - init_stretch_horizontal(); + init_stone(); init_store$1(); + init_stretch_horizontal(); init_stretch_vertical(); init_strikethrough(); init_subscript(); - init_sun_medium(); init_sun_dim(); - init_sun_snow(); + init_sun_medium(); init_sun_moon(); + init_sun_snow(); init_sun(); init_sunrise(); init_sunset(); @@ -31784,8 +31978,8 @@ var init_iconsAndAliases = __esmMin((() => { init_table(); init_tablet_smartphone(); init_tablet(); - init_tablets(); init_tag(); + init_tablets(); init_tags(); init_tally_1(); init_tally_2(); @@ -31802,10 +31996,10 @@ var init_iconsAndAliases = __esmMin((() => { init_test_tube(); init_test_tubes(); init_text_align_center(); - init_text_align_end(); init_text_align_justify(); - init_text_align_start(); + init_text_align_end(); init_text_cursor_input(); + init_text_align_start(); init_text_cursor(); init_text_initial(); init_text_quote(); @@ -31830,13 +32024,13 @@ var init_iconsAndAliases = __esmMin((() => { init_timer_off(); init_timer_reset(); init_timer(); - init_toggle_left(); init_toggle_right(); + init_toggle_left(); init_toilet(); - init_tool_case(); init_tornado(); - init_touchpad_off(); + init_tool_case(); init_torus(); + init_touchpad_off(); init_touchpad(); init_tower_control(); init_toy_brick(); @@ -31856,16 +32050,16 @@ var init_iconsAndAliases = __esmMin((() => { init_trello(); init_trending_down(); init_trending_up_down(); - init_trending_up(); init_triangle_alert(); + init_trending_up(); init_triangle_dashed(); init_triangle_right(); - init_trophy(); init_triangle(); init_truck_electric(); + init_trophy(); init_truck(); - init_turkish_lira(); init_turntable(); + init_turkish_lira(); init_turtle(); init_tv_minimal_play(); init_tv_minimal(); @@ -31880,17 +32074,17 @@ var init_iconsAndAliases = __esmMin((() => { init_undo_2(); init_undo_dot(); init_undo(); - init_unfold_horizontal(); init_unfold_vertical(); + init_unfold_horizontal(); init_ungroup(); init_university(); init_unlink_2(); init_unlink(); - init_upload(); init_unplug(); + init_upload(); init_usb(); - init_user_cog(); init_user_check(); + init_user_cog(); init_user_lock(); init_user_minus(); init_user_pen(); @@ -31903,8 +32097,8 @@ var init_iconsAndAliases = __esmMin((() => { init_user_round_search(); init_user_round_x(); init_user_round(); - init_user_search(); init_user_star(); + init_user_search(); init_user_x(); init_user(); init_users_round(); @@ -31913,8 +32107,8 @@ var init_iconsAndAliases = __esmMin((() => { init_utensils(); init_utility_pole(); init_van(); - init_vault(); init_variable(); + init_vault(); init_vector_square(); init_vegan(); init_venetian_mask(); @@ -31924,8 +32118,8 @@ var init_iconsAndAliases = __esmMin((() => { init_vibrate(); init_video_off(); init_video(); - init_videotape(); init_view(); + init_videotape(); init_volleyball(); init_voicemail(); init_volume_1(); @@ -31950,8 +32144,8 @@ var init_iconsAndAliases = __esmMin((() => { init_waypoints(); init_webcam(); init_webhook_off(); - init_webhook(); init_weight_tilde(); + init_webhook(); init_weight(); init_wheat_off(); init_wheat(); @@ -31971,10 +32165,10 @@ var init_iconsAndAliases = __esmMin((() => { init_workflow(); init_worm(); init_wrench(); - init_youtube(); init_x(); - init_zap_off(); + init_youtube(); init_zap(); + init_zap_off(); init_zoom_in(); init_zoom_out(); })); @@ -31987,8 +32181,8 @@ var init_lucide = __esmMin((() => { init_iconsAndAliases(); init_createElement(); init_a_arrow_down(); - init_a_arrow_up(); init_a_large_small(); + init_a_arrow_up(); init_accessibility(); init_activity(); init_air_vent(); @@ -32006,11 +32200,11 @@ var init_lucide = __esmMin((() => { init_align_end_vertical(); init_align_horizontal_distribute_center(); init_align_horizontal_distribute_end(); - init_align_horizontal_justify_center(); init_align_horizontal_distribute_start(); + init_align_horizontal_justify_center(); init_align_horizontal_justify_end(); - init_align_horizontal_space_around(); init_align_horizontal_justify_start(); + init_align_horizontal_space_around(); init_align_horizontal_space_between(); init_align_start_horizontal(); init_align_start_vertical(); @@ -32024,8 +32218,8 @@ var init_lucide = __esmMin((() => { init_align_vertical_space_between(); init_ambulance(); init_ampersand(); - init_ampersands(); init_amphora(); + init_ampersands(); init_anchor(); init_angry(); init_annoyed(); @@ -32033,13 +32227,13 @@ var init_lucide = __esmMin((() => { init_anvil(); init_aperture(); init_app_window_mac(); - init_app_window(); init_apple(); + init_app_window(); init_archive_restore(); init_archive_x(); init_archive(); - init_arrow_big_down_dash(); init_armchair(); + init_arrow_big_down_dash(); init_arrow_big_down(); init_arrow_big_left_dash(); init_arrow_big_left(); @@ -32057,10 +32251,10 @@ var init_lucide = __esmMin((() => { init_arrow_down_to_dot(); init_arrow_down_to_line(); init_arrow_down_up(); - init_arrow_down_z_a(); init_arrow_down_wide_narrow(); - init_arrow_down(); + init_arrow_down_z_a(); init_arrow_left_from_line(); + init_arrow_down(); init_arrow_left_right(); init_arrow_left_to_line(); init_arrow_left(); @@ -32081,10 +32275,10 @@ var init_lucide = __esmMin((() => { init_arrow_up_wide_narrow(); init_arrow_up_z_a(); init_arrow_up(); - init_arrows_up_from_line(); init_asterisk(); - init_at_sign(); + init_arrows_up_from_line(); init_atom(); + init_at_sign(); init_audio_lines(); init_audio_waveform(); init_award(); @@ -32092,13 +32286,13 @@ var init_lucide = __esmMin((() => { init_axis_3d(); init_baby(); init_backpack(); - init_badge_cent(); init_badge_alert(); + init_badge_cent(); init_badge_check(); init_badge_dollar_sign(); init_badge_euro(); - init_badge_info(); init_badge_indian_rupee(); + init_badge_info(); init_badge_japanese_yen(); init_badge_minus(); init_badge_percent(); @@ -32112,6 +32306,7 @@ var init_lucide = __esmMin((() => { init_badge(); init_baggage_claim(); init_ban(); + init_balloon(); init_banana(); init_bandage(); init_banknote_arrow_down(); @@ -32134,8 +32329,8 @@ var init_lucide = __esmMin((() => { init_bean(); init_bed_double(); init_bed_single(); - init_bed(); init_beef(); + init_bed(); init_beer_off(); init_beer(); init_bell_dot(); @@ -32151,13 +32346,13 @@ var init_lucide = __esmMin((() => { init_between_vertical_start(); init_biceps_flexed(); init_bike(); - init_binoculars(); init_binary(); + init_binoculars(); init_biohazard(); init_bird(); + init_birdhouse(); init_bitcoin(); init_blend(); - init_birdhouse(); init_blinds(); init_blocks(); init_bluetooth_connected(); @@ -32197,8 +32392,8 @@ var init_lucide = __esmMin((() => { init_bookmark_check(); init_bookmark_minus(); init_bookmark_plus(); - init_bookmark_x(); init_bookmark(); + init_bookmark_x(); init_boom_box(); init_bot_message_square(); init_bot_off(); @@ -32218,17 +32413,17 @@ var init_lucide = __esmMin((() => { init_briefcase_business(); init_briefcase_conveyor_belt(); init_briefcase_medical(); - init_briefcase(); init_bring_to_front(); + init_briefcase(); init_brush_cleaning(); init_brush(); - init_bubbles(); init_bug_off(); + init_bubbles(); init_bug_play(); init_bug(); init_building_2(); - init_building(); init_bus_front(); + init_building(); init_bus(); init_cable_car(); init_cable(); @@ -32243,10 +32438,10 @@ var init_lucide = __esmMin((() => { init_calendar_clock(); init_calendar_cog(); init_calendar_days(); - init_calendar_fold(); init_calendar_heart(); - init_calendar_minus(); + init_calendar_fold(); init_calendar_minus_2(); + init_calendar_minus(); init_calendar_off(); init_calendar_plus_2(); init_calendar_plus(); @@ -32261,21 +32456,22 @@ var init_lucide = __esmMin((() => { init_camera(); init_candy_cane(); init_candy_off(); - init_cannabis(); - init_captions_off(); init_candy(); + init_cannabis_off(); + init_cannabis(); init_captions(); + init_captions_off(); init_car_front(); init_car_taxi_front(); - init_car(); init_caravan(); - init_card_sim(); + init_car(); init_carrot(); + init_card_sim(); init_case_lower(); init_case_sensitive(); init_case_upper(); - init_cassette_tape(); init_cast(); + init_cassette_tape(); init_castle(); init_cat(); init_cctv(); @@ -32287,8 +32483,8 @@ var init_lucide = __esmMin((() => { init_chart_bar(); init_chart_candlestick(); init_chart_column_big(); - init_chart_column_increasing(); init_chart_column_decreasing(); + init_chart_column_increasing(); init_chart_column_stacked(); init_chart_column(); init_chart_gantt(); @@ -32306,14 +32502,14 @@ var init_lucide = __esmMin((() => { init_check_line(); init_check(); init_chef_hat(); - init_cherry(); init_chess_bishop(); + init_cherry(); init_chess_king(); init_chess_knight(); init_chess_pawn(); init_chess_queen(); - init_chess_rook(); init_chevron_down(); + init_chess_rook(); init_chevron_first(); init_chevron_last(); init_chevron_left(); @@ -32327,30 +32523,30 @@ var init_lucide = __esmMin((() => { init_chevrons_right_left(); init_chevrons_right(); init_chevrons_up_down(); - init_chevrons_up(); init_chromium(); init_church(); + init_chevrons_up(); init_cigarette_off(); init_cigarette(); init_circle_alert(); init_circle_arrow_down(); init_circle_arrow_left(); - init_circle_arrow_out_down_left(); init_circle_arrow_out_down_right(); + init_circle_arrow_out_down_left(); init_circle_arrow_out_up_left(); init_circle_arrow_out_up_right(); init_circle_arrow_right(); - init_circle_arrow_up(); init_circle_check_big(); + init_circle_arrow_up(); init_circle_check(); init_circle_chevron_down(); init_circle_chevron_left(); - init_circle_chevron_right(); init_circle_chevron_up(); + init_circle_chevron_right(); init_circle_dashed(); init_circle_divide(); - init_circle_dollar_sign(); init_circle_dot_dashed(); + init_circle_dollar_sign(); init_circle_dot(); init_circle_ellipsis(); init_circle_equal(); @@ -32363,9 +32559,10 @@ var init_lucide = __esmMin((() => { init_circle_parking(); init_circle_pause(); init_circle_percent(); + init_circle_pile(); init_circle_play(); - init_circle_plus(); init_circle_pound_sterling(); + init_circle_plus(); init_circle_power(); init_circle_question_mark(); init_circle_slash_2(); @@ -32373,8 +32570,8 @@ var init_lucide = __esmMin((() => { init_circle_small(); init_circle_star(); init_circle_stop(); - init_circle_user_round(); init_circle_user(); + init_circle_user_round(); init_circle_x(); init_circle(); init_circuit_board(); @@ -32383,21 +32580,21 @@ var init_lucide = __esmMin((() => { init_clipboard_check(); init_clipboard_clock(); init_clipboard_copy(); + init_clipboard_minus(); init_clipboard_list(); init_clipboard_paste(); - init_clipboard_minus(); init_clipboard_pen_line(); init_clipboard_pen(); init_clipboard_plus(); init_clipboard_type(); - init_clipboard(); init_clipboard_x(); + init_clipboard(); init_clock_1(); init_clock_10(); + init_clock_11(); init_clock_12(); init_clock_2(); init_clock_3(); - init_clock_11(); init_clock_4(); init_clock_5(); init_clock_6(); @@ -32411,11 +32608,12 @@ var init_lucide = __esmMin((() => { init_clock_fading(); init_clock_plus(); init_clock(); - init_closed_caption(); init_cloud_alert(); + init_closed_caption(); init_cloud_check(); - init_cloud_download(); + init_cloud_backup(); init_cloud_cog(); + init_cloud_download(); init_cloud_drizzle(); init_cloud_fog(); init_cloud_hail(); @@ -32425,12 +32623,13 @@ var init_lucide = __esmMin((() => { init_cloud_off(); init_cloud_rain_wind(); init_cloud_rain(); - init_cloud_snow(); init_cloud_sun_rain(); + init_cloud_snow(); init_cloud_sun(); - init_cloud_upload(); + init_cloud_sync(); init_cloud(); init_cloudy(); + init_cloud_upload(); init_clover(); init_club(); init_code_xml(); @@ -32440,8 +32639,8 @@ var init_lucide = __esmMin((() => { init_coffee(); init_cog(); init_coins(); - init_columns_3_cog(); init_columns_2(); + init_columns_3_cog(); init_columns_3(); init_columns_4(); init_combine(); @@ -32452,8 +32651,8 @@ var init_lucide = __esmMin((() => { init_concierge_bell(); init_cone(); init_construction(); - init_contact_round(); init_contact(); + init_contact_round(); init_container(); init_contrast(); init_cookie(); @@ -32464,8 +32663,8 @@ var init_lucide = __esmMin((() => { init_copy_slash(); init_copy_x(); init_copy(); - init_copyright(); init_copyleft(); + init_copyright(); init_corner_down_left(); init_corner_down_right(); init_corner_left_down(); @@ -32473,10 +32672,10 @@ var init_lucide = __esmMin((() => { init_corner_right_down(); init_corner_right_up(); init_corner_up_left(); + init_corner_up_right(); init_cpu(); init_creative_commons(); init_credit_card(); - init_corner_up_right(); init_croissant(); init_crop(); init_cross(); @@ -32489,28 +32688,28 @@ var init_lucide = __esmMin((() => { init_dam(); init_database_backup(); init_database_zap(); - init_database(); init_decimals_arrow_left(); - init_decimals_arrow_right(); + init_database(); init_delete(); + init_decimals_arrow_right(); init_dessert(); init_diameter(); init_diamond_minus(); - init_diamond_percent(); init_diamond_plus(); + init_diamond_percent(); init_diamond(); init_dice_1(); init_dice_2(); init_dice_3(); - init_dice_4(); init_dice_5(); + init_dice_4(); init_dice_6(); init_dices(); init_diff(); init_disc_2(); init_disc_3(); - init_disc_album(); init_disc(); + init_disc_album(); init_divide(); init_dna_off(); init_dna(); @@ -32529,12 +32728,12 @@ var init_lucide = __esmMin((() => { init_drill(); init_drone(); init_droplet_off(); - init_droplet(); init_droplets(); + init_droplet(); init_drum(); init_drumstick(); - init_dumbbell(); init_ear_off(); + init_dumbbell(); init_ear(); init_earth_lock(); init_earth(); @@ -32562,8 +32761,8 @@ var init_lucide = __esmMin((() => { init_fast_forward(); init_feather(); init_fence(); - init_ferris_wheel(); init_figma(); + init_ferris_wheel(); init_file_archive(); init_file_axis_3d(); init_file_badge(); @@ -32577,8 +32776,8 @@ var init_lucide = __esmMin((() => { init_file_check_corner(); init_file_check(); init_file_clock(); - init_file_code(); init_file_code_corner(); + init_file_code(); init_file_cog(); init_file_diff(); init_file_digit(); @@ -32592,18 +32791,18 @@ var init_lucide = __esmMin((() => { init_file_lock(); init_file_minus_corner(); init_file_minus(); - init_file_music(); init_file_output(); + init_file_music(); init_file_pen_line(); init_file_pen(); init_file_play(); - init_file_plus_corner(); init_file_plus(); + init_file_plus_corner(); init_file_question_mark(); init_file_scan(); init_file_search_corner(); - init_file_search(); init_file_signal(); + init_file_search(); init_file_sliders(); init_file_spreadsheet(); init_file_stack(); @@ -32625,6 +32824,7 @@ var init_lucide = __esmMin((() => { init_fire_extinguisher(); init_fish_off(); init_fish_symbol(); + init_fishing_hook(); init_fish(); init_flag_off(); init_flag_triangle_left(); @@ -32652,11 +32852,11 @@ var init_lucide = __esmMin((() => { init_folder_closed(); init_folder_code(); init_folder_cog(); - init_folder_dot(); init_folder_down(); + init_folder_dot(); init_folder_git_2(); - init_folder_git(); init_folder_heart(); + init_folder_git(); init_folder_input(); init_folder_kanban(); init_folder_key(); @@ -32674,17 +32874,17 @@ var init_lucide = __esmMin((() => { init_folder_sync(); init_folder_tree(); init_folder_up(); - init_folder_x(); init_folder(); init_folders(); + init_folder_x(); init_footprints(); init_forklift(); init_form(); init_forward(); init_frame(); init_framer(); - init_frown(); init_fuel(); + init_frown(); init_fullscreen(); init_funnel_plus(); init_funnel_x(); @@ -32697,8 +32897,8 @@ var init_lucide = __esmMin((() => { init_gamepad_2(); init_gamepad_directional(); init_gamepad(); - init_gauge(); init_gavel(); + init_gauge(); init_gem(); init_georgian_lari(); init_ghost(); @@ -32716,37 +32916,37 @@ var init_lucide = __esmMin((() => { init_git_pull_request_arrow(); init_git_pull_request_closed(); init_git_pull_request_create_arrow(); - init_git_pull_request_create(); init_git_pull_request_draft(); - init_gitlab(); + init_git_pull_request_create(); init_git_pull_request(); - init_glass_water(); init_github(); + init_gitlab(); + init_glass_water(); init_glasses(); init_globe_lock(); init_globe(); init_goal(); - init_gpu(); init_graduation_cap(); + init_gpu(); init_grape(); init_grid_2x2_check(); init_grid_2x2_plus(); init_grid_2x2_x(); - init_grid_2x2(); init_grid_3x2(); + init_grid_2x2(); init_grid_3x3(); init_grip_horizontal(); - init_grip_vertical(); init_grip(); + init_grip_vertical(); init_group(); init_guitar(); init_ham(); init_hamburger(); init_hammer(); - init_hand_fist(); init_hand_coins(); - init_hand_grab(); + init_hand_fist(); init_hand_heart(); + init_hand_grab(); init_hand_helping(); init_hand_metal(); init_hand_platter(); @@ -32759,22 +32959,23 @@ var init_lucide = __esmMin((() => { init_hard_hat(); init_hash(); init_hat_glasses(); - init_hdmi_port(); init_haze(); + init_hd(); + init_hdmi_port(); init_heading_1(); init_heading_2(); init_heading_3(); init_heading_4(); - init_heading_6(); init_heading_5(); + init_heading_6(); init_heading(); - init_headphone_off(); init_headphones(); + init_headphone_off(); init_headset(); init_heart_crack(); init_heart_handshake(); - init_heart_minus(); init_heart_off(); + init_heart_minus(); init_heart_plus(); init_heart_pulse(); init_heart(); @@ -32788,8 +32989,8 @@ var init_lucide = __esmMin((() => { init_hospital(); init_hotel(); init_hourglass(); - init_house_plug(); init_house_heart(); + init_house_plug(); init_house_plus(); init_house_wifi(); init_house(); @@ -32809,21 +33010,21 @@ var init_lucide = __esmMin((() => { init_import(); init_inbox(); init_indian_rupee(); - init_infinity(); init_info(); + init_infinity(); init_inspection_panel(); init_instagram(); init_italic(); init_iteration_ccw(); - init_iteration_cw(); init_japanese_yen(); init_joystick(); + init_iteration_cw(); init_kanban(); init_kayak(); init_key_round(); init_key_square(); - init_key(); init_keyboard_music(); + init_key(); init_keyboard_off(); init_keyboard(); init_lamp_ceiling(); @@ -32831,22 +33032,23 @@ var init_lucide = __esmMin((() => { init_lamp_floor(); init_lamp_wall_down(); init_lamp_wall_up(); - init_land_plot(); init_lamp(); + init_land_plot(); init_landmark(); init_languages(); init_laptop_minimal_check(); init_laptop_minimal(); init_laptop(); - init_lasso(); init_lasso_select(); init_laugh(); + init_lasso(); init_layers_2(); + init_layers_plus(); init_layers(); init_layout_dashboard(); init_layout_grid(); - init_layout_list(); init_layout_panel_left(); + init_layout_list(); init_layout_panel_top(); init_layout_template(); init_leaf(); @@ -32862,8 +33064,8 @@ var init_lucide = __esmMin((() => { init_link_2_off(); init_link_2(); init_link(); - init_linkedin(); init_list_check(); + init_linkedin(); init_list_checks(); init_list_chevrons_down_up(); init_list_chevrons_up_down(); @@ -32875,31 +33077,31 @@ var init_lucide = __esmMin((() => { init_list_indent_increase(); init_list_minus(); init_list_music(); - init_list_ordered(); init_list_plus(); - init_list_restart(); + init_list_ordered(); init_list_start(); + init_list_restart(); init_list_todo(); init_list_tree(); init_list_video(); - init_list_x(); init_list(); + init_list_x(); init_loader_circle(); init_loader_pinwheel(); init_loader(); - init_locate_off(); init_locate_fixed(); + init_locate_off(); init_locate(); init_lock_keyhole_open(); init_lock_keyhole(); - init_lock_open(); init_lock(); - init_log_out(); + init_lock_open(); init_log_in(); + init_log_out(); init_logs(); init_lollipop(); - init_luggage(); init_magnet(); + init_luggage(); init_mail_check(); init_mail_minus(); init_mail_open(); @@ -32911,29 +33113,29 @@ var init_lucide = __esmMin((() => { init_mail(); init_mailbox(); init_mails(); - init_map_minus(); init_map_pin_check_inside(); + init_map_minus(); init_map_pin_check(); init_map_pin_house(); init_map_pin_minus_inside(); init_map_pin_minus(); init_map_pin_off(); - init_map_pin_pen(); init_map_pin_plus_inside(); - init_map_pin_x_inside(); + init_map_pin_pen(); init_map_pin_plus(); + init_map_pin_x_inside(); init_map_pin_x(); init_map_pin(); init_map_pinned(); init_map_plus(); init_map(); - init_mars(); init_mars_stroke(); + init_mars(); init_martini(); init_maximize_2(); init_maximize(); - init_medal(); init_megaphone_off(); + init_medal(); init_megaphone(); init_meh(); init_memory_stick(); @@ -32942,10 +33144,10 @@ var init_lucide = __esmMin((() => { init_message_circle_code(); init_message_circle_dashed(); init_message_circle_heart(); - init_message_circle_more(); init_message_circle_off(); - init_message_circle_plus(); + init_message_circle_more(); init_message_circle_question_mark(); + init_message_circle_plus(); init_message_circle_reply(); init_message_circle_warning(); init_message_circle_x(); @@ -32960,8 +33162,8 @@ var init_lucide = __esmMin((() => { init_message_square_off(); init_message_square_plus(); init_message_square_quote(); - init_message_square_reply(); init_message_square_share(); + init_message_square_reply(); init_message_square_text(); init_message_square_warning(); init_message_square_x(); @@ -32970,10 +33172,10 @@ var init_lucide = __esmMin((() => { init_mic_off(); init_mic_vocal(); init_mic(); - init_microchip(); init_microscope(); - init_milestone(); + init_microchip(); init_microwave(); + init_milestone(); init_milk_off(); init_milk(); init_minimize_2(); @@ -32991,8 +33193,8 @@ var init_lucide = __esmMin((() => { init_monitor_speaker(); init_monitor_stop(); init_monitor_up(); - init_monitor_x(); init_monitor(); + init_monitor_x(); init_moon_star(); init_moon(); init_motorbike(); @@ -33005,14 +33207,14 @@ var init_lucide = __esmMin((() => { init_mouse_pointer_click(); init_mouse_pointer(); init_mouse(); - init_move_diagonal(); - init_move_diagonal_2(); init_move_3d(); + init_move_diagonal_2(); init_move_down_left(); + init_move_diagonal(); init_move_down_right(); init_move_down(); - init_move_left(); init_move_horizontal(); + init_move_left(); init_move_right(); init_move_up_left(); init_move_up_right(); @@ -33023,8 +33225,8 @@ var init_lucide = __esmMin((() => { init_music_3(); init_music_4(); init_music(); - init_navigation_2(); init_navigation_2_off(); + init_navigation_2(); init_navigation_off(); init_navigation(); init_network(); @@ -33036,8 +33238,8 @@ var init_lucide = __esmMin((() => { init_notebook_text(); init_notebook(); init_notepad_text_dashed(); - init_nut_off(); init_notepad_text(); + init_nut_off(); init_nut(); init_octagon_alert(); init_octagon_minus(); @@ -33059,23 +33261,23 @@ var init_lucide = __esmMin((() => { init_paint_bucket(); init_paint_roller(); init_paintbrush_vertical(); - init_paintbrush(); init_palette(); + init_paintbrush(); init_panda(); init_panel_bottom_close(); init_panel_bottom_dashed(); - init_panel_bottom(); init_panel_bottom_open(); + init_panel_bottom(); init_panel_left_close(); init_panel_left_dashed(); init_panel_left_open(); init_panel_left_right_dashed(); init_panel_left(); init_panel_right_close(); - init_panel_right_open(); init_panel_right_dashed(); - init_panel_top_bottom_dashed(); + init_panel_right_open(); init_panel_right(); + init_panel_top_bottom_dashed(); init_panel_top_close(); init_panel_top_dashed(); init_panel_top_open(); @@ -33095,12 +33297,12 @@ var init_lucide = __esmMin((() => { init_pen_tool(); init_pen(); init_pencil_line(); - init_pencil_off(); init_pencil_ruler(); + init_pencil_off(); init_pencil(); init_pentagon(); - init_percent(); init_person_standing(); + init_percent(); init_philippine_peso(); init_phone_call(); init_phone_forwarded(); @@ -33108,22 +33310,22 @@ var init_lucide = __esmMin((() => { init_phone_missed(); init_phone_off(); init_phone_outgoing(); - init_phone(); init_pi(); + init_phone(); init_piano(); init_pickaxe(); init_picture_in_picture_2(); init_picture_in_picture(); init_piggy_bank(); init_pilcrow_left(); - init_pilcrow(); init_pilcrow_right(); + init_pilcrow(); init_pill_bottle(); init_pill(); init_pin_off(); init_pin(); - init_pipette(); init_pizza(); + init_pipette(); init_plane_landing(); init_plane_takeoff(); init_plane(); @@ -33142,11 +33344,11 @@ var init_lucide = __esmMin((() => { init_pound_sterling(); init_power_off(); init_power(); - init_presentation(); init_printer_check(); - init_projector(); + init_presentation(); init_printer(); init_proportions(); + init_projector(); init_puzzle(); init_pyramid(); init_qr_code(); @@ -33156,16 +33358,16 @@ var init_lucide = __esmMin((() => { init_radiation(); init_radical(); init_radio_receiver(); + init_radio_tower(); init_radio(); init_radius(); - init_radio_tower(); init_rail_symbol(); init_rainbow(); init_rat(); init_ratio(); init_receipt_cent(); - init_receipt_euro(); init_receipt_indian_rupee(); + init_receipt_euro(); init_receipt_japanese_yen(); init_receipt_pound_sterling(); init_receipt_russian_ruble(); @@ -33199,19 +33401,19 @@ var init_lucide = __esmMin((() => { init_rewind(); init_ribbon(); init_rocket(); - init_rocking_chair(); init_roller_coaster(); + init_rocking_chair(); init_rose(); init_rotate_3d(); - init_rotate_ccw_square(); init_rotate_ccw_key(); + init_rotate_ccw_square(); init_rotate_ccw(); init_rotate_cw_square(); init_rotate_cw(); init_route_off(); + init_router(); init_route(); init_rows_2(); - init_router(); init_rows_3(); init_rows_4(); init_rss(); @@ -33232,10 +33434,10 @@ var init_lucide = __esmMin((() => { init_scaling(); init_scan_barcode(); init_scan_eye(); - init_scan_heart(); init_scan_face(); - init_scan_qr_code(); + init_scan_heart(); init_scan_line(); + init_scan_qr_code(); init_scan_search(); init_scan_text(); init_scan(); @@ -33245,8 +33447,9 @@ var init_lucide = __esmMin((() => { init_scooter(); init_screen_share_off(); init_screen_share(); - init_scroll_text(); init_scroll(); + init_scroll_text(); + init_search_alert(); init_search_check(); init_search_code(); init_search_slash(); @@ -33257,8 +33460,8 @@ var init_lucide = __esmMin((() => { init_send_to_back(); init_send(); init_separator_horizontal(); - init_separator_vertical(); init_server_cog(); + init_separator_vertical(); init_server_crash(); init_server_off(); init_server(); @@ -33269,8 +33472,8 @@ var init_lucide = __esmMin((() => { init_share(); init_sheet(); init_shell(); - init_shield_ban(); init_shield_alert(); + init_shield_ban(); init_shield_check(); init_shield_ellipsis(); init_shield_half(); @@ -33283,10 +33486,10 @@ var init_lucide = __esmMin((() => { init_shield(); init_ship_wheel(); init_ship(); - init_shirt(); init_shopping_bag(); - init_shopping_basket(); + init_shirt(); init_shopping_cart(); + init_shopping_basket(); init_shovel(); init_shower_head(); init_shredder(); @@ -33302,9 +33505,9 @@ var init_lucide = __esmMin((() => { init_signal(); init_signature(); init_signpost_big(); + init_signpost(); init_siren(); init_skip_back(); - init_signpost(); init_skip_forward(); init_skull(); init_slack(); @@ -33320,22 +33523,22 @@ var init_lucide = __esmMin((() => { init_snail(); init_snowflake(); init_soap_dispenser_droplet(); - init_sofa(); init_solar_panel(); + init_sofa(); init_soup(); init_space(); init_spade(); - init_sparkles(); - init_speaker(); init_sparkle(); + init_sparkles(); init_speech(); + init_speaker(); init_spell_check_2(); init_spell_check(); init_spline_pointer(); init_spline(); init_spool(); - init_split(); init_spotlight(); + init_split(); init_spray_can(); init_sprout(); init_square_activity(); @@ -33353,8 +33556,8 @@ var init_lucide = __esmMin((() => { init_square_arrow_up(); init_square_asterisk(); init_square_bottom_dashed_scissors(); - init_square_check_big(); init_square_chart_gantt(); + init_square_check_big(); init_square_check(); init_square_chevron_down(); init_square_chevron_left(); @@ -33362,15 +33565,15 @@ var init_lucide = __esmMin((() => { init_square_chevron_up(); init_square_code(); init_square_dashed_bottom_code(); - init_square_dashed_kanban(); - init_square_dashed_mouse_pointer(); init_square_dashed_bottom(); + init_square_dashed_kanban(); init_square_dashed_top_solid(); + init_square_dashed_mouse_pointer(); init_square_dashed(); init_square_divide(); init_square_dot(); - init_square_function(); init_square_equal(); + init_square_function(); init_square_kanban(); init_square_library(); init_square_m(); @@ -33381,8 +33584,8 @@ var init_lucide = __esmMin((() => { init_square_parking(); init_square_pause(); init_square_pen(); - init_square_percent(); init_square_pi(); + init_square_percent(); init_square_pilcrow(); init_square_play(); init_square_plus(); @@ -33390,8 +33593,8 @@ var init_lucide = __esmMin((() => { init_square_radical(); init_square_round_corner(); init_square_scissors(); - init_square_sigma(); init_square_slash(); + init_square_sigma(); init_square_split_horizontal(); init_square_split_vertical(); init_square_square(); @@ -33404,14 +33607,14 @@ var init_lucide = __esmMin((() => { init_square_x(); init_square(); init_squares_exclude(); - init_squares_subtract(); init_squares_intersect(); + init_squares_subtract(); init_squares_unite(); + init_squircle(); init_squircle_dashed(); init_squirrel(); - init_squircle(); - init_stamp(); init_star_half(); + init_stamp(); init_star_off(); init_star(); init_step_back(); @@ -33419,15 +33622,16 @@ var init_lucide = __esmMin((() => { init_stethoscope(); init_sticker(); init_sticky_note(); - init_stretch_horizontal(); + init_stone(); init_store$1(); + init_stretch_horizontal(); init_stretch_vertical(); init_strikethrough(); init_subscript(); - init_sun_medium(); init_sun_dim(); - init_sun_snow(); + init_sun_medium(); init_sun_moon(); + init_sun_snow(); init_sun(); init_sunrise(); init_sunset(); @@ -33448,8 +33652,8 @@ var init_lucide = __esmMin((() => { init_table(); init_tablet_smartphone(); init_tablet(); - init_tablets(); init_tag(); + init_tablets(); init_tags(); init_tally_1(); init_tally_2(); @@ -33466,10 +33670,10 @@ var init_lucide = __esmMin((() => { init_test_tube(); init_test_tubes(); init_text_align_center(); - init_text_align_end(); init_text_align_justify(); - init_text_align_start(); + init_text_align_end(); init_text_cursor_input(); + init_text_align_start(); init_text_cursor(); init_text_initial(); init_text_quote(); @@ -33494,13 +33698,13 @@ var init_lucide = __esmMin((() => { init_timer_off(); init_timer_reset(); init_timer(); - init_toggle_left(); init_toggle_right(); + init_toggle_left(); init_toilet(); - init_tool_case(); init_tornado(); - init_touchpad_off(); + init_tool_case(); init_torus(); + init_touchpad_off(); init_touchpad(); init_tower_control(); init_toy_brick(); @@ -33520,16 +33724,16 @@ var init_lucide = __esmMin((() => { init_trello(); init_trending_down(); init_trending_up_down(); - init_trending_up(); init_triangle_alert(); + init_trending_up(); init_triangle_dashed(); init_triangle_right(); - init_trophy(); init_triangle(); init_truck_electric(); + init_trophy(); init_truck(); - init_turkish_lira(); init_turntable(); + init_turkish_lira(); init_turtle(); init_tv_minimal_play(); init_tv_minimal(); @@ -33544,17 +33748,17 @@ var init_lucide = __esmMin((() => { init_undo_2(); init_undo_dot(); init_undo(); - init_unfold_horizontal(); init_unfold_vertical(); + init_unfold_horizontal(); init_ungroup(); init_university(); init_unlink_2(); init_unlink(); - init_upload(); init_unplug(); + init_upload(); init_usb(); - init_user_cog(); init_user_check(); + init_user_cog(); init_user_lock(); init_user_minus(); init_user_pen(); @@ -33567,8 +33771,8 @@ var init_lucide = __esmMin((() => { init_user_round_search(); init_user_round_x(); init_user_round(); - init_user_search(); init_user_star(); + init_user_search(); init_user_x(); init_user(); init_users_round(); @@ -33577,8 +33781,8 @@ var init_lucide = __esmMin((() => { init_utensils(); init_utility_pole(); init_van(); - init_vault(); init_variable(); + init_vault(); init_vector_square(); init_vegan(); init_venetian_mask(); @@ -33588,8 +33792,8 @@ var init_lucide = __esmMin((() => { init_vibrate(); init_video_off(); init_video(); - init_videotape(); init_view(); + init_videotape(); init_volleyball(); init_voicemail(); init_volume_1(); @@ -33614,8 +33818,8 @@ var init_lucide = __esmMin((() => { init_waypoints(); init_webcam(); init_webhook_off(); - init_webhook(); init_weight_tilde(); + init_webhook(); init_weight(); init_wheat_off(); init_wheat(); @@ -33635,10 +33839,10 @@ var init_lucide = __esmMin((() => { init_workflow(); init_worm(); init_wrench(); - init_youtube(); init_x(); - init_zap_off(); + init_youtube(); init_zap(); + init_zap_off(); init_zoom_in(); init_zoom_out(); createIcons = ({ icons = {}, nameAttr = "data-lucide", attrs = {}, root = document, inTemplates } = {}) => { @@ -34315,7 +34519,7 @@ var init_Input = __esmMin((() => { init_lit(); init_ref$2(); init_i18n(); - Input = fc(({ type = "text", size = "md", value = "", placeholder = "", label = "", error: error$2 = "", disabled = false, required = false, name = "", autocomplete = "", min, max, step, inputRef, onInput, onChange, onKeyDown, onKeyUp, className = "" }) => { + Input = fc(({ type = "text", size = "md", value = "", placeholder = "", label = "", error = "", disabled = false, required = false, name = "", autocomplete = "", min, max, step, inputRef, onInput, onChange, onKeyDown, onKeyUp, className = "" }) => { const sizeClasses$1 = { sm: "h-8 px-3 py-1 text-sm", md: "h-9 px-3 py-1 text-sm md:text-sm", @@ -34325,7 +34529,7 @@ var init_Input = __esmMin((() => { const interactionClasses = "placeholder:text-muted-foreground selection:bg-primary selection:text-primary-foreground"; const focusClasses = "focus-visible:border-ring focus-visible:ring-ring/50 focus-visible:ring-[3px]"; const darkClasses = "dark:bg-input/30"; - const stateClasses = error$2 ? "border-destructive aria-invalid:ring-destructive/20 dark:aria-invalid:ring-destructive/40" : "border-input"; + const stateClasses = error ? "border-destructive aria-invalid:ring-destructive/20 dark:aria-invalid:ring-destructive/40" : "border-input"; const disabledClasses = "disabled:pointer-events-none disabled:cursor-not-allowed disabled:opacity-50"; const handleInput = (e$10) => { onInput?.(e$10); @@ -34347,7 +34551,7 @@ var init_Input = __esmMin((() => { placeholder="${placeholder}" ?disabled=${disabled} ?required=${required} - ?aria-invalid=${!!error$2} + ?aria-invalid=${!!error} name="${name}" autocomplete="${autocomplete}" min="${min ?? ""}" @@ -34359,7 +34563,7 @@ var init_Input = __esmMin((() => { @keyup=${onKeyUp} ${inputRef ? n(inputRef) : ""} /> - ${error$2 ? x`${error$2}` : ""} + ${error ? x`${error}` : ""} `; }); @@ -34499,12 +34703,12 @@ function normalizeHeaders(headers) { return headers || {}; } } -var defaultPort, defaultHost, version$5, __defProp$1, __defNormalProp$1, __publicField$1, ResponseError, AbortableAsyncIterator, checkOk, readEnvVar, fetchWithHeaders, get, post, del, parseJSON, formatHost, __defProp, __defNormalProp, __publicField, Ollama$1, browser; +var defaultPort, defaultHost, version$3, __defProp$1, __defNormalProp$1, __publicField$1, ResponseError, AbortableAsyncIterator, checkOk, readEnvVar, fetchWithHeaders, get, post, del, parseJSON, formatHost, __defProp, __defNormalProp, __publicField, Ollama$1, browser; var init_browser = __esmMin((() => { init_whatwg_fetch_stub(); defaultPort = "11434"; defaultHost = `http://127.0.0.1:${defaultPort}`; - version$5 = "0.6.3"; + version$3 = "0.6.3"; __defProp$1 = Object.defineProperty; __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, @@ -34517,9 +34721,9 @@ var init_browser = __esmMin((() => { return value; }; ResponseError = class ResponseError extends Error { - constructor(error$2, status_code) { - super(error$2); - this.error = error$2; + constructor(error, status_code) { + super(error); + this.error = error; this.status_code = status_code; this.name = "ResponseError"; if (Error.captureStackTrace) { @@ -34563,7 +34767,7 @@ var init_browser = __esmMin((() => { try { errorData = await response.json(); message = errorData.error || message; - } catch (error$2) { + } catch (error) { console.log("Failed to parse error response as JSON"); } } else { @@ -34571,7 +34775,7 @@ var init_browser = __esmMin((() => { console.log("Getting text from response"); const textResponse = await response.text(); message = textResponse || message; - } catch (error$2) { + } catch (error) { console.log("Failed to get text from error response"); } } @@ -34584,7 +34788,7 @@ var init_browser = __esmMin((() => { const defaultHeaders = { "Content-Type": "application/json", Accept: "application/json", - "User-Agent": `ollama-js/${version$5} (${getPlatform()})` + "User-Agent": `ollama-js/${version$3} (${getPlatform()})` }; options.headers = normalizeHeaders(options.headers); try { @@ -34596,8 +34800,8 @@ var init_browser = __esmMin((() => { options.headers["Authorization"] = `Bearer ${apiKey}`; } } - } catch (error$2) { - console.error("error parsing url", error$2); + } catch (error) { + console.error("error parsing url", error); } const customHeaders = Object.fromEntries(Object.entries(options.headers).filter(([key]) => !Object.keys(defaultHeaders).some((defaultKey) => defaultKey.toLowerCase() === key.toLowerCase()))); options.headers = { @@ -34649,7 +34853,7 @@ var init_browser = __esmMin((() => { for (const part of parts) { try { yield JSON.parse(part); - } catch (error$2) { + } catch (error) { console.warn("invalid json: ", part); } } @@ -34658,7 +34862,7 @@ var init_browser = __esmMin((() => { for (const part of buffer.split("\n").filter((p$3) => p$3 !== "")) { try { yield JSON.parse(part); - } catch (error$2) { + } catch (error) { console.warn("invalid json: ", part); } } @@ -35185,10 +35389,10 @@ var init_ModelSelector = __esmMin((() => { init_i18n(); init_model_discovery(); __decorate$27 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ; ModelSelector = ModelSelector_1 = class ModelSelector$1 extends DialogBase { @@ -35279,15 +35483,15 @@ var init_ModelSelector = __esmMin((() => { provider: provider.name })); allCustomModels.push(...modelsWithProvider); - } catch (error$2) { - console.debug(`Failed to load models from ${provider.name}:`, error$2); + } catch (error) { + console.debug(`Failed to load models from ${provider.name}:`, error); } } else if (provider.models) { allCustomModels.push(...provider.models); } } - } catch (error$2) { - console.error("Failed to load custom providers:", error$2); + } catch (error) { + console.error("Failed to load custom providers:", error); } finally { this.customProviderModels = allCustomModels; this.customProvidersLoading = false; @@ -35788,49 +35992,49 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }(function() { return function s$5(a$2, o$10, h$5) { - function u$4(r$10, e$11) { - if (!o$10[r$10]) { - if (!a$2[r$10]) { + function u$4(r$9, e$11) { + if (!o$10[r$9]) { + if (!a$2[r$9]) { var t$6 = "function" == typeof __require && __require; - if (!e$11 && t$6) return t$6(r$10, !0); - if (l$3) return l$3(r$10, !0); - var n$9 = new Error("Cannot find module '" + r$10 + "'"); + if (!e$11 && t$6) return t$6(r$9, !0); + if (l$3) return l$3(r$9, !0); + var n$9 = new Error("Cannot find module '" + r$9 + "'"); throw n$9.code = "MODULE_NOT_FOUND", n$9; } - var i$7 = o$10[r$10] = { exports: {} }; - a$2[r$10][0].call(i$7.exports, function(e$12) { - var t$7 = a$2[r$10][1][e$12]; + var i$7 = o$10[r$9] = { exports: {} }; + a$2[r$9][0].call(i$7.exports, function(e$12) { + var t$7 = a$2[r$9][1][e$12]; return u$4(t$7 || e$12); }, i$7, i$7.exports, s$5, a$2, o$10, h$5); } - return o$10[r$10].exports; + return o$10[r$9].exports; } for (var l$3 = "function" == typeof __require && __require, e$10 = 0; e$10 < h$5.length; e$10++) u$4(h$5[e$10]); return u$4; }({ - 1: [function(e$10, t$6, r$10) { + 1: [function(e$10, t$6, r$9) { "use strict"; - var d$5 = e$10("./utils"), c$7 = e$10("./support"), p$3 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/="; - r$10.encode = function(e$11) { - for (var t$7, r$11, n$9, i$7, s$5, a$2, o$10, h$5 = [], u$4 = 0, l$3 = e$11.length, f$4 = l$3, c$8 = "string" !== d$5.getTypeOf(e$11); u$4 < e$11.length;) f$4 = l$3 - u$4, n$9 = c$8 ? (t$7 = e$11[u$4++], r$11 = u$4 < l$3 ? e$11[u$4++] : 0, u$4 < l$3 ? e$11[u$4++] : 0) : (t$7 = e$11.charCodeAt(u$4++), r$11 = u$4 < l$3 ? e$11.charCodeAt(u$4++) : 0, u$4 < l$3 ? e$11.charCodeAt(u$4++) : 0), i$7 = t$7 >> 2, s$5 = (3 & t$7) << 4 | r$11 >> 4, a$2 = 1 < f$4 ? (15 & r$11) << 2 | n$9 >> 6 : 64, o$10 = 2 < f$4 ? 63 & n$9 : 64, h$5.push(p$3.charAt(i$7) + p$3.charAt(s$5) + p$3.charAt(a$2) + p$3.charAt(o$10)); + var d$4 = e$10("./utils"), c$6 = e$10("./support"), p$3 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/="; + r$9.encode = function(e$11) { + for (var t$7, r$10, n$9, i$7, s$5, a$2, o$10, h$5 = [], u$4 = 0, l$3 = e$11.length, f$4 = l$3, c$7 = "string" !== d$4.getTypeOf(e$11); u$4 < e$11.length;) f$4 = l$3 - u$4, n$9 = c$7 ? (t$7 = e$11[u$4++], r$10 = u$4 < l$3 ? e$11[u$4++] : 0, u$4 < l$3 ? e$11[u$4++] : 0) : (t$7 = e$11.charCodeAt(u$4++), r$10 = u$4 < l$3 ? e$11.charCodeAt(u$4++) : 0, u$4 < l$3 ? e$11.charCodeAt(u$4++) : 0), i$7 = t$7 >> 2, s$5 = (3 & t$7) << 4 | r$10 >> 4, a$2 = 1 < f$4 ? (15 & r$10) << 2 | n$9 >> 6 : 64, o$10 = 2 < f$4 ? 63 & n$9 : 64, h$5.push(p$3.charAt(i$7) + p$3.charAt(s$5) + p$3.charAt(a$2) + p$3.charAt(o$10)); return h$5.join(""); - }, r$10.decode = function(e$11) { - var t$7, r$11, n$9, i$7, s$5, a$2, o$10 = 0, h$5 = 0, u$4 = "data:"; + }, r$9.decode = function(e$11) { + var t$7, r$10, n$9, i$7, s$5, a$2, o$10 = 0, h$5 = 0, u$4 = "data:"; if (e$11.substr(0, u$4.length) === u$4) throw new Error("Invalid base64 input, it looks like a data url."); var l$3, f$4 = 3 * (e$11 = e$11.replace(/[^A-Za-z0-9+/=]/g, "")).length / 4; if (e$11.charAt(e$11.length - 1) === p$3.charAt(64) && f$4--, e$11.charAt(e$11.length - 2) === p$3.charAt(64) && f$4--, f$4 % 1 != 0) throw new Error("Invalid base64 input, bad content length."); - for (l$3 = c$7.uint8array ? new Uint8Array(0 | f$4) : new Array(0 | f$4); o$10 < e$11.length;) t$7 = p$3.indexOf(e$11.charAt(o$10++)) << 2 | (i$7 = p$3.indexOf(e$11.charAt(o$10++))) >> 4, r$11 = (15 & i$7) << 4 | (s$5 = p$3.indexOf(e$11.charAt(o$10++))) >> 2, n$9 = (3 & s$5) << 6 | (a$2 = p$3.indexOf(e$11.charAt(o$10++))), l$3[h$5++] = t$7, 64 !== s$5 && (l$3[h$5++] = r$11), 64 !== a$2 && (l$3[h$5++] = n$9); + for (l$3 = c$6.uint8array ? new Uint8Array(0 | f$4) : new Array(0 | f$4); o$10 < e$11.length;) t$7 = p$3.indexOf(e$11.charAt(o$10++)) << 2 | (i$7 = p$3.indexOf(e$11.charAt(o$10++))) >> 4, r$10 = (15 & i$7) << 4 | (s$5 = p$3.indexOf(e$11.charAt(o$10++))) >> 2, n$9 = (3 & s$5) << 6 | (a$2 = p$3.indexOf(e$11.charAt(o$10++))), l$3[h$5++] = t$7, 64 !== s$5 && (l$3[h$5++] = r$10), 64 !== a$2 && (l$3[h$5++] = n$9); return l$3; }; }, { "./support": 30, "./utils": 32 }], - 2: [function(e$10, t$6, r$10) { + 2: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./external"), i$7 = e$10("./stream/DataWorker"), s$5 = e$10("./stream/Crc32Probe"), a$2 = e$10("./stream/DataLengthProbe"); - function o$10(e$11, t$7, r$11, n$10, i$8) { - this.compressedSize = e$11, this.uncompressedSize = t$7, this.crc32 = r$11, this.compression = n$10, this.compressedContent = i$8; + function o$10(e$11, t$7, r$10, n$10, i$8) { + this.compressedSize = e$11, this.uncompressedSize = t$7, this.crc32 = r$10, this.compression = n$10, this.compressedContent = i$8; } o$10.prototype = { getContentWorker: function() { @@ -35842,8 +36046,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { getCompressedWorker: function() { return new i$7(n$9.Promise.resolve(this.compressedContent)).withStreamInfo("compressedSize", this.compressedSize).withStreamInfo("uncompressedSize", this.uncompressedSize).withStreamInfo("crc32", this.crc32).withStreamInfo("compression", this.compression); } - }, o$10.createWorkerFrom = function(e$11, t$7, r$11) { - return e$11.pipe(new s$5()).pipe(new a$2("uncompressedSize")).pipe(t$7.compressWorker(r$11)).pipe(new a$2("compressedSize")).withStreamInfo("compression", t$7); + }, o$10.createWorkerFrom = function(e$11, t$7, r$10) { + return e$11.pipe(new s$5()).pipe(new a$2("uncompressedSize")).pipe(t$7.compressWorker(r$10)).pipe(new a$2("compressedSize")).withStreamInfo("compression", t$7); }, t$6.exports = o$10; }, { "./external": 6, @@ -35851,10 +36055,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./stream/DataLengthProbe": 26, "./stream/DataWorker": 27 }], - 3: [function(e$10, t$6, r$10) { + 3: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./stream/GenericWorker"); - r$10.STORE = { + r$9.STORE = { magic: "\0\0", compressWorker: function() { return new n$9("STORE compression"); @@ -35862,52 +36066,52 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { uncompressWorker: function() { return new n$9("STORE decompression"); } - }, r$10.DEFLATE = e$10("./flate"); + }, r$9.DEFLATE = e$10("./flate"); }, { "./flate": 7, "./stream/GenericWorker": 28 }], - 4: [function(e$10, t$6, r$10) { + 4: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./utils"); var o$10 = function() { - for (var e$11, t$7 = [], r$11 = 0; r$11 < 256; r$11++) { - e$11 = r$11; + for (var e$11, t$7 = [], r$10 = 0; r$10 < 256; r$10++) { + e$11 = r$10; for (var n$10 = 0; n$10 < 8; n$10++) e$11 = 1 & e$11 ? 3988292384 ^ e$11 >>> 1 : e$11 >>> 1; - t$7[r$11] = e$11; + t$7[r$10] = e$11; } return t$7; }(); t$6.exports = function(e$11, t$7) { - return void 0 !== e$11 && e$11.length ? "string" !== n$9.getTypeOf(e$11) ? function(e$12, t$8, r$11, n$10) { - var i$7 = o$10, s$5 = n$10 + r$11; + return void 0 !== e$11 && e$11.length ? "string" !== n$9.getTypeOf(e$11) ? function(e$12, t$8, r$10, n$10) { + var i$7 = o$10, s$5 = n$10 + r$10; e$12 ^= -1; for (var a$2 = n$10; a$2 < s$5; a$2++) e$12 = e$12 >>> 8 ^ i$7[255 & (e$12 ^ t$8[a$2])]; return -1 ^ e$12; - }(0 | t$7, e$11, e$11.length, 0) : function(e$12, t$8, r$11, n$10) { - var i$7 = o$10, s$5 = n$10 + r$11; + }(0 | t$7, e$11, e$11.length, 0) : function(e$12, t$8, r$10, n$10) { + var i$7 = o$10, s$5 = n$10 + r$10; e$12 ^= -1; for (var a$2 = n$10; a$2 < s$5; a$2++) e$12 = e$12 >>> 8 ^ i$7[255 & (e$12 ^ t$8.charCodeAt(a$2))]; return -1 ^ e$12; }(0 | t$7, e$11, e$11.length, 0) : 0; }; }, { "./utils": 32 }], - 5: [function(e$10, t$6, r$10) { + 5: [function(e$10, t$6, r$9) { "use strict"; - r$10.base64 = !1, r$10.binary = !1, r$10.dir = !1, r$10.createFolders = !0, r$10.date = null, r$10.compression = null, r$10.compressionOptions = null, r$10.comment = null, r$10.unixPermissions = null, r$10.dosPermissions = null; + r$9.base64 = !1, r$9.binary = !1, r$9.dir = !1, r$9.createFolders = !0, r$9.date = null, r$9.compression = null, r$9.compressionOptions = null, r$9.comment = null, r$9.unixPermissions = null, r$9.dosPermissions = null; }, {}], - 6: [function(e$10, t$6, r$10) { + 6: [function(e$10, t$6, r$9) { "use strict"; var n$9 = null; n$9 = "undefined" != typeof Promise ? Promise : e$10("lie"), t$6.exports = { Promise: n$9 }; }, { lie: 37 }], - 7: [function(e$10, t$6, r$10) { + 7: [function(e$10, t$6, r$9) { "use strict"; var n$9 = "undefined" != typeof Uint8Array && "undefined" != typeof Uint16Array && "undefined" != typeof Uint32Array, i$7 = e$10("pako"), s$5 = e$10("./utils"), a$2 = e$10("./stream/GenericWorker"), o$10 = n$9 ? "uint8array" : "array"; function h$5(e$11, t$7) { a$2.call(this, "FlateWorker/" + e$11), this._pako = null, this._pakoAction = e$11, this._pakoOptions = t$7, this.meta = {}; } - r$10.magic = "\b\0", s$5.inherits(h$5, a$2), h$5.prototype.processChunk = function(e$11) { + r$9.magic = "\b\0", s$5.inherits(h$5, a$2), h$5.prototype.processChunk = function(e$11) { this.meta = e$11.meta, null === this._pako && this._createPako(), this._pako.push(s$5.transformTo(o$10, e$11.data), !1); }, h$5.prototype.flush = function() { a$2.prototype.flush.call(this), null === this._pako && this._createPako(), this._pako.push([], !0); @@ -35925,9 +36129,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { meta: t$7.meta }); }; - }, r$10.compressWorker = function(e$11) { + }, r$9.compressWorker = function(e$11) { return new h$5("Deflate", e$11); - }, r$10.uncompressWorker = function() { + }, r$9.uncompressWorker = function() { return new h$5("Inflate", {}); }; }, { @@ -35935,29 +36139,29 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./utils": 32, pako: 38 }], - 8: [function(e$10, t$6, r$10) { + 8: [function(e$10, t$6, r$9) { "use strict"; function A$1(e$11, t$7) { - var r$11, n$10 = ""; - for (r$11 = 0; r$11 < t$7; r$11++) n$10 += String.fromCharCode(255 & e$11), e$11 >>>= 8; + var r$10, n$10 = ""; + for (r$10 = 0; r$10 < t$7; r$10++) n$10 += String.fromCharCode(255 & e$11), e$11 >>>= 8; return n$10; } - function n$9(e$11, t$7, r$11, n$10, i$8, s$6) { - var a$2, o$10, h$5 = e$11.file, u$4 = e$11.compression, l$3 = s$6 !== O.utf8encode, f$4 = I$2.transformTo("string", s$6(h$5.name)), c$7 = I$2.transformTo("string", O.utf8encode(h$5.name)), d$5 = h$5.comment, p$3 = I$2.transformTo("string", s$6(d$5)), m$3 = I$2.transformTo("string", O.utf8encode(d$5)), _$2 = c$7.length !== h$5.name.length, g$1 = m$3.length !== d$5.length, b$3 = "", v$3 = "", y$3 = "", w$2 = h$5.dir, k$2 = h$5.date, x$2 = { + function n$9(e$11, t$7, r$10, n$10, i$8, s$6) { + var a$2, o$10, h$5 = e$11.file, u$4 = e$11.compression, l$3 = s$6 !== O.utf8encode, f$4 = I$2.transformTo("string", s$6(h$5.name)), c$6 = I$2.transformTo("string", O.utf8encode(h$5.name)), d$4 = h$5.comment, p$3 = I$2.transformTo("string", s$6(d$4)), m$3 = I$2.transformTo("string", O.utf8encode(d$4)), _$2 = c$6.length !== h$5.name.length, g$1 = m$3.length !== d$4.length, b$3 = "", v$3 = "", y$3 = "", w$2 = h$5.dir, k$2 = h$5.date, x$2 = { crc32: 0, compressedSize: 0, uncompressedSize: 0 }; - t$7 && !r$11 || (x$2.crc32 = e$11.crc32, x$2.compressedSize = e$11.compressedSize, x$2.uncompressedSize = e$11.uncompressedSize); + t$7 && !r$10 || (x$2.crc32 = e$11.crc32, x$2.compressedSize = e$11.compressedSize, x$2.uncompressedSize = e$11.uncompressedSize); var S$4 = 0; t$7 && (S$4 |= 8), l$3 || !_$2 && !g$1 || (S$4 |= 2048); var z$2 = 0, C$2 = 0; w$2 && (z$2 |= 16), "UNIX" === i$8 ? (C$2 = 798, z$2 |= function(e$12, t$8) { - var r$12 = e$12; - return e$12 || (r$12 = t$8 ? 16893 : 33204), (65535 & r$12) << 16; + var r$11 = e$12; + return e$12 || (r$11 = t$8 ? 16893 : 33204), (65535 & r$11) << 16; }(h$5.unixPermissions, w$2)) : (C$2 = 20, z$2 |= function(e$12) { return 63 & (e$12 || 0); - }(h$5.dosPermissions)), a$2 = k$2.getUTCHours(), a$2 <<= 6, a$2 |= k$2.getUTCMinutes(), a$2 <<= 5, a$2 |= k$2.getUTCSeconds() / 2, o$10 = k$2.getUTCFullYear() - 1980, o$10 <<= 4, o$10 |= k$2.getUTCMonth() + 1, o$10 <<= 5, o$10 |= k$2.getUTCDate(), _$2 && (v$3 = A$1(1, 1) + A$1(B$2(f$4), 4) + c$7, b$3 += "up" + A$1(v$3.length, 2) + v$3), g$1 && (y$3 = A$1(1, 1) + A$1(B$2(p$3), 4) + m$3, b$3 += "uc" + A$1(y$3.length, 2) + y$3); + }(h$5.dosPermissions)), a$2 = k$2.getUTCHours(), a$2 <<= 6, a$2 |= k$2.getUTCMinutes(), a$2 <<= 5, a$2 |= k$2.getUTCSeconds() / 2, o$10 = k$2.getUTCFullYear() - 1980, o$10 <<= 4, o$10 |= k$2.getUTCMonth() + 1, o$10 <<= 5, o$10 |= k$2.getUTCDate(), _$2 && (v$3 = A$1(1, 1) + A$1(B$2(f$4), 4) + c$6, b$3 += "up" + A$1(v$3.length, 2) + v$3), g$1 && (y$3 = A$1(1, 1) + A$1(B$2(p$3), 4) + m$3, b$3 += "uc" + A$1(y$3.length, 2) + y$3); var E$2 = ""; return E$2 += "\n\0", E$2 += A$1(S$4, 2), E$2 += u$4.magic, E$2 += A$1(a$2, 2), E$2 += A$1(o$10, 2), E$2 += A$1(x$2.crc32, 4), E$2 += A$1(x$2.compressedSize, 4), E$2 += A$1(x$2.uncompressedSize, 4), E$2 += A$1(f$4.length, 2), E$2 += A$1(b$3.length, 2), { fileRecord: R$1.LOCAL_FILE_HEADER + E$2 + f$4 + b$3, @@ -35965,39 +36169,39 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; } var I$2 = e$10("../utils"), i$7 = e$10("../stream/GenericWorker"), O = e$10("../utf8"), B$2 = e$10("../crc32"), R$1 = e$10("../signature"); - function s$5(e$11, t$7, r$11, n$10) { - i$7.call(this, "ZipFileWorker"), this.bytesWritten = 0, this.zipComment = t$7, this.zipPlatform = r$11, this.encodeFileName = n$10, this.streamFiles = e$11, this.accumulate = !1, this.contentBuffer = [], this.dirRecords = [], this.currentSourceOffset = 0, this.entriesCount = 0, this.currentFile = null, this._sources = []; + function s$5(e$11, t$7, r$10, n$10) { + i$7.call(this, "ZipFileWorker"), this.bytesWritten = 0, this.zipComment = t$7, this.zipPlatform = r$10, this.encodeFileName = n$10, this.streamFiles = e$11, this.accumulate = !1, this.contentBuffer = [], this.dirRecords = [], this.currentSourceOffset = 0, this.entriesCount = 0, this.currentFile = null, this._sources = []; } I$2.inherits(s$5, i$7), s$5.prototype.push = function(e$11) { - var t$7 = e$11.meta.percent || 0, r$11 = this.entriesCount, n$10 = this._sources.length; + var t$7 = e$11.meta.percent || 0, r$10 = this.entriesCount, n$10 = this._sources.length; this.accumulate ? this.contentBuffer.push(e$11) : (this.bytesWritten += e$11.data.length, i$7.prototype.push.call(this, { data: e$11.data, meta: { currentFile: this.currentFile, - percent: r$11 ? (t$7 + 100 * (r$11 - n$10 - 1)) / r$11 : 100 + percent: r$10 ? (t$7 + 100 * (r$10 - n$10 - 1)) / r$10 : 100 } })); }, s$5.prototype.openedSource = function(e$11) { this.currentSourceOffset = this.bytesWritten, this.currentFile = e$11.file.name; var t$7 = this.streamFiles && !e$11.file.dir; if (t$7) { - var r$11 = n$9(e$11, t$7, !1, this.currentSourceOffset, this.zipPlatform, this.encodeFileName); + var r$10 = n$9(e$11, t$7, !1, this.currentSourceOffset, this.zipPlatform, this.encodeFileName); this.push({ - data: r$11.fileRecord, + data: r$10.fileRecord, meta: { percent: 0 } }); } else this.accumulate = !0; }, s$5.prototype.closedSource = function(e$11) { this.accumulate = !1; - var t$7 = this.streamFiles && !e$11.file.dir, r$11 = n$9(e$11, t$7, !0, this.currentSourceOffset, this.zipPlatform, this.encodeFileName); - if (this.dirRecords.push(r$11.dirRecord), t$7) this.push({ + var t$7 = this.streamFiles && !e$11.file.dir, r$10 = n$9(e$11, t$7, !0, this.currentSourceOffset, this.zipPlatform, this.encodeFileName); + if (this.dirRecords.push(r$10.dirRecord), t$7) this.push({ data: function(e$12) { return R$1.DATA_DESCRIPTOR + A$1(e$12.crc32, 4) + A$1(e$12.compressedSize, 4) + A$1(e$12.uncompressedSize, 4); }(e$11), meta: { percent: 100 } }); else for (this.push({ - data: r$11.fileRecord, + data: r$10.fileRecord, meta: { percent: 0 } }); this.contentBuffer.length;) this.push(this.contentBuffer.shift()); this.currentFile = null; @@ -36006,10 +36210,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { data: this.dirRecords[t$7], meta: { percent: 100 } }); - var r$11 = this.bytesWritten - e$11, n$10 = function(e$12, t$8, r$12, n$11, i$8) { + var r$10 = this.bytesWritten - e$11, n$10 = function(e$12, t$8, r$11, n$11, i$8) { var s$6 = I$2.transformTo("string", i$8(n$11)); - return R$1.CENTRAL_DIRECTORY_END + "\0\0\0\0" + A$1(e$12, 2) + A$1(e$12, 2) + A$1(t$8, 4) + A$1(r$12, 4) + A$1(s$6.length, 2) + s$6; - }(this.dirRecords.length, r$11, e$11, this.zipComment, this.encodeFileName); + return R$1.CENTRAL_DIRECTORY_END + "\0\0\0\0" + A$1(e$12, 2) + A$1(e$12, 2) + A$1(t$8, 4) + A$1(r$11, 4) + A$1(s$6.length, 2) + s$6; + }(this.dirRecords.length, r$10, e$11, this.zipComment, this.encodeFileName); this.push({ data: n$10, meta: { percent: 100 } @@ -36031,8 +36235,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, s$5.prototype.error = function(e$11) { var t$7 = this._sources; if (!i$7.prototype.error.call(this, e$11)) return !1; - for (var r$11 = 0; r$11 < t$7.length; r$11++) try { - t$7[r$11].error(e$11); + for (var r$10 = 0; r$10 < t$7.length; r$10++) try { + t$7[r$10].error(e$11); } catch (e$12) {} return !0; }, s$5.prototype.lock = function() { @@ -36046,20 +36250,20 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utf8": 31, "../utils": 32 }], - 9: [function(e$10, t$6, r$10) { + 9: [function(e$10, t$6, r$9) { "use strict"; var u$4 = e$10("../compressions"), n$9 = e$10("./ZipFileWorker"); - r$10.generateWorker = function(e$11, a$2, t$7) { + r$9.generateWorker = function(e$11, a$2, t$7) { var o$10 = new n$9(a$2.streamFiles, t$7, a$2.platform, a$2.encodeFileName), h$5 = 0; try { e$11.forEach(function(e$12, t$8) { h$5++; - var r$11 = function(e$13, t$9) { - var r$12 = e$13 || t$9, n$11 = u$4[r$12]; - if (!n$11) throw new Error(r$12 + " is not a valid compression method !"); + var r$10 = function(e$13, t$9) { + var r$11 = e$13 || t$9, n$11 = u$4[r$11]; + if (!n$11) throw new Error(r$11 + " is not a valid compression method !"); return n$11; }(t$8.options.compression, a$2.compression), n$10 = t$8.options.compressionOptions || a$2.compressionOptions || {}, i$7 = t$8.dir, s$5 = t$8.date; - t$8._compressWorker(r$11, n$10).withStreamInfo("file", { + t$8._compressWorker(r$10, n$10).withStreamInfo("file", { name: e$12, dir: i$7, date: s$5, @@ -36077,7 +36281,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../compressions": 3, "./ZipFileWorker": 8 }], - 10: [function(e$10, t$6, r$10) { + 10: [function(e$10, t$6, r$9) { "use strict"; function n$9() { if (!(this instanceof n$9)) return new n$9(); @@ -36098,16 +36302,16 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./object": 15, "./support": 30 }], - 11: [function(e$10, t$6, r$10) { + 11: [function(e$10, t$6, r$9) { "use strict"; var u$4 = e$10("./utils"), i$7 = e$10("./external"), n$9 = e$10("./utf8"), s$5 = e$10("./zipEntries"), a$2 = e$10("./stream/Crc32Probe"), l$3 = e$10("./nodejsUtils"); function f$4(n$10) { return new i$7.Promise(function(e$11, t$7) { - var r$11 = n$10.decompressed.getContentWorker().pipe(new a$2()); - r$11.on("error", function(e$12) { + var r$10 = n$10.decompressed.getContentWorker().pipe(new a$2()); + r$10.on("error", function(e$12) { t$7(e$12); }).on("end", function() { - r$11.streamInfo.crc32 !== n$10.decompressed.crc32 ? t$7(new Error("Corrupted zip : CRC32 mismatch")) : e$11(); + r$10.streamInfo.crc32 !== n$10.decompressed.crc32 ? t$7(new Error("Corrupted zip : CRC32 mismatch")) : e$11(); }).resume(); }); } @@ -36123,12 +36327,12 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var t$7 = new s$5(o$10); return t$7.load(e$12), t$7; }).then(function(e$12) { - var t$7 = [i$7.Promise.resolve(e$12)], r$11 = e$12.files; - if (o$10.checkCRC32) for (var n$10 = 0; n$10 < r$11.length; n$10++) t$7.push(f$4(r$11[n$10])); + var t$7 = [i$7.Promise.resolve(e$12)], r$10 = e$12.files; + if (o$10.checkCRC32) for (var n$10 = 0; n$10 < r$10.length; n$10++) t$7.push(f$4(r$10[n$10])); return i$7.Promise.all(t$7); }).then(function(e$12) { - for (var t$7 = e$12.shift(), r$11 = t$7.files, n$10 = 0; n$10 < r$11.length; n$10++) { - var i$8 = r$11[n$10], s$6 = i$8.fileNameStr, a$3 = u$4.resolve(i$8.fileNameStr); + for (var t$7 = e$12.shift(), r$10 = t$7.files, n$10 = 0; n$10 < r$10.length; n$10++) { + var i$8 = r$10[n$10], s$6 = i$8.fileNameStr, a$3 = u$4.resolve(i$8.fileNameStr); h$5.file(a$3, i$8.decompressed, { binary: !0, optimizedBinaryString: !0, @@ -36151,7 +36355,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./utils": 32, "./zipEntries": 33 }], - 12: [function(e$10, t$6, r$10) { + 12: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("../utils"), i$7 = e$10("../stream/GenericWorker"); function s$5(e$11, t$7) { @@ -36178,14 +36382,14 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../stream/GenericWorker": 28, "../utils": 32 }], - 13: [function(e$10, t$6, r$10) { + 13: [function(e$10, t$6, r$9) { "use strict"; var i$7 = e$10("readable-stream").Readable; - function n$9(e$11, t$7, r$11) { + function n$9(e$11, t$7, r$10) { i$7.call(this, t$7), this._helper = e$11; var n$10 = this; e$11.on("data", function(e$12, t$8) { - n$10.push(e$12) || n$10._helper.pause(), r$11 && r$11(t$8); + n$10.push(e$12) || n$10._helper.pause(), r$10 && r$10(t$8); }).on("error", function(e$12) { n$10.emit("error", e$12); }).on("end", function() { @@ -36199,7 +36403,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "readable-stream": 16 }], - 14: [function(e$10, t$6, r$10) { + 14: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = { isNode: "undefined" != typeof Buffer, @@ -36221,19 +36425,19 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; }, {}], - 15: [function(e$10, t$6, r$10) { + 15: [function(e$10, t$6, r$9) { "use strict"; - function s$5(e$11, t$7, r$11) { - var n$10, i$8 = u$4.getTypeOf(t$7), s$6 = u$4.extend(r$11 || {}, f$4); + function s$5(e$11, t$7, r$10) { + var n$10, i$8 = u$4.getTypeOf(t$7), s$6 = u$4.extend(r$10 || {}, f$4); s$6.date = s$6.date || new Date(), null !== s$6.compression && (s$6.compression = s$6.compression.toUpperCase()), "string" == typeof s$6.unixPermissions && (s$6.unixPermissions = parseInt(s$6.unixPermissions, 8)), s$6.unixPermissions && 16384 & s$6.unixPermissions && (s$6.dir = !0), s$6.dosPermissions && 16 & s$6.dosPermissions && (s$6.dir = !0), s$6.dir && (e$11 = g$1(e$11)), s$6.createFolders && (n$10 = _$2(e$11)) && b$3.call(this, n$10, !0); var a$3 = "string" === i$8 && !1 === s$6.binary && !1 === s$6.base64; - r$11 && void 0 !== r$11.binary || (s$6.binary = !a$3), (t$7 instanceof c$7 && 0 === t$7.uncompressedSize || s$6.dir || !t$7 || 0 === t$7.length) && (s$6.base64 = !1, s$6.binary = !0, t$7 = "", s$6.compression = "STORE", i$8 = "string"); + r$10 && void 0 !== r$10.binary || (s$6.binary = !a$3), (t$7 instanceof c$6 && 0 === t$7.uncompressedSize || s$6.dir || !t$7 || 0 === t$7.length) && (s$6.base64 = !1, s$6.binary = !0, t$7 = "", s$6.compression = "STORE", i$8 = "string"); var o$11 = null; - o$11 = t$7 instanceof c$7 || t$7 instanceof l$3 ? t$7 : p$3.isNode && p$3.isStream(t$7) ? new m$3(e$11, t$7) : u$4.prepareContent(e$11, t$7, s$6.binary, s$6.optimizedBinaryString, s$6.base64); - var h$6 = new d$5(e$11, o$11, s$6); + o$11 = t$7 instanceof c$6 || t$7 instanceof l$3 ? t$7 : p$3.isNode && p$3.isStream(t$7) ? new m$3(e$11, t$7) : u$4.prepareContent(e$11, t$7, s$6.binary, s$6.optimizedBinaryString, s$6.base64); + var h$6 = new d$4(e$11, o$11, s$6); this.files[e$11] = h$6; } - var i$7 = e$10("./utf8"), u$4 = e$10("./utils"), l$3 = e$10("./stream/GenericWorker"), a$2 = e$10("./stream/StreamHelper"), f$4 = e$10("./defaults"), c$7 = e$10("./compressedObject"), d$5 = e$10("./zipObject"), o$10 = e$10("./generate"), p$3 = e$10("./nodejsUtils"), m$3 = e$10("./nodejs/NodejsStreamInputAdapter"), _$2 = function(e$11) { + var i$7 = e$10("./utf8"), u$4 = e$10("./utils"), l$3 = e$10("./stream/GenericWorker"), a$2 = e$10("./stream/StreamHelper"), f$4 = e$10("./defaults"), c$6 = e$10("./compressedObject"), d$4 = e$10("./zipObject"), o$10 = e$10("./generate"), p$3 = e$10("./nodejsUtils"), m$3 = e$10("./nodejs/NodejsStreamInputAdapter"), _$2 = function(e$11) { "/" === e$11.slice(-1) && (e$11 = e$11.substring(0, e$11.length - 1)); var t$7 = e$11.lastIndexOf("/"); return 0 < t$7 ? e$11.substring(0, t$7) : ""; @@ -36253,17 +36457,17 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { throw new Error("This method has been removed in JSZip 3.0, please check the upgrade guide."); }, forEach: function(e$11) { - var t$7, r$11, n$10; - for (t$7 in this.files) n$10 = this.files[t$7], (r$11 = t$7.slice(this.root.length, t$7.length)) && t$7.slice(0, this.root.length) === this.root && e$11(r$11, n$10); + var t$7, r$10, n$10; + for (t$7 in this.files) n$10 = this.files[t$7], (r$10 = t$7.slice(this.root.length, t$7.length)) && t$7.slice(0, this.root.length) === this.root && e$11(r$10, n$10); }, - filter: function(r$11) { + filter: function(r$10) { var n$10 = []; return this.forEach(function(e$11, t$7) { - r$11(e$11, t$7) && n$10.push(t$7); + r$10(e$11, t$7) && n$10.push(t$7); }), n$10; }, - file: function(e$11, t$7, r$11) { - if (1 !== arguments.length) return e$11 = this.root + e$11, s$5.call(this, e$11, t$7, r$11), this; + file: function(e$11, t$7, r$10) { + if (1 !== arguments.length) return e$11 = this.root + e$11, s$5.call(this, e$11, t$7, r$10), this; if (h$5(e$11)) { var n$10 = e$11; return this.filter(function(e$12, t$8) { @@ -36273,20 +36477,20 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var i$8 = this.files[this.root + e$11]; return i$8 && !i$8.dir ? i$8 : null; }, - folder: function(r$11) { - if (!r$11) return this; - if (h$5(r$11)) return this.filter(function(e$12, t$8) { - return t$8.dir && r$11.test(e$12); + folder: function(r$10) { + if (!r$10) return this; + if (h$5(r$10)) return this.filter(function(e$12, t$8) { + return t$8.dir && r$10.test(e$12); }); - var e$11 = this.root + r$11, t$7 = b$3.call(this, e$11), n$10 = this.clone(); + var e$11 = this.root + r$10, t$7 = b$3.call(this, e$11), n$10 = this.clone(); return n$10.root = t$7.name, n$10; }, - remove: function(r$11) { - r$11 = this.root + r$11; - var e$11 = this.files[r$11]; - if (e$11 || ("/" !== r$11.slice(-1) && (r$11 += "/"), e$11 = this.files[r$11]), e$11 && !e$11.dir) delete this.files[r$11]; + remove: function(r$10) { + r$10 = this.root + r$10; + var e$11 = this.files[r$10]; + if (e$11 || ("/" !== r$10.slice(-1) && (r$10 += "/"), e$11 = this.files[r$10]), e$11 && !e$11.dir) delete this.files[r$10]; else for (var t$7 = this.filter(function(e$12, t$8) { - return t$8.name.slice(0, r$11.length) === r$11; + return t$8.name.slice(0, r$10.length) === r$10; }), n$10 = 0; n$10 < t$7.length; n$10++) delete this.files[t$7[n$10].name]; return this; }, @@ -36294,9 +36498,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { throw new Error("This method has been removed in JSZip 3.0, please check the upgrade guide."); }, generateInternalStream: function(e$11) { - var t$7, r$11 = {}; + var t$7, r$10 = {}; try { - if ((r$11 = u$4.extend(e$11 || {}, { + if ((r$10 = u$4.extend(e$11 || {}, { streamFiles: !1, compression: "STORE", compressionOptions: null, @@ -36305,14 +36509,14 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { comment: null, mimeType: "application/zip", encodeFileName: i$7.utf8encode - })).type = r$11.type.toLowerCase(), r$11.compression = r$11.compression.toUpperCase(), "binarystring" === r$11.type && (r$11.type = "string"), !r$11.type) throw new Error("No output type specified."); - u$4.checkSupport(r$11.type), "darwin" !== r$11.platform && "freebsd" !== r$11.platform && "linux" !== r$11.platform && "sunos" !== r$11.platform || (r$11.platform = "UNIX"), "win32" === r$11.platform && (r$11.platform = "DOS"); - var n$10 = r$11.comment || this.comment || ""; - t$7 = o$10.generateWorker(this, r$11, n$10); + })).type = r$10.type.toLowerCase(), r$10.compression = r$10.compression.toUpperCase(), "binarystring" === r$10.type && (r$10.type = "string"), !r$10.type) throw new Error("No output type specified."); + u$4.checkSupport(r$10.type), "darwin" !== r$10.platform && "freebsd" !== r$10.platform && "linux" !== r$10.platform && "sunos" !== r$10.platform || (r$10.platform = "UNIX"), "win32" === r$10.platform && (r$10.platform = "DOS"); + var n$10 = r$10.comment || this.comment || ""; + t$7 = o$10.generateWorker(this, r$10, n$10); } catch (e$12) { (t$7 = new l$3("error")).error(e$12); } - return new a$2(t$7, r$11.type || "string", r$11.mimeType); + return new a$2(t$7, r$10.type || "string", r$10.mimeType); }, generateAsync: function(e$11, t$7) { return this.generateInternalStream(e$11).accumulate(t$7); @@ -36334,11 +36538,11 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./utils": 32, "./zipObject": 35 }], - 16: [function(e$10, t$6, r$10) { + 16: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = e$10("stream"); }, { stream: void 0 }], - 17: [function(e$10, t$6, r$10) { + 17: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./DataReader"); function i$7(e$11) { @@ -36348,11 +36552,11 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { e$10("../utils").inherits(i$7, n$9), i$7.prototype.byteAt = function(e$11) { return this.data[this.zero + e$11]; }, i$7.prototype.lastIndexOfSignature = function(e$11) { - for (var t$7 = e$11.charCodeAt(0), r$11 = e$11.charCodeAt(1), n$10 = e$11.charCodeAt(2), i$8 = e$11.charCodeAt(3), s$5 = this.length - 4; 0 <= s$5; --s$5) if (this.data[s$5] === t$7 && this.data[s$5 + 1] === r$11 && this.data[s$5 + 2] === n$10 && this.data[s$5 + 3] === i$8) return s$5 - this.zero; + for (var t$7 = e$11.charCodeAt(0), r$10 = e$11.charCodeAt(1), n$10 = e$11.charCodeAt(2), i$8 = e$11.charCodeAt(3), s$5 = this.length - 4; 0 <= s$5; --s$5) if (this.data[s$5] === t$7 && this.data[s$5 + 1] === r$10 && this.data[s$5 + 2] === n$10 && this.data[s$5 + 3] === i$8) return s$5 - this.zero; return -1; }, i$7.prototype.readAndCheckSignature = function(e$11) { - var t$7 = e$11.charCodeAt(0), r$11 = e$11.charCodeAt(1), n$10 = e$11.charCodeAt(2), i$8 = e$11.charCodeAt(3), s$5 = this.readData(4); - return t$7 === s$5[0] && r$11 === s$5[1] && n$10 === s$5[2] && i$8 === s$5[3]; + var t$7 = e$11.charCodeAt(0), r$10 = e$11.charCodeAt(1), n$10 = e$11.charCodeAt(2), i$8 = e$11.charCodeAt(3), s$5 = this.readData(4); + return t$7 === s$5[0] && r$10 === s$5[1] && n$10 === s$5[2] && i$8 === s$5[3]; }, i$7.prototype.readData = function(e$11) { if (this.checkOffset(e$11), 0 === e$11) return []; var t$7 = this.data.slice(this.zero + this.index, this.zero + this.index + e$11); @@ -36362,7 +36566,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./DataReader": 18 }], - 18: [function(e$10, t$6, r$10) { + 18: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("../utils"); function i$7(e$11) { @@ -36383,9 +36587,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, byteAt: function() {}, readInt: function(e$11) { - var t$7, r$11 = 0; - for (this.checkOffset(e$11), t$7 = this.index + e$11 - 1; t$7 >= this.index; t$7--) r$11 = (r$11 << 8) + this.byteAt(t$7); - return this.index += e$11, r$11; + var t$7, r$10 = 0; + for (this.checkOffset(e$11), t$7 = this.index + e$11 - 1; t$7 >= this.index; t$7--) r$10 = (r$10 << 8) + this.byteAt(t$7); + return this.index += e$11, r$10; }, readString: function(e$11) { return n$9.transformTo("string", this.readData(e$11)); @@ -36399,7 +36603,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, t$6.exports = i$7; }, { "../utils": 32 }], - 19: [function(e$10, t$6, r$10) { + 19: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./Uint8ArrayReader"); function i$7(e$11) { @@ -36414,7 +36618,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./Uint8ArrayReader": 21 }], - 20: [function(e$10, t$6, r$10) { + 20: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./DataReader"); function i$7(e$11) { @@ -36435,7 +36639,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./DataReader": 18 }], - 21: [function(e$10, t$6, r$10) { + 21: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./ArrayReader"); function i$7(e$11) { @@ -36450,7 +36654,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./ArrayReader": 17 }], - 22: [function(e$10, t$6, r$10) { + 22: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("../utils"), i$7 = e$10("../support"), s$5 = e$10("./ArrayReader"), a$2 = e$10("./StringReader"), o$10 = e$10("./NodeBufferReader"), h$5 = e$10("./Uint8ArrayReader"); t$6.exports = function(e$11) { @@ -36465,11 +36669,11 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./StringReader": 20, "./Uint8ArrayReader": 21 }], - 23: [function(e$10, t$6, r$10) { + 23: [function(e$10, t$6, r$9) { "use strict"; - r$10.LOCAL_FILE_HEADER = "PK", r$10.CENTRAL_FILE_HEADER = "PK", r$10.CENTRAL_DIRECTORY_END = "PK", r$10.ZIP64_CENTRAL_DIRECTORY_LOCATOR = "PK\x07", r$10.ZIP64_CENTRAL_DIRECTORY_END = "PK", r$10.DATA_DESCRIPTOR = "PK\x07\b"; + r$9.LOCAL_FILE_HEADER = "PK", r$9.CENTRAL_FILE_HEADER = "PK", r$9.CENTRAL_DIRECTORY_END = "PK", r$9.ZIP64_CENTRAL_DIRECTORY_LOCATOR = "PK\x07", r$9.ZIP64_CENTRAL_DIRECTORY_END = "PK", r$9.DATA_DESCRIPTOR = "PK\x07\b"; }, {}], - 24: [function(e$10, t$6, r$10) { + 24: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./GenericWorker"), i$7 = e$10("../utils"); function s$5(e$11) { @@ -36485,7 +36689,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./GenericWorker": 28 }], - 25: [function(e$10, t$6, r$10) { + 25: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./GenericWorker"), i$7 = e$10("../crc32"); function s$5() { @@ -36499,7 +36703,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./GenericWorker": 28 }], - 26: [function(e$10, t$6, r$10) { + 26: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("../utils"), i$7 = e$10("./GenericWorker"); function s$5(e$11) { @@ -36516,7 +36720,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./GenericWorker": 28 }], - 27: [function(e$10, t$6, r$10) { + 27: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("../utils"), i$7 = e$10("./GenericWorker"); function s$5(e$11) { @@ -36557,7 +36761,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "../utils": 32, "./GenericWorker": 28 }], - 28: [function(e$10, t$6, r$10) { + 28: [function(e$10, t$6, r$9) { "use strict"; function n$9(e$11) { this.name = e$11 || "default", this.streamInfo = {}, this.generatedError = null, this.extraStreamInfo = {}, this.isPaused = !0, this.isFinished = !1, this.isLocked = !1, this._listeners = { @@ -36590,7 +36794,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.streamInfo = this.generatedError = this.extraStreamInfo = null, this._listeners = []; }, emit: function(e$11, t$7) { - if (this._listeners[e$11]) for (var r$11 = 0; r$11 < this._listeners[e$11].length; r$11++) this._listeners[e$11][r$11].call(this, t$7); + if (this._listeners[e$11]) for (var r$10 = 0; r$10 < this._listeners[e$11].length; r$10++) this._listeners[e$11][r$10].call(this, t$7); }, pipe: function(e$11) { return e$11.registerPrevious(this); @@ -36635,35 +36839,35 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, t$6.exports = n$9; }, {}], - 29: [function(e$10, t$6, r$10) { + 29: [function(e$10, t$6, r$9) { "use strict"; var h$5 = e$10("../utils"), i$7 = e$10("./ConvertWorker"), s$5 = e$10("./GenericWorker"), u$4 = e$10("../base64"), n$9 = e$10("../support"), a$2 = e$10("../external"), o$10 = null; if (n$9.nodestream) try { o$10 = e$10("../nodejs/NodejsStreamOutputAdapter"); } catch (e$11) {} function l$3(e$11, o$11) { - return new a$2.Promise(function(t$7, r$11) { + return new a$2.Promise(function(t$7, r$10) { var n$10 = [], i$8 = e$11._internalType, s$6 = e$11._outputType, a$3 = e$11._mimeType; e$11.on("data", function(e$12, t$8) { n$10.push(e$12), o$11 && o$11(t$8); }).on("error", function(e$12) { - n$10 = [], r$11(e$12); + n$10 = [], r$10(e$12); }).on("end", function() { try { - var e$12 = function(e$13, t$8, r$12) { + var e$12 = function(e$13, t$8, r$11) { switch (e$13) { - case "blob": return h$5.newBlob(h$5.transformTo("arraybuffer", t$8), r$12); + case "blob": return h$5.newBlob(h$5.transformTo("arraybuffer", t$8), r$11); case "base64": return u$4.encode(t$8); default: return h$5.transformTo(e$13, t$8); } }(s$6, function(e$13, t$8) { - var r$12, n$11 = 0, i$9 = null, s$7 = 0; - for (r$12 = 0; r$12 < t$8.length; r$12++) s$7 += t$8[r$12].length; + var r$11, n$11 = 0, i$9 = null, s$7 = 0; + for (r$11 = 0; r$11 < t$8.length; r$11++) s$7 += t$8[r$11].length; switch (e$13) { case "string": return t$8.join(""); case "array": return Array.prototype.concat.apply([], t$8); case "uint8array": - for (i$9 = new Uint8Array(s$7), r$12 = 0; r$12 < t$8.length; r$12++) i$9.set(t$8[r$12], n$11), n$11 += t$8[r$12].length; + for (i$9 = new Uint8Array(s$7), r$11 = 0; r$11 < t$8.length; r$11++) i$9.set(t$8[r$11], n$11), n$11 += t$8[r$11].length; return i$9; case "nodebuffer": return Buffer.concat(t$8); default: throw new Error("concat : unsupported type '" + e$13 + "'"); @@ -36671,13 +36875,13 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }(i$8, n$10), a$3); t$7(e$12); } catch (e$13) { - r$11(e$13); + r$10(e$13); } n$10 = []; }).resume(); }); } - function f$4(e$11, t$7, r$11) { + function f$4(e$11, t$7, r$10) { var n$10 = t$7; switch (t$7) { case "blob": @@ -36687,7 +36891,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { case "base64": n$10 = "string"; } try { - this._internalType = n$10, this._outputType = t$7, this._mimeType = r$11, h$5.checkSupport(n$10), this._worker = e$11.pipe(new i$7(n$10)), e$11.lock(); + this._internalType = n$10, this._outputType = t$7, this._mimeType = r$10, h$5.checkSupport(n$10), this._worker = e$11.pipe(new i$7(n$10)), e$11.lock(); } catch (e$12) { this._worker = new s$5("error"), this._worker.error(e$12); } @@ -36697,11 +36901,11 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return l$3(this, e$11); }, on: function(e$11, t$7) { - var r$11 = this; + var r$10 = this; return "data" === e$11 ? this._worker.on(e$11, function(e$12) { - t$7.call(r$11, e$12.data, e$12.meta); + t$7.call(r$10, e$12.data, e$12.meta); }) : this._worker.on(e$11, function() { - h$5.delay(t$7, arguments, r$11); + h$5.delay(t$7, arguments, r$10); }), this; }, resume: function() { @@ -36724,31 +36928,31 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./ConvertWorker": 24, "./GenericWorker": 28 }], - 30: [function(e$10, t$6, r$10) { + 30: [function(e$10, t$6, r$9) { "use strict"; - if (r$10.base64 = !0, r$10.array = !0, r$10.string = !0, r$10.arraybuffer = "undefined" != typeof ArrayBuffer && "undefined" != typeof Uint8Array, r$10.nodebuffer = "undefined" != typeof Buffer, r$10.uint8array = "undefined" != typeof Uint8Array, "undefined" == typeof ArrayBuffer) r$10.blob = !1; + if (r$9.base64 = !0, r$9.array = !0, r$9.string = !0, r$9.arraybuffer = "undefined" != typeof ArrayBuffer && "undefined" != typeof Uint8Array, r$9.nodebuffer = "undefined" != typeof Buffer, r$9.uint8array = "undefined" != typeof Uint8Array, "undefined" == typeof ArrayBuffer) r$9.blob = !1; else { var n$9 = new ArrayBuffer(0); try { - r$10.blob = 0 === new Blob([n$9], { type: "application/zip" }).size; + r$9.blob = 0 === new Blob([n$9], { type: "application/zip" }).size; } catch (e$11) { try { var i$7 = new (self.BlobBuilder || self.WebKitBlobBuilder || self.MozBlobBuilder || self.MSBlobBuilder)(); - i$7.append(n$9), r$10.blob = 0 === i$7.getBlob("application/zip").size; + i$7.append(n$9), r$9.blob = 0 === i$7.getBlob("application/zip").size; } catch (e$12) { - r$10.blob = !1; + r$9.blob = !1; } } } try { - r$10.nodestream = !!e$10("readable-stream").Readable; + r$9.nodestream = !!e$10("readable-stream").Readable; } catch (e$11) { - r$10.nodestream = !1; + r$9.nodestream = !1; } }, { "readable-stream": 16 }], 31: [function(e$10, t$6, s$5) { "use strict"; - for (var o$10 = e$10("./utils"), h$5 = e$10("./support"), r$10 = e$10("./nodejsUtils"), n$9 = e$10("./stream/GenericWorker"), u$4 = new Array(256), i$7 = 0; i$7 < 256; i$7++) u$4[i$7] = 252 <= i$7 ? 6 : 248 <= i$7 ? 5 : 240 <= i$7 ? 4 : 224 <= i$7 ? 3 : 192 <= i$7 ? 2 : 1; + for (var o$10 = e$10("./utils"), h$5 = e$10("./support"), r$9 = e$10("./nodejsUtils"), n$9 = e$10("./stream/GenericWorker"), u$4 = new Array(256), i$7 = 0; i$7 < 256; i$7++) u$4[i$7] = 252 <= i$7 ? 6 : 248 <= i$7 ? 5 : 240 <= i$7 ? 4 : 224 <= i$7 ? 3 : 192 <= i$7 ? 2 : 1; u$4[254] = u$4[254] = 1; function a$2() { n$9.call(this, "utf-8 decode"), this.leftOver = null; @@ -36757,36 +36961,36 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { n$9.call(this, "utf-8 encode"); } s$5.utf8encode = function(e$11) { - return h$5.nodebuffer ? r$10.newBufferFrom(e$11, "utf-8") : function(e$12) { - var t$7, r$11, n$10, i$8, s$6, a$3 = e$12.length, o$11 = 0; - for (i$8 = 0; i$8 < a$3; i$8++) 55296 == (64512 & (r$11 = e$12.charCodeAt(i$8))) && i$8 + 1 < a$3 && 56320 == (64512 & (n$10 = e$12.charCodeAt(i$8 + 1))) && (r$11 = 65536 + (r$11 - 55296 << 10) + (n$10 - 56320), i$8++), o$11 += r$11 < 128 ? 1 : r$11 < 2048 ? 2 : r$11 < 65536 ? 3 : 4; - for (t$7 = h$5.uint8array ? new Uint8Array(o$11) : new Array(o$11), i$8 = s$6 = 0; s$6 < o$11; i$8++) 55296 == (64512 & (r$11 = e$12.charCodeAt(i$8))) && i$8 + 1 < a$3 && 56320 == (64512 & (n$10 = e$12.charCodeAt(i$8 + 1))) && (r$11 = 65536 + (r$11 - 55296 << 10) + (n$10 - 56320), i$8++), r$11 < 128 ? t$7[s$6++] = r$11 : (r$11 < 2048 ? t$7[s$6++] = 192 | r$11 >>> 6 : (r$11 < 65536 ? t$7[s$6++] = 224 | r$11 >>> 12 : (t$7[s$6++] = 240 | r$11 >>> 18, t$7[s$6++] = 128 | r$11 >>> 12 & 63), t$7[s$6++] = 128 | r$11 >>> 6 & 63), t$7[s$6++] = 128 | 63 & r$11); + return h$5.nodebuffer ? r$9.newBufferFrom(e$11, "utf-8") : function(e$12) { + var t$7, r$10, n$10, i$8, s$6, a$3 = e$12.length, o$11 = 0; + for (i$8 = 0; i$8 < a$3; i$8++) 55296 == (64512 & (r$10 = e$12.charCodeAt(i$8))) && i$8 + 1 < a$3 && 56320 == (64512 & (n$10 = e$12.charCodeAt(i$8 + 1))) && (r$10 = 65536 + (r$10 - 55296 << 10) + (n$10 - 56320), i$8++), o$11 += r$10 < 128 ? 1 : r$10 < 2048 ? 2 : r$10 < 65536 ? 3 : 4; + for (t$7 = h$5.uint8array ? new Uint8Array(o$11) : new Array(o$11), i$8 = s$6 = 0; s$6 < o$11; i$8++) 55296 == (64512 & (r$10 = e$12.charCodeAt(i$8))) && i$8 + 1 < a$3 && 56320 == (64512 & (n$10 = e$12.charCodeAt(i$8 + 1))) && (r$10 = 65536 + (r$10 - 55296 << 10) + (n$10 - 56320), i$8++), r$10 < 128 ? t$7[s$6++] = r$10 : (r$10 < 2048 ? t$7[s$6++] = 192 | r$10 >>> 6 : (r$10 < 65536 ? t$7[s$6++] = 224 | r$10 >>> 12 : (t$7[s$6++] = 240 | r$10 >>> 18, t$7[s$6++] = 128 | r$10 >>> 12 & 63), t$7[s$6++] = 128 | r$10 >>> 6 & 63), t$7[s$6++] = 128 | 63 & r$10); return t$7; }(e$11); }, s$5.utf8decode = function(e$11) { return h$5.nodebuffer ? o$10.transformTo("nodebuffer", e$11).toString("utf-8") : function(e$12) { - var t$7, r$11, n$10, i$8, s$6 = e$12.length, a$3 = new Array(2 * s$6); - for (t$7 = r$11 = 0; t$7 < s$6;) if ((n$10 = e$12[t$7++]) < 128) a$3[r$11++] = n$10; - else if (4 < (i$8 = u$4[n$10])) a$3[r$11++] = 65533, t$7 += i$8 - 1; + var t$7, r$10, n$10, i$8, s$6 = e$12.length, a$3 = new Array(2 * s$6); + for (t$7 = r$10 = 0; t$7 < s$6;) if ((n$10 = e$12[t$7++]) < 128) a$3[r$10++] = n$10; + else if (4 < (i$8 = u$4[n$10])) a$3[r$10++] = 65533, t$7 += i$8 - 1; else { for (n$10 &= 2 === i$8 ? 31 : 3 === i$8 ? 15 : 7; 1 < i$8 && t$7 < s$6;) n$10 = n$10 << 6 | 63 & e$12[t$7++], i$8--; - 1 < i$8 ? a$3[r$11++] = 65533 : n$10 < 65536 ? a$3[r$11++] = n$10 : (n$10 -= 65536, a$3[r$11++] = 55296 | n$10 >> 10 & 1023, a$3[r$11++] = 56320 | 1023 & n$10); + 1 < i$8 ? a$3[r$10++] = 65533 : n$10 < 65536 ? a$3[r$10++] = n$10 : (n$10 -= 65536, a$3[r$10++] = 55296 | n$10 >> 10 & 1023, a$3[r$10++] = 56320 | 1023 & n$10); } - return a$3.length !== r$11 && (a$3.subarray ? a$3 = a$3.subarray(0, r$11) : a$3.length = r$11), o$10.applyFromCharCode(a$3); + return a$3.length !== r$10 && (a$3.subarray ? a$3 = a$3.subarray(0, r$10) : a$3.length = r$10), o$10.applyFromCharCode(a$3); }(e$11 = o$10.transformTo(h$5.uint8array ? "uint8array" : "array", e$11)); }, o$10.inherits(a$2, n$9), a$2.prototype.processChunk = function(e$11) { var t$7 = o$10.transformTo(h$5.uint8array ? "uint8array" : "array", e$11.data); if (this.leftOver && this.leftOver.length) { if (h$5.uint8array) { - var r$11 = t$7; - (t$7 = new Uint8Array(r$11.length + this.leftOver.length)).set(this.leftOver, 0), t$7.set(r$11, this.leftOver.length); + var r$10 = t$7; + (t$7 = new Uint8Array(r$10.length + this.leftOver.length)).set(this.leftOver, 0), t$7.set(r$10, this.leftOver.length); } else t$7 = this.leftOver.concat(t$7); this.leftOver = null; } var n$10 = function(e$12, t$8) { - var r$12; - for ((t$8 = t$8 || e$12.length) > e$12.length && (t$8 = e$12.length), r$12 = t$8 - 1; 0 <= r$12 && 128 == (192 & e$12[r$12]);) r$12--; - return r$12 < 0 ? t$8 : 0 === r$12 ? t$8 : r$12 + u$4[e$12[r$12]] > t$8 ? r$12 : t$8; + var r$11; + for ((t$8 = t$8 || e$12.length) > e$12.length && (t$8 = e$12.length), r$11 = t$8 - 1; 0 <= r$11 && 128 == (192 & e$12[r$11]);) r$11--; + return r$11 < 0 ? t$8 : 0 === r$11 ? t$8 : r$11 + u$4[e$12[r$11]] > t$8 ? r$11 : t$8; }(t$7), i$8 = t$7; n$10 !== t$7.length && (h$5.uint8array ? (i$8 = t$7.subarray(0, n$10), this.leftOver = t$7.subarray(n$10, t$7.length)) : (i$8 = t$7.slice(0, n$10), this.leftOver = t$7.slice(n$10, t$7.length))), this.push({ data: s$5.utf8decode(i$8), @@ -36811,36 +37015,36 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }], 32: [function(e$10, t$6, a$2) { "use strict"; - var o$10 = e$10("./support"), h$5 = e$10("./base64"), r$10 = e$10("./nodejsUtils"), u$4 = e$10("./external"); + var o$10 = e$10("./support"), h$5 = e$10("./base64"), r$9 = e$10("./nodejsUtils"), u$4 = e$10("./external"); function n$9(e$11) { return e$11; } function l$3(e$11, t$7) { - for (var r$11 = 0; r$11 < e$11.length; ++r$11) t$7[r$11] = 255 & e$11.charCodeAt(r$11); + for (var r$10 = 0; r$10 < e$11.length; ++r$10) t$7[r$10] = 255 & e$11.charCodeAt(r$10); return t$7; } - e$10("setimmediate"), a$2.newBlob = function(t$7, r$11) { + e$10("setimmediate"), a$2.newBlob = function(t$7, r$10) { a$2.checkSupport("blob"); try { - return new Blob([t$7], { type: r$11 }); + return new Blob([t$7], { type: r$10 }); } catch (e$11) { try { var n$10 = new (self.BlobBuilder || self.WebKitBlobBuilder || self.MozBlobBuilder || self.MSBlobBuilder)(); - return n$10.append(t$7), n$10.getBlob(r$11); + return n$10.append(t$7), n$10.getBlob(r$10); } catch (e$12) { throw new Error("Bug : can't construct the Blob."); } } }; var i$7 = { - stringifyByChunk: function(e$11, t$7, r$11) { + stringifyByChunk: function(e$11, t$7, r$10) { var n$10 = [], i$8 = 0, s$6 = e$11.length; - if (s$6 <= r$11) return String.fromCharCode.apply(null, e$11); - for (; i$8 < s$6;) "array" === t$7 || "nodebuffer" === t$7 ? n$10.push(String.fromCharCode.apply(null, e$11.slice(i$8, Math.min(i$8 + r$11, s$6)))) : n$10.push(String.fromCharCode.apply(null, e$11.subarray(i$8, Math.min(i$8 + r$11, s$6)))), i$8 += r$11; + if (s$6 <= r$10) return String.fromCharCode.apply(null, e$11); + for (; i$8 < s$6;) "array" === t$7 || "nodebuffer" === t$7 ? n$10.push(String.fromCharCode.apply(null, e$11.slice(i$8, Math.min(i$8 + r$10, s$6)))) : n$10.push(String.fromCharCode.apply(null, e$11.subarray(i$8, Math.min(i$8 + r$10, s$6)))), i$8 += r$10; return n$10.join(""); }, stringifyByChar: function(e$11) { - for (var t$7 = "", r$11 = 0; r$11 < e$11.length; r$11++) t$7 += String.fromCharCode(e$11[r$11]); + for (var t$7 = "", r$10 = 0; r$10 < e$11.length; r$10++) t$7 += String.fromCharCode(e$11[r$10]); return t$7; }, applyCanBeUsed: { @@ -36853,7 +37057,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }(), nodebuffer: function() { try { - return o$10.nodebuffer && 1 === String.fromCharCode.apply(null, r$10.allocBuffer(1)).length; + return o$10.nodebuffer && 1 === String.fromCharCode.apply(null, r$9.allocBuffer(1)).length; } catch (e$11) { return !1; } @@ -36861,35 +37065,35 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; function s$5(e$11) { - var t$7 = 65536, r$11 = a$2.getTypeOf(e$11), n$10 = !0; - if ("uint8array" === r$11 ? n$10 = i$7.applyCanBeUsed.uint8array : "nodebuffer" === r$11 && (n$10 = i$7.applyCanBeUsed.nodebuffer), n$10) for (; 1 < t$7;) try { - return i$7.stringifyByChunk(e$11, r$11, t$7); + var t$7 = 65536, r$10 = a$2.getTypeOf(e$11), n$10 = !0; + if ("uint8array" === r$10 ? n$10 = i$7.applyCanBeUsed.uint8array : "nodebuffer" === r$10 && (n$10 = i$7.applyCanBeUsed.nodebuffer), n$10) for (; 1 < t$7;) try { + return i$7.stringifyByChunk(e$11, r$10, t$7); } catch (e$12) { t$7 = Math.floor(t$7 / 2); } return i$7.stringifyByChar(e$11); } function f$4(e$11, t$7) { - for (var r$11 = 0; r$11 < e$11.length; r$11++) t$7[r$11] = e$11[r$11]; + for (var r$10 = 0; r$10 < e$11.length; r$10++) t$7[r$10] = e$11[r$10]; return t$7; } a$2.applyFromCharCode = s$5; - var c$7 = {}; - c$7.string = { + var c$6 = {}; + c$6.string = { string: n$9, array: function(e$11) { return l$3(e$11, new Array(e$11.length)); }, arraybuffer: function(e$11) { - return c$7.string.uint8array(e$11).buffer; + return c$6.string.uint8array(e$11).buffer; }, uint8array: function(e$11) { return l$3(e$11, new Uint8Array(e$11.length)); }, nodebuffer: function(e$11) { - return l$3(e$11, r$10.allocBuffer(e$11.length)); + return l$3(e$11, r$9.allocBuffer(e$11.length)); } - }, c$7.array = { + }, c$6.array = { string: s$5, array: n$9, arraybuffer: function(e$11) { @@ -36899,9 +37103,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return new Uint8Array(e$11); }, nodebuffer: function(e$11) { - return r$10.newBufferFrom(e$11); + return r$9.newBufferFrom(e$11); } - }, c$7.arraybuffer = { + }, c$6.arraybuffer = { string: function(e$11) { return s$5(new Uint8Array(e$11)); }, @@ -36913,9 +37117,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return new Uint8Array(e$11); }, nodebuffer: function(e$11) { - return r$10.newBufferFrom(new Uint8Array(e$11)); + return r$9.newBufferFrom(new Uint8Array(e$11)); } - }, c$7.uint8array = { + }, c$6.uint8array = { string: s$5, array: function(e$11) { return f$4(e$11, new Array(e$11.length)); @@ -36925,15 +37129,15 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, uint8array: n$9, nodebuffer: function(e$11) { - return r$10.newBufferFrom(e$11); + return r$9.newBufferFrom(e$11); } - }, c$7.nodebuffer = { + }, c$6.nodebuffer = { string: s$5, array: function(e$11) { return f$4(e$11, new Array(e$11.length)); }, arraybuffer: function(e$11) { - return c$7.nodebuffer.uint8array(e$11).buffer; + return c$6.nodebuffer.uint8array(e$11).buffer; }, uint8array: function(e$11) { return f$4(e$11, new Uint8Array(e$11.length)); @@ -36942,48 +37146,48 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, a$2.transformTo = function(e$11, t$7) { if (t$7 = t$7 || "", !e$11) return t$7; a$2.checkSupport(e$11); - var r$11 = a$2.getTypeOf(t$7); - return c$7[r$11][e$11](t$7); + var r$10 = a$2.getTypeOf(t$7); + return c$6[r$10][e$11](t$7); }, a$2.resolve = function(e$11) { - for (var t$7 = e$11.split("/"), r$11 = [], n$10 = 0; n$10 < t$7.length; n$10++) { + for (var t$7 = e$11.split("/"), r$10 = [], n$10 = 0; n$10 < t$7.length; n$10++) { var i$8 = t$7[n$10]; - "." === i$8 || "" === i$8 && 0 !== n$10 && n$10 !== t$7.length - 1 || (".." === i$8 ? r$11.pop() : r$11.push(i$8)); + "." === i$8 || "" === i$8 && 0 !== n$10 && n$10 !== t$7.length - 1 || (".." === i$8 ? r$10.pop() : r$10.push(i$8)); } - return r$11.join("/"); + return r$10.join("/"); }, a$2.getTypeOf = function(e$11) { - return "string" == typeof e$11 ? "string" : "[object Array]" === Object.prototype.toString.call(e$11) ? "array" : o$10.nodebuffer && r$10.isBuffer(e$11) ? "nodebuffer" : o$10.uint8array && e$11 instanceof Uint8Array ? "uint8array" : o$10.arraybuffer && e$11 instanceof ArrayBuffer ? "arraybuffer" : void 0; + return "string" == typeof e$11 ? "string" : "[object Array]" === Object.prototype.toString.call(e$11) ? "array" : o$10.nodebuffer && r$9.isBuffer(e$11) ? "nodebuffer" : o$10.uint8array && e$11 instanceof Uint8Array ? "uint8array" : o$10.arraybuffer && e$11 instanceof ArrayBuffer ? "arraybuffer" : void 0; }, a$2.checkSupport = function(e$11) { if (!o$10[e$11.toLowerCase()]) throw new Error(e$11 + " is not supported by this platform"); }, a$2.MAX_VALUE_16BITS = 65535, a$2.MAX_VALUE_32BITS = -1, a$2.pretty = function(e$11) { - var t$7, r$11, n$10 = ""; - for (r$11 = 0; r$11 < (e$11 || "").length; r$11++) n$10 += "\\x" + ((t$7 = e$11.charCodeAt(r$11)) < 16 ? "0" : "") + t$7.toString(16).toUpperCase(); + var t$7, r$10, n$10 = ""; + for (r$10 = 0; r$10 < (e$11 || "").length; r$10++) n$10 += "\\x" + ((t$7 = e$11.charCodeAt(r$10)) < 16 ? "0" : "") + t$7.toString(16).toUpperCase(); return n$10; - }, a$2.delay = function(e$11, t$7, r$11) { + }, a$2.delay = function(e$11, t$7, r$10) { setImmediate(function() { - e$11.apply(r$11 || null, t$7 || []); + e$11.apply(r$10 || null, t$7 || []); }); }, a$2.inherits = function(e$11, t$7) { - function r$11() {} - r$11.prototype = t$7.prototype, e$11.prototype = new r$11(); + function r$10() {} + r$10.prototype = t$7.prototype, e$11.prototype = new r$10(); }, a$2.extend = function() { - var e$11, t$7, r$11 = {}; - for (e$11 = 0; e$11 < arguments.length; e$11++) for (t$7 in arguments[e$11]) Object.prototype.hasOwnProperty.call(arguments[e$11], t$7) && void 0 === r$11[t$7] && (r$11[t$7] = arguments[e$11][t$7]); - return r$11; - }, a$2.prepareContent = function(r$11, e$11, n$10, i$8, s$6) { + var e$11, t$7, r$10 = {}; + for (e$11 = 0; e$11 < arguments.length; e$11++) for (t$7 in arguments[e$11]) Object.prototype.hasOwnProperty.call(arguments[e$11], t$7) && void 0 === r$10[t$7] && (r$10[t$7] = arguments[e$11][t$7]); + return r$10; + }, a$2.prepareContent = function(r$10, e$11, n$10, i$8, s$6) { return u$4.Promise.resolve(e$11).then(function(n$11) { - return o$10.blob && (n$11 instanceof Blob || -1 !== ["[object File]", "[object Blob]"].indexOf(Object.prototype.toString.call(n$11))) && "undefined" != typeof FileReader ? new u$4.Promise(function(t$7, r$12) { + return o$10.blob && (n$11 instanceof Blob || -1 !== ["[object File]", "[object Blob]"].indexOf(Object.prototype.toString.call(n$11))) && "undefined" != typeof FileReader ? new u$4.Promise(function(t$7, r$11) { var e$12 = new FileReader(); e$12.onload = function(e$13) { t$7(e$13.target.result); }, e$12.onerror = function(e$13) { - r$12(e$13.target.error); + r$11(e$13.target.error); }, e$12.readAsArrayBuffer(n$11); }) : n$11; }).then(function(e$12) { var t$7 = a$2.getTypeOf(e$12); return t$7 ? ("arraybuffer" === t$7 ? e$12 = a$2.transformTo("uint8array", e$12) : "string" === t$7 && (s$6 ? e$12 = h$5.decode(e$12) : n$10 && !0 !== i$8 && (e$12 = function(e$13) { return l$3(e$13, o$10.uint8array ? new Uint8Array(e$13.length) : new Array(e$13.length)); - }(e$12))), e$12) : u$4.Promise.reject(new Error("Can't read the data of '" + r$11 + "'. Is it in a supported JavaScript type (String, Blob, ArrayBuffer, etc) ?")); + }(e$12))), e$12) : u$4.Promise.reject(new Error("Can't read the data of '" + r$10 + "'. Is it in a supported JavaScript type (String, Blob, ArrayBuffer, etc) ?")); }); }; }, { @@ -36993,7 +37197,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./support": 30, setimmediate: 54 }], - 33: [function(e$10, t$6, r$10) { + 33: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./reader/readerFor"), i$7 = e$10("./utils"), s$5 = e$10("./signature"), a$2 = e$10("./zipEntry"), o$10 = e$10("./support"); function h$5(e$11) { @@ -37008,22 +37212,22 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, isSignature: function(e$11, t$7) { - var r$11 = this.reader.index; + var r$10 = this.reader.index; this.reader.setIndex(e$11); var n$10 = this.reader.readString(4) === t$7; - return this.reader.setIndex(r$11), n$10; + return this.reader.setIndex(r$10), n$10; }, readBlockEndOfCentral: function() { this.diskNumber = this.reader.readInt(2), this.diskWithCentralDirStart = this.reader.readInt(2), this.centralDirRecordsOnThisDisk = this.reader.readInt(2), this.centralDirRecords = this.reader.readInt(2), this.centralDirSize = this.reader.readInt(4), this.centralDirOffset = this.reader.readInt(4), this.zipCommentLength = this.reader.readInt(2); - var e$11 = this.reader.readData(this.zipCommentLength), t$7 = o$10.uint8array ? "uint8array" : "array", r$11 = i$7.transformTo(t$7, e$11); - this.zipComment = this.loadOptions.decodeFileName(r$11); + var e$11 = this.reader.readData(this.zipCommentLength), t$7 = o$10.uint8array ? "uint8array" : "array", r$10 = i$7.transformTo(t$7, e$11); + this.zipComment = this.loadOptions.decodeFileName(r$10); }, readBlockZip64EndOfCentral: function() { this.zip64EndOfCentralSize = this.reader.readInt(8), this.reader.skip(4), this.diskNumber = this.reader.readInt(4), this.diskWithCentralDirStart = this.reader.readInt(4), this.centralDirRecordsOnThisDisk = this.reader.readInt(8), this.centralDirRecords = this.reader.readInt(8), this.centralDirSize = this.reader.readInt(8), this.centralDirOffset = this.reader.readInt(8), this.zip64ExtensibleData = {}; - for (var e$11, t$7, r$11, n$10 = this.zip64EndOfCentralSize - 44; 0 < n$10;) e$11 = this.reader.readInt(2), t$7 = this.reader.readInt(4), r$11 = this.reader.readData(t$7), this.zip64ExtensibleData[e$11] = { + for (var e$11, t$7, r$10, n$10 = this.zip64EndOfCentralSize - 44; 0 < n$10;) e$11 = this.reader.readInt(2), t$7 = this.reader.readInt(4), r$10 = this.reader.readData(t$7), this.zip64ExtensibleData[e$11] = { id: e$11, length: t$7, - value: r$11 + value: r$10 }; }, readBlockZip64EndOfCentralLocator: function() { @@ -37048,9 +37252,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (this.reader.setIndex(e$11), this.checkSignature(s$5.ZIP64_CENTRAL_DIRECTORY_LOCATOR), this.readBlockZip64EndOfCentralLocator(), !this.isSignature(this.relativeOffsetEndOfZip64CentralDir, s$5.ZIP64_CENTRAL_DIRECTORY_END) && (this.relativeOffsetEndOfZip64CentralDir = this.reader.lastIndexOfSignature(s$5.ZIP64_CENTRAL_DIRECTORY_END), this.relativeOffsetEndOfZip64CentralDir < 0)) throw new Error("Corrupted zip: can't find the ZIP64 end of central directory"); this.reader.setIndex(this.relativeOffsetEndOfZip64CentralDir), this.checkSignature(s$5.ZIP64_CENTRAL_DIRECTORY_END), this.readBlockZip64EndOfCentral(); } - var r$11 = this.centralDirOffset + this.centralDirSize; - this.zip64 && (r$11 += 20, r$11 += 12 + this.zip64EndOfCentralSize); - var n$10 = t$7 - r$11; + var r$10 = this.centralDirOffset + this.centralDirSize; + this.zip64 && (r$10 += 20, r$10 += 12 + this.zip64EndOfCentralSize); + var n$10 = t$7 - r$10; if (0 < n$10) this.isSignature(t$7, s$5.CENTRAL_FILE_HEADER) || (this.reader.zero = n$10); else if (n$10 < 0) throw new Error("Corrupted zip: missing " + Math.abs(n$10) + " bytes."); }, @@ -37068,7 +37272,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./utils": 32, "./zipEntry": 34 }], - 34: [function(e$10, t$6, r$10) { + 34: [function(e$10, t$6, r$9) { "use strict"; var n$9 = e$10("./reader/readerFor"), s$5 = e$10("./utils"), i$7 = e$10("./compressedObject"), a$2 = e$10("./crc32"), o$10 = e$10("./utf8"), h$5 = e$10("./compressions"), u$4 = e$10("./support"); function l$3(e$11, t$7) { @@ -37082,8 +37286,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return 2048 == (2048 & this.bitFlag); }, readLocalPart: function(e$11) { - var t$7, r$11; - if (e$11.skip(22), this.fileNameLength = e$11.readInt(2), r$11 = e$11.readInt(2), this.fileName = e$11.readData(this.fileNameLength), e$11.skip(r$11), -1 === this.compressedSize || -1 === this.uncompressedSize) throw new Error("Bug or corrupted zip : didn't get enough information from the central directory (compressedSize === -1 || uncompressedSize === -1)"); + var t$7, r$10; + if (e$11.skip(22), this.fileNameLength = e$11.readInt(2), r$10 = e$11.readInt(2), this.fileName = e$11.readData(this.fileNameLength), e$11.skip(r$10), -1 === this.compressedSize || -1 === this.uncompressedSize) throw new Error("Bug or corrupted zip : didn't get enough information from the central directory (compressedSize === -1 || uncompressedSize === -1)"); if (null === (t$7 = function(e$12) { for (var t$8 in h$5) if (Object.prototype.hasOwnProperty.call(h$5, t$8) && h$5[t$8].magic === e$12) return h$5[t$8]; return null; @@ -37108,10 +37312,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, readExtraFields: function(e$11) { - var t$7, r$11, n$10, i$8 = e$11.index + this.extraFieldsLength; - for (this.extraFields || (this.extraFields = {}); e$11.index + 4 < i$8;) t$7 = e$11.readInt(2), r$11 = e$11.readInt(2), n$10 = e$11.readData(r$11), this.extraFields[t$7] = { + var t$7, r$10, n$10, i$8 = e$11.index + this.extraFieldsLength; + for (this.extraFields || (this.extraFields = {}); e$11.index + 4 < i$8;) t$7 = e$11.readInt(2), r$10 = e$11.readInt(2), n$10 = e$11.readData(r$10), this.extraFields[t$7] = { id: t$7, - length: r$11, + length: r$10, value: n$10 }; e$11.setIndex(i$8); @@ -37123,8 +37327,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var t$7 = this.findExtraFieldUnicodePath(); if (null !== t$7) this.fileNameStr = t$7; else { - var r$11 = s$5.transformTo(e$11, this.fileName); - this.fileNameStr = this.loadOptions.decodeFileName(r$11); + var r$10 = s$5.transformTo(e$11, this.fileName); + this.fileNameStr = this.loadOptions.decodeFileName(r$10); } var n$10 = this.findExtraFieldUnicodeComment(); if (null !== n$10) this.fileCommentStr = n$10; @@ -37160,28 +37364,28 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./utf8": 31, "./utils": 32 }], - 35: [function(e$10, t$6, r$10) { + 35: [function(e$10, t$6, r$9) { "use strict"; - function n$9(e$11, t$7, r$11) { - this.name = e$11, this.dir = r$11.dir, this.date = r$11.date, this.comment = r$11.comment, this.unixPermissions = r$11.unixPermissions, this.dosPermissions = r$11.dosPermissions, this._data = t$7, this._dataBinary = r$11.binary, this.options = { - compression: r$11.compression, - compressionOptions: r$11.compressionOptions + function n$9(e$11, t$7, r$10) { + this.name = e$11, this.dir = r$10.dir, this.date = r$10.date, this.comment = r$10.comment, this.unixPermissions = r$10.unixPermissions, this.dosPermissions = r$10.dosPermissions, this._data = t$7, this._dataBinary = r$10.binary, this.options = { + compression: r$10.compression, + compressionOptions: r$10.compressionOptions }; } var s$5 = e$10("./stream/StreamHelper"), i$7 = e$10("./stream/DataWorker"), a$2 = e$10("./utf8"), o$10 = e$10("./compressedObject"), h$5 = e$10("./stream/GenericWorker"); n$9.prototype = { internalStream: function(e$11) { - var t$7 = null, r$11 = "string"; + var t$7 = null, r$10 = "string"; try { if (!e$11) throw new Error("No output type specified."); - var n$10 = "string" === (r$11 = e$11.toLowerCase()) || "text" === r$11; - "binarystring" !== r$11 && "text" !== r$11 || (r$11 = "string"), t$7 = this._decompressWorker(); + var n$10 = "string" === (r$10 = e$11.toLowerCase()) || "text" === r$10; + "binarystring" !== r$10 && "text" !== r$10 || (r$10 = "string"), t$7 = this._decompressWorker(); var i$8 = !this._dataBinary; i$8 && !n$10 && (t$7 = t$7.pipe(new a$2.Utf8EncodeWorker())), !i$8 && n$10 && (t$7 = t$7.pipe(new a$2.Utf8DecodeWorker())); } catch (e$12) { (t$7 = new h$5("error")).error(e$12); } - return new s$5(t$7, r$11, ""); + return new s$5(t$7, r$10, ""); }, async: function(e$11, t$7) { return this.internalStream(e$11).accumulate(t$7); @@ -37191,8 +37395,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, _compressWorker: function(e$11, t$7) { if (this._data instanceof o$10 && this._data.compression.magic === e$11.magic) return this._data.getCompressedWorker(); - var r$11 = this._decompressWorker(); - return this._dataBinary || (r$11 = r$11.pipe(new a$2.Utf8EncodeWorker())), o$10.createWorkerFrom(r$11, e$11, t$7); + var r$10 = this._decompressWorker(); + return this._dataBinary || (r$10 = r$10.pipe(new a$2.Utf8EncodeWorker())), o$10.createWorkerFrom(r$10, e$11, t$7); }, _decompressWorker: function() { return this._data instanceof o$10 ? this._data.getContentWorker() : this._data instanceof h$5 ? this._data : new i$7(this._data); @@ -37218,13 +37422,13 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { 36: [function(e$10, l$3, t$6) { (function(t$7) { "use strict"; - var r$10, n$9, e$11 = t$7.MutationObserver || t$7.WebKitMutationObserver; + var r$9, n$9, e$11 = t$7.MutationObserver || t$7.WebKitMutationObserver; if (e$11) { var i$7 = 0, s$5 = new e$11(u$4), a$2 = t$7.document.createTextNode(""); - s$5.observe(a$2, { characterData: !0 }), r$10 = function() { + s$5.observe(a$2, { characterData: !0 }), r$9 = function() { a$2.data = i$7 = ++i$7 % 2; }; - } else if (t$7.setImmediate || void 0 === t$7.MessageChannel) r$10 = "document" in t$7 && "onreadystatechange" in t$7.document.createElement("script") ? function() { + } else if (t$7.setImmediate || void 0 === t$7.MessageChannel) r$9 = "document" in t$7 && "onreadystatechange" in t$7.document.createElement("script") ? function() { var e$12 = t$7.document.createElement("script"); e$12.onreadystatechange = function() { u$4(), e$12.onreadystatechange = null, e$12.parentNode.removeChild(e$12), e$12 = null; @@ -37234,7 +37438,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; else { var o$10 = new t$7.MessageChannel(); - o$10.port1.onmessage = u$4, r$10 = function() { + o$10.port1.onmessage = u$4, r$9 = function() { o$10.port2.postMessage(0); }; } @@ -37242,53 +37446,53 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { function u$4() { var e$12, t$8; n$9 = !0; - for (var r$11 = h$5.length; r$11;) { - for (t$8 = h$5, h$5 = [], e$12 = -1; ++e$12 < r$11;) t$8[e$12](); - r$11 = h$5.length; + for (var r$10 = h$5.length; r$10;) { + for (t$8 = h$5, h$5 = [], e$12 = -1; ++e$12 < r$10;) t$8[e$12](); + r$10 = h$5.length; } n$9 = !1; } l$3.exports = function(e$12) { - 1 !== h$5.push(e$12) || n$9 || r$10(); + 1 !== h$5.push(e$12) || n$9 || r$9(); }; }).call(this, "undefined" != typeof global ? global : "undefined" != typeof self ? self : "undefined" != typeof window ? window : {}); }, {}], - 37: [function(e$10, t$6, r$10) { + 37: [function(e$10, t$6, r$9) { "use strict"; var i$7 = e$10("immediate"); function u$4() {} var l$3 = {}, s$5 = ["REJECTED"], a$2 = ["FULFILLED"], n$9 = ["PENDING"]; function o$10(e$11) { if ("function" != typeof e$11) throw new TypeError("resolver must be a function"); - this.state = n$9, this.queue = [], this.outcome = void 0, e$11 !== u$4 && d$5(this, e$11); + this.state = n$9, this.queue = [], this.outcome = void 0, e$11 !== u$4 && d$4(this, e$11); } - function h$5(e$11, t$7, r$11) { - this.promise = e$11, "function" == typeof t$7 && (this.onFulfilled = t$7, this.callFulfilled = this.otherCallFulfilled), "function" == typeof r$11 && (this.onRejected = r$11, this.callRejected = this.otherCallRejected); + function h$5(e$11, t$7, r$10) { + this.promise = e$11, "function" == typeof t$7 && (this.onFulfilled = t$7, this.callFulfilled = this.otherCallFulfilled), "function" == typeof r$10 && (this.onRejected = r$10, this.callRejected = this.otherCallRejected); } - function f$4(t$7, r$11, n$10) { + function f$4(t$7, r$10, n$10) { i$7(function() { var e$11; try { - e$11 = r$11(n$10); + e$11 = r$10(n$10); } catch (e$12) { return l$3.reject(t$7, e$12); } e$11 === t$7 ? l$3.reject(t$7, new TypeError("Cannot resolve promise with itself")) : l$3.resolve(t$7, e$11); }); } - function c$7(e$11) { + function c$6(e$11) { var t$7 = e$11 && e$11.then; if (e$11 && ("object" == typeof e$11 || "function" == typeof e$11) && "function" == typeof t$7) return function() { t$7.apply(e$11, arguments); }; } - function d$5(t$7, e$11) { - var r$11 = !1; + function d$4(t$7, e$11) { + var r$10 = !1; function n$10(e$12) { - r$11 || (r$11 = !0, l$3.reject(t$7, e$12)); + r$10 || (r$10 = !0, l$3.reject(t$7, e$12)); } function i$8(e$12) { - r$11 || (r$11 = !0, l$3.resolve(t$7, e$12)); + r$10 || (r$10 = !0, l$3.resolve(t$7, e$12)); } var s$6 = p$3(function() { e$11(i$8, n$10); @@ -37296,23 +37500,23 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "error" === s$6.status && n$10(s$6.value); } function p$3(e$11, t$7) { - var r$11 = {}; + var r$10 = {}; try { - r$11.value = e$11(t$7), r$11.status = "success"; + r$10.value = e$11(t$7), r$10.status = "success"; } catch (e$12) { - r$11.status = "error", r$11.value = e$12; + r$10.status = "error", r$10.value = e$12; } - return r$11; + return r$10; } (t$6.exports = o$10).prototype.finally = function(t$7) { if ("function" != typeof t$7) return this; - var r$11 = this.constructor; + var r$10 = this.constructor; return this.then(function(e$11) { - return r$11.resolve(t$7()).then(function() { + return r$10.resolve(t$7()).then(function() { return e$11; }); }, function(e$11) { - return r$11.resolve(t$7()).then(function() { + return r$10.resolve(t$7()).then(function() { throw e$11; }); }); @@ -37320,9 +37524,9 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return this.then(null, e$11); }, o$10.prototype.then = function(e$11, t$7) { if ("function" != typeof e$11 && this.state === a$2 || "function" != typeof t$7 && this.state === s$5) return this; - var r$11 = new this.constructor(u$4); - this.state !== n$9 ? f$4(r$11, this.state === a$2 ? e$11 : t$7, this.outcome) : this.queue.push(new h$5(r$11, e$11, t$7)); - return r$11; + var r$10 = new this.constructor(u$4); + this.state !== n$9 ? f$4(r$10, this.state === a$2 ? e$11 : t$7, this.outcome) : this.queue.push(new h$5(r$10, e$11, t$7)); + return r$10; }, h$5.prototype.callFulfilled = function(e$11) { l$3.resolve(this.promise, e$11); }, h$5.prototype.otherCallFulfilled = function(e$11) { @@ -37332,10 +37536,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, h$5.prototype.otherCallRejected = function(e$11) { f$4(this.promise, this.onRejected, e$11); }, l$3.resolve = function(e$11, t$7) { - var r$11 = p$3(c$7, t$7); - if ("error" === r$11.status) return l$3.reject(e$11, r$11.value); - var n$10 = r$11.value; - if (n$10) d$5(e$11, n$10); + var r$10 = p$3(c$6, t$7); + if ("error" === r$10.status) return l$3.reject(e$11, r$10.value); + var n$10 = r$10.value; + if (n$10) d$4(e$11, n$10); else { e$11.state = a$2, e$11.outcome = t$7; for (var i$8 = -1, s$6 = e$11.queue.length; ++i$8 < s$6;) e$11.queue[i$8].callFulfilled(t$7); @@ -37343,7 +37547,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return e$11; }, l$3.reject = function(e$11, t$7) { e$11.state = s$5, e$11.outcome = t$7; - for (var r$11 = -1, n$10 = e$11.queue.length; ++r$11 < n$10;) e$11.queue[r$11].callRejected(t$7); + for (var r$10 = -1, n$10 = e$11.queue.length; ++r$10 < n$10;) e$11.queue[r$10].callRejected(t$7); return e$11; }, o$10.resolve = function(e$11) { if (e$11 instanceof this) return e$11; @@ -37352,7 +37556,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var t$7 = new this(u$4); return l$3.reject(t$7, e$11); }, o$10.all = function(e$11) { - var r$11 = this; + var r$10 = this; if ("[object Array]" !== Object.prototype.toString.call(e$11)) return this.reject(new TypeError("must be an array")); var n$10 = e$11.length, i$8 = !1; if (!n$10) return this.resolve([]); @@ -37360,7 +37564,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (; ++t$7 < n$10;) h$6(e$11[t$7], t$7); return o$11; function h$6(e$12, t$8) { - r$11.resolve(e$12).then(function(e$13) { + r$10.resolve(e$12).then(function(e$13) { s$6[t$8] = e$13, ++a$3 !== n$10 || i$8 || (i$8 = !0, l$3.resolve(o$11, s$6)); }, function(e$13) { i$8 || (i$8 = !0, l$3.reject(o$11, e$13)); @@ -37369,10 +37573,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, o$10.race = function(e$11) { var t$7 = this; if ("[object Array]" !== Object.prototype.toString.call(e$11)) return this.reject(new TypeError("must be an array")); - var r$11 = e$11.length, n$10 = !1; - if (!r$11) return this.resolve([]); + var r$10 = e$11.length, n$10 = !1; + if (!r$10) return this.resolve([]); var i$8 = -1, s$6 = new this(u$4); - for (; ++i$8 < r$11;) a$3 = e$11[i$8], t$7.resolve(a$3).then(function(e$12) { + for (; ++i$8 < r$10;) a$3 = e$11[i$8], t$7.resolve(a$3).then(function(e$12) { n$10 || (n$10 = !0, l$3.resolve(s$6, e$12)); }, function(e$12) { n$10 || (n$10 = !0, l$3.reject(s$6, e$12)); @@ -37381,7 +37585,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return s$6; }; }, { immediate: 36 }], - 38: [function(e$10, t$6, r$10) { + 38: [function(e$10, t$6, r$9) { "use strict"; var n$9 = {}; (0, e$10("./lib/utils/common").assign)(n$9, e$10("./lib/deflate"), e$10("./lib/inflate"), e$10("./lib/zlib/constants")), t$6.exports = n$9; @@ -37391,51 +37595,51 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./lib/utils/common": 41, "./lib/zlib/constants": 44 }], - 39: [function(e$10, t$6, r$10) { + 39: [function(e$10, t$6, r$9) { "use strict"; - var a$2 = e$10("./zlib/deflate"), o$10 = e$10("./utils/common"), h$5 = e$10("./utils/strings"), i$7 = e$10("./zlib/messages"), s$5 = e$10("./zlib/zstream"), u$4 = Object.prototype.toString, l$3 = 0, f$4 = -1, c$7 = 0, d$5 = 8; + var a$2 = e$10("./zlib/deflate"), o$10 = e$10("./utils/common"), h$5 = e$10("./utils/strings"), i$7 = e$10("./zlib/messages"), s$5 = e$10("./zlib/zstream"), u$4 = Object.prototype.toString, l$3 = 0, f$4 = -1, c$6 = 0, d$4 = 8; function p$3(e$11) { if (!(this instanceof p$3)) return new p$3(e$11); this.options = o$10.assign({ level: f$4, - method: d$5, + method: d$4, chunkSize: 16384, windowBits: 15, memLevel: 8, - strategy: c$7, + strategy: c$6, to: "" }, e$11 || {}); var t$7 = this.options; t$7.raw && 0 < t$7.windowBits ? t$7.windowBits = -t$7.windowBits : t$7.gzip && 0 < t$7.windowBits && t$7.windowBits < 16 && (t$7.windowBits += 16), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new s$5(), this.strm.avail_out = 0; - var r$11 = a$2.deflateInit2(this.strm, t$7.level, t$7.method, t$7.windowBits, t$7.memLevel, t$7.strategy); - if (r$11 !== l$3) throw new Error(i$7[r$11]); + var r$10 = a$2.deflateInit2(this.strm, t$7.level, t$7.method, t$7.windowBits, t$7.memLevel, t$7.strategy); + if (r$10 !== l$3) throw new Error(i$7[r$10]); if (t$7.header && a$2.deflateSetHeader(this.strm, t$7.header), t$7.dictionary) { var n$10; - if (n$10 = "string" == typeof t$7.dictionary ? h$5.string2buf(t$7.dictionary) : "[object ArrayBuffer]" === u$4.call(t$7.dictionary) ? new Uint8Array(t$7.dictionary) : t$7.dictionary, (r$11 = a$2.deflateSetDictionary(this.strm, n$10)) !== l$3) throw new Error(i$7[r$11]); + if (n$10 = "string" == typeof t$7.dictionary ? h$5.string2buf(t$7.dictionary) : "[object ArrayBuffer]" === u$4.call(t$7.dictionary) ? new Uint8Array(t$7.dictionary) : t$7.dictionary, (r$10 = a$2.deflateSetDictionary(this.strm, n$10)) !== l$3) throw new Error(i$7[r$10]); this._dict_set = !0; } } function n$9(e$11, t$7) { - var r$11 = new p$3(t$7); - if (r$11.push(e$11, !0), r$11.err) throw r$11.msg || i$7[r$11.err]; - return r$11.result; + var r$10 = new p$3(t$7); + if (r$10.push(e$11, !0), r$10.err) throw r$10.msg || i$7[r$10.err]; + return r$10.result; } p$3.prototype.push = function(e$11, t$7) { - var r$11, n$10, i$8 = this.strm, s$6 = this.options.chunkSize; + var r$10, n$10, i$8 = this.strm, s$6 = this.options.chunkSize; if (this.ended) return !1; n$10 = t$7 === ~~t$7 ? t$7 : !0 === t$7 ? 4 : 0, "string" == typeof e$11 ? i$8.input = h$5.string2buf(e$11) : "[object ArrayBuffer]" === u$4.call(e$11) ? i$8.input = new Uint8Array(e$11) : i$8.input = e$11, i$8.next_in = 0, i$8.avail_in = i$8.input.length; do { - if (0 === i$8.avail_out && (i$8.output = new o$10.Buf8(s$6), i$8.next_out = 0, i$8.avail_out = s$6), 1 !== (r$11 = a$2.deflate(i$8, n$10)) && r$11 !== l$3) return this.onEnd(r$11), !(this.ended = !0); + if (0 === i$8.avail_out && (i$8.output = new o$10.Buf8(s$6), i$8.next_out = 0, i$8.avail_out = s$6), 1 !== (r$10 = a$2.deflate(i$8, n$10)) && r$10 !== l$3) return this.onEnd(r$10), !(this.ended = !0); 0 !== i$8.avail_out && (0 !== i$8.avail_in || 4 !== n$10 && 2 !== n$10) || ("string" === this.options.to ? this.onData(h$5.buf2binstring(o$10.shrinkBuf(i$8.output, i$8.next_out))) : this.onData(o$10.shrinkBuf(i$8.output, i$8.next_out))); - } while ((0 < i$8.avail_in || 0 === i$8.avail_out) && 1 !== r$11); - return 4 === n$10 ? (r$11 = a$2.deflateEnd(this.strm), this.onEnd(r$11), this.ended = !0, r$11 === l$3) : 2 !== n$10 || (this.onEnd(l$3), !(i$8.avail_out = 0)); + } while ((0 < i$8.avail_in || 0 === i$8.avail_out) && 1 !== r$10); + return 4 === n$10 ? (r$10 = a$2.deflateEnd(this.strm), this.onEnd(r$10), this.ended = !0, r$10 === l$3) : 2 !== n$10 || (this.onEnd(l$3), !(i$8.avail_out = 0)); }, p$3.prototype.onData = function(e$11) { this.chunks.push(e$11); }, p$3.prototype.onEnd = function(e$11) { e$11 === l$3 && ("string" === this.options.to ? this.result = this.chunks.join("") : this.result = o$10.flattenChunks(this.chunks)), this.chunks = [], this.err = e$11, this.msg = this.strm.msg; - }, r$10.Deflate = p$3, r$10.deflate = n$9, r$10.deflateRaw = function(e$11, t$7) { + }, r$9.Deflate = p$3, r$9.deflate = n$9, r$9.deflateRaw = function(e$11, t$7) { return (t$7 = t$7 || {}).raw = !0, n$9(e$11, t$7); - }, r$10.gzip = function(e$11, t$7) { + }, r$9.gzip = function(e$11, t$7) { return (t$7 = t$7 || {}).gzip = !0, n$9(e$11, t$7); }; }, { @@ -37445,43 +37649,43 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./zlib/messages": 51, "./zlib/zstream": 53 }], - 40: [function(e$10, t$6, r$10) { + 40: [function(e$10, t$6, r$9) { "use strict"; - var c$7 = e$10("./zlib/inflate"), d$5 = e$10("./utils/common"), p$3 = e$10("./utils/strings"), m$3 = e$10("./zlib/constants"), n$9 = e$10("./zlib/messages"), i$7 = e$10("./zlib/zstream"), s$5 = e$10("./zlib/gzheader"), _$2 = Object.prototype.toString; + var c$6 = e$10("./zlib/inflate"), d$4 = e$10("./utils/common"), p$3 = e$10("./utils/strings"), m$3 = e$10("./zlib/constants"), n$9 = e$10("./zlib/messages"), i$7 = e$10("./zlib/zstream"), s$5 = e$10("./zlib/gzheader"), _$2 = Object.prototype.toString; function a$2(e$11) { if (!(this instanceof a$2)) return new a$2(e$11); - this.options = d$5.assign({ + this.options = d$4.assign({ chunkSize: 16384, windowBits: 0, to: "" }, e$11 || {}); var t$7 = this.options; t$7.raw && 0 <= t$7.windowBits && t$7.windowBits < 16 && (t$7.windowBits = -t$7.windowBits, 0 === t$7.windowBits && (t$7.windowBits = -15)), !(0 <= t$7.windowBits && t$7.windowBits < 16) || e$11 && e$11.windowBits || (t$7.windowBits += 32), 15 < t$7.windowBits && t$7.windowBits < 48 && 0 == (15 & t$7.windowBits) && (t$7.windowBits |= 15), this.err = 0, this.msg = "", this.ended = !1, this.chunks = [], this.strm = new i$7(), this.strm.avail_out = 0; - var r$11 = c$7.inflateInit2(this.strm, t$7.windowBits); - if (r$11 !== m$3.Z_OK) throw new Error(n$9[r$11]); - this.header = new s$5(), c$7.inflateGetHeader(this.strm, this.header); + var r$10 = c$6.inflateInit2(this.strm, t$7.windowBits); + if (r$10 !== m$3.Z_OK) throw new Error(n$9[r$10]); + this.header = new s$5(), c$6.inflateGetHeader(this.strm, this.header); } function o$10(e$11, t$7) { - var r$11 = new a$2(t$7); - if (r$11.push(e$11, !0), r$11.err) throw r$11.msg || n$9[r$11.err]; - return r$11.result; + var r$10 = new a$2(t$7); + if (r$10.push(e$11, !0), r$10.err) throw r$10.msg || n$9[r$10.err]; + return r$10.result; } a$2.prototype.push = function(e$11, t$7) { - var r$11, n$10, i$8, s$6, a$3, o$11, h$5 = this.strm, u$4 = this.options.chunkSize, l$3 = this.options.dictionary, f$4 = !1; + var r$10, n$10, i$8, s$6, a$3, o$11, h$5 = this.strm, u$4 = this.options.chunkSize, l$3 = this.options.dictionary, f$4 = !1; if (this.ended) return !1; n$10 = t$7 === ~~t$7 ? t$7 : !0 === t$7 ? m$3.Z_FINISH : m$3.Z_NO_FLUSH, "string" == typeof e$11 ? h$5.input = p$3.binstring2buf(e$11) : "[object ArrayBuffer]" === _$2.call(e$11) ? h$5.input = new Uint8Array(e$11) : h$5.input = e$11, h$5.next_in = 0, h$5.avail_in = h$5.input.length; do { - if (0 === h$5.avail_out && (h$5.output = new d$5.Buf8(u$4), h$5.next_out = 0, h$5.avail_out = u$4), (r$11 = c$7.inflate(h$5, m$3.Z_NO_FLUSH)) === m$3.Z_NEED_DICT && l$3 && (o$11 = "string" == typeof l$3 ? p$3.string2buf(l$3) : "[object ArrayBuffer]" === _$2.call(l$3) ? new Uint8Array(l$3) : l$3, r$11 = c$7.inflateSetDictionary(this.strm, o$11)), r$11 === m$3.Z_BUF_ERROR && !0 === f$4 && (r$11 = m$3.Z_OK, f$4 = !1), r$11 !== m$3.Z_STREAM_END && r$11 !== m$3.Z_OK) return this.onEnd(r$11), !(this.ended = !0); - h$5.next_out && (0 !== h$5.avail_out && r$11 !== m$3.Z_STREAM_END && (0 !== h$5.avail_in || n$10 !== m$3.Z_FINISH && n$10 !== m$3.Z_SYNC_FLUSH) || ("string" === this.options.to ? (i$8 = p$3.utf8border(h$5.output, h$5.next_out), s$6 = h$5.next_out - i$8, a$3 = p$3.buf2string(h$5.output, i$8), h$5.next_out = s$6, h$5.avail_out = u$4 - s$6, s$6 && d$5.arraySet(h$5.output, h$5.output, i$8, s$6, 0), this.onData(a$3)) : this.onData(d$5.shrinkBuf(h$5.output, h$5.next_out)))), 0 === h$5.avail_in && 0 === h$5.avail_out && (f$4 = !0); - } while ((0 < h$5.avail_in || 0 === h$5.avail_out) && r$11 !== m$3.Z_STREAM_END); - return r$11 === m$3.Z_STREAM_END && (n$10 = m$3.Z_FINISH), n$10 === m$3.Z_FINISH ? (r$11 = c$7.inflateEnd(this.strm), this.onEnd(r$11), this.ended = !0, r$11 === m$3.Z_OK) : n$10 !== m$3.Z_SYNC_FLUSH || (this.onEnd(m$3.Z_OK), !(h$5.avail_out = 0)); + if (0 === h$5.avail_out && (h$5.output = new d$4.Buf8(u$4), h$5.next_out = 0, h$5.avail_out = u$4), (r$10 = c$6.inflate(h$5, m$3.Z_NO_FLUSH)) === m$3.Z_NEED_DICT && l$3 && (o$11 = "string" == typeof l$3 ? p$3.string2buf(l$3) : "[object ArrayBuffer]" === _$2.call(l$3) ? new Uint8Array(l$3) : l$3, r$10 = c$6.inflateSetDictionary(this.strm, o$11)), r$10 === m$3.Z_BUF_ERROR && !0 === f$4 && (r$10 = m$3.Z_OK, f$4 = !1), r$10 !== m$3.Z_STREAM_END && r$10 !== m$3.Z_OK) return this.onEnd(r$10), !(this.ended = !0); + h$5.next_out && (0 !== h$5.avail_out && r$10 !== m$3.Z_STREAM_END && (0 !== h$5.avail_in || n$10 !== m$3.Z_FINISH && n$10 !== m$3.Z_SYNC_FLUSH) || ("string" === this.options.to ? (i$8 = p$3.utf8border(h$5.output, h$5.next_out), s$6 = h$5.next_out - i$8, a$3 = p$3.buf2string(h$5.output, i$8), h$5.next_out = s$6, h$5.avail_out = u$4 - s$6, s$6 && d$4.arraySet(h$5.output, h$5.output, i$8, s$6, 0), this.onData(a$3)) : this.onData(d$4.shrinkBuf(h$5.output, h$5.next_out)))), 0 === h$5.avail_in && 0 === h$5.avail_out && (f$4 = !0); + } while ((0 < h$5.avail_in || 0 === h$5.avail_out) && r$10 !== m$3.Z_STREAM_END); + return r$10 === m$3.Z_STREAM_END && (n$10 = m$3.Z_FINISH), n$10 === m$3.Z_FINISH ? (r$10 = c$6.inflateEnd(this.strm), this.onEnd(r$10), this.ended = !0, r$10 === m$3.Z_OK) : n$10 !== m$3.Z_SYNC_FLUSH || (this.onEnd(m$3.Z_OK), !(h$5.avail_out = 0)); }, a$2.prototype.onData = function(e$11) { this.chunks.push(e$11); }, a$2.prototype.onEnd = function(e$11) { - e$11 === m$3.Z_OK && ("string" === this.options.to ? this.result = this.chunks.join("") : this.result = d$5.flattenChunks(this.chunks)), this.chunks = [], this.err = e$11, this.msg = this.strm.msg; - }, r$10.Inflate = a$2, r$10.inflate = o$10, r$10.inflateRaw = function(e$11, t$7) { + e$11 === m$3.Z_OK && ("string" === this.options.to ? this.result = this.chunks.join("") : this.result = d$4.flattenChunks(this.chunks)), this.chunks = [], this.err = e$11, this.msg = this.strm.msg; + }, r$9.Inflate = a$2, r$9.inflate = o$10, r$9.inflateRaw = function(e$11, t$7) { return (t$7 = t$7 || {}).raw = !0, o$10(e$11, t$7); - }, r$10.ungzip = o$10; + }, r$9.ungzip = o$10; }, { "./utils/common": 41, "./utils/strings": 42, @@ -37491,45 +37695,45 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./zlib/messages": 51, "./zlib/zstream": 53 }], - 41: [function(e$10, t$6, r$10) { + 41: [function(e$10, t$6, r$9) { "use strict"; var n$9 = "undefined" != typeof Uint8Array && "undefined" != typeof Uint16Array && "undefined" != typeof Int32Array; - r$10.assign = function(e$11) { + r$9.assign = function(e$11) { for (var t$7 = Array.prototype.slice.call(arguments, 1); t$7.length;) { - var r$11 = t$7.shift(); - if (r$11) { - if ("object" != typeof r$11) throw new TypeError(r$11 + "must be non-object"); - for (var n$10 in r$11) r$11.hasOwnProperty(n$10) && (e$11[n$10] = r$11[n$10]); + var r$10 = t$7.shift(); + if (r$10) { + if ("object" != typeof r$10) throw new TypeError(r$10 + "must be non-object"); + for (var n$10 in r$10) r$10.hasOwnProperty(n$10) && (e$11[n$10] = r$10[n$10]); } } return e$11; - }, r$10.shrinkBuf = function(e$11, t$7) { + }, r$9.shrinkBuf = function(e$11, t$7) { return e$11.length === t$7 ? e$11 : e$11.subarray ? e$11.subarray(0, t$7) : (e$11.length = t$7, e$11); }; var i$7 = { - arraySet: function(e$11, t$7, r$11, n$10, i$8) { - if (t$7.subarray && e$11.subarray) e$11.set(t$7.subarray(r$11, r$11 + n$10), i$8); - else for (var s$6 = 0; s$6 < n$10; s$6++) e$11[i$8 + s$6] = t$7[r$11 + s$6]; + arraySet: function(e$11, t$7, r$10, n$10, i$8) { + if (t$7.subarray && e$11.subarray) e$11.set(t$7.subarray(r$10, r$10 + n$10), i$8); + else for (var s$6 = 0; s$6 < n$10; s$6++) e$11[i$8 + s$6] = t$7[r$10 + s$6]; }, flattenChunks: function(e$11) { - var t$7, r$11, n$10, i$8, s$6, a$2; - for (t$7 = n$10 = 0, r$11 = e$11.length; t$7 < r$11; t$7++) n$10 += e$11[t$7].length; - for (a$2 = new Uint8Array(n$10), t$7 = i$8 = 0, r$11 = e$11.length; t$7 < r$11; t$7++) s$6 = e$11[t$7], a$2.set(s$6, i$8), i$8 += s$6.length; + var t$7, r$10, n$10, i$8, s$6, a$2; + for (t$7 = n$10 = 0, r$10 = e$11.length; t$7 < r$10; t$7++) n$10 += e$11[t$7].length; + for (a$2 = new Uint8Array(n$10), t$7 = i$8 = 0, r$10 = e$11.length; t$7 < r$10; t$7++) s$6 = e$11[t$7], a$2.set(s$6, i$8), i$8 += s$6.length; return a$2; } }, s$5 = { - arraySet: function(e$11, t$7, r$11, n$10, i$8) { - for (var s$6 = 0; s$6 < n$10; s$6++) e$11[i$8 + s$6] = t$7[r$11 + s$6]; + arraySet: function(e$11, t$7, r$10, n$10, i$8) { + for (var s$6 = 0; s$6 < n$10; s$6++) e$11[i$8 + s$6] = t$7[r$10 + s$6]; }, flattenChunks: function(e$11) { return [].concat.apply([], e$11); } }; - r$10.setTyped = function(e$11) { - e$11 ? (r$10.Buf8 = Uint8Array, r$10.Buf16 = Uint16Array, r$10.Buf32 = Int32Array, r$10.assign(r$10, i$7)) : (r$10.Buf8 = Array, r$10.Buf16 = Array, r$10.Buf32 = Array, r$10.assign(r$10, s$5)); - }, r$10.setTyped(n$9); + r$9.setTyped = function(e$11) { + e$11 ? (r$9.Buf8 = Uint8Array, r$9.Buf16 = Uint16Array, r$9.Buf32 = Int32Array, r$9.assign(r$9, i$7)) : (r$9.Buf8 = Array, r$9.Buf16 = Array, r$9.Buf32 = Array, r$9.assign(r$9, s$5)); + }, r$9.setTyped(n$9); }, {}], - 42: [function(e$10, t$6, r$10) { + 42: [function(e$10, t$6, r$9) { "use strict"; var h$5 = e$10("./common"), i$7 = !0, s$5 = !0; try { @@ -37545,45 +37749,45 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (var u$4 = new h$5.Buf8(256), n$9 = 0; n$9 < 256; n$9++) u$4[n$9] = 252 <= n$9 ? 6 : 248 <= n$9 ? 5 : 240 <= n$9 ? 4 : 224 <= n$9 ? 3 : 192 <= n$9 ? 2 : 1; function l$3(e$11, t$7) { if (t$7 < 65537 && (e$11.subarray && s$5 || !e$11.subarray && i$7)) return String.fromCharCode.apply(null, h$5.shrinkBuf(e$11, t$7)); - for (var r$11 = "", n$10 = 0; n$10 < t$7; n$10++) r$11 += String.fromCharCode(e$11[n$10]); - return r$11; + for (var r$10 = "", n$10 = 0; n$10 < t$7; n$10++) r$10 += String.fromCharCode(e$11[n$10]); + return r$10; } - u$4[254] = u$4[254] = 1, r$10.string2buf = function(e$11) { - var t$7, r$11, n$10, i$8, s$6, a$2 = e$11.length, o$10 = 0; - for (i$8 = 0; i$8 < a$2; i$8++) 55296 == (64512 & (r$11 = e$11.charCodeAt(i$8))) && i$8 + 1 < a$2 && 56320 == (64512 & (n$10 = e$11.charCodeAt(i$8 + 1))) && (r$11 = 65536 + (r$11 - 55296 << 10) + (n$10 - 56320), i$8++), o$10 += r$11 < 128 ? 1 : r$11 < 2048 ? 2 : r$11 < 65536 ? 3 : 4; - for (t$7 = new h$5.Buf8(o$10), i$8 = s$6 = 0; s$6 < o$10; i$8++) 55296 == (64512 & (r$11 = e$11.charCodeAt(i$8))) && i$8 + 1 < a$2 && 56320 == (64512 & (n$10 = e$11.charCodeAt(i$8 + 1))) && (r$11 = 65536 + (r$11 - 55296 << 10) + (n$10 - 56320), i$8++), r$11 < 128 ? t$7[s$6++] = r$11 : (r$11 < 2048 ? t$7[s$6++] = 192 | r$11 >>> 6 : (r$11 < 65536 ? t$7[s$6++] = 224 | r$11 >>> 12 : (t$7[s$6++] = 240 | r$11 >>> 18, t$7[s$6++] = 128 | r$11 >>> 12 & 63), t$7[s$6++] = 128 | r$11 >>> 6 & 63), t$7[s$6++] = 128 | 63 & r$11); + u$4[254] = u$4[254] = 1, r$9.string2buf = function(e$11) { + var t$7, r$10, n$10, i$8, s$6, a$2 = e$11.length, o$10 = 0; + for (i$8 = 0; i$8 < a$2; i$8++) 55296 == (64512 & (r$10 = e$11.charCodeAt(i$8))) && i$8 + 1 < a$2 && 56320 == (64512 & (n$10 = e$11.charCodeAt(i$8 + 1))) && (r$10 = 65536 + (r$10 - 55296 << 10) + (n$10 - 56320), i$8++), o$10 += r$10 < 128 ? 1 : r$10 < 2048 ? 2 : r$10 < 65536 ? 3 : 4; + for (t$7 = new h$5.Buf8(o$10), i$8 = s$6 = 0; s$6 < o$10; i$8++) 55296 == (64512 & (r$10 = e$11.charCodeAt(i$8))) && i$8 + 1 < a$2 && 56320 == (64512 & (n$10 = e$11.charCodeAt(i$8 + 1))) && (r$10 = 65536 + (r$10 - 55296 << 10) + (n$10 - 56320), i$8++), r$10 < 128 ? t$7[s$6++] = r$10 : (r$10 < 2048 ? t$7[s$6++] = 192 | r$10 >>> 6 : (r$10 < 65536 ? t$7[s$6++] = 224 | r$10 >>> 12 : (t$7[s$6++] = 240 | r$10 >>> 18, t$7[s$6++] = 128 | r$10 >>> 12 & 63), t$7[s$6++] = 128 | r$10 >>> 6 & 63), t$7[s$6++] = 128 | 63 & r$10); return t$7; - }, r$10.buf2binstring = function(e$11) { + }, r$9.buf2binstring = function(e$11) { return l$3(e$11, e$11.length); - }, r$10.binstring2buf = function(e$11) { - for (var t$7 = new h$5.Buf8(e$11.length), r$11 = 0, n$10 = t$7.length; r$11 < n$10; r$11++) t$7[r$11] = e$11.charCodeAt(r$11); + }, r$9.binstring2buf = function(e$11) { + for (var t$7 = new h$5.Buf8(e$11.length), r$10 = 0, n$10 = t$7.length; r$10 < n$10; r$10++) t$7[r$10] = e$11.charCodeAt(r$10); return t$7; - }, r$10.buf2string = function(e$11, t$7) { - var r$11, n$10, i$8, s$6, a$2 = t$7 || e$11.length, o$10 = new Array(2 * a$2); - for (r$11 = n$10 = 0; r$11 < a$2;) if ((i$8 = e$11[r$11++]) < 128) o$10[n$10++] = i$8; - else if (4 < (s$6 = u$4[i$8])) o$10[n$10++] = 65533, r$11 += s$6 - 1; + }, r$9.buf2string = function(e$11, t$7) { + var r$10, n$10, i$8, s$6, a$2 = t$7 || e$11.length, o$10 = new Array(2 * a$2); + for (r$10 = n$10 = 0; r$10 < a$2;) if ((i$8 = e$11[r$10++]) < 128) o$10[n$10++] = i$8; + else if (4 < (s$6 = u$4[i$8])) o$10[n$10++] = 65533, r$10 += s$6 - 1; else { - for (i$8 &= 2 === s$6 ? 31 : 3 === s$6 ? 15 : 7; 1 < s$6 && r$11 < a$2;) i$8 = i$8 << 6 | 63 & e$11[r$11++], s$6--; + for (i$8 &= 2 === s$6 ? 31 : 3 === s$6 ? 15 : 7; 1 < s$6 && r$10 < a$2;) i$8 = i$8 << 6 | 63 & e$11[r$10++], s$6--; 1 < s$6 ? o$10[n$10++] = 65533 : i$8 < 65536 ? o$10[n$10++] = i$8 : (i$8 -= 65536, o$10[n$10++] = 55296 | i$8 >> 10 & 1023, o$10[n$10++] = 56320 | 1023 & i$8); } return l$3(o$10, n$10); - }, r$10.utf8border = function(e$11, t$7) { - var r$11; - for ((t$7 = t$7 || e$11.length) > e$11.length && (t$7 = e$11.length), r$11 = t$7 - 1; 0 <= r$11 && 128 == (192 & e$11[r$11]);) r$11--; - return r$11 < 0 ? t$7 : 0 === r$11 ? t$7 : r$11 + u$4[e$11[r$11]] > t$7 ? r$11 : t$7; + }, r$9.utf8border = function(e$11, t$7) { + var r$10; + for ((t$7 = t$7 || e$11.length) > e$11.length && (t$7 = e$11.length), r$10 = t$7 - 1; 0 <= r$10 && 128 == (192 & e$11[r$10]);) r$10--; + return r$10 < 0 ? t$7 : 0 === r$10 ? t$7 : r$10 + u$4[e$11[r$10]] > t$7 ? r$10 : t$7; }; }, { "./common": 41 }], - 43: [function(e$10, t$6, r$10) { + 43: [function(e$10, t$6, r$9) { "use strict"; - t$6.exports = function(e$11, t$7, r$11, n$9) { - for (var i$7 = 65535 & e$11 | 0, s$5 = e$11 >>> 16 & 65535 | 0, a$2 = 0; 0 !== r$11;) { - for (r$11 -= a$2 = 2e3 < r$11 ? 2e3 : r$11; s$5 = s$5 + (i$7 = i$7 + t$7[n$9++] | 0) | 0, --a$2;); + t$6.exports = function(e$11, t$7, r$10, n$9) { + for (var i$7 = 65535 & e$11 | 0, s$5 = e$11 >>> 16 & 65535 | 0, a$2 = 0; 0 !== r$10;) { + for (r$10 -= a$2 = 2e3 < r$10 ? 2e3 : r$10; s$5 = s$5 + (i$7 = i$7 + t$7[n$9++] | 0) | 0, --a$2;); i$7 %= 65521, s$5 %= 65521; } return i$7 | s$5 << 16 | 0; }; }, {}], - 44: [function(e$10, t$6, r$10) { + 44: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = { Z_NO_FLUSH: 0, @@ -37615,26 +37819,26 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { Z_DEFLATED: 8 }; }, {}], - 45: [function(e$10, t$6, r$10) { + 45: [function(e$10, t$6, r$9) { "use strict"; var o$10 = function() { - for (var e$11, t$7 = [], r$11 = 0; r$11 < 256; r$11++) { - e$11 = r$11; + for (var e$11, t$7 = [], r$10 = 0; r$10 < 256; r$10++) { + e$11 = r$10; for (var n$9 = 0; n$9 < 8; n$9++) e$11 = 1 & e$11 ? 3988292384 ^ e$11 >>> 1 : e$11 >>> 1; - t$7[r$11] = e$11; + t$7[r$10] = e$11; } return t$7; }(); - t$6.exports = function(e$11, t$7, r$11, n$9) { - var i$7 = o$10, s$5 = n$9 + r$11; + t$6.exports = function(e$11, t$7, r$10, n$9) { + var i$7 = o$10, s$5 = n$9 + r$10; e$11 ^= -1; for (var a$2 = n$9; a$2 < s$5; a$2++) e$11 = e$11 >>> 8 ^ i$7[255 & (e$11 ^ t$7[a$2])]; return -1 ^ e$11; }; }, {}], - 46: [function(e$10, t$6, r$10) { + 46: [function(e$10, t$6, r$9) { "use strict"; - var h$5, c$7 = e$10("../utils/common"), u$4 = e$10("./trees"), d$5 = e$10("./adler32"), p$3 = e$10("./crc32"), n$9 = e$10("./messages"), l$3 = 0, f$4 = 4, m$3 = 0, _$2 = -2, g$1 = -1, b$3 = 4, i$7 = 2, v$3 = 8, y$3 = 9, s$5 = 286, a$2 = 30, o$10 = 19, w$2 = 2 * s$5 + 1, k$2 = 15, x$2 = 3, S$4 = 258, z$2 = S$4 + x$2 + 1, C$2 = 42, E$2 = 113, A$1 = 1, I$2 = 2, O = 3, B$2 = 4; + var h$5, c$6 = e$10("../utils/common"), u$4 = e$10("./trees"), d$4 = e$10("./adler32"), p$3 = e$10("./crc32"), n$9 = e$10("./messages"), l$3 = 0, f$4 = 4, m$3 = 0, _$2 = -2, g$1 = -1, b$3 = 4, i$7 = 2, v$3 = 8, y$3 = 9, s$5 = 286, a$2 = 30, o$10 = 19, w$2 = 2 * s$5 + 1, k$2 = 15, x$2 = 3, S$4 = 258, z$2 = S$4 + x$2 + 1, C$2 = 42, E$2 = 113, A$1 = 1, I$2 = 2, O = 3, B$2 = 4; function R$1(e$11, t$7) { return e$11.msg = n$9[t$7], t$7; } @@ -37645,8 +37849,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (var t$7 = e$11.length; 0 <= --t$7;) e$11[t$7] = 0; } function F$1(e$11) { - var t$7 = e$11.state, r$11 = t$7.pending; - r$11 > e$11.avail_out && (r$11 = e$11.avail_out), 0 !== r$11 && (c$7.arraySet(e$11.output, t$7.pending_buf, t$7.pending_out, r$11, e$11.next_out), e$11.next_out += r$11, t$7.pending_out += r$11, e$11.total_out += r$11, e$11.avail_out -= r$11, t$7.pending -= r$11, 0 === t$7.pending && (t$7.pending_out = 0)); + var t$7 = e$11.state, r$10 = t$7.pending; + r$10 > e$11.avail_out && (r$10 = e$11.avail_out), 0 !== r$10 && (c$6.arraySet(e$11.output, t$7.pending_buf, t$7.pending_out, r$10, e$11.next_out), e$11.next_out += r$10, t$7.pending_out += r$10, e$11.total_out += r$10, e$11.avail_out -= r$10, t$7.pending -= r$10, 0 === t$7.pending && (t$7.pending_out = 0)); } function N$2(e$11, t$7) { u$4._tr_flush_block(e$11, 0 <= e$11.block_start ? e$11.block_start : -1, e$11.strstart - e$11.block_start, t$7), e$11.block_start = e$11.strstart, F$1(e$11.strm); @@ -37658,40 +37862,40 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { e$11.pending_buf[e$11.pending++] = t$7 >>> 8 & 255, e$11.pending_buf[e$11.pending++] = 255 & t$7; } function L$2(e$11, t$7) { - var r$11, n$10, i$8 = e$11.max_chain_length, s$6 = e$11.strstart, a$3 = e$11.prev_length, o$11 = e$11.nice_match, h$6 = e$11.strstart > e$11.w_size - z$2 ? e$11.strstart - (e$11.w_size - z$2) : 0, u$5 = e$11.window, l$4 = e$11.w_mask, f$5 = e$11.prev, c$8 = e$11.strstart + S$4, d$6 = u$5[s$6 + a$3 - 1], p$4 = u$5[s$6 + a$3]; + var r$10, n$10, i$8 = e$11.max_chain_length, s$6 = e$11.strstart, a$3 = e$11.prev_length, o$11 = e$11.nice_match, h$6 = e$11.strstart > e$11.w_size - z$2 ? e$11.strstart - (e$11.w_size - z$2) : 0, u$5 = e$11.window, l$4 = e$11.w_mask, f$5 = e$11.prev, c$7 = e$11.strstart + S$4, d$5 = u$5[s$6 + a$3 - 1], p$4 = u$5[s$6 + a$3]; e$11.prev_length >= e$11.good_match && (i$8 >>= 2), o$11 > e$11.lookahead && (o$11 = e$11.lookahead); do { - if (u$5[(r$11 = t$7) + a$3] === p$4 && u$5[r$11 + a$3 - 1] === d$6 && u$5[r$11] === u$5[s$6] && u$5[++r$11] === u$5[s$6 + 1]) { - s$6 += 2, r$11++; - do {} while (u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && u$5[++s$6] === u$5[++r$11] && s$6 < c$8); - if (n$10 = S$4 - (c$8 - s$6), s$6 = c$8 - S$4, a$3 < n$10) { + if (u$5[(r$10 = t$7) + a$3] === p$4 && u$5[r$10 + a$3 - 1] === d$5 && u$5[r$10] === u$5[s$6] && u$5[++r$10] === u$5[s$6 + 1]) { + s$6 += 2, r$10++; + do {} while (u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && u$5[++s$6] === u$5[++r$10] && s$6 < c$7); + if (n$10 = S$4 - (c$7 - s$6), s$6 = c$7 - S$4, a$3 < n$10) { if (e$11.match_start = t$7, o$11 <= (a$3 = n$10)) break; - d$6 = u$5[s$6 + a$3 - 1], p$4 = u$5[s$6 + a$3]; + d$5 = u$5[s$6 + a$3 - 1], p$4 = u$5[s$6 + a$3]; } } } while ((t$7 = f$5[t$7 & l$4]) > h$6 && 0 != --i$8); return a$3 <= e$11.lookahead ? a$3 : e$11.lookahead; } function j$2(e$11) { - var t$7, r$11, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4, f$5 = e$11.w_size; + var t$7, r$10, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4, f$5 = e$11.w_size; do { if (i$8 = e$11.window_size - e$11.lookahead - e$11.strstart, e$11.strstart >= f$5 + (f$5 - z$2)) { - for (c$7.arraySet(e$11.window, e$11.window, f$5, f$5, 0), e$11.match_start -= f$5, e$11.strstart -= f$5, e$11.block_start -= f$5, t$7 = r$11 = e$11.hash_size; n$10 = e$11.head[--t$7], e$11.head[t$7] = f$5 <= n$10 ? n$10 - f$5 : 0, --r$11;); - for (t$7 = r$11 = f$5; n$10 = e$11.prev[--t$7], e$11.prev[t$7] = f$5 <= n$10 ? n$10 - f$5 : 0, --r$11;); + for (c$6.arraySet(e$11.window, e$11.window, f$5, f$5, 0), e$11.match_start -= f$5, e$11.strstart -= f$5, e$11.block_start -= f$5, t$7 = r$10 = e$11.hash_size; n$10 = e$11.head[--t$7], e$11.head[t$7] = f$5 <= n$10 ? n$10 - f$5 : 0, --r$10;); + for (t$7 = r$10 = f$5; n$10 = e$11.prev[--t$7], e$11.prev[t$7] = f$5 <= n$10 ? n$10 - f$5 : 0, --r$10;); i$8 += f$5; } if (0 === e$11.strm.avail_in) break; - if (a$3 = e$11.strm, o$11 = e$11.window, h$6 = e$11.strstart + e$11.lookahead, u$5 = i$8, l$4 = void 0, l$4 = a$3.avail_in, u$5 < l$4 && (l$4 = u$5), r$11 = 0 === l$4 ? 0 : (a$3.avail_in -= l$4, c$7.arraySet(o$11, a$3.input, a$3.next_in, l$4, h$6), 1 === a$3.state.wrap ? a$3.adler = d$5(a$3.adler, o$11, l$4, h$6) : 2 === a$3.state.wrap && (a$3.adler = p$3(a$3.adler, o$11, l$4, h$6)), a$3.next_in += l$4, a$3.total_in += l$4, l$4), e$11.lookahead += r$11, e$11.lookahead + e$11.insert >= x$2) for (s$6 = e$11.strstart - e$11.insert, e$11.ins_h = e$11.window[s$6], e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[s$6 + 1]) & e$11.hash_mask; e$11.insert && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[s$6 + x$2 - 1]) & e$11.hash_mask, e$11.prev[s$6 & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = s$6, s$6++, e$11.insert--, !(e$11.lookahead + e$11.insert < x$2));); + if (a$3 = e$11.strm, o$11 = e$11.window, h$6 = e$11.strstart + e$11.lookahead, u$5 = i$8, l$4 = void 0, l$4 = a$3.avail_in, u$5 < l$4 && (l$4 = u$5), r$10 = 0 === l$4 ? 0 : (a$3.avail_in -= l$4, c$6.arraySet(o$11, a$3.input, a$3.next_in, l$4, h$6), 1 === a$3.state.wrap ? a$3.adler = d$4(a$3.adler, o$11, l$4, h$6) : 2 === a$3.state.wrap && (a$3.adler = p$3(a$3.adler, o$11, l$4, h$6)), a$3.next_in += l$4, a$3.total_in += l$4, l$4), e$11.lookahead += r$10, e$11.lookahead + e$11.insert >= x$2) for (s$6 = e$11.strstart - e$11.insert, e$11.ins_h = e$11.window[s$6], e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[s$6 + 1]) & e$11.hash_mask; e$11.insert && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[s$6 + x$2 - 1]) & e$11.hash_mask, e$11.prev[s$6 & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = s$6, s$6++, e$11.insert--, !(e$11.lookahead + e$11.insert < x$2));); } while (e$11.lookahead < z$2 && 0 !== e$11.strm.avail_in); } function Z$1(e$11, t$7) { - for (var r$11, n$10;;) { + for (var r$10, n$10;;) { if (e$11.lookahead < z$2) { if (j$2(e$11), e$11.lookahead < z$2 && t$7 === l$3) return A$1; if (0 === e$11.lookahead) break; } - if (r$11 = 0, e$11.lookahead >= x$2 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$11 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), 0 !== r$11 && e$11.strstart - r$11 <= e$11.w_size - z$2 && (e$11.match_length = L$2(e$11, r$11)), e$11.match_length >= x$2) if (n$10 = u$4._tr_tally(e$11, e$11.strstart - e$11.match_start, e$11.match_length - x$2), e$11.lookahead -= e$11.match_length, e$11.match_length <= e$11.max_lazy_match && e$11.lookahead >= x$2) { - for (e$11.match_length--; e$11.strstart++, e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$11 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart, 0 != --e$11.match_length;); + if (r$10 = 0, e$11.lookahead >= x$2 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$10 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), 0 !== r$10 && e$11.strstart - r$10 <= e$11.w_size - z$2 && (e$11.match_length = L$2(e$11, r$10)), e$11.match_length >= x$2) if (n$10 = u$4._tr_tally(e$11, e$11.strstart - e$11.match_start, e$11.match_length - x$2), e$11.lookahead -= e$11.match_length, e$11.match_length <= e$11.max_lazy_match && e$11.lookahead >= x$2) { + for (e$11.match_length--; e$11.strstart++, e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$10 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart, 0 != --e$11.match_length;); e$11.strstart++; } else e$11.strstart += e$11.match_length, e$11.match_length = 0, e$11.ins_h = e$11.window[e$11.strstart], e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + 1]) & e$11.hash_mask; else n$10 = u$4._tr_tally(e$11, 0, e$11.window[e$11.strstart]), e$11.lookahead--, e$11.strstart++; @@ -37700,13 +37904,13 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return e$11.insert = e$11.strstart < x$2 - 1 ? e$11.strstart : x$2 - 1, t$7 === f$4 ? (N$2(e$11, !0), 0 === e$11.strm.avail_out ? O : B$2) : e$11.last_lit && (N$2(e$11, !1), 0 === e$11.strm.avail_out) ? A$1 : I$2; } function W$1(e$11, t$7) { - for (var r$11, n$10, i$8;;) { + for (var r$10, n$10, i$8;;) { if (e$11.lookahead < z$2) { if (j$2(e$11), e$11.lookahead < z$2 && t$7 === l$3) return A$1; if (0 === e$11.lookahead) break; } - if (r$11 = 0, e$11.lookahead >= x$2 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$11 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), e$11.prev_length = e$11.match_length, e$11.prev_match = e$11.match_start, e$11.match_length = x$2 - 1, 0 !== r$11 && e$11.prev_length < e$11.max_lazy_match && e$11.strstart - r$11 <= e$11.w_size - z$2 && (e$11.match_length = L$2(e$11, r$11), e$11.match_length <= 5 && (1 === e$11.strategy || e$11.match_length === x$2 && 4096 < e$11.strstart - e$11.match_start) && (e$11.match_length = x$2 - 1)), e$11.prev_length >= x$2 && e$11.match_length <= e$11.prev_length) { - for (i$8 = e$11.strstart + e$11.lookahead - x$2, n$10 = u$4._tr_tally(e$11, e$11.strstart - 1 - e$11.prev_match, e$11.prev_length - x$2), e$11.lookahead -= e$11.prev_length - 1, e$11.prev_length -= 2; ++e$11.strstart <= i$8 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$11 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), 0 != --e$11.prev_length;); + if (r$10 = 0, e$11.lookahead >= x$2 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$10 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), e$11.prev_length = e$11.match_length, e$11.prev_match = e$11.match_start, e$11.match_length = x$2 - 1, 0 !== r$10 && e$11.prev_length < e$11.max_lazy_match && e$11.strstart - r$10 <= e$11.w_size - z$2 && (e$11.match_length = L$2(e$11, r$10), e$11.match_length <= 5 && (1 === e$11.strategy || e$11.match_length === x$2 && 4096 < e$11.strstart - e$11.match_start) && (e$11.match_length = x$2 - 1)), e$11.prev_length >= x$2 && e$11.match_length <= e$11.prev_length) { + for (i$8 = e$11.strstart + e$11.lookahead - x$2, n$10 = u$4._tr_tally(e$11, e$11.strstart - 1 - e$11.prev_match, e$11.prev_length - x$2), e$11.lookahead -= e$11.prev_length - 1, e$11.prev_length -= 2; ++e$11.strstart <= i$8 && (e$11.ins_h = (e$11.ins_h << e$11.hash_shift ^ e$11.window[e$11.strstart + x$2 - 1]) & e$11.hash_mask, r$10 = e$11.prev[e$11.strstart & e$11.w_mask] = e$11.head[e$11.ins_h], e$11.head[e$11.ins_h] = e$11.strstart), 0 != --e$11.prev_length;); if (e$11.match_available = 0, e$11.match_length = x$2 - 1, e$11.strstart++, n$10 && (N$2(e$11, !1), 0 === e$11.strm.avail_out)) return A$1; } else if (e$11.match_available) { if ((n$10 = u$4._tr_tally(e$11, 0, e$11.window[e$11.strstart - 1])) && N$2(e$11, !1), e$11.strstart++, e$11.lookahead--, 0 === e$11.strm.avail_out) return A$1; @@ -37714,11 +37918,11 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } return e$11.match_available && (n$10 = u$4._tr_tally(e$11, 0, e$11.window[e$11.strstart - 1]), e$11.match_available = 0), e$11.insert = e$11.strstart < x$2 - 1 ? e$11.strstart : x$2 - 1, t$7 === f$4 ? (N$2(e$11, !0), 0 === e$11.strm.avail_out ? O : B$2) : e$11.last_lit && (N$2(e$11, !1), 0 === e$11.strm.avail_out) ? A$1 : I$2; } - function M$3(e$11, t$7, r$11, n$10, i$8) { - this.good_length = e$11, this.max_lazy = t$7, this.nice_length = r$11, this.max_chain = n$10, this.func = i$8; + function M$3(e$11, t$7, r$10, n$10, i$8) { + this.good_length = e$11, this.max_lazy = t$7, this.nice_length = r$10, this.max_chain = n$10, this.func = i$8; } function H$1() { - this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = v$3, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new c$7.Buf16(2 * w$2), this.dyn_dtree = new c$7.Buf16(2 * (2 * a$2 + 1)), this.bl_tree = new c$7.Buf16(2 * (2 * o$10 + 1)), D$2(this.dyn_ltree), D$2(this.dyn_dtree), D$2(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new c$7.Buf16(k$2 + 1), this.heap = new c$7.Buf16(2 * s$5 + 1), D$2(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new c$7.Buf16(2 * s$5 + 1), D$2(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; + this.strm = null, this.status = 0, this.pending_buf = null, this.pending_buf_size = 0, this.pending_out = 0, this.pending = 0, this.wrap = 0, this.gzhead = null, this.gzindex = 0, this.method = v$3, this.last_flush = -1, this.w_size = 0, this.w_bits = 0, this.w_mask = 0, this.window = null, this.window_size = 0, this.prev = null, this.head = null, this.ins_h = 0, this.hash_size = 0, this.hash_bits = 0, this.hash_mask = 0, this.hash_shift = 0, this.block_start = 0, this.match_length = 0, this.prev_match = 0, this.match_available = 0, this.strstart = 0, this.match_start = 0, this.lookahead = 0, this.prev_length = 0, this.max_chain_length = 0, this.max_lazy_match = 0, this.level = 0, this.strategy = 0, this.good_match = 0, this.nice_match = 0, this.dyn_ltree = new c$6.Buf16(2 * w$2), this.dyn_dtree = new c$6.Buf16(2 * (2 * a$2 + 1)), this.bl_tree = new c$6.Buf16(2 * (2 * o$10 + 1)), D$2(this.dyn_ltree), D$2(this.dyn_dtree), D$2(this.bl_tree), this.l_desc = null, this.d_desc = null, this.bl_desc = null, this.bl_count = new c$6.Buf16(k$2 + 1), this.heap = new c$6.Buf16(2 * s$5 + 1), D$2(this.heap), this.heap_len = 0, this.heap_max = 0, this.depth = new c$6.Buf16(2 * s$5 + 1), D$2(this.depth), this.l_buf = 0, this.lit_bufsize = 0, this.last_lit = 0, this.d_buf = 0, this.opt_len = 0, this.static_len = 0, this.matches = 0, this.insert = 0, this.bi_buf = 0, this.bi_valid = 0; } function G$1(e$11) { var t$7; @@ -37730,24 +37934,24 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { e$12.window_size = 2 * e$12.w_size, D$2(e$12.head), e$12.max_lazy_match = h$5[e$12.level].max_lazy, e$12.good_match = h$5[e$12.level].good_length, e$12.nice_match = h$5[e$12.level].nice_length, e$12.max_chain_length = h$5[e$12.level].max_chain, e$12.strstart = 0, e$12.block_start = 0, e$12.lookahead = 0, e$12.insert = 0, e$12.match_length = e$12.prev_length = x$2 - 1, e$12.match_available = 0, e$12.ins_h = 0; }(e$11.state), t$7; } - function Y(e$11, t$7, r$11, n$10, i$8, s$6) { + function Y(e$11, t$7, r$10, n$10, i$8, s$6) { if (!e$11) return _$2; var a$3 = 1; - if (t$7 === g$1 && (t$7 = 6), n$10 < 0 ? (a$3 = 0, n$10 = -n$10) : 15 < n$10 && (a$3 = 2, n$10 -= 16), i$8 < 1 || y$3 < i$8 || r$11 !== v$3 || n$10 < 8 || 15 < n$10 || t$7 < 0 || 9 < t$7 || s$6 < 0 || b$3 < s$6) return R$1(e$11, _$2); + if (t$7 === g$1 && (t$7 = 6), n$10 < 0 ? (a$3 = 0, n$10 = -n$10) : 15 < n$10 && (a$3 = 2, n$10 -= 16), i$8 < 1 || y$3 < i$8 || r$10 !== v$3 || n$10 < 8 || 15 < n$10 || t$7 < 0 || 9 < t$7 || s$6 < 0 || b$3 < s$6) return R$1(e$11, _$2); 8 === n$10 && (n$10 = 9); var o$11 = new H$1(); - return (e$11.state = o$11).strm = e$11, o$11.wrap = a$3, o$11.gzhead = null, o$11.w_bits = n$10, o$11.w_size = 1 << o$11.w_bits, o$11.w_mask = o$11.w_size - 1, o$11.hash_bits = i$8 + 7, o$11.hash_size = 1 << o$11.hash_bits, o$11.hash_mask = o$11.hash_size - 1, o$11.hash_shift = ~~((o$11.hash_bits + x$2 - 1) / x$2), o$11.window = new c$7.Buf8(2 * o$11.w_size), o$11.head = new c$7.Buf16(o$11.hash_size), o$11.prev = new c$7.Buf16(o$11.w_size), o$11.lit_bufsize = 1 << i$8 + 6, o$11.pending_buf_size = 4 * o$11.lit_bufsize, o$11.pending_buf = new c$7.Buf8(o$11.pending_buf_size), o$11.d_buf = 1 * o$11.lit_bufsize, o$11.l_buf = 3 * o$11.lit_bufsize, o$11.level = t$7, o$11.strategy = s$6, o$11.method = r$11, K$1(e$11); + return (e$11.state = o$11).strm = e$11, o$11.wrap = a$3, o$11.gzhead = null, o$11.w_bits = n$10, o$11.w_size = 1 << o$11.w_bits, o$11.w_mask = o$11.w_size - 1, o$11.hash_bits = i$8 + 7, o$11.hash_size = 1 << o$11.hash_bits, o$11.hash_mask = o$11.hash_size - 1, o$11.hash_shift = ~~((o$11.hash_bits + x$2 - 1) / x$2), o$11.window = new c$6.Buf8(2 * o$11.w_size), o$11.head = new c$6.Buf16(o$11.hash_size), o$11.prev = new c$6.Buf16(o$11.w_size), o$11.lit_bufsize = 1 << i$8 + 6, o$11.pending_buf_size = 4 * o$11.lit_bufsize, o$11.pending_buf = new c$6.Buf8(o$11.pending_buf_size), o$11.d_buf = 1 * o$11.lit_bufsize, o$11.l_buf = 3 * o$11.lit_bufsize, o$11.level = t$7, o$11.strategy = s$6, o$11.method = r$10, K$1(e$11); } h$5 = [ new M$3(0, 0, 0, 0, function(e$11, t$7) { - var r$11 = 65535; - for (r$11 > e$11.pending_buf_size - 5 && (r$11 = e$11.pending_buf_size - 5);;) { + var r$10 = 65535; + for (r$10 > e$11.pending_buf_size - 5 && (r$10 = e$11.pending_buf_size - 5);;) { if (e$11.lookahead <= 1) { if (j$2(e$11), 0 === e$11.lookahead && t$7 === l$3) return A$1; if (0 === e$11.lookahead) break; } e$11.strstart += e$11.lookahead, e$11.lookahead = 0; - var n$10 = e$11.block_start + r$11; + var n$10 = e$11.block_start + r$10; if ((0 === e$11.strstart || e$11.strstart >= n$10) && (e$11.lookahead = e$11.strstart - n$10, e$11.strstart = n$10, N$2(e$11, !1), 0 === e$11.strm.avail_out)) return A$1; if (e$11.strstart - e$11.block_start >= e$11.w_size - z$2 && (N$2(e$11, !1), 0 === e$11.strm.avail_out)) return A$1; } @@ -37762,15 +37966,15 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { new M$3(8, 32, 128, 256, W$1), new M$3(32, 128, 258, 1024, W$1), new M$3(32, 258, 258, 4096, W$1) - ], r$10.deflateInit = function(e$11, t$7) { + ], r$9.deflateInit = function(e$11, t$7) { return Y(e$11, t$7, v$3, 15, 8, 0); - }, r$10.deflateInit2 = Y, r$10.deflateReset = K$1, r$10.deflateResetKeep = G$1, r$10.deflateSetHeader = function(e$11, t$7) { + }, r$9.deflateInit2 = Y, r$9.deflateReset = K$1, r$9.deflateResetKeep = G$1, r$9.deflateSetHeader = function(e$11, t$7) { return e$11 && e$11.state ? 2 !== e$11.state.wrap ? _$2 : (e$11.state.gzhead = t$7, m$3) : _$2; - }, r$10.deflate = function(e$11, t$7) { - var r$11, n$10, i$8, s$6; + }, r$9.deflate = function(e$11, t$7) { + var r$10, n$10, i$8, s$6; if (!e$11 || !e$11.state || 5 < t$7 || t$7 < 0) return e$11 ? R$1(e$11, _$2) : _$2; if (n$10 = e$11.state, !e$11.output || !e$11.input && 0 !== e$11.avail_in || 666 === n$10.status && t$7 !== f$4) return R$1(e$11, 0 === e$11.avail_out ? -5 : _$2); - if (n$10.strm = e$11, r$11 = n$10.last_flush, n$10.last_flush = t$7, n$10.status === C$2) if (2 === n$10.wrap) e$11.adler = 0, U$1(n$10, 31), U$1(n$10, 139), U$1(n$10, 8), n$10.gzhead ? (U$1(n$10, (n$10.gzhead.text ? 1 : 0) + (n$10.gzhead.hcrc ? 2 : 0) + (n$10.gzhead.extra ? 4 : 0) + (n$10.gzhead.name ? 8 : 0) + (n$10.gzhead.comment ? 16 : 0)), U$1(n$10, 255 & n$10.gzhead.time), U$1(n$10, n$10.gzhead.time >> 8 & 255), U$1(n$10, n$10.gzhead.time >> 16 & 255), U$1(n$10, n$10.gzhead.time >> 24 & 255), U$1(n$10, 9 === n$10.level ? 2 : 2 <= n$10.strategy || n$10.level < 2 ? 4 : 0), U$1(n$10, 255 & n$10.gzhead.os), n$10.gzhead.extra && n$10.gzhead.extra.length && (U$1(n$10, 255 & n$10.gzhead.extra.length), U$1(n$10, n$10.gzhead.extra.length >> 8 & 255)), n$10.gzhead.hcrc && (e$11.adler = p$3(e$11.adler, n$10.pending_buf, n$10.pending, 0)), n$10.gzindex = 0, n$10.status = 69) : (U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 9 === n$10.level ? 2 : 2 <= n$10.strategy || n$10.level < 2 ? 4 : 0), U$1(n$10, 3), n$10.status = E$2); + if (n$10.strm = e$11, r$10 = n$10.last_flush, n$10.last_flush = t$7, n$10.status === C$2) if (2 === n$10.wrap) e$11.adler = 0, U$1(n$10, 31), U$1(n$10, 139), U$1(n$10, 8), n$10.gzhead ? (U$1(n$10, (n$10.gzhead.text ? 1 : 0) + (n$10.gzhead.hcrc ? 2 : 0) + (n$10.gzhead.extra ? 4 : 0) + (n$10.gzhead.name ? 8 : 0) + (n$10.gzhead.comment ? 16 : 0)), U$1(n$10, 255 & n$10.gzhead.time), U$1(n$10, n$10.gzhead.time >> 8 & 255), U$1(n$10, n$10.gzhead.time >> 16 & 255), U$1(n$10, n$10.gzhead.time >> 24 & 255), U$1(n$10, 9 === n$10.level ? 2 : 2 <= n$10.strategy || n$10.level < 2 ? 4 : 0), U$1(n$10, 255 & n$10.gzhead.os), n$10.gzhead.extra && n$10.gzhead.extra.length && (U$1(n$10, 255 & n$10.gzhead.extra.length), U$1(n$10, n$10.gzhead.extra.length >> 8 & 255)), n$10.gzhead.hcrc && (e$11.adler = p$3(e$11.adler, n$10.pending_buf, n$10.pending, 0)), n$10.gzindex = 0, n$10.status = 69) : (U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 0), U$1(n$10, 9 === n$10.level ? 2 : 2 <= n$10.strategy || n$10.level < 2 ? 4 : 0), U$1(n$10, 3), n$10.status = E$2); else { var a$3 = v$3 + (n$10.w_bits - 8 << 4) << 8; a$3 |= (2 <= n$10.strategy || n$10.level < 2 ? 0 : n$10.level < 6 ? 1 : 6 === n$10.level ? 2 : 3) << 6, 0 !== n$10.strstart && (a$3 |= 32), a$3 += 31 - a$3 % 31, n$10.status = E$2, P$2(n$10, a$3), 0 !== n$10.strstart && (P$2(n$10, e$11.adler >>> 16), P$2(n$10, 65535 & e$11.adler)), e$11.adler = 1; @@ -37803,20 +38007,20 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } else n$10.status = 103; if (103 === n$10.status && (n$10.gzhead.hcrc ? (n$10.pending + 2 > n$10.pending_buf_size && F$1(e$11), n$10.pending + 2 <= n$10.pending_buf_size && (U$1(n$10, 255 & e$11.adler), U$1(n$10, e$11.adler >> 8 & 255), e$11.adler = 0, n$10.status = E$2)) : n$10.status = E$2), 0 !== n$10.pending) { if (F$1(e$11), 0 === e$11.avail_out) return n$10.last_flush = -1, m$3; - } else if (0 === e$11.avail_in && T$3(t$7) <= T$3(r$11) && t$7 !== f$4) return R$1(e$11, -5); + } else if (0 === e$11.avail_in && T$3(t$7) <= T$3(r$10) && t$7 !== f$4) return R$1(e$11, -5); if (666 === n$10.status && 0 !== e$11.avail_in) return R$1(e$11, -5); if (0 !== e$11.avail_in || 0 !== n$10.lookahead || t$7 !== l$3 && 666 !== n$10.status) { var o$11 = 2 === n$10.strategy ? function(e$12, t$8) { - for (var r$12;;) { + for (var r$11;;) { if (0 === e$12.lookahead && (j$2(e$12), 0 === e$12.lookahead)) { if (t$8 === l$3) return A$1; break; } - if (e$12.match_length = 0, r$12 = u$4._tr_tally(e$12, 0, e$12.window[e$12.strstart]), e$12.lookahead--, e$12.strstart++, r$12 && (N$2(e$12, !1), 0 === e$12.strm.avail_out)) return A$1; + if (e$12.match_length = 0, r$11 = u$4._tr_tally(e$12, 0, e$12.window[e$12.strstart]), e$12.lookahead--, e$12.strstart++, r$11 && (N$2(e$12, !1), 0 === e$12.strm.avail_out)) return A$1; } return e$12.insert = 0, t$8 === f$4 ? (N$2(e$12, !0), 0 === e$12.strm.avail_out ? O : B$2) : e$12.last_lit && (N$2(e$12, !1), 0 === e$12.strm.avail_out) ? A$1 : I$2; }(n$10, t$7) : 3 === n$10.strategy ? function(e$12, t$8) { - for (var r$12, n$11, i$9, s$7, a$4 = e$12.window;;) { + for (var r$11, n$11, i$9, s$7, a$4 = e$12.window;;) { if (e$12.lookahead <= S$4) { if (j$2(e$12), e$12.lookahead <= S$4 && t$8 === l$3) return A$1; if (0 === e$12.lookahead) break; @@ -37826,7 +38030,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { do {} while (n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && n$11 === a$4[++i$9] && i$9 < s$7); e$12.match_length = S$4 - (s$7 - i$9), e$12.match_length > e$12.lookahead && (e$12.match_length = e$12.lookahead); } - if (e$12.match_length >= x$2 ? (r$12 = u$4._tr_tally(e$12, 1, e$12.match_length - x$2), e$12.lookahead -= e$12.match_length, e$12.strstart += e$12.match_length, e$12.match_length = 0) : (r$12 = u$4._tr_tally(e$12, 0, e$12.window[e$12.strstart]), e$12.lookahead--, e$12.strstart++), r$12 && (N$2(e$12, !1), 0 === e$12.strm.avail_out)) return A$1; + if (e$12.match_length >= x$2 ? (r$11 = u$4._tr_tally(e$12, 1, e$12.match_length - x$2), e$12.lookahead -= e$12.match_length, e$12.strstart += e$12.match_length, e$12.match_length = 0) : (r$11 = u$4._tr_tally(e$12, 0, e$12.window[e$12.strstart]), e$12.lookahead--, e$12.strstart++), r$11 && (N$2(e$12, !1), 0 === e$12.strm.avail_out)) return A$1; } return e$12.insert = 0, t$8 === f$4 ? (N$2(e$12, !0), 0 === e$12.strm.avail_out ? O : B$2) : e$12.last_lit && (N$2(e$12, !1), 0 === e$12.strm.avail_out) ? A$1 : I$2; }(n$10, t$7) : h$5[n$10.level].func(n$10, t$7); @@ -37834,19 +38038,19 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (o$11 === I$2 && (1 === t$7 ? u$4._tr_align(n$10) : 5 !== t$7 && (u$4._tr_stored_block(n$10, 0, 0, !1), 3 === t$7 && (D$2(n$10.head), 0 === n$10.lookahead && (n$10.strstart = 0, n$10.block_start = 0, n$10.insert = 0))), F$1(e$11), 0 === e$11.avail_out)) return n$10.last_flush = -1, m$3; } return t$7 !== f$4 ? m$3 : n$10.wrap <= 0 ? 1 : (2 === n$10.wrap ? (U$1(n$10, 255 & e$11.adler), U$1(n$10, e$11.adler >> 8 & 255), U$1(n$10, e$11.adler >> 16 & 255), U$1(n$10, e$11.adler >> 24 & 255), U$1(n$10, 255 & e$11.total_in), U$1(n$10, e$11.total_in >> 8 & 255), U$1(n$10, e$11.total_in >> 16 & 255), U$1(n$10, e$11.total_in >> 24 & 255)) : (P$2(n$10, e$11.adler >>> 16), P$2(n$10, 65535 & e$11.adler)), F$1(e$11), 0 < n$10.wrap && (n$10.wrap = -n$10.wrap), 0 !== n$10.pending ? m$3 : 1); - }, r$10.deflateEnd = function(e$11) { + }, r$9.deflateEnd = function(e$11) { var t$7; return e$11 && e$11.state ? (t$7 = e$11.state.status) !== C$2 && 69 !== t$7 && 73 !== t$7 && 91 !== t$7 && 103 !== t$7 && t$7 !== E$2 && 666 !== t$7 ? R$1(e$11, _$2) : (e$11.state = null, t$7 === E$2 ? R$1(e$11, -3) : m$3) : _$2; - }, r$10.deflateSetDictionary = function(e$11, t$7) { - var r$11, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4 = t$7.length; + }, r$9.deflateSetDictionary = function(e$11, t$7) { + var r$10, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4 = t$7.length; if (!e$11 || !e$11.state) return _$2; - if (2 === (s$6 = (r$11 = e$11.state).wrap) || 1 === s$6 && r$11.status !== C$2 || r$11.lookahead) return _$2; - for (1 === s$6 && (e$11.adler = d$5(e$11.adler, t$7, l$4, 0)), r$11.wrap = 0, l$4 >= r$11.w_size && (0 === s$6 && (D$2(r$11.head), r$11.strstart = 0, r$11.block_start = 0, r$11.insert = 0), u$5 = new c$7.Buf8(r$11.w_size), c$7.arraySet(u$5, t$7, l$4 - r$11.w_size, r$11.w_size, 0), t$7 = u$5, l$4 = r$11.w_size), a$3 = e$11.avail_in, o$11 = e$11.next_in, h$6 = e$11.input, e$11.avail_in = l$4, e$11.next_in = 0, e$11.input = t$7, j$2(r$11); r$11.lookahead >= x$2;) { - for (n$10 = r$11.strstart, i$8 = r$11.lookahead - (x$2 - 1); r$11.ins_h = (r$11.ins_h << r$11.hash_shift ^ r$11.window[n$10 + x$2 - 1]) & r$11.hash_mask, r$11.prev[n$10 & r$11.w_mask] = r$11.head[r$11.ins_h], r$11.head[r$11.ins_h] = n$10, n$10++, --i$8;); - r$11.strstart = n$10, r$11.lookahead = x$2 - 1, j$2(r$11); + if (2 === (s$6 = (r$10 = e$11.state).wrap) || 1 === s$6 && r$10.status !== C$2 || r$10.lookahead) return _$2; + for (1 === s$6 && (e$11.adler = d$4(e$11.adler, t$7, l$4, 0)), r$10.wrap = 0, l$4 >= r$10.w_size && (0 === s$6 && (D$2(r$10.head), r$10.strstart = 0, r$10.block_start = 0, r$10.insert = 0), u$5 = new c$6.Buf8(r$10.w_size), c$6.arraySet(u$5, t$7, l$4 - r$10.w_size, r$10.w_size, 0), t$7 = u$5, l$4 = r$10.w_size), a$3 = e$11.avail_in, o$11 = e$11.next_in, h$6 = e$11.input, e$11.avail_in = l$4, e$11.next_in = 0, e$11.input = t$7, j$2(r$10); r$10.lookahead >= x$2;) { + for (n$10 = r$10.strstart, i$8 = r$10.lookahead - (x$2 - 1); r$10.ins_h = (r$10.ins_h << r$10.hash_shift ^ r$10.window[n$10 + x$2 - 1]) & r$10.hash_mask, r$10.prev[n$10 & r$10.w_mask] = r$10.head[r$10.ins_h], r$10.head[r$10.ins_h] = n$10, n$10++, --i$8;); + r$10.strstart = n$10, r$10.lookahead = x$2 - 1, j$2(r$10); } - return r$11.strstart += r$11.lookahead, r$11.block_start = r$11.strstart, r$11.insert = r$11.lookahead, r$11.lookahead = 0, r$11.match_length = r$11.prev_length = x$2 - 1, r$11.match_available = 0, e$11.next_in = o$11, e$11.input = h$6, e$11.avail_in = a$3, r$11.wrap = s$6, m$3; - }, r$10.deflateInfo = "pako deflate (from Nodeca project)"; + return r$10.strstart += r$10.lookahead, r$10.block_start = r$10.strstart, r$10.insert = r$10.lookahead, r$10.lookahead = 0, r$10.match_length = r$10.prev_length = x$2 - 1, r$10.match_available = 0, e$11.next_in = o$11, e$11.input = h$6, e$11.avail_in = a$3, r$10.wrap = s$6, m$3; + }, r$9.deflateInfo = "pako deflate (from Nodeca project)"; }, { "../utils/common": 41, "./adler32": 43, @@ -37854,68 +38058,68 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./messages": 51, "./trees": 52 }], - 47: [function(e$10, t$6, r$10) { + 47: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = function() { this.text = 0, this.time = 0, this.xflags = 0, this.os = 0, this.extra = null, this.extra_len = 0, this.name = "", this.comment = "", this.hcrc = 0, this.done = !1; }; }, {}], - 48: [function(e$10, t$6, r$10) { + 48: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = function(e$11, t$7) { - var r$11, n$9, i$7, s$5, a$2, o$10, h$5, u$4, l$3, f$4, c$7, d$5, p$3, m$3, _$2, g$1, b$3, v$3, y$3, w$2, k$2, x$2, S$4, z$2, C$2; - r$11 = e$11.state, n$9 = e$11.next_in, z$2 = e$11.input, i$7 = n$9 + (e$11.avail_in - 5), s$5 = e$11.next_out, C$2 = e$11.output, a$2 = s$5 - (t$7 - e$11.avail_out), o$10 = s$5 + (e$11.avail_out - 257), h$5 = r$11.dmax, u$4 = r$11.wsize, l$3 = r$11.whave, f$4 = r$11.wnext, c$7 = r$11.window, d$5 = r$11.hold, p$3 = r$11.bits, m$3 = r$11.lencode, _$2 = r$11.distcode, g$1 = (1 << r$11.lenbits) - 1, b$3 = (1 << r$11.distbits) - 1; + var r$10, n$9, i$7, s$5, a$2, o$10, h$5, u$4, l$3, f$4, c$6, d$4, p$3, m$3, _$2, g$1, b$3, v$3, y$3, w$2, k$2, x$2, S$4, z$2, C$2; + r$10 = e$11.state, n$9 = e$11.next_in, z$2 = e$11.input, i$7 = n$9 + (e$11.avail_in - 5), s$5 = e$11.next_out, C$2 = e$11.output, a$2 = s$5 - (t$7 - e$11.avail_out), o$10 = s$5 + (e$11.avail_out - 257), h$5 = r$10.dmax, u$4 = r$10.wsize, l$3 = r$10.whave, f$4 = r$10.wnext, c$6 = r$10.window, d$4 = r$10.hold, p$3 = r$10.bits, m$3 = r$10.lencode, _$2 = r$10.distcode, g$1 = (1 << r$10.lenbits) - 1, b$3 = (1 << r$10.distbits) - 1; e: do { - p$3 < 15 && (d$5 += z$2[n$9++] << p$3, p$3 += 8, d$5 += z$2[n$9++] << p$3, p$3 += 8), v$3 = m$3[d$5 & g$1]; + p$3 < 15 && (d$4 += z$2[n$9++] << p$3, p$3 += 8, d$4 += z$2[n$9++] << p$3, p$3 += 8), v$3 = m$3[d$4 & g$1]; t: for (;;) { - if (d$5 >>>= y$3 = v$3 >>> 24, p$3 -= y$3, 0 === (y$3 = v$3 >>> 16 & 255)) C$2[s$5++] = 65535 & v$3; + if (d$4 >>>= y$3 = v$3 >>> 24, p$3 -= y$3, 0 === (y$3 = v$3 >>> 16 & 255)) C$2[s$5++] = 65535 & v$3; else { if (!(16 & y$3)) { if (0 == (64 & y$3)) { - v$3 = m$3[(65535 & v$3) + (d$5 & (1 << y$3) - 1)]; + v$3 = m$3[(65535 & v$3) + (d$4 & (1 << y$3) - 1)]; continue t; } if (32 & y$3) { - r$11.mode = 12; + r$10.mode = 12; break e; } - e$11.msg = "invalid literal/length code", r$11.mode = 30; + e$11.msg = "invalid literal/length code", r$10.mode = 30; break e; } - w$2 = 65535 & v$3, (y$3 &= 15) && (p$3 < y$3 && (d$5 += z$2[n$9++] << p$3, p$3 += 8), w$2 += d$5 & (1 << y$3) - 1, d$5 >>>= y$3, p$3 -= y$3), p$3 < 15 && (d$5 += z$2[n$9++] << p$3, p$3 += 8, d$5 += z$2[n$9++] << p$3, p$3 += 8), v$3 = _$2[d$5 & b$3]; + w$2 = 65535 & v$3, (y$3 &= 15) && (p$3 < y$3 && (d$4 += z$2[n$9++] << p$3, p$3 += 8), w$2 += d$4 & (1 << y$3) - 1, d$4 >>>= y$3, p$3 -= y$3), p$3 < 15 && (d$4 += z$2[n$9++] << p$3, p$3 += 8, d$4 += z$2[n$9++] << p$3, p$3 += 8), v$3 = _$2[d$4 & b$3]; r: for (;;) { - if (d$5 >>>= y$3 = v$3 >>> 24, p$3 -= y$3, !(16 & (y$3 = v$3 >>> 16 & 255))) { + if (d$4 >>>= y$3 = v$3 >>> 24, p$3 -= y$3, !(16 & (y$3 = v$3 >>> 16 & 255))) { if (0 == (64 & y$3)) { - v$3 = _$2[(65535 & v$3) + (d$5 & (1 << y$3) - 1)]; + v$3 = _$2[(65535 & v$3) + (d$4 & (1 << y$3) - 1)]; continue r; } - e$11.msg = "invalid distance code", r$11.mode = 30; + e$11.msg = "invalid distance code", r$10.mode = 30; break e; } - if (k$2 = 65535 & v$3, p$3 < (y$3 &= 15) && (d$5 += z$2[n$9++] << p$3, (p$3 += 8) < y$3 && (d$5 += z$2[n$9++] << p$3, p$3 += 8)), h$5 < (k$2 += d$5 & (1 << y$3) - 1)) { - e$11.msg = "invalid distance too far back", r$11.mode = 30; + if (k$2 = 65535 & v$3, p$3 < (y$3 &= 15) && (d$4 += z$2[n$9++] << p$3, (p$3 += 8) < y$3 && (d$4 += z$2[n$9++] << p$3, p$3 += 8)), h$5 < (k$2 += d$4 & (1 << y$3) - 1)) { + e$11.msg = "invalid distance too far back", r$10.mode = 30; break e; } - if (d$5 >>>= y$3, p$3 -= y$3, (y$3 = s$5 - a$2) < k$2) { - if (l$3 < (y$3 = k$2 - y$3) && r$11.sane) { - e$11.msg = "invalid distance too far back", r$11.mode = 30; + if (d$4 >>>= y$3, p$3 -= y$3, (y$3 = s$5 - a$2) < k$2) { + if (l$3 < (y$3 = k$2 - y$3) && r$10.sane) { + e$11.msg = "invalid distance too far back", r$10.mode = 30; break e; } - if (S$4 = c$7, (x$2 = 0) === f$4) { + if (S$4 = c$6, (x$2 = 0) === f$4) { if (x$2 += u$4 - y$3, y$3 < w$2) { - for (w$2 -= y$3; C$2[s$5++] = c$7[x$2++], --y$3;); + for (w$2 -= y$3; C$2[s$5++] = c$6[x$2++], --y$3;); x$2 = s$5 - k$2, S$4 = C$2; } } else if (f$4 < y$3) { if (x$2 += u$4 + f$4 - y$3, (y$3 -= f$4) < w$2) { - for (w$2 -= y$3; C$2[s$5++] = c$7[x$2++], --y$3;); + for (w$2 -= y$3; C$2[s$5++] = c$6[x$2++], --y$3;); if (x$2 = 0, f$4 < w$2) { - for (w$2 -= y$3 = f$4; C$2[s$5++] = c$7[x$2++], --y$3;); + for (w$2 -= y$3 = f$4; C$2[s$5++] = c$6[x$2++], --y$3;); x$2 = s$5 - k$2, S$4 = C$2; } } } else if (x$2 += f$4 - y$3, y$3 < w$2) { - for (w$2 -= y$3; C$2[s$5++] = c$7[x$2++], --y$3;); + for (w$2 -= y$3; C$2[s$5++] = c$6[x$2++], --y$3;); x$2 = s$5 - k$2, S$4 = C$2; } for (; 2 < w$2;) C$2[s$5++] = S$4[x$2++], C$2[s$5++] = S$4[x$2++], C$2[s$5++] = S$4[x$2++], w$2 -= 3; @@ -37930,10 +38134,10 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { break; } } while (n$9 < i$7 && s$5 < o$10); - n$9 -= w$2 = p$3 >> 3, d$5 &= (1 << (p$3 -= w$2 << 3)) - 1, e$11.next_in = n$9, e$11.next_out = s$5, e$11.avail_in = n$9 < i$7 ? i$7 - n$9 + 5 : 5 - (n$9 - i$7), e$11.avail_out = s$5 < o$10 ? o$10 - s$5 + 257 : 257 - (s$5 - o$10), r$11.hold = d$5, r$11.bits = p$3; + n$9 -= w$2 = p$3 >> 3, d$4 &= (1 << (p$3 -= w$2 << 3)) - 1, e$11.next_in = n$9, e$11.next_out = s$5, e$11.avail_in = n$9 < i$7 ? i$7 - n$9 + 5 : 5 - (n$9 - i$7), e$11.avail_out = s$5 < o$10 ? o$10 - s$5 + 257 : 257 - (s$5 - o$10), r$10.hold = d$4, r$10.bits = p$3; }; }, {}], - 49: [function(e$10, t$6, r$10) { + 49: [function(e$10, t$6, r$9) { "use strict"; var I$2 = e$10("../utils/common"), O = e$10("./adler32"), B$2 = e$10("./crc32"), R$1 = e$10("./inffast"), T$3 = e$10("./inftrees"), D$2 = 1, F$1 = 2, N$2 = 0, U$1 = -2, P$2 = 1, n$9 = 852, i$7 = 592; function L$2(e$11) { @@ -37951,34 +38155,34 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { return e$11 && e$11.state ? ((t$7 = e$11.state).wsize = 0, t$7.whave = 0, t$7.wnext = 0, a$2(e$11)) : U$1; } function h$5(e$11, t$7) { - var r$11, n$10; - return e$11 && e$11.state ? (n$10 = e$11.state, t$7 < 0 ? (r$11 = 0, t$7 = -t$7) : (r$11 = 1 + (t$7 >> 4), t$7 < 48 && (t$7 &= 15)), t$7 && (t$7 < 8 || 15 < t$7) ? U$1 : (null !== n$10.window && n$10.wbits !== t$7 && (n$10.window = null), n$10.wrap = r$11, n$10.wbits = t$7, o$10(e$11))) : U$1; + var r$10, n$10; + return e$11 && e$11.state ? (n$10 = e$11.state, t$7 < 0 ? (r$10 = 0, t$7 = -t$7) : (r$10 = 1 + (t$7 >> 4), t$7 < 48 && (t$7 &= 15)), t$7 && (t$7 < 8 || 15 < t$7) ? U$1 : (null !== n$10.window && n$10.wbits !== t$7 && (n$10.window = null), n$10.wrap = r$10, n$10.wbits = t$7, o$10(e$11))) : U$1; } function u$4(e$11, t$7) { - var r$11, n$10; - return e$11 ? (n$10 = new s$5(), (e$11.state = n$10).window = null, (r$11 = h$5(e$11, t$7)) !== N$2 && (e$11.state = null), r$11) : U$1; + var r$10, n$10; + return e$11 ? (n$10 = new s$5(), (e$11.state = n$10).window = null, (r$10 = h$5(e$11, t$7)) !== N$2 && (e$11.state = null), r$10) : U$1; } - var l$3, f$4, c$7 = !0; + var l$3, f$4, c$6 = !0; function j$2(e$11) { - if (c$7) { + if (c$6) { var t$7; for (l$3 = new I$2.Buf32(512), f$4 = new I$2.Buf32(32), t$7 = 0; t$7 < 144;) e$11.lens[t$7++] = 8; for (; t$7 < 256;) e$11.lens[t$7++] = 9; for (; t$7 < 280;) e$11.lens[t$7++] = 7; for (; t$7 < 288;) e$11.lens[t$7++] = 8; for (T$3(D$2, e$11.lens, 0, 288, l$3, 0, e$11.work, { bits: 9 }), t$7 = 0; t$7 < 32;) e$11.lens[t$7++] = 5; - T$3(F$1, e$11.lens, 0, 32, f$4, 0, e$11.work, { bits: 5 }), c$7 = !1; + T$3(F$1, e$11.lens, 0, 32, f$4, 0, e$11.work, { bits: 5 }), c$6 = !1; } e$11.lencode = l$3, e$11.lenbits = 9, e$11.distcode = f$4, e$11.distbits = 5; } - function Z$1(e$11, t$7, r$11, n$10) { + function Z$1(e$11, t$7, r$10, n$10) { var i$8, s$6 = e$11.state; - return null === s$6.window && (s$6.wsize = 1 << s$6.wbits, s$6.wnext = 0, s$6.whave = 0, s$6.window = new I$2.Buf8(s$6.wsize)), n$10 >= s$6.wsize ? (I$2.arraySet(s$6.window, t$7, r$11 - s$6.wsize, s$6.wsize, 0), s$6.wnext = 0, s$6.whave = s$6.wsize) : (n$10 < (i$8 = s$6.wsize - s$6.wnext) && (i$8 = n$10), I$2.arraySet(s$6.window, t$7, r$11 - n$10, i$8, s$6.wnext), (n$10 -= i$8) ? (I$2.arraySet(s$6.window, t$7, r$11 - n$10, n$10, 0), s$6.wnext = n$10, s$6.whave = s$6.wsize) : (s$6.wnext += i$8, s$6.wnext === s$6.wsize && (s$6.wnext = 0), s$6.whave < s$6.wsize && (s$6.whave += i$8))), 0; + return null === s$6.window && (s$6.wsize = 1 << s$6.wbits, s$6.wnext = 0, s$6.whave = 0, s$6.window = new I$2.Buf8(s$6.wsize)), n$10 >= s$6.wsize ? (I$2.arraySet(s$6.window, t$7, r$10 - s$6.wsize, s$6.wsize, 0), s$6.wnext = 0, s$6.whave = s$6.wsize) : (n$10 < (i$8 = s$6.wsize - s$6.wnext) && (i$8 = n$10), I$2.arraySet(s$6.window, t$7, r$10 - n$10, i$8, s$6.wnext), (n$10 -= i$8) ? (I$2.arraySet(s$6.window, t$7, r$10 - n$10, n$10, 0), s$6.wnext = n$10, s$6.whave = s$6.wsize) : (s$6.wnext += i$8, s$6.wnext === s$6.wsize && (s$6.wnext = 0), s$6.whave < s$6.wsize && (s$6.whave += i$8))), 0; } - r$10.inflateReset = o$10, r$10.inflateReset2 = h$5, r$10.inflateResetKeep = a$2, r$10.inflateInit = function(e$11) { + r$9.inflateReset = o$10, r$9.inflateReset2 = h$5, r$9.inflateResetKeep = a$2, r$9.inflateInit = function(e$11) { return u$4(e$11, 15); - }, r$10.inflateInit2 = u$4, r$10.inflate = function(e$11, t$7) { - var r$11, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4, f$5, c$8, d$5, p$3, m$3, _$2, g$1, b$3, v$3, y$3, w$2, k$2, x$2, S$4, z$2, C$2 = 0, E$2 = new I$2.Buf8(4), A$1 = [ + }, r$9.inflateInit2 = u$4, r$9.inflate = function(e$11, t$7) { + var r$10, n$10, i$8, s$6, a$3, o$11, h$6, u$5, l$4, f$5, c$7, d$4, p$3, m$3, _$2, g$1, b$3, v$3, y$3, w$2, k$2, x$2, S$4, z$2, C$2 = 0, E$2 = new I$2.Buf8(4), A$1 = [ 16, 17, 18, @@ -38000,133 +38204,133 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { 15 ]; if (!e$11 || !e$11.state || !e$11.output || !e$11.input && 0 !== e$11.avail_in) return U$1; - 12 === (r$11 = e$11.state).mode && (r$11.mode = 13), a$3 = e$11.next_out, i$8 = e$11.output, h$6 = e$11.avail_out, s$6 = e$11.next_in, n$10 = e$11.input, o$11 = e$11.avail_in, u$5 = r$11.hold, l$4 = r$11.bits, f$5 = o$11, c$8 = h$6, x$2 = N$2; - e: for (;;) switch (r$11.mode) { + 12 === (r$10 = e$11.state).mode && (r$10.mode = 13), a$3 = e$11.next_out, i$8 = e$11.output, h$6 = e$11.avail_out, s$6 = e$11.next_in, n$10 = e$11.input, o$11 = e$11.avail_in, u$5 = r$10.hold, l$4 = r$10.bits, f$5 = o$11, c$7 = h$6, x$2 = N$2; + e: for (;;) switch (r$10.mode) { case P$2: - if (0 === r$11.wrap) { - r$11.mode = 13; + if (0 === r$10.wrap) { + r$10.mode = 13; break; } for (; l$4 < 16;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (2 & r$11.wrap && 35615 === u$5) { - E$2[r$11.check = 0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$11.check = B$2(r$11.check, E$2, 2, 0), l$4 = u$5 = 0, r$11.mode = 2; + if (2 & r$10.wrap && 35615 === u$5) { + E$2[r$10.check = 0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$10.check = B$2(r$10.check, E$2, 2, 0), l$4 = u$5 = 0, r$10.mode = 2; break; } - if (r$11.flags = 0, r$11.head && (r$11.head.done = !1), !(1 & r$11.wrap) || (((255 & u$5) << 8) + (u$5 >> 8)) % 31) { - e$11.msg = "incorrect header check", r$11.mode = 30; + if (r$10.flags = 0, r$10.head && (r$10.head.done = !1), !(1 & r$10.wrap) || (((255 & u$5) << 8) + (u$5 >> 8)) % 31) { + e$11.msg = "incorrect header check", r$10.mode = 30; break; } if (8 != (15 & u$5)) { - e$11.msg = "unknown compression method", r$11.mode = 30; + e$11.msg = "unknown compression method", r$10.mode = 30; break; } - if (l$4 -= 4, k$2 = 8 + (15 & (u$5 >>>= 4)), 0 === r$11.wbits) r$11.wbits = k$2; - else if (k$2 > r$11.wbits) { - e$11.msg = "invalid window size", r$11.mode = 30; + if (l$4 -= 4, k$2 = 8 + (15 & (u$5 >>>= 4)), 0 === r$10.wbits) r$10.wbits = k$2; + else if (k$2 > r$10.wbits) { + e$11.msg = "invalid window size", r$10.mode = 30; break; } - r$11.dmax = 1 << k$2, e$11.adler = r$11.check = 1, r$11.mode = 512 & u$5 ? 10 : 12, l$4 = u$5 = 0; + r$10.dmax = 1 << k$2, e$11.adler = r$10.check = 1, r$10.mode = 512 & u$5 ? 10 : 12, l$4 = u$5 = 0; break; case 2: for (; l$4 < 16;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (r$11.flags = u$5, 8 != (255 & r$11.flags)) { - e$11.msg = "unknown compression method", r$11.mode = 30; + if (r$10.flags = u$5, 8 != (255 & r$10.flags)) { + e$11.msg = "unknown compression method", r$10.mode = 30; break; } - if (57344 & r$11.flags) { - e$11.msg = "unknown header flags set", r$11.mode = 30; + if (57344 & r$10.flags) { + e$11.msg = "unknown header flags set", r$10.mode = 30; break; } - r$11.head && (r$11.head.text = u$5 >> 8 & 1), 512 & r$11.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$11.check = B$2(r$11.check, E$2, 2, 0)), l$4 = u$5 = 0, r$11.mode = 3; + r$10.head && (r$10.head.text = u$5 >> 8 & 1), 512 & r$10.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$10.check = B$2(r$10.check, E$2, 2, 0)), l$4 = u$5 = 0, r$10.mode = 3; case 3: for (; l$4 < 32;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.head && (r$11.head.time = u$5), 512 & r$11.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, E$2[2] = u$5 >>> 16 & 255, E$2[3] = u$5 >>> 24 & 255, r$11.check = B$2(r$11.check, E$2, 4, 0)), l$4 = u$5 = 0, r$11.mode = 4; + r$10.head && (r$10.head.time = u$5), 512 & r$10.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, E$2[2] = u$5 >>> 16 & 255, E$2[3] = u$5 >>> 24 & 255, r$10.check = B$2(r$10.check, E$2, 4, 0)), l$4 = u$5 = 0, r$10.mode = 4; case 4: for (; l$4 < 16;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.head && (r$11.head.xflags = 255 & u$5, r$11.head.os = u$5 >> 8), 512 & r$11.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$11.check = B$2(r$11.check, E$2, 2, 0)), l$4 = u$5 = 0, r$11.mode = 5; + r$10.head && (r$10.head.xflags = 255 & u$5, r$10.head.os = u$5 >> 8), 512 & r$10.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$10.check = B$2(r$10.check, E$2, 2, 0)), l$4 = u$5 = 0, r$10.mode = 5; case 5: - if (1024 & r$11.flags) { + if (1024 & r$10.flags) { for (; l$4 < 16;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.length = u$5, r$11.head && (r$11.head.extra_len = u$5), 512 & r$11.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$11.check = B$2(r$11.check, E$2, 2, 0)), l$4 = u$5 = 0; - } else r$11.head && (r$11.head.extra = null); - r$11.mode = 6; + r$10.length = u$5, r$10.head && (r$10.head.extra_len = u$5), 512 & r$10.flags && (E$2[0] = 255 & u$5, E$2[1] = u$5 >>> 8 & 255, r$10.check = B$2(r$10.check, E$2, 2, 0)), l$4 = u$5 = 0; + } else r$10.head && (r$10.head.extra = null); + r$10.mode = 6; case 6: - if (1024 & r$11.flags && (o$11 < (d$5 = r$11.length) && (d$5 = o$11), d$5 && (r$11.head && (k$2 = r$11.head.extra_len - r$11.length, r$11.head.extra || (r$11.head.extra = new Array(r$11.head.extra_len)), I$2.arraySet(r$11.head.extra, n$10, s$6, d$5, k$2)), 512 & r$11.flags && (r$11.check = B$2(r$11.check, n$10, d$5, s$6)), o$11 -= d$5, s$6 += d$5, r$11.length -= d$5), r$11.length)) break e; - r$11.length = 0, r$11.mode = 7; + if (1024 & r$10.flags && (o$11 < (d$4 = r$10.length) && (d$4 = o$11), d$4 && (r$10.head && (k$2 = r$10.head.extra_len - r$10.length, r$10.head.extra || (r$10.head.extra = new Array(r$10.head.extra_len)), I$2.arraySet(r$10.head.extra, n$10, s$6, d$4, k$2)), 512 & r$10.flags && (r$10.check = B$2(r$10.check, n$10, d$4, s$6)), o$11 -= d$4, s$6 += d$4, r$10.length -= d$4), r$10.length)) break e; + r$10.length = 0, r$10.mode = 7; case 7: - if (2048 & r$11.flags) { + if (2048 & r$10.flags) { if (0 === o$11) break e; - for (d$5 = 0; k$2 = n$10[s$6 + d$5++], r$11.head && k$2 && r$11.length < 65536 && (r$11.head.name += String.fromCharCode(k$2)), k$2 && d$5 < o$11;); - if (512 & r$11.flags && (r$11.check = B$2(r$11.check, n$10, d$5, s$6)), o$11 -= d$5, s$6 += d$5, k$2) break e; - } else r$11.head && (r$11.head.name = null); - r$11.length = 0, r$11.mode = 8; + for (d$4 = 0; k$2 = n$10[s$6 + d$4++], r$10.head && k$2 && r$10.length < 65536 && (r$10.head.name += String.fromCharCode(k$2)), k$2 && d$4 < o$11;); + if (512 & r$10.flags && (r$10.check = B$2(r$10.check, n$10, d$4, s$6)), o$11 -= d$4, s$6 += d$4, k$2) break e; + } else r$10.head && (r$10.head.name = null); + r$10.length = 0, r$10.mode = 8; case 8: - if (4096 & r$11.flags) { + if (4096 & r$10.flags) { if (0 === o$11) break e; - for (d$5 = 0; k$2 = n$10[s$6 + d$5++], r$11.head && k$2 && r$11.length < 65536 && (r$11.head.comment += String.fromCharCode(k$2)), k$2 && d$5 < o$11;); - if (512 & r$11.flags && (r$11.check = B$2(r$11.check, n$10, d$5, s$6)), o$11 -= d$5, s$6 += d$5, k$2) break e; - } else r$11.head && (r$11.head.comment = null); - r$11.mode = 9; + for (d$4 = 0; k$2 = n$10[s$6 + d$4++], r$10.head && k$2 && r$10.length < 65536 && (r$10.head.comment += String.fromCharCode(k$2)), k$2 && d$4 < o$11;); + if (512 & r$10.flags && (r$10.check = B$2(r$10.check, n$10, d$4, s$6)), o$11 -= d$4, s$6 += d$4, k$2) break e; + } else r$10.head && (r$10.head.comment = null); + r$10.mode = 9; case 9: - if (512 & r$11.flags) { + if (512 & r$10.flags) { for (; l$4 < 16;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (u$5 !== (65535 & r$11.check)) { - e$11.msg = "header crc mismatch", r$11.mode = 30; + if (u$5 !== (65535 & r$10.check)) { + e$11.msg = "header crc mismatch", r$10.mode = 30; break; } l$4 = u$5 = 0; } - r$11.head && (r$11.head.hcrc = r$11.flags >> 9 & 1, r$11.head.done = !0), e$11.adler = r$11.check = 0, r$11.mode = 12; + r$10.head && (r$10.head.hcrc = r$10.flags >> 9 & 1, r$10.head.done = !0), e$11.adler = r$10.check = 0, r$10.mode = 12; break; case 10: for (; l$4 < 32;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - e$11.adler = r$11.check = L$2(u$5), l$4 = u$5 = 0, r$11.mode = 11; + e$11.adler = r$10.check = L$2(u$5), l$4 = u$5 = 0, r$10.mode = 11; case 11: - if (0 === r$11.havedict) return e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$11.hold = u$5, r$11.bits = l$4, 2; - e$11.adler = r$11.check = 1, r$11.mode = 12; + if (0 === r$10.havedict) return e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$10.hold = u$5, r$10.bits = l$4, 2; + e$11.adler = r$10.check = 1, r$10.mode = 12; case 12: if (5 === t$7 || 6 === t$7) break e; case 13: - if (r$11.last) { - u$5 >>>= 7 & l$4, l$4 -= 7 & l$4, r$11.mode = 27; + if (r$10.last) { + u$5 >>>= 7 & l$4, l$4 -= 7 & l$4, r$10.mode = 27; break; } for (; l$4 < 3;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - switch (r$11.last = 1 & u$5, l$4 -= 1, 3 & (u$5 >>>= 1)) { + switch (r$10.last = 1 & u$5, l$4 -= 1, 3 & (u$5 >>>= 1)) { case 0: - r$11.mode = 14; + r$10.mode = 14; break; case 1: - if (j$2(r$11), r$11.mode = 20, 6 !== t$7) break; + if (j$2(r$10), r$10.mode = 20, 6 !== t$7) break; u$5 >>>= 2, l$4 -= 2; break e; case 2: - r$11.mode = 17; + r$10.mode = 17; break; - case 3: e$11.msg = "invalid block type", r$11.mode = 30; + case 3: e$11.msg = "invalid block type", r$10.mode = 30; } u$5 >>>= 2, l$4 -= 2; break; @@ -38136,206 +38340,206 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } if ((65535 & u$5) != (u$5 >>> 16 ^ 65535)) { - e$11.msg = "invalid stored block lengths", r$11.mode = 30; + e$11.msg = "invalid stored block lengths", r$10.mode = 30; break; } - if (r$11.length = 65535 & u$5, l$4 = u$5 = 0, r$11.mode = 15, 6 === t$7) break e; - case 15: r$11.mode = 16; + if (r$10.length = 65535 & u$5, l$4 = u$5 = 0, r$10.mode = 15, 6 === t$7) break e; + case 15: r$10.mode = 16; case 16: - if (d$5 = r$11.length) { - if (o$11 < d$5 && (d$5 = o$11), h$6 < d$5 && (d$5 = h$6), 0 === d$5) break e; - I$2.arraySet(i$8, n$10, s$6, d$5, a$3), o$11 -= d$5, s$6 += d$5, h$6 -= d$5, a$3 += d$5, r$11.length -= d$5; + if (d$4 = r$10.length) { + if (o$11 < d$4 && (d$4 = o$11), h$6 < d$4 && (d$4 = h$6), 0 === d$4) break e; + I$2.arraySet(i$8, n$10, s$6, d$4, a$3), o$11 -= d$4, s$6 += d$4, h$6 -= d$4, a$3 += d$4, r$10.length -= d$4; break; } - r$11.mode = 12; + r$10.mode = 12; break; case 17: for (; l$4 < 14;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (r$11.nlen = 257 + (31 & u$5), u$5 >>>= 5, l$4 -= 5, r$11.ndist = 1 + (31 & u$5), u$5 >>>= 5, l$4 -= 5, r$11.ncode = 4 + (15 & u$5), u$5 >>>= 4, l$4 -= 4, 286 < r$11.nlen || 30 < r$11.ndist) { - e$11.msg = "too many length or distance symbols", r$11.mode = 30; + if (r$10.nlen = 257 + (31 & u$5), u$5 >>>= 5, l$4 -= 5, r$10.ndist = 1 + (31 & u$5), u$5 >>>= 5, l$4 -= 5, r$10.ncode = 4 + (15 & u$5), u$5 >>>= 4, l$4 -= 4, 286 < r$10.nlen || 30 < r$10.ndist) { + e$11.msg = "too many length or distance symbols", r$10.mode = 30; break; } - r$11.have = 0, r$11.mode = 18; + r$10.have = 0, r$10.mode = 18; case 18: - for (; r$11.have < r$11.ncode;) { + for (; r$10.have < r$10.ncode;) { for (; l$4 < 3;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.lens[A$1[r$11.have++]] = 7 & u$5, u$5 >>>= 3, l$4 -= 3; + r$10.lens[A$1[r$10.have++]] = 7 & u$5, u$5 >>>= 3, l$4 -= 3; } - for (; r$11.have < 19;) r$11.lens[A$1[r$11.have++]] = 0; - if (r$11.lencode = r$11.lendyn, r$11.lenbits = 7, S$4 = { bits: r$11.lenbits }, x$2 = T$3(0, r$11.lens, 0, 19, r$11.lencode, 0, r$11.work, S$4), r$11.lenbits = S$4.bits, x$2) { - e$11.msg = "invalid code lengths set", r$11.mode = 30; + for (; r$10.have < 19;) r$10.lens[A$1[r$10.have++]] = 0; + if (r$10.lencode = r$10.lendyn, r$10.lenbits = 7, S$4 = { bits: r$10.lenbits }, x$2 = T$3(0, r$10.lens, 0, 19, r$10.lencode, 0, r$10.work, S$4), r$10.lenbits = S$4.bits, x$2) { + e$11.msg = "invalid code lengths set", r$10.mode = 30; break; } - r$11.have = 0, r$11.mode = 19; + r$10.have = 0, r$10.mode = 19; case 19: - for (; r$11.have < r$11.nlen + r$11.ndist;) { - for (; g$1 = (C$2 = r$11.lencode[u$5 & (1 << r$11.lenbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { + for (; r$10.have < r$10.nlen + r$10.ndist;) { + for (; g$1 = (C$2 = r$10.lencode[u$5 & (1 << r$10.lenbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (b$3 < 16) u$5 >>>= _$2, l$4 -= _$2, r$11.lens[r$11.have++] = b$3; + if (b$3 < 16) u$5 >>>= _$2, l$4 -= _$2, r$10.lens[r$10.have++] = b$3; else { if (16 === b$3) { for (z$2 = _$2 + 2; l$4 < z$2;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (u$5 >>>= _$2, l$4 -= _$2, 0 === r$11.have) { - e$11.msg = "invalid bit length repeat", r$11.mode = 30; + if (u$5 >>>= _$2, l$4 -= _$2, 0 === r$10.have) { + e$11.msg = "invalid bit length repeat", r$10.mode = 30; break; } - k$2 = r$11.lens[r$11.have - 1], d$5 = 3 + (3 & u$5), u$5 >>>= 2, l$4 -= 2; + k$2 = r$10.lens[r$10.have - 1], d$4 = 3 + (3 & u$5), u$5 >>>= 2, l$4 -= 2; } else if (17 === b$3) { for (z$2 = _$2 + 3; l$4 < z$2;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - l$4 -= _$2, k$2 = 0, d$5 = 3 + (7 & (u$5 >>>= _$2)), u$5 >>>= 3, l$4 -= 3; + l$4 -= _$2, k$2 = 0, d$4 = 3 + (7 & (u$5 >>>= _$2)), u$5 >>>= 3, l$4 -= 3; } else { for (z$2 = _$2 + 7; l$4 < z$2;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - l$4 -= _$2, k$2 = 0, d$5 = 11 + (127 & (u$5 >>>= _$2)), u$5 >>>= 7, l$4 -= 7; + l$4 -= _$2, k$2 = 0, d$4 = 11 + (127 & (u$5 >>>= _$2)), u$5 >>>= 7, l$4 -= 7; } - if (r$11.have + d$5 > r$11.nlen + r$11.ndist) { - e$11.msg = "invalid bit length repeat", r$11.mode = 30; + if (r$10.have + d$4 > r$10.nlen + r$10.ndist) { + e$11.msg = "invalid bit length repeat", r$10.mode = 30; break; } - for (; d$5--;) r$11.lens[r$11.have++] = k$2; + for (; d$4--;) r$10.lens[r$10.have++] = k$2; } } - if (30 === r$11.mode) break; - if (0 === r$11.lens[256]) { - e$11.msg = "invalid code -- missing end-of-block", r$11.mode = 30; + if (30 === r$10.mode) break; + if (0 === r$10.lens[256]) { + e$11.msg = "invalid code -- missing end-of-block", r$10.mode = 30; break; } - if (r$11.lenbits = 9, S$4 = { bits: r$11.lenbits }, x$2 = T$3(D$2, r$11.lens, 0, r$11.nlen, r$11.lencode, 0, r$11.work, S$4), r$11.lenbits = S$4.bits, x$2) { - e$11.msg = "invalid literal/lengths set", r$11.mode = 30; + if (r$10.lenbits = 9, S$4 = { bits: r$10.lenbits }, x$2 = T$3(D$2, r$10.lens, 0, r$10.nlen, r$10.lencode, 0, r$10.work, S$4), r$10.lenbits = S$4.bits, x$2) { + e$11.msg = "invalid literal/lengths set", r$10.mode = 30; break; } - if (r$11.distbits = 6, r$11.distcode = r$11.distdyn, S$4 = { bits: r$11.distbits }, x$2 = T$3(F$1, r$11.lens, r$11.nlen, r$11.ndist, r$11.distcode, 0, r$11.work, S$4), r$11.distbits = S$4.bits, x$2) { - e$11.msg = "invalid distances set", r$11.mode = 30; + if (r$10.distbits = 6, r$10.distcode = r$10.distdyn, S$4 = { bits: r$10.distbits }, x$2 = T$3(F$1, r$10.lens, r$10.nlen, r$10.ndist, r$10.distcode, 0, r$10.work, S$4), r$10.distbits = S$4.bits, x$2) { + e$11.msg = "invalid distances set", r$10.mode = 30; break; } - if (r$11.mode = 20, 6 === t$7) break e; - case 20: r$11.mode = 21; + if (r$10.mode = 20, 6 === t$7) break e; + case 20: r$10.mode = 21; case 21: if (6 <= o$11 && 258 <= h$6) { - e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$11.hold = u$5, r$11.bits = l$4, R$1(e$11, c$8), a$3 = e$11.next_out, i$8 = e$11.output, h$6 = e$11.avail_out, s$6 = e$11.next_in, n$10 = e$11.input, o$11 = e$11.avail_in, u$5 = r$11.hold, l$4 = r$11.bits, 12 === r$11.mode && (r$11.back = -1); + e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$10.hold = u$5, r$10.bits = l$4, R$1(e$11, c$7), a$3 = e$11.next_out, i$8 = e$11.output, h$6 = e$11.avail_out, s$6 = e$11.next_in, n$10 = e$11.input, o$11 = e$11.avail_in, u$5 = r$10.hold, l$4 = r$10.bits, 12 === r$10.mode && (r$10.back = -1); break; } - for (r$11.back = 0; g$1 = (C$2 = r$11.lencode[u$5 & (1 << r$11.lenbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { + for (r$10.back = 0; g$1 = (C$2 = r$10.lencode[u$5 & (1 << r$10.lenbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } if (g$1 && 0 == (240 & g$1)) { - for (v$3 = _$2, y$3 = g$1, w$2 = b$3; g$1 = (C$2 = r$11.lencode[w$2 + ((u$5 & (1 << v$3 + y$3) - 1) >> v$3)]) >>> 16 & 255, b$3 = 65535 & C$2, !(v$3 + (_$2 = C$2 >>> 24) <= l$4);) { + for (v$3 = _$2, y$3 = g$1, w$2 = b$3; g$1 = (C$2 = r$10.lencode[w$2 + ((u$5 & (1 << v$3 + y$3) - 1) >> v$3)]) >>> 16 & 255, b$3 = 65535 & C$2, !(v$3 + (_$2 = C$2 >>> 24) <= l$4);) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - u$5 >>>= v$3, l$4 -= v$3, r$11.back += v$3; + u$5 >>>= v$3, l$4 -= v$3, r$10.back += v$3; } - if (u$5 >>>= _$2, l$4 -= _$2, r$11.back += _$2, r$11.length = b$3, 0 === g$1) { - r$11.mode = 26; + if (u$5 >>>= _$2, l$4 -= _$2, r$10.back += _$2, r$10.length = b$3, 0 === g$1) { + r$10.mode = 26; break; } if (32 & g$1) { - r$11.back = -1, r$11.mode = 12; + r$10.back = -1, r$10.mode = 12; break; } if (64 & g$1) { - e$11.msg = "invalid literal/length code", r$11.mode = 30; + e$11.msg = "invalid literal/length code", r$10.mode = 30; break; } - r$11.extra = 15 & g$1, r$11.mode = 22; + r$10.extra = 15 & g$1, r$10.mode = 22; case 22: - if (r$11.extra) { - for (z$2 = r$11.extra; l$4 < z$2;) { + if (r$10.extra) { + for (z$2 = r$10.extra; l$4 < z$2;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.length += u$5 & (1 << r$11.extra) - 1, u$5 >>>= r$11.extra, l$4 -= r$11.extra, r$11.back += r$11.extra; + r$10.length += u$5 & (1 << r$10.extra) - 1, u$5 >>>= r$10.extra, l$4 -= r$10.extra, r$10.back += r$10.extra; } - r$11.was = r$11.length, r$11.mode = 23; + r$10.was = r$10.length, r$10.mode = 23; case 23: - for (; g$1 = (C$2 = r$11.distcode[u$5 & (1 << r$11.distbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { + for (; g$1 = (C$2 = r$10.distcode[u$5 & (1 << r$10.distbits) - 1]) >>> 16 & 255, b$3 = 65535 & C$2, !((_$2 = C$2 >>> 24) <= l$4);) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } if (0 == (240 & g$1)) { - for (v$3 = _$2, y$3 = g$1, w$2 = b$3; g$1 = (C$2 = r$11.distcode[w$2 + ((u$5 & (1 << v$3 + y$3) - 1) >> v$3)]) >>> 16 & 255, b$3 = 65535 & C$2, !(v$3 + (_$2 = C$2 >>> 24) <= l$4);) { + for (v$3 = _$2, y$3 = g$1, w$2 = b$3; g$1 = (C$2 = r$10.distcode[w$2 + ((u$5 & (1 << v$3 + y$3) - 1) >> v$3)]) >>> 16 & 255, b$3 = 65535 & C$2, !(v$3 + (_$2 = C$2 >>> 24) <= l$4);) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - u$5 >>>= v$3, l$4 -= v$3, r$11.back += v$3; + u$5 >>>= v$3, l$4 -= v$3, r$10.back += v$3; } - if (u$5 >>>= _$2, l$4 -= _$2, r$11.back += _$2, 64 & g$1) { - e$11.msg = "invalid distance code", r$11.mode = 30; + if (u$5 >>>= _$2, l$4 -= _$2, r$10.back += _$2, 64 & g$1) { + e$11.msg = "invalid distance code", r$10.mode = 30; break; } - r$11.offset = b$3, r$11.extra = 15 & g$1, r$11.mode = 24; + r$10.offset = b$3, r$10.extra = 15 & g$1, r$10.mode = 24; case 24: - if (r$11.extra) { - for (z$2 = r$11.extra; l$4 < z$2;) { + if (r$10.extra) { + for (z$2 = r$10.extra; l$4 < z$2;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - r$11.offset += u$5 & (1 << r$11.extra) - 1, u$5 >>>= r$11.extra, l$4 -= r$11.extra, r$11.back += r$11.extra; + r$10.offset += u$5 & (1 << r$10.extra) - 1, u$5 >>>= r$10.extra, l$4 -= r$10.extra, r$10.back += r$10.extra; } - if (r$11.offset > r$11.dmax) { - e$11.msg = "invalid distance too far back", r$11.mode = 30; + if (r$10.offset > r$10.dmax) { + e$11.msg = "invalid distance too far back", r$10.mode = 30; break; } - r$11.mode = 25; + r$10.mode = 25; case 25: if (0 === h$6) break e; - if (d$5 = c$8 - h$6, r$11.offset > d$5) { - if ((d$5 = r$11.offset - d$5) > r$11.whave && r$11.sane) { - e$11.msg = "invalid distance too far back", r$11.mode = 30; + if (d$4 = c$7 - h$6, r$10.offset > d$4) { + if ((d$4 = r$10.offset - d$4) > r$10.whave && r$10.sane) { + e$11.msg = "invalid distance too far back", r$10.mode = 30; break; } - p$3 = d$5 > r$11.wnext ? (d$5 -= r$11.wnext, r$11.wsize - d$5) : r$11.wnext - d$5, d$5 > r$11.length && (d$5 = r$11.length), m$3 = r$11.window; - } else m$3 = i$8, p$3 = a$3 - r$11.offset, d$5 = r$11.length; - for (h$6 < d$5 && (d$5 = h$6), h$6 -= d$5, r$11.length -= d$5; i$8[a$3++] = m$3[p$3++], --d$5;); - 0 === r$11.length && (r$11.mode = 21); + p$3 = d$4 > r$10.wnext ? (d$4 -= r$10.wnext, r$10.wsize - d$4) : r$10.wnext - d$4, d$4 > r$10.length && (d$4 = r$10.length), m$3 = r$10.window; + } else m$3 = i$8, p$3 = a$3 - r$10.offset, d$4 = r$10.length; + for (h$6 < d$4 && (d$4 = h$6), h$6 -= d$4, r$10.length -= d$4; i$8[a$3++] = m$3[p$3++], --d$4;); + 0 === r$10.length && (r$10.mode = 21); break; case 26: if (0 === h$6) break e; - i$8[a$3++] = r$11.length, h$6--, r$11.mode = 21; + i$8[a$3++] = r$10.length, h$6--, r$10.mode = 21; break; case 27: - if (r$11.wrap) { + if (r$10.wrap) { for (; l$4 < 32;) { if (0 === o$11) break e; o$11--, u$5 |= n$10[s$6++] << l$4, l$4 += 8; } - if (c$8 -= h$6, e$11.total_out += c$8, r$11.total += c$8, c$8 && (e$11.adler = r$11.check = r$11.flags ? B$2(r$11.check, i$8, c$8, a$3 - c$8) : O(r$11.check, i$8, c$8, a$3 - c$8)), c$8 = h$6, (r$11.flags ? u$5 : L$2(u$5)) !== r$11.check) { - e$11.msg = "incorrect data check", r$11.mode = 30; + if (c$7 -= h$6, e$11.total_out += c$7, r$10.total += c$7, c$7 && (e$11.adler = r$10.check = r$10.flags ? B$2(r$10.check, i$8, c$7, a$3 - c$7) : O(r$10.check, i$8, c$7, a$3 - c$7)), c$7 = h$6, (r$10.flags ? u$5 : L$2(u$5)) !== r$10.check) { + e$11.msg = "incorrect data check", r$10.mode = 30; break; } l$4 = u$5 = 0; } - r$11.mode = 28; + r$10.mode = 28; case 28: - if (r$11.wrap && r$11.flags) { + if (r$10.wrap && r$10.flags) { for (; l$4 < 32;) { if (0 === o$11) break e; o$11--, u$5 += n$10[s$6++] << l$4, l$4 += 8; } - if (u$5 !== (4294967295 & r$11.total)) { - e$11.msg = "incorrect length check", r$11.mode = 30; + if (u$5 !== (4294967295 & r$10.total)) { + e$11.msg = "incorrect length check", r$10.mode = 30; break; } l$4 = u$5 = 0; } - r$11.mode = 29; + r$10.mode = 29; case 29: x$2 = 1; break e; @@ -38346,18 +38550,18 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { case 32: default: return U$1; } - return e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$11.hold = u$5, r$11.bits = l$4, (r$11.wsize || c$8 !== e$11.avail_out && r$11.mode < 30 && (r$11.mode < 27 || 4 !== t$7)) && Z$1(e$11, e$11.output, e$11.next_out, c$8 - e$11.avail_out) ? (r$11.mode = 31, -4) : (f$5 -= e$11.avail_in, c$8 -= e$11.avail_out, e$11.total_in += f$5, e$11.total_out += c$8, r$11.total += c$8, r$11.wrap && c$8 && (e$11.adler = r$11.check = r$11.flags ? B$2(r$11.check, i$8, c$8, e$11.next_out - c$8) : O(r$11.check, i$8, c$8, e$11.next_out - c$8)), e$11.data_type = r$11.bits + (r$11.last ? 64 : 0) + (12 === r$11.mode ? 128 : 0) + (20 === r$11.mode || 15 === r$11.mode ? 256 : 0), (0 == f$5 && 0 === c$8 || 4 === t$7) && x$2 === N$2 && (x$2 = -5), x$2); - }, r$10.inflateEnd = function(e$11) { + return e$11.next_out = a$3, e$11.avail_out = h$6, e$11.next_in = s$6, e$11.avail_in = o$11, r$10.hold = u$5, r$10.bits = l$4, (r$10.wsize || c$7 !== e$11.avail_out && r$10.mode < 30 && (r$10.mode < 27 || 4 !== t$7)) && Z$1(e$11, e$11.output, e$11.next_out, c$7 - e$11.avail_out) ? (r$10.mode = 31, -4) : (f$5 -= e$11.avail_in, c$7 -= e$11.avail_out, e$11.total_in += f$5, e$11.total_out += c$7, r$10.total += c$7, r$10.wrap && c$7 && (e$11.adler = r$10.check = r$10.flags ? B$2(r$10.check, i$8, c$7, e$11.next_out - c$7) : O(r$10.check, i$8, c$7, e$11.next_out - c$7)), e$11.data_type = r$10.bits + (r$10.last ? 64 : 0) + (12 === r$10.mode ? 128 : 0) + (20 === r$10.mode || 15 === r$10.mode ? 256 : 0), (0 == f$5 && 0 === c$7 || 4 === t$7) && x$2 === N$2 && (x$2 = -5), x$2); + }, r$9.inflateEnd = function(e$11) { if (!e$11 || !e$11.state) return U$1; var t$7 = e$11.state; return t$7.window && (t$7.window = null), e$11.state = null, N$2; - }, r$10.inflateGetHeader = function(e$11, t$7) { - var r$11; - return e$11 && e$11.state ? 0 == (2 & (r$11 = e$11.state).wrap) ? U$1 : ((r$11.head = t$7).done = !1, N$2) : U$1; - }, r$10.inflateSetDictionary = function(e$11, t$7) { - var r$11, n$10 = t$7.length; - return e$11 && e$11.state ? 0 !== (r$11 = e$11.state).wrap && 11 !== r$11.mode ? U$1 : 11 === r$11.mode && O(1, t$7, n$10, 0) !== r$11.check ? -3 : Z$1(e$11, t$7, n$10, n$10) ? (r$11.mode = 31, -4) : (r$11.havedict = 1, N$2) : U$1; - }, r$10.inflateInfo = "pako inflate (from Nodeca project)"; + }, r$9.inflateGetHeader = function(e$11, t$7) { + var r$10; + return e$11 && e$11.state ? 0 == (2 & (r$10 = e$11.state).wrap) ? U$1 : ((r$10.head = t$7).done = !1, N$2) : U$1; + }, r$9.inflateSetDictionary = function(e$11, t$7) { + var r$10, n$10 = t$7.length; + return e$11 && e$11.state ? 0 !== (r$10 = e$11.state).wrap && 11 !== r$10.mode ? U$1 : 11 === r$10.mode && O(1, t$7, n$10, 0) !== r$10.check ? -3 : Z$1(e$11, t$7, n$10, n$10) ? (r$10.mode = 31, -4) : (r$10.havedict = 1, N$2) : U$1; + }, r$9.inflateInfo = "pako inflate (from Nodeca project)"; }, { "../utils/common": 41, "./adler32": 43, @@ -38365,7 +38569,7 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "./inffast": 48, "./inftrees": 50 }], - 50: [function(e$10, t$6, r$10) { + 50: [function(e$10, t$6, r$9) { "use strict"; var D$2 = e$10("../utils/common"), F$1 = [ 3, @@ -38498,35 +38702,35 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { 64, 64 ]; - t$6.exports = function(e$11, t$7, r$11, n$9, i$7, s$5, a$2, o$10) { - var h$5, u$4, l$3, f$4, c$7, d$5, p$3, m$3, _$2, g$1 = o$10.bits, b$3 = 0, v$3 = 0, y$3 = 0, w$2 = 0, k$2 = 0, x$2 = 0, S$4 = 0, z$2 = 0, C$2 = 0, E$2 = 0, A$1 = null, I$2 = 0, O = new D$2.Buf16(16), B$2 = new D$2.Buf16(16), R$1 = null, T$3 = 0; + t$6.exports = function(e$11, t$7, r$10, n$9, i$7, s$5, a$2, o$10) { + var h$5, u$4, l$3, f$4, c$6, d$4, p$3, m$3, _$2, g$1 = o$10.bits, b$3 = 0, v$3 = 0, y$3 = 0, w$2 = 0, k$2 = 0, x$2 = 0, S$4 = 0, z$2 = 0, C$2 = 0, E$2 = 0, A$1 = null, I$2 = 0, O = new D$2.Buf16(16), B$2 = new D$2.Buf16(16), R$1 = null, T$3 = 0; for (b$3 = 0; b$3 <= 15; b$3++) O[b$3] = 0; - for (v$3 = 0; v$3 < n$9; v$3++) O[t$7[r$11 + v$3]]++; + for (v$3 = 0; v$3 < n$9; v$3++) O[t$7[r$10 + v$3]]++; for (k$2 = g$1, w$2 = 15; 1 <= w$2 && 0 === O[w$2]; w$2--); if (w$2 < k$2 && (k$2 = w$2), 0 === w$2) return i$7[s$5++] = 20971520, i$7[s$5++] = 20971520, o$10.bits = 1, 0; for (y$3 = 1; y$3 < w$2 && 0 === O[y$3]; y$3++); for (k$2 < y$3 && (k$2 = y$3), b$3 = z$2 = 1; b$3 <= 15; b$3++) if (z$2 <<= 1, (z$2 -= O[b$3]) < 0) return -1; if (0 < z$2 && (0 === e$11 || 1 !== w$2)) return -1; for (B$2[1] = 0, b$3 = 1; b$3 < 15; b$3++) B$2[b$3 + 1] = B$2[b$3] + O[b$3]; - for (v$3 = 0; v$3 < n$9; v$3++) 0 !== t$7[r$11 + v$3] && (a$2[B$2[t$7[r$11 + v$3]]++] = v$3); - if (d$5 = 0 === e$11 ? (A$1 = R$1 = a$2, 19) : 1 === e$11 ? (A$1 = F$1, I$2 -= 257, R$1 = N$2, T$3 -= 257, 256) : (A$1 = U$1, R$1 = P$2, -1), b$3 = y$3, c$7 = s$5, S$4 = v$3 = E$2 = 0, l$3 = -1, f$4 = (C$2 = 1 << (x$2 = k$2)) - 1, 1 === e$11 && 852 < C$2 || 2 === e$11 && 592 < C$2) return 1; + for (v$3 = 0; v$3 < n$9; v$3++) 0 !== t$7[r$10 + v$3] && (a$2[B$2[t$7[r$10 + v$3]]++] = v$3); + if (d$4 = 0 === e$11 ? (A$1 = R$1 = a$2, 19) : 1 === e$11 ? (A$1 = F$1, I$2 -= 257, R$1 = N$2, T$3 -= 257, 256) : (A$1 = U$1, R$1 = P$2, -1), b$3 = y$3, c$6 = s$5, S$4 = v$3 = E$2 = 0, l$3 = -1, f$4 = (C$2 = 1 << (x$2 = k$2)) - 1, 1 === e$11 && 852 < C$2 || 2 === e$11 && 592 < C$2) return 1; for (;;) { - for (p$3 = b$3 - S$4, _$2 = a$2[v$3] < d$5 ? (m$3 = 0, a$2[v$3]) : a$2[v$3] > d$5 ? (m$3 = R$1[T$3 + a$2[v$3]], A$1[I$2 + a$2[v$3]]) : (m$3 = 96, 0), h$5 = 1 << b$3 - S$4, y$3 = u$4 = 1 << x$2; i$7[c$7 + (E$2 >> S$4) + (u$4 -= h$5)] = p$3 << 24 | m$3 << 16 | _$2 | 0, 0 !== u$4;); + for (p$3 = b$3 - S$4, _$2 = a$2[v$3] < d$4 ? (m$3 = 0, a$2[v$3]) : a$2[v$3] > d$4 ? (m$3 = R$1[T$3 + a$2[v$3]], A$1[I$2 + a$2[v$3]]) : (m$3 = 96, 0), h$5 = 1 << b$3 - S$4, y$3 = u$4 = 1 << x$2; i$7[c$6 + (E$2 >> S$4) + (u$4 -= h$5)] = p$3 << 24 | m$3 << 16 | _$2 | 0, 0 !== u$4;); for (h$5 = 1 << b$3 - 1; E$2 & h$5;) h$5 >>= 1; if (0 !== h$5 ? (E$2 &= h$5 - 1, E$2 += h$5) : E$2 = 0, v$3++, 0 == --O[b$3]) { if (b$3 === w$2) break; - b$3 = t$7[r$11 + a$2[v$3]]; + b$3 = t$7[r$10 + a$2[v$3]]; } if (k$2 < b$3 && (E$2 & f$4) !== l$3) { - for (0 === S$4 && (S$4 = k$2), c$7 += y$3, z$2 = 1 << (x$2 = b$3 - S$4); x$2 + S$4 < w$2 && !((z$2 -= O[x$2 + S$4]) <= 0);) x$2++, z$2 <<= 1; + for (0 === S$4 && (S$4 = k$2), c$6 += y$3, z$2 = 1 << (x$2 = b$3 - S$4); x$2 + S$4 < w$2 && !((z$2 -= O[x$2 + S$4]) <= 0);) x$2++, z$2 <<= 1; if (C$2 += 1 << x$2, 1 === e$11 && 852 < C$2 || 2 === e$11 && 592 < C$2) return 1; - i$7[l$3 = E$2 & f$4] = k$2 << 24 | x$2 << 16 | c$7 - s$5 | 0; + i$7[l$3 = E$2 & f$4] = k$2 << 24 | x$2 << 16 | c$6 - s$5 | 0; } } - return 0 !== E$2 && (i$7[c$7 + E$2] = b$3 - S$4 << 24 | 64 << 16 | 0), o$10.bits = k$2, 0; + return 0 !== E$2 && (i$7[c$6 + E$2] = b$3 - S$4 << 24 | 64 << 16 | 0), o$10.bits = k$2, 0; }; }, { "../utils/common": 41 }], - 51: [function(e$10, t$6, r$10) { + 51: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = { 2: "need dictionary", @@ -38540,13 +38744,13 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { "-6": "incompatible version" }; }, {}], - 52: [function(e$10, t$6, r$10) { + 52: [function(e$10, t$6, r$9) { "use strict"; var i$7 = e$10("../utils/common"), o$10 = 0, h$5 = 1; function n$9(e$11) { for (var t$7 = e$11.length; 0 <= --t$7;) e$11[t$7] = 0; } - var s$5 = 0, a$2 = 29, u$4 = 256, l$3 = u$4 + 1 + a$2, f$4 = 30, c$7 = 19, _$2 = 2 * l$3 + 1, g$1 = 15, d$5 = 16, p$3 = 7, m$3 = 256, b$3 = 16, v$3 = 17, y$3 = 18, w$2 = [ + var s$5 = 0, a$2 = 29, u$4 = 256, l$3 = u$4 + 1 + a$2, f$4 = 30, c$6 = 19, _$2 = 2 * l$3 + 1, g$1 = 15, d$4 = 16, p$3 = 7, m$3 = 256, b$3 = 16, v$3 = 17, y$3 = 18, w$2 = [ 0, 0, 0, @@ -38658,8 +38862,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var I$2 = new Array(a$2); n$9(I$2); var O, B$2, R$1, T$3 = new Array(f$4); - function D$2(e$11, t$7, r$11, n$10, i$8) { - this.static_tree = e$11, this.extra_bits = t$7, this.extra_base = r$11, this.elems = n$10, this.max_length = i$8, this.has_stree = e$11 && e$11.length; + function D$2(e$11, t$7, r$10, n$10, i$8) { + this.static_tree = e$11, this.extra_bits = t$7, this.extra_base = r$10, this.elems = n$10, this.max_length = i$8, this.has_stree = e$11 && e$11.length; } function F$1(e$11, t$7) { this.dyn_tree = e$11, this.max_code = 0, this.stat_desc = t$7; @@ -38670,19 +38874,19 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { function U$1(e$11, t$7) { e$11.pending_buf[e$11.pending++] = 255 & t$7, e$11.pending_buf[e$11.pending++] = t$7 >>> 8 & 255; } - function P$2(e$11, t$7, r$11) { - e$11.bi_valid > d$5 - r$11 ? (e$11.bi_buf |= t$7 << e$11.bi_valid & 65535, U$1(e$11, e$11.bi_buf), e$11.bi_buf = t$7 >> d$5 - e$11.bi_valid, e$11.bi_valid += r$11 - d$5) : (e$11.bi_buf |= t$7 << e$11.bi_valid & 65535, e$11.bi_valid += r$11); + function P$2(e$11, t$7, r$10) { + e$11.bi_valid > d$4 - r$10 ? (e$11.bi_buf |= t$7 << e$11.bi_valid & 65535, U$1(e$11, e$11.bi_buf), e$11.bi_buf = t$7 >> d$4 - e$11.bi_valid, e$11.bi_valid += r$10 - d$4) : (e$11.bi_buf |= t$7 << e$11.bi_valid & 65535, e$11.bi_valid += r$10); } - function L$2(e$11, t$7, r$11) { - P$2(e$11, r$11[2 * t$7], r$11[2 * t$7 + 1]); + function L$2(e$11, t$7, r$10) { + P$2(e$11, r$10[2 * t$7], r$10[2 * t$7 + 1]); } function j$2(e$11, t$7) { - for (var r$11 = 0; r$11 |= 1 & e$11, e$11 >>>= 1, r$11 <<= 1, 0 < --t$7;); - return r$11 >>> 1; + for (var r$10 = 0; r$10 |= 1 & e$11, e$11 >>>= 1, r$10 <<= 1, 0 < --t$7;); + return r$10 >>> 1; } - function Z$1(e$11, t$7, r$11) { + function Z$1(e$11, t$7, r$10) { var n$10, i$8, s$6 = new Array(g$1 + 1), a$3 = 0; - for (n$10 = 1; n$10 <= g$1; n$10++) s$6[n$10] = a$3 = a$3 + r$11[n$10 - 1] << 1; + for (n$10 = 1; n$10 <= g$1; n$10++) s$6[n$10] = a$3 = a$3 + r$10[n$10 - 1] << 1; for (i$8 = 0; i$8 <= t$7; i$8++) { var o$11 = e$11[2 * i$8 + 1]; 0 !== o$11 && (e$11[2 * i$8] = j$2(s$6[o$11]++, o$11)); @@ -38692,68 +38896,68 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { var t$7; for (t$7 = 0; t$7 < l$3; t$7++) e$11.dyn_ltree[2 * t$7] = 0; for (t$7 = 0; t$7 < f$4; t$7++) e$11.dyn_dtree[2 * t$7] = 0; - for (t$7 = 0; t$7 < c$7; t$7++) e$11.bl_tree[2 * t$7] = 0; + for (t$7 = 0; t$7 < c$6; t$7++) e$11.bl_tree[2 * t$7] = 0; e$11.dyn_ltree[2 * m$3] = 1, e$11.opt_len = e$11.static_len = 0, e$11.last_lit = e$11.matches = 0; } function M$3(e$11) { 8 < e$11.bi_valid ? U$1(e$11, e$11.bi_buf) : 0 < e$11.bi_valid && (e$11.pending_buf[e$11.pending++] = e$11.bi_buf), e$11.bi_buf = 0, e$11.bi_valid = 0; } - function H$1(e$11, t$7, r$11, n$10) { - var i$8 = 2 * t$7, s$6 = 2 * r$11; - return e$11[i$8] < e$11[s$6] || e$11[i$8] === e$11[s$6] && n$10[t$7] <= n$10[r$11]; + function H$1(e$11, t$7, r$10, n$10) { + var i$8 = 2 * t$7, s$6 = 2 * r$10; + return e$11[i$8] < e$11[s$6] || e$11[i$8] === e$11[s$6] && n$10[t$7] <= n$10[r$10]; } - function G$1(e$11, t$7, r$11) { - for (var n$10 = e$11.heap[r$11], i$8 = r$11 << 1; i$8 <= e$11.heap_len && (i$8 < e$11.heap_len && H$1(t$7, e$11.heap[i$8 + 1], e$11.heap[i$8], e$11.depth) && i$8++, !H$1(t$7, n$10, e$11.heap[i$8], e$11.depth));) e$11.heap[r$11] = e$11.heap[i$8], r$11 = i$8, i$8 <<= 1; - e$11.heap[r$11] = n$10; + function G$1(e$11, t$7, r$10) { + for (var n$10 = e$11.heap[r$10], i$8 = r$10 << 1; i$8 <= e$11.heap_len && (i$8 < e$11.heap_len && H$1(t$7, e$11.heap[i$8 + 1], e$11.heap[i$8], e$11.depth) && i$8++, !H$1(t$7, n$10, e$11.heap[i$8], e$11.depth));) e$11.heap[r$10] = e$11.heap[i$8], r$10 = i$8, i$8 <<= 1; + e$11.heap[r$10] = n$10; } - function K$1(e$11, t$7, r$11) { + function K$1(e$11, t$7, r$10) { var n$10, i$8, s$6, a$3, o$11 = 0; - if (0 !== e$11.last_lit) for (; n$10 = e$11.pending_buf[e$11.d_buf + 2 * o$11] << 8 | e$11.pending_buf[e$11.d_buf + 2 * o$11 + 1], i$8 = e$11.pending_buf[e$11.l_buf + o$11], o$11++, 0 === n$10 ? L$2(e$11, i$8, t$7) : (L$2(e$11, (s$6 = A$1[i$8]) + u$4 + 1, t$7), 0 !== (a$3 = w$2[s$6]) && P$2(e$11, i$8 -= I$2[s$6], a$3), L$2(e$11, s$6 = N$2(--n$10), r$11), 0 !== (a$3 = k$2[s$6]) && P$2(e$11, n$10 -= T$3[s$6], a$3)), o$11 < e$11.last_lit;); + if (0 !== e$11.last_lit) for (; n$10 = e$11.pending_buf[e$11.d_buf + 2 * o$11] << 8 | e$11.pending_buf[e$11.d_buf + 2 * o$11 + 1], i$8 = e$11.pending_buf[e$11.l_buf + o$11], o$11++, 0 === n$10 ? L$2(e$11, i$8, t$7) : (L$2(e$11, (s$6 = A$1[i$8]) + u$4 + 1, t$7), 0 !== (a$3 = w$2[s$6]) && P$2(e$11, i$8 -= I$2[s$6], a$3), L$2(e$11, s$6 = N$2(--n$10), r$10), 0 !== (a$3 = k$2[s$6]) && P$2(e$11, n$10 -= T$3[s$6], a$3)), o$11 < e$11.last_lit;); L$2(e$11, m$3, t$7); } function Y(e$11, t$7) { - var r$11, n$10, i$8, s$6 = t$7.dyn_tree, a$3 = t$7.stat_desc.static_tree, o$11 = t$7.stat_desc.has_stree, h$6 = t$7.stat_desc.elems, u$5 = -1; - for (e$11.heap_len = 0, e$11.heap_max = _$2, r$11 = 0; r$11 < h$6; r$11++) 0 !== s$6[2 * r$11] ? (e$11.heap[++e$11.heap_len] = u$5 = r$11, e$11.depth[r$11] = 0) : s$6[2 * r$11 + 1] = 0; + var r$10, n$10, i$8, s$6 = t$7.dyn_tree, a$3 = t$7.stat_desc.static_tree, o$11 = t$7.stat_desc.has_stree, h$6 = t$7.stat_desc.elems, u$5 = -1; + for (e$11.heap_len = 0, e$11.heap_max = _$2, r$10 = 0; r$10 < h$6; r$10++) 0 !== s$6[2 * r$10] ? (e$11.heap[++e$11.heap_len] = u$5 = r$10, e$11.depth[r$10] = 0) : s$6[2 * r$10 + 1] = 0; for (; e$11.heap_len < 2;) s$6[2 * (i$8 = e$11.heap[++e$11.heap_len] = u$5 < 2 ? ++u$5 : 0)] = 1, e$11.depth[i$8] = 0, e$11.opt_len--, o$11 && (e$11.static_len -= a$3[2 * i$8 + 1]); - for (t$7.max_code = u$5, r$11 = e$11.heap_len >> 1; 1 <= r$11; r$11--) G$1(e$11, s$6, r$11); - for (i$8 = h$6; r$11 = e$11.heap[1], e$11.heap[1] = e$11.heap[e$11.heap_len--], G$1(e$11, s$6, 1), n$10 = e$11.heap[1], e$11.heap[--e$11.heap_max] = r$11, e$11.heap[--e$11.heap_max] = n$10, s$6[2 * i$8] = s$6[2 * r$11] + s$6[2 * n$10], e$11.depth[i$8] = (e$11.depth[r$11] >= e$11.depth[n$10] ? e$11.depth[r$11] : e$11.depth[n$10]) + 1, s$6[2 * r$11 + 1] = s$6[2 * n$10 + 1] = i$8, e$11.heap[1] = i$8++, G$1(e$11, s$6, 1), 2 <= e$11.heap_len;); + for (t$7.max_code = u$5, r$10 = e$11.heap_len >> 1; 1 <= r$10; r$10--) G$1(e$11, s$6, r$10); + for (i$8 = h$6; r$10 = e$11.heap[1], e$11.heap[1] = e$11.heap[e$11.heap_len--], G$1(e$11, s$6, 1), n$10 = e$11.heap[1], e$11.heap[--e$11.heap_max] = r$10, e$11.heap[--e$11.heap_max] = n$10, s$6[2 * i$8] = s$6[2 * r$10] + s$6[2 * n$10], e$11.depth[i$8] = (e$11.depth[r$10] >= e$11.depth[n$10] ? e$11.depth[r$10] : e$11.depth[n$10]) + 1, s$6[2 * r$10 + 1] = s$6[2 * n$10 + 1] = i$8, e$11.heap[1] = i$8++, G$1(e$11, s$6, 1), 2 <= e$11.heap_len;); e$11.heap[--e$11.heap_max] = e$11.heap[1], function(e$12, t$8) { - var r$12, n$11, i$9, s$7, a$4, o$12, h$7 = t$8.dyn_tree, u$6 = t$8.max_code, l$4 = t$8.stat_desc.static_tree, f$5 = t$8.stat_desc.has_stree, c$8 = t$8.stat_desc.extra_bits, d$6 = t$8.stat_desc.extra_base, p$4 = t$8.stat_desc.max_length, m$4 = 0; + var r$11, n$11, i$9, s$7, a$4, o$12, h$7 = t$8.dyn_tree, u$6 = t$8.max_code, l$4 = t$8.stat_desc.static_tree, f$5 = t$8.stat_desc.has_stree, c$7 = t$8.stat_desc.extra_bits, d$5 = t$8.stat_desc.extra_base, p$4 = t$8.stat_desc.max_length, m$4 = 0; for (s$7 = 0; s$7 <= g$1; s$7++) e$12.bl_count[s$7] = 0; - for (h$7[2 * e$12.heap[e$12.heap_max] + 1] = 0, r$12 = e$12.heap_max + 1; r$12 < _$2; r$12++) p$4 < (s$7 = h$7[2 * h$7[2 * (n$11 = e$12.heap[r$12]) + 1] + 1] + 1) && (s$7 = p$4, m$4++), h$7[2 * n$11 + 1] = s$7, u$6 < n$11 || (e$12.bl_count[s$7]++, a$4 = 0, d$6 <= n$11 && (a$4 = c$8[n$11 - d$6]), o$12 = h$7[2 * n$11], e$12.opt_len += o$12 * (s$7 + a$4), f$5 && (e$12.static_len += o$12 * (l$4[2 * n$11 + 1] + a$4))); + for (h$7[2 * e$12.heap[e$12.heap_max] + 1] = 0, r$11 = e$12.heap_max + 1; r$11 < _$2; r$11++) p$4 < (s$7 = h$7[2 * h$7[2 * (n$11 = e$12.heap[r$11]) + 1] + 1] + 1) && (s$7 = p$4, m$4++), h$7[2 * n$11 + 1] = s$7, u$6 < n$11 || (e$12.bl_count[s$7]++, a$4 = 0, d$5 <= n$11 && (a$4 = c$7[n$11 - d$5]), o$12 = h$7[2 * n$11], e$12.opt_len += o$12 * (s$7 + a$4), f$5 && (e$12.static_len += o$12 * (l$4[2 * n$11 + 1] + a$4))); if (0 !== m$4) { do { for (s$7 = p$4 - 1; 0 === e$12.bl_count[s$7];) s$7--; e$12.bl_count[s$7]--, e$12.bl_count[s$7 + 1] += 2, e$12.bl_count[p$4]--, m$4 -= 2; } while (0 < m$4); - for (s$7 = p$4; 0 !== s$7; s$7--) for (n$11 = e$12.bl_count[s$7]; 0 !== n$11;) u$6 < (i$9 = e$12.heap[--r$12]) || (h$7[2 * i$9 + 1] !== s$7 && (e$12.opt_len += (s$7 - h$7[2 * i$9 + 1]) * h$7[2 * i$9], h$7[2 * i$9 + 1] = s$7), n$11--); + for (s$7 = p$4; 0 !== s$7; s$7--) for (n$11 = e$12.bl_count[s$7]; 0 !== n$11;) u$6 < (i$9 = e$12.heap[--r$11]) || (h$7[2 * i$9 + 1] !== s$7 && (e$12.opt_len += (s$7 - h$7[2 * i$9 + 1]) * h$7[2 * i$9], h$7[2 * i$9 + 1] = s$7), n$11--); } }(e$11, t$7), Z$1(s$6, u$5, e$11.bl_count); } - function X$2(e$11, t$7, r$11) { + function X$2(e$11, t$7, r$10) { var n$10, i$8, s$6 = -1, a$3 = t$7[1], o$11 = 0, h$6 = 7, u$5 = 4; - for (0 === a$3 && (h$6 = 138, u$5 = 3), t$7[2 * (r$11 + 1) + 1] = 65535, n$10 = 0; n$10 <= r$11; n$10++) i$8 = a$3, a$3 = t$7[2 * (n$10 + 1) + 1], ++o$11 < h$6 && i$8 === a$3 || (o$11 < u$5 ? e$11.bl_tree[2 * i$8] += o$11 : 0 !== i$8 ? (i$8 !== s$6 && e$11.bl_tree[2 * i$8]++, e$11.bl_tree[2 * b$3]++) : o$11 <= 10 ? e$11.bl_tree[2 * v$3]++ : e$11.bl_tree[2 * y$3]++, s$6 = i$8, u$5 = (o$11 = 0) === a$3 ? (h$6 = 138, 3) : i$8 === a$3 ? (h$6 = 6, 3) : (h$6 = 7, 4)); + for (0 === a$3 && (h$6 = 138, u$5 = 3), t$7[2 * (r$10 + 1) + 1] = 65535, n$10 = 0; n$10 <= r$10; n$10++) i$8 = a$3, a$3 = t$7[2 * (n$10 + 1) + 1], ++o$11 < h$6 && i$8 === a$3 || (o$11 < u$5 ? e$11.bl_tree[2 * i$8] += o$11 : 0 !== i$8 ? (i$8 !== s$6 && e$11.bl_tree[2 * i$8]++, e$11.bl_tree[2 * b$3]++) : o$11 <= 10 ? e$11.bl_tree[2 * v$3]++ : e$11.bl_tree[2 * y$3]++, s$6 = i$8, u$5 = (o$11 = 0) === a$3 ? (h$6 = 138, 3) : i$8 === a$3 ? (h$6 = 6, 3) : (h$6 = 7, 4)); } - function V$2(e$11, t$7, r$11) { + function V$2(e$11, t$7, r$10) { var n$10, i$8, s$6 = -1, a$3 = t$7[1], o$11 = 0, h$6 = 7, u$5 = 4; - for (0 === a$3 && (h$6 = 138, u$5 = 3), n$10 = 0; n$10 <= r$11; n$10++) if (i$8 = a$3, a$3 = t$7[2 * (n$10 + 1) + 1], !(++o$11 < h$6 && i$8 === a$3)) { + for (0 === a$3 && (h$6 = 138, u$5 = 3), n$10 = 0; n$10 <= r$10; n$10++) if (i$8 = a$3, a$3 = t$7[2 * (n$10 + 1) + 1], !(++o$11 < h$6 && i$8 === a$3)) { if (o$11 < u$5) for (; L$2(e$11, i$8, e$11.bl_tree), 0 != --o$11;); else 0 !== i$8 ? (i$8 !== s$6 && (L$2(e$11, i$8, e$11.bl_tree), o$11--), L$2(e$11, b$3, e$11.bl_tree), P$2(e$11, o$11 - 3, 2)) : o$11 <= 10 ? (L$2(e$11, v$3, e$11.bl_tree), P$2(e$11, o$11 - 3, 3)) : (L$2(e$11, y$3, e$11.bl_tree), P$2(e$11, o$11 - 11, 7)); s$6 = i$8, u$5 = (o$11 = 0) === a$3 ? (h$6 = 138, 3) : i$8 === a$3 ? (h$6 = 6, 3) : (h$6 = 7, 4); } } n$9(T$3); - var q$2 = !1; - function J$1(e$11, t$7, r$11, n$10) { - P$2(e$11, (s$5 << 1) + (n$10 ? 1 : 0), 3), function(e$12, t$8, r$12, n$11) { - M$3(e$12), n$11 && (U$1(e$12, r$12), U$1(e$12, ~r$12)), i$7.arraySet(e$12.pending_buf, e$12.window, t$8, r$12, e$12.pending), e$12.pending += r$12; - }(e$11, t$7, r$11, !0); + var q$1 = !1; + function J$1(e$11, t$7, r$10, n$10) { + P$2(e$11, (s$5 << 1) + (n$10 ? 1 : 0), 3), function(e$12, t$8, r$11, n$11) { + M$3(e$12), n$11 && (U$1(e$12, r$11), U$1(e$12, ~r$11)), i$7.arraySet(e$12.pending_buf, e$12.window, t$8, r$11, e$12.pending), e$12.pending += r$11; + }(e$11, t$7, r$10, !0); } - r$10._tr_init = function(e$11) { - q$2 || (function() { - var e$12, t$7, r$11, n$10, i$8, s$6 = new Array(g$1 + 1); - for (n$10 = r$11 = 0; n$10 < a$2 - 1; n$10++) for (I$2[n$10] = r$11, e$12 = 0; e$12 < 1 << w$2[n$10]; e$12++) A$1[r$11++] = n$10; - for (A$1[r$11 - 1] = n$10, n$10 = i$8 = 0; n$10 < 16; n$10++) for (T$3[n$10] = i$8, e$12 = 0; e$12 < 1 << k$2[n$10]; e$12++) E$2[i$8++] = n$10; + r$9._tr_init = function(e$11) { + q$1 || (function() { + var e$12, t$7, r$10, n$10, i$8, s$6 = new Array(g$1 + 1); + for (n$10 = r$10 = 0; n$10 < a$2 - 1; n$10++) for (I$2[n$10] = r$10, e$12 = 0; e$12 < 1 << w$2[n$10]; e$12++) A$1[r$10++] = n$10; + for (A$1[r$10 - 1] = n$10, n$10 = i$8 = 0; n$10 < 16; n$10++) for (T$3[n$10] = i$8, e$12 = 0; e$12 < 1 << k$2[n$10]; e$12++) E$2[i$8++] = n$10; for (i$8 >>= 7; n$10 < f$4; n$10++) for (T$3[n$10] = i$8 << 7, e$12 = 0; e$12 < 1 << k$2[n$10] - 7; e$12++) E$2[256 + i$8++] = n$10; for (t$7 = 0; t$7 <= g$1; t$7++) s$6[t$7] = 0; for (e$12 = 0; e$12 <= 143;) z$2[2 * e$12 + 1] = 8, e$12++, s$6[8]++; @@ -38761,72 +38965,72 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (; e$12 <= 279;) z$2[2 * e$12 + 1] = 7, e$12++, s$6[7]++; for (; e$12 <= 287;) z$2[2 * e$12 + 1] = 8, e$12++, s$6[8]++; for (Z$1(z$2, l$3 + 1, s$6), e$12 = 0; e$12 < f$4; e$12++) C$2[2 * e$12 + 1] = 5, C$2[2 * e$12] = j$2(e$12, 5); - O = new D$2(z$2, w$2, u$4 + 1, l$3, g$1), B$2 = new D$2(C$2, k$2, 0, f$4, g$1), R$1 = new D$2(new Array(0), x$2, 0, c$7, p$3); - }(), q$2 = !0), e$11.l_desc = new F$1(e$11.dyn_ltree, O), e$11.d_desc = new F$1(e$11.dyn_dtree, B$2), e$11.bl_desc = new F$1(e$11.bl_tree, R$1), e$11.bi_buf = 0, e$11.bi_valid = 0, W$1(e$11); - }, r$10._tr_stored_block = J$1, r$10._tr_flush_block = function(e$11, t$7, r$11, n$10) { + O = new D$2(z$2, w$2, u$4 + 1, l$3, g$1), B$2 = new D$2(C$2, k$2, 0, f$4, g$1), R$1 = new D$2(new Array(0), x$2, 0, c$6, p$3); + }(), q$1 = !0), e$11.l_desc = new F$1(e$11.dyn_ltree, O), e$11.d_desc = new F$1(e$11.dyn_dtree, B$2), e$11.bl_desc = new F$1(e$11.bl_tree, R$1), e$11.bi_buf = 0, e$11.bi_valid = 0, W$1(e$11); + }, r$9._tr_stored_block = J$1, r$9._tr_flush_block = function(e$11, t$7, r$10, n$10) { var i$8, s$6, a$3 = 0; 0 < e$11.level ? (2 === e$11.strm.data_type && (e$11.strm.data_type = function(e$12) { - var t$8, r$12 = 4093624447; - for (t$8 = 0; t$8 <= 31; t$8++, r$12 >>>= 1) if (1 & r$12 && 0 !== e$12.dyn_ltree[2 * t$8]) return o$10; + var t$8, r$11 = 4093624447; + for (t$8 = 0; t$8 <= 31; t$8++, r$11 >>>= 1) if (1 & r$11 && 0 !== e$12.dyn_ltree[2 * t$8]) return o$10; if (0 !== e$12.dyn_ltree[18] || 0 !== e$12.dyn_ltree[20] || 0 !== e$12.dyn_ltree[26]) return h$5; for (t$8 = 32; t$8 < u$4; t$8++) if (0 !== e$12.dyn_ltree[2 * t$8]) return h$5; return o$10; }(e$11)), Y(e$11, e$11.l_desc), Y(e$11, e$11.d_desc), a$3 = function(e$12) { var t$8; - for (X$2(e$12, e$12.dyn_ltree, e$12.l_desc.max_code), X$2(e$12, e$12.dyn_dtree, e$12.d_desc.max_code), Y(e$12, e$12.bl_desc), t$8 = c$7 - 1; 3 <= t$8 && 0 === e$12.bl_tree[2 * S$4[t$8] + 1]; t$8--); + for (X$2(e$12, e$12.dyn_ltree, e$12.l_desc.max_code), X$2(e$12, e$12.dyn_dtree, e$12.d_desc.max_code), Y(e$12, e$12.bl_desc), t$8 = c$6 - 1; 3 <= t$8 && 0 === e$12.bl_tree[2 * S$4[t$8] + 1]; t$8--); return e$12.opt_len += 3 * (t$8 + 1) + 5 + 5 + 4, t$8; - }(e$11), i$8 = e$11.opt_len + 3 + 7 >>> 3, (s$6 = e$11.static_len + 3 + 7 >>> 3) <= i$8 && (i$8 = s$6)) : i$8 = s$6 = r$11 + 5, r$11 + 4 <= i$8 && -1 !== t$7 ? J$1(e$11, t$7, r$11, n$10) : 4 === e$11.strategy || s$6 === i$8 ? (P$2(e$11, 2 + (n$10 ? 1 : 0), 3), K$1(e$11, z$2, C$2)) : (P$2(e$11, 4 + (n$10 ? 1 : 0), 3), function(e$12, t$8, r$12, n$11) { + }(e$11), i$8 = e$11.opt_len + 3 + 7 >>> 3, (s$6 = e$11.static_len + 3 + 7 >>> 3) <= i$8 && (i$8 = s$6)) : i$8 = s$6 = r$10 + 5, r$10 + 4 <= i$8 && -1 !== t$7 ? J$1(e$11, t$7, r$10, n$10) : 4 === e$11.strategy || s$6 === i$8 ? (P$2(e$11, 2 + (n$10 ? 1 : 0), 3), K$1(e$11, z$2, C$2)) : (P$2(e$11, 4 + (n$10 ? 1 : 0), 3), function(e$12, t$8, r$11, n$11) { var i$9; - for (P$2(e$12, t$8 - 257, 5), P$2(e$12, r$12 - 1, 5), P$2(e$12, n$11 - 4, 4), i$9 = 0; i$9 < n$11; i$9++) P$2(e$12, e$12.bl_tree[2 * S$4[i$9] + 1], 3); - V$2(e$12, e$12.dyn_ltree, t$8 - 1), V$2(e$12, e$12.dyn_dtree, r$12 - 1); + for (P$2(e$12, t$8 - 257, 5), P$2(e$12, r$11 - 1, 5), P$2(e$12, n$11 - 4, 4), i$9 = 0; i$9 < n$11; i$9++) P$2(e$12, e$12.bl_tree[2 * S$4[i$9] + 1], 3); + V$2(e$12, e$12.dyn_ltree, t$8 - 1), V$2(e$12, e$12.dyn_dtree, r$11 - 1); }(e$11, e$11.l_desc.max_code + 1, e$11.d_desc.max_code + 1, a$3 + 1), K$1(e$11, e$11.dyn_ltree, e$11.dyn_dtree)), W$1(e$11), n$10 && M$3(e$11); - }, r$10._tr_tally = function(e$11, t$7, r$11) { - return e$11.pending_buf[e$11.d_buf + 2 * e$11.last_lit] = t$7 >>> 8 & 255, e$11.pending_buf[e$11.d_buf + 2 * e$11.last_lit + 1] = 255 & t$7, e$11.pending_buf[e$11.l_buf + e$11.last_lit] = 255 & r$11, e$11.last_lit++, 0 === t$7 ? e$11.dyn_ltree[2 * r$11]++ : (e$11.matches++, t$7--, e$11.dyn_ltree[2 * (A$1[r$11] + u$4 + 1)]++, e$11.dyn_dtree[2 * N$2(t$7)]++), e$11.last_lit === e$11.lit_bufsize - 1; - }, r$10._tr_align = function(e$11) { + }, r$9._tr_tally = function(e$11, t$7, r$10) { + return e$11.pending_buf[e$11.d_buf + 2 * e$11.last_lit] = t$7 >>> 8 & 255, e$11.pending_buf[e$11.d_buf + 2 * e$11.last_lit + 1] = 255 & t$7, e$11.pending_buf[e$11.l_buf + e$11.last_lit] = 255 & r$10, e$11.last_lit++, 0 === t$7 ? e$11.dyn_ltree[2 * r$10]++ : (e$11.matches++, t$7--, e$11.dyn_ltree[2 * (A$1[r$10] + u$4 + 1)]++, e$11.dyn_dtree[2 * N$2(t$7)]++), e$11.last_lit === e$11.lit_bufsize - 1; + }, r$9._tr_align = function(e$11) { P$2(e$11, 2, 3), L$2(e$11, m$3, z$2), function(e$12) { 16 === e$12.bi_valid ? (U$1(e$12, e$12.bi_buf), e$12.bi_buf = 0, e$12.bi_valid = 0) : 8 <= e$12.bi_valid && (e$12.pending_buf[e$12.pending++] = 255 & e$12.bi_buf, e$12.bi_buf >>= 8, e$12.bi_valid -= 8); }(e$11); }; }, { "../utils/common": 41 }], - 53: [function(e$10, t$6, r$10) { + 53: [function(e$10, t$6, r$9) { "use strict"; t$6.exports = function() { this.input = null, this.next_in = 0, this.avail_in = 0, this.total_in = 0, this.output = null, this.next_out = 0, this.avail_out = 0, this.total_out = 0, this.msg = "", this.state = null, this.data_type = 2, this.adler = 0; }; }, {}], - 54: [function(e$10, t$6, r$10) { + 54: [function(e$10, t$6, r$9) { (function(e$11) { - !function(r$11, n$9) { + !function(r$10, n$9) { "use strict"; - if (!r$11.setImmediate) { - var i$7, s$5, t$7, a$2, o$10 = 1, h$5 = {}, u$4 = !1, l$3 = r$11.document, e$12 = Object.getPrototypeOf && Object.getPrototypeOf(r$11); - e$12 = e$12 && e$12.setTimeout ? e$12 : r$11, i$7 = "[object process]" === {}.toString.call(r$11.process) ? function(e$13) { + if (!r$10.setImmediate) { + var i$7, s$5, t$7, a$2, o$10 = 1, h$5 = {}, u$4 = !1, l$3 = r$10.document, e$12 = Object.getPrototypeOf && Object.getPrototypeOf(r$10); + e$12 = e$12 && e$12.setTimeout ? e$12 : r$10, i$7 = "[object process]" === {}.toString.call(r$10.process) ? function(e$13) { process.nextTick(function() { - c$7(e$13); + c$6(e$13); }); } : function() { - if (r$11.postMessage && !r$11.importScripts) { - var e$13 = !0, t$8 = r$11.onmessage; - return r$11.onmessage = function() { + if (r$10.postMessage && !r$10.importScripts) { + var e$13 = !0, t$8 = r$10.onmessage; + return r$10.onmessage = function() { e$13 = !1; - }, r$11.postMessage("", "*"), r$11.onmessage = t$8, e$13; + }, r$10.postMessage("", "*"), r$10.onmessage = t$8, e$13; } - }() ? (a$2 = "setImmediate$" + Math.random() + "$", r$11.addEventListener ? r$11.addEventListener("message", d$5, !1) : r$11.attachEvent("onmessage", d$5), function(e$13) { - r$11.postMessage(a$2 + e$13, "*"); - }) : r$11.MessageChannel ? ((t$7 = new MessageChannel()).port1.onmessage = function(e$13) { - c$7(e$13.data); + }() ? (a$2 = "setImmediate$" + Math.random() + "$", r$10.addEventListener ? r$10.addEventListener("message", d$4, !1) : r$10.attachEvent("onmessage", d$4), function(e$13) { + r$10.postMessage(a$2 + e$13, "*"); + }) : r$10.MessageChannel ? ((t$7 = new MessageChannel()).port1.onmessage = function(e$13) { + c$6(e$13.data); }, function(e$13) { t$7.port2.postMessage(e$13); }) : l$3 && "onreadystatechange" in l$3.createElement("script") ? (s$5 = l$3.documentElement, function(e$13) { var t$8 = l$3.createElement("script"); t$8.onreadystatechange = function() { - c$7(e$13), t$8.onreadystatechange = null, s$5.removeChild(t$8), t$8 = null; + c$6(e$13), t$8.onreadystatechange = null, s$5.removeChild(t$8), t$8 = null; }, s$5.appendChild(t$8); }) : function(e$13) { - setTimeout(c$7, 0, e$13); + setTimeout(c$6, 0, e$13); }, e$12.setImmediate = function(e$13) { "function" != typeof e$13 && (e$13 = new Function("" + e$13)); - for (var t$8 = new Array(arguments.length - 1), r$12 = 0; r$12 < t$8.length; r$12++) t$8[r$12] = arguments[r$12 + 1]; + for (var t$8 = new Array(arguments.length - 1), r$11 = 0; r$11 < t$8.length; r$11++) t$8[r$11] = arguments[r$11 + 1]; var n$10 = { callback: e$13, args: t$8 @@ -38837,29 +39041,29 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { function f$4(e$13) { delete h$5[e$13]; } - function c$7(e$13) { - if (u$4) setTimeout(c$7, 0, e$13); + function c$6(e$13) { + if (u$4) setTimeout(c$6, 0, e$13); else { var t$8 = h$5[e$13]; if (t$8) { u$4 = !0; try { !function(e$14) { - var t$9 = e$14.callback, r$12 = e$14.args; - switch (r$12.length) { + var t$9 = e$14.callback, r$11 = e$14.args; + switch (r$11.length) { case 0: t$9(); break; case 1: - t$9(r$12[0]); + t$9(r$11[0]); break; case 2: - t$9(r$12[0], r$12[1]); + t$9(r$11[0], r$11[1]); break; case 3: - t$9(r$12[0], r$12[1], r$12[2]); + t$9(r$11[0], r$11[1], r$11[2]); break; - default: t$9.apply(n$9, r$12); + default: t$9.apply(n$9, r$11); } }(t$8); } finally { @@ -38868,8 +39072,8 @@ var require_jszip_min = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } } - function d$5(e$13) { - e$13.source === r$11 && "string" == typeof e$13.data && 0 === e$13.data.indexOf(a$2) && c$7(+e$13.data.slice(a$2.length)); + function d$4(e$13) { + e$13.source === r$10 && "string" == typeof e$13.data && 0 === e$13.data.indexOf(a$2) && c$6(+e$13.data.slice(a$2.length)); } }("undefined" == typeof self ? void 0 === e$11 ? this : e$11 : self); }).call(this, "undefined" != typeof global ? global : "undefined" != typeof self ? self : "undefined" != typeof window ? window : {}); @@ -38914,12 +39118,12 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { RelationshipTypes$1["CommentsExtended"] = "http://schemas.microsoft.com/office/2011/relationships/commentsExtended"; RelationshipTypes$1["AltChunk"] = "http://schemas.openxmlformats.org/officeDocument/2006/relationships/aFChunk"; })(RelationshipTypes || (RelationshipTypes = {})); - function parseRelationships(root, xml$2) { - return xml$2.elements(root).map((e$10) => ({ - id: xml$2.attr(e$10, "Id"), - type: xml$2.attr(e$10, "Type"), - target: xml$2.attr(e$10, "Target"), - targetMode: xml$2.attr(e$10, "TargetMode") + function parseRelationships(root, xml$1) { + return xml$1.elements(root).map((e$10) => ({ + id: xml$1.attr(e$10, "Id"), + type: xml$1.attr(e$10, "Type"), + target: xml$1.attr(e$10, "Target"), + targetMode: xml$1.attr(e$10, "TargetMode") })); } function escapeClassName(className) { @@ -38965,14 +39169,14 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } function mergeDeep(target, ...sources) { if (!sources.length) return target; - const source$4 = sources.shift(); - if (isObject(target) && isObject(source$4)) { - for (const key in source$4) { - if (isObject(source$4[key])) { + const source = sources.shift(); + if (isObject(target) && isObject(source)) { + for (const key in source) { + if (isObject(source[key])) { const val$1 = target[key] ?? (target[key] = {}); - mergeDeep(val$1, source$4[key]); + mergeDeep(val$1, source[key]); } else { - target[key] = source$4[key]; + target[key] = source[key]; } } } @@ -39032,14 +39236,14 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { default: return defaultValue; } } - function parseCommonProperty(elem, props, xml$2) { + function parseCommonProperty(elem, props, xml$1) { if (elem.namespaceURI != ns$1.wordml) return false; switch (elem.localName) { case "color": - props.color = xml$2.attr(elem, "val"); + props.color = xml$1.attr(elem, "val"); break; case "sz": - props.fontSize = xml$2.lengthAttr(elem, "val", LengthUsage.FontSize); + props.fontSize = xml$1.lengthAttr(elem, "val", LengthUsage.FontSize); break; default: return false; } @@ -39066,15 +39270,15 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { elements(elem, localName = null) { const result = []; for (let i$7 = 0, l$3 = elem.childNodes.length; i$7 < l$3; i$7++) { - let c$7 = elem.childNodes.item(i$7); - if (c$7.nodeType == Node.ELEMENT_NODE && (localName == null || c$7.localName == localName)) result.push(c$7); + let c$6 = elem.childNodes.item(i$7); + if (c$6.nodeType == Node.ELEMENT_NODE && (localName == null || c$6.localName == localName)) result.push(c$6); } return result; } element(elem, localName) { for (let i$7 = 0, l$3 = elem.childNodes.length; i$7 < l$3; i$7++) { - let c$7 = elem.childNodes.item(i$7); - if (c$7.nodeType == 1 && c$7.localName == localName) return c$7; + let c$6 = elem.childNodes.item(i$7); + if (c$6.nodeType == 1 && c$6.localName == localName) return c$6; } return null; } @@ -39137,36 +39341,36 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { embedItalic: "italic", embedBoldItalic: "boldItalic" }; - function parseFonts(root, xml$2) { - return xml$2.elements(root).map((el) => parseFont(el, xml$2)); + function parseFonts(root, xml$1) { + return xml$1.elements(root).map((el) => parseFont(el, xml$1)); } - function parseFont(elem, xml$2) { + function parseFont(elem, xml$1) { let result = { - name: xml$2.attr(elem, "name"), + name: xml$1.attr(elem, "name"), embedFontRefs: [] }; - for (let el of xml$2.elements(elem)) { + for (let el of xml$1.elements(elem)) { switch (el.localName) { case "family": - result.family = xml$2.attr(el, "val"); + result.family = xml$1.attr(el, "val"); break; case "altName": - result.altName = xml$2.attr(el, "val"); + result.altName = xml$1.attr(el, "val"); break; case "embedRegular": case "embedBold": case "embedItalic": case "embedBoldItalic": - result.embedFontRefs.push(parseEmbedFontRef(el, xml$2)); + result.embedFontRefs.push(parseEmbedFontRef(el, xml$1)); break; } } return result; } - function parseEmbedFontRef(elem, xml$2) { + function parseEmbedFontRef(elem, xml$1) { return { - id: xml$2.attr(elem, "id"), - key: xml$2.attr(elem, "fontKey"), + id: xml$1.attr(elem, "id"), + key: xml$1.attr(elem, "fontKey"), type: embedFontTypeMap[elem.localName] }; } @@ -39223,31 +39427,31 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.body = this._documentParser.parseDocumentFile(root); } } - function parseBorder(elem, xml$2) { + function parseBorder(elem, xml$1) { return { - type: xml$2.attr(elem, "val"), - color: xml$2.attr(elem, "color"), - size: xml$2.lengthAttr(elem, "sz", LengthUsage.Border), - offset: xml$2.lengthAttr(elem, "space", LengthUsage.Point), - frame: xml$2.boolAttr(elem, "frame"), - shadow: xml$2.boolAttr(elem, "shadow") + type: xml$1.attr(elem, "val"), + color: xml$1.attr(elem, "color"), + size: xml$1.lengthAttr(elem, "sz", LengthUsage.Border), + offset: xml$1.lengthAttr(elem, "space", LengthUsage.Point), + frame: xml$1.boolAttr(elem, "frame"), + shadow: xml$1.boolAttr(elem, "shadow") }; } - function parseBorders(elem, xml$2) { + function parseBorders(elem, xml$1) { var result = {}; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "left": - result.left = parseBorder(e$10, xml$2); + result.left = parseBorder(e$10, xml$1); break; case "top": - result.top = parseBorder(e$10, xml$2); + result.top = parseBorder(e$10, xml$1); break; case "right": - result.right = parseBorder(e$10, xml$2); + result.right = parseBorder(e$10, xml$1); break; case "bottom": - result.bottom = parseBorder(e$10, xml$2); + result.bottom = parseBorder(e$10, xml$1); break; } } @@ -39261,288 +39465,288 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { SectionType$1["EvenPage"] = "evenPage"; SectionType$1["OddPage"] = "oddPage"; })(SectionType || (SectionType = {})); - function parseSectionProperties(elem, xml$2 = globalXmlParser) { + function parseSectionProperties(elem, xml$1 = globalXmlParser) { var section = {}; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "pgSz": section.pageSize = { - width: xml$2.lengthAttr(e$10, "w"), - height: xml$2.lengthAttr(e$10, "h"), - orientation: xml$2.attr(e$10, "orient") + width: xml$1.lengthAttr(e$10, "w"), + height: xml$1.lengthAttr(e$10, "h"), + orientation: xml$1.attr(e$10, "orient") }; break; case "type": - section.type = xml$2.attr(e$10, "val"); + section.type = xml$1.attr(e$10, "val"); break; case "pgMar": section.pageMargins = { - left: xml$2.lengthAttr(e$10, "left"), - right: xml$2.lengthAttr(e$10, "right"), - top: xml$2.lengthAttr(e$10, "top"), - bottom: xml$2.lengthAttr(e$10, "bottom"), - header: xml$2.lengthAttr(e$10, "header"), - footer: xml$2.lengthAttr(e$10, "footer"), - gutter: xml$2.lengthAttr(e$10, "gutter") + left: xml$1.lengthAttr(e$10, "left"), + right: xml$1.lengthAttr(e$10, "right"), + top: xml$1.lengthAttr(e$10, "top"), + bottom: xml$1.lengthAttr(e$10, "bottom"), + header: xml$1.lengthAttr(e$10, "header"), + footer: xml$1.lengthAttr(e$10, "footer"), + gutter: xml$1.lengthAttr(e$10, "gutter") }; break; case "cols": - section.columns = parseColumns(e$10, xml$2); + section.columns = parseColumns(e$10, xml$1); break; case "headerReference": - (section.headerRefs ?? (section.headerRefs = [])).push(parseFooterHeaderReference(e$10, xml$2)); + (section.headerRefs ?? (section.headerRefs = [])).push(parseFooterHeaderReference(e$10, xml$1)); break; case "footerReference": - (section.footerRefs ?? (section.footerRefs = [])).push(parseFooterHeaderReference(e$10, xml$2)); + (section.footerRefs ?? (section.footerRefs = [])).push(parseFooterHeaderReference(e$10, xml$1)); break; case "titlePg": - section.titlePage = xml$2.boolAttr(e$10, "val", true); + section.titlePage = xml$1.boolAttr(e$10, "val", true); break; case "pgBorders": - section.pageBorders = parseBorders(e$10, xml$2); + section.pageBorders = parseBorders(e$10, xml$1); break; case "pgNumType": - section.pageNumber = parsePageNumber(e$10, xml$2); + section.pageNumber = parsePageNumber(e$10, xml$1); break; } } return section; } - function parseColumns(elem, xml$2) { + function parseColumns(elem, xml$1) { return { - numberOfColumns: xml$2.intAttr(elem, "num"), - space: xml$2.lengthAttr(elem, "space"), - separator: xml$2.boolAttr(elem, "sep"), - equalWidth: xml$2.boolAttr(elem, "equalWidth", true), - columns: xml$2.elements(elem, "col").map((e$10) => ({ - width: xml$2.lengthAttr(e$10, "w"), - space: xml$2.lengthAttr(e$10, "space") + numberOfColumns: xml$1.intAttr(elem, "num"), + space: xml$1.lengthAttr(elem, "space"), + separator: xml$1.boolAttr(elem, "sep"), + equalWidth: xml$1.boolAttr(elem, "equalWidth", true), + columns: xml$1.elements(elem, "col").map((e$10) => ({ + width: xml$1.lengthAttr(e$10, "w"), + space: xml$1.lengthAttr(e$10, "space") })) }; } - function parsePageNumber(elem, xml$2) { + function parsePageNumber(elem, xml$1) { return { - chapSep: xml$2.attr(elem, "chapSep"), - chapStyle: xml$2.attr(elem, "chapStyle"), - format: xml$2.attr(elem, "fmt"), - start: xml$2.intAttr(elem, "start") + chapSep: xml$1.attr(elem, "chapSep"), + chapStyle: xml$1.attr(elem, "chapStyle"), + format: xml$1.attr(elem, "fmt"), + start: xml$1.intAttr(elem, "start") }; } - function parseFooterHeaderReference(elem, xml$2) { + function parseFooterHeaderReference(elem, xml$1) { return { - id: xml$2.attr(elem, "id"), - type: xml$2.attr(elem, "type") + id: xml$1.attr(elem, "id"), + type: xml$1.attr(elem, "type") }; } - function parseLineSpacing(elem, xml$2) { + function parseLineSpacing(elem, xml$1) { return { - before: xml$2.lengthAttr(elem, "before"), - after: xml$2.lengthAttr(elem, "after"), - line: xml$2.intAttr(elem, "line"), - lineRule: xml$2.attr(elem, "lineRule") + before: xml$1.lengthAttr(elem, "before"), + after: xml$1.lengthAttr(elem, "after"), + line: xml$1.intAttr(elem, "line"), + lineRule: xml$1.attr(elem, "lineRule") }; } - function parseRunProperties(elem, xml$2) { + function parseRunProperties(elem, xml$1) { let result = {}; - for (let el of xml$2.elements(elem)) { - parseRunProperty(el, result, xml$2); + for (let el of xml$1.elements(elem)) { + parseRunProperty(el, result, xml$1); } return result; } - function parseRunProperty(elem, props, xml$2) { - if (parseCommonProperty(elem, props, xml$2)) return true; + function parseRunProperty(elem, props, xml$1) { + if (parseCommonProperty(elem, props, xml$1)) return true; return false; } - function parseParagraphProperties(elem, xml$2) { + function parseParagraphProperties(elem, xml$1) { let result = {}; - for (let el of xml$2.elements(elem)) { - parseParagraphProperty(el, result, xml$2); + for (let el of xml$1.elements(elem)) { + parseParagraphProperty(el, result, xml$1); } return result; } - function parseParagraphProperty(elem, props, xml$2) { + function parseParagraphProperty(elem, props, xml$1) { if (elem.namespaceURI != ns$1.wordml) return false; - if (parseCommonProperty(elem, props, xml$2)) return true; + if (parseCommonProperty(elem, props, xml$1)) return true; switch (elem.localName) { case "tabs": - props.tabs = parseTabs(elem, xml$2); + props.tabs = parseTabs(elem, xml$1); break; case "sectPr": - props.sectionProps = parseSectionProperties(elem, xml$2); + props.sectionProps = parseSectionProperties(elem, xml$1); break; case "numPr": - props.numbering = parseNumbering$1(elem, xml$2); + props.numbering = parseNumbering$1(elem, xml$1); break; case "spacing": - props.lineSpacing = parseLineSpacing(elem, xml$2); + props.lineSpacing = parseLineSpacing(elem, xml$1); return false; case "textAlignment": - props.textAlignment = xml$2.attr(elem, "val"); + props.textAlignment = xml$1.attr(elem, "val"); return false; case "keepLines": - props.keepLines = xml$2.boolAttr(elem, "val", true); + props.keepLines = xml$1.boolAttr(elem, "val", true); break; case "keepNext": - props.keepNext = xml$2.boolAttr(elem, "val", true); + props.keepNext = xml$1.boolAttr(elem, "val", true); break; case "pageBreakBefore": - props.pageBreakBefore = xml$2.boolAttr(elem, "val", true); + props.pageBreakBefore = xml$1.boolAttr(elem, "val", true); break; case "outlineLvl": - props.outlineLevel = xml$2.intAttr(elem, "val"); + props.outlineLevel = xml$1.intAttr(elem, "val"); break; case "pStyle": - props.styleName = xml$2.attr(elem, "val"); + props.styleName = xml$1.attr(elem, "val"); break; case "rPr": - props.runProps = parseRunProperties(elem, xml$2); + props.runProps = parseRunProperties(elem, xml$1); break; default: return false; } return true; } - function parseTabs(elem, xml$2) { - return xml$2.elements(elem, "tab").map((e$10) => ({ - position: xml$2.lengthAttr(e$10, "pos"), - leader: xml$2.attr(e$10, "leader"), - style: xml$2.attr(e$10, "val") + function parseTabs(elem, xml$1) { + return xml$1.elements(elem, "tab").map((e$10) => ({ + position: xml$1.lengthAttr(e$10, "pos"), + leader: xml$1.attr(e$10, "leader"), + style: xml$1.attr(e$10, "val") })); } - function parseNumbering$1(elem, xml$2) { + function parseNumbering$1(elem, xml$1) { var result = {}; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "numId": - result.id = xml$2.attr(e$10, "val"); + result.id = xml$1.attr(e$10, "val"); break; case "ilvl": - result.level = xml$2.intAttr(e$10, "val"); + result.level = xml$1.intAttr(e$10, "val"); break; } } return result; } - function parseNumberingPart(elem, xml$2) { + function parseNumberingPart(elem, xml$1) { let result = { numberings: [], abstractNumberings: [], bulletPictures: [] }; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "num": - result.numberings.push(parseNumbering(e$10, xml$2)); + result.numberings.push(parseNumbering(e$10, xml$1)); break; case "abstractNum": - result.abstractNumberings.push(parseAbstractNumbering(e$10, xml$2)); + result.abstractNumberings.push(parseAbstractNumbering(e$10, xml$1)); break; case "numPicBullet": - result.bulletPictures.push(parseNumberingBulletPicture(e$10, xml$2)); + result.bulletPictures.push(parseNumberingBulletPicture(e$10, xml$1)); break; } } return result; } - function parseNumbering(elem, xml$2) { + function parseNumbering(elem, xml$1) { let result = { - id: xml$2.attr(elem, "numId"), + id: xml$1.attr(elem, "numId"), overrides: [] }; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "abstractNumId": - result.abstractId = xml$2.attr(e$10, "val"); + result.abstractId = xml$1.attr(e$10, "val"); break; case "lvlOverride": - result.overrides.push(parseNumberingLevelOverrride(e$10, xml$2)); + result.overrides.push(parseNumberingLevelOverrride(e$10, xml$1)); break; } } return result; } - function parseAbstractNumbering(elem, xml$2) { + function parseAbstractNumbering(elem, xml$1) { let result = { - id: xml$2.attr(elem, "abstractNumId"), + id: xml$1.attr(elem, "abstractNumId"), levels: [] }; - for (let e$10 of xml$2.elements(elem)) { + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "name": - result.name = xml$2.attr(e$10, "val"); + result.name = xml$1.attr(e$10, "val"); break; case "multiLevelType": - result.multiLevelType = xml$2.attr(e$10, "val"); + result.multiLevelType = xml$1.attr(e$10, "val"); break; case "numStyleLink": - result.numberingStyleLink = xml$2.attr(e$10, "val"); + result.numberingStyleLink = xml$1.attr(e$10, "val"); break; case "styleLink": - result.styleLink = xml$2.attr(e$10, "val"); + result.styleLink = xml$1.attr(e$10, "val"); break; case "lvl": - result.levels.push(parseNumberingLevel(e$10, xml$2)); + result.levels.push(parseNumberingLevel(e$10, xml$1)); break; } } return result; } - function parseNumberingLevel(elem, xml$2) { - let result = { level: xml$2.intAttr(elem, "ilvl") }; - for (let e$10 of xml$2.elements(elem)) { + function parseNumberingLevel(elem, xml$1) { + let result = { level: xml$1.intAttr(elem, "ilvl") }; + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "start": - result.start = xml$2.attr(e$10, "val"); + result.start = xml$1.attr(e$10, "val"); break; case "lvlRestart": - result.restart = xml$2.intAttr(e$10, "val"); + result.restart = xml$1.intAttr(e$10, "val"); break; case "numFmt": - result.format = xml$2.attr(e$10, "val"); + result.format = xml$1.attr(e$10, "val"); break; case "lvlText": - result.text = xml$2.attr(e$10, "val"); + result.text = xml$1.attr(e$10, "val"); break; case "lvlJc": - result.justification = xml$2.attr(e$10, "val"); + result.justification = xml$1.attr(e$10, "val"); break; case "lvlPicBulletId": - result.bulletPictureId = xml$2.attr(e$10, "val"); + result.bulletPictureId = xml$1.attr(e$10, "val"); break; case "pStyle": - result.paragraphStyle = xml$2.attr(e$10, "val"); + result.paragraphStyle = xml$1.attr(e$10, "val"); break; case "pPr": - result.paragraphProps = parseParagraphProperties(e$10, xml$2); + result.paragraphProps = parseParagraphProperties(e$10, xml$1); break; case "rPr": - result.runProps = parseRunProperties(e$10, xml$2); + result.runProps = parseRunProperties(e$10, xml$1); break; } } return result; } - function parseNumberingLevelOverrride(elem, xml$2) { - let result = { level: xml$2.intAttr(elem, "ilvl") }; - for (let e$10 of xml$2.elements(elem)) { + function parseNumberingLevelOverrride(elem, xml$1) { + let result = { level: xml$1.intAttr(elem, "ilvl") }; + for (let e$10 of xml$1.elements(elem)) { switch (e$10.localName) { case "startOverride": - result.start = xml$2.intAttr(e$10, "val"); + result.start = xml$1.intAttr(e$10, "val"); break; case "lvl": - result.numberingLevel = parseNumberingLevel(e$10, xml$2); + result.numberingLevel = parseNumberingLevel(e$10, xml$1); break; } } return result; } - function parseNumberingBulletPicture(elem, xml$2) { - var pict = xml$2.element(elem, "pict"); - var shape = pict && xml$2.element(pict, "shape"); - var imagedata = shape && xml$2.element(shape, "imagedata"); + function parseNumberingBulletPicture(elem, xml$1) { + var pict = xml$1.element(elem, "pict"); + var shape = pict && xml$1.element(pict, "shape"); + var imagedata = shape && xml$1.element(shape, "imagedata"); return imagedata ? { - id: xml$2.attr(elem, "numPicBulletId"), - referenceId: xml$2.attr(imagedata, "id"), - style: xml$2.attr(shape, "style") + id: xml$1.attr(elem, "numPicBulletId"), + referenceId: xml$1.attr(imagedata, "id"), + style: xml$1.attr(shape, "style") } : null; } class NumberingPart extends Part { @@ -39749,56 +39953,56 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } class DmlTheme {} - function parseTheme(elem, xml$2) { + function parseTheme(elem, xml$1) { var result = new DmlTheme(); - var themeElements = xml$2.element(elem, "themeElements"); - for (let el of xml$2.elements(themeElements)) { + var themeElements = xml$1.element(elem, "themeElements"); + for (let el of xml$1.elements(themeElements)) { switch (el.localName) { case "clrScheme": - result.colorScheme = parseColorScheme(el, xml$2); + result.colorScheme = parseColorScheme(el, xml$1); break; case "fontScheme": - result.fontScheme = parseFontScheme(el, xml$2); + result.fontScheme = parseFontScheme(el, xml$1); break; } } return result; } - function parseColorScheme(elem, xml$2) { + function parseColorScheme(elem, xml$1) { var result = { - name: xml$2.attr(elem, "name"), + name: xml$1.attr(elem, "name"), colors: {} }; - for (let el of xml$2.elements(elem)) { - var srgbClr = xml$2.element(el, "srgbClr"); - var sysClr = xml$2.element(el, "sysClr"); + for (let el of xml$1.elements(elem)) { + var srgbClr = xml$1.element(el, "srgbClr"); + var sysClr = xml$1.element(el, "sysClr"); if (srgbClr) { - result.colors[el.localName] = xml$2.attr(srgbClr, "val"); + result.colors[el.localName] = xml$1.attr(srgbClr, "val"); } else if (sysClr) { - result.colors[el.localName] = xml$2.attr(sysClr, "lastClr"); + result.colors[el.localName] = xml$1.attr(sysClr, "lastClr"); } } return result; } - function parseFontScheme(elem, xml$2) { - var result = { name: xml$2.attr(elem, "name") }; - for (let el of xml$2.elements(elem)) { + function parseFontScheme(elem, xml$1) { + var result = { name: xml$1.attr(elem, "name") }; + for (let el of xml$1.elements(elem)) { switch (el.localName) { case "majorFont": - result.majorFont = parseFontInfo(el, xml$2); + result.majorFont = parseFontInfo(el, xml$1); break; case "minorFont": - result.minorFont = parseFontInfo(el, xml$2); + result.minorFont = parseFontInfo(el, xml$1); break; } } return result; } - function parseFontInfo(elem, xml$2) { + function parseFontInfo(elem, xml$1) { return { - latinTypeface: xml$2.elementAttr(elem, "latin", "typeface"), - eaTypeface: xml$2.elementAttr(elem, "ea", "typeface"), - csTypeface: xml$2.elementAttr(elem, "cs", "typeface") + latinTypeface: xml$1.elementAttr(elem, "latin", "typeface"), + eaTypeface: xml$1.elementAttr(elem, "ea", "typeface"), + csTypeface: xml$1.elementAttr(elem, "cs", "typeface") }; } class ThemePart extends Part { @@ -39844,36 +40048,36 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.notes = this._documentParser.parseNotes(root, "endnote", WmlEndnote); } } - function parseSettings(elem, xml$2) { + function parseSettings(elem, xml$1) { var result = {}; - for (let el of xml$2.elements(elem)) { + for (let el of xml$1.elements(elem)) { switch (el.localName) { case "defaultTabStop": - result.defaultTabStop = xml$2.lengthAttr(el, "val"); + result.defaultTabStop = xml$1.lengthAttr(el, "val"); break; case "footnotePr": - result.footnoteProps = parseNoteProperties(el, xml$2); + result.footnoteProps = parseNoteProperties(el, xml$1); break; case "endnotePr": - result.endnoteProps = parseNoteProperties(el, xml$2); + result.endnoteProps = parseNoteProperties(el, xml$1); break; case "autoHyphenation": - result.autoHyphenation = xml$2.boolAttr(el, "val"); + result.autoHyphenation = xml$1.boolAttr(el, "val"); break; } } return result; } - function parseNoteProperties(elem, xml$2) { + function parseNoteProperties(elem, xml$1) { var result = { defaultNoteIds: [] }; - for (let el of xml$2.elements(elem)) { + for (let el of xml$1.elements(elem)) { switch (el.localName) { case "numFmt": - result.nummeringFormat = xml$2.attr(el, "val"); + result.nummeringFormat = xml$1.attr(el, "val"); break; case "footnote": case "endnote": - result.defaultNoteIds.push(xml$2.attr(el, "id")); + result.defaultNoteIds.push(xml$1.attr(el, "id")); break; } } @@ -39887,12 +40091,12 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.settings = parseSettings(root, this._package.xmlParser); } } - function parseCustomProps(root, xml$2) { - return xml$2.elements(root, "property").map((e$10) => { + function parseCustomProps(root, xml$1) { + return xml$1.elements(root, "property").map((e$10) => { const firstChild = e$10.firstChild; return { - formatId: xml$2.attr(e$10, "fmtid"), - name: xml$2.attr(e$10, "name"), + formatId: xml$1.attr(e$10, "fmtid"), + name: xml$1.attr(e$10, "name"), type: firstChild.nodeName, value: firstChild.textContent }; @@ -39919,12 +40123,12 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.comments = []; } parseXml(root) { - const xml$2 = this._package.xmlParser; - for (let el of xml$2.elements(root, "commentEx")) { + const xml$1 = this._package.xmlParser; + for (let el of xml$1.elements(root, "commentEx")) { this.comments.push({ - paraId: xml$2.attr(el, "paraId"), - paraIdParent: xml$2.attr(el, "paraIdParent"), - done: xml$2.boolAttr(el, "done") + paraId: xml$1.attr(el, "paraId"), + paraIdParent: xml$1.attr(el, "paraIdParent"), + done: xml$1.boolAttr(el, "done") }); } this.commentMap = keyBy(this.comments, (x$2) => x$2.paraId); @@ -39954,16 +40158,16 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.partsMap = {}; } static async load(blob, parser, options) { - var d$5 = new WordDocument(); - d$5._options = options; - d$5._parser = parser; - d$5._package = await OpenXmlPackage.load(blob, options); - d$5.rels = await d$5._package.loadRelationships(); + var d$4 = new WordDocument(); + d$4._options = options; + d$4._parser = parser; + d$4._package = await OpenXmlPackage.load(blob, options); + d$4.rels = await d$4._package.loadRelationships(); await Promise.all(topLevelRels.map((rel$1) => { - const r$10 = d$5.rels.find((x$2) => x$2.type === rel$1.type) ?? rel$1; - return d$5.loadRelationshipPart(r$10.target, r$10.type); + const r$9 = d$4.rels.find((x$2) => x$2.type === rel$1.type) ?? rel$1; + return d$4.loadRelationshipPart(r$9.target, r$9.type); })); - return d$5; + return d$4; } save(type = "blob") { return this._package.save(type); @@ -40052,7 +40256,7 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { return URL.createObjectURL(blob); } findPartByRelId(id, basePart = null) { - var rel$1 = (basePart.rels ?? this.rels).find((r$10) => r$10.id == id); + var rel$1 = (basePart.rels ?? this.rels).find((r$9) => r$9.id == id); const folder = basePart ? splitPath(basePart.path)[0] : ""; return rel$1 ? this.partsMap[resolvePath(rel$1.target, folder)] : null; } @@ -40074,19 +40278,19 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (let i$7 = 0; i$7 < 32; i$7++) data[i$7] = data[i$7] ^ numbers[i$7 % len]; return data; } - function parseBookmarkStart(elem, xml$2) { + function parseBookmarkStart(elem, xml$1) { return { type: DomType.BookmarkStart, - id: xml$2.attr(elem, "id"), - name: xml$2.attr(elem, "name"), - colFirst: xml$2.intAttr(elem, "colFirst"), - colLast: xml$2.intAttr(elem, "colLast") + id: xml$1.attr(elem, "id"), + name: xml$1.attr(elem, "name"), + colFirst: xml$1.intAttr(elem, "colFirst"), + colLast: xml$1.intAttr(elem, "colLast") }; } - function parseBookmarkEnd(elem, xml$2) { + function parseBookmarkEnd(elem, xml$1) { return { type: DomType.BookmarkEnd, - id: xml$2.attr(elem, "id") + id: xml$1.attr(elem, "id") }; } class VmlElement extends OpenXmlElementBase { @@ -40350,17 +40554,17 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { basedOn: null, styles: [] }; - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "rPrDefault": - var rPr = globalXmlParser.element(c$7, "rPr"); + var rPr = globalXmlParser.element(c$6, "rPr"); if (rPr) result.styles.push({ target: "span", values: this.parseDefaultProperties(rPr, {}) }); break; case "pPrDefault": - var pPr = globalXmlParser.element(c$7, "pPr"); + var pPr = globalXmlParser.element(c$6, "pPr"); if (pPr) result.styles.push({ target: "p", values: this.parseDefaultProperties(pPr, {}) @@ -40669,17 +40873,17 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { return result; } parseParagraphProperties(elem, paragraph) { - this.parseDefaultProperties(elem, paragraph.cssStyle = {}, null, (c$7) => { - if (parseParagraphProperty(c$7, paragraph, globalXmlParser)) return true; - switch (c$7.localName) { + this.parseDefaultProperties(elem, paragraph.cssStyle = {}, null, (c$6) => { + if (parseParagraphProperty(c$6, paragraph, globalXmlParser)) return true; + switch (c$6.localName) { case "pStyle": - paragraph.styleName = globalXmlParser.attr(c$7, "val"); + paragraph.styleName = globalXmlParser.attr(c$6, "val"); break; case "cnfStyle": - paragraph.className = values.classNameOfCnfStyle(c$7); + paragraph.className = values.classNameOfCnfStyle(c$6); break; case "framePr": - this.parseFrame(c$7, paragraph); + this.parseFrame(c$6, paragraph); break; case "rPr": break; default: return false; @@ -40699,10 +40903,10 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; result.anchor = globalXmlParser.attr(node, "anchor"); result.id = globalXmlParser.attr(node, "id"); - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "r": - result.children.push(this.parseRun(c$7, result)); + result.children.push(this.parseRun(c$6, result)); break; } } @@ -40718,10 +40922,10 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { var element = globalXmlParser.attr(node, "element"); if (uri) result.uri = uri; if (element) result.element = element; - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "r": - result.children.push(this.parseRun(c$7, result)); + result.children.push(this.parseRun(c$6, result)); break; } } @@ -40733,46 +40937,46 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { parent, children: [] }; - for (let c$7 of globalXmlParser.elements(node)) { - c$7 = this.checkAlternateContent(c$7); - switch (c$7.localName) { + for (let c$6 of globalXmlParser.elements(node)) { + c$6 = this.checkAlternateContent(c$6); + switch (c$6.localName) { case "t": result.children.push({ type: DomType.Text, - text: c$7.textContent + text: c$6.textContent }); break; case "delText": result.children.push({ type: DomType.DeletedText, - text: c$7.textContent + text: c$6.textContent }); break; case "commentReference": - result.children.push(new WmlCommentReference(globalXmlParser.attr(c$7, "id"))); + result.children.push(new WmlCommentReference(globalXmlParser.attr(c$6, "id"))); break; case "fldSimple": result.children.push({ type: DomType.SimpleField, - instruction: globalXmlParser.attr(c$7, "instr"), - lock: globalXmlParser.boolAttr(c$7, "lock", false), - dirty: globalXmlParser.boolAttr(c$7, "dirty", false) + instruction: globalXmlParser.attr(c$6, "instr"), + lock: globalXmlParser.boolAttr(c$6, "lock", false), + dirty: globalXmlParser.boolAttr(c$6, "dirty", false) }); break; case "instrText": result.fieldRun = true; result.children.push({ type: DomType.Instruction, - text: c$7.textContent + text: c$6.textContent }); break; case "fldChar": result.fieldRun = true; result.children.push({ type: DomType.ComplexField, - charType: globalXmlParser.attr(c$7, "fldCharType"), - lock: globalXmlParser.boolAttr(c$7, "lock", false), - dirty: globalXmlParser.boolAttr(c$7, "dirty", false) + charType: globalXmlParser.attr(c$6, "fldCharType"), + lock: globalXmlParser.boolAttr(c$6, "lock", false), + dirty: globalXmlParser.boolAttr(c$6, "dirty", false) }); break; case "noBreakHyphen": @@ -40781,7 +40985,7 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { case "br": result.children.push({ type: DomType.Break, - break: globalXmlParser.attr(c$7, "type") || "textWrapping" + break: globalXmlParser.attr(c$6, "type") || "textWrapping" }); break; case "lastRenderedPageBreak": @@ -40793,8 +40997,8 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { case "sym": result.children.push({ type: DomType.Symbol, - font: encloseFontFamily(globalXmlParser.attr(c$7, "font")), - char: globalXmlParser.attr(c$7, "char") + font: encloseFontFamily(globalXmlParser.attr(c$6, "font")), + char: globalXmlParser.attr(c$6, "char") }); break; case "tab": @@ -40803,24 +41007,24 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { case "footnoteReference": result.children.push({ type: DomType.FootnoteReference, - id: globalXmlParser.attr(c$7, "id") + id: globalXmlParser.attr(c$6, "id") }); break; case "endnoteReference": result.children.push({ type: DomType.EndnoteReference, - id: globalXmlParser.attr(c$7, "id") + id: globalXmlParser.attr(c$6, "id") }); break; case "drawing": - let d$5 = this.parseDrawing(c$7); - if (d$5) result.children = [d$5]; + let d$4 = this.parseDrawing(c$6); + if (d$4) result.children = [d$4]; break; case "pict": - result.children.push(this.parseVmlPicture(c$7)); + result.children.push(this.parseVmlPicture(c$6)); break; case "rPr": - this.parseRunProperties(c$7, result); + this.parseRunProperties(c$6, result); break; } } @@ -40873,13 +41077,13 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { return result; } parseRunProperties(elem, run) { - this.parseDefaultProperties(elem, run.cssStyle = {}, null, (c$7) => { - switch (c$7.localName) { + this.parseDefaultProperties(elem, run.cssStyle = {}, null, (c$6) => { + switch (c$6.localName) { case "rStyle": - run.styleName = globalXmlParser.attr(c$7, "val"); + run.styleName = globalXmlParser.attr(c$6, "val"); break; case "vertAlign": - run.verticalAlign = values.valueOfVertAlign(c$7, true); + run.verticalAlign = values.valueOfVertAlign(c$6, true); break; default: return false; } @@ -41040,16 +41244,16 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { type: DomType.Table, children: [] }; - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "tr": - result.children.push(this.parseTableRow(c$7)); + result.children.push(this.parseTableRow(c$6)); break; case "tblGrid": - result.columns = this.parseTableColumns(c$7); + result.columns = this.parseTableColumns(c$6); break; case "tblPr": - this.parseTableProperties(c$7, result); + this.parseTableProperties(c$6, result); break; } } @@ -41069,22 +41273,22 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { parseTableProperties(elem, table) { table.cssStyle = {}; table.cellStyle = {}; - this.parseDefaultProperties(elem, table.cssStyle, table.cellStyle, (c$7) => { - switch (c$7.localName) { + this.parseDefaultProperties(elem, table.cssStyle, table.cellStyle, (c$6) => { + switch (c$6.localName) { case "tblStyle": - table.styleName = globalXmlParser.attr(c$7, "val"); + table.styleName = globalXmlParser.attr(c$6, "val"); break; case "tblLook": - table.className = values.classNameOftblLook(c$7); + table.className = values.classNameOftblLook(c$6); break; case "tblpPr": - this.parseTablePosition(c$7, table); + this.parseTablePosition(c$6, table); break; case "tblStyleColBandSize": - table.colBandSize = globalXmlParser.intAttr(c$7, "val"); + table.colBandSize = globalXmlParser.intAttr(c$6, "val"); break; case "tblStyleRowBandSize": - table.rowBandSize = globalXmlParser.intAttr(c$7, "val"); + table.rowBandSize = globalXmlParser.intAttr(c$6, "val"); break; case "hidden": table.cssStyle["display"] = "none"; @@ -41121,33 +41325,33 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { type: DomType.Row, children: [] }; - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "tc": - result.children.push(this.parseTableCell(c$7)); + result.children.push(this.parseTableCell(c$6)); break; case "trPr": case "tblPrEx": - this.parseTableRowProperties(c$7, result); + this.parseTableRowProperties(c$6, result); break; } } return result; } parseTableRowProperties(elem, row) { - row.cssStyle = this.parseDefaultProperties(elem, {}, null, (c$7) => { - switch (c$7.localName) { + row.cssStyle = this.parseDefaultProperties(elem, {}, null, (c$6) => { + switch (c$6.localName) { case "cnfStyle": - row.className = values.classNameOfCnfStyle(c$7); + row.className = values.classNameOfCnfStyle(c$6); break; case "tblHeader": - row.isHeader = globalXmlParser.boolAttr(c$7, "val"); + row.isHeader = globalXmlParser.boolAttr(c$6, "val"); break; case "gridBefore": - row.gridBefore = globalXmlParser.intAttr(c$7, "val"); + row.gridBefore = globalXmlParser.intAttr(c$6, "val"); break; case "gridAfter": - row.gridAfter = globalXmlParser.intAttr(c$7, "val"); + row.gridAfter = globalXmlParser.intAttr(c$6, "val"); break; default: return false; } @@ -41159,32 +41363,32 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { type: DomType.Cell, children: [] }; - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "tbl": - result.children.push(this.parseTable(c$7)); + result.children.push(this.parseTable(c$6)); break; case "p": - result.children.push(this.parseParagraph(c$7)); + result.children.push(this.parseParagraph(c$6)); break; case "tcPr": - this.parseTableCellProperties(c$7, result); + this.parseTableCellProperties(c$6, result); break; } } return result; } parseTableCellProperties(elem, cell) { - cell.cssStyle = this.parseDefaultProperties(elem, {}, null, (c$7) => { - switch (c$7.localName) { + cell.cssStyle = this.parseDefaultProperties(elem, {}, null, (c$6) => { + switch (c$6.localName) { case "gridSpan": - cell.span = globalXmlParser.intAttr(c$7, "val", null); + cell.span = globalXmlParser.intAttr(c$6, "val", null); break; case "vMerge": - cell.verticalMerge = globalXmlParser.attr(c$7, "val") ?? "continue"; + cell.verticalMerge = globalXmlParser.attr(c$6, "val") ?? "continue"; break; case "cnfStyle": - cell.className = values.classNameOfCnfStyle(c$7); + cell.className = values.classNameOfCnfStyle(c$6); break; default: return false; } @@ -41207,9 +41411,9 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { transform: "none" } }; - for (const c$7 of globalXmlParser.elements(elem)) { - if (c$7.localName === "textDirection") { - const direction = globalXmlParser.attr(c$7, "val"); + for (const c$6 of globalXmlParser.elements(elem)) { + if (c$6.localName === "textDirection") { + const direction = globalXmlParser.attr(c$6, "val"); const style = directionMap[direction] || { writingMode: "horizontal-tb" }; cell.cssStyle["writing-mode"] = style.writingMode; cell.cssStyle["transform"] = style.transform; @@ -41218,109 +41422,109 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } parseDefaultProperties(elem, style = null, childStyle = null, handler = null) { style = style || {}; - for (const c$7 of globalXmlParser.elements(elem)) { - if (handler?.(c$7)) continue; - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(elem)) { + if (handler?.(c$6)) continue; + switch (c$6.localName) { case "jc": - style["text-align"] = values.valueOfJc(c$7); + style["text-align"] = values.valueOfJc(c$6); break; case "textAlignment": - style["vertical-align"] = values.valueOfTextAlignment(c$7); + style["vertical-align"] = values.valueOfTextAlignment(c$6); break; case "color": - style["color"] = xmlUtil.colorAttr(c$7, "val", null, autos.color); + style["color"] = xmlUtil.colorAttr(c$6, "val", null, autos.color); break; case "sz": - style["font-size"] = style["min-height"] = globalXmlParser.lengthAttr(c$7, "val", LengthUsage.FontSize); + style["font-size"] = style["min-height"] = globalXmlParser.lengthAttr(c$6, "val", LengthUsage.FontSize); break; case "shd": - style["background-color"] = xmlUtil.colorAttr(c$7, "fill", null, autos.shd); + style["background-color"] = xmlUtil.colorAttr(c$6, "fill", null, autos.shd); break; case "highlight": - style["background-color"] = xmlUtil.colorAttr(c$7, "val", null, autos.highlight); + style["background-color"] = xmlUtil.colorAttr(c$6, "val", null, autos.highlight); break; case "vertAlign": break; case "position": - style.verticalAlign = globalXmlParser.lengthAttr(c$7, "val", LengthUsage.FontSize); + style.verticalAlign = globalXmlParser.lengthAttr(c$6, "val", LengthUsage.FontSize); break; case "tcW": if (this.options.ignoreWidth) break; case "tblW": - style["width"] = values.valueOfSize(c$7, "w"); + style["width"] = values.valueOfSize(c$6, "w"); break; case "trHeight": - this.parseTrHeight(c$7, style); + this.parseTrHeight(c$6, style); break; case "strike": - style["text-decoration"] = globalXmlParser.boolAttr(c$7, "val", true) ? "line-through" : "none"; + style["text-decoration"] = globalXmlParser.boolAttr(c$6, "val", true) ? "line-through" : "none"; break; case "b": - style["font-weight"] = globalXmlParser.boolAttr(c$7, "val", true) ? "bold" : "normal"; + style["font-weight"] = globalXmlParser.boolAttr(c$6, "val", true) ? "bold" : "normal"; break; case "i": - style["font-style"] = globalXmlParser.boolAttr(c$7, "val", true) ? "italic" : "normal"; + style["font-style"] = globalXmlParser.boolAttr(c$6, "val", true) ? "italic" : "normal"; break; case "caps": - style["text-transform"] = globalXmlParser.boolAttr(c$7, "val", true) ? "uppercase" : "none"; + style["text-transform"] = globalXmlParser.boolAttr(c$6, "val", true) ? "uppercase" : "none"; break; case "smallCaps": - style["font-variant"] = globalXmlParser.boolAttr(c$7, "val", true) ? "small-caps" : "none"; + style["font-variant"] = globalXmlParser.boolAttr(c$6, "val", true) ? "small-caps" : "none"; break; case "u": - this.parseUnderline(c$7, style); + this.parseUnderline(c$6, style); break; case "ind": case "tblInd": - this.parseIndentation(c$7, style); + this.parseIndentation(c$6, style); break; case "rFonts": - this.parseFont(c$7, style); + this.parseFont(c$6, style); break; case "tblBorders": - this.parseBorderProperties(c$7, childStyle || style); + this.parseBorderProperties(c$6, childStyle || style); break; case "tblCellSpacing": - style["border-spacing"] = values.valueOfMargin(c$7); + style["border-spacing"] = values.valueOfMargin(c$6); style["border-collapse"] = "separate"; break; case "pBdr": - this.parseBorderProperties(c$7, style); + this.parseBorderProperties(c$6, style); break; case "bdr": - style["border"] = values.valueOfBorder(c$7); + style["border"] = values.valueOfBorder(c$6); break; case "tcBorders": - this.parseBorderProperties(c$7, style); + this.parseBorderProperties(c$6, style); break; case "vanish": - if (globalXmlParser.boolAttr(c$7, "val", true)) style["display"] = "none"; + if (globalXmlParser.boolAttr(c$6, "val", true)) style["display"] = "none"; break; case "kern": break; case "noWrap": break; case "tblCellMar": case "tcMar": - this.parseMarginProperties(c$7, childStyle || style); + this.parseMarginProperties(c$6, childStyle || style); break; case "tblLayout": - style["table-layout"] = values.valueOfTblLayout(c$7); + style["table-layout"] = values.valueOfTblLayout(c$6); break; case "vAlign": - style["vertical-align"] = values.valueOfTextAlignment(c$7); + style["vertical-align"] = values.valueOfTextAlignment(c$6); break; case "spacing": - if (elem.localName == "pPr") this.parseSpacing(c$7, style); + if (elem.localName == "pPr") this.parseSpacing(c$6, style); break; case "wordWrap": - if (globalXmlParser.boolAttr(c$7, "val")) style["overflow-wrap"] = "break-word"; + if (globalXmlParser.boolAttr(c$6, "val")) style["overflow-wrap"] = "break-word"; break; case "suppressAutoHyphens": - style["hyphens"] = globalXmlParser.boolAttr(c$7, "val", true) ? "none" : "auto"; + style["hyphens"] = globalXmlParser.boolAttr(c$6, "val", true) ? "none" : "auto"; break; case "lang": - style["$lang"] = globalXmlParser.attr(c$7, "val"); + style["$lang"] = globalXmlParser.attr(c$6, "val"); break; case "rtl": case "bidi": - if (globalXmlParser.boolAttr(c$7, "val", true)) style["direction"] = "rtl"; + if (globalXmlParser.boolAttr(c$6, "val", true)) style["direction"] = "rtl"; break; case "bCs": case "iCs": @@ -41340,7 +41544,7 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { case "rtl": case "noProof": break; default: - if (this.options.debug) console.warn(`DOCX: Unknown document element: ${elem.localName}.${c$7.localName}`); + if (this.options.debug) console.warn(`DOCX: Unknown document element: ${elem.localName}.${c$6.localName}`); break; } } @@ -41431,19 +41635,19 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } parseMarginProperties(node, output) { - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "left": - output["padding-left"] = values.valueOfMargin(c$7); + output["padding-left"] = values.valueOfMargin(c$6); break; case "right": - output["padding-right"] = values.valueOfMargin(c$7); + output["padding-right"] = values.valueOfMargin(c$6); break; case "top": - output["padding-top"] = values.valueOfMargin(c$7); + output["padding-top"] = values.valueOfMargin(c$6); break; case "bottom": - output["padding-bottom"] = values.valueOfMargin(c$7); + output["padding-bottom"] = values.valueOfMargin(c$6); break; } } @@ -41460,21 +41664,21 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } parseBorderProperties(node, output) { - for (const c$7 of globalXmlParser.elements(node)) { - switch (c$7.localName) { + for (const c$6 of globalXmlParser.elements(node)) { + switch (c$6.localName) { case "start": case "left": - output["border-left"] = values.valueOfBorder(c$7); + output["border-left"] = values.valueOfBorder(c$6); break; case "end": case "right": - output["border-right"] = values.valueOfBorder(c$7); + output["border-right"] = values.valueOfBorder(c$6); break; case "top": - output["border-top"] = values.valueOfBorder(c$7); + output["border-top"] = values.valueOfBorder(c$6); break; case "bottom": - output["border-bottom"] = values.valueOfBorder(c$7); + output["border-bottom"] = values.valueOfBorder(c$6); break; } } @@ -41515,29 +41719,29 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } class values { - static themeValue(c$7, attr) { - var val$1 = globalXmlParser.attr(c$7, attr); + static themeValue(c$6, attr) { + var val$1 = globalXmlParser.attr(c$6, attr); return val$1 ? `var(--docx-${val$1}-font)` : null; } - static valueOfSize(c$7, attr) { + static valueOfSize(c$6, attr) { var type = LengthUsage.Dxa; - switch (globalXmlParser.attr(c$7, "type")) { + switch (globalXmlParser.attr(c$6, "type")) { case "dxa": break; case "pct": type = LengthUsage.Percent; break; case "auto": return "auto"; } - return globalXmlParser.lengthAttr(c$7, attr, type); + return globalXmlParser.lengthAttr(c$6, attr, type); } - static valueOfMargin(c$7) { - return globalXmlParser.lengthAttr(c$7, "w"); + static valueOfMargin(c$6) { + return globalXmlParser.lengthAttr(c$6, "w"); } - static valueOfBorder(c$7) { - var type = values.parseBorderType(globalXmlParser.attr(c$7, "val")); + static valueOfBorder(c$6) { + var type = values.parseBorderType(globalXmlParser.attr(c$6, "val")); if (type == "none") return "none"; - var color = xmlUtil.colorAttr(c$7, "color"); - var size = globalXmlParser.lengthAttr(c$7, "sz", LengthUsage.Border); + var color = xmlUtil.colorAttr(c$6, "color"); + var size = globalXmlParser.lengthAttr(c$6, "sz", LengthUsage.Border); return `${size} ${type} ${color == "auto" ? autos.borderColor : color}`; } static parseBorderType(type) { @@ -41572,12 +41776,12 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } return "solid"; } - static valueOfTblLayout(c$7) { - var type = globalXmlParser.attr(c$7, "val"); + static valueOfTblLayout(c$6) { + var type = globalXmlParser.attr(c$6, "val"); return type == "fixed" ? "fixed" : "auto"; } - static classNameOfCnfStyle(c$7) { - const val$1 = globalXmlParser.attr(c$7, "val"); + static classNameOfCnfStyle(c$6) { + const val$1 = globalXmlParser.attr(c$6, "val"); const classes = [ "first-row", "last-row", @@ -41594,8 +41798,8 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; return classes.filter((_$2, i$7) => val$1[i$7] == "1").join(" "); } - static valueOfJc(c$7) { - var type = globalXmlParser.attr(c$7, "val"); + static valueOfJc(c$6) { + var type = globalXmlParser.attr(c$6, "val"); switch (type) { case "start": case "left": return "left"; @@ -41606,16 +41810,16 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } return type; } - static valueOfVertAlign(c$7, asTagName = false) { - var type = globalXmlParser.attr(c$7, "val"); + static valueOfVertAlign(c$6, asTagName = false) { + var type = globalXmlParser.attr(c$6, "val"); switch (type) { case "subscript": return "sub"; case "superscript": return asTagName ? "sup" : "super"; } return asTagName ? null : type; } - static valueOfTextAlignment(c$7) { - var type = globalXmlParser.attr(c$7, "val"); + static valueOfTextAlignment(c$6) { + var type = globalXmlParser.attr(c$6, "val"); switch (type) { case "auto": case "baseline": return "baseline"; @@ -41630,15 +41834,15 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (b$3 == null) return a$2; return `calc(${a$2} + ${b$3})`; } - static classNameOftblLook(c$7) { - const val$1 = globalXmlParser.hexAttr(c$7, "val", 0); + static classNameOftblLook(c$6) { + const val$1 = globalXmlParser.hexAttr(c$6, "val", 0); let className = ""; - if (globalXmlParser.boolAttr(c$7, "firstRow") || val$1 & 32) className += " first-row"; - if (globalXmlParser.boolAttr(c$7, "lastRow") || val$1 & 64) className += " last-row"; - if (globalXmlParser.boolAttr(c$7, "firstColumn") || val$1 & 128) className += " first-col"; - if (globalXmlParser.boolAttr(c$7, "lastColumn") || val$1 & 256) className += " last-col"; - if (globalXmlParser.boolAttr(c$7, "noHBand") || val$1 & 512) className += " no-hband"; - if (globalXmlParser.boolAttr(c$7, "noVBand") || val$1 & 1024) className += " no-vband"; + if (globalXmlParser.boolAttr(c$6, "firstRow") || val$1 & 32) className += " first-row"; + if (globalXmlParser.boolAttr(c$6, "lastRow") || val$1 & 64) className += " last-row"; + if (globalXmlParser.boolAttr(c$6, "firstColumn") || val$1 & 128) className += " first-col"; + if (globalXmlParser.boolAttr(c$6, "lastColumn") || val$1 & 256) className += " last-col"; + if (globalXmlParser.boolAttr(c$6, "noHBand") || val$1 & 512) className += " no-hband"; + if (globalXmlParser.boolAttr(c$6, "noVBand") || val$1 & 1024) className += " no-vband"; return className.trim(); } } @@ -41885,9 +42089,9 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { } } processTable(table) { - for (var r$10 of table.children) { - for (var c$7 of r$10.children) { - c$7.cssStyle = this.copyStyleProperties(table.cellStyle, c$7.cssStyle, [ + for (var r$9 of table.children) { + for (var c$6 of r$9.children) { + c$6.cssStyle = this.copyStyleProperties(table.cellStyle, c$6.cssStyle, [ "border-left", "border-right", "border-top", @@ -41897,7 +42101,7 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { "padding-top", "padding-bottom" ]); - this.processElement(c$7); + this.processElement(c$6); } } } @@ -42029,8 +42233,8 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { var pBreakIndex = -1; var rBreakIndex = -1; if (this.options.breakPages && p$3.children) { - pBreakIndex = p$3.children.findIndex((r$10) => { - rBreakIndex = r$10.children?.findIndex(this.isPageBreakElement.bind(this)) ?? -1; + pBreakIndex = p$3.children.findIndex((r$9) => { + rBreakIndex = r$9.children?.findIndex(this.isPageBreakElement.bind(this)) ?? -1; return rBreakIndex != -1; }); } @@ -42093,31 +42297,31 @@ var require_docx_preview = /* @__PURE__ */ __commonJSMin(((exports, module) => { return this.createElement("div", { className: `${this.className}-wrapper` }, children); } renderDefaultStyle() { - var c$7 = this.className; + var c$6 = this.className; var wrapperStyle = ` -.${c$7}-wrapper { background: gray; padding: 30px; padding-bottom: 0px; display: flex; flex-flow: column; align-items: center; } -.${c$7}-wrapper>section.${c$7} { background: white; box-shadow: 0 0 10px rgba(0, 0, 0, 0.5); margin-bottom: 30px; }`; +.${c$6}-wrapper { background: gray; padding: 30px; padding-bottom: 0px; display: flex; flex-flow: column; align-items: center; } +.${c$6}-wrapper>section.${c$6} { background: white; box-shadow: 0 0 10px rgba(0, 0, 0, 0.5); margin-bottom: 30px; }`; if (this.options.hideWrapperOnPrint) { wrapperStyle = `@media not print { ${wrapperStyle} }`; } var styleText = `${wrapperStyle} -.${c$7} { color: black; hyphens: auto; text-underline-position: from-font; } -section.${c$7} { box-sizing: border-box; display: flex; flex-flow: column nowrap; position: relative; overflow: hidden; } -section.${c$7}>article { margin-bottom: auto; z-index: 1; } -section.${c$7}>footer { z-index: 1; } -.${c$7} table { border-collapse: collapse; } -.${c$7} table td, .${c$7} table th { vertical-align: top; } -.${c$7} p { margin: 0pt; min-height: 1em; } -.${c$7} span { white-space: pre-wrap; overflow-wrap: break-word; } -.${c$7} a { color: inherit; text-decoration: inherit; } -.${c$7} svg { fill: transparent; } +.${c$6} { color: black; hyphens: auto; text-underline-position: from-font; } +section.${c$6} { box-sizing: border-box; display: flex; flex-flow: column nowrap; position: relative; overflow: hidden; } +section.${c$6}>article { margin-bottom: auto; z-index: 1; } +section.${c$6}>footer { z-index: 1; } +.${c$6} table { border-collapse: collapse; } +.${c$6} table td, .${c$6} table th { vertical-align: top; } +.${c$6} p { margin: 0pt; min-height: 1em; } +.${c$6} span { white-space: pre-wrap; overflow-wrap: break-word; } +.${c$6} a { color: inherit; text-decoration: inherit; } +.${c$6} svg { fill: transparent; } `; if (this.options.renderComments) { styleText += ` -.${c$7}-comment-ref { cursor: default; } -.${c$7}-comment-popover { display: none; z-index: 1000; padding: 0.5rem; background: white; position: absolute; box-shadow: 0 0 0.25rem rgba(0, 0, 0, 0.25); width: 30ch; } -.${c$7}-comment-ref:hover~.${c$7}-comment-popover { display: block; } -.${c$7}-comment-author,.${c$7}-comment-date { font-size: 0.875rem; color: #888; } +.${c$6}-comment-ref { cursor: default; } +.${c$6}-comment-popover { display: none; z-index: 1000; padding: 0.5rem; background: white; position: absolute; box-shadow: 0 0 0.25rem rgba(0, 0, 0, 0.25); width: 30ch; } +.${c$6}-comment-ref:hover~.${c$6}-comment-popover { display: block; } +.${c$6}-comment-author,.${c$6}-comment-date { font-size: 0.875rem; color: #888; } `; } return this.createStyleElement(styleText); @@ -42748,7 +42952,7 @@ section.${c$7}>footer { z-index: 1; } elem.innerHTML = ""; } function appendChildren(elem, children) { - children.forEach((c$7) => elem.appendChild(isString(c$7) ? document.createTextNode(c$7) : c$7)); + children.forEach((c$6) => elem.appendChild(isString(c$6) ? document.createTextNode(c$6) : c$6)); } function findParent(elem, type) { var parent = elem.parent; @@ -42818,7 +43022,7 @@ function info(msg) { console.info(`Info: ${msg}`); } } -function warn$2(msg) { +function warn(msg) { if (verbosity >= VerbosityLevel.WARNINGS) { console.warn(`Warning: ${msg}`); } @@ -42955,7 +43159,7 @@ function stringToPDFString(str, keepEscapeSequence = false) { } return decoded.replaceAll(/\x1b[^\x1b]*(?:\x1b|$)/g, ""); } catch (ex) { - warn$2(`stringToPDFString: "${ex}".`); + warn(`stringToPDFString: "${ex}".`); } } } @@ -43140,7 +43344,7 @@ function getPdfFilenameFromUrl(url, defaultFilename = "document.pdf") { return defaultFilename; } if (isDataScheme(url)) { - warn$2("getPdfFilenameFromUrl: ignore \"data:\"-URL for performance reasons."); + warn("getPdfFilenameFromUrl: ignore \"data:\"-URL for performance reasons."); return defaultFilename; } const getURL = (urlString) => { @@ -43220,7 +43424,7 @@ function stopEvent(e$10) { e$10.preventDefault(); e$10.stopPropagation(); } -function deprecated$2(details) { +function deprecated(details) { console.log("Deprecated API usage: " + details); } function getXfaPageViewport(xfaPage, { scale = 1, rotation = 0 }) { @@ -43253,7 +43457,7 @@ function getRGB(color) { if (color.startsWith("rgba(")) { return color.slice(5, -1).split(",").map((x$2) => parseInt(x$2)).slice(0, 3); } - warn$2(`Not a valid color format: "${color}"`); + warn(`Not a valid color format: "${color}"`); return [ 0, 0, @@ -43273,23 +43477,23 @@ function getColorValues(colors) { span.remove(); } function getCurrentTransform(ctx) { - const { a: a$2, b: b$3, c: c$7, d: d$5, e: e$10, f: f$4 } = ctx.getTransform(); + const { a: a$2, b: b$3, c: c$6, d: d$4, e: e$10, f: f$4 } = ctx.getTransform(); return [ a$2, b$3, - c$7, - d$5, + c$6, + d$4, e$10, f$4 ]; } function getCurrentTransformInverse(ctx) { - const { a: a$2, b: b$3, c: c$7, d: d$5, e: e$10, f: f$4 } = ctx.getTransform().invertSelf(); + const { a: a$2, b: b$3, c: c$6, d: d$4, e: e$10, f: f$4 } = ctx.getTransform().invertSelf(); return [ a$2, b$3, - c$7, - d$5, + c$6, + d$4, e$10, f$4 ]; @@ -43313,39 +43517,39 @@ function setLayerDimensions(div, viewport, mustFlip = false, mustRotate = true) div.setAttribute("data-main-rotation", viewport.rotation); } } -function applyOpacity(r$10, g$1, b$3, opacity) { +function applyOpacity(r$9, g$1, b$3, opacity) { opacity = Math.min(Math.max(opacity ?? 1, 0), 1); const white = 255 * (1 - opacity); - r$10 = Math.round(r$10 * opacity + white); + r$9 = Math.round(r$9 * opacity + white); g$1 = Math.round(g$1 * opacity + white); b$3 = Math.round(b$3 * opacity + white); return [ - r$10, + r$9, g$1, b$3 ]; } function RGBToHSL(rgb, output) { - const r$10 = rgb[0] / 255; + const r$9 = rgb[0] / 255; const g$1 = rgb[1] / 255; const b$3 = rgb[2] / 255; - const max = Math.max(r$10, g$1, b$3); - const min = Math.min(r$10, g$1, b$3); + const max = Math.max(r$9, g$1, b$3); + const min = Math.min(r$9, g$1, b$3); const l$3 = (max + min) / 2; if (max === min) { output[0] = output[1] = 0; } else { - const d$5 = max - min; - output[1] = l$3 < .5 ? d$5 / (max + min) : d$5 / (2 - max - min); + const d$4 = max - min; + output[1] = l$3 < .5 ? d$4 / (max + min) : d$4 / (2 - max - min); switch (max) { - case r$10: - output[0] = ((g$1 - b$3) / d$5 + (g$1 < b$3 ? 6 : 0)) * 60; + case r$9: + output[0] = ((g$1 - b$3) / d$4 + (g$1 < b$3 ? 6 : 0)) * 60; break; case g$1: - output[0] = ((b$3 - r$10) / d$5 + 2) * 60; + output[0] = ((b$3 - r$9) / d$4 + 2) * 60; break; case b$3: - output[0] = ((r$10 - g$1) / d$5 + 4) * 60; + output[0] = ((r$9 - g$1) / d$4 + 4) * 60; break; } } @@ -43355,38 +43559,38 @@ function HSLToRGB(hsl, output) { const h$5 = hsl[0]; const s$5 = hsl[1]; const l$3 = hsl[2]; - const c$7 = (1 - Math.abs(2 * l$3 - 1)) * s$5; - const x$2 = c$7 * (1 - Math.abs(h$5 / 60 % 2 - 1)); - const m$3 = l$3 - c$7 / 2; + const c$6 = (1 - Math.abs(2 * l$3 - 1)) * s$5; + const x$2 = c$6 * (1 - Math.abs(h$5 / 60 % 2 - 1)); + const m$3 = l$3 - c$6 / 2; switch (Math.floor(h$5 / 60)) { case 0: - output[0] = c$7 + m$3; + output[0] = c$6 + m$3; output[1] = x$2 + m$3; output[2] = m$3; break; case 1: output[0] = x$2 + m$3; - output[1] = c$7 + m$3; + output[1] = c$6 + m$3; output[2] = m$3; break; case 2: output[0] = m$3; - output[1] = c$7 + m$3; + output[1] = c$6 + m$3; output[2] = x$2 + m$3; break; case 3: output[0] = m$3; output[1] = x$2 + m$3; - output[2] = c$7 + m$3; + output[2] = c$6 + m$3; break; case 4: output[0] = x$2 + m$3; output[1] = m$3; - output[2] = c$7 + m$3; + output[2] = c$6 + m$3; break; case 5: case 6: - output[0] = c$7 + m$3; + output[0] = c$6 + m$3; output[1] = m$3; output[2] = x$2 + m$3; break; @@ -43491,7 +43695,7 @@ function makePathFromDrawOPS(data) { path$1.closePath(); break; default: - warn$2(`Unrecognized drawing path operator: ${data[i$7 - 1]}`); + warn(`Unrecognized drawing path operator: ${data[i$7 - 1]}`); break; } } @@ -43682,10 +43886,10 @@ function drawFigure(data, figure, context) { const rows = Math.floor(ps.length / verticesPerRow) - 1; const cols = verticesPerRow - 1; for (i$7 = 0; i$7 < rows; i$7++) { - let q$2 = i$7 * verticesPerRow; - for (let j$2 = 0; j$2 < cols; j$2++, q$2++) { - drawTriangle(data, context, ps[q$2], ps[q$2 + 1], ps[q$2 + verticesPerRow], cs[q$2], cs[q$2 + 1], cs[q$2 + verticesPerRow]); - drawTriangle(data, context, ps[q$2 + verticesPerRow + 1], ps[q$2 + 1], ps[q$2 + verticesPerRow], cs[q$2 + verticesPerRow + 1], cs[q$2 + 1], cs[q$2 + verticesPerRow]); + let q$1 = i$7 * verticesPerRow; + for (let j$2 = 0; j$2 < cols; j$2++, q$1++) { + drawTriangle(data, context, ps[q$1], ps[q$1 + 1], ps[q$1 + verticesPerRow], cs[q$1], cs[q$1 + 1], cs[q$1 + verticesPerRow]); + drawTriangle(data, context, ps[q$1 + verticesPerRow + 1], ps[q$1 + 1], ps[q$1 + verticesPerRow], cs[q$1 + verticesPerRow + 1], cs[q$1 + 1], cs[q$1 + verticesPerRow]); } } break; @@ -43846,13 +44050,13 @@ function mirrorContextOperations(ctx, destCtx) { destCtx.scale(x$2, y$3); this.__originalScale(x$2, y$3); }; - ctx.transform = function(a$2, b$3, c$7, d$5, e$10, f$4) { - destCtx.transform(a$2, b$3, c$7, d$5, e$10, f$4); - this.__originalTransform(a$2, b$3, c$7, d$5, e$10, f$4); + ctx.transform = function(a$2, b$3, c$6, d$4, e$10, f$4) { + destCtx.transform(a$2, b$3, c$6, d$4, e$10, f$4); + this.__originalTransform(a$2, b$3, c$6, d$4, e$10, f$4); }; - ctx.setTransform = function(a$2, b$3, c$7, d$5, e$10, f$4) { - destCtx.setTransform(a$2, b$3, c$7, d$5, e$10, f$4); - this.__originalSetTransform(a$2, b$3, c$7, d$5, e$10, f$4); + ctx.setTransform = function(a$2, b$3, c$6, d$4, e$10, f$4) { + destCtx.setTransform(a$2, b$3, c$6, d$4, e$10, f$4); + this.__originalSetTransform(a$2, b$3, c$6, d$4, e$10, f$4); }; ctx.resetTransform = function() { destCtx.resetTransform(); @@ -43892,38 +44096,38 @@ function mirrorContextOperations(ctx, destCtx) { }; } function drawImageAtIntegerCoords(ctx, srcImg, srcX, srcY, srcW, srcH, destX, destY, destW, destH) { - const [a$2, b$3, c$7, d$5, tx, ty] = getCurrentTransform(ctx); - if (b$3 === 0 && c$7 === 0) { + const [a$2, b$3, c$6, d$4, tx, ty] = getCurrentTransform(ctx); + if (b$3 === 0 && c$6 === 0) { const tlX = destX * a$2 + tx; const rTlX = Math.round(tlX); - const tlY = destY * d$5 + ty; + const tlY = destY * d$4 + ty; const rTlY = Math.round(tlY); const brX = (destX + destW) * a$2 + tx; const rWidth = Math.abs(Math.round(brX) - rTlX) || 1; - const brY = (destY + destH) * d$5 + ty; + const brY = (destY + destH) * d$4 + ty; const rHeight = Math.abs(Math.round(brY) - rTlY) || 1; - ctx.setTransform(Math.sign(a$2), 0, 0, Math.sign(d$5), rTlX, rTlY); + ctx.setTransform(Math.sign(a$2), 0, 0, Math.sign(d$4), rTlX, rTlY); ctx.drawImage(srcImg, srcX, srcY, srcW, srcH, 0, 0, rWidth, rHeight); - ctx.setTransform(a$2, b$3, c$7, d$5, tx, ty); + ctx.setTransform(a$2, b$3, c$6, d$4, tx, ty); return [rWidth, rHeight]; } - if (a$2 === 0 && d$5 === 0) { - const tlX = destY * c$7 + tx; + if (a$2 === 0 && d$4 === 0) { + const tlX = destY * c$6 + tx; const rTlX = Math.round(tlX); const tlY = destX * b$3 + ty; const rTlY = Math.round(tlY); - const brX = (destY + destH) * c$7 + tx; + const brX = (destY + destH) * c$6 + tx; const rWidth = Math.abs(Math.round(brX) - rTlX) || 1; const brY = (destX + destW) * b$3 + ty; const rHeight = Math.abs(Math.round(brY) - rTlY) || 1; - ctx.setTransform(0, Math.sign(b$3), Math.sign(c$7), 0, rTlX, rTlY); + ctx.setTransform(0, Math.sign(b$3), Math.sign(c$6), 0, rTlX, rTlY); ctx.drawImage(srcImg, srcX, srcY, srcW, srcH, 0, 0, rHeight, rWidth); - ctx.setTransform(a$2, b$3, c$7, d$5, tx, ty); + ctx.setTransform(a$2, b$3, c$6, d$4, tx, ty); return [rHeight, rWidth]; } ctx.drawImage(srcImg, srcX, srcY, srcW, srcH, destX, destY, destW, destH); const scaleX = Math.hypot(a$2, b$3); - const scaleY = Math.hypot(c$7, d$5); + const scaleY = Math.hypot(c$6, d$4); return [scaleX * destW, scaleY * destH]; } function putBinaryImageData(ctx, imgData) { @@ -44044,7 +44248,7 @@ function putBinaryImageMask(ctx, imgData) { } } function copyCtxState(sourceCtx, destCtx) { - const properties$1 = [ + const properties = [ "strokeStyle", "fillStyle", "fillRule", @@ -44057,7 +44261,7 @@ function copyCtxState(sourceCtx, destCtx) { "font", "filter" ]; - for (const property of properties$1) { + for (const property of properties) { if (sourceCtx[property] !== undefined) { destCtx[property] = sourceCtx[property]; } @@ -44300,7 +44504,7 @@ function getArrayBuffer(val$1) { if (val$1 instanceof ArrayBuffer) { return val$1; } - warn$2(`getArrayBuffer - unexpected data format: ${val$1}`); + warn(`getArrayBuffer - unexpected data format: ${val$1}`); return new Uint8Array(val$1).buffer; } function network_getArrayBuffer(xhr) { @@ -44476,7 +44680,7 @@ function makeColorComp(n$9) { function scaleAndClamp(x$2) { return Math.max(0, Math.min(255, 255 * x$2)); } -var __webpack_require__, __webpack_exports__, isNodeJS, FONT_IDENTITY_MATRIX, LINE_FACTOR, LINE_DESCENT_FACTOR, BASELINE_FACTOR, RenderingIntentFlag, AnnotationMode, AnnotationEditorPrefix, AnnotationEditorType, AnnotationEditorParamsType, PermissionFlag, MeshFigureType, TextRenderingMode, util_ImageKind, AnnotationType, AnnotationReplyType, AnnotationFlag, AnnotationFieldFlag, AnnotationBorderStyleType, AnnotationActionEventType, DocumentActionEventType, PageActionEventType, VerbosityLevel, OPS, DrawOPS, PasswordResponses, verbosity, BaseException, PasswordException, UnknownErrorException, InvalidPDFException, ResponseException, FormatError, AbortException, util_FeatureTest, hexNumbers, Util, PDFStringTranslateTable, NormalizeRegex, NormalizationMap, AnnotationPrefix, XfaText, XfaLayer, SVG_NS, PixelsPerInch, PageViewport, RenderingCancelledException, StatTimer, PDFDateString, OutputScale, SupportedImageMimeTypes, ColorScheme, CSSConstants, contrastCache, EditorToolbar, FloatingToolbar, CurrentPointers, IdManager, ImageManager, CommandManager, KeyboardManager, ColorManager, AnnotationEditorUIManager, AltText, Comment, TouchManager, AnnotationEditor, FakeEditor, SEED, MASK_HIGH, MASK_LOW, MurmurHash3_64, SerializableEmpty, AnnotationStorage, PrintAnnotationStorage, FontLoader, FontFaceObject, CssFontInfo, SystemFontInfo, FontInfo, PatternInfo, isRefProxy, isNameProxy, isValidExplicitDest, LoopbackPort, CallbackKind, StreamKind, MessageHandler, BaseCanvasFactory, DOMCanvasFactory, BaseCMapReaderFactory, DOMCMapReaderFactory, BaseFilterFactory, DOMFilterFactory, BaseStandardFontDataFactory, DOMStandardFontDataFactory, BaseWasmFactory, DOMWasmFactory, NodeFilterFactory, NodeCanvasFactory, NodeCMapReaderFactory, NodeStandardFontDataFactory, NodeWasmFactory, FORCED_DEPENDENCY_LABEL, floor, ceil, EMPTY_BBOX, BBoxReader, ensureDebugMetadata, CanvasDependencyTracker, CanvasNestedDependencyTracker, Dependencies, PathType, BaseShadingPattern, RadialAxialShadingPattern, MeshShadingPattern, DummyShadingPattern, PaintType, TilingPattern, MIN_FONT_SIZE, MAX_FONT_SIZE, EXECUTION_TIME, EXECUTION_STEPS, FULL_CHUNK_HEIGHT, SCALE_MATRIX, XY, MIN_MAX_INIT, CachedCanvases, CanvasExtraState, LINE_CAP_STYLES, LINE_JOIN_STYLES, NORMAL_CLIP, EO_CLIP, CanvasGraphics, GlobalWorkerOptions, Metadata, INTERNAL, OptionalContentGroup, OptionalContentConfig, PDFDataTransportStream, PDFDataTransportStreamReader, PDFDataTransportStreamRangeReader, PDFFetchStream, PDFFetchStreamReader, PDFFetchStreamRangeReader, OK_RESPONSE, PARTIAL_CONTENT_RESPONSE, NetworkManager, PDFNetworkStream, PDFNetworkStreamFullRequestReader, PDFNetworkStreamRangeRequestReader, urlRegex, PDFNodeStream, PDFNodeStreamFsFullReader, PDFNodeStreamFsRangeReader, INITIAL_DATA, PDFObjects, MAX_TEXT_DIVS_TO_RENDER, DEFAULT_FONT_SIZE, TextLayer, RENDERING_CANCELLED_TIMEOUT, PDFDocumentLoadingTask, PDFDataRangeTransport, PDFDocumentProxy, PDFPageProxy, PDFWorker, WorkerTransport, RenderTask, InternalRenderTask, version$4, build, ColorPicker, BasicColorPicker, ColorConverters, DateFormats, TimeFormats, BaseSVGFactory, DOMSVGFactory, annotation_layer_DEFAULT_FONT_SIZE, GetElementsByNameSet, TIMEZONE_OFFSET, AnnotationElementFactory, AnnotationElement, EditorAnnotationElement, LinkAnnotationElement, TextAnnotationElement, WidgetAnnotationElement, TextWidgetAnnotationElement, SignatureWidgetAnnotationElement, CheckboxWidgetAnnotationElement, RadioButtonWidgetAnnotationElement, PushButtonWidgetAnnotationElement, ChoiceWidgetAnnotationElement, PopupAnnotationElement, PopupElement, FreeTextAnnotationElement, LineAnnotationElement, SquareAnnotationElement, CircleAnnotationElement, PolylineAnnotationElement, PolygonAnnotationElement, CaretAnnotationElement, InkAnnotationElement, HighlightAnnotationElement, UnderlineAnnotationElement, SquigglyAnnotationElement, StrikeOutAnnotationElement, StampAnnotationElement, FileAttachmentAnnotationElement, AnnotationLayer, EOL_PATTERN, FreeTextEditor, Outline, FreeDrawOutliner, FreeDrawOutline, HighlightOutliner, HighlightOutline, FreeHighlightOutliner, FreeHighlightOutline, HighlightEditor, DrawingOptions, DrawingEditor, InkDrawOutliner, InkDrawOutline, InkDrawingOptions, InkEditor, ContourDrawOutline, BASE_HEADER_LENGTH, POINTS_PROPERTIES_NUMBER, SignatureExtractor, SignatureOptions, DrawnSignatureOptions, SignatureEditor, StampEditor, AnnotationEditorLayer, DrawLayer; +var __webpack_require__, __webpack_exports__, isNodeJS, FONT_IDENTITY_MATRIX, LINE_FACTOR, LINE_DESCENT_FACTOR, BASELINE_FACTOR, RenderingIntentFlag, AnnotationMode, AnnotationEditorPrefix, AnnotationEditorType, AnnotationEditorParamsType, PermissionFlag, MeshFigureType, TextRenderingMode, util_ImageKind, AnnotationType, AnnotationReplyType, AnnotationFlag, AnnotationFieldFlag, AnnotationBorderStyleType, AnnotationActionEventType, DocumentActionEventType, PageActionEventType, VerbosityLevel, OPS, DrawOPS, PasswordResponses, verbosity, BaseException, PasswordException, UnknownErrorException, InvalidPDFException, ResponseException, FormatError, AbortException, util_FeatureTest, hexNumbers, Util, PDFStringTranslateTable, NormalizeRegex, NormalizationMap, AnnotationPrefix, XfaText, XfaLayer, SVG_NS, PixelsPerInch, PageViewport, RenderingCancelledException, StatTimer, PDFDateString, OutputScale, SupportedImageMimeTypes, ColorScheme, CSSConstants, contrastCache, EditorToolbar, FloatingToolbar, CurrentPointers, IdManager, ImageManager, CommandManager, KeyboardManager, ColorManager, AnnotationEditorUIManager, AltText, Comment, TouchManager, AnnotationEditor, FakeEditor, SEED, MASK_HIGH, MASK_LOW, MurmurHash3_64, SerializableEmpty, AnnotationStorage, PrintAnnotationStorage, FontLoader, FontFaceObject, CssFontInfo, SystemFontInfo, FontInfo, PatternInfo, isRefProxy, isNameProxy, isValidExplicitDest, LoopbackPort, CallbackKind, StreamKind, MessageHandler, BaseCanvasFactory, DOMCanvasFactory, BaseCMapReaderFactory, DOMCMapReaderFactory, BaseFilterFactory, DOMFilterFactory, BaseStandardFontDataFactory, DOMStandardFontDataFactory, BaseWasmFactory, DOMWasmFactory, NodeFilterFactory, NodeCanvasFactory, NodeCMapReaderFactory, NodeStandardFontDataFactory, NodeWasmFactory, FORCED_DEPENDENCY_LABEL, floor, ceil, EMPTY_BBOX, BBoxReader, ensureDebugMetadata, CanvasDependencyTracker, CanvasNestedDependencyTracker, Dependencies, PathType, BaseShadingPattern, RadialAxialShadingPattern, MeshShadingPattern, DummyShadingPattern, PaintType, TilingPattern, MIN_FONT_SIZE, MAX_FONT_SIZE, EXECUTION_TIME, EXECUTION_STEPS, FULL_CHUNK_HEIGHT, SCALE_MATRIX, XY, MIN_MAX_INIT, CachedCanvases, CanvasExtraState, LINE_CAP_STYLES, LINE_JOIN_STYLES, NORMAL_CLIP, EO_CLIP, CanvasGraphics, GlobalWorkerOptions, Metadata, INTERNAL, OptionalContentGroup, OptionalContentConfig, PDFDataTransportStream, PDFDataTransportStreamReader, PDFDataTransportStreamRangeReader, PDFFetchStream, PDFFetchStreamReader, PDFFetchStreamRangeReader, OK_RESPONSE, PARTIAL_CONTENT_RESPONSE, NetworkManager, PDFNetworkStream, PDFNetworkStreamFullRequestReader, PDFNetworkStreamRangeRequestReader, urlRegex, PDFNodeStream, PDFNodeStreamFsFullReader, PDFNodeStreamFsRangeReader, INITIAL_DATA, PDFObjects, MAX_TEXT_DIVS_TO_RENDER, DEFAULT_FONT_SIZE, TextLayer, RENDERING_CANCELLED_TIMEOUT, PDFDocumentLoadingTask, PDFDataRangeTransport, PDFDocumentProxy, PDFPageProxy, PDFWorker, WorkerTransport, RenderTask, InternalRenderTask, version$2, build, ColorPicker, BasicColorPicker, ColorConverters, DateFormats, TimeFormats, BaseSVGFactory, DOMSVGFactory, annotation_layer_DEFAULT_FONT_SIZE, GetElementsByNameSet, TIMEZONE_OFFSET, AnnotationElementFactory, AnnotationElement, EditorAnnotationElement, LinkAnnotationElement, TextAnnotationElement, WidgetAnnotationElement, TextWidgetAnnotationElement, SignatureWidgetAnnotationElement, CheckboxWidgetAnnotationElement, RadioButtonWidgetAnnotationElement, PushButtonWidgetAnnotationElement, ChoiceWidgetAnnotationElement, PopupAnnotationElement, PopupElement, FreeTextAnnotationElement, LineAnnotationElement, SquareAnnotationElement, CircleAnnotationElement, PolylineAnnotationElement, PolygonAnnotationElement, CaretAnnotationElement, InkAnnotationElement, HighlightAnnotationElement, UnderlineAnnotationElement, SquigglyAnnotationElement, StrikeOutAnnotationElement, StampAnnotationElement, FileAttachmentAnnotationElement, AnnotationLayer, EOL_PATTERN, FreeTextEditor, Outline, FreeDrawOutliner, FreeDrawOutline, HighlightOutliner, HighlightOutline, FreeHighlightOutliner, FreeHighlightOutline, HighlightEditor, DrawingOptions, DrawingEditor, InkDrawOutliner, InkDrawOutline, InkDrawingOptions, InkEditor, ContourDrawOutline, BASE_HEADER_LENGTH, POINTS_PROPERTIES_NUMBER, SignatureExtractor, SignatureOptions, DrawnSignatureOptions, SignatureEditor, StampEditor, AnnotationEditorLayer, DrawLayer; var init_pdf = __esmMin((() => { __webpack_require__ = {}; (() => { @@ -44871,8 +45075,8 @@ var init_pdf = __esmMin((() => { }; hexNumbers = Array.from(Array(256).keys(), (n$9) => n$9.toString(16).padStart(2, "0")); Util = class { - static makeHexColor(r$10, g$1, b$3) { - return `#${hexNumbers[r$10]}${hexNumbers[g$1]}${hexNumbers[b$3]}`; + static makeHexColor(r$9, g$1, b$3) { + return `#${hexNumbers[r$9]}${hexNumbers[g$1]}${hexNumbers[b$3]}`; } static domMatrixToTransform(dm) { return [ @@ -44971,9 +45175,9 @@ var init_pdf = __esmMin((() => { static applyInverseTransform(p$3, m$3) { const p0 = p$3[0]; const p1 = p$3[1]; - const d$5 = m$3[0] * m$3[3] - m$3[1] * m$3[2]; - p$3[0] = (p0 * m$3[3] - p1 * m$3[2] + m$3[2] * m$3[5] - m$3[4] * m$3[3]) / d$5; - p$3[1] = (-p0 * m$3[1] + p1 * m$3[0] + m$3[4] * m$3[1] - m$3[5] * m$3[0]) / d$5; + const d$4 = m$3[0] * m$3[3] - m$3[1] * m$3[2]; + p$3[0] = (p0 * m$3[3] - p1 * m$3[2] + m$3[2] * m$3[5] - m$3[4] * m$3[3]) / d$4; + p$3[1] = (-p0 * m$3[1] + p1 * m$3[0] + m$3[4] * m$3[1] - m$3[5] * m$3[0]) / d$4; } static axialAlignedBoundingBox(rect, transform, output) { const m0 = transform[0]; @@ -45014,14 +45218,14 @@ var init_pdf = __esmMin((() => { output[3] = Math.max(output[3], b0, b1, b2, b3); } static inverseTransform(m$3) { - const d$5 = m$3[0] * m$3[3] - m$3[1] * m$3[2]; + const d$4 = m$3[0] * m$3[3] - m$3[1] * m$3[2]; return [ - m$3[3] / d$5, - -m$3[1] / d$5, - -m$3[2] / d$5, - m$3[0] / d$5, - (m$3[2] * m$3[5] - m$3[4] * m$3[3]) / d$5, - (m$3[4] * m$3[1] - m$3[5] * m$3[0]) / d$5 + m$3[3] / d$4, + -m$3[1] / d$4, + -m$3[2] / d$4, + m$3[0] / d$4, + (m$3[2] * m$3[5] - m$3[4] * m$3[3]) / d$4, + (m$3[4] * m$3[1] - m$3[5] * m$3[0]) / d$4 ]; } static singularValueDecompose2dScale(matrix, output) { @@ -45031,23 +45235,23 @@ var init_pdf = __esmMin((() => { const m3 = matrix[3]; const a$2 = m0 ** 2 + m1 ** 2; const b$3 = m0 * m2 + m1 * m3; - const c$7 = m2 ** 2 + m3 ** 2; - const first = (a$2 + c$7) / 2; - const second = Math.sqrt(first ** 2 - (a$2 * c$7 - b$3 ** 2)); + const c$6 = m2 ** 2 + m3 ** 2; + const first = (a$2 + c$6) / 2; + const second = Math.sqrt(first ** 2 - (a$2 * c$6 - b$3 ** 2)); output[0] = Math.sqrt(first + second || 1); output[1] = Math.sqrt(first - second || 1); } static normalizeRect(rect) { - const r$10 = rect.slice(0); + const r$9 = rect.slice(0); if (rect[0] > rect[2]) { - r$10[0] = rect[2]; - r$10[2] = rect[0]; + r$9[0] = rect[2]; + r$9[2] = rect[0]; } if (rect[1] > rect[3]) { - r$10[1] = rect[3]; - r$10[3] = rect[1]; + r$9[1] = rect[3]; + r$9[3] = rect[1]; } - return r$10; + return r$9; } static intersect(rect1, rect2) { const xLow = Math.max(Math.min(rect1[0], rect1[2]), Math.min(rect2[0], rect2[2])); @@ -45093,14 +45297,14 @@ var init_pdf = __esmMin((() => { minMax[2] = Math.max(minMax[2], x$2); minMax[3] = Math.max(minMax[3], y$3); } - static #getExtremum(x0, x1, x2, x3, y0, y1, y2, y3, a$2, b$3, c$7, minMax) { + static #getExtremum(x0, x1, x2, x3, y0, y1, y2, y3, a$2, b$3, c$6, minMax) { if (Math.abs(a$2) < 1e-12) { if (Math.abs(b$3) >= 1e-12) { - this.#getExtremumOnCurve(x0, x1, x2, x3, y0, y1, y2, y3, -c$7 / b$3, minMax); + this.#getExtremumOnCurve(x0, x1, x2, x3, y0, y1, y2, y3, -c$6 / b$3, minMax); } return; } - const delta = b$3 ** 2 - 4 * c$7 * a$2; + const delta = b$3 ** 2 - 4 * c$6 * a$2; if (delta < 0) { return; } @@ -45659,13 +45863,13 @@ var init_pdf = __esmMin((() => { times = []; time(name) { if (name in this.started) { - warn$2(`Timer is already running for ${name}`); + warn(`Timer is already running for ${name}`); } this.started[name] = Date.now(); } timeEnd(name) { if (!(name in this.started)) { - warn$2(`Timer has not been started for ${name}`); + warn(`Timer has not been started for ${name}`); } this.times.push({ name, @@ -46195,7 +46399,7 @@ var init_pdf = __esmMin((() => { } data.refCounter = 1; } catch (e$10) { - warn$2(e$10); + warn(e$10); data = null; } this.#cache.set(key, data); @@ -47246,7 +47450,7 @@ var init_pdf = __esmMin((() => { try { data = JSON.parse(data); } catch (ex) { - warn$2(`paste: "${ex.message}".`); + warn(`paste: "${ex.message}".`); return; } if (!Array.isArray(data)) { @@ -47280,7 +47484,7 @@ var init_pdf = __esmMin((() => { mustExec: true }); } catch (ex) { - warn$2(`paste: "${ex.message}".`); + warn(`paste: "${ex.message}".`); } } keydown(event) { @@ -50633,7 +50837,7 @@ var init_pdf = __esmMin((() => { this.#systemFonts.add(loadedName); _inspectFont?.(info$1); } catch { - warn$2(`Cannot load system font: ${info$1.baseFontName}, installing it could help to improve PDF rendering.`); + warn(`Cannot load system font: ${info$1.baseFontName}, installing it could help to improve PDF rendering.`); this.removeNativeFontFace(fontFace); } return; @@ -50656,7 +50860,7 @@ var init_pdf = __esmMin((() => { try { await nativeFontFace.loaded; } catch (ex) { - warn$2(`Failed to load font '${nativeFontFace.family}': '${ex}'.`); + warn(`Failed to load font '${nativeFontFace.family}': '${ex}'.`); font.disableFontFace = true; throw ex; } @@ -50721,7 +50925,7 @@ var init_pdf = __esmMin((() => { let called = 0; function isFontReady(name, callback) { if (++called > 30) { - warn$2("Load test font never loaded."); + warn("Load test font never loaded."); callback(); return; } @@ -50790,11 +50994,11 @@ var init_pdf = __esmMin((() => { if (!this.cssFontInfo) { nativeFontFace = new FontFace(this.loadedName, this.data, {}); } else { - const css$2 = { weight: this.cssFontInfo.fontWeight }; + const css$1 = { weight: this.cssFontInfo.fontWeight }; if (this.cssFontInfo.italicAngle) { - css$2.style = `oblique ${this.cssFontInfo.italicAngle}deg`; + css$1.style = `oblique ${this.cssFontInfo.italicAngle}deg`; } - nativeFontFace = new FontFace(this.cssFontInfo.fontFamily, this.data, css$2); + nativeFontFace = new FontFace(this.cssFontInfo.fontFamily, this.data, css$1); } this._inspectFont?.(this); return nativeFontFace; @@ -50808,11 +51012,11 @@ var init_pdf = __esmMin((() => { if (!this.cssFontInfo) { rule = `@font-face {font-family:"${this.loadedName}";src:${url}}`; } else { - let css$2 = `font-weight: ${this.cssFontInfo.fontWeight};`; + let css$1 = `font-weight: ${this.cssFontInfo.fontWeight};`; if (this.cssFontInfo.italicAngle) { - css$2 += `font-style: oblique ${this.cssFontInfo.italicAngle}deg;`; + css$1 += `font-style: oblique ${this.cssFontInfo.italicAngle}deg;`; } - rule = `@font-face {font-family:"${this.cssFontInfo.fontFamily}";${css$2}src:${url}}`; + rule = `@font-face {font-family:"${this.cssFontInfo.fontFamily}";${css$1}src:${url}}`; } this._inspectFont?.(this, url); return rule; @@ -50826,7 +51030,7 @@ var init_pdf = __esmMin((() => { try { cmds = objs.get(objId); } catch (ex) { - warn$2(`getPathGenerator - ignoring character: "${ex}".`); + warn(`getPathGenerator - ignoring character: "${ex}".`); } const path$1 = makePathFromDrawOPS(cmds); if (!this.fontExtraProperties) { @@ -51623,7 +51827,7 @@ var init_pdf = __esmMin((() => { if (options?.signal instanceof AbortSignal) { const { signal } = options; if (signal.aborted) { - warn$2("LoopbackPort - cannot use an `aborted` signal."); + warn("LoopbackPort - cannot use an `aborted` signal."); return; } const onAbort = () => this.removeEventListener(name, listener); @@ -52184,7 +52388,7 @@ var init_pdf = __esmMin((() => { const url = this.#document.URL; if (url !== this.#document.baseURI) { if (isDataScheme(url)) { - warn$2("#createUrl: ignore \"data:\"-URL for performance reasons."); + warn("#createUrl: ignore \"data:\"-URL for performance reasons."); } else { this.#baseUrl = updateUrlHash(url, ""); } @@ -52256,9 +52460,9 @@ var init_pdf = __esmMin((() => { const filter = info$1.filter = this.#createFilter(id); this.#addTransferMapConversion(table, table, table, filter); this.#addGrayConversion(filter); - const getSteps = (c$7, n$9) => { - const start = fgRGB[c$7] / 255; - const end = bgRGB[c$7] / 255; + const getSteps = (c$6, n$9) => { + const start = fgRGB[c$6] / 255; + const end = bgRGB[c$6] / 255; const arr = new Array(n$9 + 1); for (let i$7 = 0; i$7 <= n$9; i$7++) { arr[i$7] = start + i$7 / n$9 * (end - start); @@ -52488,7 +52692,7 @@ var init_pdf = __esmMin((() => { }; ; if (isNodeJS) { - warn$2("Please use the `legacy` build in Node.js environments."); + warn("Please use the `legacy` build in Node.js environments."); } NodeFilterFactory = class extends BaseFilterFactory {}; NodeCanvasFactory = class extends BaseCanvasFactory { @@ -54148,9 +54352,9 @@ var init_pdf = __esmMin((() => { this._cachedScaleForStroking[0] = -1; this._cachedGetSinglePixelWidth = null; } - transform(opIdx, a$2, b$3, c$7, d$5, e$10, f$4) { + transform(opIdx, a$2, b$3, c$6, d$4, e$10, f$4) { this.dependencyTracker?.recordIncrementalData("transform", opIdx); - this.ctx.transform(a$2, b$3, c$7, d$5, e$10, f$4); + this.ctx.transform(a$2, b$3, c$6, d$4, e$10, f$4); this._cachedScaleForStroking[0] = -1; this._cachedGetSinglePixelWidth = null; } @@ -54329,7 +54533,7 @@ var init_pdf = __esmMin((() => { } current.fontMatrix = fontObj.fontMatrix || FONT_IDENTITY_MATRIX; if (current.fontMatrix[0] === 0 || current.fontMatrix[3] === 0) { - warn$2("Invalid font matrix for font " + fontRefName); + warn("Invalid font matrix for font " + fontRefName); } if (size < 0) { size = -size; @@ -54428,13 +54632,13 @@ var init_pdf = __esmMin((() => { if (patternStrokeTransform) { currentTransform ||= ctx.getTransform(); ctx.setTransform(...patternStrokeTransform); - const { a: a$2, b: b$3, c: c$7, d: d$5 } = currentTransform; + const { a: a$2, b: b$3, c: c$6, d: d$4 } = currentTransform; const invPatternTransform = Util.inverseTransform(patternStrokeTransform); const transf = Util.transform([ a$2, b$3, - c$7, - d$5, + c$6, + d$4, 0, 0 ], invPatternTransform); @@ -54679,7 +54883,7 @@ var init_pdf = __esmMin((() => { const spacing$1 = (glyph.isSpace ? wordSpacing : 0) + charSpacing; const operatorList = font.charProcOperatorList[glyph.operatorListId]; if (!operatorList) { - warn$2(`Type3 character "${glyph.operatorListId}" is not available.`); + warn(`Type3 character "${glyph.operatorListId}" is not available.`); } else if (this.contentVisible) { this.save(); ctx.scale(fontSize, fontSize); @@ -54837,7 +55041,7 @@ var init_pdf = __esmMin((() => { info("TODO: Support non-isolated groups."); } if (group.knockout) { - warn$2("Knockout groups not supported."); + warn("Knockout groups not supported."); } const currentTransform = getCurrentTransform(currentCtx); if (group.matrix) { @@ -55085,7 +55289,7 @@ var init_pdf = __esmMin((() => { } const imgData = this.getObject(opIdx, objId); if (!imgData) { - warn$2("Dependent image isn't ready yet"); + warn("Dependent image isn't ready yet"); return; } this.paintInlineImageXObject(opIdx, imgData); @@ -55096,7 +55300,7 @@ var init_pdf = __esmMin((() => { } const imgData = this.getObject(opIdx, objId); if (!imgData) { - warn$2("Dependent image isn't ready yet"); + warn("Dependent image isn't ready yet"); return; } const width = imgData.width; @@ -55208,15 +55412,15 @@ var init_pdf = __esmMin((() => { this.compose(); } markPoint(opIdx, tag) {} - markPointProps(opIdx, tag, properties$1) {} + markPointProps(opIdx, tag, properties) {} beginMarkedContent(opIdx, tag) { this.dependencyTracker?.beginMarkedContent(opIdx); this.markedContentStack.push({ visible: true }); } - beginMarkedContentProps(opIdx, tag, properties$1) { + beginMarkedContentProps(opIdx, tag, properties) { this.dependencyTracker?.beginMarkedContent(opIdx); if (tag === "OC") { - this.markedContentStack.push({ visible: this.optionalContentConfig.isVisible(properties$1) }); + this.markedContentStack.push({ visible: this.optionalContentConfig.isVisible(properties) }); } else { this.markedContentStack.push({ visible: true }); } @@ -55270,11 +55474,11 @@ var init_pdf = __esmMin((() => { getScaleForStroking() { if (this._cachedScaleForStroking[0] === -1) { const { lineWidth } = this.current; - const { a: a$2, b: b$3, c: c$7, d: d$5 } = this.ctx.getTransform(); + const { a: a$2, b: b$3, c: c$6, d: d$4 } = this.ctx.getTransform(); let scaleX, scaleY; - if (b$3 === 0 && c$7 === 0) { + if (b$3 === 0 && c$6 === 0) { const normX = Math.abs(a$2); - const normY = Math.abs(d$5); + const normY = Math.abs(d$4); if (normX === normY) { if (lineWidth === 0) { scaleX = scaleY = 1 / normX; @@ -55292,9 +55496,9 @@ var init_pdf = __esmMin((() => { scaleY = scaledYLineWidth < 1 ? 1 / scaledYLineWidth : 1; } } else { - const absDet = Math.abs(a$2 * d$5 - b$3 * c$7); + const absDet = Math.abs(a$2 * d$4 - b$3 * c$6); const normX = Math.hypot(a$2, b$3); - const normY = Math.hypot(c$7, d$5); + const normY = Math.hypot(c$6, d$4); if (lineWidth === 0) { scaleX = normY / absDet; scaleY = normX / absDet; @@ -55466,7 +55670,7 @@ var init_pdf = __esmMin((() => { if (length < 2) { return true; } - const operator$1 = array[0]; + const operator = array[0]; for (let i$7 = 1; i$7 < length; i$7++) { const element = array[i$7]; let state$1; @@ -55475,10 +55679,10 @@ var init_pdf = __esmMin((() => { } else if (this.#groups.has(element)) { state$1 = this.#groups.get(element).visible; } else { - warn$2(`Optional content group not found: ${element}`); + warn(`Optional content group not found: ${element}`); return true; } - switch (operator$1) { + switch (operator) { case "And": if (!state$1) { return false; @@ -55493,7 +55697,7 @@ var init_pdf = __esmMin((() => { default: return true; } } - return operator$1 === "And"; + return operator === "And"; } isVisible(group) { if (this.#groups.size === 0) { @@ -55505,7 +55709,7 @@ var init_pdf = __esmMin((() => { } if (group.type === "OCG") { if (!this.#groups.has(group.id)) { - warn$2(`Optional content group not found: ${group.id}`); + warn(`Optional content group not found: ${group.id}`); return true; } return this.#groups.get(group.id).visible; @@ -55516,7 +55720,7 @@ var init_pdf = __esmMin((() => { if (!group.policy || group.policy === "AnyOn") { for (const id of group.ids) { if (!this.#groups.has(id)) { - warn$2(`Optional content group not found: ${id}`); + warn(`Optional content group not found: ${id}`); return true; } if (this.#groups.get(id).visible) { @@ -55527,7 +55731,7 @@ var init_pdf = __esmMin((() => { } else if (group.policy === "AllOn") { for (const id of group.ids) { if (!this.#groups.has(id)) { - warn$2(`Optional content group not found: ${id}`); + warn(`Optional content group not found: ${id}`); return true; } if (!this.#groups.get(id).visible) { @@ -55538,7 +55742,7 @@ var init_pdf = __esmMin((() => { } else if (group.policy === "AnyOff") { for (const id of group.ids) { if (!this.#groups.has(id)) { - warn$2(`Optional content group not found: ${id}`); + warn(`Optional content group not found: ${id}`); return true; } if (!this.#groups.get(id).visible) { @@ -55549,7 +55753,7 @@ var init_pdf = __esmMin((() => { } else if (group.policy === "AllOff") { for (const id of group.ids) { if (!this.#groups.has(id)) { - warn$2(`Optional content group not found: ${id}`); + warn(`Optional content group not found: ${id}`); return true; } if (this.#groups.get(id).visible) { @@ -55558,16 +55762,16 @@ var init_pdf = __esmMin((() => { } return true; } - warn$2(`Unknown optional content policy ${group.policy}.`); + warn(`Unknown optional content policy ${group.policy}.`); return true; } - warn$2(`Unknown group type ${group.type}.`); + warn(`Unknown group type ${group.type}.`); return true; } setVisibility(id, visible = true, preserveRB = true) { const group = this.#groups.get(id); if (!group) { - warn$2(`Optional content group not found: ${id}`); + warn(`Optional content group not found: ${id}`); return; } if (preserveRB && visible && group.rbGroups.length) { @@ -55583,20 +55787,20 @@ var init_pdf = __esmMin((() => { this.#cachedGetHash = null; } setOCGState({ state: state$1, preserveRB }) { - let operator$1; + let operator; for (const elem of state$1) { switch (elem) { case "ON": case "OFF": case "Toggle": - operator$1 = elem; + operator = elem; continue; } const group = this.#groups.get(elem); if (!group) { continue; } - switch (operator$1) { + switch (operator) { case "ON": this.setVisibility(elem, true, preserveRB); break; @@ -55894,10 +56098,10 @@ var init_pdf = __esmMin((() => { ; PDFFetchStream = class { _responseOrigin = null; - constructor(source$4) { - this.source = source$4; - this.isHttp = /^https?:/i.test(source$4.url); - this.headers = createHeaders(this.isHttp, source$4.httpHeaders); + constructor(source) { + this.source = source; + this.isHttp = /^https?:/i.test(source.url); + this.headers = createHeaders(this.isHttp, source.httpHeaders); this._fullRequestReader = null; this._rangeRequestReaders = []; } @@ -55930,20 +56134,20 @@ var init_pdf = __esmMin((() => { this._reader = null; this._loaded = 0; this._filename = null; - const source$4 = stream.source; - this._withCredentials = source$4.withCredentials || false; - this._contentLength = source$4.length; + const source = stream.source; + this._withCredentials = source.withCredentials || false; + this._contentLength = source.length; this._headersCapability = Promise.withResolvers(); - this._disableRange = source$4.disableRange || false; - this._rangeChunkSize = source$4.rangeChunkSize; + this._disableRange = source.disableRange || false; + this._rangeChunkSize = source.rangeChunkSize; if (!this._rangeChunkSize && !this._disableRange) { this._disableRange = true; } this._abortController = new AbortController(); - this._isStreamingSupported = !source$4.disableStream; - this._isRangeSupported = !source$4.disableRange; + this._isStreamingSupported = !source.disableStream; + this._isRangeSupported = !source.disableRange; const headers = new Headers(stream.headers); - const url = source$4.url; + const url = source.url; fetch(url, createFetchOptions(headers, this._withCredentials, this._abortController)).then((response) => { stream._responseOrigin = getResponseOrigin(response.url); if (!validateResponseStatus(response.status)) { @@ -56011,14 +56215,14 @@ var init_pdf = __esmMin((() => { this._stream = stream; this._reader = null; this._loaded = 0; - const source$4 = stream.source; - this._withCredentials = source$4.withCredentials || false; + const source = stream.source; + this._withCredentials = source.withCredentials || false; this._readCapability = Promise.withResolvers(); - this._isStreamingSupported = !source$4.disableStream; + this._isStreamingSupported = !source.disableStream; this._abortController = new AbortController(); const headers = new Headers(stream.headers); headers.append("Range", `bytes=${begin}-${end - 1}`); - const url = source$4.url; + const url = source.url; fetch(url, createFetchOptions(headers, this._withCredentials, this._abortController)).then((response) => { const responseOrigin = getResponseOrigin(response.url); if (responseOrigin !== stream._responseOrigin) { @@ -56142,7 +56346,7 @@ var init_pdf = __esmMin((() => { chunk }); } else { - warn$2(`Missing or invalid "Content-Range" header.`); + warn(`Missing or invalid "Content-Range" header.`); pendingRequest.onError(0); } } else if (chunk) { @@ -56167,10 +56371,10 @@ var init_pdf = __esmMin((() => { } }; PDFNetworkStream = class { - constructor(source$4) { - this._source = source$4; - this._manager = new NetworkManager(source$4); - this._rangeChunkSize = source$4.rangeChunkSize; + constructor(source) { + this._source = source; + this._manager = new NetworkManager(source); + this._rangeChunkSize = source.rangeChunkSize; this._fullRequestReader = null; this._rangeRequestReaders = []; } @@ -56199,9 +56403,9 @@ var init_pdf = __esmMin((() => { } }; PDFNetworkStreamFullRequestReader = class { - constructor(manager, source$4) { + constructor(manager, source) { this._manager = manager; - this._url = source$4.url; + this._url = source.url; this._fullRequestId = manager.request({ onHeadersReceived: this._onHeadersReceived.bind(this), onDone: this._onDone.bind(this), @@ -56209,9 +56413,9 @@ var init_pdf = __esmMin((() => { onProgress: this._onProgress.bind(this) }); this._headersCapability = Promise.withResolvers(); - this._disableRange = source$4.disableRange || false; - this._contentLength = source$4.length; - this._rangeChunkSize = source$4.rangeChunkSize; + this._disableRange = source.disableRange || false; + this._contentLength = source.length; + this._rangeChunkSize = source.rangeChunkSize; if (!this._rangeChunkSize && !this._disableRange) { this._disableRange = true; } @@ -56447,9 +56651,9 @@ var init_pdf = __esmMin((() => { ; urlRegex = /^[a-z][a-z0-9\-+.]+:/i; PDFNodeStream = class { - constructor(source$4) { - this.source = source$4; - this.url = parseUrlOrPath(source$4.url); + constructor(source) { + this.source = source; + this.url = parseUrlOrPath(source.url); assert$1(this.url.protocol === "file:", "PDFNodeStream only supports file:// URLs."); this._fullRequestReader = null; this._rangeRequestReaders = []; @@ -56483,17 +56687,17 @@ var init_pdf = __esmMin((() => { this._done = false; this._storedError = null; this.onProgress = null; - const source$4 = stream.source; - this._contentLength = source$4.length; + const source = stream.source; + this._contentLength = source.length; this._loaded = 0; this._filename = null; - this._disableRange = source$4.disableRange || false; - this._rangeChunkSize = source$4.rangeChunkSize; + this._disableRange = source.disableRange || false; + this._rangeChunkSize = source.rangeChunkSize; if (!this._rangeChunkSize && !this._disableRange) { this._disableRange = true; } - this._isStreamingSupported = !source$4.disableStream; - this._isRangeSupported = !source$4.disableRange; + this._isStreamingSupported = !source.disableStream; + this._isRangeSupported = !source.disableRange; this._readableStream = null; this._readCapability = Promise.withResolvers(); this._headersCapability = Promise.withResolvers(); @@ -56502,12 +56706,12 @@ var init_pdf = __esmMin((() => { this._contentLength = stat.size; this._setReadableStream(fs.createReadStream(this._url)); this._headersCapability.resolve(); - }, (error$2) => { - if (error$2.code === "ENOENT") { - error$2 = createResponseError(0, this._url.href); + }, (error) => { + if (error.code === "ENOENT") { + error = createResponseError(0, this._url.href); } - this._storedError = error$2; - this._headersCapability.reject(error$2); + this._storedError = error; + this._headersCapability.reject(error); }); } get headersReady() { @@ -56593,8 +56797,8 @@ var init_pdf = __esmMin((() => { this._loaded = 0; this._readableStream = null; this._readCapability = Promise.withResolvers(); - const source$4 = stream.source; - this._isStreamingSupported = !source$4.disableStream; + const source = stream.source; + this._isStreamingSupported = !source.disableStream; const fs = process.getBuiltinModule("fs"); this._setReadableStream(fs.createReadStream(this._url, { start, @@ -56843,7 +57047,7 @@ var init_pdf = __esmMin((() => { const textDivs = this.#textDivs, textContentItemsStr = this.#textContentItemsStr; for (const item of items) { if (textDivs.length > MAX_TEXT_DIVS_TO_RENDER) { - warn$2("Ignoring additional textDivs for performance reasons."); + warn("Ignoring additional textDivs for performance reasons."); this.#disableProcessItems = true; return; } @@ -56940,23 +57144,23 @@ var init_pdf = __esmMin((() => { } } #layout(params) { - const { div, properties: properties$1, ctx } = params; + const { div, properties, ctx } = params; const { style } = div; let transform = ""; if (TextLayer.#minFontSize > 1) { transform = `scale(${1 / TextLayer.#minFontSize})`; } - if (properties$1.canvasWidth !== 0 && properties$1.hasText) { + if (properties.canvasWidth !== 0 && properties.hasText) { const { fontFamily } = style; - const { canvasWidth, fontSize } = properties$1; + const { canvasWidth, fontSize } = properties; TextLayer.#ensureCtxFont(ctx, fontSize * this.#scale, fontFamily); const { width } = ctx.measureText(div.textContent); if (width > 0) { transform = `scaleX(${canvasWidth * this.#scale / width}) ${transform}`; } } - if (properties$1.angle !== 0) { - transform = `rotate(${properties$1.angle}deg) ${transform}`; + if (properties.angle !== 0) { + transform = `rotate(${properties.angle}deg) ${transform}`; } if (transform.length > 0) { style.transform = transform; @@ -57031,7 +57235,7 @@ var init_pdf = __esmMin((() => { ratio = ascent / (ascent + descent); } else { if (util_FeatureTest.platform.isFirefox) { - warn$2("Enable the `dom.textMetrics.fontBoundingBox.enabled` preference " + "in `about:config` to improve TextLayer rendering."); + warn("Enable the `dom.textMetrics.fontBoundingBox.enabled` preference " + "in `about:config` to improve TextLayer rendering."); } if (style.ascent) { ratio = style.ascent; @@ -57333,7 +57537,7 @@ var init_pdf = __esmMin((() => { } const recordForDebugger = Boolean(this._pdfBug && globalThis.StepperManager?.enabled); const shouldRecordOperations = !this.recordedBBoxes && (recordOperations || recordForDebugger); - const complete$1 = (error$2) => { + const complete$1 = (error) => { intentState.renderTasks.delete(internalRenderTask); if (shouldRecordOperations) { const recordedBBoxes = internalRenderTask.gfx?.dependencyTracker.take(); @@ -57350,11 +57554,11 @@ var init_pdf = __esmMin((() => { this.#pendingCleanup = true; } this.#tryCleanup(); - if (error$2) { - internalRenderTask.capability.reject(error$2); + if (error) { + internalRenderTask.capability.reject(error); this._abortOperatorList({ intentState, - reason: error$2 instanceof Error ? error$2 : new Error(error$2) + reason: error instanceof Error ? error : new Error(error) }); } else { internalRenderTask.capability.resolve(); @@ -57664,7 +57868,7 @@ var init_pdf = __esmMin((() => { return URL.createObjectURL(new Blob([wrapper], { type: "text/javascript" })); }; this.fromPort = (params) => { - deprecated$2("`PDFWorker.fromPort` - please use `PDFWorker.create` instead."); + deprecated("`PDFWorker.fromPort` - please use `PDFWorker.create` instead."); if (!params?.port) { throw new Error("PDFWorker.fromPort - invalid method signature."); } @@ -57768,7 +57972,7 @@ var init_pdf = __esmMin((() => { } #setupFakeWorker() { if (!PDFWorker.#isWorkerDisabled) { - warn$2("Setting up fake worker."); + warn("Setting up fake worker."); PDFWorker.#isWorkerDisabled = true; } PDFWorker._setupFakeWorkerGlobal.then((WorkerMessageHandler) => { @@ -57887,7 +58091,7 @@ var init_pdf = __esmMin((() => { case "print": renderingIntent = RenderingIntentFlag.PRINT; break; - default: warn$2(`getRenderingIntent - invalid intent: ${intent}`); + default: warn(`getRenderingIntent - invalid intent: ${intent}`); } const annotationStorage = renderingIntent & RenderingIntentFlag.PRINT && printAnnotationStorage instanceof PrintAnnotationStorage ? printAnnotationStorage : this.annotationStorage; switch (annotationMode) { @@ -57902,7 +58106,7 @@ var init_pdf = __esmMin((() => { renderingIntent += RenderingIntentFlag.ANNOTATIONS_STORAGE; annotationStorageSerializable = annotationStorage.serializable; break; - default: warn$2(`getRenderingIntent - invalid annotationMode: ${annotationMode}`); + default: warn(`getRenderingIntent - invalid annotationMode: ${annotationMode}`); } if (isEditing) { renderingIntent += RenderingIntentFlag.IS_EDITING; @@ -58090,7 +58294,7 @@ var init_pdf = __esmMin((() => { case "Font": if ("error" in exportedData) { const exportedError = exportedData.error; - warn$2(`Error during font loading: ${exportedError}`); + warn(`Error during font loading: ${exportedError}`); this.commonObjs.resolve(id, exportedError); break; } @@ -58177,7 +58381,7 @@ var init_pdf = __esmMin((() => { } saveDocument() { if (this.annotationStorage.size <= 0) { - warn$2("saveDocument called while `annotationStorage` is empty, " + "please use the getData-method instead."); + warn("saveDocument called while `annotationStorage` is empty, " + "please use the getData-method instead."); } const { map: map$2, transfer } = this.annotationStorage.serializable; return this.messageHandler.sendWithPromise("SaveDocument", { @@ -58419,7 +58623,7 @@ var init_pdf = __esmMin((() => { this.graphicsReady = true; this.graphicsReadyCallback?.(); } - cancel(error$2 = null, extraDelay = 0) { + cancel(error = null, extraDelay = 0) { this.running = false; this.cancelled = true; this.gfx?.endDrawing(); @@ -58428,9 +58632,9 @@ var init_pdf = __esmMin((() => { this.#rAF = null; } InternalRenderTask.#canvasInUse.delete(this._canvas); - error$2 ||= new RenderingCancelledException(`Rendering cancelled, page ${this._pageIndex + 1}`, extraDelay); - this.callback(error$2); - this.task.onError?.(error$2); + error ||= new RenderingCancelledException(`Rendering cancelled, page ${this._pageIndex + 1}`, extraDelay); + this.callback(error); + this.task.onError?.(error); } operatorListChanged() { if (!this.graphicsReady) { @@ -58480,7 +58684,7 @@ var init_pdf = __esmMin((() => { } } }; - version$4 = "5.4.394"; + version$2 = "5.4.394"; build = "2cc809ade"; ; ColorPicker = class ColorPicker { @@ -58758,8 +58962,8 @@ var init_pdf = __esmMin((() => { }; ; ColorConverters = class { - static CMYK_G([c$7, y$3, m$3, k$2]) { - return ["G", 1 - Math.min(1, .3 * c$7 + .59 * m$3 + .11 * y$3 + k$2)]; + static CMYK_G([c$6, y$3, m$3, k$2]) { + return ["G", 1 - Math.min(1, .3 * c$6 + .59 * m$3 + .11 * y$3 + k$2)]; } static G_CMYK([g$1]) { return [ @@ -58790,8 +58994,8 @@ var init_pdf = __esmMin((() => { const G$1 = makeColorComp(g$1); return `#${G$1}${G$1}${G$1}`; } - static RGB_G([r$10, g$1, b$3]) { - return ["G", .3 * r$10 + .59 * g$1 + .11 * b$3]; + static RGB_G([r$9, g$1, b$3]) { + return ["G", .3 * r$9 + .59 * g$1 + .11 * b$3]; } static RGB_rgb(color) { return color.map(scaleAndClamp); @@ -58805,17 +59009,17 @@ var init_pdf = __esmMin((() => { static T_rgb() { return [null]; } - static CMYK_RGB([c$7, y$3, m$3, k$2]) { + static CMYK_RGB([c$6, y$3, m$3, k$2]) { return [ "RGB", - 1 - Math.min(1, c$7 + k$2), + 1 - Math.min(1, c$6 + k$2), 1 - Math.min(1, m$3 + k$2), 1 - Math.min(1, y$3 + k$2) ]; } - static CMYK_rgb([c$7, y$3, m$3, k$2]) { + static CMYK_rgb([c$6, y$3, m$3, k$2]) { return [ - scaleAndClamp(1 - Math.min(1, c$7 + k$2)), + scaleAndClamp(1 - Math.min(1, c$6 + k$2)), scaleAndClamp(1 - Math.min(1, m$3 + k$2)), scaleAndClamp(1 - Math.min(1, y$3 + k$2)) ]; @@ -58824,14 +59028,14 @@ var init_pdf = __esmMin((() => { const rgb = this.CMYK_RGB(components).slice(1); return this.RGB_HTML(rgb); } - static RGB_CMYK([r$10, g$1, b$3]) { - const c$7 = 1 - r$10; + static RGB_CMYK([r$9, g$1, b$3]) { + const c$6 = 1 - r$9; const m$3 = 1 - g$1; const y$3 = 1 - b$3; - const k$2 = Math.min(c$7, m$3, y$3); + const k$2 = Math.min(c$6, m$3, y$3); return [ "CMYK", - c$7, + c$6, m$3, y$3, k$2 @@ -59145,10 +59349,10 @@ var init_pdf = __esmMin((() => { style.borderStyle = "dashed"; break; case AnnotationBorderStyleType.BEVELED: - warn$2("Unimplemented border style: beveled"); + warn("Unimplemented border style: beveled"); break; case AnnotationBorderStyleType.INSET: - warn$2("Unimplemented border style: inset"); + warn("Unimplemented border style: inset"); break; case AnnotationBorderStyleType.UNDERLINE: style.borderBottomStyle = "solid"; @@ -59407,7 +59611,7 @@ var init_pdf = __esmMin((() => { const exportValue = typeof exportValues === "string" ? exportValues : null; const domElement = document.querySelector(`[data-element-id="${id}"]`); if (domElement && !GetElementsByNameSet.has(domElement)) { - warn$2(`_getElementsByName - element not allowed: ${id}`); + warn(`_getElementsByName - element not allowed: ${id}`); continue; } fields.push({ @@ -59666,7 +59870,7 @@ var init_pdf = __esmMin((() => { } this.#setInternalLink(); if (!this._fieldObjects) { - warn$2(`_bindResetFormAction - "resetForm" action not supported, ` + "ensure that the `fieldObjects` parameter is provided."); + warn(`_bindResetFormAction - "resetForm" action not supported, ` + "ensure that the `fieldObjects` parameter is provided."); if (!otherClickAction) { link.onclick = () => false; } @@ -59725,7 +59929,7 @@ var init_pdf = __esmMin((() => { if (!domElement) { continue; } else if (!GetElementsByNameSet.has(domElement)) { - warn$2(`_bindResetFormAction - element not allowed: ${id}`); + warn(`_bindResetFormAction - element not allowed: ${id}`); continue; } domElement.dispatchEvent(new Event("resetform")); @@ -62447,7 +62651,7 @@ var init_pdf = __esmMin((() => { } #hasElementChanged(serialized) { const { value, fontSize, color, pageIndex } = this._initialData; - return this.hasEditedComment || this._hasBeenMoved || serialized.value !== value || serialized.fontSize !== fontSize || serialized.color.some((c$7, i$7) => c$7 !== color[i$7]) || serialized.pageIndex !== pageIndex; + return this.hasEditedComment || this._hasBeenMoved || serialized.value !== value || serialized.fontSize !== fontSize || serialized.color.some((c$6, i$7) => c$6 !== color[i$7]) || serialized.pageIndex !== pageIndex; } renderAnnotationElement(annotation) { const content = super.renderAnnotationElement(annotation); @@ -62597,12 +62801,12 @@ var init_pdf = __esmMin((() => { let [x1, y1, x2, y2] = this.#last.subarray(8, 12); const diffX = x$2 - x2; const diffY = y$3 - y2; - const d$5 = Math.hypot(diffX, diffY); - if (d$5 < this.#min) { + const d$4 = Math.hypot(diffX, diffY); + if (d$4 < this.#min) { return false; } - const diffD = d$5 - this.#min_dist; - const K$1 = diffD / d$5; + const diffD = d$4 - this.#min_dist; + const K$1 = diffD / d$4; const shiftX = K$1 * diffX; const shiftY = K$1 * diffY; let x0 = x1; @@ -64037,7 +64241,7 @@ var init_pdf = __esmMin((() => { } #hasElementChanged(serialized) { const { color } = this._initialData; - return this.hasEditedComment || serialized.color.some((c$7, i$7) => c$7 !== color[i$7]); + return this.hasEditedComment || serialized.color.some((c$6, i$7) => c$6 !== color[i$7]); } renderAnnotationElement(annotation) { if (this.deleted) { @@ -64061,11 +64265,11 @@ var init_pdf = __esmMin((() => { this[name] = value; this.updateSVGProperty(name, value); } - updateProperties(properties$1) { - if (!properties$1) { + updateProperties(properties) { + if (!properties) { return; } - for (const [name, value] of Object.entries(properties$1)) { + for (const [name, value] of Object.entries(properties)) { if (!name.startsWith("_")) { this.updateProperty(name, value); } @@ -64173,20 +64377,20 @@ var init_pdf = __esmMin((() => { } } static get defaultPropertiesToUpdate() { - const properties$1 = []; + const properties = []; const options = this._defaultDrawingOptions; for (const [type, name] of this.typesMap) { - properties$1.push([type, options[name]]); + properties.push([type, options[name]]); } - return properties$1; + return properties; } get propertiesToUpdate() { - const properties$1 = []; + const properties = []; const { _drawingOptions } = this; for (const [type, name] of this.constructor.typesMap) { - properties$1.push([type, _drawingOptions[name]]); + properties.push([type, _drawingOptions[name]]); } - return properties$1; + return properties; } _updateProperty(type, name, value) { const options = this._drawingOptions; @@ -64749,8 +64953,8 @@ var init_pdf = __esmMin((() => { const [x1, y1, x2, y2] = this.#last.subarray(2, 6); const diffX = x$2 - x2; const diffY = y$3 - y2; - const d$5 = Math.hypot(this.#parentWidth * diffX, this.#parentHeight * diffY); - if (d$5 <= 2) { + const d$4 = Math.hypot(this.#parentWidth * diffX, this.#parentHeight * diffY); + if (d$4 <= 2) { return null; } this.#points.push(x$2, y$3); @@ -65211,27 +65415,27 @@ var init_pdf = __esmMin((() => { } get rotationTransform() { const [, , width, height] = this.#bbox; - let a$2 = 0, b$3 = 0, c$7 = 0, d$5 = 0, e$10 = 0, f$4 = 0; + let a$2 = 0, b$3 = 0, c$6 = 0, d$4 = 0, e$10 = 0, f$4 = 0; switch (this.#currentRotation) { case 90: b$3 = height / width; - c$7 = -width / height; + c$6 = -width / height; e$10 = width; break; case 180: a$2 = -1; - d$5 = -1; + d$4 = -1; e$10 = width; f$4 = height; break; case 270: b$3 = -height / width; - c$7 = width / height; + c$6 = width / height; f$4 = height; break; default: return ""; } - return `matrix(${a$2} ${b$3} ${c$7} ${d$5} ${Outline.svgRound(e$10)} ${Outline.svgRound(f$4)})`; + return `matrix(${a$2} ${b$3} ${c$6} ${d$4} ${Outline.svgRound(e$10)} ${Outline.svgRound(f$4)})`; } getPathResizingSVGProperties([newX, newY, newWidth, newHeight]) { const [marginX, marginY] = this.#getMarginComponents(); @@ -65507,7 +65711,7 @@ var init_pdf = __esmMin((() => { } #hasElementChanged(serialized) { const { color, thickness, opacity, pageIndex } = this._initialData; - return this.hasEditedComment || this._hasBeenMoved || this._hasBeenResized || serialized.color.some((c$7, i$7) => c$7 !== color[i$7]) || serialized.thickness !== thickness || serialized.opacity !== opacity || serialized.pageIndex !== pageIndex; + return this.hasEditedComment || this._hasBeenMoved || this._hasBeenResized || serialized.color.some((c$6, i$7) => c$6 !== color[i$7]) || serialized.thickness !== thickness || serialized.opacity !== opacity || serialized.pageIndex !== pageIndex; } renderAnnotationElement(annotation) { if (this.deleted) { @@ -65647,9 +65851,9 @@ var init_pdf = __esmMin((() => { }; contours.push(contour); let contour0; - for (const c$7 of contours) { - if (c$7.id === lnbd) { - contour0 = c$7; + for (const c$6 of contours) { + if (c$6.id === lnbd) { + contour0 = c$6; break; } } @@ -65731,10 +65935,10 @@ var init_pdf = __esmMin((() => { let dmax = 0; let index = start; for (let i$7 = start + 2; i$7 < end - 2; i$7 += 2) { - const d$5 = Math.abs(aa - nabx * points[i$7 + 1] + naby * points[i$7]); - if (d$5 > dmax) { + const d$4 = Math.abs(aa - nabx * points[i$7 + 1] + naby * points[i$7]); + if (d$4 > dmax) { index = i$7; - dmax = d$5; + dmax = d$4; } } if (dmax > (dist * partialPhi) ** 2) { @@ -66099,9 +66303,9 @@ var init_pdf = __esmMin((() => { offset += chunk.length; } const header = new Uint32Array(data.buffer, 0, data.length >> 2); - const version$6 = header[1]; - if (version$6 !== 0) { - throw new Error(`Invalid version: ${version$6}`); + const version$4 = header[1]; + if (version$4 !== 0) { + throw new Error(`Invalid version: ${version$4}`); } const width = header[2]; const height = header[3]; @@ -66143,7 +66347,7 @@ var init_pdf = __esmMin((() => { height }; } catch (e$10) { - warn$2(`decompressSignature: ${e$10}`); + warn(`decompressSignature: ${e$10}`); return null; } } @@ -67792,8 +67996,8 @@ var init_pdf = __esmMin((() => { clipPathUse.classList.add("clip"); return clipPathId; } - #updateProperties(element, properties$1) { - for (const [key, value] of Object.entries(properties$1)) { + #updateProperties(element, properties) { + for (const [key, value] of Object.entries(properties)) { if (value === null) { element.removeAttribute(key); } else { @@ -67801,7 +68005,7 @@ var init_pdf = __esmMin((() => { } } } - draw(properties$1, isPathUpdatable = false, hasClip = false) { + draw(properties, isPathUpdatable = false, hasClip = false) { const id = DrawLayer.#id++; const root = this.#createSVG(); const defs = DrawLayer._svgFactory.createElement("defs"); @@ -67818,14 +68022,14 @@ var init_pdf = __esmMin((() => { const use = DrawLayer._svgFactory.createElement("use"); root.append(use); use.setAttribute("href", `#${pathId}`); - this.updateProperties(root, properties$1); + this.updateProperties(root, properties); this.#mapping.set(id, root); return { id, clipPathId: `url(#${clipPathId})` }; } - drawOutline(properties$1, mustRemoveSelfIntersections) { + drawOutline(properties, mustRemoveSelfIntersections) { const id = DrawLayer.#id++; const root = this.#createSVG(); const defs = DrawLayer._svgFactory.createElement("defs"); @@ -67865,19 +68069,19 @@ var init_pdf = __esmMin((() => { root.append(use2); use1.classList.add("mainOutline"); use2.classList.add("secondaryOutline"); - this.updateProperties(root, properties$1); + this.updateProperties(root, properties); this.#mapping.set(id, root); return id; } - finalizeDraw(id, properties$1) { + finalizeDraw(id, properties) { this.#toUpdate.delete(id); - this.updateProperties(id, properties$1); + this.updateProperties(id, properties); } - updateProperties(elementOrId, properties$1) { - if (!properties$1) { + updateProperties(elementOrId, properties) { + if (!properties) { return; } - const { root, bbox, rootClass, path: path$1 } = properties$1; + const { root, bbox, rootClass, path: path$1 } = properties; const element = typeof elementOrId === "number" ? this.#mapping.get(elementOrId) : elementOrId; if (!element) { return; @@ -67988,7 +68192,7 @@ var init_pdf = __esmMin((() => { updateUrlHash, Util, VerbosityLevel, - version: version$4, + version: version$2, XfaLayer }; })); @@ -68147,8 +68351,8 @@ function s2ab(s$5) { return buf; } function a2s(data) { - if (Array.isArray(data)) return data.map(function(c$7) { - return String.fromCharCode(c$7); + if (Array.isArray(data)) return data.map(function(c$6) { + return String.fromCharCode(c$6); }).join(""); var o$10 = []; for (var i$7 = 0; i$7 < data.length; ++i$7) o$10[i$7] = String.fromCharCode(data[i$7]); @@ -68169,22 +68373,22 @@ function utf8decode(content) { var out = [], widx = 0, L$2 = content.length + 250; var o$10 = new_raw_buf(content.length + 255); for (var ridx = 0; ridx < content.length; ++ridx) { - var c$7 = content.charCodeAt(ridx); - if (c$7 < 128) o$10[widx++] = c$7; - else if (c$7 < 2048) { - o$10[widx++] = 192 | c$7 >> 6 & 31; - o$10[widx++] = 128 | c$7 & 63; - } else if (c$7 >= 55296 && c$7 < 57344) { - c$7 = (c$7 & 1023) + 64; - var d$5 = content.charCodeAt(++ridx) & 1023; - o$10[widx++] = 240 | c$7 >> 8 & 7; - o$10[widx++] = 128 | c$7 >> 2 & 63; - o$10[widx++] = 128 | d$5 >> 6 & 15 | (c$7 & 3) << 4; - o$10[widx++] = 128 | d$5 & 63; + var c$6 = content.charCodeAt(ridx); + if (c$6 < 128) o$10[widx++] = c$6; + else if (c$6 < 2048) { + o$10[widx++] = 192 | c$6 >> 6 & 31; + o$10[widx++] = 128 | c$6 & 63; + } else if (c$6 >= 55296 && c$6 < 57344) { + c$6 = (c$6 & 1023) + 64; + var d$4 = content.charCodeAt(++ridx) & 1023; + o$10[widx++] = 240 | c$6 >> 8 & 7; + o$10[widx++] = 128 | c$6 >> 2 & 63; + o$10[widx++] = 128 | d$4 >> 6 & 15 | (c$6 & 3) << 4; + o$10[widx++] = 128 | d$4 & 63; } else { - o$10[widx++] = 224 | c$7 >> 12 & 15; - o$10[widx++] = 128 | c$7 >> 6 & 63; - o$10[widx++] = 128 | c$7 & 63; + o$10[widx++] = 224 | c$6 >> 12 & 15; + o$10[widx++] = 128 | c$6 >> 6 & 63; + o$10[widx++] = 128 | c$6 & 63; } if (widx > L$2) { out.push(o$10.slice(0, widx)); @@ -68201,30 +68405,30 @@ function _strrev(x$2) { while (i$7 >= 0) o$10 += x$2.charAt(i$7--); return o$10; } -function pad0(v$3, d$5) { +function pad0(v$3, d$4) { var t$6 = "" + v$3; - return t$6.length >= d$5 ? t$6 : fill("0", d$5 - t$6.length) + t$6; + return t$6.length >= d$4 ? t$6 : fill("0", d$4 - t$6.length) + t$6; } -function pad_(v$3, d$5) { +function pad_(v$3, d$4) { var t$6 = "" + v$3; - return t$6.length >= d$5 ? t$6 : fill(" ", d$5 - t$6.length) + t$6; + return t$6.length >= d$4 ? t$6 : fill(" ", d$4 - t$6.length) + t$6; } -function rpad_(v$3, d$5) { +function rpad_(v$3, d$4) { var t$6 = "" + v$3; - return t$6.length >= d$5 ? t$6 : t$6 + fill(" ", d$5 - t$6.length); + return t$6.length >= d$4 ? t$6 : t$6 + fill(" ", d$4 - t$6.length); } -function pad0r1(v$3, d$5) { +function pad0r1(v$3, d$4) { var t$6 = "" + Math.round(v$3); - return t$6.length >= d$5 ? t$6 : fill("0", d$5 - t$6.length) + t$6; + return t$6.length >= d$4 ? t$6 : fill("0", d$4 - t$6.length) + t$6; } -function pad0r2(v$3, d$5) { +function pad0r2(v$3, d$4) { var t$6 = "" + v$3; - return t$6.length >= d$5 ? t$6 : fill("0", d$5 - t$6.length) + t$6; + return t$6.length >= d$4 ? t$6 : fill("0", d$4 - t$6.length) + t$6; } -function pad0r(v$3, d$5) { - if (v$3 > p2_32 || v$3 < -p2_32) return pad0r1(v$3, d$5); +function pad0r(v$3, d$4) { + if (v$3 > p2_32 || v$3 < -p2_32) return pad0r1(v$3, d$4); var i$7 = Math.round(v$3); - return pad0r2(i$7, d$5); + return pad0r2(i$7, d$4); } function SSF_isgeneral(s$5, i$7) { i$7 = i$7 || 0; @@ -68294,10 +68498,10 @@ function SSF_frac(x$2, D$2, mixed) { sgn * P$2, Q$1 ]; - var q$2 = Math.floor(sgn * P$2 / Q$1); + var q$1 = Math.floor(sgn * P$2 / Q$1); return [ - q$2, - sgn * P$2 - q$2 * Q$1, + q$1, + sgn * P$2 - q$1 * Q$1, Q$1 ]; } @@ -68362,16 +68566,16 @@ function SSF_parse_date_code(v$3, opts, b2) { dow = 6; } else { if (date > 60) --date; - var d$5 = new Date(1900, 0, 1); - d$5.setDate(d$5.getDate() + date - 1); + var d$4 = new Date(1900, 0, 1); + d$4.setDate(d$4.getDate() + date - 1); dout = [ - d$5.getFullYear(), - d$5.getMonth() + 1, - d$5.getDate() + d$4.getFullYear(), + d$4.getMonth() + 1, + d$4.getDate() ]; - dow = d$5.getDay(); + dow = d$4.getDay(); if (date < 60) dow = (dow + 6) % 7; - if (b2) dow = SSF_fix_hijri(d$5, dout); + if (b2) dow = SSF_fix_hijri(d$4, dout); } out.y = dout[0]; out.m = dout[1]; @@ -68582,13 +68786,13 @@ function write_num_exp(fmt, val$1) { if (fmt.match(/E\-/) && o$10.match(/e\+/)) o$10 = o$10.replace(/e\+/, "e"); return o$10.replace("e", "E"); } -function write_num_f1(r$10, aval, sign) { - var den = parseInt(r$10[4], 10), rr = Math.round(aval * den), base = Math.floor(rr / den); +function write_num_f1(r$9, aval, sign) { + var den = parseInt(r$9[4], 10), rr = Math.round(aval * den), base = Math.floor(rr / den); var myn = rr - base * den, myd = den; - return sign + (base === 0 ? "" : "" + base) + " " + (myn === 0 ? fill(" ", r$10[1].length + 1 + r$10[4].length) : pad_(myn, r$10[1].length) + r$10[2] + "/" + r$10[3] + pad0(myd, r$10[4].length)); + return sign + (base === 0 ? "" : "" + base) + " " + (myn === 0 ? fill(" ", r$9[1].length + 1 + r$9[4].length) : pad_(myn, r$9[1].length) + r$9[2] + "/" + r$9[3] + pad0(myd, r$9[4].length)); } -function write_num_f2(r$10, aval, sign) { - return sign + (aval === 0 ? "" : "" + aval) + fill(" ", r$10[1].length + 2 + r$10[4].length); +function write_num_f2(r$9, aval, sign) { + return sign + (aval === 0 ? "" : "" + aval) + fill(" ", r$9[1].length + 2 + r$9[4].length); } function hashq(str) { var o$10 = "", cc; @@ -68604,17 +68808,17 @@ function hashq(str) { } return o$10; } -function rnd(val$1, d$5) { - var dd = Math.pow(10, d$5); +function rnd(val$1, d$4) { + var dd = Math.pow(10, d$4); return "" + Math.round(val$1 * dd) / dd; } -function dec(val$1, d$5) { - var _frac = val$1 - Math.floor(val$1), dd = Math.pow(10, d$5); - if (d$5 < ("" + Math.round(_frac * dd)).length) return 0; +function dec(val$1, d$4) { + var _frac = val$1 - Math.floor(val$1), dd = Math.pow(10, d$4); + if (d$4 < ("" + Math.round(_frac * dd)).length) return 0; return Math.round(_frac * dd); } -function carry(val$1, d$5) { - if (d$5 < ("" + Math.round((val$1 - Math.floor(val$1)) * Math.pow(10, d$5))).length) { +function carry(val$1, d$4) { + if (d$4 < ("" + Math.round((val$1 - Math.floor(val$1)) * Math.pow(10, d$4))).length) { return 1; } return 0; @@ -68634,31 +68838,31 @@ function write_num_flt(type, fmt, val$1) { if (fmt.indexOf("E") !== -1) return write_num_exp(fmt, val$1); if (fmt.charCodeAt(0) === 36) return "$" + write_num_flt(type, fmt.substr(fmt.charAt(1) == " " ? 2 : 1), val$1); var o$10; - var r$10, ri, ff, aval = Math.abs(val$1), sign = val$1 < 0 ? "-" : ""; + var r$9, ri, ff, aval = Math.abs(val$1), sign = val$1 < 0 ? "-" : ""; if (fmt.match(/^00+$/)) return sign + pad0r(aval, fmt.length); if (fmt.match(/^[#?]+$/)) { o$10 = pad0r(val$1, 0); if (o$10 === "0") o$10 = ""; return o$10.length > fmt.length ? o$10 : hashq(fmt.substr(0, fmt.length - o$10.length)) + o$10; } - if (r$10 = fmt.match(frac1)) return write_num_f1(r$10, aval, sign); + if (r$9 = fmt.match(frac1)) return write_num_f1(r$9, aval, sign); if (fmt.match(/^#+0+$/)) return sign + pad0r(aval, fmt.length - fmt.indexOf("0")); - if (r$10 = fmt.match(dec1)) { - o$10 = rnd(val$1, r$10[1].length).replace(/^([^\.]+)$/, "$1." + hashq(r$10[1])).replace(/\.$/, "." + hashq(r$10[1])).replace(/\.(\d*)$/, function($$, $1) { - return "." + $1 + fill("0", hashq(r$10[1]).length - $1.length); + if (r$9 = fmt.match(dec1)) { + o$10 = rnd(val$1, r$9[1].length).replace(/^([^\.]+)$/, "$1." + hashq(r$9[1])).replace(/\.$/, "." + hashq(r$9[1])).replace(/\.(\d*)$/, function($$, $1) { + return "." + $1 + fill("0", hashq(r$9[1]).length - $1.length); }); return fmt.indexOf("0.") !== -1 ? o$10 : o$10.replace(/^0\./, "."); } fmt = fmt.replace(/^#+([0.])/, "$1"); - if (r$10 = fmt.match(/^(0*)\.(#*)$/)) { - return sign + rnd(aval, r$10[2].length).replace(/\.(\d*[1-9])0*$/, ".$1").replace(/^(-?\d*)$/, "$1.").replace(/^0\./, r$10[1].length ? "0." : "."); + if (r$9 = fmt.match(/^(0*)\.(#*)$/)) { + return sign + rnd(aval, r$9[2].length).replace(/\.(\d*[1-9])0*$/, ".$1").replace(/^(-?\d*)$/, "$1.").replace(/^0\./, r$9[1].length ? "0." : "."); } - if (r$10 = fmt.match(/^#{1,3},##0(\.?)$/)) return sign + commaify(pad0r(aval, 0)); - if (r$10 = fmt.match(/^#,##0\.([#0]*0)$/)) { - return val$1 < 0 ? "-" + write_num_flt(type, fmt, -val$1) : commaify("" + (Math.floor(val$1) + carry(val$1, r$10[1].length))) + "." + pad0(dec(val$1, r$10[1].length), r$10[1].length); + if (r$9 = fmt.match(/^#{1,3},##0(\.?)$/)) return sign + commaify(pad0r(aval, 0)); + if (r$9 = fmt.match(/^#,##0\.([#0]*0)$/)) { + return val$1 < 0 ? "-" + write_num_flt(type, fmt, -val$1) : commaify("" + (Math.floor(val$1) + carry(val$1, r$9[1].length))) + "." + pad0(dec(val$1, r$9[1].length), r$9[1].length); } - if (r$10 = fmt.match(/^#,#*,#0/)) return write_num_flt(type, fmt.replace(/^#,#*,/, ""), val$1); - if (r$10 = fmt.match(/^([0#]+)(\\?-([0#]+))+$/)) { + if (r$9 = fmt.match(/^#,#*,#0/)) return write_num_flt(type, fmt.replace(/^#,#*,/, ""), val$1); + if (r$9 = fmt.match(/^([0#]+)(\\?-([0#]+))+$/)) { o$10 = _strrev(write_num_flt(type, fmt.replace(/[\\-]/g, ""), val$1)); ri = 0; return _strrev(_strrev(fmt.replace(/\\/g, "")).replace(/[0#]/g, function(x$3) { @@ -68670,39 +68874,39 @@ function write_num_flt(type, fmt, val$1) { return "(" + o$10.substr(0, 3) + ") " + o$10.substr(3, 3) + "-" + o$10.substr(6); } var oa = ""; - if (r$10 = fmt.match(/^([#0?]+)( ?)\/( ?)([#0?]+)/)) { - ri = Math.min(r$10[4].length, 7); + if (r$9 = fmt.match(/^([#0?]+)( ?)\/( ?)([#0?]+)/)) { + ri = Math.min(r$9[4].length, 7); ff = SSF_frac(aval, Math.pow(10, ri) - 1, false); o$10 = "" + sign; - oa = write_num("n", r$10[1], ff[1]); + oa = write_num("n", r$9[1], ff[1]); if (oa.charAt(oa.length - 1) == " ") oa = oa.substr(0, oa.length - 1) + "0"; - o$10 += oa + r$10[2] + "/" + r$10[3]; + o$10 += oa + r$9[2] + "/" + r$9[3]; oa = rpad_(ff[2], ri); - if (oa.length < r$10[4].length) oa = hashq(r$10[4].substr(r$10[4].length - oa.length)) + oa; + if (oa.length < r$9[4].length) oa = hashq(r$9[4].substr(r$9[4].length - oa.length)) + oa; o$10 += oa; return o$10; } - if (r$10 = fmt.match(/^# ([#0?]+)( ?)\/( ?)([#0?]+)/)) { - ri = Math.min(Math.max(r$10[1].length, r$10[4].length), 7); + if (r$9 = fmt.match(/^# ([#0?]+)( ?)\/( ?)([#0?]+)/)) { + ri = Math.min(Math.max(r$9[1].length, r$9[4].length), 7); ff = SSF_frac(aval, Math.pow(10, ri) - 1, true); - return sign + (ff[0] || (ff[1] ? "" : "0")) + " " + (ff[1] ? pad_(ff[1], ri) + r$10[2] + "/" + r$10[3] + rpad_(ff[2], ri) : fill(" ", 2 * ri + 1 + r$10[2].length + r$10[3].length)); + return sign + (ff[0] || (ff[1] ? "" : "0")) + " " + (ff[1] ? pad_(ff[1], ri) + r$9[2] + "/" + r$9[3] + rpad_(ff[2], ri) : fill(" ", 2 * ri + 1 + r$9[2].length + r$9[3].length)); } - if (r$10 = fmt.match(/^[#0?]+$/)) { + if (r$9 = fmt.match(/^[#0?]+$/)) { o$10 = pad0r(val$1, 0); if (fmt.length <= o$10.length) return o$10; return hashq(fmt.substr(0, fmt.length - o$10.length)) + o$10; } - if (r$10 = fmt.match(/^([#0?]+)\.([#0]+)$/)) { - o$10 = "" + val$1.toFixed(Math.min(r$10[2].length, 10)).replace(/([^0])0+$/, "$1"); + if (r$9 = fmt.match(/^([#0?]+)\.([#0]+)$/)) { + o$10 = "" + val$1.toFixed(Math.min(r$9[2].length, 10)).replace(/([^0])0+$/, "$1"); ri = o$10.indexOf("."); var lres = fmt.indexOf(".") - ri, rres = fmt.length - o$10.length - lres; return hashq(fmt.substr(0, lres) + o$10 + fmt.substr(fmt.length - rres)); } - if (r$10 = fmt.match(/^00,000\.([#0]*0)$/)) { - ri = dec(val$1, r$10[1].length); + if (r$9 = fmt.match(/^00,000\.([#0]*0)$/)) { + ri = dec(val$1, r$9[1].length); return val$1 < 0 ? "-" + write_num_flt(type, fmt, -val$1) : commaify(flr(val$1)).replace(/^\d,\d{3}$/, "0$&").replace(/^\d*$/, function($$) { return "00," + ($$.length < 3 ? pad0(0, 3 - $$.length) : "") + $$; - }) + "." + pad0(ri, r$10[1].length); + }) + "." + pad0(ri, r$9[1].length); } switch (fmt) { case "###,##0.00": return write_num_flt(type, "#,##0.00", val$1); @@ -68762,32 +68966,32 @@ function write_num_int(type, fmt, val$1) { if (fmt.indexOf("E") !== -1) return write_num_exp2(fmt, val$1); if (fmt.charCodeAt(0) === 36) return "$" + write_num_int(type, fmt.substr(fmt.charAt(1) == " " ? 2 : 1), val$1); var o$10; - var r$10, ri, ff, aval = Math.abs(val$1), sign = val$1 < 0 ? "-" : ""; + var r$9, ri, ff, aval = Math.abs(val$1), sign = val$1 < 0 ? "-" : ""; if (fmt.match(/^00+$/)) return sign + pad0(aval, fmt.length); if (fmt.match(/^[#?]+$/)) { o$10 = "" + val$1; if (val$1 === 0) o$10 = ""; return o$10.length > fmt.length ? o$10 : hashq(fmt.substr(0, fmt.length - o$10.length)) + o$10; } - if (r$10 = fmt.match(frac1)) return write_num_f2(r$10, aval, sign); + if (r$9 = fmt.match(frac1)) return write_num_f2(r$9, aval, sign); if (fmt.match(/^#+0+$/)) return sign + pad0(aval, fmt.length - fmt.indexOf("0")); - if (r$10 = fmt.match(dec1)) { - o$10 = ("" + val$1).replace(/^([^\.]+)$/, "$1." + hashq(r$10[1])).replace(/\.$/, "." + hashq(r$10[1])); + if (r$9 = fmt.match(dec1)) { + o$10 = ("" + val$1).replace(/^([^\.]+)$/, "$1." + hashq(r$9[1])).replace(/\.$/, "." + hashq(r$9[1])); o$10 = o$10.replace(/\.(\d*)$/, function($$, $1) { - return "." + $1 + fill("0", hashq(r$10[1]).length - $1.length); + return "." + $1 + fill("0", hashq(r$9[1]).length - $1.length); }); return fmt.indexOf("0.") !== -1 ? o$10 : o$10.replace(/^0\./, "."); } fmt = fmt.replace(/^#+([0.])/, "$1"); - if (r$10 = fmt.match(/^(0*)\.(#*)$/)) { - return sign + ("" + aval).replace(/\.(\d*[1-9])0*$/, ".$1").replace(/^(-?\d*)$/, "$1.").replace(/^0\./, r$10[1].length ? "0." : "."); + if (r$9 = fmt.match(/^(0*)\.(#*)$/)) { + return sign + ("" + aval).replace(/\.(\d*[1-9])0*$/, ".$1").replace(/^(-?\d*)$/, "$1.").replace(/^0\./, r$9[1].length ? "0." : "."); } - if (r$10 = fmt.match(/^#{1,3},##0(\.?)$/)) return sign + commaify("" + aval); - if (r$10 = fmt.match(/^#,##0\.([#0]*0)$/)) { - return val$1 < 0 ? "-" + write_num_int(type, fmt, -val$1) : commaify("" + val$1) + "." + fill("0", r$10[1].length); + if (r$9 = fmt.match(/^#{1,3},##0(\.?)$/)) return sign + commaify("" + aval); + if (r$9 = fmt.match(/^#,##0\.([#0]*0)$/)) { + return val$1 < 0 ? "-" + write_num_int(type, fmt, -val$1) : commaify("" + val$1) + "." + fill("0", r$9[1].length); } - if (r$10 = fmt.match(/^#,#*,#0/)) return write_num_int(type, fmt.replace(/^#,#*,/, ""), val$1); - if (r$10 = fmt.match(/^([0#]+)(\\?-([0#]+))+$/)) { + if (r$9 = fmt.match(/^#,#*,#0/)) return write_num_int(type, fmt.replace(/^#,#*,/, ""), val$1); + if (r$9 = fmt.match(/^([0#]+)(\\?-([0#]+))+$/)) { o$10 = _strrev(write_num_int(type, fmt.replace(/[\\-]/g, ""), val$1)); ri = 0; return _strrev(_strrev(fmt.replace(/\\/g, "")).replace(/[0#]/g, function(x$3) { @@ -68799,38 +69003,38 @@ function write_num_int(type, fmt, val$1) { return "(" + o$10.substr(0, 3) + ") " + o$10.substr(3, 3) + "-" + o$10.substr(6); } var oa = ""; - if (r$10 = fmt.match(/^([#0?]+)( ?)\/( ?)([#0?]+)/)) { - ri = Math.min(r$10[4].length, 7); + if (r$9 = fmt.match(/^([#0?]+)( ?)\/( ?)([#0?]+)/)) { + ri = Math.min(r$9[4].length, 7); ff = SSF_frac(aval, Math.pow(10, ri) - 1, false); o$10 = "" + sign; - oa = write_num("n", r$10[1], ff[1]); + oa = write_num("n", r$9[1], ff[1]); if (oa.charAt(oa.length - 1) == " ") oa = oa.substr(0, oa.length - 1) + "0"; - o$10 += oa + r$10[2] + "/" + r$10[3]; + o$10 += oa + r$9[2] + "/" + r$9[3]; oa = rpad_(ff[2], ri); - if (oa.length < r$10[4].length) oa = hashq(r$10[4].substr(r$10[4].length - oa.length)) + oa; + if (oa.length < r$9[4].length) oa = hashq(r$9[4].substr(r$9[4].length - oa.length)) + oa; o$10 += oa; return o$10; } - if (r$10 = fmt.match(/^# ([#0?]+)( ?)\/( ?)([#0?]+)/)) { - ri = Math.min(Math.max(r$10[1].length, r$10[4].length), 7); + if (r$9 = fmt.match(/^# ([#0?]+)( ?)\/( ?)([#0?]+)/)) { + ri = Math.min(Math.max(r$9[1].length, r$9[4].length), 7); ff = SSF_frac(aval, Math.pow(10, ri) - 1, true); - return sign + (ff[0] || (ff[1] ? "" : "0")) + " " + (ff[1] ? pad_(ff[1], ri) + r$10[2] + "/" + r$10[3] + rpad_(ff[2], ri) : fill(" ", 2 * ri + 1 + r$10[2].length + r$10[3].length)); + return sign + (ff[0] || (ff[1] ? "" : "0")) + " " + (ff[1] ? pad_(ff[1], ri) + r$9[2] + "/" + r$9[3] + rpad_(ff[2], ri) : fill(" ", 2 * ri + 1 + r$9[2].length + r$9[3].length)); } - if (r$10 = fmt.match(/^[#0?]+$/)) { + if (r$9 = fmt.match(/^[#0?]+$/)) { o$10 = "" + val$1; if (fmt.length <= o$10.length) return o$10; return hashq(fmt.substr(0, fmt.length - o$10.length)) + o$10; } - if (r$10 = fmt.match(/^([#0]+)\.([#0]+)$/)) { - o$10 = "" + val$1.toFixed(Math.min(r$10[2].length, 10)).replace(/([^0])0+$/, "$1"); + if (r$9 = fmt.match(/^([#0]+)\.([#0]+)$/)) { + o$10 = "" + val$1.toFixed(Math.min(r$9[2].length, 10)).replace(/([^0])0+$/, "$1"); ri = o$10.indexOf("."); var lres = fmt.indexOf(".") - ri, rres = fmt.length - o$10.length - lres; return hashq(fmt.substr(0, lres) + o$10 + fmt.substr(fmt.length - rres)); } - if (r$10 = fmt.match(/^00,000\.([#0]*0)$/)) { + if (r$9 = fmt.match(/^00,000\.([#0]*0)$/)) { return val$1 < 0 ? "-" + write_num_int(type, fmt, -val$1) : commaify("" + val$1).replace(/^\d,\d{3}$/, "0$&").replace(/^\d*$/, function($$) { return "00," + ($$.length < 3 ? pad0(0, 3 - $$.length) : "") + $$; - }) + "." + pad0(0, r$10[1].length); + }) + "." + pad0(0, r$9[1].length); } switch (fmt) { case "###,###": @@ -68866,9 +69070,9 @@ function SSF_split_fmt(fmt) { return out; } function fmt_is_date(fmt) { - var i$7 = 0, c$7 = "", o$10 = ""; + var i$7 = 0, c$6 = "", o$10 = ""; while (i$7 < fmt.length) { - switch (c$7 = fmt.charAt(i$7)) { + switch (c$6 = fmt.charAt(i$7)) { case "G": if (SSF_isgeneral(fmt, i$7)) i$7 += 6; i$7++; @@ -68910,17 +69114,17 @@ function fmt_is_date(fmt) { ++i$7; break; case "[": - o$10 = c$7; + o$10 = c$6; while (fmt.charAt(i$7++) !== "]" && i$7 < fmt.length) o$10 += fmt.charAt(i$7); if (o$10.match(SSF_abstime)) return true; break; case ".": case "0": case "#": - while (i$7 < fmt.length && ("0#?.,E+-%".indexOf(c$7 = fmt.charAt(++i$7)) > -1 || c$7 == "\\" && fmt.charAt(i$7 + 1) == "-" && "0#".indexOf(fmt.charAt(i$7 + 2)) > -1)) {} + while (i$7 < fmt.length && ("0#?.,E+-%".indexOf(c$6 = fmt.charAt(++i$7)) > -1 || c$6 == "\\" && fmt.charAt(i$7 + 1) == "-" && "0#".indexOf(fmt.charAt(i$7 + 2)) > -1)) {} break; case "?": - while (fmt.charAt(++i$7) === c$7) {} + while (fmt.charAt(++i$7) === c$6) {} break; case "*": ++i$7; @@ -68952,12 +69156,12 @@ function fmt_is_date(fmt) { return false; } function eval_fmt(fmt, v$3, opts, flen) { - var out = [], o$10 = "", i$7 = 0, c$7 = "", lst = "t", dt, j$2, cc; + var out = [], o$10 = "", i$7 = 0, c$6 = "", lst = "t", dt, j$2, cc; var hr = "H"; while (i$7 < fmt.length) { - switch (c$7 = fmt.charAt(i$7)) { + switch (c$6 = fmt.charAt(i$7)) { case "G": - if (!SSF_isgeneral(fmt, i$7)) throw new Error("unrecognized character " + c$7 + " in " + fmt); + if (!SSF_isgeneral(fmt, i$7)) throw new Error("unrecognized character " + c$6 + " in " + fmt); out[out.length] = { t: "G", v: "General" @@ -69004,7 +69208,7 @@ function eval_fmt(fmt, v$3, opts, flen) { t: "X", v: fmt.substr(i$7, 2) }; - lst = c$7; + lst = c$6; i$7 += 2; break; } @@ -69013,7 +69217,7 @@ function eval_fmt(fmt, v$3, opts, flen) { case "Y": case "H": case "S": - case "E": c$7 = c$7.toLowerCase(); + case "E": c$6 = c$6.toLowerCase(); case "m": case "d": case "y": @@ -69026,49 +69230,49 @@ function eval_fmt(fmt, v$3, opts, flen) { dt = SSF_parse_date_code(v$3, opts); if (dt == null) return ""; } - o$10 = c$7; - while (++i$7 < fmt.length && fmt.charAt(i$7).toLowerCase() === c$7) o$10 += c$7; - if (c$7 === "m" && lst.toLowerCase() === "h") c$7 = "M"; - if (c$7 === "h") c$7 = hr; + o$10 = c$6; + while (++i$7 < fmt.length && fmt.charAt(i$7).toLowerCase() === c$6) o$10 += c$6; + if (c$6 === "m" && lst.toLowerCase() === "h") c$6 = "M"; + if (c$6 === "h") c$6 = hr; out[out.length] = { - t: c$7, + t: c$6, v: o$10 }; - lst = c$7; + lst = c$6; break; case "A": case "a": case "上": - var q$2 = { - t: c$7, - v: c$7 + var q$1 = { + t: c$6, + v: c$6 }; if (dt == null) dt = SSF_parse_date_code(v$3, opts); if (fmt.substr(i$7, 3).toUpperCase() === "A/P") { - if (dt != null) q$2.v = dt.H >= 12 ? fmt.charAt(i$7 + 2) : c$7; - q$2.t = "T"; + if (dt != null) q$1.v = dt.H >= 12 ? fmt.charAt(i$7 + 2) : c$6; + q$1.t = "T"; hr = "h"; i$7 += 3; } else if (fmt.substr(i$7, 5).toUpperCase() === "AM/PM") { - if (dt != null) q$2.v = dt.H >= 12 ? "PM" : "AM"; - q$2.t = "T"; + if (dt != null) q$1.v = dt.H >= 12 ? "PM" : "AM"; + q$1.t = "T"; i$7 += 5; hr = "h"; } else if (fmt.substr(i$7, 5).toUpperCase() === "上午/下午") { - if (dt != null) q$2.v = dt.H >= 12 ? "下午" : "上午"; - q$2.t = "T"; + if (dt != null) q$1.v = dt.H >= 12 ? "下午" : "上午"; + q$1.t = "T"; i$7 += 5; hr = "h"; } else { - q$2.t = "t"; + q$1.t = "t"; ++i$7; } - if (dt == null && q$2.t === "T") return ""; - out[out.length] = q$2; - lst = c$7; + if (dt == null && q$1.t === "T") return ""; + out[out.length] = q$1; + lst = c$6; break; case "[": - o$10 = c$7; + o$10 = c$6; while (fmt.charAt(i$7++) !== "]" && i$7 < fmt.length) o$10 += fmt.charAt(i$7); if (o$10.slice(-1) !== "]") throw "unterminated \"[\" block: |" + o$10 + "|"; if (o$10.match(SSF_abstime)) { @@ -69090,8 +69294,8 @@ function eval_fmt(fmt, v$3, opts, flen) { } break; case ".": if (dt != null) { - o$10 = c$7; - while (++i$7 < fmt.length && (c$7 = fmt.charAt(i$7)) === "0") o$10 += c$7; + o$10 = c$6; + while (++i$7 < fmt.length && (c$6 = fmt.charAt(i$7)) === "0") o$10 += c$6; out[out.length] = { t: "s", v: o$10 @@ -69100,21 +69304,21 @@ function eval_fmt(fmt, v$3, opts, flen) { } case "0": case "#": - o$10 = c$7; - while (++i$7 < fmt.length && "0#?.,E+-%".indexOf(c$7 = fmt.charAt(i$7)) > -1) o$10 += c$7; + o$10 = c$6; + while (++i$7 < fmt.length && "0#?.,E+-%".indexOf(c$6 = fmt.charAt(i$7)) > -1) o$10 += c$6; out[out.length] = { t: "n", v: o$10 }; break; case "?": - o$10 = c$7; - while (fmt.charAt(++i$7) === c$7) o$10 += c$7; + o$10 = c$6; + while (fmt.charAt(++i$7) === c$6) o$10 += c$6; out[out.length] = { - t: c$7, + t: c$6, v: o$10 }; - lst = c$7; + lst = c$6; break; case "*": ++i$7; @@ -69123,8 +69327,8 @@ function eval_fmt(fmt, v$3, opts, flen) { case "(": case ")": out[out.length] = { - t: flen === 1 ? "t" : c$7, - v: c$7 + t: flen === 1 ? "t" : c$6, + v: c$6 }; ++i$7; break; @@ -69137,7 +69341,7 @@ function eval_fmt(fmt, v$3, opts, flen) { case "7": case "8": case "9": - o$10 = c$7; + o$10 = c$6; while (i$7 < fmt.length && "0123456789".indexOf(fmt.charAt(++i$7)) > -1) o$10 += fmt.charAt(i$7); out[out.length] = { t: "D", @@ -69146,8 +69350,8 @@ function eval_fmt(fmt, v$3, opts, flen) { break; case " ": out[out.length] = { - t: c$7, - v: c$7 + t: c$6, + v: c$6 }; ++i$7; break; @@ -69159,10 +69363,10 @@ function eval_fmt(fmt, v$3, opts, flen) { ++i$7; break; default: - if (",$-+/():!^&'~{}<>=€acfijklopqrtuvwxzP".indexOf(c$7) === -1) throw new Error("unrecognized character " + c$7 + " in " + fmt); + if (",$-+/():!^&'~{}<>=€acfijklopqrtuvwxzP".indexOf(c$6) === -1) throw new Error("unrecognized character " + c$6 + " in " + fmt); out[out.length] = { t: "t", - v: c$7 + v: c$6 }; ++i$7; break; @@ -69297,7 +69501,7 @@ function eval_fmt(fmt, v$3, opts, flen) { case "n": case "?": jj = i$7 + 1; - while (out[jj] != null && ((c$7 = out[jj].t) === "?" || c$7 === "D" || (c$7 === " " || c$7 === "t") && out[jj + 1] != null && (out[jj + 1].t === "?" || out[jj + 1].t === "t" && out[jj + 1].v === "/") || out[i$7].t === "(" && (c$7 === " " || c$7 === "n" || c$7 === ")") || c$7 === "t" && (out[jj].v === "/" || out[jj].v === " " && out[jj + 1] != null && out[jj + 1].t == "?"))) { + while (out[jj] != null && ((c$6 = out[jj].t) === "?" || c$6 === "D" || (c$6 === " " || c$6 === "t") && out[jj + 1] != null && (out[jj + 1].t === "?" || out[jj + 1].t === "t" && out[jj + 1].v === "/") || out[i$7].t === "(" && (c$6 === " " || c$6 === "n" || c$6 === ")") || c$6 === "t" && (out[jj].v === "/" || out[jj].v === " " && out[jj + 1] != null && out[jj + 1].t == "?"))) { out[i$7].v += out[jj].v; out[jj] = { v: "", @@ -69526,7 +69730,7 @@ function dateNF_regex(dateNF) { return new RegExp("^" + fmt + "$"); } function dateNF_fix(str, dateNF, match) { - var Y = -1, m$3 = -1, d$5 = -1, H$1 = -1, M$3 = -1, S$4 = -1; + var Y = -1, m$3 = -1, d$4 = -1, H$1 = -1, M$3 = -1, S$4 = -1; (dateNF.match(dateNFregex) || []).forEach(function(n$9, i$7) { var v$3 = parseInt(match[i$7 + 1], 10); switch (n$9.toLowerCase().charAt(0)) { @@ -69534,7 +69738,7 @@ function dateNF_fix(str, dateNF, match) { Y = v$3; break; case "d": - d$5 = v$3; + d$4 = v$3; break; case "h": H$1 = v$3; @@ -69553,12 +69757,12 @@ function dateNF_fix(str, dateNF, match) { M$3 = m$3; m$3 = -1; } - var datestr = ("" + (Y >= 0 ? Y : new Date().getFullYear())).slice(-4) + "-" + ("00" + (m$3 >= 1 ? m$3 : 1)).slice(-2) + "-" + ("00" + (d$5 >= 1 ? d$5 : 1)).slice(-2); + var datestr = ("" + (Y >= 0 ? Y : new Date().getFullYear())).slice(-4) + "-" + ("00" + (m$3 >= 1 ? m$3 : 1)).slice(-2) + "-" + ("00" + (d$4 >= 1 ? d$4 : 1)).slice(-2); if (datestr.length == 7) datestr = "0" + datestr; if (datestr.length == 8) datestr = "20" + datestr; var timestr = ("00" + (H$1 >= 0 ? H$1 : 0)).slice(-2) + ":" + ("00" + (M$3 >= 0 ? M$3 : 0)).slice(-2) + ":" + ("00" + (S$4 >= 0 ? S$4 : 0)).slice(-2); if (H$1 == -1 && M$3 == -1 && S$4 == -1) return datestr; - if (Y == -1 && m$3 == -1 && d$5 == -1) return timestr; + if (Y == -1 && m$3 == -1 && d$4 == -1) return timestr; return datestr + "T" + timestr; } function SSF__load(fmt, idx) { @@ -69724,8 +69928,8 @@ function parseDate(str, date1904) { if (m$3) return new Date(Date.UTC(+m$3[1], +m$3[2] - 1, +m$3[3], 0, 0, 0, 0)); m$3 = str.match(pdre3); if (m$3) return new Date(Date.UTC(+m$3[1], +m$3[2] - 1, +m$3[3], +m$3[4], +m$3[5], m$3[6] && parseInt(m$3[6].slice(1), 10) || 0, m$3[7] && parseInt((m$3[7] + "0000").slice(1, 4), 10) || 0)); - var d$5 = new Date(str); - return d$5; + var d$4 = new Date(str); + return d$4; } function cc2str(arr, debomit) { if (has_buf && Buffer.isBuffer(arr)) { @@ -69770,8 +69974,8 @@ function cc2str(arr, debomit) { "Ÿ": "Ÿ" }; if (Array.isArray(arr)) arr = new Uint8Array(arr); - return new TextDecoder("latin1").decode(arr).replace(/[€‚ƒ„…†‡ˆ‰Š‹ŒŽ‘’“”•–—˜™š›œžŸ]/g, function(c$7) { - return rev[c$7] || c$7; + return new TextDecoder("latin1").decode(arr).replace(/[€‚ƒ„…†‡ˆ‰Š‹ŒŽ‘’“”•–—˜™š›œžŸ]/g, function(c$6) { + return rev[c$6] || c$6; }); } catch (e$10) {} var o$10 = [], i$7 = 0; @@ -69796,9 +70000,9 @@ function dup(o$10) { for (var k$2 in o$10) if (Object.prototype.hasOwnProperty.call(o$10, k$2)) out[k$2] = dup(o$10[k$2]); return out; } -function fill(c$7, l$3) { +function fill(c$6, l$3) { var o$10 = ""; - while (o$10.length < l$3) o$10 += c$7; + while (o$10.length < l$3) o$10 += c$6; return o$10; } function fuzzynum(s$5) { @@ -69845,8 +70049,8 @@ function fuzzydate(s$5) { M$3 = lnos.match(pdre3); if (M$3) return new Date(Date.UTC(+M$3[1], +M$3[2] - 1, +M$3[3], +M$3[4], +M$3[5], M$3[6] && parseInt(M$3[6].slice(1), 10) || 0, M$3[7] && parseInt((M$3[7] + "0000").slice(1, 4), 10) || 0)); var o$10 = new Date(utc_append_works && s$5.indexOf("UTC") == -1 ? s$5 + " UTC" : s$5), n$9 = new Date(NaN); - var y$3 = o$10.getYear(), m$3 = o$10.getMonth(), d$5 = o$10.getDate(); - if (isNaN(d$5)) return n$9; + var y$3 = o$10.getYear(), m$3 = o$10.getMonth(), d$4 = o$10.getDate(); + if (isNaN(d$4)) return n$9; if (lower.match(/jan|feb|mar|apr|may|jun|jul|aug|sep|oct|nov|dec/)) { lower = lower.replace(/[^a-z]/g, "").replace(/([^a-z]|^)[ap]m?([^a-z]|$)/, ""); if (lower.length > 3 && lower_months.indexOf(lower) == -1) return n$9; @@ -69989,12 +70193,12 @@ function zip_add_file(zip, path$1, content) { function zip_new() { return CFB.utils.cfb_new(); } -function zip_read(d$5, o$10) { +function zip_read(d$4, o$10) { switch (o$10.type) { - case "base64": return CFB.read(d$5, { type: "base64" }); - case "binary": return CFB.read(d$5, { type: "binary" }); + case "base64": return CFB.read(d$4, { type: "base64" }); + case "binary": return CFB.read(d$4, { type: "binary" }); case "buffer": - case "array": return CFB.read(d$5, { type: "buffer" }); + case "array": return CFB.read(d$4, { type: "buffer" }); } throw new Error("Unrecognized type " + o$10.type); } @@ -70012,26 +70216,26 @@ function resolve_path(path$1, base) { } function parsexmltag(tag, skip_root, skip_LC) { var z$2 = {}; - var eq = 0, c$7 = 0; - for (; eq !== tag.length; ++eq) if ((c$7 = tag.charCodeAt(eq)) === 32 || c$7 === 10 || c$7 === 13) break; + var eq = 0, c$6 = 0; + for (; eq !== tag.length; ++eq) if ((c$6 = tag.charCodeAt(eq)) === 32 || c$6 === 10 || c$6 === 13) break; if (!skip_root) z$2[0] = tag.slice(0, eq); if (eq === tag.length) return z$2; - var m$3 = tag.match(attregexg), j$2 = 0, v$3 = "", i$7 = 0, q$2 = "", cc = "", quot = 1; + var m$3 = tag.match(attregexg), j$2 = 0, v$3 = "", i$7 = 0, q$1 = "", cc = "", quot = 1; if (m$3) for (i$7 = 0; i$7 != m$3.length; ++i$7) { cc = m$3[i$7].slice(1); - for (c$7 = 0; c$7 != cc.length; ++c$7) if (cc.charCodeAt(c$7) === 61) break; - q$2 = cc.slice(0, c$7).trim(); - while (cc.charCodeAt(c$7 + 1) == 32) ++c$7; - quot = (eq = cc.charCodeAt(c$7 + 1)) == 34 || eq == 39 ? 1 : 0; - v$3 = cc.slice(c$7 + 1 + quot, cc.length - quot); - for (j$2 = 0; j$2 != q$2.length; ++j$2) if (q$2.charCodeAt(j$2) === 58) break; - if (j$2 === q$2.length) { - if (q$2.indexOf("_") > 0) q$2 = q$2.slice(0, q$2.indexOf("_")); - z$2[q$2] = v$3; - if (!skip_LC) z$2[q$2.toLowerCase()] = v$3; + for (c$6 = 0; c$6 != cc.length; ++c$6) if (cc.charCodeAt(c$6) === 61) break; + q$1 = cc.slice(0, c$6).trim(); + while (cc.charCodeAt(c$6 + 1) == 32) ++c$6; + quot = (eq = cc.charCodeAt(c$6 + 1)) == 34 || eq == 39 ? 1 : 0; + v$3 = cc.slice(c$6 + 1 + quot, cc.length - quot); + for (j$2 = 0; j$2 != q$1.length; ++j$2) if (q$1.charCodeAt(j$2) === 58) break; + if (j$2 === q$1.length) { + if (q$1.indexOf("_") > 0) q$1 = q$1.slice(0, q$1.indexOf("_")); + z$2[q$1] = v$3; + if (!skip_LC) z$2[q$1.toLowerCase()] = v$3; } else { - var k$2 = (j$2 === 5 && q$2.slice(0, 5) === "xmlns" ? "xmlns" : "") + q$2.slice(j$2 + 1); - if (z$2[k$2] && q$2.slice(j$2 - 3, j$2) == "ext") continue; + var k$2 = (j$2 === 5 && q$1.slice(0, 5) === "xmlns" ? "xmlns" : "") + q$1.slice(j$2 + 1); + if (z$2[k$2] && q$1.slice(j$2 - 3, j$2) == "ext") continue; z$2[k$2] = v$3; if (!skip_LC) z$2[k$2.toLowerCase()] = v$3; } @@ -70040,21 +70244,21 @@ function parsexmltag(tag, skip_root, skip_LC) { } function parsexmltagraw(tag, skip_root, skip_LC) { var z$2 = {}; - var eq = 0, c$7 = 0; - for (; eq !== tag.length; ++eq) if ((c$7 = tag.charCodeAt(eq)) === 32 || c$7 === 10 || c$7 === 13) break; + var eq = 0, c$6 = 0; + for (; eq !== tag.length; ++eq) if ((c$6 = tag.charCodeAt(eq)) === 32 || c$6 === 10 || c$6 === 13) break; if (!skip_root) z$2[0] = tag.slice(0, eq); if (eq === tag.length) return z$2; - var m$3 = tag.match(attregexg), j$2 = 0, v$3 = "", i$7 = 0, q$2 = "", cc = "", quot = 1; + var m$3 = tag.match(attregexg), j$2 = 0, v$3 = "", i$7 = 0, q$1 = "", cc = "", quot = 1; if (m$3) for (i$7 = 0; i$7 != m$3.length; ++i$7) { cc = m$3[i$7].slice(1); - for (c$7 = 0; c$7 != cc.length; ++c$7) if (cc.charCodeAt(c$7) === 61) break; - q$2 = cc.slice(0, c$7).trim(); - while (cc.charCodeAt(c$7 + 1) == 32) ++c$7; - quot = (eq = cc.charCodeAt(c$7 + 1)) == 34 || eq == 39 ? 1 : 0; - v$3 = cc.slice(c$7 + 1 + quot, cc.length - quot); - if (q$2.indexOf("_") > 0) q$2 = q$2.slice(0, q$2.indexOf("_")); - z$2[q$2] = v$3; - if (!skip_LC) z$2[q$2.toLowerCase()] = v$3; + for (c$6 = 0; c$6 != cc.length; ++c$6) if (cc.charCodeAt(c$6) === 61) break; + q$1 = cc.slice(0, c$6).trim(); + while (cc.charCodeAt(c$6 + 1) == 32) ++c$6; + quot = (eq = cc.charCodeAt(c$6 + 1)) == 34 || eq == 39 ? 1 : 0; + v$3 = cc.slice(c$6 + 1 + quot, cc.length - quot); + if (q$1.indexOf("_") > 0) q$1 = q$1.slice(0, q$1.indexOf("_")); + z$2[q$1] = v$3; + if (!skip_LC) z$2[q$1.toLowerCase()] = v$3; } return z$2; } @@ -70105,46 +70309,46 @@ function parsexmlbool(value) { return false; } function utf8reada(orig) { - var out = "", i$7 = 0, c$7 = 0, d$5 = 0, e$10 = 0, f$4 = 0, w$2 = 0; + var out = "", i$7 = 0, c$6 = 0, d$4 = 0, e$10 = 0, f$4 = 0, w$2 = 0; while (i$7 < orig.length) { - c$7 = orig.charCodeAt(i$7++); - if (c$7 < 128) { - out += String.fromCharCode(c$7); + c$6 = orig.charCodeAt(i$7++); + if (c$6 < 128) { + out += String.fromCharCode(c$6); continue; } - d$5 = orig.charCodeAt(i$7++); - if (c$7 > 191 && c$7 < 224) { - f$4 = (c$7 & 31) << 6; - f$4 |= d$5 & 63; + d$4 = orig.charCodeAt(i$7++); + if (c$6 > 191 && c$6 < 224) { + f$4 = (c$6 & 31) << 6; + f$4 |= d$4 & 63; out += String.fromCharCode(f$4); continue; } e$10 = orig.charCodeAt(i$7++); - if (c$7 < 240) { - out += String.fromCharCode((c$7 & 15) << 12 | (d$5 & 63) << 6 | e$10 & 63); + if (c$6 < 240) { + out += String.fromCharCode((c$6 & 15) << 12 | (d$4 & 63) << 6 | e$10 & 63); continue; } f$4 = orig.charCodeAt(i$7++); - w$2 = ((c$7 & 7) << 18 | (d$5 & 63) << 12 | (e$10 & 63) << 6 | f$4 & 63) - 65536; + w$2 = ((c$6 & 7) << 18 | (d$4 & 63) << 12 | (e$10 & 63) << 6 | f$4 & 63) - 65536; out += String.fromCharCode(55296 + (w$2 >>> 10 & 1023)); out += String.fromCharCode(56320 + (w$2 & 1023)); } return out; } function utf8readb(data) { - var out = new_raw_buf(2 * data.length), w$2, i$7, j$2 = 1, k$2 = 0, ww = 0, c$7; + var out = new_raw_buf(2 * data.length), w$2, i$7, j$2 = 1, k$2 = 0, ww = 0, c$6; for (i$7 = 0; i$7 < data.length; i$7 += j$2) { j$2 = 1; - if ((c$7 = data.charCodeAt(i$7)) < 128) w$2 = c$7; - else if (c$7 < 224) { - w$2 = (c$7 & 31) * 64 + (data.charCodeAt(i$7 + 1) & 63); + if ((c$6 = data.charCodeAt(i$7)) < 128) w$2 = c$6; + else if (c$6 < 224) { + w$2 = (c$6 & 31) * 64 + (data.charCodeAt(i$7 + 1) & 63); j$2 = 2; - } else if (c$7 < 240) { - w$2 = (c$7 & 15) * 4096 + (data.charCodeAt(i$7 + 1) & 63) * 64 + (data.charCodeAt(i$7 + 2) & 63); + } else if (c$6 < 240) { + w$2 = (c$6 & 15) * 4096 + (data.charCodeAt(i$7 + 1) & 63) * 64 + (data.charCodeAt(i$7 + 2) & 63); j$2 = 3; } else { j$2 = 4; - w$2 = (c$7 & 7) * 262144 + (data.charCodeAt(i$7 + 1) & 63) * 4096 + (data.charCodeAt(i$7 + 2) & 63) * 64 + (data.charCodeAt(i$7 + 3) & 63); + w$2 = (c$6 & 7) * 262144 + (data.charCodeAt(i$7 + 1) & 63) * 4096 + (data.charCodeAt(i$7 + 2) & 63) * 64 + (data.charCodeAt(i$7 + 3) & 63); w$2 -= 65536; ww = 55296 + (w$2 >>> 10 & 1023); w$2 = 56320 + (w$2 & 1023); @@ -70190,9 +70394,9 @@ function wxt_helper(h$5) { function writextag(f$4, g$1, h$5) { return "<" + f$4 + (h$5 != null ? wxt_helper(h$5) : "") + (g$1 != null ? (g$1.match(wtregex) ? " xml:space=\"preserve\"" : "") + ">" + g$1 + ""; } -function write_w3cdtf(d$5, t$6) { +function write_w3cdtf(d$4, t$6) { try { - return d$5.toISOString().replace(/\.\d*/, ""); + return d$4.toISOString().replace(/\.\d*/, ""); } catch (e$10) { if (t$6) throw e$10; } @@ -70210,10 +70414,10 @@ function write_vt(s$5, xlsx) { if (s$5 instanceof Date) return writextag("vt:filetime", write_w3cdtf(s$5)); throw new Error("Unable to serialize " + s$5); } -function xlml_normalize(d$5) { - if (has_buf && Buffer.isBuffer(d$5)) return d$5.toString("utf8"); - if (typeof d$5 === "string") return d$5; - if (typeof Uint8Array !== "undefined" && d$5 instanceof Uint8Array) return utf8read(a2s(ab2a(d$5))); +function xlml_normalize(d$4) { + if (has_buf && Buffer.isBuffer(d$4)) return d$4.toString("utf8"); + if (typeof d$4 === "string") return d$4; + if (typeof Uint8Array !== "undefined" && d$4 instanceof Uint8Array) return utf8read(a2s(ab2a(d$4))); throw new Error("Bad input format: expected Buffer or string"); } function read_double_le(b$3, idx) { @@ -70427,20 +70631,20 @@ function WriteShift(t$6, val$1, f$4) { } else if (f$4 === "sbcs" || f$4 == "cpstr") { if (typeof $cptable !== "undefined" && current_ansi == 874) { for (i$7 = 0; i$7 != val$1.length; ++i$7) { - var cpp$1 = $cptable.utils.encode(current_ansi, val$1.charAt(i$7)); - this[this.l + i$7] = cpp$1[0]; + var cpp = $cptable.utils.encode(current_ansi, val$1.charAt(i$7)); + this[this.l + i$7] = cpp[0]; } size = val$1.length; } else if (typeof $cptable !== "undefined" && f$4 == "cpstr") { - cpp$1 = $cptable.utils.encode(current_codepage, val$1); - if (cpp$1.length == val$1.length) { - for (i$7 = 0; i$7 < val$1.length; ++i$7) if (cpp$1[i$7] == 0 && val$1.charCodeAt(i$7) != 0) cpp$1[i$7] = 95; + cpp = $cptable.utils.encode(current_codepage, val$1); + if (cpp.length == val$1.length) { + for (i$7 = 0; i$7 < val$1.length; ++i$7) if (cpp[i$7] == 0 && val$1.charCodeAt(i$7) != 0) cpp[i$7] = 95; } - if (cpp$1.length == 2 * val$1.length) { - for (i$7 = 0; i$7 < val$1.length; ++i$7) if (cpp$1[2 * i$7] == 0 && cpp$1[2 * i$7 + 1] == 0 && val$1.charCodeAt(i$7) != 0) cpp$1[2 * i$7] = 95; + if (cpp.length == 2 * val$1.length) { + for (i$7 = 0; i$7 < val$1.length; ++i$7) if (cpp[2 * i$7] == 0 && cpp[2 * i$7 + 1] == 0 && val$1.charCodeAt(i$7) != 0) cpp[2 * i$7] = 95; } - for (i$7 = 0; i$7 < cpp$1.length; ++i$7) this[this.l + i$7] = cpp$1[i$7]; - size = cpp$1.length; + for (i$7 = 0; i$7 < cpp.length; ++i$7) this[this.l + i$7] = cpp[i$7]; + size = cpp.length; } else { val$1 = val$1.replace(/[^\x00-\x7F]/g, "_"); for (i$7 = 0; i$7 != val$1.length; ++i$7) this[this.l + i$7] = val$1.charCodeAt(i$7) & 255; @@ -70530,9 +70734,9 @@ function recordhopper(data, cb, opts) { length = tmpbyte & 127; for (cntbyte = 1; cntbyte < 4 && tmpbyte & 128; ++cntbyte) length += ((tmpbyte = data.read_shift(1)) & 127) << 7 * cntbyte; tgt = data.l + length; - var d$5 = R$1.f && R$1.f(data, length, opts); + var d$4 = R$1.f && R$1.f(data, length, opts); data.l = tgt; - if (cb(d$5, R$1, RT)) return; + if (cb(d$4, R$1, RT)) return; } } function buf_array() { @@ -70628,32 +70832,32 @@ function shift_range_xls(cell, range, opts) { out.e = shift_cell_xls(out.e, range.s, opts); return out; } -function encode_cell_xls(c$7, biff) { - if (c$7.cRel && c$7.c < 0) { - c$7 = dup(c$7); - while (c$7.c < 0) c$7.c += biff > 8 ? 16384 : 256; +function encode_cell_xls(c$6, biff) { + if (c$6.cRel && c$6.c < 0) { + c$6 = dup(c$6); + while (c$6.c < 0) c$6.c += biff > 8 ? 16384 : 256; } - if (c$7.rRel && c$7.r < 0) { - c$7 = dup(c$7); - while (c$7.r < 0) c$7.r += biff > 8 ? 1048576 : biff > 5 ? 65536 : 16384; + if (c$6.rRel && c$6.r < 0) { + c$6 = dup(c$6); + while (c$6.r < 0) c$6.r += biff > 8 ? 1048576 : biff > 5 ? 65536 : 16384; } - var s$5 = encode_cell(c$7); - if (!c$7.cRel && c$7.cRel != null) s$5 = fix_col(s$5); - if (!c$7.rRel && c$7.rRel != null) s$5 = fix_row(s$5); + var s$5 = encode_cell(c$6); + if (!c$6.cRel && c$6.cRel != null) s$5 = fix_col(s$5); + if (!c$6.rRel && c$6.rRel != null) s$5 = fix_row(s$5); return s$5; } -function encode_range_xls(r$10, opts) { - if (r$10.s.r == 0 && !r$10.s.rRel) { - if (r$10.e.r == (opts.biff >= 12 ? 1048575 : opts.biff >= 8 ? 65536 : 16384) && !r$10.e.rRel) { - return (r$10.s.cRel ? "" : "$") + encode_col(r$10.s.c) + ":" + (r$10.e.cRel ? "" : "$") + encode_col(r$10.e.c); +function encode_range_xls(r$9, opts) { + if (r$9.s.r == 0 && !r$9.s.rRel) { + if (r$9.e.r == (opts.biff >= 12 ? 1048575 : opts.biff >= 8 ? 65536 : 16384) && !r$9.e.rRel) { + return (r$9.s.cRel ? "" : "$") + encode_col(r$9.s.c) + ":" + (r$9.e.cRel ? "" : "$") + encode_col(r$9.e.c); } } - if (r$10.s.c == 0 && !r$10.s.cRel) { - if (r$10.e.c == (opts.biff >= 12 ? 16383 : 255) && !r$10.e.cRel) { - return (r$10.s.rRel ? "" : "$") + encode_row(r$10.s.r) + ":" + (r$10.e.rRel ? "" : "$") + encode_row(r$10.e.r); + if (r$9.s.c == 0 && !r$9.s.cRel) { + if (r$9.e.c == (opts.biff >= 12 ? 16383 : 255) && !r$9.e.cRel) { + return (r$9.s.rRel ? "" : "$") + encode_row(r$9.s.r) + ":" + (r$9.e.rRel ? "" : "$") + encode_row(r$9.e.r); } } - return encode_cell_xls(r$10.s, opts.biff) + ":" + encode_cell_xls(r$10.e, opts.biff); + return encode_cell_xls(r$9.s, opts.biff) + ":" + encode_cell_xls(r$9.e, opts.biff); } function decode_row(rowstr) { return parseInt(unfix_row(rowstr), 10) - 1; @@ -70668,9 +70872,9 @@ function unfix_row(cstr) { return cstr.replace(/\$(\d+)$/, "$1"); } function decode_col(colstr) { - var c$7 = unfix_col(colstr), d$5 = 0, i$7 = 0; - for (; i$7 !== c$7.length; ++i$7) d$5 = 26 * d$5 + c$7.charCodeAt(i$7) - 64; - return d$5 - 1; + var c$6 = unfix_col(colstr), d$4 = 0, i$7 = 0; + for (; i$7 !== c$6.length; ++i$7) d$4 = 26 * d$4 + c$6.charCodeAt(i$7) - 64; + return d$4 - 1; } function encode_col(col) { if (col < 0) throw new Error("invalid column " + col); @@ -70775,12 +70979,12 @@ function safe_decode_range(range) { return o$10; } function safe_format_cell(cell, v$3) { - var q$2 = cell.t == "d" && v$3 instanceof Date; + var q$1 = cell.t == "d" && v$3 instanceof Date; if (cell.z != null) try { - return cell.w = SSF_format(cell.z, q$2 ? datenum(v$3) : v$3); + return cell.w = SSF_format(cell.z, q$1 ? datenum(v$3) : v$3); } catch (e$10) {} try { - return cell.w = SSF_format((cell.XF || {}).numFmtId || (q$2 ? 14 : 0), q$2 ? datenum(v$3) : v$3); + return cell.w = SSF_format((cell.XF || {}).numFmtId || (q$1 ? 14 : 0), q$1 ? datenum(v$3) : v$3); } catch (e$10) { return "" + v$3; } @@ -71081,12 +71285,12 @@ function parse_RfX(data) { cell.e.c = data.read_shift(4); return cell; } -function write_RfX(r$10, o$10) { +function write_RfX(r$9, o$10) { if (!o$10) o$10 = new_buf(16); - o$10.write_shift(4, r$10.s.r); - o$10.write_shift(4, r$10.e.r); - o$10.write_shift(4, r$10.s.c); - o$10.write_shift(4, r$10.e.c); + o$10.write_shift(4, r$9.s.r); + o$10.write_shift(4, r$9.e.r); + o$10.write_shift(4, r$9.s.c); + o$10.write_shift(4, r$9.e.c); return o$10; } function parse_Xnum(data) { @@ -71098,8 +71302,8 @@ function write_Xnum(data, o$10) { } function parse_BrtColor(data) { var out = {}; - var d$5 = data.read_shift(1); - var xColorType = d$5 >>> 1; + var d$4 = data.read_shift(1); + var xColorType = d$4 >>> 1; var index = data.read_shift(1); var nTS = data.read_shift(2, "i"); var bR = data.read_shift(1); @@ -71165,17 +71369,17 @@ function write_BrtColor(color, o$10) { return o$10; } function parse_FontFlags(data) { - var d$5 = data.read_shift(1); + var d$4 = data.read_shift(1); data.l++; var out = { - fBold: d$5 & 1, - fItalic: d$5 & 2, - fUnderline: d$5 & 4, - fStrikeout: d$5 & 8, - fOutline: d$5 & 16, - fShadow: d$5 & 32, - fCondense: d$5 & 64, - fExtend: d$5 & 128 + fBold: d$4 & 1, + fItalic: d$4 & 2, + fUnderline: d$4 & 4, + fStrikeout: d$4 & 8, + fOutline: d$4 & 16, + fShadow: d$4 & 32, + fCondense: d$4 & 64, + fExtend: d$4 & 128 }; return out; } @@ -71409,8 +71613,8 @@ function add_rels(rels, rId, f$4, type, relobj, targetmode) { rels[("/" + relobj.Target).replace("//", "/")] = relobj; return rId; } -function parse_manifest(d$5, opts) { - var str = xlml_normalize(d$5); +function parse_manifest(d$4, opts) { + var str = xlml_normalize(d$4); var Rn; var FEtag; while (Rn = xlmlregex.exec(str)) switch (Rn[3]) { @@ -71555,25 +71759,25 @@ function load_props_pairs(HP, TOP, props, opts) { } } function parse_ext_props(data, p$3, opts) { - var q$2 = {}; + var q$1 = {}; if (!p$3) p$3 = {}; data = utf8read(data); EXT_PROPS.forEach(function(f$4) { - var xml$2 = (str_match_xml_ns(data, f$4[0]) || [])[1]; + var xml$1 = (str_match_xml_ns(data, f$4[0]) || [])[1]; switch (f$4[2]) { case "string": - if (xml$2) p$3[f$4[1]] = unescapexml(xml$2); + if (xml$1) p$3[f$4[1]] = unescapexml(xml$1); break; case "bool": - p$3[f$4[1]] = xml$2 === "true"; + p$3[f$4[1]] = xml$1 === "true"; break; case "raw": var cur = str_match_xml(data, f$4[0]); - if (cur && cur.length > 0) q$2[f$4[1]] = cur[1]; + if (cur && cur.length > 0) q$1[f$4[1]] = cur[1]; break; } }); - if (q$2.HeadingPairs && q$2.TitlesOfParts) load_props_pairs(q$2.HeadingPairs, q$2.TitlesOfParts, p$3, opts); + if (q$1.HeadingPairs && q$1.TitlesOfParts) load_props_pairs(q$1.HeadingPairs, q$1.TitlesOfParts, p$3, opts); return p$3; } function write_ext_props(cp) { @@ -72450,9 +72654,9 @@ function write_Hyperlink(hl) { return out.slice(0, out.l); } function parse_LongRGBA(blob) { - var r$10 = blob.read_shift(1), g$1 = blob.read_shift(1), b$3 = blob.read_shift(1), a$2 = blob.read_shift(1); + var r$9 = blob.read_shift(1), g$1 = blob.read_shift(1), b$3 = blob.read_shift(1), a$2 = blob.read_shift(1); return [ - r$10, + r$9, g$1, b$3, a$2 @@ -72538,12 +72742,12 @@ function parse_Ref8U(blob) { } }; } -function write_Ref8U(r$10, o$10) { +function write_Ref8U(r$9, o$10) { if (!o$10) o$10 = new_buf(8); - o$10.write_shift(2, r$10.s.r); - o$10.write_shift(2, r$10.e.r); - o$10.write_shift(2, r$10.s.c); - o$10.write_shift(2, r$10.e.c); + o$10.write_shift(2, r$9.s.r); + o$10.write_shift(2, r$9.e.r); + o$10.write_shift(2, r$9.s.c); + o$10.write_shift(2, r$9.e.c); return o$10; } function parse_RefU(blob) { @@ -72954,13 +73158,13 @@ function write_BIFF4Format(f$4) { function parse_Dimensions(blob, length, opts) { var end = blob.l + length; var w$2 = opts.biff == 8 || !opts.biff ? 4 : 2; - var r$10 = blob.read_shift(w$2), R$1 = blob.read_shift(w$2); - var c$7 = blob.read_shift(2), C$2 = blob.read_shift(2); + var r$9 = blob.read_shift(w$2), R$1 = blob.read_shift(w$2); + var c$6 = blob.read_shift(2), C$2 = blob.read_shift(2); blob.l = end; return { s: { - r: r$10, - c: c$7 + r: r$9, + c: c$6 }, e: { r: R$1, @@ -73021,8 +73225,8 @@ function parse_MulBlank(blob, length) { function parse_CellStyleXF(blob, length, style, opts) { var o$10 = {}; var a$2 = blob.read_shift(4), b$3 = blob.read_shift(4); - var c$7 = blob.read_shift(4), d$5 = blob.read_shift(2); - o$10.patternType = XLSFillPattern[c$7 >> 26]; + var c$6 = blob.read_shift(4), d$4 = blob.read_shift(2); + o$10.patternType = XLSFillPattern[c$6 >> 26]; if (!opts.cellStyles) return o$10; o$10.alc = a$2 & 7; o$10.fWrap = a$2 >> 3 & 1; @@ -73045,13 +73249,13 @@ function parse_CellStyleXF(blob, length, style, opts) { o$10.icvLeft = b$3 >> 16 & 127; o$10.icvRight = b$3 >> 23 & 127; o$10.grbitDiag = b$3 >> 30 & 3; - o$10.icvTop = c$7 & 127; - o$10.icvBottom = c$7 >> 7 & 127; - o$10.icvDiag = c$7 >> 14 & 127; - o$10.dgDiag = c$7 >> 21 & 15; - o$10.icvFore = d$5 & 127; - o$10.icvBack = d$5 >> 7 & 127; - o$10.fsxButton = d$5 >> 14 & 1; + o$10.icvTop = c$6 & 127; + o$10.icvBottom = c$6 >> 7 & 127; + o$10.icvDiag = c$6 >> 14 & 127; + o$10.dgDiag = c$6 >> 21 & 15; + o$10.icvFore = d$4 & 127; + o$10.icvBack = d$4 >> 7 & 127; + o$10.fsxButton = d$4 >> 14 & 1; return o$10; } function parse_XF(blob, length, opts) { @@ -73448,11 +73652,11 @@ function write_HLinkTooltip(hl) { return O; } function parse_Country(blob) { - var o$10 = [0, 0], d$5; - d$5 = blob.read_shift(2); - o$10[0] = CountryEnum[d$5] || d$5; - d$5 = blob.read_shift(2); - o$10[1] = CountryEnum[d$5] || d$5; + var o$10 = [0, 0], d$4; + d$4 = blob.read_shift(2); + o$10[0] = CountryEnum[d$4] || d$4; + d$4 = blob.read_shift(2); + o$10[1] = CountryEnum[d$4] || d$4; return o$10; } function write_Country(o$10) { @@ -73531,9 +73735,9 @@ function parse_ShtProps(blob, length, opts) { blob.l += length; return def; } - var d$5 = blob.read_shift(1); + var d$4 = blob.read_shift(1); blob.l += 3; - if (d$5 & 16) def.area = true; + if (d$4 & 16) def.area = true; return def; } function write_RRTabId(n$9) { @@ -73554,10 +73758,10 @@ function parse_ImData(blob) { blob.l += lcb; return o$10; } -function write_BIFF2Cell(out, r$10, c$7, ixfe, ifmt) { +function write_BIFF2Cell(out, r$9, c$6, ixfe, ifmt) { if (!out) out = new_buf(7); - out.write_shift(2, r$10); - out.write_shift(2, c$7); + out.write_shift(2, r$9); + out.write_shift(2, c$6); out.write_shift(1, ixfe || 0); out.write_shift(1, ifmt || 0); out.write_shift(1, 0); @@ -73578,9 +73782,9 @@ function parse_BIFF2NUM(blob, length, opts) { cell.val = num; return cell; } -function write_BIFF2NUM(r$10, c$7, val$1, ixfe, ifmt) { +function write_BIFF2NUM(r$9, c$6, val$1, ixfe, ifmt) { var out = new_buf(15); - write_BIFF2Cell(out, r$10, c$7, ixfe || 0, ifmt || 0); + write_BIFF2Cell(out, r$9, c$6, ixfe || 0, ifmt || 0); out.write_shift(8, val$1, "f"); return out; } @@ -73591,9 +73795,9 @@ function parse_BIFF2INT(blob, length, opts) { cell.val = num; return cell; } -function write_BIFF2INT(r$10, c$7, val$1, ixfe, ifmt) { +function write_BIFF2INT(r$9, c$6, val$1, ixfe, ifmt) { var out = new_buf(9); - write_BIFF2Cell(out, r$10, c$7, ixfe || 0, ifmt || 0); + write_BIFF2Cell(out, r$9, c$6, ixfe || 0, ifmt || 0); out.write_shift(2, val$1); return out; } @@ -73641,17 +73845,17 @@ function parse_BIFF4SheetInfo(blob) { name }; } -function read_wb_ID(d$5, opts) { +function read_wb_ID(d$4, opts) { var o$10 = opts || {}, OLD_WTF = !!o$10.WTF; o$10.WTF = true; try { - var out = SYLK.to_workbook(d$5, o$10); + var out = SYLK.to_workbook(d$4, o$10); o$10.WTF = OLD_WTF; return out; } catch (e$10) { o$10.WTF = OLD_WTF; if (e$10.message.indexOf("SYLK bad record ID") == -1 && OLD_WTF) throw e$10; - return PRN.to_workbook(d$5, opts); + return PRN.to_workbook(d$4, opts); } } function parse_rpr(rpr) { @@ -74005,9 +74209,9 @@ function parse_EncInfoAgl(blob) { "saltValue" ]; blob.l += 4; - var xml$2 = blob.read_shift(blob.length - blob.l, "utf8"); + var xml$1 = blob.read_shift(blob.length - blob.l, "utf8"); var o$10 = {}; - xml$2.replace(tagregex, function xml_agile(x$2) { + xml$1.replace(tagregex, function xml_agile(x$2) { var y$3 = parsexmltag(x$2); switch (strip_ns(y$3[0])) { case "= 8 ? length : length - 2, opts, o$10); return o$10; } -function rtf_to_sheet(d$5, opts) { +function rtf_to_sheet(d$4, opts) { switch (opts.type) { - case "base64": return rtf_to_sheet_str(Base64_decode(d$5), opts); - case "binary": return rtf_to_sheet_str(d$5, opts); - case "buffer": return rtf_to_sheet_str(has_buf && Buffer.isBuffer(d$5) ? d$5.toString("binary") : a2s(d$5), opts); - case "array": return rtf_to_sheet_str(cc2str(d$5), opts); + case "base64": return rtf_to_sheet_str(Base64_decode(d$4), opts); + case "binary": return rtf_to_sheet_str(d$4, opts); + case "buffer": return rtf_to_sheet_str(has_buf && Buffer.isBuffer(d$4) ? d$4.toString("binary") : a2s(d$4), opts); + case "array": return rtf_to_sheet_str(cc2str(d$4), opts); } throw new Error("Unrecognized type " + opts.type); } @@ -74181,22 +74385,22 @@ function rtf_to_sheet_str(str, opts) { ws["!ref"] = encode_range(range); return ws; } -function rtf_to_workbook(d$5, opts) { - var wb = sheet_to_workbook(rtf_to_sheet(d$5, opts), opts); +function rtf_to_workbook(d$4, opts) { + var wb = sheet_to_workbook(rtf_to_sheet(d$4, opts), opts); wb.bookType = "rtf"; return wb; } function sheet_to_rtf(ws, opts) { var o$10 = ["{\\rtf1\\ansi"]; if (!ws["!ref"]) return o$10[0] + "}"; - var r$10 = safe_decode_range(ws["!ref"]), cell; + var r$9 = safe_decode_range(ws["!ref"]), cell; var dense = ws["!data"] != null, row = []; - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { o$10.push("\\trowd\\trautofit1"); - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) o$10.push("\\cellx" + (C$2 + 1)); + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) o$10.push("\\cellx" + (C$2 + 1)); o$10.push("\\pard\\intbl"); if (dense) row = ws["!data"][R$1] || []; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { var coord = encode_cell({ r: R$1, c: C$2 @@ -74703,8 +74907,8 @@ function write_numFmts(NF) { [23, 26], [41, 44], [50, 392] - ].forEach(function(r$10) { - for (var i$7 = r$10[0]; i$7 <= r$10[1]; ++i$7) if (NF[i$7] != null) o$10[o$10.length] = writextag("numFmt", null, { + ].forEach(function(r$9) { + for (var i$7 = r$9[0]; i$7 <= r$9[1]; ++i$7) if (NF[i$7] != null) o$10[o$10.length] = writextag("numFmt", null, { numFmtId: i$7, formatCode: escapexml(NF[i$7]) }); @@ -74782,8 +74986,8 @@ function parse_cellXfs(t$6, styles$1, opts) { function write_cellXfs(cellXfs) { var o$10 = []; o$10[o$10.length] = writextag("cellXfs", null); - cellXfs.forEach(function(c$7) { - o$10[o$10.length] = writextag("xf", null, c$7); + cellXfs.forEach(function(c$6) { + o$10[o$10.length] = writextag("xf", null, c$6); }); o$10[o$10.length] = ""; if (o$10.length === 2) return ""; @@ -74876,10 +75080,10 @@ function write_BrtFont(font, o$10) { o$10.write_shift(1, font.charset || 0); o$10.write_shift(1, 0); write_BrtColor(font.color, o$10); - var scheme$1 = 0; - if (font.scheme == "major") scheme$1 = 1; - if (font.scheme == "minor") scheme$1 = 2; - o$10.write_shift(1, scheme$1); + var scheme = 0; + if (font.scheme == "major") scheme = 1; + if (font.scheme == "minor") scheme = 2; + o$10.write_shift(1, scheme); write_XLWideString(font.name, o$10); return o$10.length > o$10.l ? o$10.slice(0, o$10.l) : o$10; } @@ -75027,8 +75231,8 @@ function write_FMTS_bin(ba, NF) { [23, 26], [41, 44], [50, 392] - ].forEach(function(r$10) { - for (var i$7 = r$10[0]; i$7 <= r$10[1]; ++i$7) if (NF[i$7] != null) ++cnt; + ].forEach(function(r$9) { + for (var i$7 = r$9[0]; i$7 <= r$9[1]; ++i$7) if (NF[i$7] != null) ++cnt; }); if (cnt == 0) return; write_record(ba, 615, write_UInt32LE(cnt)); @@ -75037,8 +75241,8 @@ function write_FMTS_bin(ba, NF) { [23, 26], [41, 44], [50, 392] - ].forEach(function(r$10) { - for (var i$7 = r$10[0]; i$7 <= r$10[1]; ++i$7) if (NF[i$7] != null) write_record(ba, 44, write_BrtFmt(i$7, NF[i$7])); + ].forEach(function(r$9) { + for (var i$7 = r$9[0]; i$7 <= r$9[1]; ++i$7) if (NF[i$7] != null) write_record(ba, 44, write_BrtFmt(i$7, NF[i$7])); }); write_record(ba, 616); } @@ -75083,8 +75287,8 @@ function write_CELLSTYLEXFS_bin(ba) { } function write_CELLXFS_bin(ba, data) { write_record(ba, 617, write_UInt32LE(data.length)); - data.forEach(function(c$7) { - write_record(ba, 47, write_BrtXF(c$7, 0)); + data.forEach(function(c$6) { + write_record(ba, 47, write_BrtXF(c$6, 0)); }); write_record(ba, 618); } @@ -75536,14 +75740,14 @@ function parse_xlmeta_bin(data, name, _opts) { out.Types.push({ name: val$1.name }); break; case 51: - val$1.forEach(function(r$10) { + val$1.forEach(function(r$9) { if (metatype == 1) out.Cell.push({ - type: out.Types[r$10[0] - 1].name, - index: r$10[1] + type: out.Types[r$9[0] - 1].name, + index: r$9[1] }); else if (metatype == 0) out.Value.push({ - type: out.Types[r$10[0] - 1].name, - index: r$10[1] + type: out.Types[r$9[0] - 1].name, + index: r$9[1] }); }); break; @@ -75668,8 +75872,8 @@ function write_xlmeta_xml() { return o$10.join(""); } function parse_cc_xml(data) { - var d$5 = []; - if (!data) return d$5; + var d$4 = []; + if (!data) return d$4; var i$7 = 1; (data.match(tagregex) || []).forEach(function(x$2) { var y$3 = parsexmltag(x$2); @@ -75682,11 +75886,11 @@ function parse_cc_xml(data) { delete y$3[0]; if (y$3.i) i$7 = y$3.i; else y$3.i = i$7; - d$5.push(y$3); + d$4.push(y$3); break; } }); - return d$5; + return d$4; } function parse_BrtCalcChainItem$(data) { var out = {}; @@ -75843,7 +76047,7 @@ function write_vml(rId, comments, ws) { return o$10.join(""); } function write_vml_comment(x$2, _shapeid, ws) { - var c$7 = decode_cell(x$2[0]); + var c$6 = decode_cell(x$2[0]); var fillopts = { "color2": "#BEFF82", "type": "gradient" @@ -75874,18 +76078,18 @@ function write_vml_comment(x$2, _shapeid, ws) { "", "", writetag("x:Anchor", [ - c$7.c + 1, + c$6.c + 1, 0, - c$7.r + 1, + c$6.r + 1, 0, - c$7.c + 3, + c$6.c + 3, 20, - c$7.r + 5, + c$6.r + 5, 20 ].join(",")), writetag("x:AutoFill", "False"), - writetag("x:Row", String(c$7.r)), - writetag("x:Column", String(c$7.c)), + writetag("x:Row", String(c$6.r)), + writetag("x:Column", String(c$6.c)), x$2[1].hidden ? "" : "", "", "" @@ -75895,21 +76099,21 @@ function sheet_insert_comments(sheet, comments, threaded, people) { var dense = sheet["!data"] != null; var cell; comments.forEach(function(comment) { - var r$10 = decode_cell(comment.ref); - if (r$10.r < 0 || r$10.c < 0) return; + var r$9 = decode_cell(comment.ref); + if (r$9.r < 0 || r$9.c < 0) return; if (dense) { - if (!sheet["!data"][r$10.r]) sheet["!data"][r$10.r] = []; - cell = sheet["!data"][r$10.r][r$10.c]; + if (!sheet["!data"][r$9.r]) sheet["!data"][r$9.r] = []; + cell = sheet["!data"][r$9.r][r$9.c]; } else cell = sheet[comment.ref]; if (!cell) { cell = { t: "z" }; - if (dense) sheet["!data"][r$10.r][r$10.c] = cell; + if (dense) sheet["!data"][r$9.r][r$9.c] = cell; else sheet[comment.ref] = cell; var range = safe_decode_range(sheet["!ref"] || "BDWGO1000001:A1"); - if (range.s.r > r$10.r) range.s.r = r$10.r; - if (range.e.r < r$10.r) range.e.r = r$10.r; - if (range.s.c > r$10.c) range.s.c = r$10.c; - if (range.e.c < r$10.c) range.e.c = r$10.c; + if (range.s.r > r$9.r) range.s.r = r$9.r; + if (range.e.r < r$9.r) range.e.r = r$9.r; + if (range.s.c > r$9.c) range.s.c = r$9.c; + if (range.e.c < r$9.c) range.e.c = r$9.c; var encoded = encode_range(range); sheet["!ref"] = encoded; } @@ -75994,23 +76198,23 @@ function write_comments_xml(data) { } o$10.push(""); o$10.push(""); - data.forEach(function(d$5) { + data.forEach(function(d$4) { var lastauthor = 0, ts = [], tcnt = 0; - if (d$5[1][0] && d$5[1][0].T && d$5[1][0].ID) lastauthor = iauthor.indexOf("tc=" + d$5[1][0].ID); - d$5[1].forEach(function(c$7) { - if (c$7.a) lastauthor = iauthor.indexOf(escapexml(c$7.a)); - if (c$7.T) ++tcnt; - ts.push(c$7.t == null ? "" : escapexml(c$7.t)); + if (d$4[1][0] && d$4[1][0].T && d$4[1][0].ID) lastauthor = iauthor.indexOf("tc=" + d$4[1][0].ID); + d$4[1].forEach(function(c$6) { + if (c$6.a) lastauthor = iauthor.indexOf(escapexml(c$6.a)); + if (c$6.T) ++tcnt; + ts.push(c$6.t == null ? "" : escapexml(c$6.t)); }); if (tcnt === 0) { - d$5[1].forEach(function(c$7) { - o$10.push(""); - o$10.push(writetag("t", c$7.t == null ? "" : escapexml(c$7.t))); + d$4[1].forEach(function(c$6) { + o$10.push(""); + o$10.push(writetag("t", c$6.t == null ? "" : escapexml(c$6.t))); o$10.push(""); }); } else { - if (d$5[1][0] && d$5[1][0].T && d$5[1][0].ID) lastauthor = iauthor.indexOf("tc=" + d$5[1][0].ID); - o$10.push(""); + if (d$4[1][0] && d$4[1][0].T && d$4[1][0].ID) lastauthor = iauthor.indexOf("tc=" + d$4[1][0].ID); + o$10.push(""); var t$6 = "Comment:\n " + ts[0] + "\n"; for (var i$7 = 1; i$7 < ts.length; ++i$7) t$6 += "Reply:\n " + ts[i$7] + "\n"; o$10.push(writetag("t", escapexml(t$6))); @@ -76078,21 +76282,21 @@ function write_tcmnt_xml(comments, people, opts) { var o$10 = [XML_HEADER, writextag("ThreadedComments", null, { "xmlns": XMLNS.TCMNT }).replace(/[\/]>/, ">")]; comments.forEach(function(carr) { var rootid = ""; - (carr[1] || []).forEach(function(c$7, idx) { - if (!c$7.T) { - delete c$7.ID; + (carr[1] || []).forEach(function(c$6, idx) { + if (!c$6.T) { + delete c$6.ID; return; } - if (c$7.a && people.indexOf(c$7.a) == -1) people.push(c$7.a); + if (c$6.a && people.indexOf(c$6.a) == -1) people.push(c$6.a); var tcopts = { ref: carr[0], id: "{54EE7951-7262-4200-6969-" + ("000000000000" + opts.tcid++).slice(-12) + "}" }; if (idx == 0) rootid = tcopts.id; else tcopts.parentId = rootid; - c$7.ID = tcopts.id; - if (c$7.a) tcopts.personId = "{54EE7950-7262-4200-6969-" + ("000000000000" + people.indexOf(c$7.a)).slice(-12) + "}"; - o$10.push(writextag("threadedComment", writetag("text", c$7.t || ""), tcopts)); + c$6.ID = tcopts.id; + if (c$6.a) tcopts.personId = "{54EE7950-7262-4200-6969-" + ("000000000000" + people.indexOf(c$6.a)).slice(-12) + "}"; + o$10.push(writextag("threadedComment", writetag("text", c$6.t || ""), tcopts)); }); }); o$10.push(""); @@ -76171,7 +76375,7 @@ function write_BrtCommentAuthor(data) { function parse_comments_bin(data, opts) { var out = []; var authors = []; - var c$7 = {}; + var c$6 = {}; var pass = false; recordhopper(data, function hopper_cmnt(val$1, R$1, RT) { switch (RT) { @@ -76179,20 +76383,20 @@ function parse_comments_bin(data, opts) { authors.push(val$1); break; case 635: - c$7 = val$1; + c$6 = val$1; break; case 637: - c$7.t = val$1.t; - c$7.h = val$1.h; - c$7.r = val$1.r; + c$6.t = val$1.t; + c$6.h = val$1.h; + c$6.r = val$1.r; break; case 636: - c$7.author = authors[c$7.iauthor]; - delete c$7.iauthor; - if (opts.sheetRows && c$7.rfx && opts.sheetRows <= c$7.rfx.r) break; - if (!c$7.t) c$7.t = ""; - delete c$7.rfx; - out.push(c$7); + c$6.author = authors[c$6.iauthor]; + delete c$6.iauthor; + if (opts.sheetRows && c$6.rfx && opts.sheetRows <= c$6.rfx.r) break; + if (!c$6.t) c$6.t = ""; + delete c$6.rfx; + out.push(c$6); break; case 3072: break; case 35: @@ -76214,33 +76418,33 @@ function write_comments_bin(data) { write_record(ba, 628); write_record(ba, 630); data.forEach(function(comment) { - comment[1].forEach(function(c$7) { - if (iauthor.indexOf(c$7.a) > -1) return; - iauthor.push(c$7.a.slice(0, 54)); - write_record(ba, 632, write_BrtCommentAuthor(c$7.a)); - if (c$7.T && c$7.ID && iauthor.indexOf("tc=" + c$7.ID) == -1) { - iauthor.push("tc=" + c$7.ID); - write_record(ba, 632, write_BrtCommentAuthor("tc=" + c$7.ID)); + comment[1].forEach(function(c$6) { + if (iauthor.indexOf(c$6.a) > -1) return; + iauthor.push(c$6.a.slice(0, 54)); + write_record(ba, 632, write_BrtCommentAuthor(c$6.a)); + if (c$6.T && c$6.ID && iauthor.indexOf("tc=" + c$6.ID) == -1) { + iauthor.push("tc=" + c$6.ID); + write_record(ba, 632, write_BrtCommentAuthor("tc=" + c$6.ID)); } }); }); write_record(ba, 631); write_record(ba, 633); data.forEach(function(comment) { - comment[1].forEach(function(c$7) { + comment[1].forEach(function(c$6) { var _ia = -1; - if (c$7.ID) _ia = iauthor.indexOf("tc=" + c$7.ID); + if (c$6.ID) _ia = iauthor.indexOf("tc=" + c$6.ID); if (_ia == -1 && comment[1][0].T && comment[1][0].ID) _ia = iauthor.indexOf("tc=" + comment[1][0].ID); - if (_ia == -1) _ia = iauthor.indexOf(c$7.a); - c$7.iauthor = _ia; + if (_ia == -1) _ia = iauthor.indexOf(c$6.a); + c$6.iauthor = _ia; var range = { s: decode_cell(comment[0]), e: decode_cell(comment[0]) }; - write_record(ba, 635, write_BrtBeginComment([range, c$7])); - if (c$7.t && c$7.t.length > 0) write_record(ba, 637, write_BrtCommentText(c$7)); + write_record(ba, 635, write_BrtBeginComment([range, c$6])); + if (c$6.t && c$6.t.length > 0) write_record(ba, 637, write_BrtCommentText(c$6)); write_record(ba, 636); - delete c$7.iauthor; + delete c$6.iauthor; }); }); write_record(ba, 634); @@ -76281,10 +76485,10 @@ function shift_formula_str(f$4, delta) { }); } function shift_formula_xlsx(f$4, range, cell) { - var r$10 = decode_range(range), s$5 = r$10.s, c$7 = decode_cell(cell); + var r$9 = decode_range(range), s$5 = r$9.s, c$6 = decode_cell(cell); var delta = { - r: c$7.r - s$5.r, - c: c$7.c - s$5.c + r: c$6.r - s$5.r, + c: c$6.c - s$5.c }; return shift_formula_str(f$4, delta); } @@ -76300,11 +76504,11 @@ function parseread1(blob) { return; } function parse_ColRelU(blob, length) { - var c$7 = blob.read_shift(length == 1 ? 1 : 2); + var c$6 = blob.read_shift(length == 1 ? 1 : 2); return [ - c$7 & 16383, - c$7 >> 14 & 1, - c$7 >> 15 & 1 + c$6 & 16383, + c$6 >> 14 & 1, + c$6 >> 15 & 1 ]; } function parse_RgceArea(blob, length, opts) { @@ -76313,15 +76517,15 @@ function parse_RgceArea(blob, length, opts) { if (opts.biff >= 2 && opts.biff <= 5) return parse_RgceArea_BIFF2(blob, length, opts); else if (opts.biff == 12) w$2 = 4; } - var r$10 = blob.read_shift(w$2), R$1 = blob.read_shift(w$2); - var c$7 = parse_ColRelU(blob, 2); + var r$9 = blob.read_shift(w$2), R$1 = blob.read_shift(w$2); + var c$6 = parse_ColRelU(blob, 2); var C$2 = parse_ColRelU(blob, 2); return { s: { - r: r$10, - c: c$7[0], - cRel: c$7[1], - rRel: c$7[2] + r: r$9, + c: c$6[0], + cRel: c$6[1], + rRel: c$6[2] }, e: { r: R$1, @@ -76332,15 +76536,15 @@ function parse_RgceArea(blob, length, opts) { }; } function parse_RgceArea_BIFF2(blob) { - var r$10 = parse_ColRelU(blob, 2), R$1 = parse_ColRelU(blob, 2); - var c$7 = blob.read_shift(1); + var r$9 = parse_ColRelU(blob, 2), R$1 = parse_ColRelU(blob, 2); + var c$6 = blob.read_shift(1); var C$2 = blob.read_shift(1); return { s: { - r: r$10[0], - c: c$7, - cRel: r$10[1], - rRel: r$10[2] + r: r$9[0], + c: c$6, + cRel: r$9[1], + rRel: r$9[2] }, e: { r: R$1[0], @@ -76352,15 +76556,15 @@ function parse_RgceArea_BIFF2(blob) { } function parse_RgceAreaRel(blob, length, opts) { if (opts.biff < 8) return parse_RgceArea_BIFF2(blob, length, opts); - var r$10 = blob.read_shift(opts.biff == 12 ? 4 : 2), R$1 = blob.read_shift(opts.biff == 12 ? 4 : 2); - var c$7 = parse_ColRelU(blob, 2); + var r$9 = blob.read_shift(opts.biff == 12 ? 4 : 2), R$1 = blob.read_shift(opts.biff == 12 ? 4 : 2); + var c$6 = parse_ColRelU(blob, 2); var C$2 = parse_ColRelU(blob, 2); return { s: { - r: r$10, - c: c$7[0], - cRel: c$7[1], - rRel: c$7[2] + r: r$9, + c: c$6[0], + cRel: c$6[1], + rRel: c$6[2] }, e: { r: R$1, @@ -76372,47 +76576,47 @@ function parse_RgceAreaRel(blob, length, opts) { } function parse_RgceLoc(blob, length, opts) { if (opts && opts.biff >= 2 && opts.biff <= 5) return parse_RgceLoc_BIFF2(blob, length, opts); - var r$10 = blob.read_shift(opts && opts.biff == 12 ? 4 : 2); - var c$7 = parse_ColRelU(blob, 2); + var r$9 = blob.read_shift(opts && opts.biff == 12 ? 4 : 2); + var c$6 = parse_ColRelU(blob, 2); return { - r: r$10, - c: c$7[0], - cRel: c$7[1], - rRel: c$7[2] + r: r$9, + c: c$6[0], + cRel: c$6[1], + rRel: c$6[2] }; } function parse_RgceLoc_BIFF2(blob) { - var r$10 = parse_ColRelU(blob, 2); - var c$7 = blob.read_shift(1); + var r$9 = parse_ColRelU(blob, 2); + var c$6 = blob.read_shift(1); return { - r: r$10[0], - c: c$7, - cRel: r$10[1], - rRel: r$10[2] + r: r$9[0], + c: c$6, + cRel: r$9[1], + rRel: r$9[2] }; } function parse_RgceElfLoc(blob) { - var r$10 = blob.read_shift(2); - var c$7 = blob.read_shift(2); + var r$9 = blob.read_shift(2); + var c$6 = blob.read_shift(2); return { - r: r$10, - c: c$7 & 255, - fQuoted: !!(c$7 & 16384), - cRel: c$7 >> 15, - rRel: c$7 >> 15 + r: r$9, + c: c$6 & 255, + fQuoted: !!(c$6 & 16384), + cRel: c$6 >> 15, + rRel: c$6 >> 15 }; } function parse_RgceLocRel(blob, length, opts) { var biff = opts && opts.biff ? opts.biff : 8; if (biff >= 2 && biff <= 5) return parse_RgceLocRel_BIFF2(blob, length, opts); - var r$10 = blob.read_shift(biff >= 12 ? 4 : 2); + var r$9 = blob.read_shift(biff >= 12 ? 4 : 2); var cl = blob.read_shift(2); var cRel = (cl & 16384) >> 14, rRel = (cl & 32768) >> 15; cl &= 16383; - if (rRel == 1) while (r$10 > 524287) r$10 -= 1048576; + if (rRel == 1) while (r$9 > 524287) r$9 -= 1048576; if (cRel == 1) while (cl > 8191) cl = cl - 16384; return { - r: r$10, + r: r$9, c: cl, cRel, rRel @@ -76420,14 +76624,14 @@ function parse_RgceLocRel(blob, length, opts) { } function parse_RgceLocRel_BIFF2(blob) { var rl = blob.read_shift(2); - var c$7 = blob.read_shift(1); + var c$6 = blob.read_shift(1); var rRel = (rl & 32768) >> 15, cRel = (rl & 16384) >> 14; rl &= 16383; if (rRel == 1 && rl >= 8192) rl = rl - 16384; - if (cRel == 1 && c$7 >= 128) c$7 = c$7 - 256; + if (cRel == 1 && c$6 >= 128) c$6 = c$6 - 256; return { r: rl, - c: c$7, + c: c$6, cRel, rRel }; @@ -76762,7 +76966,7 @@ function parse_PtgList(blob) { var ixti = blob.read_shift(2); var flags = blob.read_shift(2); var idx = blob.read_shift(4); - var c$7 = blob.read_shift(2); + var c$6 = blob.read_shift(2); var C$2 = blob.read_shift(2); var rt = PtgListRT[flags >> 2 & 31]; return { @@ -76770,7 +76974,7 @@ function parse_PtgList(blob) { coltype: flags & 3, rt, idx, - c: c$7, + c: c$6, C: C$2 }; } @@ -76852,18 +77056,18 @@ function parse_Rgce(blob, length, opts) { function stringify_array(f$4) { var o$10 = []; for (var i$7 = 0; i$7 < f$4.length; ++i$7) { - var x$2 = f$4[i$7], r$10 = []; + var x$2 = f$4[i$7], r$9 = []; for (var j$2 = 0; j$2 < x$2.length; ++j$2) { var y$3 = x$2[j$2]; if (y$3) switch (y$3[0]) { case 2: - r$10.push("\"" + y$3[1].replace(/"/g, "\"\"") + "\""); + r$9.push("\"" + y$3[1].replace(/"/g, "\"\"") + "\""); break; - default: r$10.push(y$3[1]); + default: r$9.push(y$3[1]); } - else r$10.push(""); + else r$9.push(""); } - o$10.push(r$10.join(",")); + o$10.push(r$9.join(",")); } return o$10.join(";"); } @@ -76925,7 +77129,7 @@ function stringify_formula(formula, range, cell, supbooks, opts) { r: 0 } }; - var stack = [], e1, e2, c$7, ixti = 0, nameidx = 0, r$10, sname = ""; + var stack = [], e1, e2, c$6, ixti = 0, nameidx = 0, r$9, sname = ""; if (!formula[0] || !formula[0][0]) return ""; var last_sp = -1, sp = ""; for (var ff = 0, fflen = formula[0].length; ff < fflen; ++ff) { @@ -76991,19 +77195,19 @@ function stringify_formula(formula, range, cell, supbooks, opts) { case "PtgAttrIf": break; case "PtgAttrIfError": break; case "PtgRef": - c$7 = shift_cell_xls(f$4[1][1], _range, opts); - stack.push(encode_cell_xls(c$7, biff)); + c$6 = shift_cell_xls(f$4[1][1], _range, opts); + stack.push(encode_cell_xls(c$6, biff)); break; case "PtgRefN": - c$7 = cell ? shift_cell_xls(f$4[1][1], cell, opts) : f$4[1][1]; - stack.push(encode_cell_xls(c$7, biff)); + c$6 = cell ? shift_cell_xls(f$4[1][1], cell, opts) : f$4[1][1]; + stack.push(encode_cell_xls(c$6, biff)); break; case "PtgRef3d": ixti = f$4[1][1]; - c$7 = shift_cell_xls(f$4[1][2], _range, opts); + c$6 = shift_cell_xls(f$4[1][2], _range, opts); sname = get_ixti(supbooks, ixti, opts); var w$2 = sname; - stack.push(sname + "!" + encode_cell_xls(c$7, biff)); + stack.push(sname + "!" + encode_cell_xls(c$6, biff)); break; case "PtgFunc": case "PtgFuncVar": @@ -77031,18 +77235,18 @@ function stringify_formula(formula, range, cell, supbooks, opts) { stack.push(f$4[1]); break; case "PtgAreaN": - r$10 = shift_range_xls(f$4[1][1], cell ? { s: cell } : _range, opts); - stack.push(encode_range_xls(r$10, opts)); + r$9 = shift_range_xls(f$4[1][1], cell ? { s: cell } : _range, opts); + stack.push(encode_range_xls(r$9, opts)); break; case "PtgArea": - r$10 = shift_range_xls(f$4[1][1], _range, opts); - stack.push(encode_range_xls(r$10, opts)); + r$9 = shift_range_xls(f$4[1][1], _range, opts); + stack.push(encode_range_xls(r$9, opts)); break; case "PtgArea3d": ixti = f$4[1][1]; - r$10 = f$4[1][2]; + r$9 = f$4[1][2]; sname = get_ixti(supbooks, ixti, opts); - stack.push(sname + "!" + encode_range_xls(r$10, opts)); + stack.push(sname + "!" + encode_range_xls(r$9, opts)); break; case "PtgAttrSum": stack.push("SUM(" + stack.pop() + ")"); @@ -77113,24 +77317,24 @@ function stringify_formula(formula, range, cell, supbooks, opts) { stack.push("#REF!"); break; case "PtgExp": - c$7 = { + c$6 = { c: f$4[1][1], r: f$4[1][0] }; - var q$2 = { + var q$1 = { c: cell.c, r: cell.r }; - if (supbooks.sharedf[encode_cell(c$7)]) { - var parsedf = supbooks.sharedf[encode_cell(c$7)]; - stack.push(stringify_formula(parsedf, _range, q$2, supbooks, opts)); + if (supbooks.sharedf[encode_cell(c$6)]) { + var parsedf = supbooks.sharedf[encode_cell(c$6)]; + stack.push(stringify_formula(parsedf, _range, q$1, supbooks, opts)); } else { var fnd = false; for (e1 = 0; e1 != supbooks.arrayf.length; ++e1) { e2 = supbooks.arrayf[e1]; - if (c$7.c < e2[0].s.c || c$7.c > e2[0].e.c) continue; - if (c$7.r < e2[0].s.r || c$7.r > e2[0].e.r) continue; - stack.push(stringify_formula(e2[1], _range, q$2, supbooks, opts)); + if (c$6.c < e2[0].s.c || c$6.c > e2[0].e.c) continue; + if (c$6.r < e2[0].s.r || c$6.r > e2[0].e.r) continue; + stack.push(stringify_formula(e2[1], _range, q$1, supbooks, opts)); fnd = true; break; } @@ -77514,19 +77718,19 @@ function csf_to_ods_formula(f$4) { var o$10 = "of:=" + f$4.replace(crefregex, "$1[.$2$3$4$5]").replace(/\]:\[/g, ":"); return o$10.replace(/;/g, "|").replace(/,/g, ";"); } -function ods_to_csf_3D(r$10) { - r$10 = r$10.replace(/\$'([^']|'')+'/g, function($$) { +function ods_to_csf_3D(r$9) { + r$9 = r$9.replace(/\$'([^']|'')+'/g, function($$) { return $$.slice(1); }); - r$10 = r$10.replace(/\$([^\]\. #$]+)/g, function($$, $1) { + r$9 = r$9.replace(/\$([^\]\. #$]+)/g, function($$, $1) { return $1.match(/^([A-Z]{1,2}|[A-W][A-Z]{2}|X[A-E][A-Z]|XF[A-D])?(10[0-3]\d{4}|104[0-7]\d{3}|1048[0-4]\d{2}|10485[0-6]\d|104857[0-6]|[1-9]\d{0,5})?$/) ? $$ : $1; }); - var a$2 = r$10.split(":"); + var a$2 = r$9.split(":"); var s$5 = a$2[0].split(".")[0]; return [s$5, a$2[0].split(".")[1] + (a$2.length > 1 ? ":" + (a$2[1].split(".")[1] || a$2[1].split(".")[0]) : "")]; } -function csf_to_ods_3D(r$10) { - return r$10.replace(/!/, ".").replace(/:/, ":."); +function csf_to_ods_3D(r$9) { + return r$9.replace(/!/, ".").replace(/:/, ":."); } function get_sst_id(sst, str, rev) { var i$7 = 0, len = sst.length; @@ -77675,8 +77879,8 @@ function check_ws(ws, sname, i$7) { } } function parse_ws_xml_dim(ws, s$5) { - var d$5 = safe_decode_range(s$5); - if (d$5.s.r <= d$5.e.r && d$5.s.c <= d$5.e.c && d$5.s.r >= 0 && d$5.s.c >= 0) ws["!ref"] = encode_range(d$5); + var d$4 = safe_decode_range(s$5); + if (d$4.s.r <= d$4.e.r && d$4.s.c <= d$4.e.c && d$4.s.r >= 0 && d$4.s.c >= 0) ws["!ref"] = encode_range(d$4); } function parse_ws_xml(data, opts, idx, rels, wb, themes, styles$1) { if (!data) return data; @@ -77910,8 +78114,8 @@ function write_ws_xml_autofilter(data, ws, wb, idx) { } function parse_ws_xml_sheetviews(data, wb) { if (!wb.Views) wb.Views = [{}]; - (data.match(sviewregex) || []).forEach(function(r$10, i$7) { - var tag = parsexmltag(r$10); + (data.match(sviewregex) || []).forEach(function(r$9, i$7) { + var tag = parsexmltag(r$9); if (!wb.Views[i$7]) wb.Views[i$7] = {}; if (+tag.zoomScale) wb.Views[i$7].zoom = +tag.zoomScale; if (tag.rightToLeft && parsexmlbool(tag.rightToLeft)) wb.Views[i$7].RTL = true; @@ -78006,22 +78210,22 @@ function write_ws_xml_cell(cell, ref, ws, opts, idx, wb, date1904) { return writextag("c", v$3, o$10); } function write_ws_xml_data(ws, opts, idx, wb) { - var o$10 = [], r$10 = [], range = safe_decode_range(ws["!ref"]), cell = "", ref, rr = "", cols = [], R$1 = 0, C$2 = 0, rows = ws["!rows"]; + var o$10 = [], r$9 = [], range = safe_decode_range(ws["!ref"]), cell = "", ref, rr = "", cols = [], R$1 = 0, C$2 = 0, rows = ws["!rows"]; var dense = ws["!data"] != null, data = dense ? ws["!data"] : []; var params = { r: rr }, row, height = -1; var date1904 = (((wb || {}).Workbook || {}).WBProps || {}).date1904; for (C$2 = range.s.c; C$2 <= range.e.c; ++C$2) cols[C$2] = encode_col(C$2); for (R$1 = range.s.r; R$1 <= range.e.r; ++R$1) { - r$10 = []; + r$9 = []; rr = encode_row(R$1); var data_R = dense ? data[R$1] : []; for (C$2 = range.s.c; C$2 <= range.e.c; ++C$2) { ref = cols[C$2] + rr; var _cell = dense ? data_R[C$2] : ws[ref]; if (_cell === undefined) continue; - if ((cell = write_ws_xml_cell(_cell, ref, ws, opts, idx, wb, date1904)) != null) r$10.push(cell); + if ((cell = write_ws_xml_cell(_cell, ref, ws, opts, idx, wb, date1904)) != null) r$9.push(cell); } - if (r$10.length > 0 || rows && rows[R$1]) { + if (r$9.length > 0 || rows && rows[R$1]) { params = { r: rr }; if (rows && rows[R$1]) { row = rows[R$1]; @@ -78037,7 +78241,7 @@ function write_ws_xml_data(ws, opts, idx, wb) { params.outlineLevel = row.level; } } - o$10[o$10.length] = writextag("row", r$10.join(""), params); + o$10[o$10.length] = writextag("row", r$9.join(""), params); } } if (rows) for (; R$1 < rows.length; ++R$1) { @@ -79190,21 +79394,21 @@ function write_SHEETPROTECT(ba, ws) { function write_ws_bin(idx, opts, wb, rels) { var ba = buf_array(); var s$5 = wb.SheetNames[idx], ws = wb.Sheets[s$5] || {}; - var c$7 = s$5; + var c$6 = s$5; try { - if (wb && wb.Workbook) c$7 = wb.Workbook.Sheets[idx].CodeName || c$7; + if (wb && wb.Workbook) c$6 = wb.Workbook.Sheets[idx].CodeName || c$6; } catch (e$10) {} - var r$10 = safe_decode_range(ws["!ref"] || "A1"); - if (r$10.e.c > 16383 || r$10.e.r > 1048575) { + var r$9 = safe_decode_range(ws["!ref"] || "A1"); + if (r$9.e.c > 16383 || r$9.e.r > 1048575) { if (opts.WTF) throw new Error("Range " + (ws["!ref"] || "A1") + " exceeds format limit A1:XFD1048576"); - r$10.e.c = Math.min(r$10.e.c, 16383); - r$10.e.r = Math.min(r$10.e.c, 1048575); + r$9.e.c = Math.min(r$9.e.c, 16383); + r$9.e.r = Math.min(r$9.e.c, 1048575); } ws["!links"] = []; ws["!comments"] = []; write_record(ba, 129); - if (wb.vbaraw || ws["!outline"]) write_record(ba, 147, write_BrtWsProp(c$7, ws["!outline"])); - write_record(ba, 148, write_BrtWsDim(r$10)); + if (wb.vbaraw || ws["!outline"]) write_record(ba, 147, write_BrtWsProp(c$6, ws["!outline"])); + write_record(ba, 148, write_BrtWsDim(r$9)); write_WSVIEWS2(ba, ws, wb.Workbook); write_WSFMTINFO(ba, ws); write_COLINFOS(ba, ws, idx, opts, wb); @@ -79224,9 +79428,9 @@ function parse_Cache(data) { var num = data.match(/^/); var f$4; (data.match(/\/]*>([^<])<\/c:v><\/c:pt>/gm) || []).forEach(function(pt) { - var q$2 = pt.match(/\/]*>([^<]*)<\/c:v><\/c:pt>/); - if (!q$2) return; - col[+q$2[1]] = num ? +q$2[2] : q$2[2]; + var q$1 = pt.match(/\/]*>([^<]*)<\/c:v><\/c:pt>/); + if (!q$1) return; + col[+q$1[1]] = num ? +q$1[2] : q$1[2]; }); var nf = unescapexml((str_match_xml(data, "c:formatCode") || ["", "General"])[1]); (str_match_ng(data, "", "") || []).forEach(function(F$1) { @@ -79394,8 +79598,8 @@ function check_ws_name(n$9, safe) { if (n$9.length > 31) throw new Error("Sheet name cannot exceed 31 chars"); if (n$9.charCodeAt(0) == 39 || n$9.charCodeAt(n$9.length - 1) == 39) throw new Error("Sheet name cannot start or end with apostrophe (')"); if (n$9.toLowerCase() == "history") throw new Error("Sheet name cannot be 'History'"); - badchars.forEach(function(c$7) { - if (n$9.indexOf(c$7) == -1) return; + badchars.forEach(function(c$6) { + if (n$9.indexOf(c$6) == -1) return; throw new Error("Sheet name cannot contain : \\ / ? * [ ]"); }); } catch (e$10) { @@ -79658,12 +79862,12 @@ function write_wb_xml(wb) { if (write_names) { o$10[o$10.length] = ""; if (wb.Workbook && wb.Workbook.Names) wb.Workbook.Names.forEach(function(n$9) { - var d$5 = { name: n$9.Name }; - if (n$9.Comment) d$5.comment = n$9.Comment; - if (n$9.Sheet != null) d$5.localSheetId = "" + n$9.Sheet; - if (n$9.Hidden) d$5.hidden = "1"; + var d$4 = { name: n$9.Name }; + if (n$9.Comment) d$4.comment = n$9.Comment; + if (n$9.Sheet != null) d$4.localSheetId = "" + n$9.Sheet; + if (n$9.Hidden) d$4.hidden = "1"; if (!n$9.Ref) return; - o$10[o$10.length] = writextag("definedName", escapexml(n$9.Ref), d$5); + o$10[o$10.length] = writextag("definedName", escapexml(n$9.Ref), d$4); }); o$10[o$10.length] = ""; } @@ -79904,13 +80108,13 @@ function write_BUNDLESHS(ba, wb) { write_record(ba, 143); for (var idx = 0; idx != wb.SheetNames.length; ++idx) { var viz = wb.Workbook && wb.Workbook.Sheets && wb.Workbook.Sheets[idx] && wb.Workbook.Sheets[idx].Hidden || 0; - var d$5 = { + var d$4 = { Hidden: viz, iTabID: idx + 1, strRelID: "rId" + (idx + 1), name: wb.SheetNames[idx] }; - write_record(ba, 156, write_BrtBundleSh(d$5)); + write_record(ba, 156, write_BrtBundleSh(d$4)); } write_record(ba, 144); } @@ -80141,7 +80345,7 @@ function process_style_xlml(styles$1, stag, opts) { } styles$1[stag.ID] = stag; } -function parse_xlml_data(xml$2, ss, data, cell, base, styles$1, csty, row, arrayf, o$10, date1904) { +function parse_xlml_data(xml$1, ss, data, cell, base, styles$1, csty, row, arrayf, o$10, date1904) { var nf = "General", sid = cell.StyleID, S$4 = {}; o$10 = o$10 || {}; var interiors = []; @@ -80158,33 +80362,33 @@ function parse_xlml_data(xml$2, ss, data, cell, base, styles$1, csty, row, array switch (data.Type) { case "Boolean": cell.t = "b"; - cell.v = parsexmlbool(xml$2); + cell.v = parsexmlbool(xml$1); break; case "String": cell.t = "s"; - cell.r = xlml_fixstr(unescapexml(xml$2)); - cell.v = xml$2.indexOf("<") > -1 ? unescapexml(ss || xml$2).replace(/<[^<>]*>/g, "") : cell.r; + cell.r = xlml_fixstr(unescapexml(xml$1)); + cell.v = xml$1.indexOf("<") > -1 ? unescapexml(ss || xml$1).replace(/<[^<>]*>/g, "") : cell.r; break; case "DateTime": - if (xml$2.slice(-1) != "Z") xml$2 += "Z"; - cell.v = datenum(parseDate(xml$2, date1904), date1904); - if (cell.v !== cell.v) cell.v = unescapexml(xml$2); + if (xml$1.slice(-1) != "Z") xml$1 += "Z"; + cell.v = datenum(parseDate(xml$1, date1904), date1904); + if (cell.v !== cell.v) cell.v = unescapexml(xml$1); if (!nf || nf == "General") nf = "yyyy-mm-dd"; case "Number": - if (cell.v === undefined) cell.v = +xml$2; + if (cell.v === undefined) cell.v = +xml$1; if (!cell.t) cell.t = "n"; break; case "Error": cell.t = "e"; - cell.v = RBErr[xml$2]; - if (o$10.cellText !== false) cell.w = xml$2; + cell.v = RBErr[xml$1]; + if (o$10.cellText !== false) cell.w = xml$1; break; default: - if (xml$2 == "" && ss == "") { + if (xml$1 == "" && ss == "") { cell.t = "z"; } else { cell.t = "s"; - cell.v = xlml_fixstr(ss || xml$2); + cell.v = xlml_fixstr(ss || xml$1); } break; } @@ -80222,10 +80426,10 @@ function xlml_clean_comment(comment) { comment.t = comment.t.replace(/\r\n/g, "\n").replace(/\r/g, "\n"); comment.v = comment.w = comment.ixfe = undefined; } -function parse_xlml_xml(d$5, _opts) { +function parse_xlml_xml(d$4, _opts) { var opts = _opts || {}; make_ssf(); - var str = debom(xlml_normalize(d$5)); + var str = debom(xlml_normalize(d$4)); if (opts.type == "binary" || opts.type == "array" || opts.type == "base64") { if (typeof $cptable !== "undefined") str = $cptable.utils.decode(65001, char_codes(str)); else str = utf8read(str); @@ -80274,7 +80478,7 @@ function parse_xlml_xml(d$5, _opts) { if (opts.dense) cursheet["!data"] = []; var cell = {}, row = {}; var dtag = xlml_parsexmltag(""), didx = 0; - var c$7 = 0, r$10 = 0; + var c$6 = 0, r$9 = 0; var refguess = { s: { r: 2e6, @@ -80310,9 +80514,9 @@ function parse_xlml_xml(d$5, _opts) { } if (state$1[state$1.length - 1][1]) break; if (Rn[1] === "/") parse_xlml_data(str.slice(didx, Rn.index), ss, dtag, state$1[state$1.length - 1][0] == "comment" ? comment : cell, { - c: c$7, - r: r$10 - }, styles$1, cstys[c$7], row, arrayf, opts, Workbook.WBProps.date1904); + c: c$6, + r: r$9 + }, styles$1, cstys[c$6], row, arrayf, opts, Workbook.WBProps.date1904); else { ss = ""; dtag = xlml_parsexmltag(Rn[0]); @@ -80322,11 +80526,11 @@ function parse_xlml_xml(d$5, _opts) { case "cell": if (Rn[1] === "/") { if (comments.length > 0) cell.c = comments; - if ((!opts.sheetRows || opts.sheetRows > r$10) && cell.v !== void 0) { + if ((!opts.sheetRows || opts.sheetRows > r$9) && cell.v !== void 0) { if (opts.dense) { - if (!cursheet["!data"][r$10]) cursheet["!data"][r$10] = []; - cursheet["!data"][r$10][c$7] = cell; - } else cursheet[encode_col(c$7) + encode_row(r$10)] = cell; + if (!cursheet["!data"][r$9]) cursheet["!data"][r$9] = []; + cursheet["!data"][r$9][c$6] = cell; + } else cursheet[encode_col(c$6) + encode_row(r$9)] = cell; } if (cell.HRef) { cell.l = { Target: unescapexml(cell.HRef) }; @@ -80335,12 +80539,12 @@ function parse_xlml_xml(d$5, _opts) { delete cell.HRefScreenTip; } if (cell.MergeAcross || cell.MergeDown) { - cc = c$7 + (parseInt(cell.MergeAcross, 10) | 0); - rr = r$10 + (parseInt(cell.MergeDown, 10) | 0); - if (cc > c$7 || rr > r$10) merges.push({ + cc = c$6 + (parseInt(cell.MergeAcross, 10) | 0); + rr = r$9 + (parseInt(cell.MergeDown, 10) | 0); + if (cc > c$6 || rr > r$9) merges.push({ s: { - c: c$7, - r: r$10 + c: c$6, + r: r$9 }, e: { c: cc, @@ -80349,12 +80553,12 @@ function parse_xlml_xml(d$5, _opts) { }); } if (!opts.sheetStubs) { - if (cell.MergeAcross) c$7 = cc + 1; - else ++c$7; + if (cell.MergeAcross) c$6 = cc + 1; + else ++c$6; } else if (cell.MergeAcross || cell.MergeDown) { - for (var cma = c$7; cma <= cc; ++cma) { - for (var cmd = r$10; cmd <= rr; ++cmd) { - if (cma > c$7 || cmd > r$10) { + for (var cma = c$6; cma <= cc; ++cma) { + for (var cmd = r$9; cmd <= rr; ++cmd) { + if (cma > c$6 || cmd > r$9) { if (opts.dense) { if (!cursheet["!data"][cmd]) cursheet["!data"][cmd] = []; cursheet["!data"][cmd][cma] = { t: "z" }; @@ -80362,39 +80566,39 @@ function parse_xlml_xml(d$5, _opts) { } } } - c$7 = cc + 1; - } else ++c$7; + c$6 = cc + 1; + } else ++c$6; } else { cell = xlml_parsexmltagobj(Rn[0]); - if (cell.Index) c$7 = +cell.Index - 1; - if (c$7 < refguess.s.c) refguess.s.c = c$7; - if (c$7 > refguess.e.c) refguess.e.c = c$7; - if (Rn[0].slice(-2) === "/>") ++c$7; + if (cell.Index) c$6 = +cell.Index - 1; + if (c$6 < refguess.s.c) refguess.s.c = c$6; + if (c$6 > refguess.e.c) refguess.e.c = c$6; + if (Rn[0].slice(-2) === "/>") ++c$6; comments = []; } break; case "row": if (Rn[1] === "/" || Rn[0].slice(-2) === "/>") { - if (r$10 < refguess.s.r) refguess.s.r = r$10; - if (r$10 > refguess.e.r) refguess.e.r = r$10; + if (r$9 < refguess.s.r) refguess.s.r = r$9; + if (r$9 > refguess.e.r) refguess.e.r = r$9; if (Rn[0].slice(-2) === "/>") { row = xlml_parsexmltag(Rn[0]); - if (row.Index) r$10 = +row.Index - 1; + if (row.Index) r$9 = +row.Index - 1; } - c$7 = 0; - ++r$10; + c$6 = 0; + ++r$9; } else { row = xlml_parsexmltag(Rn[0]); - if (row.Index) r$10 = +row.Index - 1; + if (row.Index) r$9 = +row.Index - 1; rowobj = {}; if (row.AutoFitHeight == "0" || row.Height) { rowobj.hpx = parseInt(row.Height, 10); rowobj.hpt = px2pt(rowobj.hpx); - rowinfo[r$10] = rowobj; + rowinfo[r$9] = rowobj; } if (row.Hidden == "1") { rowobj.hidden = true; - rowinfo[r$10] = rowobj; + rowinfo[r$9] = rowobj; } } break; @@ -80425,7 +80629,7 @@ function parse_xlml_xml(d$5, _opts) { c: 0 } }; - r$10 = c$7 = 0; + r$9 = c$6 = 0; state$1.push([Rn[3], false]); tmp = xlml_parsexmltag(Rn[0]); sheetname = unescapexml(tmp.Name); @@ -81145,13 +81349,13 @@ function write_ws_xlml_wsopts(ws, opts, idx, wb) { return writextag("WorksheetOptions", o$10.join(""), { xmlns: XLMLNS.x }); } function write_ws_xlml_comment(comments) { - return comments.map(function(c$7) { - var t$6 = xlml_unfixstr(c$7.t || ""); - var d$5 = writextag("ss:Data", t$6, { "xmlns": "http://www.w3.org/TR/REC-html40" }); + return comments.map(function(c$6) { + var t$6 = xlml_unfixstr(c$6.t || ""); + var d$4 = writextag("ss:Data", t$6, { "xmlns": "http://www.w3.org/TR/REC-html40" }); var p$3 = {}; - if (c$7.a) p$3["ss:Author"] = c$7.a; + if (c$6.a) p$3["ss:Author"] = c$6.a; if (!comments.hidden) p$3["ss:ShowAlways"] = "1"; - return writextag("Comment", d$5, p$3); + return writextag("Comment", d$4, p$3); }).join(""); } function write_ws_xlml_cell(cell, ref, ws, opts, idx, wb, addr) { @@ -81294,14 +81498,14 @@ function write_xlml(wb, opts) { opts.cellXfs = []; get_cell_style(opts.cellXfs, {}, { revssf: { "General": 0 } }); } - var d$5 = []; - d$5.push(write_props_xlml(wb, opts)); - d$5.push(write_wb_xlml(wb, opts)); - d$5.push(""); - d$5.push(write_names_xlml(wb, opts)); - for (var i$7 = 0; i$7 < wb.SheetNames.length; ++i$7) d$5.push(writextag("Worksheet", write_ws_xlml(i$7, opts, wb), { "ss:Name": escapexml(wb.SheetNames[i$7]) })); - d$5[2] = write_sty_xlml(wb, opts); - return XML_HEADER + writextag("Workbook", d$5.join(""), { + var d$4 = []; + d$4.push(write_props_xlml(wb, opts)); + d$4.push(write_wb_xlml(wb, opts)); + d$4.push(""); + d$4.push(write_names_xlml(wb, opts)); + for (var i$7 = 0; i$7 < wb.SheetNames.length; ++i$7) d$4.push(writextag("Worksheet", write_ws_xlml(i$7, opts, wb), { "ss:Name": escapexml(wb.SheetNames[i$7]) })); + d$4[2] = write_sty_xlml(wb, opts); + return XML_HEADER + writextag("Workbook", d$4.join(""), { "xmlns": XLMLNS.ss, "xmlns:o": XLMLNS.o, "xmlns:x": XLMLNS.x, @@ -81333,8 +81537,8 @@ function parse_compobj(obj) { function slurp(RecordType, R$1, blob, length, opts) { var l$3 = length; var bufs = []; - var d$5 = blob.slice(blob.l, blob.l + l$3); - if (opts && opts.enc && opts.enc.insitu && d$5.length > 0) switch (RecordType) { + var d$4 = blob.slice(blob.l, blob.l + l$3); + if (opts && opts.enc && opts.enc.insitu && d$4.length > 0) switch (RecordType) { case 9: case 521: case 1033: @@ -81347,9 +81551,9 @@ function slurp(RecordType, R$1, blob, length, opts) { case 404: case 10: break; case 133: break; - default: opts.enc.insitu(d$5); + default: opts.enc.insitu(d$4); } - bufs.push(d$5); + bufs.push(d$4); blob.l += l$3; var nextrt = __readUInt16LE(blob, blob.l), next = XLSRecordEnum[nextrt]; var start = 0; @@ -81360,8 +81564,8 @@ function slurp(RecordType, R$1, blob, length, opts) { else if (nextrt == 2165 || nextrt == 2175) { start += 12; } - d$5 = blob.slice(start, blob.l + 4 + l$3); - bufs.push(d$5); + d$4 = blob.slice(start, blob.l + 4 + l$3); + bufs.push(d$4); blob.l += 4 + l$3; next = XLSRecordEnum[nextrt = __readUInt16LE(blob, blob.l)]; } @@ -82174,8 +82378,8 @@ function parse_workbook(blob, options) { wb.SheetNames.push("Sheet1"); if (wb.Sheets) wb.Sheets["Sheet1"] = Preamble; } else wb.Preamble = Preamble; - if (wb.Sheets) FilterDatabases.forEach(function(r$10, i$7) { - wb.Sheets[wb.SheetNames[i$7]]["!autofilter"] = r$10; + if (wb.Sheets) FilterDatabases.forEach(function(r$9, i$7) { + wb.Sheets[wb.SheetNames[i$7]]["!autofilter"] = r$9; }); wb.Strings = sst; wb.SSF = dup(table_fmt); @@ -82191,7 +82395,7 @@ function parse_xls_props(cfb, props, o$10) { var DSI = CFB.find(cfb, "/!DocumentSummaryInformation"); if (DSI && DSI.size > 0) try { var DocSummary = parse_PropertySetStream(DSI, DocSummaryPIDDSI, PSCLSID.DSI); - for (var d$5 in DocSummary) props[d$5] = DocSummary[d$5]; + for (var d$4 in DocSummary) props[d$4] = DocSummary[d$4]; } catch (e$10) { if (o$10.WTF) throw e$10; } @@ -82335,15 +82539,15 @@ function write_biff_continue(ba, type, payload, length) { i$7 += w$2; } } -function write_BIFF2BERR(r$10, c$7, val$1, t$6) { +function write_BIFF2BERR(r$9, c$6, val$1, t$6) { var out = new_buf(9); - write_BIFF2Cell(out, r$10, c$7); + write_BIFF2Cell(out, r$9, c$6); write_Bes(val$1, t$6 || "b", out); return out; } -function write_BIFF2LABEL(r$10, c$7, val$1) { +function write_BIFF2LABEL(r$9, c$6, val$1) { var out = new_buf(8 + 2 * val$1.length); - write_BIFF2Cell(out, r$10, c$7); + write_BIFF2Cell(out, r$9, c$6); out.write_shift(1, val$1.length); out.write_shift(val$1.length, val$1, "sbcs"); return out.l < out.length ? out.slice(0, out.l) : out; @@ -82503,9 +82707,9 @@ function write_MsoDrawingGroup() { function write_comments_biff8(ba, comments) { var notes = [], sz = 0, pl = buf_array(), baseid = b8oid; var _oasc; - comments.forEach(function(c$7, ci) { + comments.forEach(function(c$6, ci) { var author = ""; - var text$2 = c$7[0].map(function(t$6) { + var text$2 = c$6[0].map(function(t$6) { if (t$6.a && !author) author = t$6.a; return t$6.t; }).join(""); @@ -82553,20 +82757,20 @@ function write_comments_biff8(ba, comments) { oasc.write_shift(2, 575); oasc.write_shift(4, 196609); oasc.write_shift(2, 959); - oasc.write_shift(4, 131072 | (c$7[0].hidden ? 2 : 0)); + oasc.write_shift(4, 131072 | (c$6[0].hidden ? 2 : 0)); } { oasc.l += 2; oasc.write_shift(2, 61456); oasc.write_shift(4, 18); oasc.write_shift(2, 3); - oasc.write_shift(2, c$7[2] + 2); + oasc.write_shift(2, c$6[2] + 2); oasc.l += 2; - oasc.write_shift(2, c$7[1] + 1); + oasc.write_shift(2, c$6[1] + 1); oasc.l += 2; - oasc.write_shift(2, c$7[2] + 4); + oasc.write_shift(2, c$6[2] + 4); oasc.l += 2; - oasc.write_shift(2, c$7[1] + 5); + oasc.write_shift(2, c$6[1] + 5); oasc.l += 2; } { @@ -82630,9 +82834,9 @@ function write_comments_biff8(ba, comments) { } { var notesh = new_buf(12 + author.length); - notesh.write_shift(2, c$7[1]); - notesh.write_shift(2, c$7[2]); - notesh.write_shift(2, 0 | (c$7[0].hidden ? 0 : 2)); + notesh.write_shift(2, c$6[1]); + notesh.write_shift(2, c$6[2]); + notesh.write_shift(2, 0 | (c$6[0].hidden ? 0 : 2)); notesh.write_shift(2, b8oid); notesh.write_shift(2, author.length); notesh.write_shift(1, 0); @@ -82705,8 +82909,8 @@ function write_FMTS_biff8(ba, NF, opts) { [23, 26], [41, 44], [50, 392] - ].forEach(function(r$10) { - for (var i$7 = r$10[0]; i$7 <= r$10[1]; ++i$7) if (NF[i$7] != null) write_biff_rec(ba, 1054, write_Format(i$7, NF[i$7], opts)); + ].forEach(function(r$9) { + for (var i$7 = r$9[0]; i$7 <= r$9[1]; ++i$7) if (NF[i$7] != null) write_biff_rec(ba, 1054, write_Format(i$7, NF[i$7], opts)); }); } function write_FEAT(ba, ws) { @@ -82737,8 +82941,8 @@ function write_CELLXFS_biff8(ba, opts) { numFmtId: 0, style: true }, 0, opts)); - opts.cellXfs.forEach(function(c$7) { - write_biff_rec(ba, 224, write_XF(c$7, 0, opts)); + opts.cellXfs.forEach(function(c$6) { + write_biff_rec(ba, 224, write_XF(c$6, 0, opts)); }); } function write_ws_biff8_hlinks(ba, ws) { @@ -82894,11 +83098,11 @@ function write_biff8_global(wb, bufs, opts) { if (b8 && b8ocnts.length) write_biff_rec(C$2, 235, write_MsoDrawingGroup()); if (b8 && opts.Strings) write_biff_continue(C$2, 252, write_SST(opts.Strings, opts)); write_biff_rec(C$2, 10); - var c$7 = C$2.end(); + var c$6 = C$2.end(); var B$2 = buf_array(); var blen = 0, j$2 = 0; for (j$2 = 0; j$2 < wb.SheetNames.length; ++j$2) blen += (b8 ? 12 : 11) + (b8 ? 2 : 1) * wb.SheetNames[j$2].length; - var start = a$2.length + blen + c$7.length; + var start = a$2.length + blen + c$6.length; for (j$2 = 0; j$2 < wb.SheetNames.length; ++j$2) { var _sheet = _sheets[j$2] || {}; write_biff_rec(B$2, 133, write_BoundSheet8({ @@ -82914,7 +83118,7 @@ function write_biff8_global(wb, bufs, opts) { var out = []; if (a$2.length) out.push(a$2); if (b$3.length) out.push(b$3); - if (c$7.length) out.push(c$7); + if (c$6.length) out.push(c$6); return bconcat(out); } function write_biff8_buf(wb, opts) { @@ -83087,12 +83291,12 @@ function html_to_sheet(str, _opts) { if (merges.length) ws["!merges"] = merges; return ws; } -function make_html_row(ws, r$10, R$1, o$10) { +function make_html_row(ws, r$9, R$1, o$10) { var M$3 = ws["!merges"] || []; var oo = []; var sp = {}; var dense = ws["!data"] != null; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { var RS = 0, CS = 0; for (var j$2 = 0; j$2 < M$3.length; ++j$2) { if (M$3[j$2].s.r > R$1 || M$3[j$2].s.c > C$2) continue; @@ -83161,9 +83365,9 @@ function sheet_to_html(ws, opts) { var header = o$10.header != null ? o$10.header : HTML_BEGIN; var footer = o$10.footer != null ? o$10.footer : HTML_END; var out = [header]; - var r$10 = decode_range(ws["!ref"] || "A1"); - out.push(make_html_preamble(ws, r$10, o$10)); - if (ws["!ref"]) for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) out.push(make_html_row(ws, r$10, R$1, o$10)); + var r$9 = decode_range(ws["!ref"] || "A1"); + out.push(make_html_preamble(ws, r$9, o$10)); + if (ws["!ref"]) for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) out.push(make_html_row(ws, r$9, R$1, o$10)); out.push("" + footer); return out.join(""); } @@ -83333,9 +83537,9 @@ function parse_text_p(text$2) { var v$3 = unescapexml(fixed.replace(/<[^<>]*>/g, "")); return [v$3]; } -function parse_ods_styles(d$5, _opts, _nfm) { +function parse_ods_styles(d$4, _opts, _nfm) { var number_format_map = _nfm || {}; - var str = xlml_normalize(d$5); + var str = xlml_normalize(d$4); xlmlregex.lastIndex = 0; str = remove_doctype(str_remove_ng(str, "")); var Rn, NFtag, NF = "", tNF = "", y$3, etpos = 0, tidx = -1, infmt = false, payload = ""; @@ -83592,10 +83796,10 @@ function parse_ods_styles(d$5, _opts, _nfm) { } return number_format_map; } -function parse_content_xml(d$5, _opts, _nfm) { +function parse_content_xml(d$4, _opts, _nfm) { var opts = _opts || {}; if (DENSE != null && opts.dense == null) opts.dense = DENSE; - var str = xlml_normalize(d$5); + var str = xlml_normalize(d$4); var state$1 = [], tmp; var tag; var nfidx, NF = "", pidx = 0; @@ -83604,7 +83808,7 @@ function parse_content_xml(d$5, _opts, _nfm) { var Sheets = {}, SheetNames = []; var ws = {}; if (opts.dense) ws["!data"] = []; - var Rn, q$2; + var Rn, q$1; var ctag = { value: "" }, ctag2 = {}; var textp = "", textpidx = 0, textptag, oldtextp = "", oldtextpidx = 0; var textR = [], oldtextR = []; @@ -83713,20 +83917,20 @@ function parse_content_xml(d$5, _opts, _nfm) { ++C$2; ctag = parsexmltag(Rn[0], false); colpeat = parseInt(ctag["number-columns-repeated"] || "1", 10) || 1; - q$2 = { + q$1 = { t: "z", v: null }; - if (ctag.formula && opts.cellFormula != false) q$2.f = ods_to_csf_formula(unescapexml(ctag.formula)); - if (ctag["style-name"] && styles$1[ctag["style-name"]]) q$2.z = styles$1[ctag["style-name"]]; + if (ctag.formula && opts.cellFormula != false) q$1.f = ods_to_csf_formula(unescapexml(ctag.formula)); + if (ctag["style-name"] && styles$1[ctag["style-name"]]) q$1.z = styles$1[ctag["style-name"]]; if ((ctag["数据类型"] || ctag["value-type"]) == "string") { - q$2.t = "s"; - q$2.v = unescapexml(ctag["string-value"] || ""); + q$1.t = "s"; + q$1.v = unescapexml(ctag["string-value"] || ""); if (opts.dense) { if (!ws["!data"][R$1]) ws["!data"][R$1] = []; - ws["!data"][R$1][C$2] = q$2; + ws["!data"][R$1][C$2] = q$1; } else { - ws[encode_col(C$2) + encode_row(R$1)] = q$2; + ws[encode_col(C$2) + encode_row(R$1)] = q$1; } } C$2 += colpeat - 1; @@ -83746,11 +83950,11 @@ function parse_content_xml(d$5, _opts, _nfm) { ctag2 = parsexmltagraw(Rn[0], true); comments = []; comment = {}; - q$2 = { + q$1 = { t: ctag["数据类型"] || ctag["value-type"], v: null }; - if (ctag["style-name"] && styles$1[ctag["style-name"]]) q$2.z = styles$1[ctag["style-name"]]; + if (ctag["style-name"] && styles$1[ctag["style-name"]]) q$1.z = styles$1[ctag["style-name"]]; if (opts.cellFormula) { if (ctag.formula) ctag.formula = unescapexml(ctag.formula); if (ctag["number-matrix-columns-spanned"] && ctag["number-matrix-rows-spanned"]) { @@ -83766,12 +83970,12 @@ function parse_content_xml(d$5, _opts, _nfm) { c: C$2 + mC - 1 } }; - q$2.F = encode_range(mrange); - arrayf.push([mrange, q$2.F]); + q$1.F = encode_range(mrange); + arrayf.push([mrange, q$1.F]); } - if (ctag.formula) q$2.f = ods_to_csf_formula(ctag.formula); + if (ctag.formula) q$1.f = ods_to_csf_formula(ctag.formula); else for (i$7 = 0; i$7 < arrayf.length; ++i$7) if (R$1 >= arrayf[i$7][0].s.r && R$1 <= arrayf[i$7][0].e.r) { - if (C$2 >= arrayf[i$7][0].s.c && C$2 <= arrayf[i$7][0].e.c) q$2.F = arrayf[i$7][1]; + if (C$2 >= arrayf[i$7][0].s.c && C$2 <= arrayf[i$7][0].e.c) q$1.F = arrayf[i$7][1]; } } if (ctag["number-columns-spanned"] || ctag["number-rows-spanned"]) { @@ -83792,78 +83996,78 @@ function parse_content_xml(d$5, _opts, _nfm) { } } if (ctag["number-columns-repeated"]) colpeat = parseInt(ctag["number-columns-repeated"], 10); - switch (q$2.t) { + switch (q$1.t) { case "boolean": - q$2.t = "b"; - q$2.v = parsexmlbool(ctag["boolean-value"]) || +ctag["boolean-value"] >= 1; + q$1.t = "b"; + q$1.v = parsexmlbool(ctag["boolean-value"]) || +ctag["boolean-value"] >= 1; break; case "float": - q$2.t = "n"; - q$2.v = parseFloat(ctag.value); - if (opts.cellDates && q$2.z && fmt_is_date(q$2.z)) { - q$2.v = numdate(q$2.v + (WB.WBProps.date1904 ? 1462 : 0)); - q$2.t = typeof q$2.v == "number" ? "n" : "d"; + q$1.t = "n"; + q$1.v = parseFloat(ctag.value); + if (opts.cellDates && q$1.z && fmt_is_date(q$1.z)) { + q$1.v = numdate(q$1.v + (WB.WBProps.date1904 ? 1462 : 0)); + q$1.t = typeof q$1.v == "number" ? "n" : "d"; } break; case "percentage": - q$2.t = "n"; - q$2.v = parseFloat(ctag.value); + q$1.t = "n"; + q$1.v = parseFloat(ctag.value); break; case "currency": - q$2.t = "n"; - q$2.v = parseFloat(ctag.value); + q$1.t = "n"; + q$1.v = parseFloat(ctag.value); break; case "date": - q$2.t = "d"; - q$2.v = parseDate(ctag["date-value"], WB.WBProps.date1904); + q$1.t = "d"; + q$1.v = parseDate(ctag["date-value"], WB.WBProps.date1904); if (!opts.cellDates) { - q$2.t = "n"; - q$2.v = datenum(q$2.v, WB.WBProps.date1904); + q$1.t = "n"; + q$1.v = datenum(q$1.v, WB.WBProps.date1904); } - if (!q$2.z) q$2.z = "m/d/yy"; + if (!q$1.z) q$1.z = "m/d/yy"; break; case "time": - q$2.t = "n"; - q$2.v = parse_isodur(ctag["time-value"]) / 86400; + q$1.t = "n"; + q$1.v = parse_isodur(ctag["time-value"]) / 86400; if (opts.cellDates) { - q$2.v = numdate(q$2.v); - q$2.t = typeof q$2.v == "number" ? "n" : "d"; + q$1.v = numdate(q$1.v); + q$1.t = typeof q$1.v == "number" ? "n" : "d"; } - if (!q$2.z) q$2.z = "HH:MM:SS"; + if (!q$1.z) q$1.z = "HH:MM:SS"; break; case "number": - q$2.t = "n"; - q$2.v = parseFloat(ctag["数据数值"]); + q$1.t = "n"; + q$1.v = parseFloat(ctag["数据数值"]); break; - default: if (q$2.t === "string" || q$2.t === "text" || !q$2.t) { - q$2.t = "s"; + default: if (q$1.t === "string" || q$1.t === "text" || !q$1.t) { + q$1.t = "s"; if (ctag["string-value"] != null) { textp = unescapexml(ctag["string-value"]); textR = []; } - } else throw new Error("Unsupported value type " + q$2.t); + } else throw new Error("Unsupported value type " + q$1.t); } } else { isstub = false; if (ctag2["calcext:value-type"] == "error" && RBErr[textp] != null) { - q$2.t = "e"; - q$2.w = textp; - q$2.v = RBErr[textp]; + q$1.t = "e"; + q$1.w = textp; + q$1.v = RBErr[textp]; } - if (q$2.t === "s") { - q$2.v = textp || ""; - if (textR.length) q$2.R = textR; + if (q$1.t === "s") { + q$1.v = textp || ""; + if (textR.length) q$1.R = textR; isstub = textpidx == 0; } - if (atag.Target) q$2.l = atag; + if (atag.Target) q$1.l = atag; if (comments.length > 0) { - q$2.c = comments; + q$1.c = comments; comments = []; } - if (textp && opts.cellText !== false) q$2.w = textp; + if (textp && opts.cellText !== false) q$1.w = textp; if (isstub) { - q$2.t = "z"; - delete q$2.v; + q$1.t = "z"; + delete q$1.v; } if (!isstub || opts.sheetStubs) { if (!(opts.sheetRows && opts.sheetRows <= R$1)) { @@ -83871,17 +84075,17 @@ function parse_content_xml(d$5, _opts, _nfm) { colpeat = parseInt(ctag["number-columns-repeated"] || "1", 10); if (opts.dense) { if (!ws["!data"][R$1 + rpt]) ws["!data"][R$1 + rpt] = []; - ws["!data"][R$1 + rpt][C$2] = rpt == 0 ? q$2 : dup(q$2); - while (--colpeat > 0) ws["!data"][R$1 + rpt][C$2 + colpeat] = dup(q$2); + ws["!data"][R$1 + rpt][C$2] = rpt == 0 ? q$1 : dup(q$1); + while (--colpeat > 0) ws["!data"][R$1 + rpt][C$2 + colpeat] = dup(q$1); } else { ws[encode_cell({ r: R$1 + rpt, c: C$2 - })] = q$2; + })] = q$1; while (--colpeat > 0) ws[encode_cell({ r: R$1 + rpt, c: C$2 + colpeat - })] = dup(q$2); + })] = dup(q$1); } if (range.e.c <= C$2) range.e.c = C$2; } @@ -83890,7 +84094,7 @@ function parse_content_xml(d$5, _opts, _nfm) { colpeat = parseInt(ctag["number-columns-repeated"] || "1", 10); C$2 += colpeat - 1; colpeat = 0; - q$2 = {}; + q$1 = {}; textp = ""; textR = []; } @@ -84226,7 +84430,7 @@ function parse_fods(data, opts) { return wb; } function write_number_format_ods(nf, nfidx) { - var type = "number", payload = "", nopts = { "style:name": nfidx }, c$7 = "", i$7 = 0; + var type = "number", payload = "", nopts = { "style:name": nfidx }, c$6 = "", i$7 = 0; nf = nf.replace(/"[$]"/g, "$"); j: { if (nf.indexOf(";") > -1) { @@ -84242,14 +84446,14 @@ function write_number_format_ods(nf, nfidx) { type = "currency"; } if (nf[i$7] == "\"") { - c$7 = ""; - while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$7 += nf[i$7]; + c$6 = ""; + while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$6 += nf[i$7]; --i$7; if (nf[i$7 + 1] == "*") { i$7++; - payload += "" + escapexml(c$7.replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.replace(/""/g, "\"")) + ""; } else { - payload += "" + escapexml(c$7.replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.replace(/""/g, "\"")) + ""; } nf = nf.slice(i$7 + 1); i$7 = 0; @@ -84287,7 +84491,7 @@ function write_number_format_ods(nf, nfidx) { "d" ].indexOf(nf[0]) > -1) { type = "date"; - k: for (; i$7 < nf.length; ++i$7) switch (c$7 = nf[i$7].toLowerCase()) { + k: for (; i$7 < nf.length; ++i$7) switch (c$6 = nf[i$7].toLowerCase()) { case "h": case "s": has_time = true; @@ -84304,9 +84508,9 @@ function write_number_format_ods(nf, nfidx) { } case "y": case "d": - while ((nf[++i$7] || "").toLowerCase() == c$7[0]) c$7 += c$7[0]; + while ((nf[++i$7] || "").toLowerCase() == c$6[0]) c$6 += c$6[0]; --i$7; - switch (c$7) { + switch (c$6) { case "y": case "yy": payload += ""; @@ -84320,32 +84524,32 @@ function write_number_format_ods(nf, nfidx) { case "mm": case "mmm": case "mmmm": - payload += "= 3 ? "true" : "false") + "\"/>"; + payload += "= 3 ? "true" : "false") + "\"/>"; break; case "d": case "dd": - payload += ""; + payload += ""; break; case "ddd": case "dddd": - payload += ""; + payload += ""; break; } break; case "\"": - while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$7 += nf[i$7]; + while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$6 += nf[i$7]; --i$7; - payload += "" + escapexml(c$7.slice(1).replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.slice(1).replace(/""/g, "\"")) + ""; break; case "\\": - c$7 = nf[++i$7]; - payload += "" + escapexml(c$7) + ""; + c$6 = nf[++i$7]; + payload += "" + escapexml(c$6) + ""; break; case "/": case ":": - payload += "" + escapexml(c$7) + ""; + payload += "" + escapexml(c$6) + ""; break; - default: console.error("unrecognized character " + c$7 + " in ODF format " + nf); + default: console.error("unrecognized character " + c$6 + " in ODF format " + nf); } if (!has_time) break j; nf = nf.slice(i$7 + 1); @@ -84357,39 +84561,39 @@ function write_number_format_ods(nf, nfidx) { nf = nf.replace(/[\[\]]/g, ""); nopts["number:truncate-on-overflow"] = "false"; } - for (; i$7 < nf.length; ++i$7) switch (c$7 = nf[i$7].toLowerCase()) { + for (; i$7 < nf.length; ++i$7) switch (c$6 = nf[i$7].toLowerCase()) { case "h": case "m": case "s": - while ((nf[++i$7] || "").toLowerCase() == c$7[0]) c$7 += c$7[0]; + while ((nf[++i$7] || "").toLowerCase() == c$6[0]) c$6 += c$6[0]; --i$7; - switch (c$7) { + switch (c$6) { case "h": case "hh": - payload += ""; + payload += ""; break; case "m": case "mm": - payload += ""; + payload += ""; break; case "s": case "ss": if (nf[i$7 + 1] == ".") do { - c$7 += nf[i$7 + 1]; + c$6 += nf[i$7 + 1]; ++i$7; } while (nf[i$7 + 1] == "0"); - payload += ""; + payload += ""; break; } break; case "\"": - while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$7 += nf[i$7]; + while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$6 += nf[i$7]; --i$7; - payload += "" + escapexml(c$7.slice(1).replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.slice(1).replace(/""/g, "\"")) + ""; break; case "/": case ":": - payload += "" + escapexml(c$7) + ""; + payload += "" + escapexml(c$6) + ""; break; case "a": if (nf.slice(i$7, i$7 + 3).toLowerCase() == "a/p") { @@ -84402,7 +84606,7 @@ function write_number_format_ods(nf, nfidx) { i$7 += 4; break; } - default: console.error("unrecognized character " + c$7 + " in ODF format " + nf); + default: console.error("unrecognized character " + c$6 + " in ODF format " + nf); } break j; } @@ -84416,13 +84620,13 @@ function write_number_format_ods(nf, nfidx) { } i$7 = 0; if (nf[i$7] == "\"") { - while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$7 += nf[i$7]; + while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$6 += nf[i$7]; --i$7; if (nf[i$7 + 1] == "*") { i$7++; - payload += "" + escapexml(c$7.replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.replace(/""/g, "\"")) + ""; } else { - payload += "" + escapexml(c$7.replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.replace(/""/g, "\"")) + ""; } nf = nf.slice(i$7 + 1); i$7 = 0; @@ -84435,10 +84639,10 @@ function write_number_format_ods(nf, nfidx) { i$7 = np.index + np[0].length; } if (nf[i$7] == "\"") { - c$7 = ""; - while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$7 += nf[i$7]; + c$6 = ""; + while (nf[++i$7] != "\"" || nf[++i$7] == "\"") c$6 += nf[i$7]; --i$7; - payload += "" + escapexml(c$7.replace(/""/g, "\"")) + ""; + payload += "" + escapexml(c$6.replace(/""/g, "\"")) + ""; } } if (!payload) { @@ -84697,8 +84901,8 @@ function write_shallow(proto) { return u8concat(out); } function mappa(data, cb) { - return (data == null ? void 0 : data.map(function(d$5) { - return cb(d$5.data); + return (data == null ? void 0 : data.map(function(d$4) { + return cb(d$4.data); })) || []; } function parse_iwa_file(buf) { @@ -84774,14 +84978,14 @@ function parse_snappy_chunk(type, buf) { var len = buf[l$3++] >> 2; if (len < 60) ++len; else { - var c$7 = len - 59; + var c$6 = len - 59; len = buf[l$3]; - if (c$7 > 1) len |= buf[l$3 + 1] << 8; - if (c$7 > 2) len |= buf[l$3 + 2] << 16; - if (c$7 > 3) len |= buf[l$3 + 3] << 24; + if (c$6 > 1) len |= buf[l$3 + 1] << 8; + if (c$6 > 2) len |= buf[l$3 + 2] << 16; + if (c$6 > 3) len |= buf[l$3 + 3] << 24; len >>>= 0; len++; - l$3 += c$7; + l$3 += c$6; } chunks.push(buf[subarray](l$3, l$3 + len)); l$3 += len; @@ -84852,50 +85056,50 @@ function compress_iwa_file(buf) { var out = []; var l$3 = 0; while (l$3 < buf.length) { - var c$7 = Math.min(buf.length - l$3, 268435455); + var c$6 = Math.min(buf.length - l$3, 268435455); var frame = new Uint8Array(4); out.push(frame); - var usz = write_varint49(c$7); + var usz = write_varint49(c$6); var L$2 = usz.length; out.push(usz); - if (c$7 <= 60) { + if (c$6 <= 60) { L$2++; - out.push(new Uint8Array([c$7 - 1 << 2])); - } else if (c$7 <= 256) { + out.push(new Uint8Array([c$6 - 1 << 2])); + } else if (c$6 <= 256) { L$2 += 2; - out.push(new Uint8Array([240, c$7 - 1 & 255])); - } else if (c$7 <= 65536) { + out.push(new Uint8Array([240, c$6 - 1 & 255])); + } else if (c$6 <= 65536) { L$2 += 3; out.push(new Uint8Array([ 244, - c$7 - 1 & 255, - c$7 - 1 >> 8 & 255 + c$6 - 1 & 255, + c$6 - 1 >> 8 & 255 ])); - } else if (c$7 <= 16777216) { + } else if (c$6 <= 16777216) { L$2 += 4; out.push(new Uint8Array([ 248, - c$7 - 1 & 255, - c$7 - 1 >> 8 & 255, - c$7 - 1 >> 16 & 255 + c$6 - 1 & 255, + c$6 - 1 >> 8 & 255, + c$6 - 1 >> 16 & 255 ])); - } else if (c$7 <= 4294967296) { + } else if (c$6 <= 4294967296) { L$2 += 5; out.push(new Uint8Array([ 252, - c$7 - 1 & 255, - c$7 - 1 >> 8 & 255, - c$7 - 1 >> 16 & 255, - c$7 - 1 >>> 24 & 255 + c$6 - 1 & 255, + c$6 - 1 >> 8 & 255, + c$6 - 1 >> 16 & 255, + c$6 - 1 >>> 24 & 255 ])); } - out.push(buf[subarray](l$3, l$3 + c$7)); - L$2 += c$7; + out.push(buf[subarray](l$3, l$3 + c$6)); + L$2 += c$6; frame[0] = 0; frame[1] = L$2 & 255; frame[2] = L$2 >> 8 & 255; frame[3] = L$2 >> 16 & 255; - l$3 += c$7; + l$3 += c$6; } return u8concat(out); } @@ -84909,77 +85113,77 @@ function numbers_format_cell(cell, t$6, flags, ofmt, nfmt) { var dmin = ((_b = fmt[15]) == null ? void 0 : _b[0]) ? varint_to_i32(fmt[15][0].data) : -1; var dmax = ((_c = fmt[16]) == null ? void 0 : _c[0]) ? varint_to_i32(fmt[16][0].data) : -1; var auto = ((_d = fmt[40]) == null ? void 0 : _d[0]) ? varint_to_i32(fmt[40][0].data) : -1; - var d$5 = cell.v, dd = d$5; + var d$4 = cell.v, dd = d$4; autodur: if (auto) { - if (d$5 == 0) { + if (d$4 == 0) { dmin = dmax = 2; break autodur; } - if (d$5 >= 604800) dmin = 1; - else if (d$5 >= 86400) dmin = 2; - else if (d$5 >= 3600) dmin = 4; - else if (d$5 >= 60) dmin = 8; - else if (d$5 >= 1) dmin = 16; + if (d$4 >= 604800) dmin = 1; + else if (d$4 >= 86400) dmin = 2; + else if (d$4 >= 3600) dmin = 4; + else if (d$4 >= 60) dmin = 8; + else if (d$4 >= 1) dmin = 16; else dmin = 32; - if (Math.floor(d$5) != d$5) dmax = 32; - else if (d$5 % 60) dmax = 16; - else if (d$5 % 3600) dmax = 8; - else if (d$5 % 86400) dmax = 4; - else if (d$5 % 604800) dmax = 2; + if (Math.floor(d$4) != d$4) dmax = 32; + else if (d$4 % 60) dmax = 16; + else if (d$4 % 3600) dmax = 8; + else if (d$4 % 86400) dmax = 4; + else if (d$4 % 604800) dmax = 2; if (dmax < dmin) dmax = dmin; } if (dmin == -1 || dmax == -1) break dur; var dstr = [], zstr = []; if (dmin == 1) { - dd = d$5 / 604800; + dd = d$4 / 604800; if (dmax == 1) { zstr.push("d\"d\""); } else { dd |= 0; - d$5 -= 604800 * dd; + d$4 -= 604800 * dd; } dstr.push(dd + (dstyle == 2 ? " week" + (dd == 1 ? "" : "s") : dstyle == 1 ? "w" : "")); } if (dmin <= 2 && dmax >= 2) { - dd = d$5 / 86400; + dd = d$4 / 86400; if (dmax > 2) { dd |= 0; - d$5 -= 86400 * dd; + d$4 -= 86400 * dd; } zstr.push("d\"d\""); dstr.push(dd + (dstyle == 2 ? " day" + (dd == 1 ? "" : "s") : dstyle == 1 ? "d" : "")); } if (dmin <= 4 && dmax >= 4) { - dd = d$5 / 3600; + dd = d$4 / 3600; if (dmax > 4) { dd |= 0; - d$5 -= 3600 * dd; + d$4 -= 3600 * dd; } zstr.push((dmin >= 4 ? "[h]" : "h") + "\"h\""); dstr.push(dd + (dstyle == 2 ? " hour" + (dd == 1 ? "" : "s") : dstyle == 1 ? "h" : "")); } if (dmin <= 8 && dmax >= 8) { - dd = d$5 / 60; + dd = d$4 / 60; if (dmax > 8) { dd |= 0; - d$5 -= 60 * dd; + d$4 -= 60 * dd; } zstr.push((dmin >= 8 ? "[m]" : "m") + "\"m\""); if (dstyle == 0) dstr.push((dmin == 8 && dmax == 8 || dd >= 10 ? "" : "0") + dd); else dstr.push(dd + (dstyle == 2 ? " minute" + (dd == 1 ? "" : "s") : dstyle == 1 ? "m" : "")); } if (dmin <= 16 && dmax >= 16) { - dd = d$5; + dd = d$4; if (dmax > 16) { dd |= 0; - d$5 -= dd; + d$4 -= dd; } zstr.push((dmin >= 16 ? "[s]" : "s") + "\"s\""); if (dstyle == 0) dstr.push((dmax == 16 && dmin == 16 || dd >= 10 ? "" : "0") + dd); else dstr.push(dd + (dstyle == 2 ? " second" + (dd == 1 ? "" : "s") : dstyle == 1 ? "s" : "")); } if (dmax >= 32) { - dd = Math.round(1e3 * d$5); + dd = Math.round(1e3 * d$4); if (dmin < 32) zstr.push(".000\"ms\""); if (dstyle == 0) dstr.push((dd >= 100 ? "" : dd >= 10 ? "0" : "00") + dd); else dstr.push(dd + (dstyle == 2 ? " millisecond" + (dd == 1 ? "" : "s") : dstyle == 1 ? "ms" : "")); @@ -85390,8 +85594,8 @@ function numbers_del_oref(iwa, ref) { var orefs = ((_a = iwa.messages[0].meta[5]) == null ? void 0 : _a[0]) ? parse_packed_varints(iwa.messages[0].meta[5][0].data) : []; iwa.messages[0].meta[5] = [{ type: 2, - data: write_packed_varints(orefs.filter(function(r$10) { - return r$10 != ref; + data: write_packed_varints(orefs.filter(function(r$9) { + return r$9 != ref; })) }]; } @@ -85519,16 +85723,16 @@ function parse_TSD_CommentStorageArchive(M$3, data) { t: "", a: "" }; - var csp$1 = parse_shallow(data); - if ((_b = (_a = csp$1 == null ? void 0 : csp$1[1]) == null ? void 0 : _a[0]) == null ? void 0 : _b.data) out.t = u8str((_d = (_c = csp$1 == null ? void 0 : csp$1[1]) == null ? void 0 : _c[0]) == null ? void 0 : _d.data) || ""; - if ((_f = (_e$1 = csp$1 == null ? void 0 : csp$1[3]) == null ? void 0 : _e$1[0]) == null ? void 0 : _f.data) { - var as = M$3[parse_TSP_Reference((_h = (_g = csp$1 == null ? void 0 : csp$1[3]) == null ? void 0 : _g[0]) == null ? void 0 : _h.data)][0]; + var csp = parse_shallow(data); + if ((_b = (_a = csp == null ? void 0 : csp[1]) == null ? void 0 : _a[0]) == null ? void 0 : _b.data) out.t = u8str((_d = (_c = csp == null ? void 0 : csp[1]) == null ? void 0 : _c[0]) == null ? void 0 : _d.data) || ""; + if ((_f = (_e$1 = csp == null ? void 0 : csp[3]) == null ? void 0 : _e$1[0]) == null ? void 0 : _f.data) { + var as = M$3[parse_TSP_Reference((_h = (_g = csp == null ? void 0 : csp[3]) == null ? void 0 : _g[0]) == null ? void 0 : _h.data)][0]; var asp = parse_shallow(as.data); if ((_j = (_i$1 = asp[1]) == null ? void 0 : _i$1[0]) == null ? void 0 : _j.data) out.a = u8str(asp[1][0].data); } - if (csp$1 == null ? void 0 : csp$1[4]) { + if (csp == null ? void 0 : csp[4]) { out.replies = []; - csp$1[4].forEach(function(pi) { + csp[4].forEach(function(pi) { var cs = M$3[parse_TSP_Reference(pi.data)][0]; out.replies.push(parse_TSD_CommentStorageArchive(M$3, cs.data)); }); @@ -85666,14 +85870,14 @@ function parse_TST_TableModelArchive(M$3, root, ws, opts) { if (!((_b2 = AST_colon_tract[3]) == null ? void 0 : _b2[0]) || !((_c2 = AST_colon_tract[4]) == null ? void 0 : _c2[0])) return; var colrange = parse_shallow(AST_colon_tract[3][0].data); var rowrange = parse_shallow(AST_colon_tract[4][0].data); - var c$7 = varint_to_i32(colrange[1][0].data); - var C$2 = ((_d2 = colrange[2]) == null ? void 0 : _d2[0]) ? varint_to_i32(colrange[2][0].data) : c$7; - var r$10 = varint_to_i32(rowrange[1][0].data); - var R$1 = ((_e2 = rowrange[2]) == null ? void 0 : _e2[0]) ? varint_to_i32(rowrange[2][0].data) : r$10; + var c$6 = varint_to_i32(colrange[1][0].data); + var C$2 = ((_d2 = colrange[2]) == null ? void 0 : _d2[0]) ? varint_to_i32(colrange[2][0].data) : c$6; + var r$9 = varint_to_i32(rowrange[1][0].data); + var R$1 = ((_e2 = rowrange[2]) == null ? void 0 : _e2[0]) ? varint_to_i32(rowrange[2][0].data) : r$9; return { s: { - r: r$10, - c: c$7 + r: r$9, + c: c$6 }, e: { r: R$1, @@ -85934,7 +86138,7 @@ function build_numbers_deps(cfb) { }); return dependents; } -function write_TSP_Color_RGB(r$10, g$1, b$3) { +function write_TSP_Color_RGB(r$9, g$1, b$3) { return write_shallow([ [], [{ @@ -85944,7 +86148,7 @@ function write_TSP_Color_RGB(r$10, g$1, b$3) { [], [{ type: 5, - data: new Uint8Array(Float32Array.from([r$10 / 255]).buffer) + data: new Uint8Array(Float32Array.from([r$9 / 255]).buffer) }], [{ type: 5, @@ -87056,12 +87260,12 @@ function write_numbers_tma(cfb, deps, ws, tmaroot, tmafile, tmaref) { LUT.cmnt.forEach(function(cc, i$7) { if (i$7 == 0) return; var replies = []; - if (cc.replies) cc.replies.forEach(function(c$7) { - if (!authors[c$7.a || ""]) authors[c$7.a || ""] = numbers_add_msg(cfb, 212, [ + if (cc.replies) cc.replies.forEach(function(c$6) { + if (!authors[c$6.a || ""]) authors[c$6.a || ""] = numbers_add_msg(cfb, 212, [ [], [{ type: 2, - data: stru8(c$7.a || "") + data: stru8(c$6.a || "") }], [{ type: 2, @@ -87073,12 +87277,12 @@ function write_numbers_tma(cfb, deps, ws, tmaroot, tmafile, tmaref) { data: write_varint49(0) }] ], "/Index/Tables/DataList", deps); - var aaaid2 = authors[c$7.a || ""]; + var aaaid2 = authors[c$6.a || ""]; var csaid2 = numbers_add_msg(cfb, 3056, [ [], [{ type: 2, - data: stru8(c$7.t || "") + data: stru8(c$6.t || "") }], [{ type: 2, @@ -87154,10 +87358,10 @@ function write_numbers_tma(cfb, deps, ws, tmaroot, tmafile, tmaref) { type: 2, data: write_TSP_Reference(aaaid) }], - replies.map(function(r$10) { + replies.map(function(r$9) { return { type: 2, - data: write_TSP_Reference(r$10) + data: write_TSP_Reference(r$9) }; }), [{ @@ -87177,8 +87381,8 @@ function write_numbers_tma(cfb, deps, ws, tmaroot, tmafile, tmaref) { ], "/Index/Tables/DataList", deps); numbers_iwa_doit(cfb, deps, csaid, function(iwa) { numbers_add_oref(iwa, aaaid); - replies.forEach(function(r$10) { - return numbers_add_oref(iwa, r$10); + replies.forEach(function(r$9) { + return numbers_add_oref(iwa, r$9); }); }); cmntdata[3].push({ @@ -87228,9 +87432,9 @@ function write_numbers_tma(cfb, deps, ws, tmaroot, tmafile, tmaref) { function fix_opts_func(defaults) { return function fix_opts(opts) { for (var i$7 = 0; i$7 != defaults.length; ++i$7) { - var d$5 = defaults[i$7]; - if (opts[d$5[0]] === undefined) opts[d$5[0]] = d$5[1]; - if (d$5[2] === "n") opts[d$5[0]] = Number(opts[d$5[0]]); + var d$4 = defaults[i$7]; + if (opts[d$4[0]] === undefined) opts[d$4[0]] = d$4[1]; + if (d$4[2] === "n") opts[d$4[0]] = Number(opts[d$4[0]]); } }; } @@ -87638,8 +87842,8 @@ function write_zip_xlsb(wb, opts) { if (comments && comments.length > 0) { var needtc = false; comments.forEach(function(carr) { - carr[1].forEach(function(c$7) { - if (c$7.T == true) needtc = true; + carr[1].forEach(function(c$6) { + if (c$6.T == true) needtc = true; }); }); if (needtc) { @@ -87777,8 +87981,8 @@ function write_zip_xlsx(wb, opts) { if (comments && comments.length > 0) { var needtc = false; comments.forEach(function(carr) { - carr[1].forEach(function(c$7) { - if (c$7.T == true) needtc = true; + carr[1].forEach(function(c$6) { + if (c$6.T == true) needtc = true; }); }); if (needtc) { @@ -87889,10 +88093,10 @@ function read_cfb(cfb, opts) { return parse_xlscfb(cfb, opts); } function read_zip(data, opts) { - var zip, d$5 = data; + var zip, d$4 = data; var o$10 = opts || {}; if (!o$10.type) o$10.type = has_buf && Buffer.isBuffer(data) ? "buffer" : "base64"; - zip = zip_read(d$5, o$10); + zip = zip_read(d$4, o$10); return parse_zip(zip, o$10); } function read_plaintext(data, o$10) { @@ -87930,22 +88134,22 @@ function read_plaintext_raw(data, o$10) { return read_plaintext(str, o$10); } function read_utf16(data, o$10) { - var d$5 = data; - if (o$10.type == "base64") d$5 = Base64_decode(d$5); - if (typeof ArrayBuffer !== "undefined" && data instanceof ArrayBuffer) d$5 = new Uint8Array(data); - d$5 = typeof $cptable !== "undefined" ? $cptable.utils.decode(1200, d$5.slice(2), "str") : has_buf && Buffer.isBuffer(data) ? data.slice(2).toString("utf16le") : typeof Uint8Array !== "undefined" && d$5 instanceof Uint8Array ? typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le").decode(d$5.slice(2)) : utf16lereadu(d$5.slice(2)) : utf16leread(d$5.slice(2)); + var d$4 = data; + if (o$10.type == "base64") d$4 = Base64_decode(d$4); + if (typeof ArrayBuffer !== "undefined" && data instanceof ArrayBuffer) d$4 = new Uint8Array(data); + d$4 = typeof $cptable !== "undefined" ? $cptable.utils.decode(1200, d$4.slice(2), "str") : has_buf && Buffer.isBuffer(data) ? data.slice(2).toString("utf16le") : typeof Uint8Array !== "undefined" && d$4 instanceof Uint8Array ? typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le").decode(d$4.slice(2)) : utf16lereadu(d$4.slice(2)) : utf16leread(d$4.slice(2)); o$10.type = "binary"; - return read_plaintext(d$5, o$10); + return read_plaintext(d$4, o$10); } function bstrify(data) { return !data.match(/[^\x00-\x7F]/) ? data : utf8write(data); } -function read_prn(data, d$5, o$10, str) { +function read_prn(data, d$4, o$10, str) { if (str) { o$10.type = "string"; return PRN.to_workbook(data, o$10); } - return PRN.to_workbook(d$5, o$10); + return PRN.to_workbook(d$4, o$10); } function readSync(data, opts) { reset_cp(); @@ -87954,7 +88158,7 @@ function readSync(data, opts) { if (typeof ArrayBuffer !== "undefined" && data instanceof ArrayBuffer) return readSync(new Uint8Array(data), (o$10 = dup(o$10), o$10.type = "array", o$10)); if (typeof Int8Array !== "undefined" && data instanceof Int8Array) return readSync(new Uint8Array(data.buffer, data.byteOffset, data.length), o$10); if (typeof Uint8Array !== "undefined" && data instanceof Uint8Array && !o$10.type) o$10.type = typeof Deno !== "undefined" ? "buffer" : "array"; - var d$5 = data, n$9 = [ + var d$4 = data, n$9 = [ 0, 0, 0, @@ -87969,14 +88173,14 @@ function readSync(data, opts) { if (!o$10.type) o$10.type = has_buf && Buffer.isBuffer(data) ? "buffer" : "base64"; if (o$10.type == "file") { o$10.type = has_buf ? "buffer" : "binary"; - d$5 = read_binary(data); + d$4 = read_binary(data); if (typeof Uint8Array !== "undefined" && !has_buf) o$10.type = "array"; } if (o$10.type == "string") { str = true; o$10.type = "binary"; o$10.codepage = 65001; - d$5 = bstrify(data); + d$4 = bstrify(data); } if (o$10.type == "array" && typeof Uint8Array !== "undefined" && data instanceof Uint8Array && typeof ArrayBuffer !== "undefined") { var ab = new ArrayBuffer(3), vu = new Uint8Array(ab); @@ -87984,47 +88188,47 @@ function readSync(data, opts) { if (!vu.foo) { o$10 = dup(o$10); o$10.type = "array"; - return readSync(ab2a(d$5), o$10); + return readSync(ab2a(d$4), o$10); } } - switch ((n$9 = firstbyte(d$5, o$10))[0]) { + switch ((n$9 = firstbyte(d$4, o$10))[0]) { case 208: - if (n$9[1] === 207 && n$9[2] === 17 && n$9[3] === 224 && n$9[4] === 161 && n$9[5] === 177 && n$9[6] === 26 && n$9[7] === 225) return read_cfb(CFB.read(d$5, o$10), o$10); + if (n$9[1] === 207 && n$9[2] === 17 && n$9[3] === 224 && n$9[4] === 161 && n$9[5] === 177 && n$9[6] === 26 && n$9[7] === 225) return read_cfb(CFB.read(d$4, o$10), o$10); break; case 9: - if (n$9[1] <= 8) return parse_xlscfb(d$5, o$10); + if (n$9[1] <= 8) return parse_xlscfb(d$4, o$10); break; - case 60: return parse_xlml(d$5, o$10); + case 60: return parse_xlml(d$4, o$10); case 73: if (n$9[1] === 73 && n$9[2] === 42 && n$9[3] === 0) throw new Error("TIFF Image File is not a spreadsheet"); - if (n$9[1] === 68) return read_wb_ID(d$5, o$10); + if (n$9[1] === 68) return read_wb_ID(d$4, o$10); break; case 84: - if (n$9[1] === 65 && n$9[2] === 66 && n$9[3] === 76) return DIF.to_workbook(d$5, o$10); + if (n$9[1] === 65 && n$9[2] === 66 && n$9[3] === 76) return DIF.to_workbook(d$4, o$10); break; - case 80: return n$9[1] === 75 && n$9[2] < 9 && n$9[3] < 9 ? read_zip(d$5, o$10) : read_prn(data, d$5, o$10, str); - case 239: return n$9[3] === 60 ? parse_xlml(d$5, o$10) : read_prn(data, d$5, o$10, str); + case 80: return n$9[1] === 75 && n$9[2] < 9 && n$9[3] < 9 ? read_zip(d$4, o$10) : read_prn(data, d$4, o$10, str); + case 239: return n$9[3] === 60 ? parse_xlml(d$4, o$10) : read_prn(data, d$4, o$10, str); case 255: if (n$9[1] === 254) { - return read_utf16(d$5, o$10); - } else if (n$9[1] === 0 && n$9[2] === 2 && n$9[3] === 0) return WK_.to_workbook(d$5, o$10); + return read_utf16(d$4, o$10); + } else if (n$9[1] === 0 && n$9[2] === 2 && n$9[3] === 0) return WK_.to_workbook(d$4, o$10); break; case 0: if (n$9[1] === 0) { - if (n$9[2] >= 2 && n$9[3] === 0) return WK_.to_workbook(d$5, o$10); - if (n$9[2] === 0 && (n$9[3] === 8 || n$9[3] === 9)) return WK_.to_workbook(d$5, o$10); + if (n$9[2] >= 2 && n$9[3] === 0) return WK_.to_workbook(d$4, o$10); + if (n$9[2] === 0 && (n$9[3] === 8 || n$9[3] === 9)) return WK_.to_workbook(d$4, o$10); } break; case 3: case 131: case 139: - case 140: return DBF.to_workbook(d$5, o$10); + case 140: return DBF.to_workbook(d$4, o$10); case 123: - if (n$9[1] === 92 && n$9[2] === 114 && n$9[3] === 116) return rtf_to_workbook(d$5, o$10); + if (n$9[1] === 92 && n$9[2] === 114 && n$9[3] === 116) return rtf_to_workbook(d$4, o$10); break; case 10: case 13: - case 32: return read_plaintext_raw(d$5, o$10); + case 32: return read_plaintext_raw(d$4, o$10); case 137: if (n$9[1] === 80 && n$9[2] === 78 && n$9[3] === 71) throw new Error("PNG Image File is not a spreadsheet"); break; @@ -88036,8 +88240,8 @@ function readSync(data, opts) { if (n$9[1] === 237) throw new Error("Unsupported Multiplan 3.x file!"); break; } - if (DBF_SUPPORTED_VERSIONS.indexOf(n$9[0]) > -1 && n$9[2] <= 12 && n$9[3] <= 31) return DBF.to_workbook(d$5, o$10); - return read_prn(data, d$5, o$10, str); + if (DBF_SUPPORTED_VERSIONS.indexOf(n$9[0]) > -1 && n$9[2] <= 12 && n$9[3] <= 31) return DBF.to_workbook(d$4, o$10); + return read_prn(data, d$4, o$10, str); } function readFileSync(filename, opts) { var o$10 = opts || {}; @@ -88129,8 +88333,8 @@ function write_string_type(out, opts, bom) { case "buffer": { if (has_buf) return Buffer_from(o$10, "utf8"); else if (typeof TextEncoder !== "undefined") return new TextEncoder().encode(o$10); - else return write_string_type(o$10, { type: "binary" }).split("").map(function(c$7) { - return c$7.charCodeAt(0); + else return write_string_type(o$10, { type: "binary" }).split("").map(function(c$6) { + return c$6.charCodeAt(0); }); } } @@ -88144,8 +88348,8 @@ function write_stxt_type(out, opts) { case "file": return write_dl(opts.file, out, "binary"); case "buffer": { if (has_buf) return Buffer_from(out, "binary"); - else return out.split("").map(function(c$7) { - return c$7.charCodeAt(0); + else return out.split("").map(function(c$6) { + return c$6.charCodeAt(0); }); } } @@ -88274,7 +88478,7 @@ function writeFileAsync(filename, wb, opts, cb) { if (!(_cb instanceof Function)) _cb = opts; return _fs.writeFile(filename, writeSync(wb, o$10), _cb); } -function make_json_row(sheet, r$10, R$1, cols, header, hdr, o$10) { +function make_json_row(sheet, r$9, R$1, cols, header, hdr, o$10) { var rr = encode_row(R$1); var defval = o$10.defval, raw = o$10.raw || !Object.prototype.hasOwnProperty.call(o$10, "raw"); var isempty = true, dense = sheet["!data"] != null; @@ -88290,7 +88494,7 @@ function make_json_row(sheet, r$10, R$1, cols, header, hdr, o$10) { } else row.__rowNum__ = R$1; } - if (!dense || sheet["!data"][R$1]) for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + if (!dense || sheet["!data"][R$1]) for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { var val$1 = dense ? (sheet["!data"][R$1] || [])[C$2] : sheet[cols[C$2] + rr]; if (val$1 == null || val$1.t === undefined) { if (defval === undefined) continue; @@ -88341,7 +88545,7 @@ function sheet_to_json(sheet, opts) { t: "n", v: 0 }, header = 0, offset = 1, hdr = [], v$3 = 0, vv = ""; - var r$10 = { + var r$9 = { s: { r: 0, c: 0 @@ -88359,38 +88563,38 @@ function sheet_to_json(sheet, opts) { else if (o$10.header == null) header = 0; switch (typeof range) { case "string": - r$10 = safe_decode_range(range); + r$9 = safe_decode_range(range); break; case "number": - r$10 = safe_decode_range(sheet["!ref"]); - r$10.s.r = range; + r$9 = safe_decode_range(sheet["!ref"]); + r$9.s.r = range; break; - default: r$10 = range; + default: r$9 = range; } if (header > 0) offset = 0; - var rr = encode_row(r$10.s.r); + var rr = encode_row(r$9.s.r); var cols = []; var out = []; var outi = 0, counter = 0; var dense = sheet["!data"] != null; - var R$1 = r$10.s.r, C$2 = 0; + var R$1 = r$9.s.r, C$2 = 0; var header_cnt = {}; if (dense && !sheet["!data"][R$1]) sheet["!data"][R$1] = []; var colinfo = o$10.skipHidden && sheet["!cols"] || []; var rowinfo = o$10.skipHidden && sheet["!rows"] || []; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { if ((colinfo[C$2] || {}).hidden) continue; cols[C$2] = encode_col(C$2); val$1 = dense ? sheet["!data"][R$1][C$2] : sheet[cols[C$2] + rr]; switch (header) { case 1: - hdr[C$2] = C$2 - r$10.s.c; + hdr[C$2] = C$2 - r$9.s.c; break; case 2: hdr[C$2] = cols[C$2]; break; case 3: - hdr[C$2] = o$10.header[C$2 - r$10.s.c]; + hdr[C$2] = o$10.header[C$2 - r$9.s.c]; break; default: if (val$1 == null) val$1 = { @@ -88410,20 +88614,20 @@ function sheet_to_json(sheet, opts) { hdr[C$2] = vv; } } - for (R$1 = r$10.s.r + offset; R$1 <= r$10.e.r; ++R$1) { + for (R$1 = r$9.s.r + offset; R$1 <= r$9.e.r; ++R$1) { if ((rowinfo[R$1] || {}).hidden) continue; - var row = make_json_row(sheet, r$10, R$1, cols, header, hdr, o$10); + var row = make_json_row(sheet, r$9, R$1, cols, header, hdr, o$10); if (row.isempty === false || (header === 1 ? o$10.blankrows !== false : !!o$10.blankrows)) out[outi++] = row.row; } out.length = outi; return out; } -function make_csv_row(sheet, r$10, R$1, cols, fs, rs, FS, w$2, o$10) { +function make_csv_row(sheet, r$9, R$1, cols, fs, rs, FS, w$2, o$10) { var isempty = true; var row = [], txt = "", rr = encode_row(R$1); var dense = sheet["!data"] != null; var datarow = dense && sheet["!data"][R$1] || []; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { if (!cols[C$2]) continue; var val$1 = dense ? datarow[C$2] : sheet[cols[C$2] + rr]; if (val$1 == null) txt = ""; @@ -88450,17 +88654,17 @@ function sheet_to_csv(sheet, opts) { var out = []; var o$10 = opts == null ? {} : opts; if (sheet == null || sheet["!ref"] == null) return ""; - var r$10 = safe_decode_range(sheet["!ref"]); + var r$9 = safe_decode_range(sheet["!ref"]); var FS = o$10.FS !== undefined ? o$10.FS : ",", fs = FS.charCodeAt(0); var RS = o$10.RS !== undefined ? o$10.RS : "\n", rs = RS.charCodeAt(0); var row = "", cols = []; var colinfo = o$10.skipHidden && sheet["!cols"] || []; var rowinfo = o$10.skipHidden && sheet["!rows"] || []; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) if (!(colinfo[C$2] || {}).hidden) cols[C$2] = encode_col(C$2); + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) if (!(colinfo[C$2] || {}).hidden) cols[C$2] = encode_col(C$2); var w$2 = 0; - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { if ((rowinfo[R$1] || {}).hidden) continue; - row = make_csv_row(sheet, r$10, R$1, cols, fs, rs, FS, w$2, o$10); + row = make_csv_row(sheet, r$9, R$1, cols, fs, rs, FS, w$2, o$10); if (row == null) { continue; } @@ -88480,13 +88684,13 @@ function sheet_to_txt(sheet, opts) { function sheet_to_formulae(sheet, opts) { var y$3 = "", x$2, val$1 = ""; if (sheet == null || sheet["!ref"] == null) return []; - var r$10 = safe_decode_range(sheet["!ref"]), rr = "", cols = [], C$2; + var r$9 = safe_decode_range(sheet["!ref"]), rr = "", cols = [], C$2; var cmds = []; var dense = sheet["!data"] != null; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) cols[C$2] = encode_col(C$2); - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) cols[C$2] = encode_col(C$2); + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { rr = encode_row(R$1); - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { y$3 = cols[C$2] + rr; x$2 = dense ? (sheet["!data"][R$1] || [])[C$2] : sheet[y$3]; val$1 = ""; @@ -88736,24 +88940,24 @@ function write_csv_stream(sheet, opts) { stream.push(null); return stream; } - var r$10 = safe_decode_range(sheet["!ref"]); + var r$9 = safe_decode_range(sheet["!ref"]); var FS = o$10.FS !== undefined ? o$10.FS : ",", fs = FS.charCodeAt(0); var RS = o$10.RS !== undefined ? o$10.RS : "\n", rs = RS.charCodeAt(0); var row = "", cols = []; var colinfo = o$10.skipHidden && sheet["!cols"] || []; var rowinfo = o$10.skipHidden && sheet["!rows"] || []; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) if (!(colinfo[C$2] || {}).hidden) cols[C$2] = encode_col(C$2); - var R$1 = r$10.s.r; + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) if (!(colinfo[C$2] || {}).hidden) cols[C$2] = encode_col(C$2); + var R$1 = r$9.s.r; var BOM = false, w$2 = 0; stream._read = function() { if (!BOM) { BOM = true; return stream.push(""); } - while (R$1 <= r$10.e.r) { + while (R$1 <= r$9.e.r) { ++R$1; if ((rowinfo[R$1 - 1] || {}).hidden) continue; - row = make_csv_row(sheet, r$10, R$1 - 1, cols, fs, rs, FS, w$2, o$10); + row = make_csv_row(sheet, r$9, R$1 - 1, cols, fs, rs, FS, w$2, o$10); if (row != null) { if (row || o$10.blankrows !== false) return stream.push((w$2++ ? RS : "") + row); } @@ -88768,20 +88972,20 @@ function write_html_stream(ws, opts) { var header = o$10.header != null ? o$10.header : HTML_BEGIN; var footer = o$10.footer != null ? o$10.footer : HTML_END; stream.push(header); - var r$10 = decode_range(ws["!ref"]); - stream.push(make_html_preamble(ws, r$10, o$10)); - var R$1 = r$10.s.r; + var r$9 = decode_range(ws["!ref"]); + stream.push(make_html_preamble(ws, r$9, o$10)); + var R$1 = r$9.s.r; var end = false; stream._read = function() { - if (R$1 > r$10.e.r) { + if (R$1 > r$9.e.r) { if (!end) { end = true; stream.push("" + footer); } return stream.push(null); } - while (R$1 <= r$10.e.r) { - stream.push(make_html_row(ws, r$10, R$1, o$10)); + while (R$1 <= r$9.e.r) { + stream.push(make_html_row(ws, r$9, R$1, o$10)); ++R$1; break; } @@ -88798,7 +89002,7 @@ function write_json_stream(sheet, opts) { t: "n", v: 0 }, header = 0, offset = 1, hdr = [], v$3 = 0, vv = ""; - var r$10 = { + var r$9 = { s: { r: 0, c: 0 @@ -88815,37 +89019,37 @@ function write_json_stream(sheet, opts) { else if (Array.isArray(o$10.header)) header = 3; switch (typeof range) { case "string": - r$10 = safe_decode_range(range); + r$9 = safe_decode_range(range); break; case "number": - r$10 = safe_decode_range(sheet["!ref"]); - r$10.s.r = range; + r$9 = safe_decode_range(sheet["!ref"]); + r$9.s.r = range; break; - default: r$10 = range; + default: r$9 = range; } if (header > 0) offset = 0; - var rr = encode_row(r$10.s.r); + var rr = encode_row(r$9.s.r); var cols = []; var counter = 0; var dense = sheet["!data"] != null; - var R$1 = r$10.s.r, C$2 = 0; + var R$1 = r$9.s.r, C$2 = 0; var header_cnt = {}; if (dense && !sheet["!data"][R$1]) sheet["!data"][R$1] = []; var colinfo = o$10.skipHidden && sheet["!cols"] || []; var rowinfo = o$10.skipHidden && sheet["!rows"] || []; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { if ((colinfo[C$2] || {}).hidden) continue; cols[C$2] = encode_col(C$2); val$1 = dense ? sheet["!data"][R$1][C$2] : sheet[cols[C$2] + rr]; switch (header) { case 1: - hdr[C$2] = C$2 - r$10.s.c; + hdr[C$2] = C$2 - r$9.s.c; break; case 2: hdr[C$2] = cols[C$2]; break; case 3: - hdr[C$2] = o$10.header[C$2 - r$10.s.c]; + hdr[C$2] = o$10.header[C$2 - r$9.s.c]; break; default: if (val$1 == null) val$1 = { @@ -88865,11 +89069,11 @@ function write_json_stream(sheet, opts) { hdr[C$2] = vv; } } - R$1 = r$10.s.r + offset; + R$1 = r$9.s.r + offset; stream._read = function() { - while (R$1 <= r$10.e.r) { + while (R$1 <= r$9.e.r) { if ((rowinfo[R$1 - 1] || {}).hidden) continue; - var row = make_json_row(sheet, r$10, R$1, cols, header, hdr, o$10); + var row = make_json_row(sheet, r$9, R$1, cols, header, hdr, o$10); ++R$1; if (row.isempty === false || (header === 1 ? o$10.blankrows !== false : !!o$10.blankrows)) { stream.push(row.row); @@ -89052,7 +89256,7 @@ function write_xlml_stream(wb, o$10) { }; return stream; } -var XLSX, current_codepage, current_ansi, $cptable, VALID_ANSI, CS2CP, set_ansi, set_cp, debom, _getchar, _getansi, DENSE, DIF_XL, Base64_map, has_buf, Buffer_from, buf_utf16le, s2a, bconcat, chr0, chr1, p2_32, days, months, table_fmt, SSF_default_map, SSF_default_str, pct1, frac1, dec1, closeparen, phone, SSF_abstime, cfregex2, SSF, SSFImplicit, dateNFregex, bad_formats, CRC32, CFB, _fs, dnthresh, dnthresh1, dnthresh2, pdre1, pdre2, pdre3, FDRE1, FDRE2, FDISO, utc_append_works, lower_months, split_regex, xml_boundary, str_match_xml_ns, str_match_xml_ns_g, str_remove_xml_ns_g, str_match_xml_ig, XML_HEADER, attregexg, tagregex1, tagregex2, tagregex, nsregex, nsregex2, encodings, rencoding, unescapexml, decregex, charegex, htmlcharegex, xlml_fixstr, utf8corpus, utf8read, utf8write, htmldecode, vtvregex, vtmregex, wtregex, xlmlregex, XMLNS, XMLNS_main, XLMLNS, ___toBuffer, __toBuffer, ___utf16le, __utf16le, ___hexlify, __hexlify, ___utf8, __utf8, ___lpstr, __lpstr, ___cpstr, __cpstr, ___lpwstr, __lpwstr, ___lpp4, __lpp4, ___8lpp4, __8lpp4, ___double, __double, is_buf, __readUInt8, __readUInt16LE, __readInt16LE, __readUInt32LE, __readInt32LE, __readInt32BE, __writeUInt32LE, __writeInt32LE, __writeUInt16LE, parse_BrtCommentText, parse_XLSBCodeName, write_XLSBCodeName, parse_XLNameWideString, parse_RelID, write_RelID, parse_UncheckedRfX, write_UncheckedRfX, VT_I2, VT_I4, VT_BOOL, VT_VARIANT, VT_UI4, VT_FILETIME, VT_BLOB, VT_CF, VT_VECTOR_VARIANT, VT_VECTOR_LPSTR, VT_STRING, VT_USTR, VT_CUSTOM, DocSummaryPIDDSI, SummaryPIDSI, CountryEnum, XLSFillPattern, _XLSIcv, XLSIcv, BErr, RBErr, XLSLblBuiltIn, ct2type, CT_LIST, RELS, CT_ODS, CORE_PROPS, EXT_PROPS, PseudoPropsPairs, custregex, XLMLDocPropsMap, evert_XLMLDPM, XLSPSSkip, parse_Ref, FtTab, parse_BIFF2Format, write_BIFF4XF, parse_XLHeaderFooter, parse_BIFF5OT, parse_Blank, parse_Scl, parse_String, DBF_SUPPORTED_VERSIONS, DBF, SYLK, DIF, ETH, PRN, WK_, parse_rs, rs_to_html, sitregex, sirregex, sstr1, sstr2, straywsregex, write_BrtSSTItem, crypto_CreateXorArray_Method1, crypto_DecryptData_Method1, crypto_MakeXorDecryptor, DEF_MDW, MAX_MDW, MIN_MDW, MDW, DEF_PPI, PPI, XLMLPatternTypeMap, cellXF_uint, cellXF_bool, parse_sty_xml, XLSBFillPTNames, rev_XLSBFillPTNames, parse_BrtFill, parse_BrtBorder, XLSXThemeClrScheme, parse_BrtCommentAuthor, CT_VBA, VBAFMTS, rc_to_a1, crefregex, a1_to_rc, parse_PtgMemErr, parse_PtgMemNoMem, parse_PtgTbl, parse_PtgElfCol, parse_PtgElfColS, parse_PtgElfColSV, parse_PtgElfColV, parse_PtgElfRadical, parse_PtgElfRadicalLel, parse_PtgElfRadicalS, parse_PtgElfRw, parse_PtgElfRwV, PtgListRT, PtgTypes, PtgDupes, Ptg18, Ptg19, PtgBinOp, parse_XLSBArrayParsedFormula, parse_XLSBCellParsedFormula, parse_XLSBNameParsedFormula, parse_XLSBSharedParsedFormula, write_XLSBNameParsedFormula, Cetab, Ftab, FtabArgc, strs, _ssfopts, browser_has_Map, mergecregex, hlinkregex, dimregex, colregex, afregex, marginregex, sheetprregex, sheetprot_deffalse, sheetprot_deftrue, sviewregex, parse_ws_xml_data, parse_BrtWsDim, write_BrtWsDim, parse_BrtMergeCell, write_BrtMergeCell, BrtMarginKeys, WBPropsDef, WBViewDef, SheetDef, CalcPrDef, badchars, wbnsregex, attregexg2, attregex2, XLMLFormatMap, CONTINUE_RT, PSCLSID, XLSBRecordEnum, XLSRecordEnum, b8oid, b8ocnts, HTML_BEGIN, HTML_END, write_styles_ods, write_content_ods, subarray, numbers_lut_new, USE_WIDE_ROWS, qreg, utils$1, _Readable, __stream, version$3, xlsx_default; +var XLSX, current_codepage, current_ansi, $cptable, VALID_ANSI, CS2CP, set_ansi, set_cp, debom, _getchar, _getansi, DENSE, DIF_XL, Base64_map, has_buf, Buffer_from, buf_utf16le, s2a, bconcat, chr0, chr1, p2_32, days, months, table_fmt, SSF_default_map, SSF_default_str, pct1, frac1, dec1, closeparen, phone, SSF_abstime, cfregex2, SSF, SSFImplicit, dateNFregex, bad_formats, CRC32, CFB, _fs, dnthresh, dnthresh1, dnthresh2, pdre1, pdre2, pdre3, FDRE1, FDRE2, FDISO, utc_append_works, lower_months, split_regex, xml_boundary, str_match_xml_ns, str_match_xml_ns_g, str_remove_xml_ns_g, str_match_xml_ig, XML_HEADER, attregexg, tagregex1, tagregex2, tagregex, nsregex, nsregex2, encodings, rencoding, unescapexml, decregex, charegex, htmlcharegex, xlml_fixstr, utf8corpus, utf8read, utf8write, htmldecode, vtvregex, vtmregex, wtregex, xlmlregex, XMLNS, XMLNS_main, XLMLNS, ___toBuffer, __toBuffer, ___utf16le, __utf16le, ___hexlify, __hexlify, ___utf8, __utf8, ___lpstr, __lpstr, ___cpstr, __cpstr, ___lpwstr, __lpwstr, ___lpp4, __lpp4, ___8lpp4, __8lpp4, ___double, __double, is_buf, __readUInt8, __readUInt16LE, __readInt16LE, __readUInt32LE, __readInt32LE, __readInt32BE, __writeUInt32LE, __writeInt32LE, __writeUInt16LE, parse_BrtCommentText, parse_XLSBCodeName, write_XLSBCodeName, parse_XLNameWideString, parse_RelID, write_RelID, parse_UncheckedRfX, write_UncheckedRfX, VT_I2, VT_I4, VT_BOOL, VT_VARIANT, VT_UI4, VT_FILETIME, VT_BLOB, VT_CF, VT_VECTOR_VARIANT, VT_VECTOR_LPSTR, VT_STRING, VT_USTR, VT_CUSTOM, DocSummaryPIDDSI, SummaryPIDSI, CountryEnum, XLSFillPattern, _XLSIcv, XLSIcv, BErr, RBErr, XLSLblBuiltIn, ct2type, CT_LIST, RELS, CT_ODS, CORE_PROPS, EXT_PROPS, PseudoPropsPairs, custregex, XLMLDocPropsMap, evert_XLMLDPM, XLSPSSkip, parse_Ref, FtTab, parse_BIFF2Format, write_BIFF4XF, parse_XLHeaderFooter, parse_BIFF5OT, parse_Blank, parse_Scl, parse_String, DBF_SUPPORTED_VERSIONS, DBF, SYLK, DIF, ETH, PRN, WK_, parse_rs, rs_to_html, sitregex, sirregex, sstr1, sstr2, straywsregex, write_BrtSSTItem, crypto_CreateXorArray_Method1, crypto_DecryptData_Method1, crypto_MakeXorDecryptor, DEF_MDW, MAX_MDW, MIN_MDW, MDW, DEF_PPI, PPI, XLMLPatternTypeMap, cellXF_uint, cellXF_bool, parse_sty_xml, XLSBFillPTNames, rev_XLSBFillPTNames, parse_BrtFill, parse_BrtBorder, XLSXThemeClrScheme, parse_BrtCommentAuthor, CT_VBA, VBAFMTS, rc_to_a1, crefregex, a1_to_rc, parse_PtgMemErr, parse_PtgMemNoMem, parse_PtgTbl, parse_PtgElfCol, parse_PtgElfColS, parse_PtgElfColSV, parse_PtgElfColV, parse_PtgElfRadical, parse_PtgElfRadicalLel, parse_PtgElfRadicalS, parse_PtgElfRw, parse_PtgElfRwV, PtgListRT, PtgTypes, PtgDupes, Ptg18, Ptg19, PtgBinOp, parse_XLSBArrayParsedFormula, parse_XLSBCellParsedFormula, parse_XLSBNameParsedFormula, parse_XLSBSharedParsedFormula, write_XLSBNameParsedFormula, Cetab, Ftab, FtabArgc, strs, _ssfopts, browser_has_Map, mergecregex, hlinkregex, dimregex, colregex, afregex, marginregex, sheetprregex, sheetprot_deffalse, sheetprot_deftrue, sviewregex, parse_ws_xml_data, parse_BrtWsDim, write_BrtWsDim, parse_BrtMergeCell, write_BrtMergeCell, BrtMarginKeys, WBPropsDef, WBViewDef, SheetDef, CalcPrDef, badchars, wbnsregex, attregexg2, attregex2, XLMLFormatMap, CONTINUE_RT, PSCLSID, XLSBRecordEnum, XLSRecordEnum, b8oid, b8ocnts, HTML_BEGIN, HTML_END, write_styles_ods, write_content_ods, subarray, numbers_lut_new, USE_WIDE_ROWS, qreg, utils$1, _Readable, __stream, version$1, xlsx_default; var init_xlsx = __esmMin((() => { XLSX = {}; XLSX.version = "0.20.3"; @@ -89415,28 +89619,28 @@ var init_xlsx = __esmMin((() => { var CRC32$1 = {}; CRC32$1.version = "1.2.0"; function signed_crc_table() { - var c$7 = 0, table = new Array(256); + var c$6 = 0, table = new Array(256); for (var n$9 = 0; n$9 != 256; ++n$9) { - c$7 = n$9; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - c$7 = c$7 & 1 ? -306674912 ^ c$7 >>> 1 : c$7 >>> 1; - table[n$9] = c$7; + c$6 = n$9; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + c$6 = c$6 & 1 ? -306674912 ^ c$6 >>> 1 : c$6 >>> 1; + table[n$9] = c$6; } return typeof Int32Array !== "undefined" ? new Int32Array(table) : table; } var T0 = signed_crc_table(); function slice_by_16_tables(T$3) { - var c$7 = 0, v$3 = 0, n$9 = 0, table = typeof Int32Array !== "undefined" ? new Int32Array(4096) : new Array(4096); + var c$6 = 0, v$3 = 0, n$9 = 0, table = typeof Int32Array !== "undefined" ? new Int32Array(4096) : new Array(4096); for (n$9 = 0; n$9 != 256; ++n$9) table[n$9] = T$3[n$9]; for (n$9 = 0; n$9 != 256; ++n$9) { v$3 = T$3[n$9]; - for (c$7 = 256 + n$9; c$7 < 4096; c$7 += 256) v$3 = table[c$7] = v$3 >>> 8 ^ T$3[v$3 & 255]; + for (c$6 = 256 + n$9; c$6 < 4096; c$6 += 256) v$3 = table[c$6] = v$3 >>> 8 ^ T$3[v$3 & 255]; } var out = []; for (n$9 = 1; n$9 != 16; ++n$9) out[n$9 - 1] = typeof Int32Array !== "undefined" && typeof table.subarray == "function" ? table.subarray(n$9 * 256, n$9 * 256 + 256) : table.slice(n$9 * 256, n$9 * 256 + 256); @@ -89460,24 +89664,24 @@ var init_xlsx = __esmMin((() => { } function crc32_str(str, seed) { var C$2 = seed ^ -1; - for (var i$7 = 0, L$2 = str.length, c$7 = 0, d$5 = 0; i$7 < L$2;) { - c$7 = str.charCodeAt(i$7++); - if (c$7 < 128) { - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ c$7) & 255]; - } else if (c$7 < 2048) { - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (192 | c$7 >> 6 & 31)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$7 & 63)) & 255]; - } else if (c$7 >= 55296 && c$7 < 57344) { - c$7 = (c$7 & 1023) + 64; - d$5 = str.charCodeAt(i$7++) & 1023; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (240 | c$7 >> 8 & 7)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$7 >> 2 & 63)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | d$5 >> 6 & 15 | (c$7 & 3) << 4)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | d$5 & 63)) & 255]; + for (var i$7 = 0, L$2 = str.length, c$6 = 0, d$4 = 0; i$7 < L$2;) { + c$6 = str.charCodeAt(i$7++); + if (c$6 < 128) { + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ c$6) & 255]; + } else if (c$6 < 2048) { + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (192 | c$6 >> 6 & 31)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$6 & 63)) & 255]; + } else if (c$6 >= 55296 && c$6 < 57344) { + c$6 = (c$6 & 1023) + 64; + d$4 = str.charCodeAt(i$7++) & 1023; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (240 | c$6 >> 8 & 7)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$6 >> 2 & 63)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | d$4 >> 6 & 15 | (c$6 & 3) << 4)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | d$4 & 63)) & 255]; } else { - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (224 | c$7 >> 12 & 15)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$7 >> 6 & 63)) & 255]; - C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$7 & 63)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (224 | c$6 >> 12 & 15)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$6 >> 6 & 63)) & 255]; + C$2 = C$2 >>> 8 ^ T0[(C$2 ^ (128 | c$6 & 63)) & 255]; } } return ~C$2; @@ -89491,23 +89695,23 @@ var init_xlsx = __esmMin((() => { CFB = /* @__PURE__ */ (function _CFB() { var exports$1 = {}; exports$1.version = "1.2.2"; - function namecmp(l$3, r$10) { - var L$2 = l$3.split("/"), R$1 = r$10.split("/"); - for (var i$8 = 0, c$7 = 0, Z$1 = Math.min(L$2.length, R$1.length); i$8 < Z$1; ++i$8) { - if (c$7 = L$2[i$8].length - R$1[i$8].length) return c$7; + function namecmp(l$3, r$9) { + var L$2 = l$3.split("/"), R$1 = r$9.split("/"); + for (var i$8 = 0, c$6 = 0, Z$1 = Math.min(L$2.length, R$1.length); i$8 < Z$1; ++i$8) { + if (c$6 = L$2[i$8].length - R$1[i$8].length) return c$6; if (L$2[i$8] != R$1[i$8]) return L$2[i$8] < R$1[i$8] ? -1 : 1; } return L$2.length - R$1.length; } function dirname(p$3) { if (p$3.charAt(p$3.length - 1) == "/") return p$3.slice(0, -1).indexOf("/") === -1 ? p$3 : dirname(p$3.slice(0, -1)); - var c$7 = p$3.lastIndexOf("/"); - return c$7 === -1 ? p$3 : p$3.slice(0, c$7 + 1); + var c$6 = p$3.lastIndexOf("/"); + return c$6 === -1 ? p$3 : p$3.slice(0, c$6 + 1); } function filename(p$3) { if (p$3.charAt(p$3.length - 1) == "/") return filename(p$3.slice(0, -1)); - var c$7 = p$3.lastIndexOf("/"); - return c$7 === -1 ? p$3 : p$3.slice(c$7 + 1); + var c$6 = p$3.lastIndexOf("/"); + return c$6 === -1 ? p$3 : p$3.slice(c$6 + 1); } function write_dos_date(buf, date) { if (typeof date === "string") date = new Date(date); @@ -89524,14 +89728,14 @@ var init_xlsx = __esmMin((() => { var hms = buf.read_shift(2) & 65535; var ymd = buf.read_shift(2) & 65535; var val$1 = new Date(); - var d$5 = ymd & 31; + var d$4 = ymd & 31; ymd >>>= 5; var m$3 = ymd & 15; ymd >>>= 4; val$1.setMilliseconds(0); val$1.setFullYear(ymd + 1980); val$1.setMonth(m$3 - 1); - val$1.setDate(d$5); + val$1.setDate(d$4); var S$4 = hms & 31; hms >>>= 5; var M$3 = hms & 63; @@ -89622,10 +89826,10 @@ var init_xlsx = __esmMin((() => { nmfs = blob.read_shift(4, "i"); difat_start = blob.read_shift(4, "i"); difat_sec_cnt = blob.read_shift(4, "i"); - for (var q$3 = -1, j$2 = 0; j$2 < 109; ++j$2) { - q$3 = blob.read_shift(4, "i"); - if (q$3 < 0) break; - fat_addrs[j$2] = q$3; + for (var q$2 = -1, j$2 = 0; j$2 < 109; ++j$2) { + q$2 = blob.read_shift(4, "i"); + if (q$2 < 0) break; + fat_addrs[j$2] = q$2; } /** Break the file up into sectors */ var sectors = sectorify(file, ssz); @@ -89683,13 +89887,13 @@ var init_xlsx = __esmMin((() => { } function build_full_paths(FI, FP, Paths) { var i$8 = 0, L$2 = 0, R$1 = 0, C$2 = 0, j$2 = 0, pl = Paths.length; - var dad = [], q$3 = []; + var dad = [], q$2 = []; for (; i$8 < pl; ++i$8) { - dad[i$8] = q$3[i$8] = i$8; + dad[i$8] = q$2[i$8] = i$8; FP[i$8] = Paths[i$8]; } - for (; j$2 < q$3.length; ++j$2) { - i$8 = q$3[j$2]; + for (; j$2 < q$2.length; ++j$2) { + i$8 = q$2[j$2]; L$2 = FI[i$8].L; R$1 = FI[i$8].R; C$2 = FI[i$8].C; @@ -89700,11 +89904,11 @@ var init_xlsx = __esmMin((() => { if (C$2 !== -1) dad[C$2] = i$8; if (L$2 !== -1 && i$8 != dad[i$8]) { dad[L$2] = dad[i$8]; - if (q$3.lastIndexOf(L$2) < j$2) q$3.push(L$2); + if (q$2.lastIndexOf(L$2) < j$2) q$2.push(L$2); } if (R$1 !== -1 && i$8 != dad[i$8]) { dad[R$1] = dad[i$8]; - if (q$3.lastIndexOf(R$1) < j$2) q$3.push(R$1); + if (q$2.lastIndexOf(R$1) < j$2) q$2.push(R$1); } } for (i$8 = 1; i$8 < pl; ++i$8) if (dad[i$8] === i$8) { @@ -89740,15 +89944,15 @@ var init_xlsx = __esmMin((() => { /** Chase down the rest of the DIFAT chain to build a comprehensive list DIFAT chains by storing the next sector number as the last 32 bits */ function sleuth_fat(idx, cnt, sectors, ssz, fat_addrs) { - var q$3 = ENDOFCHAIN; + var q$2 = ENDOFCHAIN; if (idx === ENDOFCHAIN) { if (cnt !== 0) throw new Error("DIFAT chain shorter than expected"); } else if (idx !== -1) { var sector = sectors[idx], m$3 = (ssz >>> 2) - 1; if (!sector) return; for (var i$8 = 0; i$8 < m$3; ++i$8) { - if ((q$3 = __readInt32LE(sector, i$8 * 4)) === ENDOFCHAIN) break; - fat_addrs.push(q$3); + if ((q$2 = __readInt32LE(sector, i$8 * 4)) === ENDOFCHAIN) break; + fat_addrs.push(q$2); } if (cnt >= 1) sleuth_fat(__readInt32LE(sector, ssz - 4), cnt - 1, sectors, ssz, fat_addrs); } @@ -90359,7 +90563,7 @@ var init_xlsx = __esmMin((() => { } var use_typed_arrays = typeof Uint8Array !== "undefined"; var bitswap8 = use_typed_arrays ? new Uint8Array(1 << 8) : []; - for (var q$2 = 0; q$2 < 1 << 8; ++q$2) bitswap8[q$2] = bit_swap_8(q$2); + for (var q$1 = 0; q$1 < 1 << 8; ++q$1) bitswap8[q$1] = bit_swap_8(q$1); function bit_swap_n(n$9, b$3) { var rev = bitswap8[n$9 & 255]; if (b$3 <= 8) return rev >>> 8 - b$3; @@ -90542,8 +90746,8 @@ var init_xlsx = __esmMin((() => { bl = write_bits_3(out, bl, +!!(boff + L$2 == data.length) + 2); var hash = 0; while (L$2-- > 0) { - var d$5 = data[boff]; - hash = (hash << 5 ^ d$5) & 32767; + var d$4 = data[boff]; + hash = (hash << 5 ^ d$4) & 32767; var match = -1, mlen = 0; if (match = addrs[hash]) { match |= boff & ~32767; @@ -90551,37 +90755,37 @@ var init_xlsx = __esmMin((() => { if (match < boff) while (data[match + mlen] == data[boff + mlen] && mlen < 250) ++mlen; } if (mlen > 2) { - d$5 = LEN_LN_RE[mlen]; - if (d$5 <= 22) bl = write_bits_8(out, bl, bitswap8[d$5 + 1] >> 1) - 1; + d$4 = LEN_LN_RE[mlen]; + if (d$4 <= 22) bl = write_bits_8(out, bl, bitswap8[d$4 + 1] >> 1) - 1; else { write_bits_8(out, bl, 3); bl += 5; - write_bits_8(out, bl, bitswap8[d$5 - 23] >> 5); + write_bits_8(out, bl, bitswap8[d$4 - 23] >> 5); bl += 3; } - var len_eb = d$5 < 8 ? 0 : d$5 - 4 >> 2; + var len_eb = d$4 < 8 ? 0 : d$4 - 4 >> 2; if (len_eb > 0) { - write_bits_16(out, bl, mlen - LEN_LN[d$5]); + write_bits_16(out, bl, mlen - LEN_LN[d$4]); bl += len_eb; } - d$5 = DST_LN_RE[boff - match]; - bl = write_bits_8(out, bl, bitswap8[d$5] >> 3); + d$4 = DST_LN_RE[boff - match]; + bl = write_bits_8(out, bl, bitswap8[d$4] >> 3); bl -= 3; - var dst_eb = d$5 < 4 ? 0 : d$5 - 2 >> 1; + var dst_eb = d$4 < 4 ? 0 : d$4 - 2 >> 1; if (dst_eb > 0) { - write_bits_16(out, bl, boff - match - DST_LN[d$5]); + write_bits_16(out, bl, boff - match - DST_LN[d$4]); bl += dst_eb; } - for (var q$3 = 0; q$3 < mlen; ++q$3) { + for (var q$2 = 0; q$2 < mlen; ++q$2) { addrs[hash] = boff & 32767; hash = (hash << 5 ^ data[boff]) & 32767; ++boff; } L$2 -= mlen - 1; } else { - if (d$5 <= 143) d$5 = d$5 + 48; + if (d$4 <= 143) d$4 = d$4 + 48; else bl = write_bits_1(out, bl, 1); - bl = write_bits_8(out, bl, bitswap8[d$5]); + bl = write_bits_8(out, bl, bitswap8[d$4]); addrs[hash] = boff & 32767; ++boff; } @@ -90988,8 +91192,8 @@ var init_xlsx = __esmMin((() => { return o$10.join("\r\n") + "\r\n"; } function write_quoted_printable(text$2) { - var encoded = text$2.replace(/[\x00-\x08\x0B\x0C\x0E-\x1F\x7E-\xFF=]/g, function(c$7) { - var w$2 = c$7.charCodeAt(0).toString(16).toUpperCase(); + var encoded = text$2.replace(/[\x00-\x08\x0B\x0C\x0E-\x1F\x7E-\xFF=]/g, function(c$6) { + var w$2 = c$6.charCodeAt(0).toString(16).toUpperCase(); return "=" + (w$2.length == 1 ? "0" + w$2 : w$2); }); encoded = encoded.replace(/ $/gm, "=20").replace(/\t$/gm, "=09"); @@ -91111,8 +91315,8 @@ var init_xlsx = __esmMin((() => { fp = cfb.FullPaths[i$8].slice(root.length); fi = cfb.FileIndex[i$8]; if (!fi.size || !fi.content || fp == "Sh33tJ5") continue; - fp = fp.replace(/[\x00-\x08\x0B\x0C\x0E-\x1F\x7E-\xFF]/g, function(c$7) { - return "_x" + c$7.charCodeAt(0).toString(16) + "_"; + fp = fp.replace(/[\x00-\x08\x0B\x0C\x0E-\x1F\x7E-\xFF]/g, function(c$6) { + return "_x" + c$6.charCodeAt(0).toString(16) + "_"; }).replace(/[\u0080-\uFFFF]/g, function(u$4) { return "_u" + u$4.charCodeAt(0).toString(16) + "_"; }); @@ -91357,8 +91561,8 @@ var init_xlsx = __esmMin((() => { var s$5 = text$2 + "", i$7 = s$5.indexOf(" -1 ? 16 : 10)) || $$; - }).replace(coderegex, function(m$3, c$7) { - return String.fromCharCode(parseInt(c$7, 16)); + }).replace(coderegex, function(m$3, c$6) { + return String.fromCharCode(parseInt(c$6, 16)); }); var j$2 = s$5.indexOf("]]>"); return raw_unescapexml(s$5.slice(0, i$7)) + s$5.slice(i$7 + 9, j$2) + raw_unescapexml(s$5.slice(j$2 + 3)); @@ -91384,29 +91588,29 @@ var init_xlsx = __esmMin((() => { utf8write = has_buf ? function(data) { return Buffer_from(data, "utf8").toString("binary"); } : function(orig) { - var out = [], i$7 = 0, c$7 = 0, d$5 = 0; + var out = [], i$7 = 0, c$6 = 0, d$4 = 0; while (i$7 < orig.length) { - c$7 = orig.charCodeAt(i$7++); + c$6 = orig.charCodeAt(i$7++); switch (true) { - case c$7 < 128: - out.push(String.fromCharCode(c$7)); + case c$6 < 128: + out.push(String.fromCharCode(c$6)); break; - case c$7 < 2048: - out.push(String.fromCharCode(192 + (c$7 >> 6))); - out.push(String.fromCharCode(128 + (c$7 & 63))); + case c$6 < 2048: + out.push(String.fromCharCode(192 + (c$6 >> 6))); + out.push(String.fromCharCode(128 + (c$6 & 63))); break; - case c$7 >= 55296 && c$7 < 57344: - c$7 -= 55296; - d$5 = orig.charCodeAt(i$7++) - 56320 + (c$7 << 10); - out.push(String.fromCharCode(240 + (d$5 >> 18 & 7))); - out.push(String.fromCharCode(144 + (d$5 >> 12 & 63))); - out.push(String.fromCharCode(128 + (d$5 >> 6 & 63))); - out.push(String.fromCharCode(128 + (d$5 & 63))); + case c$6 >= 55296 && c$6 < 57344: + c$6 -= 55296; + d$4 = orig.charCodeAt(i$7++) - 56320 + (c$6 << 10); + out.push(String.fromCharCode(240 + (d$4 >> 18 & 7))); + out.push(String.fromCharCode(144 + (d$4 >> 12 & 63))); + out.push(String.fromCharCode(128 + (d$4 >> 6 & 63))); + out.push(String.fromCharCode(128 + (d$4 & 63))); break; default: - out.push(String.fromCharCode(224 + (c$7 >> 12))); - out.push(String.fromCharCode(128 + (c$7 >> 6 & 63))); - out.push(String.fromCharCode(128 + (c$7 & 63))); + out.push(String.fromCharCode(224 + (c$6 >> 12))); + out.push(String.fromCharCode(128 + (c$6 >> 6 & 63))); + out.push(String.fromCharCode(128 + (c$6 & 63))); } } return out.join(""); @@ -92459,21 +92663,21 @@ var init_xlsx = __esmMin((() => { }); function dbf_to_aoa(buf, opts) { var out = []; - var d$5 = new_raw_buf(1); + var d$4 = new_raw_buf(1); switch (opts.type) { case "base64": - d$5 = s2a(Base64_decode(buf)); + d$4 = s2a(Base64_decode(buf)); break; case "binary": - d$5 = s2a(buf); + d$4 = s2a(buf); break; case "buffer": case "array": - d$5 = buf; + d$4 = buf; break; } - prep_blob(d$5, 0); - var ft = d$5.read_shift(1); + prep_blob(d$4, 0); + var ft = d$4.read_shift(1); var memo = !!(ft & 136); var vfp = false, l7 = false; switch (ft) { @@ -92496,35 +92700,35 @@ var init_xlsx = __esmMin((() => { default: throw new Error("DBF Unsupported Version: " + ft.toString(16)); } var nrow = 0, fpos = 521; - if (ft == 2) nrow = d$5.read_shift(2); - d$5.l += 3; - if (ft != 2) nrow = d$5.read_shift(4); + if (ft == 2) nrow = d$4.read_shift(2); + d$4.l += 3; + if (ft != 2) nrow = d$4.read_shift(4); if (nrow > 1048576) nrow = 1e6; - if (ft != 2) fpos = d$5.read_shift(2); - var rlen = d$5.read_shift(2); + if (ft != 2) fpos = d$4.read_shift(2); + var rlen = d$4.read_shift(2); var current_cp = opts.codepage || 1252; if (ft != 2) { - d$5.l += 16; - d$5.read_shift(1); - if (d$5[d$5.l] !== 0) current_cp = dbf_codepage_map[d$5[d$5.l]]; - d$5.l += 1; - d$5.l += 2; + d$4.l += 16; + d$4.read_shift(1); + if (d$4[d$4.l] !== 0) current_cp = dbf_codepage_map[d$4[d$4.l]]; + d$4.l += 1; + d$4.l += 2; } - if (l7) d$5.l += 36; + if (l7) d$4.l += 36; var fields = [], field = {}; - var hend = Math.min(d$5.length, ft == 2 ? 521 : fpos - 10 - (vfp ? 264 : 0)); + var hend = Math.min(d$4.length, ft == 2 ? 521 : fpos - 10 - (vfp ? 264 : 0)); var ww = l7 ? 32 : 11; - while (d$5.l < hend && d$5[d$5.l] != 13) { + while (d$4.l < hend && d$4[d$4.l] != 13) { field = {}; - field.name = (typeof $cptable !== "undefined" ? $cptable.utils.decode(current_cp, d$5.slice(d$5.l, d$5.l + ww)) : a2s(d$5.slice(d$5.l, d$5.l + ww))).replace(/[\u0000\r\n][\S\s]*$/g, ""); - d$5.l += ww; - field.type = String.fromCharCode(d$5.read_shift(1)); - if (ft != 2 && !l7) field.offset = d$5.read_shift(4); - field.len = d$5.read_shift(1); - if (ft == 2) field.offset = d$5.read_shift(2); - field.dec = d$5.read_shift(1); + field.name = (typeof $cptable !== "undefined" ? $cptable.utils.decode(current_cp, d$4.slice(d$4.l, d$4.l + ww)) : a2s(d$4.slice(d$4.l, d$4.l + ww))).replace(/[\u0000\r\n][\S\s]*$/g, ""); + d$4.l += ww; + field.type = String.fromCharCode(d$4.read_shift(1)); + if (ft != 2 && !l7) field.offset = d$4.read_shift(4); + field.len = d$4.read_shift(1); + if (ft == 2) field.offset = d$4.read_shift(2); + field.dec = d$4.read_shift(1); if (field.name.length) fields.push(field); - if (ft != 2) d$5.l += l7 ? 13 : 14; + if (ft != 2) d$4.l += l7 ? 13 : 14; switch (field.type) { case "B": if ((!vfp || field.len != 8) && opts.WTF) console.log("Skipping " + field.name + ":" + field.type); @@ -92549,23 +92753,23 @@ var init_xlsx = __esmMin((() => { default: throw new Error("Unknown Field Type: " + field.type); } } - if (d$5[d$5.l] !== 13) d$5.l = fpos - 1; - if (d$5.read_shift(1) !== 13) throw new Error("DBF Terminator not found " + d$5.l + " " + d$5[d$5.l]); - d$5.l = fpos; + if (d$4[d$4.l] !== 13) d$4.l = fpos - 1; + if (d$4.read_shift(1) !== 13) throw new Error("DBF Terminator not found " + d$4.l + " " + d$4[d$4.l]); + d$4.l = fpos; var R$1 = 0, C$2 = 0; out[0] = []; for (C$2 = 0; C$2 != fields.length; ++C$2) out[0][C$2] = fields[C$2].name; while (nrow-- > 0) { - if (d$5[d$5.l] === 42) { - d$5.l += rlen; + if (d$4[d$4.l] === 42) { + d$4.l += rlen; continue; } - ++d$5.l; + ++d$4.l; out[++R$1] = []; C$2 = 0; for (C$2 = 0; C$2 != fields.length; ++C$2) { - var dd = d$5.slice(d$5.l, d$5.l + fields[C$2].len); - d$5.l += fields[C$2].len; + var dd = d$4.slice(d$4.l, d$4.l + fields[C$2].len); + d$4.l += fields[C$2].len; prep_blob(dd, 0); var s$5 = typeof $cptable !== "undefined" ? $cptable.utils.decode(current_cp, dd) : a2s(dd); switch (fields[C$2].type) { @@ -92642,7 +92846,7 @@ var init_xlsx = __esmMin((() => { } } if (ft != 2) { - if (d$5.l < d$5.length && d$5[d$5.l++] != 26) throw new Error("DBF EOF Marker missing " + (d$5.l - 1) + " of " + d$5.length + " " + d$5[d$5.l - 1].toString(16)); + if (d$4.l < d$4.length && d$4[d$4.l++] != 26) throw new Error("DBF EOF Marker missing " + (d$4.l - 1) + " of " + d$4.length + " " + d$4[d$4.l - 1].toString(16)); } if (opts && opts.sheetRows) out = out.slice(0, opts.sheetRows); opts.DBF = fields; @@ -92944,12 +93148,12 @@ var init_xlsx = __esmMin((() => { var encode_sylk_str = function($$) { return $$.replace(/\n/g, "\x1B :").replace(/\r/g, "\x1B ="); }; - function sylk_to_aoa(d$5, opts) { + function sylk_to_aoa(d$4, opts) { switch (opts.type) { - case "base64": return sylk_to_aoa_str(Base64_decode(d$5), opts); - case "binary": return sylk_to_aoa_str(d$5, opts); - case "buffer": return sylk_to_aoa_str(has_buf && Buffer.isBuffer(d$5) ? d$5.toString("binary") : a2s(d$5), opts); - case "array": return sylk_to_aoa_str(cc2str(d$5), opts); + case "base64": return sylk_to_aoa_str(Base64_decode(d$4), opts); + case "binary": return sylk_to_aoa_str(d$4, opts); + case "buffer": return sylk_to_aoa_str(has_buf && Buffer.isBuffer(d$4) ? d$4.toString("binary") : a2s(d$4), opts); + case "array": return sylk_to_aoa_str(cc2str(d$4), opts); } throw new Error("Unrecognized type " + opts.type); } @@ -93161,8 +93365,8 @@ var init_xlsx = __esmMin((() => { wb ]; } - function sylk_to_workbook(d$5, opts) { - var aoasht = sylk_to_aoa(d$5, opts); + function sylk_to_workbook(d$4, opts) { + var aoasht = sylk_to_aoa(d$4, opts); var aoa = aoasht[0], ws = aoasht[1], wb = aoasht[2]; var _opts = dup(opts); _opts.date1904 = (((wb || {}).Workbook || {}).WBProps || {}).date1904; @@ -93204,8 +93408,8 @@ var init_xlsx = __esmMin((() => { } function write_ws_cmnt_sylk(cmnt, R$1, C$2) { var o$10 = "C;Y" + (R$1 + 1) + ";X" + (C$2 + 1) + ";A"; - o$10 += encode_sylk_str(cmnt.map(function(c$7) { - return c$7.t; + o$10 += encode_sylk_str(cmnt.map(function(c$6) { + return c$6.t; }).join("")); return o$10; } @@ -93234,27 +93438,27 @@ var init_xlsx = __esmMin((() => { if (!opts) opts = {}; opts._formats = ["General"]; var preamble = ["ID;PSheetJS;N;E"], o$10 = []; - var r$10 = safe_decode_range(ws["!ref"] || "A1"), cell; + var r$9 = safe_decode_range(ws["!ref"] || "A1"), cell; var dense = ws["!data"] != null; var RS = "\r\n"; var d1904 = (((wb || {}).Workbook || {}).WBProps || {}).date1904; var _lastfmt = "General"; preamble.push("P;PGeneral"); - var R$1 = r$10.s.r, C$2 = r$10.s.c, p$3 = []; - if (ws["!ref"]) for (R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + var R$1 = r$9.s.r, C$2 = r$9.s.c, p$3 = []; + if (ws["!ref"]) for (R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { if (dense && !ws["!data"][R$1]) continue; p$3 = []; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { cell = dense ? ws["!data"][R$1][C$2] : ws[encode_col(C$2) + encode_row(R$1)]; if (!cell || !cell.c) continue; p$3.push(write_ws_cmnt_sylk(cell.c, R$1, C$2)); } if (p$3.length) o$10.push(p$3.join(RS)); } - if (ws["!ref"]) for (R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + if (ws["!ref"]) for (R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { if (dense && !ws["!data"][R$1]) continue; p$3 = []; - for (C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { cell = dense ? ws["!data"][R$1][C$2] : ws[encode_col(C$2) + encode_row(R$1)]; if (!cell || cell.v == null && (!cell.f || cell.F)) continue; if ((cell.z || (cell.t == "d" ? table_fmt[14] : "General")) != _lastfmt) { @@ -93273,11 +93477,11 @@ var init_xlsx = __esmMin((() => { preamble.push("F;P0;DG0G8;M255"); if (ws["!cols"]) write_ws_cols_sylk(preamble, ws["!cols"]); if (ws["!rows"]) write_ws_rows_sylk(preamble, ws["!rows"]); - if (ws["!ref"]) preamble.push("B;Y" + (r$10.e.r - r$10.s.r + 1) + ";X" + (r$10.e.c - r$10.s.c + 1) + ";D" + [ - r$10.s.c, - r$10.s.r, - r$10.e.c, - r$10.e.r + if (ws["!ref"]) preamble.push("B;Y" + (r$9.e.r - r$9.s.r + 1) + ";X" + (r$9.e.c - r$9.s.c + 1) + ";D" + [ + r$9.s.c, + r$9.s.r, + r$9.e.c, + r$9.e.r ].join(" ")); preamble.push("O;L;D;B" + (d1904 ? ";V4" : "") + ";K47;G100 0.001"); delete opts._formats; @@ -93289,12 +93493,12 @@ var init_xlsx = __esmMin((() => { }; })(); DIF = /* @__PURE__ */ (function() { - function dif_to_aoa(d$5, opts) { + function dif_to_aoa(d$4, opts) { switch (opts.type) { - case "base64": return dif_to_aoa_str(Base64_decode(d$5), opts); - case "binary": return dif_to_aoa_str(d$5, opts); - case "buffer": return dif_to_aoa_str(has_buf && Buffer.isBuffer(d$5) ? d$5.toString("binary") : a2s(d$5), opts); - case "array": return dif_to_aoa_str(cc2str(d$5), opts); + case "base64": return dif_to_aoa_str(Base64_decode(d$4), opts); + case "binary": return dif_to_aoa_str(d$4, opts); + case "buffer": return dif_to_aoa_str(has_buf && Buffer.isBuffer(d$4) ? d$4.toString("binary") : a2s(d$4), opts); + case "array": return dif_to_aoa_str(cc2str(d$4), opts); } throw new Error("Unrecognized type " + opts.type); } @@ -93362,18 +93566,18 @@ var init_xlsx = __esmMin((() => { function sheet_to_dif(ws) { var _DIF_XL = DIF_XL; if (!ws["!ref"]) throw new Error("Cannot export empty sheet to DIF"); - var r$10 = safe_decode_range(ws["!ref"]); + var r$9 = safe_decode_range(ws["!ref"]); var dense = ws["!data"] != null; var o$10 = [ "TABLE\r\n0,1\r\n\"sheetjs\"\r\n", - "VECTORS\r\n0," + (r$10.e.r - r$10.s.r + 1) + "\r\n\"\"\r\n", - "TUPLES\r\n0," + (r$10.e.c - r$10.s.c + 1) + "\r\n\"\"\r\n", + "VECTORS\r\n0," + (r$9.e.r - r$9.s.r + 1) + "\r\n\"\"\r\n", + "TUPLES\r\n0," + (r$9.e.c - r$9.s.c + 1) + "\r\n\"\"\r\n", "DATA\r\n0,0\r\n\"\"\r\n" ]; - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { var row = dense ? ws["!data"][R$1] : []; var p$3 = "-1,0\r\nBOT\r\n"; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { var cell = dense ? row && row[C$2] : ws[encode_cell({ r: R$1, c: C$2 @@ -93463,11 +93667,11 @@ var init_xlsx = __esmMin((() => { if (opts && opts.sheetRows) arr = arr.slice(0, opts.sheetRows); return arr; } - function eth_to_sheet(d$5, opts) { - return aoa_to_sheet(eth_to_aoa(d$5, opts), opts); + function eth_to_sheet(d$4, opts) { + return aoa_to_sheet(eth_to_aoa(d$4, opts), opts); } - function eth_to_workbook(d$5, opts) { - return sheet_to_workbook(eth_to_sheet(d$5, opts), opts); + function eth_to_workbook(d$4, opts) { + return sheet_to_workbook(eth_to_sheet(d$4, opts), opts); } var header = [ "socialcalc:version:1.5", @@ -93480,10 +93684,10 @@ var init_xlsx = __esmMin((() => { function sheet_to_eth_data(ws) { if (!ws || !ws["!ref"]) return ""; var o$10 = [], oo = [], cell, coord = ""; - var r$10 = decode_range(ws["!ref"]); + var r$9 = decode_range(ws["!ref"]); var dense = ws["!data"] != null; - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { coord = encode_cell({ r: R$1, c: C$2 @@ -93537,7 +93741,7 @@ var init_xlsx = __esmMin((() => { o$10.push(oo.join(":")); } } - o$10.push("sheet:c:" + (r$10.e.c - r$10.s.c + 1) + ":r:" + (r$10.e.r - r$10.s.r + 1) + ":tvf:1"); + o$10.push("sheet:c:" + (r$9.e.c - r$9.s.c + 1) + ":r:" + (r$9.e.r - r$9.s.r + 1) + ":tvf:1"); o$10.push("valueformat:1:text-wiki"); return o$10.join("\n"); } @@ -93757,30 +93961,30 @@ var init_xlsx = __esmMin((() => { if (str.indexOf(" ") >= 0 || str.indexOf(",") >= 0 || str.indexOf(";") >= 0) return dsv_to_sheet_str(str, opts); return aoa_to_sheet(prn_to_aoa_str(str, opts), opts); } - function prn_to_sheet(d$5, opts) { + function prn_to_sheet(d$4, opts) { var str = "", bytes = opts.type == "string" ? [ 0, 0, 0, 0 - ] : firstbyte(d$5, opts); + ] : firstbyte(d$4, opts); switch (opts.type) { case "base64": - str = Base64_decode(d$5); + str = Base64_decode(d$4); break; case "binary": - str = d$5; + str = d$4; break; case "buffer": - if (opts.codepage == 65001) str = d$5.toString("utf8"); - else if (opts.codepage && typeof $cptable !== "undefined") str = $cptable.utils.decode(opts.codepage, d$5); - else str = has_buf && Buffer.isBuffer(d$5) ? d$5.toString("binary") : a2s(d$5); + if (opts.codepage == 65001) str = d$4.toString("utf8"); + else if (opts.codepage && typeof $cptable !== "undefined") str = $cptable.utils.decode(opts.codepage, d$4); + else str = has_buf && Buffer.isBuffer(d$4) ? d$4.toString("binary") : a2s(d$4); break; case "array": - str = cc2str(d$5); + str = cc2str(d$4); break; case "string": - str = d$5; + str = d$4; break; default: throw new Error("Unrecognized type " + opts.type); } @@ -93790,17 +93994,17 @@ var init_xlsx = __esmMin((() => { if (str.slice(0, 19) == "socialcalc:version:") return ETH.to_sheet(opts.type == "string" ? str : utf8read(str), opts); return prn_to_sheet_str(str, opts); } - function prn_to_workbook(d$5, opts) { - return sheet_to_workbook(prn_to_sheet(d$5, opts), opts); + function prn_to_workbook(d$4, opts) { + return sheet_to_workbook(prn_to_sheet(d$4, opts), opts); } function sheet_to_prn(ws) { var o$10 = []; if (!ws["!ref"]) return ""; - var r$10 = safe_decode_range(ws["!ref"]), cell; + var r$9 = safe_decode_range(ws["!ref"]), cell; var dense = ws["!data"] != null; - for (var R$1 = r$10.s.r; R$1 <= r$10.e.r; ++R$1) { + for (var R$1 = r$9.s.r; R$1 <= r$9.e.r; ++R$1) { var oo = []; - for (var C$2 = r$10.s.c; C$2 <= r$10.e.c; ++C$2) { + for (var C$2 = r$9.s.c; C$2 <= r$9.e.c; ++C$2) { var coord = encode_cell({ r: R$1, c: C$2 @@ -93834,17 +94038,17 @@ var init_xlsx = __esmMin((() => { var R$1 = Enum$1[RT] || Enum$1[65535]; var length = data.read_shift(2); var tgt = data.l + length; - var d$5 = R$1.f && R$1.f(data, length, opts); + var d$4 = R$1.f && R$1.f(data, length, opts); data.l = tgt; - if (cb(d$5, R$1, RT)) return; + if (cb(d$4, R$1, RT)) return; } } - function lotus_to_workbook(d$5, opts) { + function lotus_to_workbook(d$4, opts) { switch (opts.type) { - case "base64": return lotus_to_workbook_buf(s2a(Base64_decode(d$5)), opts); - case "binary": return lotus_to_workbook_buf(s2a(d$5), opts); + case "base64": return lotus_to_workbook_buf(s2a(Base64_decode(d$4)), opts); + case "binary": return lotus_to_workbook_buf(s2a(d$4), opts); case "buffer": - case "array": return lotus_to_workbook_buf(d$5, opts); + case "array": return lotus_to_workbook_buf(d$4, opts); } throw "Unsupported type " + opts.type; } @@ -93862,8 +94066,8 @@ var init_xlsx = __esmMin((() => { "hh:mm:ss", "hh:mm" ]; - function lotus_to_workbook_buf(d$5, opts) { - if (!d$5) return d$5; + function lotus_to_workbook_buf(d$4, opts) { + if (!d$4) return d$4; var o$10 = opts || {}; if (DENSE != null && o$10.dense == null) o$10.dense = DENSE; var s$5 = {}, n$9 = "Sheet1", next_n = "", sidx = 0; @@ -93881,15 +94085,15 @@ var init_xlsx = __esmMin((() => { }; var sheetRows = o$10.sheetRows || 0; var lastcell = {}; - if (d$5[4] == 81 && d$5[5] == 80 && d$5[6] == 87) return qpw_to_workbook_buf(d$5, opts); - if (d$5[2] == 0) { - if (d$5[3] == 8 || d$5[3] == 9) { - if (d$5.length >= 16 && d$5[14] == 5 && d$5[15] === 108) throw new Error("Unsupported Works 3 for Mac file"); + if (d$4[4] == 81 && d$4[5] == 80 && d$4[6] == 87) return qpw_to_workbook_buf(d$4, opts); + if (d$4[2] == 0) { + if (d$4[3] == 8 || d$4[3] == 9) { + if (d$4.length >= 16 && d$4[14] == 5 && d$4[15] === 108) throw new Error("Unsupported Works 3 for Mac file"); } } - if (d$5[2] == 2) { + if (d$4[2] == 2) { o$10.Enum = WK1Enum; - lotushopper(d$5, function(val$1, R$1, RT) { + lotushopper(d$4, function(val$1, R$1, RT) { switch (RT) { case 0: o$10.vers = val$1; @@ -93975,13 +94179,13 @@ var init_xlsx = __esmMin((() => { break; } }, o$10); - } else if (d$5[2] == 26 || d$5[2] == 14) { + } else if (d$4[2] == 26 || d$4[2] == 14) { o$10.Enum = WK3Enum; - if (d$5[2] == 14) { + if (d$4[2] == 14) { o$10.qpro = true; - d$5.l = 0; + d$4.l = 0; } - lotushopper(d$5, function(val$1, R$1, RT) { + lotushopper(d$4, function(val$1, R$1, RT) { switch (RT) { case 204: n$9 = val$1; @@ -94034,7 +94238,7 @@ var init_xlsx = __esmMin((() => { default: break; } }, o$10); - } else throw new Error("Unrecognized LOTUS BOF " + d$5[2]); + } else throw new Error("Unrecognized LOTUS BOF " + d$4[2]); s$5["!ref"] = encode_range(refguess); sheets[next_n || n$9] = s$5; snames.push(next_n || n$9); @@ -94416,11 +94620,11 @@ var init_xlsx = __esmMin((() => { break; case 2: { - var c$7 = wk1_parse_rc(o$10[0].c, blob.read_shift(2), true); - var r$10 = wk1_parse_rc(o$10[0].r, blob.read_shift(2), false); + var c$6 = wk1_parse_rc(o$10[0].c, blob.read_shift(2), true); + var r$9 = wk1_parse_rc(o$10[0].r, blob.read_shift(2), false); C$2 = wk1_parse_rc(o$10[0].c, blob.read_shift(2), true); R$1 = wk1_parse_rc(o$10[0].r, blob.read_shift(2), false); - out.push(c$7 + r$10 + ":" + C$2 + R$1); + out.push(c$6 + r$9 + ":" + C$2 + R$1); } break; case 3: @@ -94957,8 +95161,8 @@ var init_xlsx = __esmMin((() => { if (flags != 0) throw "unsupported QPW string type " + flags.toString(16); return p$3.read_shift(cch, "sbcs-cont"); } - function qpw_to_workbook_buf(d$5, opts) { - prep_blob(d$5, 0); + function qpw_to_workbook_buf(d$4, opts) { + prep_blob(d$4, 0); var o$10 = opts || {}; if (DENSE != null && o$10.dense == null) o$10.dense = DENSE; var s$5 = {}; @@ -94980,9 +95184,9 @@ var init_xlsx = __esmMin((() => { Sheets: {} }; var FMTS = []; - outer: while (d$5.l < d$5.length) { - var RT = d$5.read_shift(2), length = d$5.read_shift(2); - var p$3 = d$5.slice(d$5.l, d$5.l + length); + outer: while (d$4.l < d$4.length) { + var RT = d$4.read_shift(2), length = d$4.read_shift(2); + var p$3 = d$4.slice(d$4.l, d$4.l + length); prep_blob(p$3, 0); switch (RT) { case 1: @@ -95216,7 +95420,7 @@ var init_xlsx = __esmMin((() => { break; default: break; } - d$5.l += length; + d$4.l += length; } return wb; } @@ -95227,8 +95431,8 @@ var init_xlsx = __esmMin((() => { }; })(); parse_rs = /* @__PURE__ */ (function() { - function parse_r(r$10) { - var t$6 = str_match_xml_ns(r$10, "t"); + function parse_r(r$9) { + var t$6 = str_match_xml_ns(r$9, "t"); if (!t$6) return { t: "s", v: "" @@ -95237,14 +95441,14 @@ var init_xlsx = __esmMin((() => { t: "s", v: unescapexml(t$6[1]) }; - var rpr = str_match_xml_ns(r$10, "rPr"); + var rpr = str_match_xml_ns(r$9, "rPr"); if (rpr) o$10.s = parse_rpr(rpr[1]); return o$10; } var rregex = /<(?:\w+:)?r>/g, rend = /<\/(?:\w+:)?r>/; return function parse_rs$1(rs) { - return rs.replace(rregex, "").split(rend).map(parse_r).filter(function(r$10) { - return r$10.v; + return rs.replace(rregex, "").split(rend).map(parse_r).filter(function(r$9) { + return r$9.v; }); }; })(); @@ -95280,14 +95484,14 @@ var init_xlsx = __esmMin((() => { outro.push(""); return font; } - function r_to_html(r$10) { + function r_to_html(r$9) { var terms = [ [], - r$10.v, + r$9.v, [] ]; - if (!r$10.v) return ""; - if (r$10.s) parse_rpr2(r$10.s, terms[0], terms[2]); + if (!r$9.v) return ""; + if (r$9.s) parse_rpr2(r$9.s, terms[0], terms[2]); return terms[0].join("") + terms[1].replace(nlregex, "
") + terms[2].join(""); } return function parse_rs$1(rs) { @@ -95657,10 +95861,10 @@ var init_xlsx = __esmMin((() => { a1_to_rc = /* @__PURE__ */ (function() { return function a1_to_rc$1(fstr, base) { return fstr.replace(crefregex, function($0, $1, $2, $3, $4, $5) { - var c$7 = decode_col($3) - ($2 ? 0 : base.c); - var r$10 = decode_row($5) - ($4 ? 0 : base.r); - var R$1 = $4 == "$" ? r$10 + 1 : r$10 == 0 ? "" : "[" + r$10 + "]"; - var C$2 = $2 == "$" ? c$7 + 1 : c$7 == 0 ? "" : "[" + c$7 + "]"; + var c$6 = decode_col($3) - ($2 ? 0 : base.c); + var r$9 = decode_row($5) - ($4 ? 0 : base.r); + var R$1 = $4 == "$" ? r$9 + 1 : r$9 == 0 ? "" : "[" + r$9 + "]"; + var C$2 = $2 == "$" ? c$6 + 1 : c$6 == 0 ? "" : "[" + c$6 + "]"; return $1 + "R" + R$1 + "C" + C$2; }); }; @@ -97230,7 +97434,7 @@ var init_xlsx = __esmMin((() => { var rregex = /r=["']([^"']*)["']/; var refregex = /ref=["']([^"']*)["']/; return function parse_ws_xml_data$1(sdata, s$5, opts, guess, themes, styles$1, wb) { - var ri = 0, x$2 = "", cells = [], cref = [], idx = 0, i$7 = 0, cc = 0, d$5 = "", p$3; + var ri = 0, x$2 = "", cells = [], cref = [], idx = 0, i$7 = 0, cc = 0, d$4 = "", p$3; var tag, tagr = 0, tagc = 0; var sstr, ftag; var fmtid = 0, fillid = 0; @@ -97319,9 +97523,9 @@ var init_xlsx = __esmMin((() => { x$2 = "" : "") + x$2; if (cref != null && cref.length === 2) { idx = 0; - d$5 = cref[1]; - for (i$7 = 0; i$7 != d$5.length; ++i$7) { - if ((cc = d$5.charCodeAt(i$7) - 64) < 1 || cc > 26) break; + d$4 = cref[1]; + for (i$7 = 0; i$7 != d$4.length; ++i$7) { + if ((cc = d$4.charCodeAt(i$7) - 64) < 1 || cc > 26) break; idx = 26 * idx + cc; } --idx; @@ -97334,11 +97538,11 @@ var init_xlsx = __esmMin((() => { r: tagr - 1, c: tagc }); - d$5 = x$2.slice(i$7); + d$4 = x$2.slice(i$7); p$3 = { t: "" }; - if ((cref = str_match_xml_ns(d$5, "v")) != null && cref[1] !== "") p$3.v = unescapexml(cref[1]); + if ((cref = str_match_xml_ns(d$4, "v")) != null && cref[1] !== "") p$3.v = unescapexml(cref[1]); if (opts.cellFormula) { - if ((cref = str_match_xml_ns(d$5, "f")) != null) { + if ((cref = str_match_xml_ns(d$4, "f")) != null) { if (cref[1] == "") { if (cref[0].indexOf("t=\"shared\"") > -1) { ftag = parsexmltag(cref[0]); @@ -97348,7 +97552,7 @@ var init_xlsx = __esmMin((() => { p$3.f = unescapexml(utf8read(cref[1]), true); if (!opts.xlfn) p$3.f = _xlfn(p$3.f); if (cref[0].indexOf("t=\"array\"") > -1) { - p$3.F = (d$5.match(refregex) || [])[1]; + p$3.F = (d$4.match(refregex) || [])[1]; if (p$3.F.indexOf(":") > -1) arrayf.push([safe_decode_range(p$3.F), p$3.F]); } else if (cref[0].indexOf("t=\"shared\"") > -1) { ftag = parsexmltag(cref[0]); @@ -97361,7 +97565,7 @@ var init_xlsx = __esmMin((() => { ]; } } - } else if (cref = d$5.match(/]*\/>/)) { + } else if (cref = d$4.match(/]*\/>/)) { ftag = parsexmltag(cref[0]); if (sharedf[ftag.si]) p$3.f = shift_formula_xlsx(sharedf[ftag.si][1], sharedf[ftag.si][2], tag.r); } @@ -97403,7 +97607,7 @@ var init_xlsx = __esmMin((() => { if (opts.cellHTML) p$3.h = escapehtml(p$3.v); break; case "inlineStr": - cref = str_match_xml_ns(d$5, "is"); + cref = str_match_xml_ns(d$4, "is"); p$3.t = "s"; if (cref != null && (sstr = parse_si(cref[1]))) { p$3.v = sstr.t; @@ -99176,15 +99380,15 @@ var init_xlsx = __esmMin((() => { if (!ws["!ref"]) return; var range = decode_range(ws["!ref"]); for (var R$1 = 0; R$1 <= range.e.r; ++R$1) for (var C$2 = 0; C$2 <= range.e.c; ++C$2) { - var c$7 = dense ? (ws["!data"][R$1] || [])[C$2] : ws[encode_cell({ + var c$6 = dense ? (ws["!data"][R$1] || [])[C$2] : ws[encode_cell({ r: R$1, c: C$2 })]; - if (!c$7 || !c$7.z || c$7.z.toLowerCase() == "general") continue; - if (!nfs[c$7.z]) { - var out = write_number_format_ods(c$7.z, "N" + nfi); + if (!c$6 || !c$6.z || c$6.z.toLowerCase() == "general") continue; + if (!nfs[c$6.z]) { + var out = write_number_format_ods(c$6.z, "N" + nfi); if (out) { - nfs[c$7.z] = "N" + nfi; + nfs[c$6.z] = "N" + nfi; ++nfi; o$10.push(out + "\n"); } @@ -99335,7 +99539,7 @@ var init_xlsx = __esmMin((() => { to_xlml: write_xlml_stream, set_readable }; - version$3 = XLSX.version; + version$1 = XLSX.version; xlsx_default = { parse_xlscfb, parse_zip, @@ -99366,13 +99570,13 @@ var init_xlsx = __esmMin((() => { * @returns Promise * @throws Error if loading fails */ -async function loadAttachment(source$4, fileName) { +async function loadAttachment(source, fileName) { let arrayBuffer; let detectedFileName = fileName || "unnamed"; let mimeType = "application/octet-stream"; let size = 0; - if (typeof source$4 === "string") { - const response = await fetch(source$4); + if (typeof source === "string") { + const response = await fetch(source); if (!response.ok) { throw new Error(i18n("Failed to fetch file")); } @@ -99380,21 +99584,21 @@ async function loadAttachment(source$4, fileName) { size = arrayBuffer.byteLength; mimeType = response.headers.get("content-type") || mimeType; if (!fileName) { - const urlParts = source$4.split("/"); + const urlParts = source.split("/"); detectedFileName = urlParts[urlParts.length - 1] || "document"; } - } else if (source$4 instanceof File) { - arrayBuffer = await source$4.arrayBuffer(); - size = source$4.size; - mimeType = source$4.type || mimeType; - detectedFileName = fileName || source$4.name; - } else if (source$4 instanceof Blob) { - arrayBuffer = await source$4.arrayBuffer(); - size = source$4.size; - mimeType = source$4.type || mimeType; - } else if (source$4 instanceof ArrayBuffer) { - arrayBuffer = source$4; - size = source$4.byteLength; + } else if (source instanceof File) { + arrayBuffer = await source.arrayBuffer(); + size = source.size; + mimeType = source.type || mimeType; + detectedFileName = fileName || source.name; + } else if (source instanceof Blob) { + arrayBuffer = await source.arrayBuffer(); + size = source.size; + mimeType = source.type || mimeType; + } else if (source instanceof ArrayBuffer) { + arrayBuffer = source; + size = source.byteLength; } else { throw new Error(i18n("Invalid source type")); } @@ -99515,9 +99719,9 @@ async function processPdf(arrayBuffer, fileName) { extractedText, preview }; - } catch (error$2) { - console.error("Error processing PDF:", error$2); - throw new Error(`Failed to process PDF: ${String(error$2)}`); + } catch (error) { + console.error("Error processing PDF:", error); + throw new Error(`Failed to process PDF: ${String(error)}`); } finally { if (pdf) { pdf.destroy(); @@ -99544,8 +99748,8 @@ async function generatePdfPreview(pdf) { }; await page.render(renderContext).promise; return canvas.toDataURL("image/png").split(",")[1]; - } catch (error$2) { - console.error("Error generating PDF preview:", error$2); + } catch (error) { + console.error("Error generating PDF preview:", error); return undefined; } } @@ -99566,9 +99770,9 @@ async function processDocx(arrayBuffer, fileName) { } extractedText += `\n\n`; return { extractedText }; - } catch (error$2) { - console.error("Error processing DOCX:", error$2); - throw new Error(`Failed to process DOCX: ${String(error$2)}`); + } catch (error) { + console.error("Error processing DOCX:", error); + throw new Error(`Failed to process DOCX: ${String(error)}`); } } function extractTextFromElement(element) { @@ -99678,9 +99882,9 @@ async function processPptx(arrayBuffer, fileName) { } extractedText += "\n"; return { extractedText }; - } catch (error$2) { - console.error("Error processing PPTX:", error$2); - throw new Error(`Failed to process PPTX: ${String(error$2)}`); + } catch (error) { + console.error("Error processing PPTX:", error); + throw new Error(`Failed to process PPTX: ${String(error)}`); } } async function processExcel(arrayBuffer, fileName) { @@ -99694,9 +99898,9 @@ async function processExcel(arrayBuffer, fileName) { } extractedText += "\n"; return { extractedText }; - } catch (error$2) { - console.error("Error processing Excel:", error$2); - throw new Error(`Failed to process Excel: ${String(error$2)}`); + } catch (error) { + console.error("Error processing Excel:", error); + throw new Error(`Failed to process Excel: ${String(error)}`); } } var import_docx_preview$2, import_jszip_min; @@ -99723,10 +99927,10 @@ var init_ModeToggle = __esmMin((() => { init_decorators(); init_i18n$1(); __decorate$26 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ModeToggle = class ModeToggle$1 extends i { constructor() { @@ -99787,10 +99991,10 @@ var init_AttachmentOverlay = __esmMin((() => { init_xlsx(); init_i18n(); __decorate$25 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; AttachmentOverlay = class AttachmentOverlay extends i { constructor() { @@ -100048,9 +100252,9 @@ var init_AttachmentOverlay = __esmMin((() => { } wrapper.appendChild(pageContainer); } - } catch (error$2) { - console.error("Error rendering PDF:", error$2); - this.error = error$2?.message || i18n("Failed to load PDF"); + } catch (error) { + console.error("Error rendering PDF:", error); + this.error = error?.message || i18n("Failed to load PDF"); } finally { if (pdf) { pdf.destroy(); @@ -100142,9 +100346,9 @@ var init_AttachmentOverlay = __esmMin((() => { } `; container.appendChild(style); - } catch (error$2) { - console.error("Error rendering DOCX:", error$2); - this.error = error$2?.message || i18n("Failed to load document"); + } catch (error) { + console.error("Error rendering DOCX:", error); + this.error = error?.message || i18n("Failed to load document"); } } async renderExcel() { @@ -100192,9 +100396,9 @@ var init_AttachmentOverlay = __esmMin((() => { const sheetName = workbook.SheetNames[0]; wrapper.appendChild(this.renderExcelSheet(workbook.Sheets[sheetName], sheetName)); } - } catch (error$2) { - console.error("Error rendering Excel:", error$2); - this.error = error$2?.message || i18n("Failed to load spreadsheet"); + } catch (error) { + console.error("Error rendering Excel:", error); + this.error = error?.message || i18n("Failed to load spreadsheet"); } } renderExcelSheet(worksheet, sheetName) { @@ -100244,9 +100448,9 @@ var init_AttachmentOverlay = __esmMin((() => { pre.textContent = this.attachment.extractedText || i18n("No text content available"); wrapper.appendChild(pre); container.appendChild(wrapper); - } catch (error$2) { - console.error("Error rendering extracted text:", error$2); - this.error = error$2?.message || i18n("Failed to display text content"); + } catch (error) { + console.error("Error rendering extracted text:", error); + this.error = error?.message || i18n("Failed to display text content"); } } }; @@ -100270,10 +100474,10 @@ var init_AttachmentTile = __esmMin((() => { init_AttachmentOverlay(); init_i18n(); __decorate$24 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; AttachmentTile = class AttachmentTile$1 extends i { constructor() { @@ -100370,10 +100574,10 @@ var init_MessageEditor = __esmMin((() => { init_i18n(); init_AttachmentTile(); __decorate$23 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; MessageEditor = class MessageEditor$1 extends i { constructor() { @@ -100437,9 +100641,9 @@ var init_MessageEditor = __esmMin((() => { } const attachment = await loadAttachment(file); newAttachments.push(attachment); - } catch (error$2) { - console.error("Error processing pasted image:", error$2); - alert(`Failed to process pasted image: ${String(error$2)}`); + } catch (error) { + console.error("Error processing pasted image:", error); + alert(`Failed to process pasted image: ${String(error)}`); } } this.attachments = [...this.attachments, ...newAttachments]; @@ -100490,9 +100694,9 @@ var init_MessageEditor = __esmMin((() => { } const attachment = await loadAttachment(file); newAttachments.push(attachment); - } catch (error$2) { - console.error(`Error processing ${file.name}:`, error$2); - alert(`Failed to process ${file.name}: ${String(error$2)}`); + } catch (error) { + console.error(`Error processing ${file.name}:`, error); + alert(`Failed to process ${file.name}: ${String(error)}`); } } this.attachments = [...this.attachments, ...newAttachments]; @@ -100530,9 +100734,9 @@ var init_MessageEditor = __esmMin((() => { } const attachment = await loadAttachment(file); newAttachments.push(attachment); - } catch (error$2) { - console.error(`Error processing ${file.name}:`, error$2); - alert(`Failed to process ${file.name}: ${String(error$2)}`); + } catch (error) { + console.error(`Error processing ${file.name}:`, error); + alert(`Failed to process ${file.name}: ${String(error)}`); } } this.attachments = [...this.attachments, ...newAttachments]; @@ -100734,19 +100938,19 @@ var init_repeat$1 = __esmMin((() => { init_directive(); init_directive_helpers(); u = (e$10, s$5, t$6) => { - const r$10 = new Map(); - for (let l$3 = s$5; l$3 <= t$6; l$3++) r$10.set(e$10[l$3], l$3); - return r$10; + const r$9 = new Map(); + for (let l$3 = s$5; l$3 <= t$6; l$3++) r$9.set(e$10[l$3], l$3); + return r$9; }, c = e$2(class extends i$2 { constructor(e$10) { if (super(e$10), e$10.type !== t$1.CHILD) throw Error("repeat() can only be used in text expressions"); } dt(e$10, s$5, t$6) { - let r$10; - void 0 === t$6 ? t$6 = s$5 : void 0 !== s$5 && (r$10 = s$5); + let r$9; + void 0 === t$6 ? t$6 = s$5 : void 0 !== s$5 && (r$9 = s$5); const l$3 = [], o$10 = []; let i$7 = 0; - for (const s$6 of e$10) l$3[i$7] = r$10 ? r$10(s$6, i$7) : i$7, o$10[i$7] = t$6(s$6, i$7), i$7++; + for (const s$6 of e$10) l$3[i$7] = r$9 ? r$9(s$6, i$7) : i$7, o$10[i$7] = t$6(s$6, i$7), i$7++; return { values: o$10, keys: l$3 @@ -100755,32 +100959,32 @@ var init_repeat$1 = __esmMin((() => { render(e$10, s$5, t$6) { return this.dt(e$10, s$5, t$6).values; } - update(s$5, [t$6, r$10, c$7]) { - const d$5 = p(s$5), { values: p$3, keys: a$2 } = this.dt(t$6, r$10, c$7); - if (!Array.isArray(d$5)) return this.ut = a$2, p$3; + update(s$5, [t$6, r$9, c$6]) { + const d$4 = p(s$5), { values: p$3, keys: a$2 } = this.dt(t$6, r$9, c$6); + if (!Array.isArray(d$4)) return this.ut = a$2, p$3; const h$5 = this.ut ??= [], v$3 = []; - let m$3, y$3, x$2 = 0, j$2 = d$5.length - 1, k$2 = 0, w$2 = p$3.length - 1; - for (; x$2 <= j$2 && k$2 <= w$2;) if (null === d$5[x$2]) x$2++; - else if (null === d$5[j$2]) j$2--; - else if (h$5[x$2] === a$2[k$2]) v$3[k$2] = v$1(d$5[x$2], p$3[k$2]), x$2++, k$2++; - else if (h$5[j$2] === a$2[w$2]) v$3[w$2] = v$1(d$5[j$2], p$3[w$2]), j$2--, w$2--; - else if (h$5[x$2] === a$2[w$2]) v$3[w$2] = v$1(d$5[x$2], p$3[w$2]), s(s$5, v$3[w$2 + 1], d$5[x$2]), x$2++, w$2--; - else if (h$5[j$2] === a$2[k$2]) v$3[k$2] = v$1(d$5[j$2], p$3[k$2]), s(s$5, d$5[x$2], d$5[j$2]), j$2--, k$2++; + let m$3, y$3, x$2 = 0, j$2 = d$4.length - 1, k$2 = 0, w$2 = p$3.length - 1; + for (; x$2 <= j$2 && k$2 <= w$2;) if (null === d$4[x$2]) x$2++; + else if (null === d$4[j$2]) j$2--; + else if (h$5[x$2] === a$2[k$2]) v$3[k$2] = v$1(d$4[x$2], p$3[k$2]), x$2++, k$2++; + else if (h$5[j$2] === a$2[w$2]) v$3[w$2] = v$1(d$4[j$2], p$3[w$2]), j$2--, w$2--; + else if (h$5[x$2] === a$2[w$2]) v$3[w$2] = v$1(d$4[x$2], p$3[w$2]), s(s$5, v$3[w$2 + 1], d$4[x$2]), x$2++, w$2--; + else if (h$5[j$2] === a$2[k$2]) v$3[k$2] = v$1(d$4[j$2], p$3[k$2]), s(s$5, d$4[x$2], d$4[j$2]), j$2--, k$2++; else if (void 0 === m$3 && (m$3 = u(a$2, k$2, w$2), y$3 = u(h$5, x$2, j$2)), m$3.has(h$5[x$2])) if (m$3.has(h$5[j$2])) { - const e$10 = y$3.get(a$2[k$2]), t$7 = void 0 !== e$10 ? d$5[e$10] : null; + const e$10 = y$3.get(a$2[k$2]), t$7 = void 0 !== e$10 ? d$4[e$10] : null; if (null === t$7) { - const e$11 = s(s$5, d$5[x$2]); + const e$11 = s(s$5, d$4[x$2]); v$1(e$11, p$3[k$2]), v$3[k$2] = e$11; - } else v$3[k$2] = v$1(t$7, p$3[k$2]), s(s$5, d$5[x$2], t$7), d$5[e$10] = null; + } else v$3[k$2] = v$1(t$7, p$3[k$2]), s(s$5, d$4[x$2], t$7), d$4[e$10] = null; k$2++; - } else M$1(d$5[j$2]), j$2--; - else M$1(d$5[x$2]), x$2++; + } else M$1(d$4[j$2]), j$2--; + else M$1(d$4[x$2]), x$2++; for (; k$2 <= w$2;) { const e$10 = s(s$5, v$3[w$2 + 1]); v$1(e$10, p$3[k$2]), v$3[k$2++] = e$10; } for (; x$2 <= j$2;) { - const e$10 = d$5[x$2++]; + const e$10 = d$4[x$2++]; null !== e$10 && M$1(e$10); } return this.ut = a$2, m$1(s$5, v$3), T$2; @@ -100819,10 +101023,10 @@ var init_MessageList = __esmMin((() => { init_repeat(); init_message_renderer_registry(); __decorate$22 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; MessageList = class extends i { constructor() { @@ -102128,10 +102332,10 @@ var init_mapped_key = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/mapped/mapped-result.mjs -function MappedResult(properties$1) { +function MappedResult(properties) { return CreateType({ [Kind]: "MappedResult", - properties: properties$1 + properties }); } var init_mapped_result = __esmMin((() => { @@ -102547,8 +102751,8 @@ var init_string$1 = __esmMin((() => { function* FromUnion$9(syntax) { const trim = syntax.trim().replace(/"|'/g, ""); return trim === "boolean" ? yield Boolean$1() : trim === "number" ? yield Number$1() : trim === "bigint" ? yield BigInt() : trim === "string" ? yield String$1() : yield (() => { - const literals$1 = trim.split("|").map((literal) => Literal(literal.trim())); - return literals$1.length === 0 ? Never() : literals$1.length === 1 ? literals$1[0] : UnionEvaluated(literals$1); + const literals = trim.split("|").map((literal) => Literal(literal.trim())); + return literals.length === 0 ? Never() : literals.length === 1 ? literals[0] : UnionEvaluated(literals); })(); } function* FromTerminal(syntax) { @@ -102682,10 +102886,10 @@ var init_indexed_property_keys = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/indexed/indexed-from-mapped-result.mjs -function FromProperties$18(type, properties$1, options) { +function FromProperties$18(type, properties, options) { const result = {}; - for (const K2 of Object.getOwnPropertyNames(properties$1)) { - result[K2] = Index(type, IndexPropertyKeys(properties$1[K2]), options); + for (const K2 of Object.getOwnPropertyNames(properties)) { + result[K2] = Index(type, IndexPropertyKeys(properties[K2]), options); } return result; } @@ -102693,8 +102897,8 @@ function FromMappedResult$11(type, mappedResult, options) { return FromProperties$18(type, mappedResult.properties, options); } function IndexFromMappedResult(type, mappedResult, options) { - const properties$1 = FromMappedResult$11(type, mappedResult, options); - return MappedResult(properties$1); + const properties = FromMappedResult$11(type, mappedResult, options); + return MappedResult(properties); } var init_indexed_from_mapped_result = __esmMin((() => { init_mapped(); @@ -102725,8 +102929,8 @@ function FromTuple$4(types, key) { function FromArray$5(type, key) { return key === "[number]" ? type : Never(); } -function FromProperty$2(properties$1, propertyKey) { - return propertyKey in properties$1 ? properties$1[propertyKey] : Never(); +function FromProperty$2(properties, propertyKey) { + return propertyKey in properties ? properties[propertyKey] : Never(); } function IndexFromPropertyKey(type, propertyKey) { return IsIntersect(type) ? FromIntersect$7(type.allOf, propertyKey) : IsUnion(type) ? FromUnion$7(type.anyOf, propertyKey) : IsTuple(type) ? FromTuple$4(type.items ?? [], propertyKey) : IsArray$1(type) ? FromArray$5(type.items, propertyKey) : IsObject(type) ? FromProperty$2(type.properties, propertyKey) : Never(); @@ -102743,8 +102947,8 @@ function IndexFromComputed(type, key) { /** `[Json]` Returns an Indexed property type for the given keys */ function Index(type, key, options) { if (IsRef(type) || IsRef(key)) { - const error$2 = `Index types using Ref parameters require both Type and Key to be of TSchema`; - if (!IsSchema(type) || !IsSchema(key)) throw new TypeBoxError(error$2); + const error = `Index types using Ref parameters require both Type and Key to be of TSchema`; + if (!IsSchema(type) || !IsSchema(key)) throw new TypeBoxError(error); return Computed("Index", [type, key]); } if (IsMappedResult(key)) return IndexFromMappedResult(type, key, options); @@ -102781,8 +102985,8 @@ function MappedIndexProperties(type, mappedKey, options) { return MappedIndexPropertyKeys(type, mappedKey.keys, options); } function IndexFromMappedKey(type, mappedKey, options) { - const properties$1 = MappedIndexProperties(type, mappedKey, options); - return MappedResult(properties$1); + const properties = MappedIndexProperties(type, mappedKey, options); + return MappedResult(properties); } var init_indexed_from_mapped_key = __esmMin((() => { init_indexed$1(); @@ -102822,25 +103026,25 @@ var init_iterator = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/object/object.mjs -function RequiredKeys(properties$1) { +function RequiredKeys(properties) { const keys$1 = []; - for (let key in properties$1) { - if (!IsOptional(properties$1[key])) keys$1.push(key); + for (let key in properties) { + if (!IsOptional(properties[key])) keys$1.push(key); } return keys$1; } /** `[Json]` Creates an Object type */ -function _Object(properties$1, options) { - const required = RequiredKeys(properties$1); +function _Object(properties, options) { + const required = RequiredKeys(properties); const schematic = required.length > 0 ? { [Kind]: "Object", type: "object", - properties: properties$1, + properties, required } : { [Kind]: "Object", type: "object", - properties: properties$1 + properties }; return CreateType(schematic, options); } @@ -103323,17 +103527,17 @@ var init_keyof$1 = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/keyof/keyof-from-mapped-result.mjs -function FromProperties$13(properties$1, options) { +function FromProperties$13(properties, options) { const result = {}; - for (const K2 of globalThis.Object.getOwnPropertyNames(properties$1)) result[K2] = KeyOf(properties$1[K2], Clone(options)); + for (const K2 of globalThis.Object.getOwnPropertyNames(properties)) result[K2] = KeyOf(properties[K2], Clone(options)); return result; } function FromMappedResult$7(mappedResult, options) { return FromProperties$13(mappedResult.properties, options); } function KeyOfFromMappedResult(mappedResult, options) { - const properties$1 = FromMappedResult$7(mappedResult, options); - return MappedResult(properties$1); + const properties = FromMappedResult$7(mappedResult, options); + return MappedResult(properties); } var init_keyof_from_mapped_result = __esmMin((() => { init_mapped(); @@ -104276,11 +104480,11 @@ function FromProperty$1(args, type) { const mapped = FromType$1(args, type); return isReadonly && isOptional ? ReadonlyOptional(mapped) : isReadonly && !isOptional ? Readonly(mapped) : !isReadonly && isOptional ? Optional(mapped) : mapped; } -function FromProperties$8(args, properties$1) { - return globalThis.Object.getOwnPropertyNames(properties$1).reduce((result, key) => { +function FromProperties$8(args, properties) { + return globalThis.Object.getOwnPropertyNames(properties).reduce((result, key) => { return { ...result, - [key]: FromProperty$1(args, properties$1[key]) + [key]: FromProperty$1(args, properties[key]) }; }, {}); } @@ -104384,8 +104588,8 @@ function FromTemplateLiteral(schema, mode, options) { pattern: FromLiteralValue(schema.pattern, mode) }; const strings = [...TemplateLiteralExpressionGenerate(expression)]; - const literals$1 = strings.map((value) => Literal(value)); - const mapped = FromRest$2(literals$1, mode); + const literals = strings.map((value) => Literal(value)); + const mapped = FromRest$2(literals, mode); const union = Union(mapped); return TemplateLiteral([union], options); } @@ -104461,17 +104665,17 @@ var init_intrinsic = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/omit/omit-from-mapped-result.mjs -function FromProperties$7(properties$1, propertyKeys, options) { +function FromProperties$7(properties, propertyKeys, options) { const result = {}; - for (const K2 of globalThis.Object.getOwnPropertyNames(properties$1)) result[K2] = Omit(properties$1[K2], propertyKeys, Clone(options)); + for (const K2 of globalThis.Object.getOwnPropertyNames(properties)) result[K2] = Omit(properties[K2], propertyKeys, Clone(options)); return result; } function FromMappedResult$3(mappedResult, propertyKeys, options) { return FromProperties$7(mappedResult.properties, propertyKeys, options); } function OmitFromMappedResult(mappedResult, propertyKeys, options) { - const properties$1 = FromMappedResult$3(mappedResult, propertyKeys, options); - return MappedResult(properties$1); + const properties = FromMappedResult$3(mappedResult, propertyKeys, options); + return MappedResult(properties); } var init_omit_from_mapped_result = __esmMin((() => { init_mapped(); @@ -104487,29 +104691,29 @@ function FromIntersect$2(types, propertyKeys) { function FromUnion$2(types, propertyKeys) { return types.map((type) => OmitResolve(type, propertyKeys)); } -function FromProperty(properties$1, key) { - const { [key]: _$2, ...R$1 } = properties$1; +function FromProperty(properties, key) { + const { [key]: _$2, ...R$1 } = properties; return R$1; } -function FromProperties$6(properties$1, propertyKeys) { - return propertyKeys.reduce((T$3, K2) => FromProperty(T$3, K2), properties$1); +function FromProperties$6(properties, propertyKeys) { + return propertyKeys.reduce((T$3, K2) => FromProperty(T$3, K2), properties); } -function FromObject$4(properties$1, propertyKeys) { - const options = Discard(properties$1, [ +function FromObject$4(properties, propertyKeys) { + const options = Discard(properties, [ TransformKind, "$id", "required", "properties" ]); - const omittedProperties = FromProperties$6(properties$1["properties"], propertyKeys); + const omittedProperties = FromProperties$6(properties["properties"], propertyKeys); return Object$1(omittedProperties, options); } function UnionFromPropertyKeys$1(propertyKeys) { const result = propertyKeys.reduce((result$1, key) => IsLiteralValue(key) ? [...result$1, Literal(key)] : result$1, []); return Union(result); } -function OmitResolve(properties$1, propertyKeys) { - return IsIntersect(properties$1) ? Intersect(FromIntersect$2(properties$1.allOf, propertyKeys)) : IsUnion(properties$1) ? Union(FromUnion$2(properties$1.anyOf, propertyKeys)) : IsObject(properties$1) ? FromObject$4(properties$1, propertyKeys) : Object$1({}); +function OmitResolve(properties, propertyKeys) { + return IsIntersect(properties) ? Intersect(FromIntersect$2(properties.allOf, propertyKeys)) : IsUnion(properties) ? Union(FromUnion$2(properties.anyOf, propertyKeys)) : IsObject(properties) ? FromObject$4(properties, propertyKeys) : Object$1({}); } /** `[Json]` Constructs a type whose keys are picked from the given type */ function Omit(type, key, options) { @@ -104555,8 +104759,8 @@ function FromMappedKey$1(type, mappedKey, options) { return FromPropertyKeys$1(type, mappedKey.keys, options); } function OmitFromMappedKey(type, mappedKey, options) { - const properties$1 = FromMappedKey$1(type, mappedKey, options); - return MappedResult(properties$1); + const properties = FromMappedKey$1(type, mappedKey, options); + return MappedResult(properties); } var init_omit_from_mapped_key = __esmMin((() => { init_mapped(); @@ -104574,17 +104778,17 @@ var init_omit = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/pick/pick-from-mapped-result.mjs -function FromProperties$5(properties$1, propertyKeys, options) { +function FromProperties$5(properties, propertyKeys, options) { const result = {}; - for (const K2 of globalThis.Object.getOwnPropertyNames(properties$1)) result[K2] = Pick(properties$1[K2], propertyKeys, Clone(options)); + for (const K2 of globalThis.Object.getOwnPropertyNames(properties)) result[K2] = Pick(properties[K2], propertyKeys, Clone(options)); return result; } function FromMappedResult$2(mappedResult, propertyKeys, options) { return FromProperties$5(mappedResult.properties, propertyKeys, options); } function PickFromMappedResult(mappedResult, propertyKeys, options) { - const properties$1 = FromMappedResult$2(mappedResult, propertyKeys, options); - return MappedResult(properties$1); + const properties = FromMappedResult$2(mappedResult, propertyKeys, options); + return MappedResult(properties); } var init_pick_from_mapped_result = __esmMin((() => { init_mapped(); @@ -104600,9 +104804,9 @@ function FromIntersect$1(types, propertyKeys) { function FromUnion$1(types, propertyKeys) { return types.map((type) => PickResolve(type, propertyKeys)); } -function FromProperties$4(properties$1, propertyKeys) { +function FromProperties$4(properties, propertyKeys) { const result = {}; - for (const K2 of propertyKeys) if (K2 in properties$1) result[K2] = properties$1[K2]; + for (const K2 of propertyKeys) if (K2 in properties) result[K2] = properties[K2]; return result; } function FromObject$3(T$3, K$1) { @@ -104612,15 +104816,15 @@ function FromObject$3(T$3, K$1) { "required", "properties" ]); - const properties$1 = FromProperties$4(T$3["properties"], K$1); - return Object$1(properties$1, options); + const properties = FromProperties$4(T$3["properties"], K$1); + return Object$1(properties, options); } function UnionFromPropertyKeys(propertyKeys) { const result = propertyKeys.reduce((result$1, key) => IsLiteralValue(key) ? [...result$1, Literal(key)] : result$1, []); return Union(result); } -function PickResolve(properties$1, propertyKeys) { - return IsIntersect(properties$1) ? Intersect(FromIntersect$1(properties$1.allOf, propertyKeys)) : IsUnion(properties$1) ? Union(FromUnion$1(properties$1.anyOf, propertyKeys)) : IsObject(properties$1) ? FromObject$3(properties$1, propertyKeys) : Object$1({}); +function PickResolve(properties, propertyKeys) { + return IsIntersect(properties) ? Intersect(FromIntersect$1(properties.allOf, propertyKeys)) : IsUnion(properties) ? Union(FromUnion$1(properties.anyOf, propertyKeys)) : IsObject(properties) ? FromObject$3(properties, propertyKeys) : Object$1({}); } /** `[Json]` Constructs a type whose keys are picked from the given type */ function Pick(type, key, options) { @@ -104666,8 +104870,8 @@ function FromMappedKey(type, mappedKey, options) { return FromPropertyKeys(type, mappedKey.keys, options); } function PickFromMappedKey(type, mappedKey, options) { - const properties$1 = FromMappedKey(type, mappedKey, options); - return MappedResult(properties$1); + const properties = FromMappedKey(type, mappedKey, options); + return MappedResult(properties); } var init_pick_from_mapped_key = __esmMin((() => { init_mapped(); @@ -104691,9 +104895,9 @@ function FromComputed$2(target, parameters) { function FromRef$1($ref) { return Computed("Partial", [Ref($ref)]); } -function FromProperties$3(properties$1) { +function FromProperties$3(properties) { const partialProperties = {}; - for (const K$1 of globalThis.Object.getOwnPropertyNames(properties$1)) partialProperties[K$1] = Optional(properties$1[K$1]); + for (const K$1 of globalThis.Object.getOwnPropertyNames(properties)) partialProperties[K$1] = Optional(properties[K$1]); return partialProperties; } function FromObject$2(type) { @@ -104703,8 +104907,8 @@ function FromObject$2(type) { "required", "properties" ]); - const properties$1 = FromProperties$3(type["properties"]); - return Object$1(properties$1, options); + const properties = FromProperties$3(type["properties"]); + return Object$1(properties, options); } function FromRest$1(types) { return types.map((type) => PartialResolve(type)); @@ -104772,9 +104976,9 @@ function FromComputed$1(target, parameters) { function FromRef($ref) { return Computed("Required", [Ref($ref)]); } -function FromProperties$1(properties$1) { +function FromProperties$1(properties) { const requiredProperties = {}; - for (const K$1 of globalThis.Object.getOwnPropertyNames(properties$1)) requiredProperties[K$1] = Discard(properties$1[K$1], [OptionalKind]); + for (const K$1 of globalThis.Object.getOwnPropertyNames(properties)) requiredProperties[K$1] = Discard(properties[K$1], [OptionalKind]); return requiredProperties; } function FromObject$1(type) { @@ -104784,8 +104988,8 @@ function FromObject$1(type) { "required", "properties" ]); - const properties$1 = FromProperties$1(type["properties"]); - return Object$1(properties$1, options); + const properties = FromProperties$1(type["properties"]); + return Object$1(properties, options); } function FromRest(types) { return types.map((type) => RequiredResolve(type)); @@ -104896,11 +105100,11 @@ function FromIntersect(moduleProperties, types) { function FromIterator(moduleProperties, type) { return Iterator(FromType(moduleProperties, type)); } -function FromObject(moduleProperties, properties$1) { - return Object$1(globalThis.Object.keys(properties$1).reduce((result, key) => { +function FromObject(moduleProperties, properties) { + return Object$1(globalThis.Object.keys(properties).reduce((result, key) => { return { ...result, - [key]: FromType(moduleProperties, properties$1[key]) + [key]: FromType(moduleProperties, properties[key]) }; }, {})); } @@ -104968,8 +105172,8 @@ var init_compute = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/@sinclair/typebox/build/esm/type/module/module.mjs /** `[Json]` Creates a Type Definition Module. */ -function Module(properties$1) { - return new TModule(properties$1); +function Module(properties) { + return new TModule(properties); } var TModule; var init_module$1 = __esmMin((() => { @@ -105390,8 +105594,8 @@ var init_json$2 = __esmMin((() => { return Mapped(key, map$2, options); } /** `[Json]` Creates a Type Definition Module. */ - Module(properties$1) { - return Module(properties$1); + Module(properties) { + return Module(properties); } /** `[Json]` Creates a Never type */ Never(options) { @@ -105410,8 +105614,8 @@ var init_json$2 = __esmMin((() => { return Number$1(options); } /** `[Json]` Creates an Object type */ - Object(properties$1, options) { - return Object$1(properties$1, options); + Object(properties, options) { + return Object$1(properties, options); } /** `[Json]` Constructs a type whose keys are omitted from the given type */ Omit(schema, selector, options) { @@ -105879,10 +106083,10 @@ var init_ConsoleRuntimeProvider = __esmMin((() => { }; }); let completionSent = false; - window.complete = async (error$2, returnValue) => { + window.complete = async (error, returnValue) => { if (completionSent) return; completionSent = true; - const finalError = error$2 || lastError; + const finalError = error || lastError; if (window.sendRuntimeMessage) { if (finalError) { await window.sendRuntimeMessage({ @@ -106162,10 +106366,10 @@ var init_SandboxedIframe = __esmMin((() => { init_RuntimeMessageBridge(); init_RuntimeMessageRouter(); __decorate$21 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; SandboxIframe = class SandboxIframe$1 extends i { createRenderRoot() { @@ -106436,8 +106640,8 @@ var init_SandboxedIframe = __esmMin((() => { return parserError.textContent || "Unknown parse error"; } return null; - } catch (error$2) { - return error$2.message || "Unknown validation error"; + } catch (error) { + return error.message || "Unknown validation error"; } } /** @@ -107001,9 +107205,9 @@ async function executeJavaScript(code, runtimeProviders, signal, sandboxUrlProvi output: output.trim() || "Code executed successfully (no output)", files: result.files }; - } catch (error$2) { + } catch (error) { sandbox.remove(); - throw new Error(error$2.message || "Execution failed"); + throw new Error(error.message || "Execution failed"); } } function createJavaScriptReplTool() { @@ -107013,7 +107217,7 @@ function createJavaScriptReplTool() { runtimeProvidersFactory: () => [], sandboxUrlProvider: undefined, get description() { - const runtimeProviderDescriptions = this.runtimeProvidersFactory?.().map((d$5) => d$5.getDescription()).filter((d$5) => d$5.trim().length > 0) || []; + const runtimeProviderDescriptions = this.runtimeProvidersFactory?.().map((d$4) => d$4.getDescription()).filter((d$4) => d$4.trim().length > 0) || []; return JAVASCRIPT_REPL_TOOL_DESCRIPTION(runtimeProviderDescriptions); }, parameters: javascriptReplSchema, @@ -107096,7 +107300,7 @@ var init_javascript_repl = __esmMin((() => { const codeContentRef = e(); const codeChevronRef = e(); if (result && params) { - const output = result.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || ""; + const output = result.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || ""; const files = result.details?.files || []; const attachments = files.map((f$4, i$7) => { let extractedText; @@ -107220,15 +107424,15 @@ function applyProxyIfNeeded(model, apiKey, proxyUrl) { * @param error - The error to check * @returns true if error is likely a CORS error */ -function isCorsError(error$2) { - if (!(error$2 instanceof Error)) { +function isCorsError(error) { + if (!(error instanceof Error)) { return false; } - const message = error$2.message.toLowerCase(); - if (error$2.name === "TypeError" && message.includes("failed to fetch")) { + const message = error.message.toLowerCase(); + if (error.name === "TypeError" && message.includes("failed to fetch")) { return true; } - if (error$2.name === "NetworkError") { + if (error.name === "NetworkError") { return true; } if (message.includes("cors") || message.includes("cross-origin")) { @@ -107351,7 +107555,7 @@ var init_extract_document = __esmMin((() => { if (result && params) { const details = result.details; const title = details ? result.isError ? `Failed to extract ${details.fileName || "document"}` : `Extracted text from ${details.fileName} (${details.format.toUpperCase()}, ${(details.size / 1024).toFixed(1)}KB)` : result.isError ? "Failed to extract document" : "Extracted text from document"; - const output = result.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || ""; + const output = result.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || ""; return { content: x`
@@ -107402,7 +107606,7 @@ var init_BashRenderer = __esmMin((() => { render(params, result) { const state$1 = result ? result.isError ? "error" : "complete" : "inprogress"; if (result && params?.command) { - const output = result.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || ""; + const output = result.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || ""; const combined = output ? `> ${params.command}\n\n${output}` : `> ${params.command}`; return { content: x` @@ -107457,7 +107661,7 @@ var init_DefaultRenderer = __esmMin((() => { } } if (result) { - let outputJson = result.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || i18n("(no output)"); + let outputJson = result.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || i18n("(no output)"); let outputLanguage = "text"; try { const parsed = JSON.parse(outputJson); @@ -107556,8 +107760,8 @@ var init_tools = __esmMin((() => { function formatClock(ts) { if (!ts) return ""; try { - const d$5 = new Date(ts); - return d$5.toLocaleTimeString([], { + const d$4 = new Date(ts); + return d$4.toLocaleTimeString([], { hour: "2-digit", minute: "2-digit" }); @@ -107610,10 +107814,10 @@ var init_ThinkingBlock = __esmMin((() => { init_decorators(); init_lucide(); __decorate$20 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ThinkingBlock = class ThinkingBlock$1 extends i { constructor() { @@ -107665,10 +107869,10 @@ var init_Messages = __esmMin((() => { init_message_meta(); init_ThinkingBlock(); __decorate$19 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; UserMessage = class UserMessage$1 extends i { createRenderRoot() { @@ -107679,7 +107883,7 @@ var init_Messages = __esmMin((() => { this.style.display = "block"; } render() { - const content = typeof this.message.content === "string" ? this.message.content : this.message.content.find((c$7) => c$7.type === "text")?.text || ""; + const content = typeof this.message.content === "string" ? this.message.content : this.message.content.find((c$6) => c$6.type === "text")?.text || ""; return x`
${renderSurfaceChip(this.message.surface, this.message.senderHost, this.message.senderIp)} @@ -107792,7 +107996,7 @@ var init_Messages = __esmMin((() => { } } render() { - const textOutput = this.result?.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || ""; + const textOutput = this.result?.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || ""; const output = this.pretty(textOutput); const details = this.pretty(this.result?.details); return x` @@ -107878,10 +108082,10 @@ var init_StreamingMessageContainer = __esmMin((() => { init_lit(); init_decorators(); __decorate$18 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; StreamingMessageContainer = class extends i { constructor() { @@ -107979,10 +108183,10 @@ var init_AgentInterface = __esmMin((() => { init_format$1(); init_i18n(); __decorate$17 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; AgentInterface = class AgentInterface$1 extends i { constructor() { @@ -108433,10 +108637,10 @@ var init_ArtifactsRuntimeProvider = __esmMin((() => { error: `Unknown artifact action: ${action}` }); } - } catch (error$2) { + } catch (error) { respond({ success: false, - error: error$2.message + error: error.message }); } } @@ -108521,7 +108725,7 @@ var init_ArtifactElement = __esmMin((() => { /** * Escapes text to prevent scripting attacks. */ -function escape$4(text$2) { +function escape$1(text$2) { return String(text$2).replace(ESCAPE_REGEX, (match) => ESCAPE_LOOKUP[match]); } function getDefaultValue(schema) { @@ -109254,7 +109458,7 @@ function sizingGroup(value, options, baseOptions) { } return buildCommon.makeFragment(inner$1); } -var SourceLocation, Token, ParseError, deflt, uppercase, hyphenate, ESCAPE_LOOKUP, ESCAPE_REGEX, getBaseElem, isCharacterBox, assert, protocolFromUrl, utils, SETTINGS_SCHEMA, Settings, Style, D$1, Dc, T$1, Tc, S$1, Sc, SS, SSc, styles, sup, sub, fracNum, fracDen, cramp, text$1, Style$1, scriptData, allBlocks, hLinePad, sqrtMain, sqrtSize1, sqrtSize2, sqrtSize3, sqrtSize4, phasePath, sqrtTall, sqrtPath, innerPath, path, tallDelim, DocumentFragment$1, fontMetricsData, sigmasAndXis, extraCharacterMap, fontMetricsBySizeIndex, sizeStyleMap, sizeMultipliers, sizeAtStyle, Options, ptPerUnit, relativeUnit, validUnit, calculateSize, makeEm, createClass, initNode, toNode, invalidAttributeNameRegex, toMarkup, Span, Anchor, Img, iCombinations, SymbolNode, SvgNode, PathNode, LineNode, ATOMS, NON_ATOMS, symbols, math, text, main, ams, accent, bin, close, inner, mathord, op, open, punct, rel, spacing, textord, ligatures, mathTextSymbols, i$1, ch, textSymbols, _i, _ch, letters, _i2, _ch2, wideChar, _i3, _ch3, _i4, _ch4, extraLatin, _i5, _ch5, wideLatinLetterData, wideNumeralData, wideCharacterFont, lookupSymbol, makeSymbol, mathsym, boldsymbol, makeOrd, canCombine, tryCombineChars, sizeElementFromChildren, makeSpan$2, makeSvgSpan, makeLineSpan, makeAnchor, makeFragment, wrapFragment, getVListChildrenAndDepth, makeVList, makeGlue, retrieveTextFontName, fontMap, svgData, staticSvg, buildCommon, thinspace, mediumspace, thickspace, spacings, tightSpacings, _functions, _htmlGroupBuilders, _mathmlGroupBuilders, normalizeArgument, ordargument, makeSpan$1, binLeftCanceller, binRightCanceller, styleMap$1, DomEnum, buildExpression$1, traverseNonSpaceNodes, checkPartialGroup, getOutermostNode, getTypeOfDomTree, makeNullDelimiter, buildGroup$1, MathNode, TextNode, SpaceNode, mathMLTree, makeText, makeRow, getVariant, buildExpression, buildExpressionRow, buildGroup, optionsFromSettings, displayWrap, buildTree, buildHTMLTree, stretchyCodePoint, mathMLnode, katexImagesData, groupLength, svgSpan, encloseSpan, stretchy, htmlBuilder$a, mathmlBuilder$9, NON_STRETCHY_ACCENT_REGEX, paddedNode, makeSpan, binrelClass, cdArrowFunctionName, newCell, isStartOfArrow, isLabelEnd, htmlBuilder$8, mathmlBuilder$7, globalMap, checkControlSequence, getRHS, letCommand, getMetrics, styleWrap, centerSpan, makeSmallDelim, mathrmSize, makeLargeDelim, makeGlyphSpan, makeInner, lapInEms, lap, verts, doubleVerts, makeStackedDelim, vbPad, emPad, sqrtSvg, makeSqrtImage, stackLargeDelimiters, stackAlwaysDelimiters, stackNeverDelimiters, sizeToMaxHeight, makeSizedDelim, stackNeverDelimiterSequence, stackAlwaysDelimiterSequence, stackLargeDelimiterSequence, delimTypeToFont, traverseSequence, makeCustomSizedDelim, makeLeftRightDelim, delimiter, delimiterSizes, delimiters, htmlBuilder$7, mathmlBuilder$6, _environments, _macros, validateAmsEnvironmentContext, htmlBuilder$6, alignMap, mathmlBuilder$5, alignedHandler, environments, htmlBuilder$5, mathmlBuilder$4, fontAliases, adjustStyle, htmlBuilder$4, mathmlBuilder$3, stylArray, delimFromValue, htmlBuilder$3, mathmlBuilder$2, sizeData, chooseMathStyle, assembleSupSub, noSuccessor, htmlBuilder$2, mathmlBuilder$1, singleCharBigOps, singleCharIntegrals, htmlBuilder$1, mathmlBuilder, sizeFuncs, htmlBuilder, styleMap, htmlBuilderDelegate, defaultVariant, cssSpace, regularSpace, pad, textFontFamilies, textFontWeights, textFontShapes, optionsWithFont, makeVerb, functions, spaceRegexString, controlWordRegexString, controlSymbolRegexString, controlWordWhitespaceRegexString, controlSpaceRegexString, combiningDiacriticalMarkString, combiningDiacriticalMarksEndRegex, tokenRegexString, Lexer, Namespace, macros, digitToNumber, newcommand, dotsByToken, spaceAfterDots, latexRaiseA, braketHelper, implicitCommands, MacroExpander, unicodeSubRegEx, uSubsAndSups, unicodeAccents, unicodeSymbols, Parser, parseTree, render, renderToString, generateParseTree, renderError, renderToDomTree, renderToHTMLTree, version$2, __domTree, katex; +var SourceLocation, Token, ParseError, deflt, uppercase, hyphenate, ESCAPE_LOOKUP, ESCAPE_REGEX, getBaseElem, isCharacterBox, assert, protocolFromUrl, utils, SETTINGS_SCHEMA, Settings, Style, D$1, Dc, T$1, Tc, S$1, Sc, SS, SSc, styles, sup, sub, fracNum, fracDen, cramp, text$1, Style$1, scriptData, allBlocks, hLinePad, sqrtMain, sqrtSize1, sqrtSize2, sqrtSize3, sqrtSize4, phasePath, sqrtTall, sqrtPath, innerPath, path, tallDelim, DocumentFragment$1, fontMetricsData, sigmasAndXis, extraCharacterMap, fontMetricsBySizeIndex, sizeStyleMap, sizeMultipliers, sizeAtStyle, Options, ptPerUnit, relativeUnit, validUnit, calculateSize, makeEm, createClass, initNode, toNode, invalidAttributeNameRegex, toMarkup, Span, Anchor, Img, iCombinations, SymbolNode, SvgNode, PathNode, LineNode, ATOMS, NON_ATOMS, symbols, math, text, main, ams, accent, bin, close, inner, mathord, op, open, punct, rel, spacing, textord, ligatures, mathTextSymbols, i$1, ch, textSymbols, _i, _ch, letters, _i2, _ch2, wideChar, _i3, _ch3, _i4, _ch4, extraLatin, _i5, _ch5, wideLatinLetterData, wideNumeralData, wideCharacterFont, lookupSymbol, makeSymbol, mathsym, boldsymbol, makeOrd, canCombine, tryCombineChars, sizeElementFromChildren, makeSpan$2, makeSvgSpan, makeLineSpan, makeAnchor, makeFragment, wrapFragment, getVListChildrenAndDepth, makeVList, makeGlue, retrieveTextFontName, fontMap, svgData, staticSvg, buildCommon, thinspace, mediumspace, thickspace, spacings, tightSpacings, _functions, _htmlGroupBuilders, _mathmlGroupBuilders, normalizeArgument, ordargument, makeSpan$1, binLeftCanceller, binRightCanceller, styleMap$1, DomEnum, buildExpression$1, traverseNonSpaceNodes, checkPartialGroup, getOutermostNode, getTypeOfDomTree, makeNullDelimiter, buildGroup$1, MathNode, TextNode, SpaceNode, mathMLTree, makeText, makeRow, getVariant, buildExpression, buildExpressionRow, buildGroup, optionsFromSettings, displayWrap, buildTree, buildHTMLTree, stretchyCodePoint, mathMLnode, katexImagesData, groupLength, svgSpan, encloseSpan, stretchy, htmlBuilder$a, mathmlBuilder$9, NON_STRETCHY_ACCENT_REGEX, paddedNode, makeSpan, binrelClass, cdArrowFunctionName, newCell, isStartOfArrow, isLabelEnd, htmlBuilder$8, mathmlBuilder$7, globalMap, checkControlSequence, getRHS, letCommand, getMetrics, styleWrap, centerSpan, makeSmallDelim, mathrmSize, makeLargeDelim, makeGlyphSpan, makeInner, lapInEms, lap, verts, doubleVerts, makeStackedDelim, vbPad, emPad, sqrtSvg, makeSqrtImage, stackLargeDelimiters, stackAlwaysDelimiters, stackNeverDelimiters, sizeToMaxHeight, makeSizedDelim, stackNeverDelimiterSequence, stackAlwaysDelimiterSequence, stackLargeDelimiterSequence, delimTypeToFont, traverseSequence, makeCustomSizedDelim, makeLeftRightDelim, delimiter, delimiterSizes, delimiters, htmlBuilder$7, mathmlBuilder$6, _environments, _macros, validateAmsEnvironmentContext, htmlBuilder$6, alignMap, mathmlBuilder$5, alignedHandler, environments, htmlBuilder$5, mathmlBuilder$4, fontAliases, adjustStyle, htmlBuilder$4, mathmlBuilder$3, stylArray, delimFromValue, htmlBuilder$3, mathmlBuilder$2, sizeData, chooseMathStyle, assembleSupSub, noSuccessor, htmlBuilder$2, mathmlBuilder$1, singleCharBigOps, singleCharIntegrals, htmlBuilder$1, mathmlBuilder, sizeFuncs, htmlBuilder, styleMap, htmlBuilderDelegate, defaultVariant, cssSpace, regularSpace, pad, textFontFamilies, textFontWeights, textFontShapes, optionsWithFont, makeVerb, functions, spaceRegexString, controlWordRegexString, controlSymbolRegexString, controlWordWhitespaceRegexString, controlSpaceRegexString, combiningDiacriticalMarkString, combiningDiacriticalMarksEndRegex, tokenRegexString, Lexer, Namespace, macros, digitToNumber, newcommand, dotsByToken, spaceAfterDots, latexRaiseA, braketHelper, implicitCommands, MacroExpander, unicodeSubRegEx, uSubsAndSups, unicodeAccents, unicodeSymbols, Parser, parseTree, render, renderToString, generateParseTree, renderError, renderToDomTree, renderToHTMLTree, version, __domTree, katex; var init_katex = __esmMin((() => { SourceLocation = class SourceLocation { constructor(lexer, start, end) { @@ -109306,7 +109510,7 @@ var init_katex = __esmMin((() => { this.position = void 0; this.length = void 0; this.rawMessage = void 0; - var error$2 = "KaTeX parse error: " + message; + var error = "KaTeX parse error: " + message; var start; var end; var loc = token && token.loc; @@ -109315,9 +109519,9 @@ var init_katex = __esmMin((() => { start = loc.start; end = loc.end; if (start === input.length) { - error$2 += " at end of input: "; + error += " at end of input: "; } else { - error$2 += " at position " + (start + 1) + ": "; + error += " at position " + (start + 1) + ": "; } var underlined = input.slice(start, end).replace(/[^]/g, "$&̲"); var left; @@ -109332,9 +109536,9 @@ var init_katex = __esmMin((() => { } else { right = input.slice(end); } - error$2 += left + underlined + right; + error += left + underlined + right; } - var self$1 = new Error(error$2); + var self$1 = new Error(error); self$1.name = "ParseError"; self$1.__proto__ = ParseError.prototype; self$1.position = start; @@ -109405,7 +109609,7 @@ var init_katex = __esmMin((() => { }; utils = { deflt, - escape: escape$4, + escape: escape$1, hyphenate, getBaseElem, isCharacterBox, @@ -109565,7 +109769,7 @@ var init_katex = __esmMin((() => { if (typeof strict === "function") { try { strict = strict(errorCode, errorMsg, token); - } catch (error$2) { + } catch (error) { strict = "error"; } } @@ -126331,9 +126535,9 @@ var init_katex = __esmMin((() => { var _depth = -oldChildren[0].shift - oldChildren[0].elem.depth; var currPos = _depth; for (var i$7 = 1; i$7 < oldChildren.length; i$7++) { - var diff$1 = -oldChildren[i$7].shift - currPos - oldChildren[i$7].elem.depth; - var size = diff$1 - (oldChildren[i$7 - 1].elem.height + oldChildren[i$7 - 1].elem.depth); - currPos = currPos + diff$1; + var diff = -oldChildren[i$7].shift - currPos - oldChildren[i$7].elem.depth; + var size = diff - (oldChildren[i$7 - 1].elem.height + oldChildren[i$7 - 1].elem.depth); + currPos = currPos + diff; children.push({ type: "kern", size @@ -129733,8 +129937,8 @@ var init_katex = __esmMin((() => { } }; htmlBuilder$6 = function htmlBuilder$10(group, options) { - var r$10; - var c$7; + var r$9; + var c$6; var nr = group.body.length; var hLinesBeforeRow = group.hLinesBeforeRow; var nc = 0; @@ -129768,25 +129972,25 @@ var init_katex = __esmMin((() => { } } setHLinePos(hLinesBeforeRow[0]); - for (r$10 = 0; r$10 < group.body.length; ++r$10) { - var inrow = group.body[r$10]; + for (r$9 = 0; r$9 < group.body.length; ++r$9) { + var inrow = group.body[r$9]; var height = arstrutHeight; var depth = arstrutDepth; if (nc < inrow.length) { nc = inrow.length; } var outrow = new Array(inrow.length); - for (c$7 = 0; c$7 < inrow.length; ++c$7) { - var elt = buildGroup$1(inrow[c$7], options); + for (c$6 = 0; c$6 < inrow.length; ++c$6) { + var elt = buildGroup$1(inrow[c$6], options); if (depth < elt.depth) { depth = elt.depth; } if (height < elt.height) { height = elt.height; } - outrow[c$7] = elt; + outrow[c$6] = elt; } - var rowGap = group.rowGaps[r$10]; + var rowGap = group.rowGaps[r$9]; var gap = 0; if (rowGap) { gap = calculateSize(rowGap, options); @@ -129806,8 +130010,8 @@ var init_katex = __esmMin((() => { totalHeight += height; outrow.pos = totalHeight; totalHeight += depth + gap; - body[r$10] = outrow; - setHLinePos(hLinesBeforeRow[r$10 + 1]); + body[r$9] = outrow; + setHLinePos(hLinesBeforeRow[r$9 + 1]); } var offset = totalHeight / 2 + options.fontMetrics().axisHeight; var colDescriptions = group.cols || []; @@ -129816,10 +130020,10 @@ var init_katex = __esmMin((() => { var colDescrNum; var tagSpans = []; if (group.tags && group.tags.some((tag$1) => tag$1)) { - for (r$10 = 0; r$10 < nr; ++r$10) { - var rw = body[r$10]; + for (r$9 = 0; r$9 < nr; ++r$9) { + var rw = body[r$9]; var shift = rw.pos - offset; - var tag = group.tags[r$10]; + var tag = group.tags[r$9]; var tagSpan = void 0; if (tag === true) { tagSpan = buildCommon.makeSpan(["eqn-num"], [], options); @@ -129837,7 +130041,7 @@ var init_katex = __esmMin((() => { }); } } - for (c$7 = 0, colDescrNum = 0; c$7 < nc || colDescrNum < colDescriptions.length; ++c$7, ++colDescrNum) { + for (c$6 = 0, colDescrNum = 0; c$6 < nc || colDescrNum < colDescriptions.length; ++c$6, ++colDescrNum) { var colDescr = colDescriptions[colDescrNum] || {}; var firstSeparator = true; while (colDescr.type === "separator") { @@ -129865,11 +130069,11 @@ var init_katex = __esmMin((() => { colDescr = colDescriptions[colDescrNum] || {}; firstSeparator = false; } - if (c$7 >= nc) { + if (c$6 >= nc) { continue; } var sepwidth = void 0; - if (c$7 > 0 || group.hskipBeforeAndAfter) { + if (c$6 > 0 || group.hskipBeforeAndAfter) { sepwidth = utils.deflt(colDescr.pregap, arraycolsep); if (sepwidth !== 0) { colSep = buildCommon.makeSpan(["arraycolsep"], []); @@ -129878,9 +130082,9 @@ var init_katex = __esmMin((() => { } } var col = []; - for (r$10 = 0; r$10 < nr; ++r$10) { - var row = body[r$10]; - var elem = row[c$7]; + for (r$9 = 0; r$9 < nr; ++r$9) { + var row = body[r$9]; + var elem = row[c$6]; if (!elem) { continue; } @@ -129899,7 +130103,7 @@ var init_katex = __esmMin((() => { }, options); col = buildCommon.makeSpan(["col-align-" + (colDescr.align || "c")], [col]); cols.push(col); - if (c$7 < nc - 1 || group.hskipBeforeAndAfter) { + if (c$6 < nc - 1 || group.hskipBeforeAndAfter) { sepwidth = utils.deflt(colDescr.postgap, arraycolsep); if (sepwidth !== 0) { colSep = buildCommon.makeSpan(["arraycolsep"], []); @@ -130629,14 +130833,14 @@ var init_katex = __esmMin((() => { } denomShift = options.fontMetrics().denom2; } - var frac$2; + var frac; if (!rule) { var candidateClearance = numShift - numerm.depth - (denomm.height - denomShift); if (candidateClearance < clearance) { numShift += .5 * (clearance - candidateClearance); denomShift += .5 * (clearance - candidateClearance); } - frac$2 = buildCommon.makeVList({ + frac = buildCommon.makeVList({ positionType: "individualShift", children: [{ type: "elem", @@ -130657,7 +130861,7 @@ var init_katex = __esmMin((() => { denomShift += clearance - (axisHeight - .5 * ruleWidth - (denomm.height - denomShift)); } var midShift = -(axisHeight - .5 * ruleWidth); - frac$2 = buildCommon.makeVList({ + frac = buildCommon.makeVList({ positionType: "individualShift", children: [ { @@ -130679,8 +130883,8 @@ var init_katex = __esmMin((() => { }, options); } newOptions = options.havingStyle(style); - frac$2.height *= newOptions.sizeMultiplier / options.sizeMultiplier; - frac$2.depth *= newOptions.sizeMultiplier / options.sizeMultiplier; + frac.height *= newOptions.sizeMultiplier / options.sizeMultiplier; + frac.depth *= newOptions.sizeMultiplier / options.sizeMultiplier; var delimSize; if (style.size === Style$1.DISPLAY.size) { delimSize = options.fontMetrics().delim1; @@ -130705,7 +130909,7 @@ var init_katex = __esmMin((() => { } return buildCommon.makeSpan(["mord"].concat(newOptions.sizingClasses(options)), [ leftDelim, - buildCommon.makeSpan(["mfrac"], [frac$2]), + buildCommon.makeSpan(["mfrac"], [frac]), rightDelim ], options); }; @@ -131183,14 +131387,14 @@ var init_katex = __esmMin((() => { } var chars = []; for (var i$7 = 0; i$7 < href.length; i$7++) { - var c$7 = href[i$7]; - if (c$7 === "~") { - c$7 = "\\textasciitilde"; + var c$6 = href[i$7]; + if (c$6 === "~") { + c$6 = "\\textasciitilde"; } chars.push({ type: "textord", mode: "text", - text: c$7 + text: c$6 }); } var body = { @@ -131556,8 +131760,8 @@ var init_katex = __esmMin((() => { } else { inner$1 = buildCommon.makeSpan(["inner"], [buildGroup$1(group.body, options)]); } - var fix$1 = buildCommon.makeSpan(["fix"], []); - var node = buildCommon.makeSpan([group.alignment], [inner$1, fix$1], options); + var fix = buildCommon.makeSpan(["fix"], []); + var node = buildCommon.makeSpan([group.alignment], [inner$1, fix], options); var strut = buildCommon.makeSpan(["strut"]); strut.style.height = makeEm(node.height + node.depth); if (node.depth) { @@ -131862,11 +132066,11 @@ var init_katex = __esmMin((() => { node = new MathNode("mo", buildExpression(group.body, options)); } else { node = new MathNode("mi", [new TextNode(group.name.slice(1))]); - var operator$1 = new MathNode("mo", [makeText("⁡", "text")]); + var operator = new MathNode("mo", [makeText("⁡", "text")]); if (group.parentIsSupSub) { - node = new MathNode("mrow", [node, operator$1]); + node = new MathNode("mrow", [node, operator]); } else { - node = newDocumentFragment([node, operator$1]); + node = newDocumentFragment([node, operator]); } } return node; @@ -132156,13 +132360,13 @@ var init_katex = __esmMin((() => { var word = expression.map((node$1) => node$1.toText()).join(""); expression = [new mathMLTree.TextNode(word)]; } - var identifier$1 = new mathMLTree.MathNode("mi", expression); - identifier$1.setAttribute("mathvariant", "normal"); - var operator$1 = new mathMLTree.MathNode("mo", [makeText("⁡", "text")]); + var identifier = new mathMLTree.MathNode("mi", expression); + identifier.setAttribute("mathvariant", "normal"); + var operator = new mathMLTree.MathNode("mo", [makeText("⁡", "text")]); if (group.parentIsSupSub) { - return new mathMLTree.MathNode("mrow", [identifier$1, operator$1]); + return new mathMLTree.MathNode("mrow", [identifier, operator]); } else { - return mathMLTree.newDocumentFragment([identifier$1, operator$1]); + return mathMLTree.newDocumentFragment([identifier, operator]); } }; defineFunction({ @@ -132238,9 +132442,9 @@ var init_katex = __esmMin((() => { return buildCommon.makeSpan(["mord", "overline"], [vlist], options); }, mathmlBuilder(group, options) { - var operator$1 = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode("‾")]); - operator$1.setAttribute("stretchy", "true"); - var node = new mathMLTree.MathNode("mover", [buildGroup(group.body, options), operator$1]); + var operator = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode("‾")]); + operator.setAttribute("stretchy", "true"); + var node = new mathMLTree.MathNode("mover", [buildGroup(group.body, options), operator]); node.setAttribute("accent", "true"); return node; } @@ -132332,8 +132536,8 @@ var init_katex = __esmMin((() => { }, htmlBuilder: (group, options) => { var inner$1 = buildCommon.makeSpan(["inner"], [buildGroup$1(group.body, options.withPhantom())]); - var fix$1 = buildCommon.makeSpan(["fix"], []); - return buildCommon.makeSpan(["mord", "rlap"], [inner$1, fix$1], options); + var fix = buildCommon.makeSpan(["fix"], []); + return buildCommon.makeSpan(["mord", "rlap"], [inner$1, fix], options); }, mathmlBuilder: (group, options) => { var inner$1 = buildExpression(ordargument(group.body), options); @@ -133133,9 +133337,9 @@ var init_katex = __esmMin((() => { return buildCommon.makeSpan(["mord", "underline"], [vlist], options); }, mathmlBuilder(group, options) { - var operator$1 = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode("‾")]); - operator$1.setAttribute("stretchy", "true"); - var node = new mathMLTree.MathNode("munder", [buildGroup(group.body, options), operator$1]); + var operator = new mathMLTree.MathNode("mo", [new mathMLTree.TextNode("‾")]); + operator.setAttribute("stretchy", "true"); + var node = new mathMLTree.MathNode("munder", [buildGroup(group.body, options), operator]); node.setAttribute("accentunder", "true"); return node; } @@ -133188,11 +133392,11 @@ var init_katex = __esmMin((() => { var body = []; var newOptions = options.havingStyle(options.style.text()); for (var i$7 = 0; i$7 < text$2.length; i$7++) { - var c$7 = text$2[i$7]; - if (c$7 === "~") { - c$7 = "\\textasciitilde"; + var c$6 = text$2[i$7]; + if (c$6 === "~") { + c$6 = "\\textasciitilde"; } - body.push(buildCommon.makeSymbol(c$7, "Typewriter-Regular", group.mode, newOptions, ["mord", "texttt"])); + body.push(buildCommon.makeSymbol(c$6, "Typewriter-Regular", group.mode, newOptions, ["mord", "texttt"])); } return buildCommon.makeSpan(["mord", "text"].concat(newOptions.sizingClasses(options)), buildCommon.tryCombineChars(body), newOptions); }, @@ -135302,15 +135506,15 @@ var init_katex = __esmMin((() => { /** * Parses a group when the mode is changing. */ - parseGroupOfType(name, type, optional$2) { + parseGroupOfType(name, type, optional) { switch (type) { - case "color": return this.parseColorGroup(optional$2); - case "size": return this.parseSizeGroup(optional$2); - case "url": return this.parseUrlGroup(optional$2); + case "color": return this.parseColorGroup(optional); + case "size": return this.parseSizeGroup(optional); + case "url": return this.parseUrlGroup(optional); case "math": - case "text": return this.parseArgumentGroup(optional$2, type); + case "text": return this.parseArgumentGroup(optional, type); case "hbox": { - var group = this.parseArgumentGroup(optional$2, "text"); + var group = this.parseArgumentGroup(optional, "text"); return group != null ? { type: "styling", mode: group.mode, @@ -135319,7 +135523,7 @@ var init_katex = __esmMin((() => { } : null; } case "raw": { - var token = this.parseStringGroup("raw", optional$2); + var token = this.parseStringGroup("raw", optional); return token != null ? { type: "raw", mode: "text", @@ -135327,7 +135531,7 @@ var init_katex = __esmMin((() => { } : null; } case "primitive": { - if (optional$2) { + if (optional) { throw new ParseError("A primitive argument cannot be optional"); } var _group2 = this.parseGroup(name); @@ -135338,7 +135542,7 @@ var init_katex = __esmMin((() => { } case "original": case null: - case undefined: return this.parseArgumentGroup(optional$2); + case undefined: return this.parseArgumentGroup(optional); default: throw new ParseError("Unknown group type as " + name, this.fetch()); } } @@ -135354,8 +135558,8 @@ var init_katex = __esmMin((() => { * Parses a group, essentially returning the string formed by the * brace-enclosed tokens plus some position information. */ - parseStringGroup(modeName, optional$2) { - var argToken = this.gullet.scanArgument(optional$2); + parseStringGroup(modeName, optional) { + var argToken = this.gullet.scanArgument(optional); if (argToken == null) { return null; } @@ -135392,8 +135596,8 @@ var init_katex = __esmMin((() => { /** * Parses a color description. */ - parseColorGroup(optional$2) { - var res = this.parseStringGroup("color", optional$2); + parseColorGroup(optional) { + var res = this.parseStringGroup("color", optional); if (res == null) { return null; } @@ -135414,19 +135618,19 @@ var init_katex = __esmMin((() => { /** * Parses a size specification, consisting of magnitude and unit. */ - parseSizeGroup(optional$2) { + parseSizeGroup(optional) { var res; var isBlank = false; this.gullet.consumeSpaces(); - if (!optional$2 && this.gullet.future().text !== "{") { + if (!optional && this.gullet.future().text !== "{") { res = this.parseRegexGroup(/^[-+]? *(?:$|\d+|\d+\.\d*|\.\d*) *[a-z]{0,2} *$/, "size"); } else { - res = this.parseStringGroup("size", optional$2); + res = this.parseStringGroup("size", optional); } if (!res) { return null; } - if (!optional$2 && res.text.length === 0) { + if (!optional && res.text.length === 0) { res.text = "0pt"; isBlank = true; } @@ -135452,10 +135656,10 @@ var init_katex = __esmMin((() => { * Parses an URL, checking escaped letters and allowed protocols, * and setting the catcode of % as an active character (as in \hyperref). */ - parseUrlGroup(optional$2) { + parseUrlGroup(optional) { this.gullet.lexer.setCatcode("%", 13); this.gullet.lexer.setCatcode("~", 12); - var res = this.parseStringGroup("url", optional$2); + var res = this.parseStringGroup("url", optional); this.gullet.lexer.setCatcode("%", 14); this.gullet.lexer.setCatcode("~", 13); if (res == null) { @@ -135471,8 +135675,8 @@ var init_katex = __esmMin((() => { /** * Parses an argument with the mode specified. */ - parseArgumentGroup(optional$2, mode) { - var argToken = this.gullet.scanArgument(optional$2); + parseArgumentGroup(optional, mode) { + var argToken = this.gullet.scanArgument(optional); if (argToken == null) { return null; } @@ -135733,12 +135937,12 @@ var init_katex = __esmMin((() => { var settings = new Settings(options); return parseTree(expression, settings); }; - renderError = function renderError$1(error$2, expression, options) { - if (options.throwOnError || !(error$2 instanceof ParseError)) { - throw error$2; + renderError = function renderError$1(error, expression, options) { + if (options.throwOnError || !(error instanceof ParseError)) { + throw error; } var node = buildCommon.makeSpan(["katex-error"], [new SymbolNode(expression)]); - node.setAttribute("title", error$2.toString()); + node.setAttribute("title", error.toString()); node.setAttribute("style", "color:" + options.errorColor); return node; }; @@ -135747,8 +135951,8 @@ var init_katex = __esmMin((() => { try { var tree = parseTree(expression, settings); return buildTree(tree, expression, settings); - } catch (error$2) { - return renderError(error$2, expression, settings); + } catch (error) { + return renderError(error, expression, settings); } }; renderToHTMLTree = function renderToHTMLTree$1(expression, options) { @@ -135756,11 +135960,11 @@ var init_katex = __esmMin((() => { try { var tree = parseTree(expression, settings); return buildHTMLTree(tree, expression, settings); - } catch (error$2) { - return renderError(error$2, expression, settings); + } catch (error) { + return renderError(error, expression, settings); } }; - version$2 = "0.16.27"; + version = "0.16.27"; __domTree = { Span, Anchor, @@ -135770,7 +135974,7 @@ var init_katex = __esmMin((() => { LineNode }; katex = { - version: version$2, + version, render, renderToString, ParseError, @@ -135815,11 +136019,11 @@ function L() { function G(l$3) { T = l$3; } -function d$1(l$3, e$10 = "") { +function d(l$3, e$10 = "") { let t$6 = typeof l$3 == "string" ? l$3 : l$3.source, n$9 = { - replace: (r$10, i$7) => { + replace: (r$9, i$7) => { let s$5 = typeof i$7 == "string" ? i$7 : i$7.source; - return s$5 = s$5.replace(m.caret, "$1"), t$6 = t$6.replace(r$10, s$5), n$9; + return s$5 = s$5.replace(m.caret, "$1"), t$6 = t$6.replace(r$9, s$5), n$9; }, getRegex: () => new RegExp(t$6, e$10) }; @@ -135844,23 +136048,23 @@ function V(l$3, e$10) { let o$10 = !1, p$3 = s$5; for (; --p$3 >= 0 && a$2[p$3] === "\\";) o$10 = !o$10; return o$10 ? "|" : " |"; - }), n$9 = t$6.split(m.splitPipe), r$10 = 0; + }), n$9 = t$6.split(m.splitPipe), r$9 = 0; if (n$9[0].trim() || n$9.shift(), n$9.length > 0 && !n$9.at(-1)?.trim() && n$9.pop(), e$10) if (n$9.length > e$10) n$9.splice(e$10); else for (; n$9.length < e$10;) n$9.push(""); - for (; r$10 < n$9.length; r$10++) n$9[r$10] = n$9[r$10].trim().replace(m.slashPipe, "|"); + for (; r$9 < n$9.length; r$9++) n$9[r$9] = n$9[r$9].trim().replace(m.slashPipe, "|"); return n$9; } function z(l$3, e$10, t$6) { let n$9 = l$3.length; if (n$9 === 0) return ""; - let r$10 = 0; - for (; r$10 < n$9;) { - let i$7 = l$3.charAt(n$9 - r$10 - 1); - if (i$7 === e$10 && !t$6) r$10++; - else if (i$7 !== e$10 && t$6) r$10++; + let r$9 = 0; + for (; r$9 < n$9;) { + let i$7 = l$3.charAt(n$9 - r$9 - 1); + if (i$7 === e$10 && !t$6) r$9++; + else if (i$7 !== e$10 && t$6) r$9++; else break; } - return l$3.slice(0, n$9 - r$10); + return l$3.slice(0, n$9 - r$9); } function fe(l$3, e$10) { if (l$3.indexOf(e$10[1]) === -1) return -1; @@ -135870,8 +136074,8 @@ function fe(l$3, e$10) { else if (l$3[n$9] === e$10[1] && (t$6--, t$6 < 0)) return n$9; return t$6 > 0 ? -2 : -1; } -function me(l$3, e$10, t$6, n$9, r$10) { - let i$7 = e$10.href, s$5 = e$10.title || null, a$2 = l$3[1].replace(r$10.other.outputLinkReplace, "$1"); +function me(l$3, e$10, t$6, n$9, r$9) { + let i$7 = e$10.href, s$5 = e$10.title || null, a$2 = l$3[1].replace(r$9.other.outputLinkReplace, "$1"); n$9.state.inLink = !0; let o$10 = { type: l$3[0].charAt(0) === "!" ? "image" : "link", @@ -135886,20 +136090,20 @@ function me(l$3, e$10, t$6, n$9, r$10) { function Ye(l$3, e$10, t$6) { let n$9 = l$3.match(t$6.other.indentCodeCompensation); if (n$9 === null) return e$10; - let r$10 = n$9[1]; + let r$9 = n$9[1]; return e$10.split(` `).map((i$7) => { let s$5 = i$7.match(t$6.other.beginningSpace); if (s$5 === null) return i$7; let [a$2] = s$5; - return a$2.length >= r$10.length ? i$7.slice(r$10.length) : i$7; + return a$2.length >= r$9.length ? i$7.slice(r$9.length) : i$7; }).join(` `); } function k(l$3, e$10) { return _.parse(l$3, e$10); } -var T, E, be, m, Re, Te, Oe, I, we, F, ie, oe, ye, j, Pe, Q, Se, $e, v, U, _e, ae, Le, K, re, Me, ze, Ae, Ee, le, Ie, D, W, ue, Ce, pe, Be, qe, ve, ce, De, He, he, Ze, Ge, Ne, Fe, je, Qe, Ue, q$1, Ke, de, ke, We, se, X$1, Xe, N, Je, C, M, Ve, ge, y, x$1, P, $$1, b, S, B, _, Zt, Gt, Nt, Ft, jt, Qt, Ut, Kt; +var T, E, be, m, Re, Te, Oe, I, we, F, ie, oe, ye, j, Pe, Q, Se, $e, v, U, _e, ae, Le, K, re, Me, ze, Ae, Ee, le, Ie, D, W, ue, Ce, pe, Be, qe, ve, ce, De, He, he, Ze, Ge, Ne, Fe, je, Qe, Ue, q, Ke, de, ke, We, se, X$1, Xe, N, Je, C, M, Ve, ge, y, x$1, P, $$1, b, S, B, _, Zt, Gt, Nt, Ft, jt, Qt, Ut, Kt; var init_marked_esm = __esmMin((() => { T = L(); E = { exec: () => null }; @@ -135966,7 +136170,7 @@ var init_marked_esm = __esmMin((() => { fencesBeginRegex: (l$3) => new RegExp(`^ {0,${Math.min(3, l$3 - 1)}}(?:\`\`\`|~~~)`), headingBeginRegex: (l$3) => new RegExp(`^ {0,${Math.min(3, l$3 - 1)}}#`), htmlBeginRegex: (l$3) => new RegExp(`^ {0,${Math.min(3, l$3 - 1)}}<(?:[a-z].*>|!--)`, "i") - }, Re = /^(?:[ \t]*(?:\n|$))+/, Te = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, Oe = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, I = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, we = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, F = /(?:[*+-]|\d{1,9}[.)])/, ie = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, oe = d$1(ie).replace(/bull/g, F).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), ye = d$1(ie).replace(/bull/g, F).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), j = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, Pe = /^[^\n]+/, Q = /(?!\s*\])(?:\\[\s\S]|[^\[\]\\])+/, Se = d$1(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Q).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), $e = d$1(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, F).getRegex(), v = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", U = /|$))/, _e = d$1("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", U).replace("tag", v).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), ae = d$1(j).replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex(), Le = d$1(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", ae).getRegex(), K = { + }, Re = /^(?:[ \t]*(?:\n|$))+/, Te = /^((?: {4}| {0,3}\t)[^\n]+(?:\n(?:[ \t]*(?:\n|$))*)?)+/, Oe = /^ {0,3}(`{3,}(?=[^`\n]*(?:\n|$))|~{3,})([^\n]*)(?:\n|$)(?:|([\s\S]*?)(?:\n|$))(?: {0,3}\1[~`]* *(?=\n|$)|$)/, I = /^ {0,3}((?:-[\t ]*){3,}|(?:_[ \t]*){3,}|(?:\*[ \t]*){3,})(?:\n+|$)/, we = /^ {0,3}(#{1,6})(?=\s|$)(.*)(?:\n+|$)/, F = /(?:[*+-]|\d{1,9}[.)])/, ie = /^(?!bull |blockCode|fences|blockquote|heading|html|table)((?:.|\n(?!\s*?\n|bull |blockCode|fences|blockquote|heading|html|table))+?)\n {0,3}(=+|-+) *(?:\n+|$)/, oe = d(ie).replace(/bull/g, F).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/\|table/g, "").getRegex(), ye = d(ie).replace(/bull/g, F).replace(/blockCode/g, /(?: {4}| {0,3}\t)/).replace(/fences/g, / {0,3}(?:`{3,}|~{3,})/).replace(/blockquote/g, / {0,3}>/).replace(/heading/g, / {0,3}#{1,6}/).replace(/html/g, / {0,3}<[^\n>]+>\n/).replace(/table/g, / {0,3}\|?(?:[:\- ]*\|)+[\:\- ]*\n/).getRegex(), j = /^([^\n]+(?:\n(?!hr|heading|lheading|blockquote|fences|list|html|table| +\n)[^\n]+)*)/, Pe = /^[^\n]+/, Q = /(?!\s*\])(?:\\[\s\S]|[^\[\]\\])+/, Se = d(/^ {0,3}\[(label)\]: *(?:\n[ \t]*)?([^<\s][^\s]*|<.*?>)(?:(?: +(?:\n[ \t]*)?| *\n[ \t]*)(title))? *(?:\n+|$)/).replace("label", Q).replace("title", /(?:"(?:\\"?|[^"\\])*"|'[^'\n]*(?:\n[^'\n]+)*\n?'|\([^()]*\))/).getRegex(), $e = d(/^( {0,3}bull)([ \t][^\n]+?)?(?:\n|$)/).replace(/bull/g, F).getRegex(), v = "address|article|aside|base|basefont|blockquote|body|caption|center|col|colgroup|dd|details|dialog|dir|div|dl|dt|fieldset|figcaption|figure|footer|form|frame|frameset|h[1-6]|head|header|hr|html|iframe|legend|li|link|main|menu|menuitem|meta|nav|noframes|ol|optgroup|option|p|param|search|section|summary|table|tbody|td|tfoot|th|thead|title|tr|track|ul", U = /|$))/, _e = d("^ {0,3}(?:<(script|pre|style|textarea)[\\s>][\\s\\S]*?(?:[^\\n]*\\n+|$)|comment[^\\n]*(\\n+|$)|<\\?[\\s\\S]*?(?:\\?>\\n*|$)|\\n*|$)|\\n*|$)|)[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|<(?!script|pre|style|textarea)([a-z][\\w-]*)(?:attribute)*? */?>(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$)|(?=[ \\t]*(?:\\n|$))[\\s\\S]*?(?:(?:\\n[ ]*)+\\n|$))", "i").replace("comment", U).replace("tag", v).replace("attribute", / +[a-zA-Z:_][\w.:-]*(?: *= *"[^"\n]*"| *= *'[^'\n]*'| *= *[^\s"'=<>`]+)?/).getRegex(), ae = d(j).replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("|table", "").replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex(), Le = d(/^( {0,3}> ?(paragraph|[^\n]*)(?:\n|$))+/).replace("paragraph", ae).getRegex(), K = { blockquote: Le, code: Te, def: Se, @@ -135980,21 +136184,21 @@ var init_marked_esm = __esmMin((() => { paragraph: ae, table: E, text: Pe - }, re = d$1("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex(), Me = { + }, re = d("^ *([^\\n ].*)\\n {0,3}((?:\\| *)?:?-+:? *(?:\\| *:?-+:? *)*(?:\\| *)?)(?:\\n((?:(?! *\\n|hr|heading|blockquote|code|fences|list|html).*(?:\\n|$))*)\\n*|$)").replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("blockquote", " {0,3}>").replace("code", "(?: {4}| {0,3} )[^\\n]").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex(), Me = { ...K, lheading: ye, table: re, - paragraph: d$1(j).replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", re).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex() + paragraph: d(j).replace("hr", I).replace("heading", " {0,3}#{1,6}(?:\\s|$)").replace("|lheading", "").replace("table", re).replace("blockquote", " {0,3}>").replace("fences", " {0,3}(?:`{3,}(?=[^`\\n]*\\n)|~{3,})[^\\n]*\\n").replace("list", " {0,3}(?:[*+-]|1[.)]) ").replace("html", ")|<(?:script|pre|style|textarea|!--)").replace("tag", v).getRegex() }, ze = { ...K, - html: d$1(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", U).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(), + html: d(`^ *(?:comment *(?:\\n|\\s*$)|<(tag)[\\s\\S]+? *(?:\\n{2,}|\\s*$)|\\s]*)*?/?> *(?:\\n{2,}|\\s*$))`).replace("comment", U).replace(/tag/g, "(?!(?:a|em|strong|small|s|cite|q|dfn|abbr|data|time|code|var|samp|kbd|sub|sup|i|b|u|mark|ruby|rt|rp|bdi|bdo|span|br|wbr|ins|del|img)\\b)\\w+(?!:|[^\\w\\s@]*@)\\b").getRegex(), def: /^ *\[([^\]]+)\]: *]+)>?(?: +(["(][^\n]+[")]))? *(?:\n+|$)/, heading: /^(#{1,6})(.*)(?:\n+|$)/, fences: E, lheading: /^(.+?)\n {0,3}(=+|-+) *(?:\n+|$)/, - paragraph: d$1(j).replace("hr", I).replace("heading", ` *#{1,6} *[^ + paragraph: d(j).replace("hr", I).replace("heading", ` *#{1,6} *[^ ]`).replace("lheading", oe).replace("|table", "").replace("blockquote", " {0,3}>").replace("|fences", "").replace("|list", "").replace("|html", "").replace("|tag", "").getRegex() - }, Ae = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, Ee = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, le = /^( {2,}|\\)\n(?!\s*$)/, Ie = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\`+)[^`]+\k(?!`))*?\]\((?:\\[\s\S]|[^\\\(\)]|\((?:\\[\s\S]|[^\\\(\)])*\))*\)/).replace("precode-", be ? "(?`+)[^`]+\k(?!`)/).replace("html", /<(?! )[^<>]*?>/).getRegex(), ce = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, De = d$1(ce, "u").replace(/punct/g, D).getRegex(), He = d$1(ce, "u").replace(/punct/g, pe).getRegex(), he = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", Ze = d$1(he, "gu").replace(/notPunctSpace/g, ue).replace(/punctSpace/g, W).replace(/punct/g, D).getRegex(), Ge = d$1(he, "gu").replace(/notPunctSpace/g, qe).replace(/punctSpace/g, Be).replace(/punct/g, pe).getRegex(), Ne = d$1("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, ue).replace(/punctSpace/g, W).replace(/punct/g, D).getRegex(), Fe = d$1(/\\(punct)/, "gu").replace(/punct/g, D).getRegex(), je = d$1(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), Qe = d$1(U).replace("(?:-->|$)", "-->").getRegex(), Ue = d$1("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment", Qe).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), q$1 = /(?:\[(?:\\[\s\S]|[^\[\]\\])*\]|\\[\s\S]|`+[^`]*?`+(?!`)|[^\[\]\\`])*?/, Ke = d$1(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", q$1).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), de = d$1(/^!?\[(label)\]\[(ref)\]/).replace("label", q$1).replace("ref", Q).getRegex(), ke = d$1(/^!?\[(ref)\](?:\[\])?/).replace("ref", Q).getRegex(), We = d$1("reflink|nolink(?!\\()", "g").replace("reflink", de).replace("nolink", ke).getRegex(), se = /[hH][tT][tT][pP][sS]?|[fF][tT][pP]/, X$1 = { + }, Ae = /^\\([!"#$%&'()*+,\-./:;<=>?@\[\]\\^_`{|}~])/, Ee = /^(`+)([^`]|[^`][\s\S]*?[^`])\1(?!`)/, le = /^( {2,}|\\)\n(?!\s*$)/, Ie = /^(`+|[^`])(?:(?= {2,}\n)|[\s\S]*?(?:(?=[\\`+)[^`]+\k(?!`))*?\]\((?:\\[\s\S]|[^\\\(\)]|\((?:\\[\s\S]|[^\\\(\)])*\))*\)/).replace("precode-", be ? "(?`+)[^`]+\k(?!`)/).replace("html", /<(?! )[^<>]*?>/).getRegex(), ce = /^(?:\*+(?:((?!\*)punct)|[^\s*]))|^_+(?:((?!_)punct)|([^\s_]))/, De = d(ce, "u").replace(/punct/g, D).getRegex(), He = d(ce, "u").replace(/punct/g, pe).getRegex(), he = "^[^_*]*?__[^_*]*?\\*[^_*]*?(?=__)|[^*]+(?=[^*])|(?!\\*)punct(\\*+)(?=[\\s]|$)|notPunctSpace(\\*+)(?!\\*)(?=punctSpace|$)|(?!\\*)punctSpace(\\*+)(?=notPunctSpace)|[\\s](\\*+)(?!\\*)(?=punct)|(?!\\*)punct(\\*+)(?!\\*)(?=punct)|notPunctSpace(\\*+)(?=notPunctSpace)", Ze = d(he, "gu").replace(/notPunctSpace/g, ue).replace(/punctSpace/g, W).replace(/punct/g, D).getRegex(), Ge = d(he, "gu").replace(/notPunctSpace/g, qe).replace(/punctSpace/g, Be).replace(/punct/g, pe).getRegex(), Ne = d("^[^_*]*?\\*\\*[^_*]*?_[^_*]*?(?=\\*\\*)|[^_]+(?=[^_])|(?!_)punct(_+)(?=[\\s]|$)|notPunctSpace(_+)(?!_)(?=punctSpace|$)|(?!_)punctSpace(_+)(?=notPunctSpace)|[\\s](_+)(?!_)(?=punct)|(?!_)punct(_+)(?!_)(?=punct)", "gu").replace(/notPunctSpace/g, ue).replace(/punctSpace/g, W).replace(/punct/g, D).getRegex(), Fe = d(/\\(punct)/, "gu").replace(/punct/g, D).getRegex(), je = d(/^<(scheme:[^\s\x00-\x1f<>]*|email)>/).replace("scheme", /[a-zA-Z][a-zA-Z0-9+.-]{1,31}/).replace("email", /[a-zA-Z0-9.!#$%&'*+/=?^_`{|}~-]+(@)[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)+(?![-_])/).getRegex(), Qe = d(U).replace("(?:-->|$)", "-->").getRegex(), Ue = d("^comment|^|^<[a-zA-Z][\\w-]*(?:attribute)*?\\s*/?>|^<\\?[\\s\\S]*?\\?>|^|^").replace("comment", Qe).replace("attribute", /\s+[a-zA-Z:_][\w.:-]*(?:\s*=\s*"[^"]*"|\s*=\s*'[^']*'|\s*=\s*[^\s"'=<>`]+)?/).getRegex(), q = /(?:\[(?:\\[\s\S]|[^\[\]\\])*\]|\\[\s\S]|`+[^`]*?`+(?!`)|[^\[\]\\`])*?/, Ke = d(/^!?\[(label)\]\(\s*(href)(?:(?:[ \t]*(?:\n[ \t]*)?)(title))?\s*\)/).replace("label", q).replace("href", /<(?:\\.|[^\n<>\\])+>|[^ \t\n\x00-\x1f]*/).replace("title", /"(?:\\"?|[^"\\])*"|'(?:\\'?|[^'\\])*'|\((?:\\\)?|[^)\\])*\)/).getRegex(), de = d(/^!?\[(label)\]\[(ref)\]/).replace("label", q).replace("ref", Q).getRegex(), ke = d(/^!?\[(ref)\](?:\[\])?/).replace("ref", Q).getRegex(), We = d("reflink|nolink(?!\\()", "g").replace("reflink", de).replace("nolink", ke).getRegex(), se = /[hH][tT][tT][pP][sS]?|[fF][tT][pP]/, X$1 = { _backpedal: E, anyPunctuation: Fe, autolink: je, @@ -136016,20 +136220,20 @@ var init_marked_esm = __esmMin((() => { url: E }, Xe = { ...X$1, - link: d$1(/^!?\[(label)\]\((.*?)\)/).replace("label", q$1).getRegex(), - reflink: d$1(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label", q$1).getRegex() + link: d(/^!?\[(label)\]\((.*?)\)/).replace("label", q).getRegex(), + reflink: d(/^!?\[(label)\]\s*\[([^\]]*)\]/).replace("label", q).getRegex() }, N = { ...X$1, emStrongRDelimAst: Ge, emStrongLDelim: He, - url: d$1(/^((?:protocol):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/).replace("protocol", se).replace("email", /[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(), + url: d(/^((?:protocol):\/\/|www\.)(?:[a-zA-Z0-9\-]+\.?)+[^\s<]*|^email/).replace("protocol", se).replace("email", /[A-Za-z0-9._+-]+(@)[a-zA-Z0-9-_]+(?:\.[a-zA-Z0-9-_]*[a-zA-Z0-9])+(?![-_])/).getRegex(), _backpedal: /(?:[^?!.,:;*_'"~()&]+|\([^)]*\)|&(?![a-zA-Z0-9]+;$)|[?!.,:;*_'"~)]+(?!$))+/, del: /^(~~?)(?=[^\s~])((?:\\[\s\S]|[^\\])*?(?:\\[\s\S]|[^\s~\\]))\1(?=[^~]|$)/, - text: d$1(/^([`~]+|[^`~])(?:(?= {2,}\n)|(?=[a-zA-Z0-9.!#$%&'*+\/=?_`{\|}~-]+@)|[\s\S]*?(?:(?=[\\ { fences(e$10) { let t$6 = this.rules.block.fences.exec(e$10); if (t$6) { - let n$9 = t$6[0], r$10 = Ye(n$9, t$6[3] || "", this.rules); + let n$9 = t$6[0], r$9 = Ye(n$9, t$6[3] || "", this.rules); return { type: "code", raw: n$9, lang: t$6[2] ? t$6[2].trim().replace(this.rules.inline.anyPunctuation, "$1") : t$6[2], - text: r$10 + text: r$9 }; } } @@ -136091,8 +136295,8 @@ var init_marked_esm = __esmMin((() => { if (t$6) { let n$9 = t$6[2].trim(); if (this.rules.other.endingHash.test(n$9)) { - let r$10 = z(n$9, "#"); - (this.options.pedantic || !r$10 || this.rules.other.endingSpaceChar.test(r$10)) && (n$9 = r$10.trim()); + let r$9 = z(n$9, "#"); + (this.options.pedantic || !r$9 || this.rules.other.endingSpaceChar.test(r$9)) && (n$9 = r$9.trim()); } return { type: "heading", @@ -136116,7 +136320,7 @@ var init_marked_esm = __esmMin((() => { if (t$6) { let n$9 = z(t$6[0], ` `).split(` -`), r$10 = "", i$7 = "", s$5 = []; +`), r$9 = "", i$7 = "", s$5 = []; for (; n$9.length > 0;) { let a$2 = !1, o$10 = [], p$3; for (p$3 = 0; p$3 < n$9.length; p$3++) if (this.rules.other.blockquoteStart.test(n$9[p$3])) o$10.push(n$9[p$3]), a$2 = !0; @@ -136124,33 +136328,33 @@ var init_marked_esm = __esmMin((() => { else break; n$9 = n$9.slice(p$3); let u$4 = o$10.join(` -`), c$7 = u$4.replace(this.rules.other.blockquoteSetextReplace, ` +`), c$6 = u$4.replace(this.rules.other.blockquoteSetextReplace, ` $1`).replace(this.rules.other.blockquoteSetextReplace2, ""); - r$10 = r$10 ? `${r$10} + r$9 = r$9 ? `${r$9} ${u$4}` : u$4, i$7 = i$7 ? `${i$7} -${c$7}` : c$7; +${c$6}` : c$6; let g$1 = this.lexer.state.top; - if (this.lexer.state.top = !0, this.lexer.blockTokens(c$7, s$5, !0), this.lexer.state.top = g$1, n$9.length === 0) break; + if (this.lexer.state.top = !0, this.lexer.blockTokens(c$6, s$5, !0), this.lexer.state.top = g$1, n$9.length === 0) break; let h$5 = s$5.at(-1); if (h$5?.type === "code") break; if (h$5?.type === "blockquote") { let R$1 = h$5, f$4 = R$1.raw + ` ` + n$9.join(` `), O = this.blockquote(f$4); - s$5[s$5.length - 1] = O, r$10 = r$10.substring(0, r$10.length - R$1.raw.length) + O.raw, i$7 = i$7.substring(0, i$7.length - R$1.text.length) + O.text; + s$5[s$5.length - 1] = O, r$9 = r$9.substring(0, r$9.length - R$1.raw.length) + O.raw, i$7 = i$7.substring(0, i$7.length - R$1.text.length) + O.text; break; } else if (h$5?.type === "list") { let R$1 = h$5, f$4 = R$1.raw + ` ` + n$9.join(` `), O = this.list(f$4); - s$5[s$5.length - 1] = O, r$10 = r$10.substring(0, r$10.length - h$5.raw.length) + O.raw, i$7 = i$7.substring(0, i$7.length - R$1.raw.length) + O.raw, n$9 = f$4.substring(s$5.at(-1).raw.length).split(` + s$5[s$5.length - 1] = O, r$9 = r$9.substring(0, r$9.length - h$5.raw.length) + O.raw, i$7 = i$7.substring(0, i$7.length - R$1.raw.length) + O.raw, n$9 = f$4.substring(s$5.at(-1).raw.length).split(` `); continue; } } return { type: "blockquote", - raw: r$10, + raw: r$9, tokens: s$5, text: i$7 }; @@ -136159,35 +136363,35 @@ ${c$7}` : c$7; list(e$10) { let t$6 = this.rules.block.list.exec(e$10); if (t$6) { - let n$9 = t$6[1].trim(), r$10 = n$9.length > 1, i$7 = { + let n$9 = t$6[1].trim(), r$9 = n$9.length > 1, i$7 = { type: "list", raw: "", - ordered: r$10, - start: r$10 ? +n$9.slice(0, -1) : "", + ordered: r$9, + start: r$9 ? +n$9.slice(0, -1) : "", loose: !1, items: [] }; - n$9 = r$10 ? `\\d{1,9}\\${n$9.slice(-1)}` : `\\${n$9}`, this.options.pedantic && (n$9 = r$10 ? n$9 : "[*+-]"); + n$9 = r$9 ? `\\d{1,9}\\${n$9.slice(-1)}` : `\\${n$9}`, this.options.pedantic && (n$9 = r$9 ? n$9 : "[*+-]"); let s$5 = this.rules.other.listItemRegex(n$9), a$2 = !1; for (; e$10;) { - let p$3 = !1, u$4 = "", c$7 = ""; + let p$3 = !1, u$4 = "", c$6 = ""; if (!(t$6 = s$5.exec(e$10)) || this.rules.block.hr.test(e$10)) break; u$4 = t$6[0], e$10 = e$10.substring(u$4.length); let g$1 = t$6[2].split(` `, 1)[0].replace(this.rules.other.listReplaceTabs, (H$1) => " ".repeat(3 * H$1.length)), h$5 = e$10.split(` `, 1)[0], R$1 = !g$1.trim(), f$4 = 0; - if (this.options.pedantic ? (f$4 = 2, c$7 = g$1.trimStart()) : R$1 ? f$4 = t$6[1].length + 1 : (f$4 = t$6[2].search(this.rules.other.nonSpaceChar), f$4 = f$4 > 4 ? 1 : f$4, c$7 = g$1.slice(f$4), f$4 += t$6[1].length), R$1 && this.rules.other.blankLine.test(h$5) && (u$4 += h$5 + ` + if (this.options.pedantic ? (f$4 = 2, c$6 = g$1.trimStart()) : R$1 ? f$4 = t$6[1].length + 1 : (f$4 = t$6[2].search(this.rules.other.nonSpaceChar), f$4 = f$4 > 4 ? 1 : f$4, c$6 = g$1.slice(f$4), f$4 += t$6[1].length), R$1 && this.rules.other.blankLine.test(h$5) && (u$4 += h$5 + ` `, e$10 = e$10.substring(h$5.length + 1), p$3 = !0), !p$3) { let H$1 = this.rules.other.nextBulletRegex(f$4), ee = this.rules.other.hrRegex(f$4), te = this.rules.other.fencesBeginRegex(f$4), ne = this.rules.other.headingBeginRegex(f$4), xe = this.rules.other.htmlBeginRegex(f$4); for (; e$10;) { let Z$1 = e$10.split(` `, 1)[0], A$1; if (h$5 = Z$1, this.options.pedantic ? (h$5 = h$5.replace(this.rules.other.listReplaceNesting, " "), A$1 = h$5) : A$1 = h$5.replace(this.rules.other.tabCharGlobal, " "), te.test(h$5) || ne.test(h$5) || xe.test(h$5) || H$1.test(h$5) || ee.test(h$5)) break; - if (A$1.search(this.rules.other.nonSpaceChar) >= f$4 || !h$5.trim()) c$7 += ` + if (A$1.search(this.rules.other.nonSpaceChar) >= f$4 || !h$5.trim()) c$6 += ` ` + A$1.slice(f$4); else { if (R$1 || g$1.replace(this.rules.other.tabCharGlobal, " ").search(this.rules.other.nonSpaceChar) >= 4 || te.test(g$1) || ne.test(g$1) || ee.test(g$1)) break; - c$7 += ` + c$6 += ` ` + h$5; } !R$1 && !h$5.trim() && (R$1 = !0), u$4 += Z$1 + ` @@ -136196,13 +136400,13 @@ ${c$7}` : c$7; } i$7.loose || (a$2 ? i$7.loose = !0 : this.rules.other.doubleBlankLine.test(u$4) && (a$2 = !0)); let O = null, Y; - this.options.gfm && (O = this.rules.other.listIsTask.exec(c$7), O && (Y = O[0] !== "[ ] ", c$7 = c$7.replace(this.rules.other.listReplaceTask, ""))), i$7.items.push({ + this.options.gfm && (O = this.rules.other.listIsTask.exec(c$6), O && (Y = O[0] !== "[ ] ", c$6 = c$6.replace(this.rules.other.listReplaceTask, ""))), i$7.items.push({ type: "list_item", raw: u$4, task: !!O, checked: Y, loose: !1, - text: c$7, + text: c$6, tokens: [] }), i$7.raw += u$4; } @@ -136211,8 +136415,8 @@ ${c$7}` : c$7; else return; i$7.raw = i$7.raw.trimEnd(); for (let p$3 = 0; p$3 < i$7.items.length; p$3++) if (this.lexer.state.top = !1, i$7.items[p$3].tokens = this.lexer.blockTokens(i$7.items[p$3].text, []), !i$7.loose) { - let u$4 = i$7.items[p$3].tokens.filter((g$1) => g$1.type === "space"), c$7 = u$4.length > 0 && u$4.some((g$1) => this.rules.other.anyLine.test(g$1.raw)); - i$7.loose = c$7; + let u$4 = i$7.items[p$3].tokens.filter((g$1) => g$1.type === "space"), c$6 = u$4.length > 0 && u$4.some((g$1) => this.rules.other.anyLine.test(g$1.raw)); + i$7.loose = c$6; } if (i$7.loose) for (let p$3 = 0; p$3 < i$7.items.length; p$3++) i$7.items[p$3].loose = !0; return i$7; @@ -136231,12 +136435,12 @@ ${c$7}` : c$7; def(e$10) { let t$6 = this.rules.block.def.exec(e$10); if (t$6) { - let n$9 = t$6[1].toLowerCase().replace(this.rules.other.multipleSpaceGlobal, " "), r$10 = t$6[2] ? t$6[2].replace(this.rules.other.hrefBrackets, "$1").replace(this.rules.inline.anyPunctuation, "$1") : "", i$7 = t$6[3] ? t$6[3].substring(1, t$6[3].length - 1).replace(this.rules.inline.anyPunctuation, "$1") : t$6[3]; + let n$9 = t$6[1].toLowerCase().replace(this.rules.other.multipleSpaceGlobal, " "), r$9 = t$6[2] ? t$6[2].replace(this.rules.other.hrefBrackets, "$1").replace(this.rules.inline.anyPunctuation, "$1") : "", i$7 = t$6[3] ? t$6[3].substring(1, t$6[3].length - 1).replace(this.rules.inline.anyPunctuation, "$1") : t$6[3]; return { type: "def", tag: n$9, raw: t$6[0], - href: r$10, + href: r$9, title: i$7 }; } @@ -136244,7 +136448,7 @@ ${c$7}` : c$7; table(e$10) { let t$6 = this.rules.block.table.exec(e$10); if (!t$6 || !this.rules.other.tableDelimiter.test(t$6[2])) return; - let n$9 = V(t$6[1]), r$10 = t$6[2].replace(this.rules.other.tableAlignChars, "").split("|"), i$7 = t$6[3]?.trim() ? t$6[3].replace(this.rules.other.tableRowBlankLine, "").split(` + let n$9 = V(t$6[1]), r$9 = t$6[2].replace(this.rules.other.tableAlignChars, "").split("|"), i$7 = t$6[3]?.trim() ? t$6[3].replace(this.rules.other.tableRowBlankLine, "").split(` `) : [], s$5 = { type: "table", raw: t$6[0], @@ -136252,8 +136456,8 @@ ${c$7}` : c$7; align: [], rows: [] }; - if (n$9.length === r$10.length) { - for (let a$2 of r$10) this.rules.other.tableAlignRight.test(a$2) ? s$5.align.push("right") : this.rules.other.tableAlignCenter.test(a$2) ? s$5.align.push("center") : this.rules.other.tableAlignLeft.test(a$2) ? s$5.align.push("left") : s$5.align.push(null); + if (n$9.length === r$9.length) { + for (let a$2 of r$9) this.rules.other.tableAlignRight.test(a$2) ? s$5.align.push("right") : this.rules.other.tableAlignCenter.test(a$2) ? s$5.align.push("center") : this.rules.other.tableAlignLeft.test(a$2) ? s$5.align.push("left") : s$5.align.push(null); for (let a$2 = 0; a$2 < n$9.length; a$2++) s$5.header.push({ text: n$9[a$2], tokens: this.lexer.inline(n$9[a$2]), @@ -136336,13 +136540,13 @@ ${c$7}` : c$7; t$6[2] = t$6[2].substring(0, s$5), t$6[0] = t$6[0].substring(0, o$10).trim(), t$6[3] = ""; } } - let r$10 = t$6[2], i$7 = ""; + let r$9 = t$6[2], i$7 = ""; if (this.options.pedantic) { - let s$5 = this.rules.other.pedanticHrefTitle.exec(r$10); - s$5 && (r$10 = s$5[1], i$7 = s$5[3]); + let s$5 = this.rules.other.pedanticHrefTitle.exec(r$9); + s$5 && (r$9 = s$5[1], i$7 = s$5[3]); } else i$7 = t$6[3] ? t$6[3].slice(1, -1) : ""; - return r$10 = r$10.trim(), this.rules.other.startAngleBracket.test(r$10) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(n$9) ? r$10 = r$10.slice(1) : r$10 = r$10.slice(1, -1)), me(t$6, { - href: r$10 && r$10.replace(this.rules.inline.anyPunctuation, "$1"), + return r$9 = r$9.trim(), this.rules.other.startAngleBracket.test(r$9) && (this.options.pedantic && !this.rules.other.endAngleBracket.test(n$9) ? r$9 = r$9.slice(1) : r$9 = r$9.slice(1, -1)), me(t$6, { + href: r$9 && r$9.replace(this.rules.inline.anyPunctuation, "$1"), title: i$7 && i$7.replace(this.rules.inline.anyPunctuation, "$1") }, t$6[0], this.lexer, this.rules); } @@ -136350,7 +136554,7 @@ ${c$7}` : c$7; reflink(e$10, t$6) { let n$9; if ((n$9 = this.rules.inline.reflink.exec(e$10)) || (n$9 = this.rules.inline.nolink.exec(e$10))) { - let r$10 = (n$9[2] || n$9[1]).replace(this.rules.other.multipleSpaceGlobal, " "), i$7 = t$6[r$10.toLowerCase()]; + let r$9 = (n$9[2] || n$9[1]).replace(this.rules.other.multipleSpaceGlobal, " "), i$7 = t$6[r$9.toLowerCase()]; if (!i$7) { let s$5 = n$9[0].charAt(0); return { @@ -136363,22 +136567,22 @@ ${c$7}` : c$7; } } emStrong(e$10, t$6, n$9 = "") { - let r$10 = this.rules.inline.emStrongLDelim.exec(e$10); - if (!r$10 || r$10[3] && n$9.match(this.rules.other.unicodeAlphaNumeric)) return; - if (!(r$10[1] || r$10[2] || "") || !n$9 || this.rules.inline.punctuation.exec(n$9)) { - let s$5 = [...r$10[0]].length - 1, a$2, o$10, p$3 = s$5, u$4 = 0, c$7 = r$10[0][0] === "*" ? this.rules.inline.emStrongRDelimAst : this.rules.inline.emStrongRDelimUnd; - for (c$7.lastIndex = 0, t$6 = t$6.slice(-1 * e$10.length + s$5); (r$10 = c$7.exec(t$6)) != null;) { - if (a$2 = r$10[1] || r$10[2] || r$10[3] || r$10[4] || r$10[5] || r$10[6], !a$2) continue; - if (o$10 = [...a$2].length, r$10[3] || r$10[4]) { + let r$9 = this.rules.inline.emStrongLDelim.exec(e$10); + if (!r$9 || r$9[3] && n$9.match(this.rules.other.unicodeAlphaNumeric)) return; + if (!(r$9[1] || r$9[2] || "") || !n$9 || this.rules.inline.punctuation.exec(n$9)) { + let s$5 = [...r$9[0]].length - 1, a$2, o$10, p$3 = s$5, u$4 = 0, c$6 = r$9[0][0] === "*" ? this.rules.inline.emStrongRDelimAst : this.rules.inline.emStrongRDelimUnd; + for (c$6.lastIndex = 0, t$6 = t$6.slice(-1 * e$10.length + s$5); (r$9 = c$6.exec(t$6)) != null;) { + if (a$2 = r$9[1] || r$9[2] || r$9[3] || r$9[4] || r$9[5] || r$9[6], !a$2) continue; + if (o$10 = [...a$2].length, r$9[3] || r$9[4]) { p$3 += o$10; continue; - } else if ((r$10[5] || r$10[6]) && s$5 % 3 && !((s$5 + o$10) % 3)) { + } else if ((r$9[5] || r$9[6]) && s$5 % 3 && !((s$5 + o$10) % 3)) { u$4 += o$10; continue; } if (p$3 -= o$10, p$3 > 0) continue; o$10 = Math.min(o$10, o$10 + p$3 + u$4); - let g$1 = [...r$10[0]][0].length, h$5 = e$10.slice(0, s$5 + r$10.index + g$1 + o$10); + let g$1 = [...r$9[0]][0].length, h$5 = e$10.slice(0, s$5 + r$9.index + g$1 + o$10); if (Math.min(s$5, o$10) % 2) { let f$4 = h$5.slice(1, -1); return { @@ -136401,8 +136605,8 @@ ${c$7}` : c$7; codespan(e$10) { let t$6 = this.rules.inline.code.exec(e$10); if (t$6) { - let n$9 = t$6[2].replace(this.rules.other.newLineCharGlobal, " "), r$10 = this.rules.other.nonSpaceChar.test(n$9), i$7 = this.rules.other.startingSpaceChar.test(n$9) && this.rules.other.endingSpaceChar.test(n$9); - return r$10 && i$7 && (n$9 = n$9.substring(1, n$9.length - 1)), { + let n$9 = t$6[2].replace(this.rules.other.newLineCharGlobal, " "), r$9 = this.rules.other.nonSpaceChar.test(n$9), i$7 = this.rules.other.startingSpaceChar.test(n$9) && this.rules.other.endingSpaceChar.test(n$9); + return r$9 && i$7 && (n$9 = n$9.substring(1, n$9.length - 1)), { type: "codespan", raw: t$6[0], text: n$9 @@ -136428,12 +136632,12 @@ ${c$7}` : c$7; autolink(e$10) { let t$6 = this.rules.inline.autolink.exec(e$10); if (t$6) { - let n$9, r$10; - return t$6[2] === "@" ? (n$9 = t$6[1], r$10 = "mailto:" + n$9) : (n$9 = t$6[1], r$10 = n$9), { + let n$9, r$9; + return t$6[2] === "@" ? (n$9 = t$6[1], r$9 = "mailto:" + n$9) : (n$9 = t$6[1], r$9 = n$9), { type: "link", raw: t$6[0], text: n$9, - href: r$10, + href: r$9, tokens: [{ type: "text", raw: n$9, @@ -136445,20 +136649,20 @@ ${c$7}` : c$7; url(e$10) { let t$6; if (t$6 = this.rules.inline.url.exec(e$10)) { - let n$9, r$10; - if (t$6[2] === "@") n$9 = t$6[0], r$10 = "mailto:" + n$9; + let n$9, r$9; + if (t$6[2] === "@") n$9 = t$6[0], r$9 = "mailto:" + n$9; else { let i$7; do i$7 = t$6[0], t$6[0] = this.rules.inline._backpedal.exec(t$6[0])?.[0] ?? ""; while (i$7 !== t$6[0]); - n$9 = t$6[0], t$6[1] === "www." ? r$10 = "http://" + t$6[0] : r$10 = t$6[0]; + n$9 = t$6[0], t$6[1] === "www." ? r$9 = "http://" + t$6[0] : r$9 = t$6[0]; } return { type: "link", raw: t$6[0], text: n$9, - href: r$10, + href: r$9, tokens: [{ type: "text", raw: n$9, @@ -136522,66 +136726,66 @@ ${c$7}` : c$7; } blockTokens(e$10, t$6 = [], n$9 = !1) { for (this.options.pedantic && (e$10 = e$10.replace(m.tabCharGlobal, " ").replace(m.spaceLine, "")); e$10;) { - let r$10; - if (this.options.extensions?.block?.some((s$5) => (r$10 = s$5.call({ lexer: this }, e$10, t$6)) ? (e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10), !0) : !1)) continue; - if (r$10 = this.tokenizer.space(e$10)) { - e$10 = e$10.substring(r$10.raw.length); + let r$9; + if (this.options.extensions?.block?.some((s$5) => (r$9 = s$5.call({ lexer: this }, e$10, t$6)) ? (e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9), !0) : !1)) continue; + if (r$9 = this.tokenizer.space(e$10)) { + e$10 = e$10.substring(r$9.raw.length); let s$5 = t$6.at(-1); - r$10.raw.length === 1 && s$5 !== void 0 ? s$5.raw += ` -` : t$6.push(r$10); + r$9.raw.length === 1 && s$5 !== void 0 ? s$5.raw += ` +` : t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.code(e$10)) { - e$10 = e$10.substring(r$10.raw.length); + if (r$9 = this.tokenizer.code(e$10)) { + e$10 = e$10.substring(r$9.raw.length); let s$5 = t$6.at(-1); s$5?.type === "paragraph" || s$5?.type === "text" ? (s$5.raw += (s$5.raw.endsWith(` `) ? "" : ` -`) + r$10.raw, s$5.text += ` -` + r$10.text, this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$10); +`) + r$9.raw, s$5.text += ` +` + r$9.text, this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.fences(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.fences(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.heading(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.heading(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.hr(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.hr(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.blockquote(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.blockquote(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.list(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.list(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.html(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.html(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.def(e$10)) { - e$10 = e$10.substring(r$10.raw.length); + if (r$9 = this.tokenizer.def(e$10)) { + e$10 = e$10.substring(r$9.raw.length); let s$5 = t$6.at(-1); s$5?.type === "paragraph" || s$5?.type === "text" ? (s$5.raw += (s$5.raw.endsWith(` `) ? "" : ` -`) + r$10.raw, s$5.text += ` -` + r$10.raw, this.inlineQueue.at(-1).src = s$5.text) : this.tokens.links[r$10.tag] || (this.tokens.links[r$10.tag] = { - href: r$10.href, - title: r$10.title - }, t$6.push(r$10)); +`) + r$9.raw, s$5.text += ` +` + r$9.raw, this.inlineQueue.at(-1).src = s$5.text) : this.tokens.links[r$9.tag] || (this.tokens.links[r$9.tag] = { + href: r$9.href, + title: r$9.title + }, t$6.push(r$9)); continue; } - if (r$10 = this.tokenizer.table(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.table(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } - if (r$10 = this.tokenizer.lheading(e$10)) { - e$10 = e$10.substring(r$10.raw.length), t$6.push(r$10); + if (r$9 = this.tokenizer.lheading(e$10)) { + e$10 = e$10.substring(r$9.raw.length), t$6.push(r$9); continue; } let i$7 = e$10; @@ -136591,21 +136795,21 @@ ${c$7}` : c$7; o$10 = p$3.call({ lexer: this }, a$2), typeof o$10 == "number" && o$10 >= 0 && (s$5 = Math.min(s$5, o$10)); }), s$5 < 1 / 0 && s$5 >= 0 && (i$7 = e$10.substring(0, s$5 + 1)); } - if (this.state.top && (r$10 = this.tokenizer.paragraph(i$7))) { + if (this.state.top && (r$9 = this.tokenizer.paragraph(i$7))) { let s$5 = t$6.at(-1); n$9 && s$5?.type === "paragraph" ? (s$5.raw += (s$5.raw.endsWith(` `) ? "" : ` -`) + r$10.raw, s$5.text += ` -` + r$10.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$10), n$9 = i$7.length !== e$10.length, e$10 = e$10.substring(r$10.raw.length); +`) + r$9.raw, s$5.text += ` +` + r$9.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$9), n$9 = i$7.length !== e$10.length, e$10 = e$10.substring(r$9.raw.length); continue; } - if (r$10 = this.tokenizer.text(e$10)) { - e$10 = e$10.substring(r$10.raw.length); + if (r$9 = this.tokenizer.text(e$10)) { + e$10 = e$10.substring(r$9.raw.length); let s$5 = t$6.at(-1); s$5?.type === "text" ? (s$5.raw += (s$5.raw.endsWith(` `) ? "" : ` -`) + r$10.raw, s$5.text += ` -` + r$10.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$10); +`) + r$9.raw, s$5.text += ` +` + r$9.text, this.inlineQueue.pop(), this.inlineQueue.at(-1).src = s$5.text) : t$6.push(r$9); continue; } if (e$10) { @@ -136625,14 +136829,14 @@ ${c$7}` : c$7; }), t$6; } inlineTokens(e$10, t$6 = []) { - let n$9 = e$10, r$10 = null; + let n$9 = e$10, r$9 = null; if (this.tokens.links) { let o$10 = Object.keys(this.tokens.links); - if (o$10.length > 0) for (; (r$10 = this.tokenizer.rules.inline.reflinkSearch.exec(n$9)) != null;) o$10.includes(r$10[0].slice(r$10[0].lastIndexOf("[") + 1, -1)) && (n$9 = n$9.slice(0, r$10.index) + "[" + "a".repeat(r$10[0].length - 2) + "]" + n$9.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex)); + if (o$10.length > 0) for (; (r$9 = this.tokenizer.rules.inline.reflinkSearch.exec(n$9)) != null;) o$10.includes(r$9[0].slice(r$9[0].lastIndexOf("[") + 1, -1)) && (n$9 = n$9.slice(0, r$9.index) + "[" + "a".repeat(r$9[0].length - 2) + "]" + n$9.slice(this.tokenizer.rules.inline.reflinkSearch.lastIndex)); } - for (; (r$10 = this.tokenizer.rules.inline.anyPunctuation.exec(n$9)) != null;) n$9 = n$9.slice(0, r$10.index) + "++" + n$9.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex); + for (; (r$9 = this.tokenizer.rules.inline.anyPunctuation.exec(n$9)) != null;) n$9 = n$9.slice(0, r$9.index) + "++" + n$9.slice(this.tokenizer.rules.inline.anyPunctuation.lastIndex); let i$7; - for (; (r$10 = this.tokenizer.rules.inline.blockSkip.exec(n$9)) != null;) i$7 = r$10[2] ? r$10[2].length : 0, n$9 = n$9.slice(0, r$10.index + i$7) + "[" + "a".repeat(r$10[0].length - i$7 - 2) + "]" + n$9.slice(this.tokenizer.rules.inline.blockSkip.lastIndex); + for (; (r$9 = this.tokenizer.rules.inline.blockSkip.exec(n$9)) != null;) i$7 = r$9[2] ? r$9[2].length : 0, n$9 = n$9.slice(0, r$9.index + i$7) + "[" + "a".repeat(r$9[0].length - i$7 - 2) + "]" + n$9.slice(this.tokenizer.rules.inline.blockSkip.lastIndex); n$9 = this.options.hooks?.emStrongMask?.call({ lexer: this }, n$9) ?? n$9; let s$5 = !1, a$2 = ""; for (; e$10;) { @@ -136683,9 +136887,9 @@ ${c$7}` : c$7; } let p$3 = e$10; if (this.options.extensions?.startInline) { - let u$4 = 1 / 0, c$7 = e$10.slice(1), g$1; + let u$4 = 1 / 0, c$6 = e$10.slice(1), g$1; this.options.extensions.startInline.forEach((h$5) => { - g$1 = h$5.call({ lexer: this }, c$7), typeof g$1 == "number" && g$1 >= 0 && (u$4 = Math.min(u$4, g$1)); + g$1 = h$5.call({ lexer: this }, c$6), typeof g$1 == "number" && g$1 >= 0 && (u$4 = Math.min(u$4, g$1)); }), u$4 < 1 / 0 && u$4 >= 0 && (p$3 = e$10.substring(0, u$4 + 1)); } if (o$10 = this.tokenizer.inlineText(p$3)) { @@ -136715,9 +136919,9 @@ ${c$7}` : c$7; return ""; } code({ text: e$10, lang: t$6, escaped: n$9 }) { - let r$10 = (t$6 || "").match(m.notSpaceStart)?.[0], i$7 = e$10.replace(m.endingNewline, "") + ` + let r$9 = (t$6 || "").match(m.notSpaceStart)?.[0], i$7 = e$10.replace(m.endingNewline, "") + ` `; - return r$10 ? "
" + (n$9 ? i$7 : w(i$7, !0)) + `
+ return r$9 ? "
" + (n$9 ? i$7 : w(i$7, !0)) + `
` : "
" + (n$9 ? i$7 : w(i$7, !0)) + `
`; } @@ -136741,14 +136945,14 @@ ${this.parser.parse(e$10)} `; } list(e$10) { - let t$6 = e$10.ordered, n$9 = e$10.start, r$10 = ""; + let t$6 = e$10.ordered, n$9 = e$10.start, r$9 = ""; for (let a$2 = 0; a$2 < e$10.items.length; a$2++) { let o$10 = e$10.items[a$2]; - r$10 += this.listitem(o$10); + r$9 += this.listitem(o$10); } let i$7 = t$6 ? "ol" : "ul", s$5 = t$6 && n$9 !== 1 ? " start=\"" + n$9 + "\"" : ""; return "<" + i$7 + s$5 + `> -` + r$10 + " +` + r$9 + " `; } listitem(e$10) { @@ -136776,17 +136980,17 @@ ${this.parser.parse(e$10)} let t$6 = "", n$9 = ""; for (let i$7 = 0; i$7 < e$10.header.length; i$7++) n$9 += this.tablecell(e$10.header[i$7]); t$6 += this.tablerow({ text: n$9 }); - let r$10 = ""; + let r$9 = ""; for (let i$7 = 0; i$7 < e$10.rows.length; i$7++) { let s$5 = e$10.rows[i$7]; n$9 = ""; for (let a$2 = 0; a$2 < s$5.length; a$2++) n$9 += this.tablecell(s$5[a$2]); - r$10 += this.tablerow({ text: n$9 }); + r$9 += this.tablerow({ text: n$9 }); } - return r$10 && (r$10 = `${r$10}`), ` + return r$9 && (r$9 = `${r$9}`), `
` + t$6 + ` -` + r$10 + `
+` + r$9 + ` `; } tablerow({ text: e$10 }) { @@ -136815,14 +137019,14 @@ ${e$10} return `${this.parser.parseInline(e$10)}`; } link({ href: e$10, title: t$6, tokens: n$9 }) { - let r$10 = this.parser.parseInline(n$9), i$7 = J(e$10); - if (i$7 === null) return r$10; + let r$9 = this.parser.parseInline(n$9), i$7 = J(e$10); + if (i$7 === null) return r$9; e$10 = i$7; let s$5 = "
", s$5; + return t$6 && (s$5 += " title=\"" + w(t$6) + "\""), s$5 += ">" + r$9 + "", s$5; } - image({ href: e$10, title: t$6, text: n$9, tokens: r$10 }) { - r$10 && (n$9 = this.parser.parseInline(r$10, this.parser.textRenderer)); + image({ href: e$10, title: t$6, text: n$9, tokens: r$9 }) { + r$9 && (n$9 = this.parser.parseInline(r$9, this.parser.textRenderer)); let i$7 = J(e$10); if (i$7 === null) return w(n$9); e$10 = i$7; @@ -136877,8 +137081,8 @@ ${e$10} } parse(e$10, t$6 = !0) { let n$9 = ""; - for (let r$10 = 0; r$10 < e$10.length; r$10++) { - let i$7 = e$10[r$10]; + for (let r$9 = 0; r$9 < e$10.length; r$9++) { + let i$7 = e$10[r$9]; if (this.options.extensions?.renderers?.[i$7.type]) { let a$2 = i$7, o$10 = this.options.extensions.renderers[a$2.type].call({ parser: this }, a$2); if (o$10 !== !1 || ![ @@ -136942,7 +137146,7 @@ ${e$10} } case "text": { let a$2 = s$5, o$10 = this.renderer.text(a$2); - for (; r$10 + 1 < e$10.length && e$10[r$10 + 1].type === "text";) a$2 = e$10[++r$10], o$10 += ` + for (; r$9 + 1 < e$10.length && e$10[r$9 + 1].type === "text";) a$2 = e$10[++r$9], o$10 += ` ` + this.renderer.text(a$2); t$6 ? n$9 += this.renderer.paragraph({ type: "paragraph", @@ -136968,8 +137172,8 @@ ${e$10} } parseInline(e$10, t$6 = this.renderer) { let n$9 = ""; - for (let r$10 = 0; r$10 < e$10.length; r$10++) { - let i$7 = e$10[r$10]; + for (let r$9 = 0; r$9 < e$10.length; r$9++) { + let i$7 = e$10[r$9]; if (this.options.extensions?.renderers?.[i$7.type]) { let a$2 = this.options.extensions.renderers[i$7.type].call({ parser: this }, i$7); if (a$2 !== !1 || ![ @@ -137092,20 +137296,20 @@ ${e$10} } walkTokens(e$10, t$6) { let n$9 = []; - for (let r$10 of e$10) switch (n$9 = n$9.concat(t$6.call(this, r$10)), r$10.type) { + for (let r$9 of e$10) switch (n$9 = n$9.concat(t$6.call(this, r$9)), r$9.type) { case "table": { - let i$7 = r$10; + let i$7 = r$9; for (let s$5 of i$7.header) n$9 = n$9.concat(this.walkTokens(s$5.tokens, t$6)); for (let s$5 of i$7.rows) for (let a$2 of s$5) n$9 = n$9.concat(this.walkTokens(a$2.tokens, t$6)); break; } case "list": { - let i$7 = r$10; + let i$7 = r$9; n$9 = n$9.concat(this.walkTokens(i$7.items, t$6)); break; } default: { - let i$7 = r$10; + let i$7 = r$9; this.defaults.extensions?.childTokens?.[i$7.type] ? this.defaults.extensions.childTokens[i$7.type].forEach((s$5) => { let a$2 = i$7[s$5].flat(1 / 0); n$9 = n$9.concat(this.walkTokens(a$2, t$6)); @@ -137120,8 +137324,8 @@ ${e$10} childTokens: {} }; return e$10.forEach((n$9) => { - let r$10 = { ...n$9 }; - if (r$10.async = this.defaults.async || r$10.async || !1, n$9.extensions && (n$9.extensions.forEach((i$7) => { + let r$9 = { ...n$9 }; + if (r$9.async = this.defaults.async || r$9.async || !1, n$9.extensions && (n$9.extensions.forEach((i$7) => { if (!i$7.name) throw new Error("extension name required"); if ("renderer" in i$7) { let s$5 = t$6.renderers[i$7.name]; @@ -137136,18 +137340,18 @@ ${e$10} s$5 ? s$5.unshift(i$7.tokenizer) : t$6[i$7.level] = [i$7.tokenizer], i$7.start && (i$7.level === "block" ? t$6.startBlock ? t$6.startBlock.push(i$7.start) : t$6.startBlock = [i$7.start] : i$7.level === "inline" && (t$6.startInline ? t$6.startInline.push(i$7.start) : t$6.startInline = [i$7.start])); } "childTokens" in i$7 && i$7.childTokens && (t$6.childTokens[i$7.name] = i$7.childTokens); - }), r$10.extensions = t$6), n$9.renderer) { + }), r$9.extensions = t$6), n$9.renderer) { let i$7 = this.defaults.renderer || new P(this.defaults); for (let s$5 in n$9.renderer) { if (!(s$5 in i$7)) throw new Error(`renderer '${s$5}' does not exist`); if (["options", "parser"].includes(s$5)) continue; let a$2 = s$5, o$10 = n$9.renderer[a$2], p$3 = i$7[a$2]; i$7[a$2] = (...u$4) => { - let c$7 = o$10.apply(i$7, u$4); - return c$7 === !1 && (c$7 = p$3.apply(i$7, u$4)), c$7 || ""; + let c$6 = o$10.apply(i$7, u$4); + return c$6 === !1 && (c$6 = p$3.apply(i$7, u$4)), c$6 || ""; }; } - r$10.renderer = i$7; + r$9.renderer = i$7; } if (n$9.tokenizer) { let i$7 = this.defaults.tokenizer || new y(this.defaults); @@ -137160,11 +137364,11 @@ ${e$10} ].includes(s$5)) continue; let a$2 = s$5, o$10 = n$9.tokenizer[a$2], p$3 = i$7[a$2]; i$7[a$2] = (...u$4) => { - let c$7 = o$10.apply(i$7, u$4); - return c$7 === !1 && (c$7 = p$3.apply(i$7, u$4)), c$7; + let c$6 = o$10.apply(i$7, u$4); + return c$6 === !1 && (c$6 = p$3.apply(i$7, u$4)), c$6; }; } - r$10.tokenizer = i$7; + r$9.tokenizer = i$7; } if (n$9.hooks) { let i$7 = this.defaults.hooks || new S(); @@ -137177,29 +137381,29 @@ ${e$10} let g$1 = await o$10.call(i$7, u$4); return p$3.call(i$7, g$1); })(); - let c$7 = o$10.call(i$7, u$4); - return p$3.call(i$7, c$7); + let c$6 = o$10.call(i$7, u$4); + return p$3.call(i$7, c$6); } : i$7[a$2] = (...u$4) => { if (this.defaults.async) return (async () => { let g$1 = await o$10.apply(i$7, u$4); return g$1 === !1 && (g$1 = await p$3.apply(i$7, u$4)), g$1; })(); - let c$7 = o$10.apply(i$7, u$4); - return c$7 === !1 && (c$7 = p$3.apply(i$7, u$4)), c$7; + let c$6 = o$10.apply(i$7, u$4); + return c$6 === !1 && (c$6 = p$3.apply(i$7, u$4)), c$6; }; } - r$10.hooks = i$7; + r$9.hooks = i$7; } if (n$9.walkTokens) { let i$7 = this.defaults.walkTokens, s$5 = n$9.walkTokens; - r$10.walkTokens = function(a$2) { + r$9.walkTokens = function(a$2) { let o$10 = []; return o$10.push(s$5.call(this, a$2)), i$7 && (o$10 = o$10.concat(i$7.call(this, a$2))), o$10; }; } this.defaults = { ...this.defaults, - ...r$10 + ...r$9 }; }), this; } @@ -137216,8 +137420,8 @@ ${e$10} return b.parse(e$10, t$6 ?? this.defaults); } parseMarkdown(e$10) { - return (n$9, r$10) => { - let i$7 = { ...r$10 }, s$5 = { + return (n$9, r$9) => { + let i$7 = { ...r$9 }, s$5 = { ...this.defaults, ...i$7 }, a$2 = this.onError(!!s$5.silent, !!s$5.async); @@ -137225,17 +137429,17 @@ ${e$10} if (typeof n$9 > "u" || n$9 === null) return a$2(new Error("marked(): input parameter is undefined or null")); if (typeof n$9 != "string") return a$2(new Error("marked(): input parameter is of type " + Object.prototype.toString.call(n$9) + ", string expected")); if (s$5.hooks && (s$5.hooks.options = s$5, s$5.hooks.block = e$10), s$5.async) return (async () => { - let o$10 = s$5.hooks ? await s$5.hooks.preprocess(n$9) : n$9, u$4 = await (s$5.hooks ? await s$5.hooks.provideLexer() : e$10 ? x$1.lex : x$1.lexInline)(o$10, s$5), c$7 = s$5.hooks ? await s$5.hooks.processAllTokens(u$4) : u$4; - s$5.walkTokens && await Promise.all(this.walkTokens(c$7, s$5.walkTokens)); - let h$5 = await (s$5.hooks ? await s$5.hooks.provideParser() : e$10 ? b.parse : b.parseInline)(c$7, s$5); + let o$10 = s$5.hooks ? await s$5.hooks.preprocess(n$9) : n$9, u$4 = await (s$5.hooks ? await s$5.hooks.provideLexer() : e$10 ? x$1.lex : x$1.lexInline)(o$10, s$5), c$6 = s$5.hooks ? await s$5.hooks.processAllTokens(u$4) : u$4; + s$5.walkTokens && await Promise.all(this.walkTokens(c$6, s$5.walkTokens)); + let h$5 = await (s$5.hooks ? await s$5.hooks.provideParser() : e$10 ? b.parse : b.parseInline)(c$6, s$5); return s$5.hooks ? await s$5.hooks.postprocess(h$5) : h$5; })().catch(a$2); try { s$5.hooks && (n$9 = s$5.hooks.preprocess(n$9)); let p$3 = (s$5.hooks ? s$5.hooks.provideLexer() : e$10 ? x$1.lex : x$1.lexInline)(n$9, s$5); s$5.hooks && (p$3 = s$5.hooks.processAllTokens(p$3)), s$5.walkTokens && this.walkTokens(p$3, s$5.walkTokens); - let c$7 = (s$5.hooks ? s$5.hooks.provideParser() : e$10 ? b.parse : b.parseInline)(p$3, s$5); - return s$5.hooks && (c$7 = s$5.hooks.postprocess(c$7)), c$7; + let c$6 = (s$5.hooks ? s$5.hooks.provideParser() : e$10 ? b.parse : b.parseInline)(p$3, s$5); + return s$5.hooks && (c$6 = s$5.hooks.postprocess(c$6)), c$6; } catch (o$10) { return a$2(o$10); } @@ -137245,8 +137449,8 @@ ${e$10} return (n$9) => { if (n$9.message += ` Please report this to https://github.com/markedjs/marked.`, e$10) { - let r$10 = "

An error occurred:

" + w(n$9.message + "", !0) + "
"; - return t$6 ? Promise.resolve(r$10) : r$10; + let r$9 = "

An error occurred:

" + w(n$9.message + "", !0) + "
"; + return t$6 ? Promise.resolve(r$9) : r$9; } if (t$6) return Promise.reject(n$9); throw n$9; @@ -137288,10 +137492,10 @@ var init_MarkdownBlock = __esmMin((() => { init_unsafe_html(); init_marked_esm(); __decorate$16 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; MarkdownBlock = class MarkdownBlock$1 extends i { constructor() { @@ -137545,10 +137749,10 @@ var init_DocxArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$15 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; DocxArtifact = class DocxArtifact$1 extends ArtifactElement { constructor() { @@ -137705,9 +137909,9 @@ var init_DocxArtifact = __esmMin((() => { } `; container.appendChild(style); - } catch (error$2) { - console.error("Error rendering DOCX:", error$2); - this.error = error$2?.message || i18n("Failed to load document"); + } catch (error) { + console.error("Error rendering DOCX:", error); + this.error = error?.message || i18n("Failed to load document"); } } render() { @@ -137744,10 +137948,10 @@ var init_ExcelArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$14 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ExcelArtifact = class ExcelArtifact$1 extends ArtifactElement { constructor() { @@ -137869,9 +138073,9 @@ var init_ExcelArtifact = __esmMin((() => { const sheetName = workbook.SheetNames[0]; wrapper.appendChild(this.renderExcelSheet(workbook.Sheets[sheetName], sheetName)); } - } catch (error$2) { - console.error("Error rendering Excel:", error$2); - this.error = error$2?.message || i18n("Failed to load spreadsheet"); + } catch (error) { + console.error("Error rendering Excel:", error); + this.error = error?.message || i18n("Failed to load spreadsheet"); } } renderExcelSheet(worksheet, sheetName) { @@ -137934,10 +138138,10 @@ var init_GenericArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$13 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; GenericArtifact = class GenericArtifact$1 extends ArtifactElement { constructor() { @@ -138043,7 +138247,7 @@ var init_GenericArtifact = __esmMin((() => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/core.js var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function deepFreeze$1(obj) { + function deepFreeze(obj) { if (obj instanceof Map) { obj.clear = obj.delete = obj.set = function() { throw new Error("map is read-only"); @@ -138058,7 +138262,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { const prop = obj[name]; const type = typeof prop; if ((type === "object" || type === "function") && !Object.isFrozen(prop)) { - deepFreeze$1(prop); + deepFreeze(prop); } }); return obj; @@ -138066,7 +138270,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @typedef {import('highlight.js').CallbackResponse} CallbackResponse */ /** @typedef {import('highlight.js').CompiledMode} CompiledMode */ /** @implements CallbackResponse */ - var Response$2 = class { + var Response = class { /** * @param {CompiledMode} mode */ @@ -138083,7 +138287,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} value * @returns {string} */ - function escapeHTML$2(value) { + function escapeHTML(value) { return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """).replace(/'/g, "'"); } /** @@ -138094,7 +138298,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Record[]} objects * @returns {T} a single new object */ - function inherit$1$1(original, ...objects) { + function inherit$1(original, ...objects) { /** @type Record */ const result = Object.create(null); for (const key in original) { @@ -138117,12 +138321,12 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @typedef {{scope?: string, language?: string, sublanguage?: boolean}} Node */ /** @typedef {{walk: (r: Renderer) => void}} Tree */ /** */ - const SPAN_CLOSE$1 = ""; + const SPAN_CLOSE = ""; /** * Determines if a node needs to be wrapped in * * @param {Node} node */ - const emitsWrappingTags$1 = (node) => { + const emitsWrappingTags = (node) => { return !!node.scope; }; /** @@ -138130,7 +138334,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} name * @param {{prefix:string}} options */ - const scopeToCSSClass$1 = (name, { prefix }) => { + const scopeToCSSClass = (name, { prefix }) => { if (name.startsWith("language:")) { return name.replace("language:", "language-"); } @@ -138141,7 +138345,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { return `${prefix}${name}`; }; /** @type {Renderer} */ - var HTMLRenderer$1 = class { + var HTMLRenderer = class { /** * Creates a new HTMLRenderer * @@ -138158,15 +138362,15 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * * @param {string} text */ addText(text$2) { - this.buffer += escapeHTML$2(text$2); + this.buffer += escapeHTML(text$2); } /** * Adds a node open to the output stream (if needed) * * @param {Node} node */ openNode(node) { - if (!emitsWrappingTags$1(node)) return; - const className = scopeToCSSClass$1(node.scope, { prefix: this.classPrefix }); + if (!emitsWrappingTags(node)) return; + const className = scopeToCSSClass(node.scope, { prefix: this.classPrefix }); this.span(className); } /** @@ -138174,8 +138378,8 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * * @param {Node} node */ closeNode(node) { - if (!emitsWrappingTags$1(node)) return; - this.buffer += SPAN_CLOSE$1; + if (!emitsWrappingTags(node)) return; + this.buffer += SPAN_CLOSE; } /** * returns the accumulated buffer @@ -138196,16 +138400,16 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @typedef {import('highlight.js').Emitter} Emitter */ /** */ /** @returns {DataNode} */ - const newNode$1 = (opts = {}) => { + const newNode = (opts = {}) => { /** @type DataNode */ const result = { children: [] }; Object.assign(result, opts); return result; }; - var TokenTree$1 = class TokenTree$1 { + var TokenTree = class TokenTree { constructor() { /** @type DataNode */ - this.rootNode = newNode$1(); + this.rootNode = newNode(); this.stack = [this.rootNode]; } get top() { @@ -138221,7 +138425,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @param {string} scope */ openNode(scope) { /** @type Node */ - const node = newNode$1({ scope }); + const node = newNode({ scope }); this.add(node); this.stack.push(node); } @@ -138268,7 +138472,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { node.children = [node.children.join("")]; } else { node.children.forEach((child) => { - TokenTree$1._collapse(child); + TokenTree._collapse(child); }); } } @@ -138290,7 +138494,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** * @implements {Emitter} */ - var TokenTreeEmitter$1 = class extends TokenTree$1 { + var TokenTreeEmitter = class extends TokenTree { /** * @param {*} options */ @@ -138325,7 +138529,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { this.add(node); } toHTML() { - const renderer = new HTMLRenderer$1(this, this.options); + const renderer = new HTMLRenderer(this, this.options); return renderer.value(); } finalize() { @@ -138341,7 +138545,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp | string } re * @returns {string} */ - function source$3(re$1) { + function source(re$1) { if (!re$1) return null; if (typeof re$1 === "string") return re$1; return re$1.source; @@ -138350,36 +138554,36 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp | string } re * @returns {string} */ - function lookahead$3(re$1) { - return concat$3("(?=", re$1, ")"); + function lookahead(re$1) { + return concat("(?=", re$1, ")"); } /** * @param {RegExp | string } re * @returns {string} */ - function anyNumberOfTimes$1(re$1) { - return concat$3("(?:", re$1, ")*"); + function anyNumberOfTimes(re$1) { + return concat("(?:", re$1, ")*"); } /** * @param {RegExp | string } re * @returns {string} */ - function optional$1(re$1) { - return concat$3("(?:", re$1, ")?"); + function optional(re$1) { + return concat("(?:", re$1, ")?"); } /** * @param {...(RegExp | string) } args * @returns {string} */ - function concat$3(...args) { - const joined = args.map((x$2) => source$3(x$2)).join(""); + function concat(...args) { + const joined = args.map((x$2) => source(x$2)).join(""); return joined; } /** * @param { Array } args * @returns {object} */ - function stripOptionsFromArgs$3(args) { + function stripOptionsFromArgs(args) { const opts = args[args.length - 1]; if (typeof opts === "object" && opts.constructor === Object) { args.splice(args.length - 1, 1); @@ -138396,17 +138600,17 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {(RegExp | string)[] | [...(RegExp | string)[], RegexEitherOptions]} args * @returns {string} */ - function either$3(...args) { + function either(...args) { /** @type { object & {capture?: boolean} } */ - const opts = stripOptionsFromArgs$3(args); - const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source$3(x$2)).join("|") + ")"; + const opts = stripOptionsFromArgs(args); + const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source(x$2)).join("|") + ")"; return joined; } /** * @param {RegExp | string} re * @returns {number} */ - function countMatchGroups$1(re$1) { + function countMatchGroups(re$1) { return new RegExp(re$1.toString() + "|").exec("").length - 1; } /** @@ -138414,25 +138618,25 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp} re * @param {string} lexeme */ - function startsWith$1(re$1, lexeme) { + function startsWith(re$1, lexeme) { const match = re$1 && re$1.exec(lexeme); return match && match.index === 0; } - const BACKREF_RE$1 = /\[(?:[^\\\]]|\\.)*\]|\(\??|\\([1-9][0-9]*)|\\./; + const BACKREF_RE = /\[(?:[^\\\]]|\\.)*\]|\(\??|\\([1-9][0-9]*)|\\./; /** * @param {(string | RegExp)[]} regexps * @param {{joinWith: string}} opts * @returns {string} */ - function _rewriteBackreferences$1(regexps, { joinWith }) { + function _rewriteBackreferences(regexps, { joinWith }) { let numCaptures = 0; return regexps.map((regex) => { numCaptures += 1; const offset = numCaptures; - let re$1 = source$3(regex); + let re$1 = source(regex); let out = ""; while (re$1.length > 0) { - const match = BACKREF_RE$1.exec(re$1); + const match = BACKREF_RE.exec(re$1); if (!match) { out += re$1; break; @@ -138453,22 +138657,22 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } /** @typedef {import('highlight.js').Mode} Mode */ /** @typedef {import('highlight.js').ModeCallback} ModeCallback */ - const MATCH_NOTHING_RE$1 = /\b\B/; - const IDENT_RE$5 = "[a-zA-Z]\\w*"; - const UNDERSCORE_IDENT_RE$1 = "[a-zA-Z_]\\w*"; - const NUMBER_RE$1 = "\\b\\d+(\\.\\d+)?"; - const C_NUMBER_RE$1 = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)"; - const BINARY_NUMBER_RE$1 = "\\b(0b[01]+)"; - const RE_STARTERS_RE$1 = "!|!=|!==|%|%=|&|&&|&=|\\*|\\*=|\\+|\\+=|,|-|-=|/=|/|:|;|<<|<<=|<=|<|===|==|=|>>>=|>>=|>=|>>>|>>|>|\\?|\\[|\\{|\\(|\\^|\\^=|\\||\\|=|\\|\\||~"; + const MATCH_NOTHING_RE = /\b\B/; + const IDENT_RE = "[a-zA-Z]\\w*"; + const UNDERSCORE_IDENT_RE = "[a-zA-Z_]\\w*"; + const NUMBER_RE = "\\b\\d+(\\.\\d+)?"; + const C_NUMBER_RE = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)"; + const BINARY_NUMBER_RE = "\\b(0b[01]+)"; + const RE_STARTERS_RE = "!|!=|!==|%|%=|&|&&|&=|\\*|\\*=|\\+|\\+=|,|-|-=|/=|/|:|;|<<|<<=|<=|<|===|==|=|>>>=|>>=|>=|>>>|>>|>|\\?|\\[|\\{|\\(|\\^|\\^=|\\||\\|=|\\|\\||~"; /** * @param { Partial & {binary?: string | RegExp} } opts */ - const SHEBANG$1 = (opts = {}) => { + const SHEBANG = (opts = {}) => { const beginShebang = /^#![ ]*\//; if (opts.binary) { - opts.begin = concat$3(beginShebang, /.*\b/, opts.binary, /\b.*/); + opts.begin = concat(beginShebang, /.*\b/, opts.binary, /\b.*/); } - return inherit$1$1({ + return inherit$1({ scope: "meta", begin: beginShebang, end: /$/, @@ -138478,25 +138682,25 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, opts); }; - const BACKSLASH_ESCAPE$1 = { + const BACKSLASH_ESCAPE = { begin: "\\\\[\\s\\S]", relevance: 0 }; - const APOS_STRING_MODE$1 = { + const APOS_STRING_MODE = { scope: "string", begin: "'", end: "'", illegal: "\\n", - contains: [BACKSLASH_ESCAPE$1] + contains: [BACKSLASH_ESCAPE] }; - const QUOTE_STRING_MODE$1 = { + const QUOTE_STRING_MODE = { scope: "string", begin: "\"", end: "\"", illegal: "\\n", - contains: [BACKSLASH_ESCAPE$1] + contains: [BACKSLASH_ESCAPE] }; - const PHRASAL_WORDS_MODE$1 = { begin: /\b(a|an|the|are|I'm|isn't|don't|doesn't|won't|but|just|should|pretty|simply|enough|gonna|going|wtf|so|such|will|you|your|they|like|more)\b/ }; + const PHRASAL_WORDS_MODE = { begin: /\b(a|an|the|are|I'm|isn't|don't|doesn't|won't|but|just|should|pretty|simply|enough|gonna|going|wtf|so|such|will|you|your|they|like|more)\b/ }; /** * Creates a comment mode * @@ -138505,8 +138709,8 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Mode | {}} [modeOptions] * @returns {Partial} */ - const COMMENT$1 = function(begin, end, modeOptions = {}) { - const mode = inherit$1$1({ + const COMMENT = function(begin, end, modeOptions = {}) { + const mode = inherit$1({ scope: "comment", begin, end, @@ -138519,51 +138723,51 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeBegin: true, relevance: 0 }); - const ENGLISH_WORD = either$3("I", "a", "is", "so", "us", "to", "at", "if", "in", "it", "on", /[A-Za-z]+['](d|ve|re|ll|t|s|n)/, /[A-Za-z]+[-][a-z]+/, /[A-Za-z][a-z]{2,}/); - mode.contains.push({ begin: concat$3(/[ ]+/, "(", ENGLISH_WORD, /[.]?[:]?([.][ ]|[ ])/, "){3}") }); + const ENGLISH_WORD = either("I", "a", "is", "so", "us", "to", "at", "if", "in", "it", "on", /[A-Za-z]+['](d|ve|re|ll|t|s|n)/, /[A-Za-z]+[-][a-z]+/, /[A-Za-z][a-z]{2,}/); + mode.contains.push({ begin: concat(/[ ]+/, "(", ENGLISH_WORD, /[.]?[:]?([.][ ]|[ ])/, "){3}") }); return mode; }; - const C_LINE_COMMENT_MODE$1 = COMMENT$1("//", "$"); - const C_BLOCK_COMMENT_MODE$1 = COMMENT$1("/\\*", "\\*/"); - const HASH_COMMENT_MODE$1 = COMMENT$1("#", "$"); - const NUMBER_MODE$1 = { + const C_LINE_COMMENT_MODE = COMMENT("//", "$"); + const C_BLOCK_COMMENT_MODE = COMMENT("/\\*", "\\*/"); + const HASH_COMMENT_MODE = COMMENT("#", "$"); + const NUMBER_MODE = { scope: "number", - begin: NUMBER_RE$1, + begin: NUMBER_RE, relevance: 0 }; - const C_NUMBER_MODE$1 = { + const C_NUMBER_MODE = { scope: "number", - begin: C_NUMBER_RE$1, + begin: C_NUMBER_RE, relevance: 0 }; - const BINARY_NUMBER_MODE$1 = { + const BINARY_NUMBER_MODE = { scope: "number", - begin: BINARY_NUMBER_RE$1, + begin: BINARY_NUMBER_RE, relevance: 0 }; - const REGEXP_MODE$1 = { + const REGEXP_MODE = { scope: "regexp", begin: /\/(?=[^/\n]*\/)/, end: /\/[gimuy]*/, - contains: [BACKSLASH_ESCAPE$1, { + contains: [BACKSLASH_ESCAPE, { begin: /\[/, end: /\]/, relevance: 0, - contains: [BACKSLASH_ESCAPE$1] + contains: [BACKSLASH_ESCAPE] }] }; - const TITLE_MODE$1 = { + const TITLE_MODE = { scope: "title", - begin: IDENT_RE$5, + begin: IDENT_RE, relevance: 0 }; - const UNDERSCORE_TITLE_MODE$1 = { + const UNDERSCORE_TITLE_MODE = { scope: "title", - begin: UNDERSCORE_IDENT_RE$1, + begin: UNDERSCORE_IDENT_RE, relevance: 0 }; - const METHOD_GUARD$1 = { - begin: "\\.\\s*" + UNDERSCORE_IDENT_RE$1, + const METHOD_GUARD = { + begin: "\\.\\s*" + UNDERSCORE_IDENT_RE, relevance: 0 }; /** @@ -138573,7 +138777,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * group is what is used for comparison * @param {Partial} mode */ - const END_SAME_AS_BEGIN$1 = function(mode) { + const END_SAME_AS_BEGIN = function(mode) { return Object.assign(mode, { "on:begin": (m$3, resp) => { resp.data._beginMatch = m$3[1]; @@ -138583,32 +138787,32 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }); }; - var MODES$6 = /* @__PURE__ */ Object.freeze({ + var MODES = /* @__PURE__ */ Object.freeze({ __proto__: null, - APOS_STRING_MODE: APOS_STRING_MODE$1, - BACKSLASH_ESCAPE: BACKSLASH_ESCAPE$1, - BINARY_NUMBER_MODE: BINARY_NUMBER_MODE$1, - BINARY_NUMBER_RE: BINARY_NUMBER_RE$1, - COMMENT: COMMENT$1, - C_BLOCK_COMMENT_MODE: C_BLOCK_COMMENT_MODE$1, - C_LINE_COMMENT_MODE: C_LINE_COMMENT_MODE$1, - C_NUMBER_MODE: C_NUMBER_MODE$1, - C_NUMBER_RE: C_NUMBER_RE$1, - END_SAME_AS_BEGIN: END_SAME_AS_BEGIN$1, - HASH_COMMENT_MODE: HASH_COMMENT_MODE$1, - IDENT_RE: IDENT_RE$5, - MATCH_NOTHING_RE: MATCH_NOTHING_RE$1, - METHOD_GUARD: METHOD_GUARD$1, - NUMBER_MODE: NUMBER_MODE$1, - NUMBER_RE: NUMBER_RE$1, - PHRASAL_WORDS_MODE: PHRASAL_WORDS_MODE$1, - QUOTE_STRING_MODE: QUOTE_STRING_MODE$1, - REGEXP_MODE: REGEXP_MODE$1, - RE_STARTERS_RE: RE_STARTERS_RE$1, - SHEBANG: SHEBANG$1, - TITLE_MODE: TITLE_MODE$1, - UNDERSCORE_IDENT_RE: UNDERSCORE_IDENT_RE$1, - UNDERSCORE_TITLE_MODE: UNDERSCORE_TITLE_MODE$1 + APOS_STRING_MODE, + BACKSLASH_ESCAPE, + BINARY_NUMBER_MODE, + BINARY_NUMBER_RE, + COMMENT, + C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + C_NUMBER_MODE, + C_NUMBER_RE, + END_SAME_AS_BEGIN, + HASH_COMMENT_MODE, + IDENT_RE, + MATCH_NOTHING_RE, + METHOD_GUARD, + NUMBER_MODE, + NUMBER_RE, + PHRASAL_WORDS_MODE, + QUOTE_STRING_MODE, + REGEXP_MODE, + RE_STARTERS_RE, + SHEBANG, + TITLE_MODE, + UNDERSCORE_IDENT_RE, + UNDERSCORE_TITLE_MODE }); /** @typedef {import('highlight.js').CallbackResponse} CallbackResponse @@ -138623,7 +138827,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExpMatchArray} match * @param {CallbackResponse} response */ - function skipIfHasPrecedingDot$1(match, response) { + function skipIfHasPrecedingDot(match, response) { const before = match.input[match.index - 1]; if (before === ".") { response.ignoreMatch(); @@ -138633,7 +138837,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * * @type {CompilerExt} */ - function scopeClassName$1(mode, _parent) { + function scopeClassName(mode, _parent) { if (mode.className !== undefined) { mode.scope = mode.className; delete mode.className; @@ -138643,11 +138847,11 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * `beginKeywords` syntactic sugar * @type {CompilerExt} */ - function beginKeywords$1(mode, parent) { + function beginKeywords(mode, parent) { if (!parent) return; if (!mode.beginKeywords) return; mode.begin = "\\b(" + mode.beginKeywords.split(" ").join("|") + ")(?!\\.)(?=\\b|\\s)"; - mode.__beforeBegin = skipIfHasPrecedingDot$1; + mode.__beforeBegin = skipIfHasPrecedingDot; mode.keywords = mode.keywords || mode.beginKeywords; delete mode.beginKeywords; if (mode.relevance === undefined) mode.relevance = 0; @@ -138656,15 +138860,15 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * Allow `illegal` to contain an array of illegal values * @type {CompilerExt} */ - function compileIllegal$1(mode, _parent) { + function compileIllegal(mode, _parent) { if (!Array.isArray(mode.illegal)) return; - mode.illegal = either$3(...mode.illegal); + mode.illegal = either(...mode.illegal); } /** * `match` to match a single expression for readability * @type {CompilerExt} */ - function compileMatch$1(mode, _parent) { + function compileMatch(mode, _parent) { if (!mode.match) return; if (mode.begin || mode.end) throw new Error("begin & end are not supported with match"); mode.begin = mode.match; @@ -138674,10 +138878,10 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * provides the default 1 relevance to all modes * @type {CompilerExt} */ - function compileRelevance$1(mode, _parent) { + function compileRelevance(mode, _parent) { if (mode.relevance === undefined) mode.relevance = 1; } - const beforeMatchExt$1 = (mode, parent) => { + const beforeMatchExt = (mode, parent) => { if (!mode.beforeMatch) return; if (mode.starts) throw new Error("beforeMatch cannot be used with starts"); const originalMode = Object.assign({}, mode); @@ -138685,7 +138889,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { delete mode[key]; }); mode.keywords = originalMode.keywords; - mode.begin = concat$3(originalMode.beforeMatch, lookahead$3(originalMode.begin)); + mode.begin = concat(originalMode.beforeMatch, lookahead(originalMode.begin)); mode.starts = { relevance: 0, contains: [Object.assign(originalMode, { endsParent: true })] @@ -138693,7 +138897,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { mode.relevance = 0; delete originalMode.beforeMatch; }; - const COMMON_KEYWORDS$1 = [ + const COMMON_KEYWORDS = [ "of", "and", "for", @@ -138706,14 +138910,14 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { "list", "value" ]; - const DEFAULT_KEYWORD_SCOPE$1 = "keyword"; + const DEFAULT_KEYWORD_SCOPE = "keyword"; /** * Given raw keywords from a language definition, compile them. * * @param {string | Record | Array} rawKeywords * @param {boolean} caseInsensitive */ - function compileKeywords$1(rawKeywords, caseInsensitive, scopeName = DEFAULT_KEYWORD_SCOPE$1) { + function compileKeywords(rawKeywords, caseInsensitive, scopeName = DEFAULT_KEYWORD_SCOPE) { /** @type {import("highlight.js/private").KeywordDict} */ const compiledKeywords = Object.create(null); if (typeof rawKeywords === "string") { @@ -138722,7 +138926,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { compileList(scopeName, rawKeywords); } else { Object.keys(rawKeywords).forEach(function(scopeName$1) { - Object.assign(compiledKeywords, compileKeywords$1(rawKeywords[scopeName$1], caseInsensitive, scopeName$1)); + Object.assign(compiledKeywords, compileKeywords(rawKeywords[scopeName$1], caseInsensitive, scopeName$1)); }); } return compiledKeywords; @@ -138740,7 +138944,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } keywordList.forEach(function(keyword) { const pair = keyword.split("|"); - compiledKeywords[pair[0]] = [scopeName$1, scoreForKeyword$1(pair[0], pair[1])]; + compiledKeywords[pair[0]] = [scopeName$1, scoreForKeyword(pair[0], pair[1])]; }); } } @@ -138752,49 +138956,49 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} keyword * @param {string} [providedScore] */ - function scoreForKeyword$1(keyword, providedScore) { + function scoreForKeyword(keyword, providedScore) { if (providedScore) { return Number(providedScore); } - return commonKeyword$1(keyword) ? 0 : 1; + return commonKeyword(keyword) ? 0 : 1; } /** * Determines if a given keyword is common or not * * @param {string} keyword */ - function commonKeyword$1(keyword) { - return COMMON_KEYWORDS$1.includes(keyword.toLowerCase()); + function commonKeyword(keyword) { + return COMMON_KEYWORDS.includes(keyword.toLowerCase()); } /** * @type {Record} */ - const seenDeprecations$1 = {}; + const seenDeprecations = {}; /** * @param {string} message */ - const error$1 = (message) => { + const error = (message) => { console.error(message); }; /** * @param {string} message * @param {any} args */ - const warn$1 = (message, ...args) => { + const warn = (message, ...args) => { console.log(`WARN: ${message}`, ...args); }; /** * @param {string} version * @param {string} message */ - const deprecated$1 = (version$6, message) => { - if (seenDeprecations$1[`${version$6}/${message}`]) return; - console.log(`Deprecated as of ${version$6}. ${message}`); - seenDeprecations$1[`${version$6}/${message}`] = true; + const deprecated = (version$4, message) => { + if (seenDeprecations[`${version$4}/${message}`]) return; + console.log(`Deprecated as of ${version$4}. ${message}`); + seenDeprecations[`${version$4}/${message}`] = true; }; /** @typedef {import('highlight.js').CompiledMode} CompiledMode */ - const MultiClassError$1 = new Error(); + const MultiClassError = new Error(); /** * Renumbers labeled scope names to account for additional inner match * groups that otherwise would break everything. @@ -138823,7 +139027,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Array} regexes * @param {{key: "beginScope"|"endScope"}} opts */ - function remapScopeNames$1(mode, regexes, { key }) { + function remapScopeNames(mode, regexes, { key }) { let offset = 0; const scopeNames = mode[key]; /** @type Record */ @@ -138833,7 +139037,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { for (let i$7 = 1; i$7 <= regexes.length; i$7++) { positions[i$7 + offset] = scopeNames[i$7]; emit[i$7 + offset] = true; - offset += countMatchGroups$1(regexes[i$7 - 1]); + offset += countMatchGroups(regexes[i$7 - 1]); } mode[key] = positions; mode[key]._emit = emit; @@ -138842,34 +139046,34 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** * @param {CompiledMode} mode */ - function beginMultiClass$1(mode) { + function beginMultiClass(mode) { if (!Array.isArray(mode.begin)) return; if (mode.skip || mode.excludeBegin || mode.returnBegin) { - error$1("skip, excludeBegin, returnBegin not compatible with beginScope: {}"); - throw MultiClassError$1; + error("skip, excludeBegin, returnBegin not compatible with beginScope: {}"); + throw MultiClassError; } if (typeof mode.beginScope !== "object" || mode.beginScope === null) { - error$1("beginScope must be object"); - throw MultiClassError$1; + error("beginScope must be object"); + throw MultiClassError; } - remapScopeNames$1(mode, mode.begin, { key: "beginScope" }); - mode.begin = _rewriteBackreferences$1(mode.begin, { joinWith: "" }); + remapScopeNames(mode, mode.begin, { key: "beginScope" }); + mode.begin = _rewriteBackreferences(mode.begin, { joinWith: "" }); } /** * @param {CompiledMode} mode */ - function endMultiClass$1(mode) { + function endMultiClass(mode) { if (!Array.isArray(mode.end)) return; if (mode.skip || mode.excludeEnd || mode.returnEnd) { - error$1("skip, excludeEnd, returnEnd not compatible with endScope: {}"); - throw MultiClassError$1; + error("skip, excludeEnd, returnEnd not compatible with endScope: {}"); + throw MultiClassError; } if (typeof mode.endScope !== "object" || mode.endScope === null) { - error$1("endScope must be object"); - throw MultiClassError$1; + error("endScope must be object"); + throw MultiClassError; } - remapScopeNames$1(mode, mode.end, { key: "endScope" }); - mode.end = _rewriteBackreferences$1(mode.end, { joinWith: "" }); + remapScopeNames(mode, mode.end, { key: "endScope" }); + mode.end = _rewriteBackreferences(mode.end, { joinWith: "" }); } /** * this exists only to allow `scope: {}` to be used beside `match:` @@ -138882,7 +139086,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {CompiledMode} mode */ - function scopeSugar$1(mode) { + function scopeSugar(mode) { if (mode.scope && typeof mode.scope === "object" && mode.scope !== null) { mode.beginScope = mode.scope; delete mode.scope; @@ -138891,16 +139095,16 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** * @param {CompiledMode} mode */ - function MultiClass$1(mode) { - scopeSugar$1(mode); + function MultiClass(mode) { + scopeSugar(mode); if (typeof mode.beginScope === "string") { mode.beginScope = { _wrap: mode.beginScope }; } if (typeof mode.endScope === "string") { mode.endScope = { _wrap: mode.endScope }; } - beginMultiClass$1(mode); - endMultiClass$1(mode); + beginMultiClass(mode); + endMultiClass(mode); } /** @typedef {import('highlight.js').Mode} Mode @@ -138917,7 +139121,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Language} language * @returns {CompiledLanguage} */ - function compileLanguage$1(language) { + function compileLanguage(language) { /** * Builds a regex with the case sensitivity of the current language * @@ -138925,7 +139129,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {boolean} [global] */ function langRe(value, global$1) { - return new RegExp(source$3(value), "m" + (language.case_insensitive ? "i" : "") + (language.unicodeRegex ? "u" : "") + (global$1 ? "g" : "")); + return new RegExp(source(value), "m" + (language.case_insensitive ? "i" : "") + (language.unicodeRegex ? "u" : "") + (global$1 ? "g" : "")); } /** Stores multiple regular expressions and allows you to quickly search for @@ -138951,14 +139155,14 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { opts.position = this.position++; this.matchIndexes[this.matchAt] = opts; this.regexes.push([opts, re$1]); - this.matchAt += countMatchGroups$1(re$1) + 1; + this.matchAt += countMatchGroups(re$1) + 1; } compile() { if (this.regexes.length === 0) { this.exec = () => null; } const terminators = this.regexes.map((el) => el[1]); - this.matcherRe = langRe(_rewriteBackreferences$1(terminators, { joinWith: "|" }), true); + this.matcherRe = langRe(_rewriteBackreferences(terminators, { joinWith: "|" }), true); this.lastIndex = 0; } /** @param {string} s */ @@ -139085,17 +139289,17 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { const cmode = mode; if (mode.isCompiled) return cmode; [ - scopeClassName$1, - compileMatch$1, - MultiClass$1, - beforeMatchExt$1 + scopeClassName, + compileMatch, + MultiClass, + beforeMatchExt ].forEach((ext) => ext(mode, parent)); language.compilerExtensions.forEach((ext) => ext(mode, parent)); mode.__beforeBegin = null; [ - beginKeywords$1, - compileIllegal$1, - compileRelevance$1 + beginKeywords, + compileIllegal, + compileRelevance ].forEach((ext) => ext(mode, parent)); mode.isCompiled = true; let keywordPattern = null; @@ -139106,7 +139310,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } keywordPattern = keywordPattern || /\w+/; if (mode.keywords) { - mode.keywords = compileKeywords$1(mode.keywords, language.case_insensitive); + mode.keywords = compileKeywords(mode.keywords, language.case_insensitive); } cmode.keywordPatternRe = langRe(keywordPattern, true); if (parent) { @@ -139114,7 +139318,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { cmode.beginRe = langRe(cmode.begin); if (!mode.end && !mode.endsWithParent) mode.end = /\B|\b/; if (mode.end) cmode.endRe = langRe(cmode.end); - cmode.terminatorEnd = source$3(cmode.end) || ""; + cmode.terminatorEnd = source(cmode.end) || ""; if (mode.endsWithParent && parent.terminatorEnd) { cmode.terminatorEnd += (mode.end ? "|" : "") + parent.terminatorEnd; } @@ -139124,13 +139328,13 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { mode.illegal ); if (!mode.contains) mode.contains = []; - mode.contains = [].concat(...mode.contains.map(function(c$7) { - return expandOrCloneMode$1(c$7 === "self" ? mode : c$7); + mode.contains = [].concat(...mode.contains.map(function(c$6) { + return expandOrCloneMode(c$6 === "self" ? mode : c$6); })); - mode.contains.forEach(function(c$7) { + mode.contains.forEach(function(c$6) { compileMode( /** @type Mode */ - c$7, + c$6, cmode ); }); @@ -139144,7 +139348,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (language.contains && language.contains.includes("self")) { throw new Error("ERR: contains `self` is not supported at the top-level of a language. See documentation."); } - language.classNameAliases = inherit$1$1(language.classNameAliases || {}); + language.classNameAliases = inherit$1(language.classNameAliases || {}); return compileMode( /** @type Mode */ language @@ -139161,9 +139365,9 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Mode | null} mode * @returns {boolean} - is there a dependency on the parent? * */ - function dependencyOnParent$1(mode) { + function dependencyOnParent(mode) { if (!mode) return false; - return mode.endsWithParent || dependencyOnParent$1(mode.starts); + return mode.endsWithParent || dependencyOnParent(mode.starts); } /** * Expands a mode or clones it if necessary @@ -139175,25 +139379,25 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Mode} mode * @returns {Mode | Mode[]} * */ - function expandOrCloneMode$1(mode) { + function expandOrCloneMode(mode) { if (mode.variants && !mode.cachedVariants) { mode.cachedVariants = mode.variants.map(function(variant) { - return inherit$1$1(mode, { variants: null }, variant); + return inherit$1(mode, { variants: null }, variant); }); } if (mode.cachedVariants) { return mode.cachedVariants; } - if (dependencyOnParent$1(mode)) { - return inherit$1$1(mode, { starts: mode.starts ? inherit$1$1(mode.starts) : null }); + if (dependencyOnParent(mode)) { + return inherit$1(mode, { starts: mode.starts ? inherit$1(mode.starts) : null }); } if (Object.isFrozen(mode)) { - return inherit$1$1(mode); + return inherit$1(mode); } return mode; } - var version$1 = "11.11.1"; - var HTMLInjectionError$1 = class extends Error { + var version = "11.11.1"; + var HTMLInjectionError = class extends Error { constructor(reason, html) { super(reason); this.name = "HTMLInjectionError"; @@ -139220,15 +139424,15 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { @typedef {import('highlight.js').HighlightOptions} HighlightOptions @typedef {import('highlight.js').HighlightResult} HighlightResult */ - const escape$3 = escapeHTML$2; - const inherit$2 = inherit$1$1; - const NO_MATCH$1 = Symbol("nomatch"); - const MAX_KEYWORD_HITS$1 = 7; + const escape = escapeHTML; + const inherit = inherit$1; + const NO_MATCH = Symbol("nomatch"); + const MAX_KEYWORD_HITS = 7; /** * @param {any} hljs - object that is extended (legacy) * @returns {HLJSApi} */ - const HLJS$1 = function(hljs$1) { + const HLJS = function(hljs) { /** @type {Record} */ const languages = Object.create(null); /** @type {Record} */ @@ -139252,7 +139456,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { classPrefix: "hljs-", cssSelector: "pre code", languages: null, - __emitter: TokenTreeEmitter$1 + __emitter: TokenTreeEmitter }; /** * Tests a language name to see if highlighting should be skipped @@ -139271,8 +139475,8 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (match) { const language = getLanguage(match[1]); if (!language) { - warn$1(LANGUAGE_NOT_FOUND.replace("{}", match[1])); - warn$1("Falling back to no-highlight mode for this block.", block); + warn(LANGUAGE_NOT_FOUND.replace("{}", match[1])); + warn("Falling back to no-highlight mode for this block.", block); } return language ? match[1] : "no-highlight"; } @@ -139299,7 +139503,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @property {CompiledMode} top - top of the current mode stack * @property {boolean} illegal - indicates whether any illegal matches were found */ - function highlight$2(codeOrLanguageName, optionsOrCode, ignoreIllegals) { + function highlight(codeOrLanguageName, optionsOrCode, ignoreIllegals) { let code = ""; let languageName = ""; if (typeof optionsOrCode === "object") { @@ -139307,8 +139511,8 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { ignoreIllegals = optionsOrCode.ignoreIllegals; languageName = optionsOrCode.language; } else { - deprecated$1("10.7.0", "highlight(lang, code, ...args) has been deprecated."); - deprecated$1("10.7.0", "Please use highlight(code, options) instead.\nhttps://github.com/highlightjs/highlight.js/issues/2277"); + deprecated("10.7.0", "highlight(lang, code, ...args) has been deprecated."); + deprecated("10.7.0", "Please use highlight(code, options) instead.\nhttps://github.com/highlightjs/highlight.js/issues/2277"); languageName = codeOrLanguageName; code = optionsOrCode; } @@ -139364,7 +139568,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { emitter.addText(buf); buf = ""; keywordHits[word] = (keywordHits[word] || 0) + 1; - if (keywordHits[word] <= MAX_KEYWORD_HITS$1) relevance += keywordRelevance; + if (keywordHits[word] <= MAX_KEYWORD_HITS) relevance += keywordRelevance; if (kind.startsWith("_")) { buf += match[0]; } else { @@ -139468,10 +139672,10 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @returns {CompiledMode | void} - the next mode, or if void continue on in current mode */ function endOfMode(mode, match, matchPlusRemainder) { - let matched = startsWith$1(mode.endRe, matchPlusRemainder); + let matched = startsWith(mode.endRe, matchPlusRemainder); if (matched) { if (mode["on:end"]) { - const resp = new Response$2(mode); + const resp = new Response(mode); mode["on:end"](match, resp); if (resp.isMatchIgnored) matched = false; } @@ -139509,7 +139713,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { function doBeginMatch(match) { const lexeme = match[0]; const newMode = match.rule; - const resp = new Response$2(newMode); + const resp = new Response(newMode); const beforeCallbacks = [newMode.__beforeBegin, newMode["on:begin"]]; for (const cb of beforeCallbacks) { if (!cb) continue; @@ -139540,7 +139744,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { const matchPlusRemainder = codeToHighlight.substring(match.index); const endMode = endOfMode(top, match, matchPlusRemainder); if (!endMode) { - return NO_MATCH$1; + return NO_MATCH; } const origin = top; if (top.endScope && top.endScope._wrap) { @@ -139619,7 +139823,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { throw err; } else if (match.type === "end") { const processed = doEndMatch(match); - if (processed !== NO_MATCH$1) { + if (processed !== NO_MATCH) { return processed; } } @@ -139636,10 +139840,10 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } const language = getLanguage(languageName); if (!language) { - error$1(LANGUAGE_NOT_FOUND.replace("{}", languageName)); + error(LANGUAGE_NOT_FOUND.replace("{}", languageName)); throw new Error("Unknown language: \"" + languageName + "\""); } - const md = compileLanguage$1(language); + const md = compileLanguage(language); let result = ""; /** @type {CompiledMode} */ let top = continuation || md; @@ -139687,7 +139891,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (err.message && err.message.includes("Illegal")) { return { language: languageName, - value: escape$3(codeToHighlight), + value: escape(codeToHighlight), illegal: true, relevance: 0, _illegalBy: { @@ -139702,7 +139906,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { } else if (SAFE_MODE) { return { language: languageName, - value: escape$3(codeToHighlight), + value: escape(codeToHighlight), illegal: false, relevance: 0, errorRaised: err, @@ -139723,7 +139927,7 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { */ function justTextHighlightResult(code) { const result = { - value: escape$3(code), + value: escape(code), illegal: false, relevance: 0, _top: PLAINTEXT_LANGUAGE, @@ -139748,9 +139952,9 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { */ function highlightAuto(code, languageSubset) { languageSubset = languageSubset || options.languages || Object.keys(languages); - const plaintext$1 = justTextHighlightResult(code); + const plaintext = justTextHighlightResult(code); const results = languageSubset.filter(getLanguage).filter(autoDetection).map((name) => _highlight(name, code, false)); - results.unshift(plaintext$1); + results.unshift(plaintext); const sorted = results.sort((a$2, b$3) => { if (a$2.relevance !== b$3.relevance) return b$3.relevance - a$2.relevance; if (a$2.language && b$3.language) { @@ -139806,13 +140010,13 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { console.warn(element); } if (options.throwUnescapedHTML) { - const err = new HTMLInjectionError$1("One of your code blocks includes unescaped HTML.", element.innerHTML); + const err = new HTMLInjectionError("One of your code blocks includes unescaped HTML.", element.innerHTML); throw err; } } node = element; const text$2 = node.textContent; - const result = language ? highlight$2(text$2, { + const result = language ? highlight(text$2, { language, ignoreIllegals: true }) : highlightAuto(text$2); @@ -139842,15 +140046,15 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {Partial} userOptions */ function configure(userOptions) { - options = inherit$2(options, userOptions); + options = inherit(options, userOptions); } const initHighlighting = () => { highlightAll(); - deprecated$1("10.6.0", "initHighlighting() deprecated. Use highlightAll() now."); + deprecated("10.6.0", "initHighlighting() deprecated. Use highlightAll() now."); }; function initHighlightingOnLoad() { highlightAll(); - deprecated$1("10.6.0", "initHighlightingOnLoad() deprecated. Use highlightAll() now."); + deprecated("10.6.0", "initHighlightingOnLoad() deprecated. Use highlightAll() now."); } let wantsHighlight = false; /** @@ -139879,19 +140083,19 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { function registerLanguage(languageName, languageDefinition) { let lang = null; try { - lang = languageDefinition(hljs$1); - } catch (error$1$1) { - error$1("Language definition for '{}' could not be registered.".replace("{}", languageName)); + lang = languageDefinition(hljs); + } catch (error$1) { + error("Language definition for '{}' could not be registered.".replace("{}", languageName)); if (!SAFE_MODE) { - throw error$1$1; + throw error$1; } else { - error$1(error$1$1); + error(error$1); } lang = PLAINTEXT_LANGUAGE; } if (!lang.name) lang.name = languageName; languages[languageName] = lang; - lang.rawDefinition = languageDefinition.bind(null, hljs$1); + lang.rawDefinition = languageDefinition.bind(null, hljs); if (lang.aliases) { registerAliases(lang.aliases, { languageName }); } @@ -139995,12 +140199,12 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {HighlightedHTMLElement} el */ function deprecateHighlightBlock(el) { - deprecated$1("10.7.0", "highlightBlock will be removed entirely in v12.0"); - deprecated$1("10.7.0", "Please use highlightElement now."); + deprecated("10.7.0", "highlightBlock will be removed entirely in v12.0"); + deprecated("10.7.0", "Please use highlightElement now."); return highlightElement(el); } - Object.assign(hljs$1, { - highlight: highlight$2, + Object.assign(hljs, { + highlight, highlightAuto, highlightAll, highlightElement, @@ -140014,44 +140218,44 @@ var require_core$1 = /* @__PURE__ */ __commonJSMin(((exports, module) => { getLanguage, registerAliases, autoDetection, - inherit: inherit$2, + inherit, addPlugin, removePlugin }); - hljs$1.debugMode = function() { + hljs.debugMode = function() { SAFE_MODE = false; }; - hljs$1.safeMode = function() { + hljs.safeMode = function() { SAFE_MODE = true; }; - hljs$1.versionString = version$1; - hljs$1.regex = { - concat: concat$3, - lookahead: lookahead$3, - either: either$3, - optional: optional$1, - anyNumberOfTimes: anyNumberOfTimes$1 + hljs.versionString = version; + hljs.regex = { + concat, + lookahead, + either, + optional, + anyNumberOfTimes }; - for (const key in MODES$6) { - if (typeof MODES$6[key] === "object") { - deepFreeze$1(MODES$6[key]); + for (const key in MODES) { + if (typeof MODES[key] === "object") { + deepFreeze(MODES[key]); } } - Object.assign(hljs$1, MODES$6); - return hljs$1; + Object.assign(hljs, MODES); + return hljs; }; - const highlight$1 = HLJS$1({}); - highlight$1.newInstance = () => HLJS$1({}); - module.exports = highlight$1; - highlight$1.HighlightJS = highlight$1; - highlight$1.default = highlight$1; + const highlight = HLJS({}); + highlight.newInstance = () => HLJS({}); + module.exports = highlight; + highlight.HighlightJS = highlight; + highlight.default = highlight; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/1c.js var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function _1c(hljs$1) { - const UNDERSCORE_IDENT_RE$2 = "[A-Za-zА-Яа-яёЁ_][A-Za-zА-Яа-яёЁ_0-9]+"; + function _1c(hljs) { + const UNDERSCORE_IDENT_RE = "[A-Za-zА-Яа-яёЁ_][A-Za-zА-Яа-яёЁ_0-9]+"; const v7_keywords = "далее "; const v8_keywords = "возврат вызватьисключение выполнить для если и из или иначе иначеесли исключение каждого конецесли " + "конецпопытки конеццикла не новый перейти перем по пока попытка прервать продолжить тогда цикл экспорт "; const KEYWORD = v7_keywords + v8_keywords; @@ -140090,7 +140294,7 @@ var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { const v8_universal_collection = "comsafearray деревозначений массив соответствие списокзначений структура таблицазначений фиксированнаяструктура " + "фиксированноесоответствие фиксированныймассив "; const TYPE = v8_shared_object + v8_universal_collection; const LITERAL = "null истина ложь неопределено"; - const NUMBERS = hljs$1.inherit(hljs$1.NUMBER_MODE); + const NUMBERS = hljs.inherit(hljs.NUMBER_MODE); const STRINGS = { className: "string", begin: "\"|\\|", @@ -140112,13 +140316,13 @@ var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "punctuation", relevance: 0 }; - const COMMENTS = hljs$1.inherit(hljs$1.C_LINE_COMMENT_MODE); + const COMMENTS = hljs.inherit(hljs.C_LINE_COMMENT_MODE); const META = { className: "meta", begin: "#|&", end: "$", keywords: { - $pattern: UNDERSCORE_IDENT_RE$2, + $pattern: UNDERSCORE_IDENT_RE, keyword: KEYWORD + METAKEYWORD }, contains: [COMMENTS] @@ -140145,12 +140349,12 @@ var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { endsParent: true, contains: [{ className: "params", - begin: UNDERSCORE_IDENT_RE$2, + begin: UNDERSCORE_IDENT_RE, end: ",", excludeEnd: true, endsWithParent: true, keywords: { - $pattern: UNDERSCORE_IDENT_RE$2, + $pattern: UNDERSCORE_IDENT_RE, keyword: "знач", literal: LITERAL }, @@ -140160,13 +140364,13 @@ var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { DATE ] }, COMMENTS] - }, hljs$1.inherit(hljs$1.TITLE_MODE, { begin: UNDERSCORE_IDENT_RE$2 })] + }, hljs.inherit(hljs.TITLE_MODE, { begin: UNDERSCORE_IDENT_RE })] }; return { name: "1C:Enterprise", case_insensitive: true, keywords: { - $pattern: UNDERSCORE_IDENT_RE$2, + $pattern: UNDERSCORE_IDENT_RE, keyword: KEYWORD, built_in: BUILTIN, class: CLASS, @@ -140192,10 +140396,10 @@ var require__1c = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/abnf.js var require_abnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function abnf(hljs$1) { - const regex = hljs$1.regex; + function abnf(hljs) { + const regex = hljs.regex; const IDENT = /^[a-zA-Z][a-zA-Z0-9-]*/; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "ALPHA", "BIT", "CHAR", @@ -140213,7 +140417,7 @@ var require_abnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { "VCHAR", "WSP" ]; - const COMMENT$2 = hljs$1.COMMENT(/;/, /$/); + const COMMENT = hljs.COMMENT(/;/, /$/); const TERMINAL_BINARY = { scope: "symbol", match: /%b[0-1]+(-[0-1]+|(\.[0-1]+)+)?/ @@ -140241,17 +140445,17 @@ var require_abnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Augmented Backus-Naur Form", illegal: /[!@#$^&',?+~`|:]/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ ASSIGNMENT, RULE_DECLARATION, - COMMENT$2, + COMMENT, TERMINAL_BINARY, TERMINAL_DECIMAL, TERMINAL_HEXADECIMAL, CASE_SENSITIVITY, - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE ] }; } @@ -140262,8 +140466,8 @@ var require_abnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/accesslog.js var require_accesslog = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function accesslog(hljs$1) { - const regex = hljs$1.regex; + function accesslog(hljs) { + const regex = hljs.regex; const HTTP_VERBS = [ "GET", "POST", @@ -140337,18 +140541,18 @@ var require_accesslog = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/actionscript.js var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function actionscript(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /[a-zA-Z_$][a-zA-Z0-9_$]*/; - const PKG_NAME_RE = regex.concat(IDENT_RE$6, regex.concat("(\\.", IDENT_RE$6, ")*")); + function actionscript(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /[a-zA-Z_$][a-zA-Z0-9_$]*/; + const PKG_NAME_RE = regex.concat(IDENT_RE$2, regex.concat("(\\.", IDENT_RE$2, ")*")); const IDENT_FUNC_RETURN_TYPE_RE = /([*]|[a-zA-Z_$][a-zA-Z0-9_$]*)/; const AS3_REST_ARG_MODE = { className: "rest_arg", begin: /[.]{3}/, - end: IDENT_RE$6, + end: IDENT_RE$2, relevance: 10 }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "as", "break", "case", @@ -140400,7 +140604,7 @@ var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "while", "with" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null", @@ -140410,15 +140614,15 @@ var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "ActionScript", aliases: ["as"], keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2 }, contains: [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, { match: [ /\bpackage/, @@ -140434,7 +140638,7 @@ var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /\b(?:class|interface|extends|implements)/, /\s+/, - IDENT_RE$6 + IDENT_RE$2 ], className: { 1: "keyword", @@ -140453,23 +140657,23 @@ var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, illegal: /\S/, contains: [ - hljs$1.inherit(hljs$1.TITLE_MODE, { className: "title.function" }), + hljs.inherit(hljs.TITLE_MODE, { className: "title.function" }), { className: "params", begin: /\(/, end: /\)/, contains: [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, AS3_REST_ARG_MODE ] }, { begin: regex.concat(/:\s*/, IDENT_FUNC_RETURN_TYPE_RE) } ] }, - hljs$1.METHOD_GUARD + hljs.METHOD_GUARD ], illegal: /#/ }; @@ -140481,16 +140685,16 @@ var require_actionscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ada.js var require_ada = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function ada(hljs$1) { + function ada(hljs) { const INTEGER_RE = "\\d(_|\\d)*"; const EXPONENT_RE = "[eE][-+]?" + INTEGER_RE; const DECIMAL_LITERAL_RE = INTEGER_RE + "(\\." + INTEGER_RE + ")?" + "(" + EXPONENT_RE + ")?"; const BASED_INTEGER_RE = "\\w+"; const BASED_LITERAL_RE = INTEGER_RE + "#" + BASED_INTEGER_RE + "(\\." + BASED_INTEGER_RE + ")?" + "#" + "(" + EXPONENT_RE + ")?"; - const NUMBER_RE$2 = "\\b(" + BASED_LITERAL_RE + "|" + DECIMAL_LITERAL_RE + ")"; + const NUMBER_RE = "\\b(" + BASED_LITERAL_RE + "|" + DECIMAL_LITERAL_RE + ")"; const ID_REGEX = "[A-Za-z](_?[A-Za-z0-9.])*"; const BAD_CHARS = `[]\\{\\}%#'"`; - const COMMENTS = hljs$1.COMMENT("--", "$"); + const COMMENTS = hljs.COMMENT("--", "$"); const VAR_DECLS = { begin: "\\s+:\\s+", end: "\\s*(:=|;|\\)|=>|$)", @@ -140512,7 +140716,7 @@ var require_ada = /* @__PURE__ */ __commonJSMin(((exports, module) => { } ] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "abort", "else", "new", @@ -140589,7 +140793,7 @@ var require_ada = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Ada", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, literal: ["True", "False"] }, contains: [ @@ -140609,7 +140813,7 @@ var require_ada = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "number", - begin: NUMBER_RE$2, + begin: NUMBER_RE, relevance: 0 }, { @@ -140672,7 +140876,7 @@ var require_ada = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/angelscript.js var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function angelscript(hljs$1) { + function angelscript(hljs) { const builtInTypeMode = { className: "built_in", begin: "\\b(void|bool|int8|int16|int32|int64|int|uint8|uint16|uint32|uint64|uint|string|ref|array|double|float|auto|dictionary)" @@ -140689,7 +140893,7 @@ var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; builtInTypeMode.contains = [genericMode]; objectHandleMode.contains = [genericMode]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "for", "in|0", "break", @@ -140740,7 +140944,7 @@ var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "AngelScript", aliases: ["asc"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: "(^using\\s+[A-Za-z0-9_\\.]+;$|\\bfunction\\s*[^\\(])", contains: [ { @@ -140748,7 +140952,7 @@ var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "'", end: "'", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], relevance: 0 }, { @@ -140761,11 +140965,11 @@ var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], relevance: 0 }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "string", begin: "^\\s*\\[", @@ -140817,7 +141021,7 @@ var require_angelscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/apache.js var require_apache = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function apache(hljs$1) { + function apache(hljs) { const NUMBER_REF = { className: "number", begin: /[$%]\d+/ @@ -140839,7 +141043,7 @@ var require_apache = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["apacheconf"], case_insensitive: true, contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "section", begin: /<\/?/, @@ -140847,7 +141051,7 @@ var require_apache = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ IP_ADDRESS, PORT_NUMBER, - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { relevance: 0 }) + hljs.inherit(hljs.QUOTE_STRING_MODE, { relevance: 0 }) ] }, { @@ -140894,7 +141098,7 @@ var require_apache = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, IP_ADDRESS, NUMBER, - hljs$1.QUOTE_STRING_MODE + hljs.QUOTE_STRING_MODE ] } } @@ -140909,25 +141113,25 @@ var require_apache = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/applescript.js var require_applescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function applescript(hljs$1) { - const regex = hljs$1.regex; - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }); + function applescript(hljs) { + const regex = hljs.regex; + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }); const PARAMS = { className: "params", begin: /\(/, end: /\)/, contains: [ "self", - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, STRING ] }; - const COMMENT_MODE_1 = hljs$1.COMMENT(/--/, /$/); - const COMMENT_MODE_2 = hljs$1.COMMENT(/\(\*/, /\*\)/, { contains: ["self", COMMENT_MODE_1] }); + const COMMENT_MODE_1 = hljs.COMMENT(/--/, /$/); + const COMMENT_MODE_2 = hljs.COMMENT(/\(\*/, /\*\)/, { contains: ["self", COMMENT_MODE_1] }); const COMMENTS = [ COMMENT_MODE_1, COMMENT_MODE_2, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ]; const KEYWORD_PATTERNS = [ /apart from/, @@ -140979,7 +141183,7 @@ var require_applescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ STRING, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, { className: "built_in", begin: regex.concat(/\b/, regex.either(...BUILT_IN_PATTERNS), /\b/) @@ -140999,7 +141203,7 @@ var require_applescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { { beginKeywords: "on", illegal: /[${=;\n]/, - contains: [hljs$1.UNDERSCORE_TITLE_MODE, PARAMS] + contains: [hljs.UNDERSCORE_TITLE_MODE, PARAMS] }, ...COMMENTS ], @@ -141013,10 +141217,10 @@ var require_applescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/arcade.js var require_arcade = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function arcade(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = "[A-Za-z_][0-9A-Za-z_]*"; - const KEYWORDS$6 = { + function arcade(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = "[A-Za-z_][0-9A-Za-z_]*"; + const KEYWORDS$2 = { keyword: [ "break", "case", @@ -141311,7 +141515,7 @@ var require_arcade = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [ { begin: "\\b(0[bB][01]+)" }, { begin: "\\b(0[oO][0-7]+)" }, - { begin: hljs$1.C_NUMBER_RE } + { begin: hljs.C_NUMBER_RE } ], relevance: 0 }; @@ -141319,72 +141523,72 @@ var require_arcade = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "subst", begin: "\\$\\{", end: "\\}", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [] }; const TEMPLATE_STRING = { className: "string", begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }; SUBST.contains = [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, TEMPLATE_STRING, NUMBER, - hljs$1.REGEXP_MODE + hljs.REGEXP_MODE ]; - const PARAMS_CONTAINS = SUBST.contains.concat([hljs$1.C_BLOCK_COMMENT_MODE, hljs$1.C_LINE_COMMENT_MODE]); + const PARAMS_CONTAINS = SUBST.contains.concat([hljs.C_BLOCK_COMMENT_MODE, hljs.C_LINE_COMMENT_MODE]); return { name: "ArcGIS Arcade", case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, TEMPLATE_STRING, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, SYMBOL, NUMBER, { begin: /[{,]\s*/, relevance: 0, contains: [{ - begin: IDENT_RE$6 + "\\s*:", + begin: IDENT_RE$2 + "\\s*:", returnBegin: true, relevance: 0, contains: [{ className: "attr", - begin: IDENT_RE$6, + begin: IDENT_RE$2, relevance: 0 }] }] }, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(return)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(return)\\b)\\s*", keywords: "return", contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.REGEXP_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.REGEXP_MODE, { className: "function", - begin: "(\\(.*?\\)|" + IDENT_RE$6 + ")\\s*=>", + begin: "(\\(.*?\\)|" + IDENT_RE$2 + ")\\s*=>", returnBegin: true, end: "\\s*=>", contains: [{ className: "params", variants: [ - { begin: IDENT_RE$6 }, + { begin: IDENT_RE$2 }, { begin: /\(\s*\)/ }, { begin: /\(/, end: /\)/, excludeBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: PARAMS_CONTAINS } ] @@ -141397,9 +141601,9 @@ var require_arcade = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "function", end: /\{/, excludeEnd: true, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [hljs.inherit(hljs.TITLE_MODE, { className: "title.function", - begin: IDENT_RE$6 + begin: IDENT_RE$2 }), { className: "params", begin: /\(/, @@ -141422,9 +141626,9 @@ var require_arcade = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/arduino.js var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function cPlusPlus(hljs$1) { - const regex = hljs$1.regex; - const C_LINE_COMMENT_MODE$2 = hljs$1.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); + function cPlusPlus(hljs) { + const regex = hljs.regex; + const C_LINE_COMMENT_MODE = hljs.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); const DECLTYPE_AUTO_RE = "decltype\\(auto\\)"; const NAMESPACE_RE = "[a-zA-Z_]\\w*::"; const TEMPLATE_ARGUMENT_RE = "<[^<>]+>"; @@ -141441,14 +141645,14 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "(u8?|U|L)?\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "(u8?|U|L)?'(" + CHARACTER_ESCAPES + "|.)", end: "'", illegal: "." }, - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /(?:u8?|U|L)?R"([^()\\ ]{0,16})\(/, end: /\)([^()\\ ]{0,16})"/ }) @@ -141469,21 +141673,21 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\\\n/, relevance: 0 }, - hljs$1.inherit(STRINGS, { className: "string" }), + hljs.inherit(STRINGS, { className: "string" }), { className: "string", begin: /<.*?>/ }, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; - const TITLE_MODE$2 = { + const TITLE_MODE = { className: "title", - begin: regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE, + begin: regex.optional(NAMESPACE_RE) + hljs.IDENT_RE, relevance: 0 }; - const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE + "\\s*\\("; + const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs.IDENT_RE + "\\s*\\("; const RESERVED_KEYWORDS = [ "alignas", "alignof", @@ -141752,7 +141956,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { "vprintf", "vsprintf" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "NULL", "false", "nullopt", @@ -141763,7 +141967,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { const CPP_KEYWORDS = { type: RESERVED_TYPES, keyword: RESERVED_KEYWORDS, - literal: LITERALS$6, + literal: LITERALS$2, built_in: BUILT_IN, _type_hints: TYPE_HINTS }; @@ -141771,14 +141975,14 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function.dispatch", relevance: 0, keywords: { _hint: FUNCTION_HINTS }, - begin: regex.concat(/\b/, /(?!decltype)/, /(?!if)/, /(?!for)/, /(?!switch)/, /(?!while)/, hljs$1.IDENT_RE, regex.lookahead(/(<[^<>]+>|)\s*\(/)) + begin: regex.concat(/\b/, /(?!decltype)/, /(?!if)/, /(?!for)/, /(?!switch)/, /(?!while)/, hljs.IDENT_RE, regex.lookahead(/(<[^<>]+>|)\s*\(/)) }; const EXPRESSION_CONTAINS = [ FUNCTION_DISPATCH, PREPROCESSOR, CPP_PRIMITIVE_TYPES, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, NUMBERS, STRINGS ]; @@ -141824,7 +142028,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: FUNCTION_TITLE, returnBegin: true, - contains: [TITLE_MODE$2], + contains: [TITLE_MODE], relevance: 0 }, { @@ -141847,8 +142051,8 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: CPP_KEYWORDS, relevance: 0, contains: [ - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, CPP_PRIMITIVE_TYPES, @@ -141859,8 +142063,8 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [ "self", - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, CPP_PRIMITIVE_TYPES @@ -141869,8 +142073,8 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }, CPP_PRIMITIVE_TYPES, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, PREPROCESSOR ] }; @@ -141897,7 +142101,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: ["self", CPP_PRIMITIVE_TYPES] }, { - begin: hljs$1.IDENT_RE + "::", + begin: hljs.IDENT_RE + "::", keywords: CPP_KEYWORDS }, { @@ -141915,7 +142119,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; } /** @type LanguageFn */ - function arduino(hljs$1) { + function arduino(hljs) { const ARDUINO_KW = { type: [ "boolean", @@ -142282,7 +142486,7 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { "LOW" ] }; - const ARDUINO = cPlusPlus(hljs$1); + const ARDUINO = cPlusPlus(hljs); const kws = ARDUINO.keywords; kws.type = [...kws.type, ...ARDUINO_KW.type]; kws.literal = [...kws.literal, ...ARDUINO_KW.literal]; @@ -142300,22 +142504,22 @@ var require_arduino = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/armasm.js var require_armasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function armasm(hljs$1) { - const COMMENT$2 = { variants: [ - hljs$1.COMMENT("^[ \\t]*(?=#)", "$", { + function armasm(hljs) { + const COMMENT = { variants: [ + hljs.COMMENT("^[ \\t]*(?=#)", "$", { relevance: 0, excludeBegin: true }), - hljs$1.COMMENT("[;@]", "$", { relevance: 0 }), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.COMMENT("[;@]", "$", { relevance: 0 }), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; return { name: "ARM Assembly", case_insensitive: true, aliases: ["arm"], keywords: { - $pattern: "\\.?" + hljs$1.IDENT_RE, + $pattern: "\\.?" + hljs.IDENT_RE, meta: ".2byte .4byte .align .ascii .asciz .balign .byte .code .data .else .end .endif .endm .endr .equ .err .exitm .extern .global .hword .if .ifdef .ifndef .include .irp .long .macro .rept .req .section .set .skip .space .text .word .arm .thumb .code16 .code32 .force_thumb .thumb_func .ltorg " + "ALIAS ALIGN ARM AREA ASSERT ATTR CN CODE CODE16 CODE32 COMMON CP DATA DCB DCD DCDU DCDO DCFD DCFDU DCI DCQ DCQU DCW DCWU DN ELIF ELSE END ENDFUNC ENDIF ENDP ENTRY EQU EXPORT EXPORTAS EXTERN FIELD FILL FUNCTION GBLA GBLL GBLS GET GLOBAL IF IMPORT INCBIN INCLUDE INFO KEEP LCLA LCLL LCLS LTORG MACRO MAP MEND MEXIT NOFP OPT PRESERVE8 PROC QN READONLY RELOC REQUIRE REQUIRE8 RLIST FN ROUT SETA SETL SETS SN SPACE SUBT THUMB THUMBX TTL WHILE WEND ", built_in: "r0 r1 r2 r3 r4 r5 r6 r7 r8 r9 r10 r11 r12 r13 r14 r15 " + "w0 w1 w2 w3 w4 w5 w6 w7 w8 w9 w10 w11 w12 w13 w14 w15 " + "w16 w17 w18 w19 w20 w21 w22 w23 w24 w25 w26 w27 w28 w29 w30 " + "x0 x1 x2 x3 x4 x5 x6 x7 x8 x9 x10 x11 x12 x13 x14 x15 " + "x16 x17 x18 x19 x20 x21 x22 x23 x24 x25 x26 x27 x28 x29 x30 " + "pc lr sp ip sl sb fp " + "a1 a2 a3 a4 v1 v2 v3 v4 v5 v6 v7 v8 f0 f1 f2 f3 f4 f5 f6 f7 " + "p0 p1 p2 p3 p4 p5 p6 p7 p8 p9 p10 p11 p12 p13 p14 p15 " + "c0 c1 c2 c3 c4 c5 c6 c7 c8 c9 c10 c11 c12 c13 c14 c15 " + "q0 q1 q2 q3 q4 q5 q6 q7 q8 q9 q10 q11 q12 q13 q14 q15 " + "cpsr_c cpsr_x cpsr_s cpsr_f cpsr_cx cpsr_cxs cpsr_xs cpsr_xsf cpsr_sf cpsr_cxsf " + "spsr_c spsr_x spsr_s spsr_f spsr_cx spsr_cxs spsr_xs spsr_xsf spsr_sf spsr_cxsf " + "s0 s1 s2 s3 s4 s5 s6 s7 s8 s9 s10 s11 s12 s13 s14 s15 " + "s16 s17 s18 s19 s20 s21 s22 s23 s24 s25 s26 s27 s28 s29 s30 s31 " + "d0 d1 d2 d3 d4 d5 d6 d7 d8 d9 d10 d11 d12 d13 d14 d15 " + "d16 d17 d18 d19 d20 d21 d22 d23 d24 d25 d26 d27 d28 d29 d30 d31 " + "{PC} {VAR} {TRUE} {FALSE} {OPT} {CONFIG} {ENDIAN} {CODESIZE} {CPU} {FPU} {ARCHITECTURE} {PCSTOREOFFSET} {ARMASM_VERSION} {INTER} {ROPI} {RWPI} {SWST} {NOSWST} . @" }, @@ -142324,8 +142528,8 @@ var require_armasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "keyword", begin: "\\b(" + "adc|" + "(qd?|sh?|u[qh]?)?add(8|16)?|usada?8|(q|sh?|u[qh]?)?(as|sa)x|" + "and|adrl?|sbc|rs[bc]|asr|b[lx]?|blx|bxj|cbn?z|tb[bh]|bic|" + "bfc|bfi|[su]bfx|bkpt|cdp2?|clz|clrex|cmp|cmn|cpsi[ed]|cps|" + "setend|dbg|dmb|dsb|eor|isb|it[te]{0,3}|lsl|lsr|ror|rrx|" + "ldm(([id][ab])|f[ds])?|ldr((s|ex)?[bhd])?|movt?|mvn|mra|mar|" + "mul|[us]mull|smul[bwt][bt]|smu[as]d|smmul|smmla|" + "mla|umlaal|smlal?([wbt][bt]|d)|mls|smlsl?[ds]|smc|svc|sev|" + "mia([bt]{2}|ph)?|mrr?c2?|mcrr2?|mrs|msr|orr|orn|pkh(tb|bt)|rbit|" + "rev(16|sh)?|sel|[su]sat(16)?|nop|pop|push|rfe([id][ab])?|" + "stm([id][ab])?|str(ex)?[bhd]?|(qd?)?sub|(sh?|q|u[qh]?)?sub(8|16)|" + "[su]xt(a?h|a?b(16)?)|srs([id][ab])?|swpb?|swi|smi|tst|teq|" + "wfe|wfi|yield" + ")" + "(eq|ne|cs|cc|mi|pl|vs|vc|hi|ls|ge|lt|gt|le|al|hs|lo)?" + "[sptrx]?" + "(?=\\s)" }, - COMMENT$2, - hljs$1.QUOTE_STRING_MODE, + COMMENT, + hljs.QUOTE_STRING_MODE, { className: "string", begin: "'", @@ -142368,8 +142572,8 @@ var require_armasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/xml.js var require_xml = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function xml$1(hljs$1) { - const regex = hljs$1.regex; + function xml(hljs) { + const regex = hljs.regex; const TAG_NAME_RE = regex.concat(/[\p{L}_]/u, regex.optional(/[\p{L}0-9_.-]*:/u), /[\p{L}0-9_.-]*/u); const XML_IDENT_RE = /[\p{L}0-9._:-]+/u; const XML_ENTITIES = { @@ -142384,12 +142588,12 @@ var require_xml = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /\n/ }] }; - const XML_META_PAR_KEYWORDS = hljs$1.inherit(XML_META_KEYWORDS, { + const XML_META_PAR_KEYWORDS = hljs.inherit(XML_META_KEYWORDS, { begin: /\(/, end: /\)/ }); - const APOS_META_STRING_MODE = hljs$1.inherit(hljs$1.APOS_STRING_MODE, { className: "string" }); - const QUOTE_META_STRING_MODE = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { className: "string" }); + const APOS_META_STRING_MODE = hljs.inherit(hljs.APOS_STRING_MODE, { className: "string" }); + const QUOTE_META_STRING_MODE = hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string" }); const TAG_INTERNALS = { endsWithParent: true, illegal: / { } ] }, - hljs$1.COMMENT(//, { relevance: 10 }), + hljs.COMMENT(//, { relevance: 10 }), { begin: //, @@ -142539,15 +142743,15 @@ var require_xml = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; } - module.exports = xml$1; + module.exports = xml; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/asciidoc.js var require_asciidoc = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function asciidoc(hljs$1) { - const regex = hljs$1.regex; + function asciidoc(hljs) { + const regex = hljs.regex; const HORIZONTAL_RULE = { begin: "^'{3,}[ \\t]*$", relevance: 10 @@ -142620,8 +142824,8 @@ var require_asciidoc = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "AsciiDoc", aliases: ["adoc"], contains: [ - hljs$1.COMMENT("^/{4,}\\n", "\\n/{4,}$", { relevance: 10 }), - hljs$1.COMMENT("^//", "$", { relevance: 0 }), + hljs.COMMENT("^/{4,}\\n", "\\n/{4,}$", { relevance: 10 }), + hljs.COMMENT("^//", "$", { relevance: 0 }), { className: "title", begin: "^\\.\\w.*$" @@ -142732,9 +142936,9 @@ var require_asciidoc = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/aspectj.js var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function aspectj(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = [ + function aspectj(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = [ "false", "synchronized", "int", @@ -142818,10 +143022,10 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; return { name: "AspectJ", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /<\/|#/, contains: [ - hljs$1.COMMENT(/\/\*\*/, /\*\//, { + hljs.COMMENT(/\/\*\*/, /\*\//, { relevance: 0, contains: [{ begin: /\w+@/, @@ -142831,10 +143035,10 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /@[A-Za-z]+/ }] }), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "class", beginKeywords: "aspect", @@ -142843,11 +143047,11 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /[:;"\[\]]/, contains: [ { beginKeywords: "extends implements pertypewithin perthis pertarget percflowbelow percflow issingleton" }, - hljs$1.UNDERSCORE_TITLE_MODE, + hljs.UNDERSCORE_TITLE_MODE, { begin: /\([^\)]*/, end: /[)]+/, - keywords: KEYWORDS$6.concat(SHORTKEYS), + keywords: KEYWORDS$2.concat(SHORTKEYS), excludeEnd: false } ] @@ -142860,7 +143064,7 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, keywords: "class interface", illegal: /[:"\[\]]/, - contains: [{ beginKeywords: "extends implements" }, hljs$1.UNDERSCORE_TITLE_MODE] + contains: [{ beginKeywords: "extends implements" }, hljs.UNDERSCORE_TITLE_MODE] }, { beginKeywords: "pointcut after before around throwing returning", @@ -142868,9 +143072,9 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: false, illegal: /["\[\]]/, contains: [{ - begin: regex.concat(hljs$1.UNDERSCORE_IDENT_RE, /\s*\(/), + begin: regex.concat(hljs.UNDERSCORE_IDENT_RE, /\s*\(/), returnBegin: true, - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }] }, { @@ -142879,13 +143083,13 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[{;]/, relevance: 0, excludeEnd: false, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /["\[\]]/, contains: [{ - begin: regex.concat(hljs$1.UNDERSCORE_IDENT_RE, /\s*\(/), - keywords: KEYWORDS$6.concat(SHORTKEYS), + begin: regex.concat(hljs.UNDERSCORE_IDENT_RE, /\s*\(/), + keywords: KEYWORDS$2.concat(SHORTKEYS), relevance: 0 - }, hljs$1.QUOTE_STRING_MODE] + }, hljs.QUOTE_STRING_MODE] }, { beginKeywords: "new throw", @@ -142896,33 +143100,33 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\w+ +\w+(\.\w+)?\s*\([^\)]*\)\s*((throws)[\w\s,]+)?[\{;]/, returnBegin: true, end: /[{;=]/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, excludeEnd: true, contains: [ { - begin: regex.concat(hljs$1.UNDERSCORE_IDENT_RE, /\s*\(/), + begin: regex.concat(hljs.UNDERSCORE_IDENT_RE, /\s*\(/), returnBegin: true, relevance: 0, - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }, { className: "params", begin: /\(/, end: /\)/, relevance: 0, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, { className: "meta", begin: /@[A-Za-z]+/ @@ -142937,7 +143141,7 @@ var require_aspectj = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/autohotkey.js var require_autohotkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function autohotkey(hljs$1) { + function autohotkey(hljs) { const BACKTICK_ESCAPE = { begin: "`[\\s\\S]" }; return { name: "AutoHotkey", @@ -142950,12 +143154,12 @@ var require_autohotkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ BACKTICK_ESCAPE, - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { contains: [BACKTICK_ESCAPE] }), - hljs$1.COMMENT(";", "$", { relevance: 0 }), - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.inherit(hljs.QUOTE_STRING_MODE, { contains: [BACKTICK_ESCAPE] }), + hljs.COMMENT(";", "$", { relevance: 0 }), + hljs.C_BLOCK_COMMENT_MODE, { className: "number", - begin: hljs$1.NUMBER_RE, + begin: hljs.NUMBER_RE, relevance: 0 }, { @@ -142994,8 +143198,8 @@ var require_autohotkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/autoit.js var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function autoit(hljs$1) { - const KEYWORDS$6 = "ByRef Case Const ContinueCase ContinueLoop " + "Dim Do Else ElseIf EndFunc EndIf EndSelect " + "EndSwitch EndWith Enum Exit ExitLoop For Func " + "Global If In Local Next ReDim Return Select Static " + "Step Switch Then To Until Volatile WEnd While With"; + function autoit(hljs) { + const KEYWORDS$2 = "ByRef Case Const ContinueCase ContinueLoop " + "Dim Do Else ElseIf EndFunc EndIf EndSelect " + "EndSwitch EndWith Enum Exit ExitLoop For Func " + "Global If In Local Next ReDim Return Select Static " + "Step Switch Then To Until Volatile WEnd While With"; const DIRECTIVES = [ "EndRegion", "forcedef", @@ -143014,10 +143218,10 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; const LITERAL = "True False And Null Not Or Default"; const BUILT_IN = "Abs ACos AdlibRegister AdlibUnRegister Asc AscW ASin Assign ATan AutoItSetOption AutoItWinGetTitle AutoItWinSetTitle Beep Binary BinaryLen BinaryMid BinaryToString BitAND BitNOT BitOR BitRotate BitShift BitXOR BlockInput Break Call CDTray Ceiling Chr ChrW ClipGet ClipPut ConsoleRead ConsoleWrite ConsoleWriteError ControlClick ControlCommand ControlDisable ControlEnable ControlFocus ControlGetFocus ControlGetHandle ControlGetPos ControlGetText ControlHide ControlListView ControlMove ControlSend ControlSetText ControlShow ControlTreeView Cos Dec DirCopy DirCreate DirGetSize DirMove DirRemove DllCall DllCallAddress DllCallbackFree DllCallbackGetPtr DllCallbackRegister DllClose DllOpen DllStructCreate DllStructGetData DllStructGetPtr DllStructGetSize DllStructSetData DriveGetDrive DriveGetFileSystem DriveGetLabel DriveGetSerial DriveGetType DriveMapAdd DriveMapDel DriveMapGet DriveSetLabel DriveSpaceFree DriveSpaceTotal DriveStatus EnvGet EnvSet EnvUpdate Eval Execute Exp FileChangeDir FileClose FileCopy FileCreateNTFSLink FileCreateShortcut FileDelete FileExists FileFindFirstFile FileFindNextFile FileFlush FileGetAttrib FileGetEncoding FileGetLongName FileGetPos FileGetShortcut FileGetShortName FileGetSize FileGetTime FileGetVersion FileInstall FileMove FileOpen FileOpenDialog FileRead FileReadLine FileReadToArray FileRecycle FileRecycleEmpty FileSaveDialog FileSelectFolder FileSetAttrib FileSetEnd FileSetPos FileSetTime FileWrite FileWriteLine Floor FtpSetProxy FuncName GUICreate GUICtrlCreateAvi GUICtrlCreateButton GUICtrlCreateCheckbox GUICtrlCreateCombo GUICtrlCreateContextMenu GUICtrlCreateDate GUICtrlCreateDummy GUICtrlCreateEdit GUICtrlCreateGraphic GUICtrlCreateGroup GUICtrlCreateIcon GUICtrlCreateInput GUICtrlCreateLabel GUICtrlCreateList GUICtrlCreateListView GUICtrlCreateListViewItem GUICtrlCreateMenu GUICtrlCreateMenuItem GUICtrlCreateMonthCal GUICtrlCreateObj GUICtrlCreatePic GUICtrlCreateProgress GUICtrlCreateRadio GUICtrlCreateSlider GUICtrlCreateTab GUICtrlCreateTabItem GUICtrlCreateTreeView GUICtrlCreateTreeViewItem GUICtrlCreateUpdown GUICtrlDelete GUICtrlGetHandle GUICtrlGetState GUICtrlRead GUICtrlRecvMsg GUICtrlRegisterListViewSort GUICtrlSendMsg GUICtrlSendToDummy GUICtrlSetBkColor GUICtrlSetColor GUICtrlSetCursor GUICtrlSetData GUICtrlSetDefBkColor GUICtrlSetDefColor GUICtrlSetFont GUICtrlSetGraphic GUICtrlSetImage GUICtrlSetLimit GUICtrlSetOnEvent GUICtrlSetPos GUICtrlSetResizing GUICtrlSetState GUICtrlSetStyle GUICtrlSetTip GUIDelete GUIGetCursorInfo GUIGetMsg GUIGetStyle GUIRegisterMsg GUISetAccelerators GUISetBkColor GUISetCoord GUISetCursor GUISetFont GUISetHelp GUISetIcon GUISetOnEvent GUISetState GUISetStyle GUIStartGroup GUISwitch Hex HotKeySet HttpSetProxy HttpSetUserAgent HWnd InetClose InetGet InetGetInfo InetGetSize InetRead IniDelete IniRead IniReadSection IniReadSectionNames IniRenameSection IniWrite IniWriteSection InputBox Int IsAdmin IsArray IsBinary IsBool IsDeclared IsDllStruct IsFloat IsFunc IsHWnd IsInt IsKeyword IsNumber IsObj IsPtr IsString Log MemGetStats Mod MouseClick MouseClickDrag MouseDown MouseGetCursor MouseGetPos MouseMove MouseUp MouseWheel MsgBox Number ObjCreate ObjCreateInterface ObjEvent ObjGet ObjName OnAutoItExitRegister OnAutoItExitUnRegister Ping PixelChecksum PixelGetColor PixelSearch ProcessClose ProcessExists ProcessGetStats ProcessList ProcessSetPriority ProcessWait ProcessWaitClose ProgressOff ProgressOn ProgressSet Ptr Random RegDelete RegEnumKey RegEnumVal RegRead RegWrite Round Run RunAs RunAsWait RunWait Send SendKeepActive SetError SetExtended ShellExecute ShellExecuteWait Shutdown Sin Sleep SoundPlay SoundSetWaveVolume SplashImageOn SplashOff SplashTextOn Sqrt SRandom StatusbarGetText StderrRead StdinWrite StdioClose StdoutRead String StringAddCR StringCompare StringFormat StringFromASCIIArray StringInStr StringIsAlNum StringIsAlpha StringIsASCII StringIsDigit StringIsFloat StringIsInt StringIsLower StringIsSpace StringIsUpper StringIsXDigit StringLeft StringLen StringLower StringMid StringRegExp StringRegExpReplace StringReplace StringReverse StringRight StringSplit StringStripCR StringStripWS StringToASCIIArray StringToBinary StringTrimLeft StringTrimRight StringUpper Tan TCPAccept TCPCloseSocket TCPConnect TCPListen TCPNameToIP TCPRecv TCPSend TCPShutdown, UDPShutdown TCPStartup, UDPStartup TimerDiff TimerInit ToolTip TrayCreateItem TrayCreateMenu TrayGetMsg TrayItemDelete TrayItemGetHandle TrayItemGetState TrayItemGetText TrayItemSetOnEvent TrayItemSetState TrayItemSetText TraySetClick TraySetIcon TraySetOnEvent TraySetPauseIcon TraySetState TraySetToolTip TrayTip UBound UDPBind UDPCloseSocket UDPOpen UDPRecv UDPSend VarGetType WinActivate WinActive WinClose WinExists WinFlash WinGetCaretPos WinGetClassList WinGetClientSize WinGetHandle WinGetPos WinGetProcess WinGetState WinGetText WinGetTitle WinKill WinList WinMenuSelectItem WinMinimizeAll WinMinimizeAllUndo WinMove WinSetOnTop WinSetState WinSetTitle WinSetTrans WinWait WinWaitActive WinWaitClose WinWaitNotActive"; - const COMMENT$2 = { variants: [ - hljs$1.COMMENT(";", "$", { relevance: 0 }), - hljs$1.COMMENT("#cs", "#ce"), - hljs$1.COMMENT("#comments-start", "#comments-end") + const COMMENT = { variants: [ + hljs.COMMENT(";", "$", { relevance: 0 }), + hljs.COMMENT("#cs", "#ce"), + hljs.COMMENT("#comments-start", "#comments-end") ] }; const VARIABLE = { begin: "\\$[A-z0-9_]+" }; const STRING = { @@ -143038,7 +143242,7 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { }] }] }; - const NUMBER = { variants: [hljs$1.BINARY_NUMBER_MODE, hljs$1.C_NUMBER_MODE] }; + const NUMBER = { variants: [hljs.BINARY_NUMBER_MODE, hljs.C_NUMBER_MODE] }; const PREPROCESSOR = { className: "meta", begin: "#", @@ -143080,7 +143284,7 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { }] }, STRING, - COMMENT$2 + COMMENT ] }; const CONSTANT = { @@ -143091,7 +143295,7 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "Func", end: "$", illegal: "\\$|\\[|%", - contains: [hljs$1.inherit(hljs$1.UNDERSCORE_TITLE_MODE, { className: "title.function" }), { + contains: [hljs.inherit(hljs.UNDERSCORE_TITLE_MODE, { className: "title.function" }), { className: "params", begin: "\\(", end: "\\)", @@ -143107,12 +143311,12 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, illegal: /\/\*/, keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, built_in: BUILT_IN, literal: LITERAL }, contains: [ - COMMENT$2, + COMMENT, VARIABLE, STRING, NUMBER, @@ -143129,26 +143333,26 @@ var require_autoit = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/avrasm.js var require_avrasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function avrasm(hljs$1) { + function avrasm(hljs) { return { name: "AVR Assembly", case_insensitive: true, keywords: { - $pattern: "\\.?" + hljs$1.IDENT_RE, + $pattern: "\\.?" + hljs.IDENT_RE, keyword: "adc add adiw and andi asr bclr bld brbc brbs brcc brcs break breq brge brhc brhs " + "brid brie brlo brlt brmi brne brpl brsh brtc brts brvc brvs bset bst call cbi cbr " + "clc clh cli cln clr cls clt clv clz com cp cpc cpi cpse dec eicall eijmp elpm eor " + "fmul fmuls fmulsu icall ijmp in inc jmp ld ldd ldi lds lpm lsl lsr mov movw mul " + "muls mulsu neg nop or ori out pop push rcall ret reti rjmp rol ror sbc sbr sbrc sbrs " + "sec seh sbi sbci sbic sbis sbiw sei sen ser ses set sev sez sleep spm st std sts sub " + "subi swap tst wdr", built_in: "r0 r1 r2 r3 r4 r5 r6 r7 r8 r9 r10 r11 r12 r13 r14 r15 r16 r17 r18 r19 r20 r21 r22 " + "r23 r24 r25 r26 r27 r28 r29 r30 r31 x|0 xh xl y|0 yh yl z|0 zh zl " + "ucsr1c udr1 ucsr1a ucsr1b ubrr1l ubrr1h ucsr0c ubrr0h tccr3c tccr3a tccr3b tcnt3h " + "tcnt3l ocr3ah ocr3al ocr3bh ocr3bl ocr3ch ocr3cl icr3h icr3l etimsk etifr tccr1c " + "ocr1ch ocr1cl twcr twdr twar twsr twbr osccal xmcra xmcrb eicra spmcsr spmcr portg " + "ddrg ping portf ddrf sreg sph spl xdiv rampz eicrb eimsk gimsk gicr eifr gifr timsk " + "tifr mcucr mcucsr tccr0 tcnt0 ocr0 assr tccr1a tccr1b tcnt1h tcnt1l ocr1ah ocr1al " + "ocr1bh ocr1bl icr1h icr1l tccr2 tcnt2 ocr2 ocdr wdtcr sfior eearh eearl eedr eecr " + "porta ddra pina portb ddrb pinb portc ddrc pinc portd ddrd pind spdr spsr spcr udr0 " + "ucsr0a ucsr0b ubrr0l acsr admux adcsr adch adcl porte ddre pine pinf", meta: ".byte .cseg .db .def .device .dseg .dw .endmacro .equ .eseg .exit .include .list " + ".listmac .macro .nolist .org .set" }, contains: [ - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT(";", "$", { relevance: 0 }), - hljs$1.C_NUMBER_MODE, - hljs$1.BINARY_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT(";", "$", { relevance: 0 }), + hljs.C_NUMBER_MODE, + hljs.BINARY_NUMBER_MODE, { className: "number", begin: "\\b(\\$[a-zA-Z0-9]+|0o[0-7]+)" }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", begin: "'", @@ -143178,15 +143382,15 @@ var require_avrasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/awk.js var require_awk = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function awk(hljs$1) { + function awk(hljs) { const VARIABLE = { className: "variable", variants: [{ begin: /\$[\w\d#@][\w\d_]*/ }, { begin: /\$\{(.*?)\}/ }] }; - const KEYWORDS$6 = "BEGIN END if else while do for in break continue delete next nextfile function func exit|10"; + const KEYWORDS$2 = "BEGIN END if else while do for in break continue delete next nextfile function func exit|10"; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { begin: /(u|b)?r?'''/, @@ -143216,19 +143420,19 @@ var require_awk = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /(b|br)"/, end: /"/ }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ] }; return { name: "Awk", - keywords: { keyword: KEYWORDS$6 }, + keywords: { keyword: KEYWORDS$2 }, contains: [ VARIABLE, STRING, - hljs$1.REGEXP_MODE, - hljs$1.HASH_COMMENT_MODE, - hljs$1.NUMBER_MODE + hljs.REGEXP_MODE, + hljs.HASH_COMMENT_MODE, + hljs.NUMBER_MODE ] }; } @@ -143239,8 +143443,8 @@ var require_awk = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/axapta.js var require_axapta = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function axapta(hljs$1) { - const IDENT_RE$6 = hljs$1.UNDERSCORE_IDENT_RE; + function axapta(hljs) { + const IDENT_RE$2 = hljs.UNDERSCORE_IDENT_RE; const BUILT_IN_KEYWORDS = [ "anytype", "boolean", @@ -143368,7 +143572,7 @@ var require_axapta = /* @__PURE__ */ __commonJSMin(((exports, module) => { "where", "while" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: NORMAL_KEYWORDS, built_in: BUILT_IN_KEYWORDS, literal: LITERAL_KEYWORDS @@ -143376,26 +143580,26 @@ var require_axapta = /* @__PURE__ */ __commonJSMin(((exports, module) => { const CLASS_DEFINITION = { variants: [{ match: [ /(class|interface)\s+/, - IDENT_RE$6, + IDENT_RE$2, /\s+(extends|implements)\s+/, - IDENT_RE$6 - ] }, { match: [/class\s+/, IDENT_RE$6] }], + IDENT_RE$2 + ] }, { match: [/class\s+/, IDENT_RE$2] }], scope: { 2: "title.class", 4: "title.class.inherited" }, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; return { name: "X++", aliases: ["x++"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { className: "meta", begin: "#", @@ -143412,8 +143616,8 @@ var require_axapta = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/bash.js var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function bash$1(hljs$1) { - const regex = hljs$1.regex; + function bash(hljs) { + const regex = hljs.regex; const VAR = {}; const BRACED_VAR = { begin: /\$\{/, @@ -143431,15 +143635,15 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "subst", begin: /\$\(/, end: /\)/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; - const COMMENT$2 = hljs$1.inherit(hljs$1.COMMENT(), { + const COMMENT = hljs.inherit(hljs.COMMENT(), { match: [/(^|\s)/, /#.*$/], scope: { 2: "comment" } }); const HERE_DOC = { begin: /<<-?\s*(?=\w+)/, - starts: { contains: [hljs$1.END_SAME_AS_BEGIN({ + starts: { contains: [hljs.END_SAME_AS_BEGIN({ begin: /(\w+)/, end: /(\w+)/, className: "string" @@ -143450,7 +143654,7 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, VAR, SUBST ] @@ -143471,7 +143675,7 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\d+#[0-9a-f]+/, className: "number" }, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, VAR ] }; @@ -143486,7 +143690,7 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { "dash", "scsh" ]; - const KNOWN_SHEBANG = hljs$1.SHEBANG({ + const KNOWN_SHEBANG = hljs.SHEBANG({ binary: `(${SH_LIKE_SHELLS.join("|")})`, relevance: 10 }); @@ -143494,10 +143698,10 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", begin: /\w[\w\d_]*\s*\(\s*\)\s*\{/, returnBegin: true, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: /\w[\w\d_]*/ })], + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: /\w[\w\d_]*/ })], relevance: 0 }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "if", "then", "else", @@ -143516,7 +143720,7 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { "function", "select" ]; - const LITERALS$6 = ["true", "false"]; + const LITERALS$2 = ["true", "false"]; const PATH_MODE = { match: /(\/[a-z._-]+)+/ }; const SHELL_BUILT_INS = [ "break", @@ -143740,8 +143944,8 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["sh", "zsh"], keywords: { $pattern: /\b[a-z][a-z0-9._-]+\b/, - keyword: KEYWORDS$6, - literal: LITERALS$6, + keyword: KEYWORDS$2, + literal: LITERALS$2, built_in: [ ...SHELL_BUILT_INS, ...BASH_BUILT_INS, @@ -143753,10 +143957,10 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ KNOWN_SHEBANG, - hljs$1.SHEBANG(), + hljs.SHEBANG(), FUNCTION, ARITHMETIC, - COMMENT$2, + COMMENT, HERE_DOC, PATH_MODE, QUOTE_STRING, @@ -143767,15 +143971,15 @@ var require_bash = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; } - module.exports = bash$1; + module.exports = bash; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/basic.js var require_basic = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function basic(hljs$1) { - const KEYWORDS$6 = [ + function basic(hljs) { + const KEYWORDS$2 = [ "ABS", "ASC", "AND", @@ -143960,17 +144164,17 @@ var require_basic = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "^.", keywords: { $pattern: "[a-zA-Z][a-zA-Z0-9_$%!#]*", - keyword: KEYWORDS$6 + keyword: KEYWORDS$2 }, contains: [ { scope: "string", begin: /"/, end: /"|$/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, - hljs$1.COMMENT("REM", "$", { relevance: 10 }), - hljs$1.COMMENT("'", "$", { relevance: 0 }), + hljs.COMMENT("REM", "$", { relevance: 10 }), + hljs.COMMENT("'", "$", { relevance: 0 }), { className: "symbol", begin: "^[0-9]+ ", @@ -143999,7 +144203,7 @@ var require_basic = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/bnf.js var require_bnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function bnf(hljs$1) { + function bnf(hljs) { return { name: "Backus–Naur Form", contains: [{ @@ -144014,10 +144218,10 @@ var require_bnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: // }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ] }] }; @@ -144029,7 +144233,7 @@ var require_bnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/brainfuck.js var require_brainfuck = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function brainfuck(hljs$1) { + function brainfuck(hljs) { const LITERAL = { className: "literal", begin: /[+-]+/, @@ -144039,7 +144243,7 @@ var require_brainfuck = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Brainfuck", aliases: ["bf"], contains: [ - hljs$1.COMMENT(/[^\[\]\.,\+\-<> \r\n]/, /[\[\]\.,\+\-<> \r\n]/, { + hljs.COMMENT(/[^\[\]\.,\+\-<> \r\n]/, /[\[\]\.,\+\-<> \r\n]/, { contains: [{ match: /[ ]+[^\[\]\.,\+\-<> \r\n]/, relevance: 0 @@ -144072,14 +144276,14 @@ var require_brainfuck = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/c.js var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function c$1(hljs$1) { - const regex = hljs$1.regex; - const C_LINE_COMMENT_MODE$2 = hljs$1.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); + function c(hljs) { + const regex = hljs.regex; + const C_LINE_COMMENT_MODE = hljs.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); const DECLTYPE_AUTO_RE = "decltype\\(auto\\)"; const NAMESPACE_RE = "[a-zA-Z_]\\w*::"; const TEMPLATE_ARGUMENT_RE = "<[^<>]+>"; const FUNCTION_TYPE_RE = "(" + DECLTYPE_AUTO_RE + "|" + regex.optional(NAMESPACE_RE) + "[a-zA-Z_]\\w*" + regex.optional(TEMPLATE_ARGUMENT_RE) + ")"; - const TYPES$6 = { + const TYPES$2 = { className: "type", variants: [{ begin: "\\b[a-z\\d_]*_t\\b" }, { match: /\batomic_[a-z]{3,6}\b/ }] }; @@ -144091,14 +144295,14 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "(u8?|U|L)?\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "(u8?|U|L)?'(" + CHARACTER_ESCAPES + "|.)", end: "'", illegal: "." }, - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /(?:u8?|U|L)?R"([^()\\ ]{0,16})\(/, end: /\)([^()\\ ]{0,16})"/ }) @@ -144124,21 +144328,21 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\\\n/, relevance: 0 }, - hljs$1.inherit(STRINGS, { className: "string" }), + hljs.inherit(STRINGS, { className: "string" }), { className: "string", begin: /<.*?>/ }, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; - const TITLE_MODE$2 = { + const TITLE_MODE = { className: "title", - begin: regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE, + begin: regex.optional(NAMESPACE_RE) + hljs.IDENT_RE, relevance: 0 }; - const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE + "\\s*\\("; + const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs.IDENT_RE + "\\s*\\("; const C_KEYWORDS = [ "asm", "auto", @@ -144215,7 +144419,7 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { "bool", "imaginary" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: C_KEYWORDS, type: C_TYPES, literal: "true false NULL", @@ -144223,9 +144427,9 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const EXPRESSION_CONTAINS = [ PREPROCESSOR, - TYPES$6, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + TYPES$2, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, NUMBERS, STRINGS ]; @@ -144244,11 +144448,11 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /;/ } ], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: EXPRESSION_CONTAINS.concat([{ begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: EXPRESSION_CONTAINS.concat(["self"]), relevance: 0 }]), @@ -144259,18 +144463,18 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { returnBegin: true, end: /[{;=]/, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /[^\w\s\*&:<>.]/, contains: [ { begin: DECLTYPE_AUTO_RE, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0 }, { begin: FUNCTION_TITLE, returnBegin: true, - contains: [hljs$1.inherit(TITLE_MODE$2, { className: "title.function" })], + contains: [hljs.inherit(TITLE_MODE, { className: "title.function" })], relevance: 0 }, { @@ -144281,72 +144485,72 @@ var require_c = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, - TYPES$6, + TYPES$2, { begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ "self", - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, - TYPES$6 + TYPES$2 ] } ] }, - TYPES$6, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + TYPES$2, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, PREPROCESSOR ] }; return { name: "C", aliases: ["h"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, disableAutodetect: true, illegal: "=]/, - contains: [{ beginKeywords: "final class struct" }, hljs$1.TITLE_MODE] + contains: [{ beginKeywords: "final class struct" }, hljs.TITLE_MODE] } ]), exports: { preprocessor: PREPROCESSOR, strings: STRINGS, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 } }; } - module.exports = c$1; + module.exports = c; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/cal.js var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function cal(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = [ + function cal(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = [ "div", "mod", "in", @@ -144374,11 +144578,11 @@ var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with", "var" ]; - const LITERALS$6 = "false true"; + const LITERALS$2 = "false true"; const COMMENT_MODES = [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.COMMENT(/\{/, /\}/, { relevance: 0 }), - hljs$1.COMMENT(/\(\*/, /\*\)/, { relevance: 10 }) + hljs.C_LINE_COMMENT_MODE, + hljs.COMMENT(/\{/, /\}/, { relevance: 0 }), + hljs.COMMENT(/\(\*/, /\*\)/, { relevance: 10 }) ]; const STRING = { className: "string", @@ -144415,11 +144619,11 @@ var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ STRING, CHAR_STRING, - hljs$1.NUMBER_MODE + hljs.NUMBER_MODE ] }, ...COMMENT_MODES] }; @@ -144462,8 +144666,8 @@ var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "C/AL", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2 }, illegal: /\/\*/, contains: [ @@ -144472,7 +144676,7 @@ var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { CHAR_STRING, DATE, DBL_QUOTED_VARIABLE, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, OBJECT, PROCEDURE ] @@ -144485,8 +144689,8 @@ var require_cal = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/capnproto.js var require_capnproto = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function capnproto(hljs$1) { - const KEYWORDS$6 = [ + function capnproto(hljs) { + const KEYWORDS$2 = [ "struct", "enum", "interface", @@ -144505,7 +144709,7 @@ var require_capnproto = /* @__PURE__ */ __commonJSMin(((exports, module) => { "from", "fixed" ]; - const TYPES$6 = [ + const TYPES$2 = [ "Void", "Bool", "Int8", @@ -144525,16 +144729,16 @@ var require_capnproto = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Capability", "List" ]; - const LITERALS$6 = ["true", "false"]; + const LITERALS$2 = ["true", "false"]; const CLASS_DEFINITION = { variants: [{ match: [ /(struct|enum|interface)/, /\s+/, - hljs$1.IDENT_RE + hljs.IDENT_RE ] }, { match: [ /extends/, /\s*\(/, - hljs$1.IDENT_RE, + hljs.IDENT_RE, /\s*\)/ ] }], scope: { @@ -144546,14 +144750,14 @@ var require_capnproto = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Cap’n Proto", aliases: ["capnp"], keywords: { - keyword: KEYWORDS$6, - type: TYPES$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + type: TYPES$2, + literal: LITERALS$2 }, contains: [ - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, - hljs$1.HASH_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, + hljs.HASH_COMMENT_MODE, { className: "meta", begin: /@0x[\w\d]{16};/, @@ -144574,8 +144778,8 @@ var require_capnproto = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ceylon.js var require_ceylon = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function ceylon(hljs$1) { - const KEYWORDS$6 = [ + function ceylon(hljs) { + const KEYWORDS$2 = [ "assembly", "module", "package", @@ -144650,7 +144854,7 @@ var require_ceylon = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, begin: /``/, end: /``/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 10 }; const EXPRESSIONS = [ @@ -144681,13 +144885,13 @@ var require_ceylon = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Ceylon", keywords: { - keyword: KEYWORDS$6.concat(DECLARATION_MODIFIERS), + keyword: KEYWORDS$2.concat(DECLARATION_MODIFIERS), meta: DOCUMENTATION }, illegal: "\\$[^01]|#[^0-9a-fA-F]", contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.COMMENT("/\\*", "\\*/", { contains: ["self"] }), + hljs.C_LINE_COMMENT_MODE, + hljs.COMMENT("/\\*", "\\*/", { contains: ["self"] }), { className: "meta", begin: "@[a-z]\\w*(?::\"[^\"]*\")?" @@ -144702,8 +144906,8 @@ var require_ceylon = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/clean.js var require_clean = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function clean(hljs$1) { - const KEYWORDS$6 = [ + function clean(hljs) { + const KEYWORDS$2 = [ "if", "let", "in", @@ -144739,16 +144943,16 @@ var require_clean = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Clean", aliases: ["icl", "dcl"], keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, built_in: "Int Real Char Bool", literal: "True False" }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { begin: "->|<-[|:]?|#!?|>>=|\\{\\||\\|\\}|:==|=:|<>" } ] }; @@ -144760,11 +144964,11 @@ var require_clean = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/clojure.js var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function clojure(hljs$1) { + function clojure(hljs) { const SYMBOLSTART = "a-zA-Z_\\-!.?+*=<>&'"; const SYMBOL_RE = "[#]?[" + SYMBOLSTART + "][" + SYMBOLSTART + "0-9/;:$#]*"; const globals = "def defonce defprotocol defstruct defmulti defmethod defn- defn defmacro deftype defrecord"; - const keywords$1 = { + const keywords = { $pattern: SYMBOL_RE, built_in: globals + " " + "cond apply if-not if-let if not not= =|0 <|0 >|0 <=|0 >=|0 ==|0 +|0 /|0 *|0 -|0 rem " + "quot neg? pos? delay? symbol? keyword? true? false? integer? empty? coll? list? " + "set? ifn? fn? associative? sequential? sorted? counted? reversible? number? decimal? " + "class? distinct? isa? float? rational? reduced? ratio? odd? even? char? seq? vector? " + "string? map? nil? contains? zero? instance? not-every? not-any? libspec? -> ->> .. . " + "inc compare do dotimes mapcat take remove take-while drop letfn drop-last take-last " + "drop-while while intern condp case reduced cycle split-at split-with repeat replicate " + "iterate range merge zipmap declare line-seq sort comparator sort-by dorun doall nthnext " + "nthrest partition eval doseq await await-for let agent atom send send-off release-pending-sends " + "add-watch mapv filterv remove-watch agent-error restart-agent set-error-handler error-handler " + "set-error-mode! error-mode shutdown-agents quote var fn loop recur throw try monitor-enter " + "monitor-exit macroexpand macroexpand-1 for dosync and or " + "when when-not when-let comp juxt partial sequence memoize constantly complement identity assert " + "peek pop doto proxy first rest cons cast coll last butlast " + "sigs reify second ffirst fnext nfirst nnext meta with-meta ns in-ns create-ns import " + "refer keys select-keys vals key val rseq name namespace promise into transient persistent! conj! " + "assoc! dissoc! pop! disj! use class type num float double short byte boolean bigint biginteger " + "bigdec print-method print-dup throw-if printf format load compile get-in update-in pr pr-on newline " + "flush read slurp read-line subvec with-open memfn time re-find re-groups rand-int rand mod locking " + "assert-valid-fdecl alias resolve ref deref refset swap! reset! set-validator! compare-and-set! alter-meta! " + "reset-meta! commute get-validator alter ref-set ref-history-count ref-min-history ref-max-history ensure sync io! " + "new next conj set! to-array future future-call into-array aset gen-class reduce map filter find empty " + "hash-map hash-set sorted-map sorted-map-by sorted-set sorted-set-by vec vector seq flatten reverse assoc dissoc list " + "disj get union difference intersection extend extend-type extend-protocol int nth delay count concat chunk chunk-buffer " + "chunk-append chunk-first chunk-rest max min dec unchecked-inc-int unchecked-inc unchecked-dec-inc unchecked-dec unchecked-negate " + "unchecked-add-int unchecked-add unchecked-subtract-int unchecked-subtract chunk-next chunk-cons chunked-seq? prn vary-meta " + "lazy-seq spread list* str find-keyword keyword symbol gensym force rationalize" }; @@ -144800,15 +145004,15 @@ var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { scope: "regex", begin: /#"/, end: /"/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }); + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }); const COMMA = { scope: "punctuation", match: /,/, relevance: 0 }; - const COMMENT$2 = hljs$1.COMMENT(";", "$", { relevance: 0 }); + const COMMENT = hljs.COMMENT(";", "$", { relevance: 0 }); const LITERAL = { className: "literal", begin: /\b(true|false|nil)\b/ @@ -144831,7 +145035,7 @@ var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const NAME = { - keywords: keywords$1, + keywords, className: "name", begin: SYMBOL_RE, relevance: 0, @@ -144843,7 +145047,7 @@ var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { CHARACTER, REGEX, STRING, - COMMENT$2, + COMMENT, KEY, COLLECTION, NUMBER, @@ -144882,7 +145086,7 @@ var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { CHARACTER, REGEX, STRING, - COMMENT$2, + COMMENT, KEY, COLLECTION, NUMBER, @@ -144897,7 +145101,7 @@ var require_clojure = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/clojure-repl.js var require_clojure_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function clojureRepl(hljs$1) { + function clojureRepl(hljs) { return { name: "Clojure REPL", contains: [{ @@ -144917,7 +145121,7 @@ var require_clojure_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/cmake.js var require_cmake = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function cmake(hljs$1) { + function cmake(hljs) { return { name: "CMake", aliases: ["cmake.in"], @@ -144929,10 +145133,10 @@ var require_cmake = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\$\{/, end: /\}/ }, - hljs$1.COMMENT(/#\[\[/, /]]/), - hljs$1.HASH_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE + hljs.COMMENT(/#\[\[/, /]]/), + hljs.HASH_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE ] }; } @@ -144942,7 +145146,7 @@ var require_cmake = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/coffeescript.js var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const KEYWORDS$5 = [ + const KEYWORDS = [ "as", "in", "of", @@ -144983,7 +145187,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "extends", "using" ]; - const LITERALS$5 = [ + const LITERALS = [ "true", "false", "null", @@ -144991,7 +145195,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NaN", "Infinity" ]; - const TYPES$5 = [ + const TYPES = [ "Object", "Function", "Boolean", @@ -145032,7 +145236,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Intl", "WebAssembly" ]; - const ERROR_TYPES$5 = [ + const ERROR_TYPES = [ "Error", "EvalError", "InternalError", @@ -145042,7 +145246,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "TypeError", "URIError" ]; - const BUILT_IN_GLOBALS$5 = [ + const BUILT_IN_GLOBALS = [ "setInterval", "setTimeout", "clearInterval", @@ -145061,9 +145265,9 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "escape", "unescape" ]; - const BUILT_INS$5 = [].concat(BUILT_IN_GLOBALS$5, TYPES$5, ERROR_TYPES$5); + const BUILT_INS = [].concat(BUILT_IN_GLOBALS, TYPES, ERROR_TYPES); /** @type LanguageFn */ - function coffeescript(hljs$1) { + function coffeescript(hljs) { const COFFEE_BUILT_INS = ["npm", "print"]; const COFFEE_LITERALS = [ "yes", @@ -145093,9 +145297,9 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; const excluding = (list) => (kw) => !list.includes(kw); const KEYWORDS$1$1 = { - keyword: KEYWORDS$5.concat(COFFEE_KEYWORDS).filter(excluding(NOT_VALID_KEYWORDS)), - literal: LITERALS$5.concat(COFFEE_LITERALS), - built_in: BUILT_INS$5.concat(COFFEE_BUILT_INS) + keyword: KEYWORDS.concat(COFFEE_KEYWORDS).filter(excluding(NOT_VALID_KEYWORDS)), + literal: LITERALS.concat(COFFEE_LITERALS), + built_in: BUILT_INS.concat(COFFEE_BUILT_INS) }; const JS_IDENT_RE = "[A-Za-z$_][0-9A-Za-z$_]*"; const SUBST = { @@ -145105,8 +145309,8 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: KEYWORDS$1$1 }; const EXPRESSIONS = [ - hljs$1.BINARY_NUMBER_MODE, - hljs$1.inherit(hljs$1.C_NUMBER_MODE, { starts: { + hljs.BINARY_NUMBER_MODE, + hljs.inherit(hljs.C_NUMBER_MODE, { starts: { end: "(\\s*/)?", relevance: 0 } }), @@ -145116,22 +145320,22 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: /'''/, end: /'''/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /'/, end: /'/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /"""/, end: /"""/, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }, { begin: /"/, end: /"/, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] } ] }, @@ -145141,7 +145345,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "///", end: "///", - contains: [SUBST, hljs$1.HASH_COMMENT_MODE] + contains: [SUBST, hljs.HASH_COMMENT_MODE] }, { begin: "//[gim]{0,3}(?=\\W)", @@ -145165,7 +145369,7 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { } ]; SUBST.contains = EXPRESSIONS; - const TITLE = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: JS_IDENT_RE }); + const TITLE = hljs.inherit(hljs.TITLE_MODE, { begin: JS_IDENT_RE }); const POSSIBLE_PARAMS_RE = "(\\(.*\\)\\s*)?\\B[-=]>"; const PARAMS = { className: "params", @@ -145202,8 +145406,8 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /\/\*/, contains: [ ...EXPRESSIONS, - hljs$1.COMMENT("###", "###"), - hljs$1.HASH_COMMENT_MODE, + hljs.COMMENT("###", "###"), + hljs.HASH_COMMENT_MODE, { className: "function", begin: "^\\s*" + JS_IDENT_RE + "\\s*=\\s*" + POSSIBLE_PARAMS_RE, @@ -145240,8 +145444,8 @@ var require_coffeescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/coq.js var require_coq = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function coq(hljs$1) { - const KEYWORDS$6 = [ + function coq(hljs) { + const KEYWORDS$2 = [ "_|0", "as", "at", @@ -145479,7 +145683,7 @@ var require_coq = /* @__PURE__ */ __commonJSMin(((exports, module) => { "where", "with" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "abstract", "absurd", "admit", @@ -145657,13 +145861,13 @@ var require_coq = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Coq", keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6 + keyword: KEYWORDS$2, + built_in: BUILT_INS$2 }, contains: [ - hljs$1.QUOTE_STRING_MODE, - hljs$1.COMMENT("\\(\\*", "\\*\\)"), - hljs$1.C_NUMBER_MODE, + hljs.QUOTE_STRING_MODE, + hljs.COMMENT("\\(\\*", "\\*\\)"), + hljs.C_NUMBER_MODE, { className: "type", excludeBegin: true, @@ -145681,7 +145885,7 @@ var require_coq = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/cos.js var require_cos = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function cos(hljs$1) { + function cos(hljs) { const STRINGS = { className: "string", variants: [{ @@ -145707,8 +145911,8 @@ var require_cos = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ NUMBERS, STRINGS, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "comment", begin: /;/, @@ -145764,9 +145968,9 @@ var require_cos = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/cpp.js var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function cpp(hljs$1) { - const regex = hljs$1.regex; - const C_LINE_COMMENT_MODE$2 = hljs$1.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); + function cpp(hljs) { + const regex = hljs.regex; + const C_LINE_COMMENT_MODE = hljs.COMMENT("//", "$", { contains: [{ begin: /\\\n/ }] }); const DECLTYPE_AUTO_RE = "decltype\\(auto\\)"; const NAMESPACE_RE = "[a-zA-Z_]\\w*::"; const TEMPLATE_ARGUMENT_RE = "<[^<>]+>"; @@ -145783,14 +145987,14 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "(u8?|U|L)?\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "(u8?|U|L)?'(" + CHARACTER_ESCAPES + "|.)", end: "'", illegal: "." }, - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /(?:u8?|U|L)?R"([^()\\ ]{0,16})\(/, end: /\)([^()\\ ]{0,16})"/ }) @@ -145811,21 +146015,21 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\\\n/, relevance: 0 }, - hljs$1.inherit(STRINGS, { className: "string" }), + hljs.inherit(STRINGS, { className: "string" }), { className: "string", begin: /<.*?>/ }, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; - const TITLE_MODE$2 = { + const TITLE_MODE = { className: "title", - begin: regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE, + begin: regex.optional(NAMESPACE_RE) + hljs.IDENT_RE, relevance: 0 }; - const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs$1.IDENT_RE + "\\s*\\("; + const FUNCTION_TITLE = regex.optional(NAMESPACE_RE) + hljs.IDENT_RE + "\\s*\\("; const RESERVED_KEYWORDS = [ "alignas", "alignof", @@ -146094,7 +146298,7 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { "vprintf", "vsprintf" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "NULL", "false", "nullopt", @@ -146105,7 +146309,7 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { const CPP_KEYWORDS = { type: RESERVED_TYPES, keyword: RESERVED_KEYWORDS, - literal: LITERALS$6, + literal: LITERALS$2, built_in: BUILT_IN, _type_hints: TYPE_HINTS }; @@ -146113,14 +146317,14 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function.dispatch", relevance: 0, keywords: { _hint: FUNCTION_HINTS }, - begin: regex.concat(/\b/, /(?!decltype)/, /(?!if)/, /(?!for)/, /(?!switch)/, /(?!while)/, hljs$1.IDENT_RE, regex.lookahead(/(<[^<>]+>|)\s*\(/)) + begin: regex.concat(/\b/, /(?!decltype)/, /(?!if)/, /(?!for)/, /(?!switch)/, /(?!while)/, hljs.IDENT_RE, regex.lookahead(/(<[^<>]+>|)\s*\(/)) }; const EXPRESSION_CONTAINS = [ FUNCTION_DISPATCH, PREPROCESSOR, CPP_PRIMITIVE_TYPES, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, NUMBERS, STRINGS ]; @@ -146166,7 +146370,7 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: FUNCTION_TITLE, returnBegin: true, - contains: [TITLE_MODE$2], + contains: [TITLE_MODE], relevance: 0 }, { @@ -146189,8 +146393,8 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: CPP_KEYWORDS, relevance: 0, contains: [ - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, CPP_PRIMITIVE_TYPES, @@ -146201,8 +146405,8 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [ "self", - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRINGS, NUMBERS, CPP_PRIMITIVE_TYPES @@ -146211,8 +146415,8 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }, CPP_PRIMITIVE_TYPES, - C_LINE_COMMENT_MODE$2, - hljs$1.C_BLOCK_COMMENT_MODE, + C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, PREPROCESSOR ] }; @@ -146239,7 +146443,7 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: ["self", CPP_PRIMITIVE_TYPES] }, { - begin: hljs$1.IDENT_RE + "::", + begin: hljs.IDENT_RE + "::", keywords: CPP_KEYWORDS }, { @@ -146263,24 +146467,24 @@ var require_cpp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/crmsh.js var require_crmsh = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function crmsh(hljs$1) { + function crmsh(hljs) { const RESOURCES = "primitive rsc_template"; const COMMANDS = "group clone ms master location colocation order fencing_topology " + "rsc_ticket acl_target acl_group user role " + "tag xml"; const PROPERTY_SETS = "property rsc_defaults op_defaults"; - const KEYWORDS$6 = "params meta operations op rule attributes utilization"; + const KEYWORDS$2 = "params meta operations op rule attributes utilization"; const OPERATORS = "read write deny defined not_defined in_range date spec in " + "ref reference attribute type xpath version and or lt gt tag " + "lte gte eq ne \\"; - const TYPES$6 = "number string"; - const LITERALS$6 = "Master Started Slave Stopped start promote demote stop monitor true false"; + const TYPES$2 = "number string"; + const LITERALS$2 = "Master Started Slave Stopped start promote demote stop monitor true false"; return { name: "crmsh", aliases: ["crm", "pcmk"], case_insensitive: true, keywords: { - keyword: KEYWORDS$6 + " " + OPERATORS + " " + TYPES$6, - literal: LITERALS$6 + keyword: KEYWORDS$2 + " " + OPERATORS + " " + TYPES$2, + literal: LITERALS$2 }, contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { beginKeywords: "node", starts: { @@ -146314,7 +146518,7 @@ var require_crmsh = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\\s*([\\w_-]+:)?" } }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "meta", begin: "(ocf|systemd|service|lsb):[\\w_:-]+", @@ -146351,7 +146555,7 @@ var require_crmsh = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/crystal.js var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function crystal(hljs$1) { + function crystal(hljs) { const INT_SUFFIX = "(_?[ui](8|16|32|64|128))?"; const FLOAT_SUFFIX = "(_?f(32|64))?"; const CRYSTAL_IDENT_RE = "[a-zA-Z_]\\w*[!?=]?"; @@ -146393,7 +146597,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { } const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], variants: [ { begin: /'/, @@ -146473,11 +146677,11 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const REGEXP = { - begin: "(?!%\\})(" + hljs$1.RE_STARTERS_RE + "|\\n|\\b(case|if|select|unless|until|when|while)\\b)\\s*", + begin: "(?!%\\})(" + hljs.RE_STARTERS_RE + "|\\n|\\b(case|if|select|unless|until|when|while)\\b)\\s*", keywords: "case if select unless until when while", contains: [{ className: "regexp", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], variants: [{ begin: "//[a-z]*", relevance: 0 @@ -146490,7 +146694,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const REGEXP2 = { className: "regexp", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], variants: [ { begin: "%r\\(", @@ -146523,7 +146727,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "meta", begin: "@\\[", end: "\\]", - contains: [hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { className: "string" })] + contains: [hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string" })] }; const CRYSTAL_DEFAULT_CONTAINS = [ EXPANSION, @@ -146533,15 +146737,15 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { REGEXP, ATTRIBUTE, VARIABLE, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "class", beginKeywords: "class module struct", end: "$|;", illegal: /=/, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.inherit(hljs$1.TITLE_MODE, { begin: CRYSTAL_PATH_RE }), + hljs.HASH_COMMENT_MODE, + hljs.inherit(hljs.TITLE_MODE, { begin: CRYSTAL_PATH_RE }), { begin: "<" } ] }, @@ -146550,20 +146754,20 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "lib enum union", end: "$|;", illegal: /=/, - contains: [hljs$1.HASH_COMMENT_MODE, hljs$1.inherit(hljs$1.TITLE_MODE, { begin: CRYSTAL_PATH_RE })] + contains: [hljs.HASH_COMMENT_MODE, hljs.inherit(hljs.TITLE_MODE, { begin: CRYSTAL_PATH_RE })] }, { beginKeywords: "annotation", end: "$|;", illegal: /=/, - contains: [hljs$1.HASH_COMMENT_MODE, hljs$1.inherit(hljs$1.TITLE_MODE, { begin: CRYSTAL_PATH_RE })], + contains: [hljs.HASH_COMMENT_MODE, hljs.inherit(hljs.TITLE_MODE, { begin: CRYSTAL_PATH_RE })], relevance: 2 }, { className: "function", beginKeywords: "def", end: /\B\b/, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: CRYSTAL_METHOD_RE, endsParent: true })] @@ -146572,7 +146776,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "fun macro", end: /\B\b/, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: CRYSTAL_METHOD_RE, endsParent: true })], @@ -146580,7 +146784,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "symbol", - begin: hljs$1.UNDERSCORE_IDENT_RE + "(!|\\?)?:", + begin: hljs.UNDERSCORE_IDENT_RE + "(!|\\?)?:", relevance: 0 }, { @@ -146617,7 +146821,7 @@ var require_crystal = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/csharp.js var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function csharp(hljs$1) { + function csharp(hljs) { const BUILT_IN_KEYWORDS = [ "bool", "byte", @@ -146764,12 +146968,12 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with", "yield" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: NORMAL_KEYWORDS.concat(CONTEXTUAL_KEYWORDS), built_in: BUILT_IN_KEYWORDS, literal: LITERAL_KEYWORDS }; - const TITLE_MODE$2 = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "[a-zA-Z](\\.?\\w)*" }); + const TITLE_MODE = hljs.inherit(hljs.TITLE_MODE, { begin: "[a-zA-Z](\\.?\\w)*" }); const NUMBERS = { className: "number", variants: [ @@ -146790,14 +146994,14 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"", contains: [{ begin: "\"\"" }] }; - const VERBATIM_STRING_NO_LF = hljs$1.inherit(VERBATIM_STRING, { illegal: /\n/ }); + const VERBATIM_STRING_NO_LF = hljs.inherit(VERBATIM_STRING, { illegal: /\n/ }); const SUBST = { className: "subst", begin: /\{/, end: /\}/, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; - const SUBST_NO_LF = hljs$1.inherit(SUBST, { illegal: /\n/ }); + const SUBST_NO_LF = hljs.inherit(SUBST, { illegal: /\n/ }); const INTERPOLATED_STRING = { className: "string", begin: /\$"/, @@ -146806,7 +147010,7 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ { begin: /\{\{/ }, { begin: /\}\}/ }, - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST_NO_LF ] }; @@ -146821,7 +147025,7 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { SUBST ] }; - const INTERPOLATED_VERBATIM_STRING_NO_LF = hljs$1.inherit(INTERPOLATED_VERBATIM_STRING, { + const INTERPOLATED_VERBATIM_STRING_NO_LF = hljs.inherit(INTERPOLATED_VERBATIM_STRING, { illegal: /\n/, contains: [ { begin: /\{\{/ }, @@ -146834,45 +147038,45 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { INTERPOLATED_VERBATIM_STRING, INTERPOLATED_STRING, VERBATIM_STRING, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBERS, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_BLOCK_COMMENT_MODE ]; SUBST_NO_LF.contains = [ INTERPOLATED_VERBATIM_STRING_NO_LF, INTERPOLATED_STRING, VERBATIM_STRING_NO_LF, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBERS, - hljs$1.inherit(hljs$1.C_BLOCK_COMMENT_MODE, { illegal: /\n/ }) + hljs.inherit(hljs.C_BLOCK_COMMENT_MODE, { illegal: /\n/ }) ]; const STRING = { variants: [ RAW_STRING, INTERPOLATED_VERBATIM_STRING, INTERPOLATED_STRING, VERBATIM_STRING, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ] }; const GENERIC_MODIFIER = { begin: "<", end: ">", - contains: [{ beginKeywords: "in out" }, TITLE_MODE$2] + contains: [{ beginKeywords: "in out" }, TITLE_MODE] }; - const TYPE_IDENT_RE = hljs$1.IDENT_RE + "(<" + hljs$1.IDENT_RE + "(\\s*,\\s*" + hljs$1.IDENT_RE + ")*>)?(\\[\\])?"; + const TYPE_IDENT_RE = hljs.IDENT_RE + "(<" + hljs.IDENT_RE + "(\\s*,\\s*" + hljs.IDENT_RE + ")*>)?(\\[\\])?"; const AT_IDENTIFIER = { - begin: "@" + hljs$1.IDENT_RE, + begin: "@" + hljs.IDENT_RE, relevance: 0 }; return { name: "C#", aliases: ["cs", "c#"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /::/, contains: [ - hljs$1.COMMENT("///", "$", { + hljs.COMMENT("///", "$", { returnBegin: true, contains: [{ className: "doctag", @@ -146889,8 +147093,8 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }] }), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "meta", begin: "#", @@ -146906,10 +147110,10 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /[^\s:,]/, contains: [ { beginKeywords: "where class" }, - TITLE_MODE$2, + TITLE_MODE, GENERIC_MODIFIER, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -146918,9 +147122,9 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[{;=]/, illegal: /[^\s:]/, contains: [ - TITLE_MODE$2, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + TITLE_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -146929,10 +147133,10 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[{;=]/, illegal: /[^\s:]/, contains: [ - TITLE_MODE$2, + TITLE_MODE, GENERIC_MODIFIER, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -146953,20 +147157,20 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "function", - begin: "(" + TYPE_IDENT_RE + "\\s+)+" + hljs$1.IDENT_RE + "\\s*(<[^=]+>\\s*)?\\(", + begin: "(" + TYPE_IDENT_RE + "\\s+)+" + hljs.IDENT_RE + "\\s*(<[^=]+>\\s*)?\\(", returnBegin: true, end: /\s*[{;=]/, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ { beginKeywords: FUNCTION_MODIFIERS.join(" "), relevance: 0 }, { - begin: hljs$1.IDENT_RE + "\\s*(<[^=]+>\\s*)?\\(", + begin: hljs.IDENT_RE + "\\s*(<[^=]+>\\s*)?\\(", returnBegin: true, - contains: [hljs$1.TITLE_MODE, GENERIC_MODIFIER], + contains: [hljs.TITLE_MODE, GENERIC_MODIFIER], relevance: 0 }, { match: /\(\)/ }, @@ -146976,16 +147180,16 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\)/, excludeBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ STRING, NUMBERS, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_BLOCK_COMMENT_MODE ] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, AT_IDENTIFIER @@ -146999,8 +147203,8 @@ var require_csharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/csp.js var require_csp = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function csp(hljs$1) { - const KEYWORDS$6 = [ + function csp(hljs) { + const KEYWORDS$2 = [ "base-uri", "child-src", "connect-src", @@ -147027,7 +147231,7 @@ var require_csp = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: false, keywords: { $pattern: "[a-zA-Z][a-zA-Z0-9_-]*", - keyword: KEYWORDS$6 + keyword: KEYWORDS$2 }, contains: [{ className: "string", @@ -147047,13 +147251,13 @@ var require_csp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/css.js var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const MODES$5 = (hljs$1) => { + const MODES = (hljs) => { return { IMPORTANT: { scope: "meta", begin: "!important" }, - BLOCK_COMMENT: hljs$1.C_BLOCK_COMMENT_MODE, + BLOCK_COMMENT: hljs.C_BLOCK_COMMENT_MODE, HEXCOLOR: { scope: "number", begin: /#(([0-9a-fA-F]{3,4})|(([0-9a-fA-F]{2}){3,4}))\b/ @@ -147067,11 +147271,11 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[/, end: /\]/, illegal: "$", - contains: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + contains: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, CSS_NUMBER_MODE: { scope: "number", - begin: hljs$1.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", + begin: hljs.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", relevance: 0 }, CSS_VARIABLE: { @@ -147080,7 +147284,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; }; - const HTML_TAGS$4 = [ + const HTML_TAGS = [ "a", "abbr", "address", @@ -147159,7 +147363,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "var", "video" ]; - const SVG_TAGS$4 = [ + const SVG_TAGS = [ "defs", "g", "marker", @@ -147202,8 +147406,8 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "foreignObject", "clipPath" ]; - const TAGS$4 = [...HTML_TAGS$4, ...SVG_TAGS$4]; - const MEDIA_FEATURES$4 = [ + const TAGS = [...HTML_TAGS, ...SVG_TAGS]; + const MEDIA_FEATURES = [ "any-hover", "any-pointer", "aspect-ratio", @@ -147238,7 +147442,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "min-height", "max-height" ].sort().reverse(); - const PSEUDO_CLASSES$4 = [ + const PSEUDO_CLASSES = [ "active", "any-link", "blank", @@ -147299,7 +147503,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "visited", "where" ].sort().reverse(); - const PSEUDO_ELEMENTS$4 = [ + const PSEUDO_ELEMENTS = [ "after", "backdrop", "before", @@ -147315,7 +147519,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "slotted", "spelling-error" ].sort().reverse(); - const ATTRIBUTES$4 = [ + const ATTRIBUTES = [ "accent-color", "align-content", "align-items", @@ -147832,14 +148036,14 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { "zoom" ].sort().reverse(); /** @type LanguageFn */ - function css$1(hljs$1) { - const regex = hljs$1.regex; - const modes = MODES$5(hljs$1); + function css(hljs) { + const regex = hljs.regex; + const modes = MODES(hljs); const VENDOR_PREFIX = { begin: /-(webkit|moz|ms|o)-(?=[a-z])/ }; const AT_MODIFIERS = "and or not only"; const AT_PROPERTY_RE = /@-?\w[\w]*(-\w+)*/; - const IDENT_RE$6 = "[a-zA-Z-][a-zA-Z0-9_-]*"; - const STRINGS = [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE]; + const IDENT_RE$2 = "[a-zA-Z-][a-zA-Z0-9_-]*"; + const STRINGS = [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE]; return { name: "CSS", case_insensitive: true, @@ -147857,18 +148061,18 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "selector-class", - begin: "\\." + IDENT_RE$6, + begin: "\\." + IDENT_RE$2, relevance: 0 }, modes.ATTRIBUTE_SELECTOR_MODE, { className: "selector-pseudo", - variants: [{ begin: ":(" + PSEUDO_CLASSES$4.join("|") + ")" }, { begin: ":(:)?(" + PSEUDO_ELEMENTS$4.join("|") + ")" }] + variants: [{ begin: ":(" + PSEUDO_CLASSES.join("|") + ")" }, { begin: ":(:)?(" + PSEUDO_ELEMENTS.join("|") + ")" }] }, modes.CSS_VARIABLE, { className: "attribute", - begin: "\\b(" + ATTRIBUTES$4.join("|") + ")\\b" + begin: "\\b(" + ATTRIBUTES.join("|") + ")\\b" }, { begin: /:/, @@ -147910,7 +148114,7 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: { $pattern: /[a-z-]+/, keyword: AT_MODIFIERS, - attribute: MEDIA_FEATURES$4.join(" ") + attribute: MEDIA_FEATURES.join(" ") }, contains: [ { @@ -147924,12 +148128,12 @@ var require_css = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "selector-tag", - begin: "\\b(" + TAGS$4.join("|") + ")\\b" + begin: "\\b(" + TAGS.join("|") + ")\\b" } ] }; } - module.exports = css$1; + module.exports = css; })); //#endregion @@ -147951,14 +148155,14 @@ var require_d = /* @__PURE__ */ __commonJSMin(((exports, module) => { * up to the end of line is matched as special token sequence) */ /** @type LanguageFn */ - function d(hljs$1) { + function d(hljs) { /** * Language keywords * * @type {Object} */ const D_KEYWORDS = { - $pattern: hljs$1.UNDERSCORE_IDENT_RE, + $pattern: hljs.UNDERSCORE_IDENT_RE, keyword: "abstract alias align asm assert auto body break byte case cast catch class " + "const continue debug default delete deprecated do else enum export extern final " + "finally for foreach foreach_reverse|10 goto if immutable import in inout int " + "interface invariant is lazy macro mixin module new nothrow out override package " + "pragma private protected public pure ref return scope shared static struct " + "super switch synchronized template this throw try typedef typeid typeof union " + "unittest version void volatile while with __FILE__ __LINE__ __gshared|10 " + "__thread __traits __DATE__ __EOF__ __TIME__ __TIMESTAMP__ __VENDOR__ __VERSION__", built_in: "bool cdouble cent cfloat char creal dchar delegate double dstring float function " + "idouble ifloat ireal long real short string ubyte ucent uint ulong ushort wchar " + "wstring", literal: "false null true" @@ -148111,7 +148315,7 @@ var require_d = /* @__PURE__ */ __commonJSMin(((exports, module) => { * * @type {Object} */ - const D_NESTING_COMMENT_MODE = hljs$1.COMMENT("\\/\\+", "\\+\\/", { + const D_NESTING_COMMENT_MODE = hljs.COMMENT("\\/\\+", "\\+\\/", { contains: ["self"], relevance: 10 }); @@ -148119,8 +148323,8 @@ var require_d = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "D", keywords: D_KEYWORDS, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, D_NESTING_COMMENT_MODE, D_HEX_STRING_MODE, D_STRING_MODE, @@ -148142,8 +148346,8 @@ var require_d = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/markdown.js var require_markdown = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function markdown(hljs$1) { - const regex = hljs$1.regex; + function markdown(hljs) { + const regex = hljs.regex; const INLINE_HTML = { begin: /<\/?[A-Za-z_]/, end: ">", @@ -148276,8 +148480,8 @@ var require_markdown = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }] }; - const BOLD_WITHOUT_ITALIC = hljs$1.inherit(BOLD, { contains: [] }); - const ITALIC_WITHOUT_BOLD = hljs$1.inherit(ITALIC, { contains: [] }); + const BOLD_WITHOUT_ITALIC = hljs.inherit(BOLD, { contains: [] }); + const ITALIC_WITHOUT_BOLD = hljs.inherit(ITALIC, { contains: [] }); BOLD.contains.push(ITALIC_WITHOUT_BOLD); ITALIC.contains.push(BOLD_WITHOUT_ITALIC); let CONTAINABLE = [INLINE_HTML, LINK]; @@ -148344,7 +148548,7 @@ var require_markdown = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dart.js var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dart(hljs$1) { + function dart(hljs) { const SUBST = { className: "subst", variants: [{ begin: "\\$[A-Za-z0-9_]+" }] @@ -148387,7 +148591,7 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "'''", end: "'''", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, BRACED_SUBST ] @@ -148396,7 +148600,7 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\"\"\"", end: "\"\"\"", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, BRACED_SUBST ] @@ -148406,7 +148610,7 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "'", illegal: "\\n", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, BRACED_SUBST ] @@ -148416,7 +148620,7 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"", illegal: "\\n", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, BRACED_SUBST ] @@ -148521,7 +148725,7 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with", "yield" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: BASIC_KEYWORDS, built_in: BUILT_IN_TYPES.concat(NULLABLE_BUILT_IN_TYPES).concat([ "Never", @@ -148537,27 +148741,27 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; return { name: "Dart", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ STRING, - hljs$1.COMMENT(/\/\*\*(?!\/)/, /\*\//, { + hljs.COMMENT(/\/\*\*(?!\/)/, /\*\//, { subLanguage: "markdown", relevance: 0 }), - hljs$1.COMMENT(/\/{3,} ?/, /$/, { contains: [{ + hljs.COMMENT(/\/{3,} ?/, /$/, { contains: [{ subLanguage: "markdown", begin: ".", end: "$", relevance: 0 }] }), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "class", beginKeywords: "class interface", end: /\{/, excludeEnd: true, - contains: [{ beginKeywords: "extends implements" }, hljs$1.UNDERSCORE_TITLE_MODE] + contains: [{ beginKeywords: "extends implements" }, hljs.UNDERSCORE_TITLE_MODE] }, NUMBER, { @@ -148575,8 +148779,8 @@ var require_dart = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/delphi.js var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function delphi(hljs$1) { - const KEYWORDS$6 = [ + function delphi(hljs) { + const KEYWORDS$2 = [ "exports", "register", "file", @@ -148706,9 +148910,9 @@ var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { "varargs" ]; const COMMENT_MODES = [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.COMMENT(/\{/, /\}/, { relevance: 0 }), - hljs$1.COMMENT(/\(\*/, /\*\)/, { relevance: 10 }) + hljs.C_LINE_COMMENT_MODE, + hljs.COMMENT(/\{/, /\}/, { relevance: 0 }), + hljs.COMMENT(/\(\*/, /\*\)/, { relevance: 10 }) ]; const DIRECTIVE = { className: "meta", @@ -148754,9 +148958,9 @@ var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; const CLASS = { - begin: hljs$1.IDENT_RE + "\\s*=\\s*class\\s*\\(", + begin: hljs.IDENT_RE + "\\s*=\\s*class\\s*\\(", returnBegin: true, - contains: [hljs$1.TITLE_MODE] + contains: [hljs.TITLE_MODE] }; const FUNCTION = { className: "function", @@ -148764,12 +148968,12 @@ var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[:;]/, keywords: "function constructor|10 destructor|10 procedure|10", contains: [ - hljs$1.TITLE_MODE, + hljs.TITLE_MODE, { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ STRING, CHAR_STRING, @@ -148788,7 +148992,7 @@ var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { "pascal" ], case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /"|\$[G-Zg-z]|\/\*|<\/|\|/, contains: [ STRING, @@ -148807,8 +149011,8 @@ var require_delphi = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/diff.js var require_diff = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function diff(hljs$1) { - const regex = hljs$1.regex; + function diff(hljs) { + const regex = hljs.regex; return { name: "Diff", aliases: ["patch"], @@ -148850,11 +149054,11 @@ var require_diff = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/django.js var require_django = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function django(hljs$1) { + function django(hljs) { const FILTER = { begin: /\|[A-Za-z]+:?/, keywords: { name: "truncatewords removetags linebreaksbr yesno get_digit timesince random striptags " + "filesizeformat escape linebreaks length_is ljust rjust cut urlize fix_ampersands " + "title floatformat capfirst pprint divisibleby add make_list unordered_list urlencode " + "timeuntil urlizetrunc wordcount stringformat linenumbers slice date dictsort " + "dictsortreversed default_if_none pluralize lower join center default " + "truncatewords_html upper length phone2numeric wordwrap time addslashes slugify first " + "escapejs force_escape iriencode last safe safeseq truncatechars localize unlocalize " + "localtime utc timezone" }, - contains: [hljs$1.QUOTE_STRING_MODE, hljs$1.APOS_STRING_MODE] + contains: [hljs.QUOTE_STRING_MODE, hljs.APOS_STRING_MODE] }; return { name: "Django", @@ -148862,8 +149066,8 @@ var require_django = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, subLanguage: "xml", contains: [ - hljs$1.COMMENT(/\{%\s*comment\s*%\}/, /\{%\s*endcomment\s*%\}/), - hljs$1.COMMENT(/\{#/, /#\}/), + hljs.COMMENT(/\{%\s*comment\s*%\}/, /\{%\s*endcomment\s*%\}/), + hljs.COMMENT(/\{#/, /#\}/), { className: "template-tag", begin: /\{%/, @@ -148896,8 +149100,8 @@ var require_django = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dns.js var require_dns = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dns(hljs$1) { - const KEYWORDS$6 = [ + function dns(hljs) { + const KEYWORDS$2 = [ "IN", "A", "AAAA", @@ -148940,9 +149144,9 @@ var require_dns = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "DNS Zone", aliases: ["bind", "zone"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.COMMENT(";", "$", { relevance: 0 }), + hljs.COMMENT(";", "$", { relevance: 0 }), { className: "meta", begin: /^\$(TTL|GENERATE|INCLUDE|ORIGIN)\b/ @@ -148955,7 +149159,7 @@ var require_dns = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "number", begin: "((25[0-5]|(2[0-4]|1{0,1}[0-9]){0,1}[0-9]).){3,3}(25[0-5]|(2[0-4]|1{0,1}[0-9]){0,1}[0-9])\\b" }, - hljs$1.inherit(hljs$1.NUMBER_MODE, { begin: /\b\d+[dhwm]?/ }) + hljs.inherit(hljs.NUMBER_MODE, { begin: /\b\d+[dhwm]?/ }) ] }; } @@ -148966,8 +149170,8 @@ var require_dns = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dockerfile.js var require_dockerfile = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dockerfile(hljs$1) { - const KEYWORDS$6 = [ + function dockerfile(hljs) { + const KEYWORDS$2 = [ "from", "maintainer", "expose", @@ -148981,12 +149185,12 @@ var require_dockerfile = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Dockerfile", aliases: ["docker"], case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, + hljs.HASH_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, { beginKeywords: "run cmd entrypoint volume add copy workdir label healthcheck shell", starts: { @@ -149005,14 +149209,14 @@ var require_dockerfile = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dos.js var require_dos = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dos(hljs$1) { - const COMMENT$2 = hljs$1.COMMENT(/^\s*@?rem\b/, /$/, { relevance: 10 }); + function dos(hljs) { + const COMMENT = hljs.COMMENT(/^\s*@?rem\b/, /$/, { relevance: 10 }); const LABEL = { className: "symbol", begin: "^\\s*[A-Za-z._?][A-Za-z0-9_$#@~.?]*(:|\\s+label)", relevance: 0 }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "if", "else", "goto", @@ -149032,7 +149236,7 @@ var require_dos = /* @__PURE__ */ __commonJSMin(((exports, module) => { "gtr", "geq" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "prn", "nul", "lpt3", @@ -149128,8 +149332,8 @@ var require_dos = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, illegal: /\/\*/, keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6 + keyword: KEYWORDS$2, + built_in: BUILT_INS$2 }, contains: [ { @@ -149140,14 +149344,14 @@ var require_dos = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", begin: LABEL.begin, end: "goto:eof", - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "([_a-zA-Z]\\w*\\.)*([_a-zA-Z]\\w*:)?[_a-zA-Z]\\w*" }), COMMENT$2] + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: "([_a-zA-Z]\\w*\\.)*([_a-zA-Z]\\w*:)?[_a-zA-Z]\\w*" }), COMMENT] }, { className: "number", begin: "\\b\\d+", relevance: 0 }, - COMMENT$2 + COMMENT ] }; } @@ -149158,7 +149362,7 @@ var require_dos = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dsconfig.js var require_dsconfig = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dsconfig(hljs$1) { + function dsconfig(hljs) { const QUOTED_PROPERTY = { className: "string", begin: /"/, @@ -149209,7 +149413,7 @@ var require_dsconfig = /* @__PURE__ */ __commonJSMin(((exports, module) => { APOS_PROPERTY, UNQUOTED_PROPERTY, VALUELESS_PROPERTY, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }; } @@ -149220,15 +149424,15 @@ var require_dsconfig = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dts.js var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dts(hljs$1) { + function dts(hljs) { const STRINGS = { className: "string", variants: [ - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { begin: "((u8?|U)|L)?\"" }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { begin: "((u8?|U)|L)?\"" }), { begin: "(u8?|U)?R\"", end: "\"", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "'\\\\?.", @@ -149239,7 +149443,7 @@ var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const NUMBERS = { className: "number", - variants: [{ begin: "\\b(\\d+(\\.\\d*)?|\\.\\d+)(u|U|l|L|ul|UL|f|F)" }, { begin: hljs$1.C_NUMBER_RE }], + variants: [{ begin: "\\b(\\d+(\\.\\d*)?|\\.\\d+)(u|U|l|L|ul|UL|f|F)" }, { begin: hljs.C_NUMBER_RE }], relevance: 0 }; const PREPROCESSOR = { @@ -149256,7 +149460,7 @@ var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "include", end: "$", keywords: { keyword: "include" }, - contains: [hljs$1.inherit(STRINGS, { className: "string" }), { + contains: [hljs.inherit(STRINGS, { className: "string" }), { className: "string", begin: "<", end: ">", @@ -149264,8 +149468,8 @@ var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { }] }, STRINGS, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; const REFERENCE = { @@ -149330,14 +149534,14 @@ var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { ATTR, ATTR_NO_VALUE, CELL_PROPERTY, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, NUMBERS, STRINGS, PREPROCESSOR, PUNC, { - begin: hljs$1.IDENT_RE + "::", + begin: hljs.IDENT_RE + "::", keywords: "" } ] @@ -149350,7 +149554,7 @@ var require_dts = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/dust.js var require_dust = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function dust(hljs$1) { + function dust(hljs) { const EXPRESSION_KEYWORDS = "if eq ne lt lte gt gte select default math sep"; return { name: "Dust", @@ -149368,7 +149572,7 @@ var require_dust = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { endsWithParent: true, relevance: 0, - contains: [hljs$1.QUOTE_STRING_MODE] + contains: [hljs.QUOTE_STRING_MODE] } }] }, { @@ -149387,8 +149591,8 @@ var require_dust = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ebnf.js var require_ebnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function ebnf(hljs$1) { - const commentMode = hljs$1.COMMENT(/\(\*/, /\*\)/); + function ebnf(hljs) { + const commentMode = hljs.COMMENT(/\(\*/, /\*\)/); const nonTerminalMode = { className: "attribute", begin: /^[ ]*[a-zA-Z]+([\s_-]+[a-zA-Z]+)*/ @@ -149406,8 +149610,8 @@ var require_ebnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { { className: "string", variants: [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { begin: "`", end: "`" @@ -149433,11 +149637,11 @@ var require_ebnf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/elixir.js var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function elixir(hljs$1) { - const regex = hljs$1.regex; + function elixir(hljs) { + const regex = hljs.regex; const ELIXIR_IDENT_RE = "[a-zA-Z_][a-zA-Z0-9_.]*(!|\\?)?"; const ELIXIR_METHOD_RE = "[a-zA-Z_]\\w*[!?=]?|[-+~]@|<<|>>|=~|===?|<=>|[<>]=?|\\*\\*|[-/+%^&*~`|]|\\[\\]=?"; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "after", "alias", "and", @@ -149470,15 +149674,15 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { "when", "with|0" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "false", "nil", "true" ]; const KWS = { $pattern: ELIXIR_IDENT_RE, - keyword: KEYWORDS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2 }; const SUBST = { className: "subst", @@ -149492,7 +149696,7 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const ESCAPES_RE = /\\[\s\S]/; - const BACKSLASH_ESCAPE$2 = { + const BACKSLASH_ESCAPE = { match: ESCAPES_RE, scope: "char.escape", relevance: 0 @@ -149542,32 +149746,32 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { const LOWERCASE_SIGIL = { className: "string", begin: "~[a-z]" + "(?=" + SIGIL_DELIMITERS + ")", - contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs$1.inherit(x$2, { contains: [ + contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs.inherit(x$2, { contains: [ escapeSigilEnd(x$2.end), - BACKSLASH_ESCAPE$2, + BACKSLASH_ESCAPE, SUBST ] })) }; const UPCASE_SIGIL = { className: "string", begin: "~[A-Z]" + "(?=" + SIGIL_DELIMITERS + ")", - contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs$1.inherit(x$2, { contains: [escapeSigilEnd(x$2.end)] })) + contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs.inherit(x$2, { contains: [escapeSigilEnd(x$2.end)] })) }; const REGEX_SIGIL = { className: "regex", variants: [{ begin: "~r" + "(?=" + SIGIL_DELIMITERS + ")", - contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs$1.inherit(x$2, { + contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs.inherit(x$2, { end: regex.concat(x$2.end, /[uismxfU]{0,7}/), contains: [ escapeSigilEnd(x$2.end), - BACKSLASH_ESCAPE$2, + BACKSLASH_ESCAPE, SUBST ] })) }, { begin: "~R" + "(?=" + SIGIL_DELIMITERS + ")", - contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs$1.inherit(x$2, { + contains: SIGIL_DELIMITER_MODES.map((x$2) => hljs.inherit(x$2, { end: regex.concat(x$2.end, /[uismxfU]{0,7}/), contains: [escapeSigilEnd(x$2.end)] })) @@ -149575,7 +149779,7 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], variants: [ { begin: /"""/, @@ -149619,12 +149823,12 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "def defp defmacro defmacrop", end: /\B\b/, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: ELIXIR_IDENT_RE, endsParent: true })] }; - const CLASS = hljs$1.inherit(FUNCTION, { + const CLASS = hljs.inherit(FUNCTION, { className: "class", beginKeywords: "defimpl defmodule defprotocol defrecord", end: /\bdo\b|$|;/ @@ -149634,7 +149838,7 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { REGEX_SIGIL, UPCASE_SIGIL, LOWERCASE_SIGIL, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, CLASS, FUNCTION, { begin: "::" }, @@ -149675,8 +149879,8 @@ var require_elixir = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/elm.js var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function elm(hljs$1) { - const COMMENT$2 = { variants: [hljs$1.COMMENT("--", "$"), hljs$1.COMMENT(/\{-/, /-\}/, { contains: ["self"] })] }; + function elm(hljs) { + const COMMENT = { variants: [hljs.COMMENT("--", "$"), hljs.COMMENT(/\{-/, /-\}/, { contains: ["self"] })] }; const CONSTRUCTOR = { className: "type", begin: "\\b[A-Z][\\w']*", @@ -149689,7 +149893,7 @@ var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ className: "type", begin: "\\b[A-Z][\\w]*(\\((\\.\\.|,|\\w+)\\))?" - }, COMMENT$2] + }, COMMENT] }; const RECORD = { begin: /\{/, @@ -149702,7 +149906,7 @@ var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "'", illegal: "." }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "let", "in", "if", @@ -149727,20 +149931,20 @@ var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; return { name: "Elm", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ { beginKeywords: "port effect module", end: "exposing", keywords: "port effect module where command subscription exposing", - contains: [LIST, COMMENT$2], + contains: [LIST, COMMENT], illegal: "\\W\\.|;" }, { begin: "import", end: "$", keywords: "import as exposing", - contains: [LIST, COMMENT$2], + contains: [LIST, COMMENT], illegal: "\\W\\.|;" }, { @@ -149751,26 +149955,26 @@ var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { CONSTRUCTOR, LIST, RECORD, - COMMENT$2 + COMMENT ] }, { beginKeywords: "infix infixl infixr", end: "$", - contains: [hljs$1.C_NUMBER_MODE, COMMENT$2] + contains: [hljs.C_NUMBER_MODE, COMMENT] }, { begin: "port", end: "$", keywords: "port", - contains: [COMMENT$2] + contains: [COMMENT] }, CHARACTER, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, CONSTRUCTOR, - hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "^[_a-z][\\w']*" }), - COMMENT$2, + hljs.inherit(hljs.TITLE_MODE, { begin: "^[_a-z][\\w']*" }), + COMMENT, { begin: "->|<-" } ], illegal: /;/ @@ -149782,8 +149986,8 @@ var require_elm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ruby.js var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function ruby(hljs$1) { - const regex = hljs$1.regex; + function ruby(hljs) { + const regex = hljs.regex; const RUBY_METHOD_RE = "([a-zA-Z_]\\w*[!?=]?|[-+~]@|<<|>>|=~|===?|<=>|[<>]=?|\\*\\*|[-/+%^&*~`|]|\\[\\]=?)"; const CLASS_NAME_RE = regex.either(/\b([A-Z]+[a-z0-9]+)+/, /\b([A-Z]+[a-z0-9]+)+[A-Z]+/); const CLASS_NAME_WITH_NAMESPACE_RE = regex.concat(CLASS_NAME_RE, /(::\w+)*/); @@ -149865,12 +150069,12 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: ">" }; const COMMENT_MODES = [ - hljs$1.COMMENT("#", "$", { contains: [YARDOCTAG] }), - hljs$1.COMMENT("^=begin", "^=end", { + hljs.COMMENT("#", "$", { contains: [YARDOCTAG] }), + hljs.COMMENT("^=begin", "^=end", { contains: [YARDOCTAG], relevance: 10 }), - hljs$1.COMMENT("^__END__", hljs$1.MATCH_NOTHING_RE) + hljs.COMMENT("^__END__", hljs.MATCH_NOTHING_RE) ]; const SUBST = { className: "subst", @@ -149880,7 +150084,7 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], variants: [ { begin: /'/, @@ -149934,10 +150138,10 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: /\B\?\\?\S/ }, { begin: regex.concat(/<<[-~]?'?/, regex.lookahead(/(\w+)(?=\W)[^\n]*\n(?:[^\n]*\n)*?\s*\1\b/)), - contains: [hljs$1.END_SAME_AS_BEGIN({ + contains: [hljs.END_SAME_AS_BEGIN({ begin: /(\w+)/, end: /(\w+)/, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] })] } ] @@ -150017,10 +150221,10 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { UPPER_CASE_CONSTANT, CLASS_REFERENCE, METHOD_DEFINITION, - { begin: hljs$1.IDENT_RE + "::" }, + { begin: hljs.IDENT_RE + "::" }, { className: "symbol", - begin: hljs$1.UNDERSCORE_IDENT_RE + "(!|\\?)?:", + begin: hljs.UNDERSCORE_IDENT_RE + "(!|\\?)?:", relevance: 0 }, { @@ -150044,11 +150248,11 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: RUBY_KEYWORDS }, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|unless)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|unless)\\s*", keywords: "unless", contains: [{ className: "regexp", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], illegal: /\n/, variants: [ { @@ -150108,7 +150312,7 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { ], keywords: RUBY_KEYWORDS, illegal: /\/\*/, - contains: [hljs$1.SHEBANG({ binary: "ruby" })].concat(IRB_DEFAULT).concat(COMMENT_MODES).concat(RUBY_DEFAULT_CONTAINS) + contains: [hljs.SHEBANG({ binary: "ruby" })].concat(IRB_DEFAULT).concat(COMMENT_MODES).concat(RUBY_DEFAULT_CONTAINS) }; } module.exports = ruby; @@ -150118,11 +150322,11 @@ var require_ruby = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/erb.js var require_erb = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function erb(hljs$1) { + function erb(hljs) { return { name: "ERB", subLanguage: "xml", - contains: [hljs$1.COMMENT("<%#", "%>"), { + contains: [hljs.COMMENT("<%#", "%>"), { begin: "<%[%=-]?", end: "[%-]?%>", subLanguage: "ruby", @@ -150138,8 +150342,8 @@ var require_erb = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/erlang-repl.js var require_erlang_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function erlangRepl(hljs$1) { - const regex = hljs$1.regex; + function erlangRepl(hljs) { + const regex = hljs.regex; return { name: "Erlang REPL", keywords: { @@ -150152,14 +150356,14 @@ var require_erlang_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "^[0-9]+> ", relevance: 10 }, - hljs$1.COMMENT("%", "$"), + hljs.COMMENT("%", "$"), { className: "number", begin: "\\b(\\d+(_\\d+)*#[a-fA-F0-9]+(_[a-fA-F0-9]+)*|\\d+(_\\d+)*(\\.\\d+(_\\d+)*)?([eE][-+]?\\d+)?)", relevance: 0 }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { begin: regex.concat(/\?(::)?/, /([A-Z]\w*)/, /((::)[A-Z]\w*)*/) }, { begin: "->" }, { begin: "ok" }, @@ -150182,14 +150386,14 @@ var require_erlang_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/erlang.js var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function erlang(hljs$1) { + function erlang(hljs) { const BASIC_ATOM_RE = "[a-z'][a-zA-Z0-9_']*"; const FUNCTION_NAME_RE = "(" + BASIC_ATOM_RE + ":" + BASIC_ATOM_RE + "|" + BASIC_ATOM_RE + ")"; const ERLANG_RESERVED = { keyword: "after and andalso|10 band begin bnot bor bsl bzr bxor case catch cond div end fun if " + "let not of orelse|10 query receive rem try when xor maybe else", literal: "false true" }; - const COMMENT$2 = hljs$1.COMMENT("%", "$"); + const COMMENT = hljs.COMMENT("%", "$"); const NUMBER = { className: "number", begin: "\\b(\\d+(_\\d+)*#[a-fA-F0-9]+(_[a-fA-F0-9]+)*|\\d+(_\\d+)*(\\.\\d+(_\\d+)*)?([eE][-+]?\\d+)?)", @@ -150226,11 +150430,11 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const RECORD_ACCESS = { - begin: "#" + hljs$1.UNDERSCORE_IDENT_RE, + begin: "#" + hljs.UNDERSCORE_IDENT_RE, relevance: 0, returnBegin: true, contains: [{ - begin: "#" + hljs$1.UNDERSCORE_IDENT_RE, + begin: "#" + hljs.UNDERSCORE_IDENT_RE, relevance: 0 }, { begin: /\{/, @@ -150248,7 +150452,7 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const SIGIL = { scope: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { match: /~\w?"""("*)(?!")[\s\S]*?"""\1/ }, { @@ -150299,14 +150503,14 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: ERLANG_RESERVED }; BLOCK_STATEMENTS.contains = [ - COMMENT$2, + COMMENT, NAMED_FUN, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { className: "" }), + hljs.inherit(hljs.APOS_STRING_MODE, { className: "" }), BLOCK_STATEMENTS, FUNCTION_CALL, SIGIL, TRIPLE_QUOTE, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBER, TUPLE, VAR1, @@ -150315,13 +150519,13 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { CHAR_LITERAL ]; const BASIC_MODES = [ - COMMENT$2, + COMMENT, NAMED_FUN, BLOCK_STATEMENTS, FUNCTION_CALL, SIGIL, TRIPLE_QUOTE, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBER, TUPLE, VAR1, @@ -150376,14 +150580,14 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "->", returnBegin: true, illegal: "\\(|#|//|/\\*|\\\\|:|;", - contains: [PARAMS, hljs$1.inherit(hljs$1.TITLE_MODE, { begin: BASIC_ATOM_RE })], + contains: [PARAMS, hljs.inherit(hljs.TITLE_MODE, { begin: BASIC_ATOM_RE })], starts: { end: ";|\\.", keywords: ERLANG_RESERVED, contains: BASIC_MODES } }, - COMMENT$2, + COMMENT, { begin: "^-", end: "\\.", @@ -150391,20 +150595,20 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, returnBegin: true, keywords: { - $pattern: "-" + hljs$1.IDENT_RE, + $pattern: "-" + hljs.IDENT_RE, keyword: DIRECTIVES.map((x$2) => `${x$2}|1.5`).join(" ") }, contains: [ PARAMS, SIGIL, TRIPLE_QUOTE, - hljs$1.QUOTE_STRING_MODE + hljs.QUOTE_STRING_MODE ] }, NUMBER, SIGIL, TRIPLE_QUOTE, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, RECORD_ACCESS, VAR1, VAR2, @@ -150421,8 +150625,8 @@ var require_erlang = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/excel.js var require_excel = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function excel(hljs$1) { - const BUILT_INS$6 = [ + function excel(hljs) { + const BUILT_INS$2 = [ "ABS", "ACCRINT", "ACCRINTM", @@ -150943,7 +151147,7 @@ var require_excel = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, keywords: { $pattern: /[a-zA-Z][\w\.]*/, - built_in: BUILT_INS$6 + built_in: BUILT_INS$2 }, contains: [ { @@ -150965,14 +151169,14 @@ var require_excel = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /[A-Z]{0,2}\d*:[A-Z]{0,2}\d*/, relevance: 0 }, - hljs$1.BACKSLASH_ESCAPE, - hljs$1.QUOTE_STRING_MODE, + hljs.BACKSLASH_ESCAPE, + hljs.QUOTE_STRING_MODE, { className: "number", - begin: hljs$1.NUMBER_RE + "(%)?", + begin: hljs.NUMBER_RE + "(%)?", relevance: 0 }, - hljs$1.COMMENT(/\bN\(/, /\)/, { + hljs.COMMENT(/\bN\(/, /\)/, { excludeBegin: true, excludeEnd: true, illegal: /\n/ @@ -150987,7 +151191,7 @@ var require_excel = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/fix.js var require_fix = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function fix(hljs$1) { + function fix(hljs) { return { name: "FIX", contains: [{ @@ -151020,7 +151224,7 @@ var require_fix = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/flix.js var require_flix = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function flix(hljs$1) { + function flix(hljs) { const CHAR = { className: "string", begin: /'(.|\\[xXuU][a-zA-Z0-9]+)'/ @@ -151071,12 +151275,12 @@ var require_flix = /* @__PURE__ */ __commonJSMin(((exports, module) => { literal: ["true", "false"] }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, CHAR, STRING, METHOD, - hljs$1.C_NUMBER_MODE + hljs.C_NUMBER_MODE ] }; } @@ -151087,17 +151291,17 @@ var require_flix = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/fortran.js var require_fortran = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function fortran(hljs$1) { - const regex = hljs$1.regex; + function fortran(hljs) { + const regex = hljs.regex; const PARAMS = { className: "params", begin: "\\(", end: "\\)" }; - const COMMENT$2 = { variants: [ - hljs$1.COMMENT("!", "$", { relevance: 0 }), - hljs$1.COMMENT("^C[ ]", "$", { relevance: 0 }), - hljs$1.COMMENT("^C$", "$", { relevance: 0 }) + const COMMENT = { variants: [ + hljs.COMMENT("!", "$", { relevance: 0 }), + hljs.COMMENT("^C[ ]", "$", { relevance: 0 }), + hljs.COMMENT("^C$", "$", { relevance: 0 }) ] }; const OPTIONAL_NUMBER_SUFFIX = /(_[a-z_\d]+)?/; const OPTIONAL_NUMBER_EXP = /([de][+-]?\d+)?/; @@ -151114,14 +151318,14 @@ var require_fortran = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "subroutine function program", illegal: "[${=\\n]", - contains: [hljs$1.UNDERSCORE_TITLE_MODE, PARAMS] + contains: [hljs.UNDERSCORE_TITLE_MODE, PARAMS] }; const STRING = { className: "string", relevance: 0, - variants: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + variants: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "kind", "do", "concurrent", @@ -151324,8 +151528,8 @@ var require_fortran = /* @__PURE__ */ __commonJSMin(((exports, module) => { "equivalence", "data" ]; - const LITERALS$6 = [".False.", ".True."]; - const BUILT_INS$6 = [ + const LITERALS$2 = [".False.", ".True."]; + const BUILT_INS$2 = [ "alog", "alog10", "amax0", @@ -151613,9 +151817,9 @@ var require_fortran = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["f90", "f95"], keywords: { $pattern: /\b[a-z][a-z0-9_]+\b|\.[a-z][a-z0-9_]+\./, - keyword: KEYWORDS$6, - literal: LITERALS$6, - built_in: BUILT_INS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2, + built_in: BUILT_INS$2 }, illegal: /\/\*/, contains: [ @@ -151625,7 +151829,7 @@ var require_fortran = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /^C\s*=(?!=)/, relevance: 0 }, - COMMENT$2, + COMMENT, NUMBER ] }; @@ -151640,14 +151844,14 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} value * @returns {RegExp} * */ - function escape$2(value) { + function escape(value) { return new RegExp(value.replace(/[-/\\^$*+?.()|[\]{}]/g, "\\$&"), "m"); } /** * @param {RegExp | string } re * @returns {string} */ - function source$2(re$1) { + function source(re$1) { if (!re$1) return null; if (typeof re$1 === "string") return re$1; return re$1.source; @@ -151656,22 +151860,22 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp | string } re * @returns {string} */ - function lookahead$2(re$1) { - return concat$2("(?=", re$1, ")"); + function lookahead(re$1) { + return concat("(?=", re$1, ")"); } /** * @param {...(RegExp | string) } args * @returns {string} */ - function concat$2(...args) { - const joined = args.map((x$2) => source$2(x$2)).join(""); + function concat(...args) { + const joined = args.map((x$2) => source(x$2)).join(""); return joined; } /** * @param { Array } args * @returns {object} */ - function stripOptionsFromArgs$2(args) { + function stripOptionsFromArgs(args) { const opts = args[args.length - 1]; if (typeof opts === "object" && opts.constructor === Object) { args.splice(args.length - 1, 1); @@ -151688,15 +151892,15 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {(RegExp | string)[] | [...(RegExp | string)[], RegexEitherOptions]} args * @returns {string} */ - function either$2(...args) { + function either(...args) { /** @type { object & {capture?: boolean} } */ - const opts = stripOptionsFromArgs$2(args); - const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source$2(x$2)).join("|") + ")"; + const opts = stripOptionsFromArgs(args); + const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source(x$2)).join("|") + ")"; return joined; } /** @type LanguageFn */ - function fsharp(hljs$1) { - const KEYWORDS$6 = [ + function fsharp(hljs) { + const KEYWORDS$2 = [ "abstract", "and", "as", @@ -151777,7 +151981,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { "help", "quit" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null", @@ -151871,13 +152075,13 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { "failwithf" ]; const ALL_KEYWORDS = { - keyword: KEYWORDS$6, - literal: LITERALS$6, + keyword: KEYWORDS$2, + literal: LITERALS$2, built_in: BUILTINS, "variable.constant": SPECIAL_IDENTIFIERS }; - const ML_COMMENT = hljs$1.COMMENT(/\(\*(?!\))/, /\*\)/, { contains: ["self"] }); - const COMMENT$2 = { variants: [ML_COMMENT, hljs$1.C_LINE_COMMENT_MODE] }; + const ML_COMMENT = hljs.COMMENT(/\(\*(?!\))/, /\*\)/, { contains: ["self"] }); + const COMMENT = { variants: [ML_COMMENT, hljs.C_LINE_COMMENT_MODE] }; const IDENTIFIER_RE = /[a-zA-Z_](\w|')*/; const QUOTED_IDENTIFIER = { scope: "variable", @@ -151887,7 +152091,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { const BEGIN_GENERIC_TYPE_SYMBOL_RE = /\B('|\^)/; const GENERIC_TYPE_SYMBOL = { scope: "symbol", - variants: [{ match: concat$2(BEGIN_GENERIC_TYPE_SYMBOL_RE, /``.*?``/) }, { match: concat$2(BEGIN_GENERIC_TYPE_SYMBOL_RE, hljs$1.UNDERSCORE_IDENT_RE) }], + variants: [{ match: concat(BEGIN_GENERIC_TYPE_SYMBOL_RE, /``.*?``/) }, { match: concat(BEGIN_GENERIC_TYPE_SYMBOL_RE, hljs.UNDERSCORE_IDENT_RE) }], relevance: 0 }; const makeOperatorMode = function({ includeEqual }) { @@ -151895,13 +152099,13 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (includeEqual) allOperatorChars = "!%&*+-/<=>@^|~?"; else allOperatorChars = "!%&*+-/<>@^|~?"; const OPERATOR_CHARS = Array.from(allOperatorChars); - const OPERATOR_CHAR_RE = concat$2("[", ...OPERATOR_CHARS.map(escape$2), "]"); - const OPERATOR_CHAR_OR_DOT_RE = either$2(OPERATOR_CHAR_RE, /\./); - const OPERATOR_FIRST_CHAR_OF_MULTIPLE_RE = concat$2(OPERATOR_CHAR_OR_DOT_RE, lookahead$2(OPERATOR_CHAR_OR_DOT_RE)); - const SYMBOLIC_OPERATOR_RE = either$2(concat$2(OPERATOR_FIRST_CHAR_OF_MULTIPLE_RE, OPERATOR_CHAR_OR_DOT_RE, "*"), concat$2(OPERATOR_CHAR_RE, "+")); + const OPERATOR_CHAR_RE = concat("[", ...OPERATOR_CHARS.map(escape), "]"); + const OPERATOR_CHAR_OR_DOT_RE = either(OPERATOR_CHAR_RE, /\./); + const OPERATOR_FIRST_CHAR_OF_MULTIPLE_RE = concat(OPERATOR_CHAR_OR_DOT_RE, lookahead(OPERATOR_CHAR_OR_DOT_RE)); + const SYMBOLIC_OPERATOR_RE = either(concat(OPERATOR_FIRST_CHAR_OF_MULTIPLE_RE, OPERATOR_CHAR_OR_DOT_RE, "*"), concat(OPERATOR_CHAR_RE, "+")); return { scope: "operator", - match: either$2(SYMBOLIC_OPERATOR_RE, /:\?>/, /:\?/, /:>/, /:=/, /::?/, /\$/), + match: either(SYMBOLIC_OPERATOR_RE, /:\?>/, /:\?/, /:>/, /:=/, /::?/, /\$/), relevance: 0 }; }; @@ -151909,15 +152113,15 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { const OPERATOR_WITHOUT_EQUAL = makeOperatorMode({ includeEqual: false }); const makeTypeAnnotationMode = function(prefix, prefixScope) { return { - begin: concat$2(prefix, lookahead$2(concat$2(/\s*/, either$2(/\w/, /'/, /\^/, /#/, /``/, /\(/, /{\|/)))), + begin: concat(prefix, lookahead(concat(/\s*/, either(/\w/, /'/, /\^/, /#/, /``/, /\(/, /{\|/)))), beginScope: prefixScope, - end: lookahead$2(either$2(/\n/, /=/)), + end: lookahead(either(/\n/, /=/)), relevance: 0, - keywords: hljs$1.inherit(ALL_KEYWORDS, { type: KNOWN_TYPES }), + keywords: hljs.inherit(ALL_KEYWORDS, { type: KNOWN_TYPES }), contains: [ - COMMENT$2, + COMMENT, GENERIC_TYPE_SYMBOL, - hljs$1.inherit(QUOTED_IDENTIFIER, { scope: null }), + hljs.inherit(QUOTED_IDENTIFIER, { scope: null }), OPERATOR_WITHOUT_EQUAL ] }; @@ -151935,11 +152139,11 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { 2: "keyword", 4: "title.class" }, - end: lookahead$2(/\(|=|$/), + end: lookahead(/\(|=|$/), keywords: ALL_KEYWORDS, contains: [ - COMMENT$2, - hljs$1.inherit(QUOTED_IDENTIFIER, { scope: null }), + COMMENT, + hljs.inherit(QUOTED_IDENTIFIER, { scope: null }), GENERIC_TYPE_SYMBOL, { scope: "operator", @@ -151955,24 +152159,24 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { const PREPROCESSOR = { begin: [ /^\s*/, - concat$2(/#/, either$2(...PREPROCESSOR_KEYWORDS)), + concat(/#/, either(...PREPROCESSOR_KEYWORDS)), /\b/ ], beginScope: { 2: "meta" }, - end: lookahead$2(/\s|$/) + end: lookahead(/\s|$/) }; - const NUMBER = { variants: [hljs$1.BINARY_NUMBER_MODE, hljs$1.C_NUMBER_MODE] }; + const NUMBER = { variants: [hljs.BINARY_NUMBER_MODE, hljs.C_NUMBER_MODE] }; const QUOTED_STRING = { scope: "string", begin: /"/, end: /"/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; const VERBATIM_STRING = { scope: "string", begin: /@"/, end: /"/, - contains: [{ match: /""/ }, hljs$1.BACKSLASH_ESCAPE] + contains: [{ match: /""/ }, hljs.BACKSLASH_ESCAPE] }; const TRIPLE_QUOTED_STRING = { scope: "string", @@ -151993,7 +152197,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ { match: /\{\{/ }, { match: /\}\}/ }, - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST ] }; @@ -152005,7 +152209,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { { match: /\{\{/ }, { match: /\}\}/ }, { match: /""/ }, - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST ] }; @@ -152022,7 +152226,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const CHAR_LITERAL = { scope: "string", - match: concat$2(/'/, either$2(/[^\\']/, /\\(?:.|\d{3}|x[a-fA-F\d]{2}|u[a-fA-F\d]{4}|U[a-fA-F\d]{8})/), /'/) + match: concat(/'/, either(/[^\\']/, /\\(?:.|\d{3}|x[a-fA-F\d]{2}|u[a-fA-F\d]{4}|U[a-fA-F\d]{8})/), /'/) }; SUBST.contains = [ INTERPOLATED_VERBATIM_STRING, @@ -152031,7 +152235,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { QUOTED_STRING, CHAR_LITERAL, BANG_KEYWORD_MODE, - COMMENT$2, + COMMENT, QUOTED_IDENTIFIER, TYPE_ANNOTATION, COMPUTATION_EXPRESSION, @@ -152058,7 +152262,7 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ BANG_KEYWORD_MODE, STRING, - COMMENT$2, + COMMENT, QUOTED_IDENTIFIER, TYPE_DECLARATION, { @@ -152092,9 +152296,9 @@ var require_fsharp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gams.js var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function gams(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = { + function gams(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = { keyword: "abort acronym acronyms alias all and assign binary card diag display " + "else eq file files for free ge gt if integer le loop lt maximizing " + "minimizing model models ne negative no not option options or ord " + "positive prod put putpage puttl repeat sameas semicont semiint smax " + "smin solve sos1 sos2 sum system table then until using while xor yes", literal: "eps inf na", built_in: "abs arccos arcsin arctan arctan2 Beta betaReg binomial ceil centropy " + "cos cosh cvPower div div0 eDist entropy errorf execSeed exp fact " + "floor frac gamma gammaReg log logBeta logGamma log10 log2 mapVal max " + "min mod ncpCM ncpF ncpVUpow ncpVUsin normal pi poly power " + "randBinomial randLinear randTriangle round rPower sigmoid sign " + "signPower sin sinh slexp sllog10 slrec sqexp sqlog10 sqr sqrec sqrt " + "tan tanh trunc uniform uniformInt vcPower bool_and bool_eqv bool_imp " + "bool_not bool_or bool_xor ifThen rel_eq rel_ge rel_gt rel_le rel_lt " + "rel_ne gday gdow ghour gleap gmillisec gminute gmonth gsecond gyear " + "jdate jnow jstart jtime errorLevel execError gamsRelease gamsVersion " + "handleCollect handleDelete handleStatus handleSubmit heapFree " + "heapLimit heapSize jobHandle jobKill jobStatus jobTerminate " + "licenseLevel licenseStatus maxExecError sleep timeClose timeComp " + "timeElapsed timeExec timeStart" @@ -152120,19 +152324,19 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"" }], illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; const ASSIGNMENT = { begin: "/", end: "/", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ QSTR, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.C_NUMBER_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.C_NUMBER_MODE ] }; const COMMENT_WORD = /[a-z0-9&#*=?@\\><:,()$[\]_.{}!+%^-]+/; @@ -152155,9 +152359,9 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "GAMS", aliases: ["gms"], case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.COMMENT(/^\$ontext/, /^\$offtext/), + hljs.COMMENT(/^\$ontext/, /^\$offtext/), { className: "meta", begin: "^\\$[a-z0-9]+", @@ -152168,20 +152372,20 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "^\\$[a-z0-9]+" }] }, - hljs$1.COMMENT("^\\*", "$"), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.COMMENT("^\\*", "$"), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, { beginKeywords: "set sets parameter parameters variable variables " + "scalar scalars equation equations", end: ";", contains: [ - hljs$1.COMMENT("^\\*", "$"), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.COMMENT("^\\*", "$"), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, ASSIGNMENT, DESCTEXT ] @@ -152196,12 +152400,12 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "$", contains: [DESCTEXT] }, - hljs$1.COMMENT("^\\*", "$"), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.C_NUMBER_MODE + hljs.COMMENT("^\\*", "$"), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.C_NUMBER_MODE ] }, { @@ -152217,7 +152421,7 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { SYMBOLS ] }, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, SYMBOLS ] }; @@ -152228,13 +152432,13 @@ var require_gams = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gauss.js var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function gauss(hljs$1) { - const KEYWORDS$6 = { + function gauss(hljs) { + const KEYWORDS$2 = { keyword: "bool break call callexe checkinterrupt clear clearg closeall cls comlog compile " + "continue create debug declare delete disable dlibrary dllcall do dos ed edit else " + "elseif enable end endfor endif endp endo errorlog errorlogat expr external fn " + "for format goto gosub graph if keyword let lib library line load loadarray loadexe " + "loadf loadk loadm loadp loads loadx local locate loopnextindex lprint lpwidth lshow " + "matrix msym ndpclex new open output outwidth plot plotsym pop prcsn print " + "printdos proc push retp return rndcon rndmod rndmult rndseed run save saveall screen " + "scroll setarray show sparse stop string struct system trace trap threadfor " + "threadendfor threadbegin threadjoin threadstat threadend until use while winprint " + "ne ge le gt lt and xor or not eq eqv", built_in: "abs acf aconcat aeye amax amean AmericanBinomCall AmericanBinomCall_Greeks AmericanBinomCall_ImpVol " + "AmericanBinomPut AmericanBinomPut_Greeks AmericanBinomPut_ImpVol AmericanBSCall AmericanBSCall_Greeks " + "AmericanBSCall_ImpVol AmericanBSPut AmericanBSPut_Greeks AmericanBSPut_ImpVol amin amult annotationGetDefaults " + "annotationSetBkd annotationSetFont annotationSetLineColor annotationSetLineStyle annotationSetLineThickness " + "annualTradingDays arccos arcsin areshape arrayalloc arrayindex arrayinit arraytomat asciiload asclabel astd " + "astds asum atan atan2 atranspose axmargin balance band bandchol bandcholsol bandltsol bandrv bandsolpd bar " + "base10 begwind besselj bessely beta box boxcox cdfBeta cdfBetaInv cdfBinomial cdfBinomialInv cdfBvn cdfBvn2 " + "cdfBvn2e cdfCauchy cdfCauchyInv cdfChic cdfChii cdfChinc cdfChincInv cdfExp cdfExpInv cdfFc cdfFnc cdfFncInv " + "cdfGam cdfGenPareto cdfHyperGeo cdfLaplace cdfLaplaceInv cdfLogistic cdfLogisticInv cdfmControlCreate cdfMvn " + "cdfMvn2e cdfMvnce cdfMvne cdfMvt2e cdfMvtce cdfMvte cdfN cdfN2 cdfNc cdfNegBinomial cdfNegBinomialInv cdfNi " + "cdfPoisson cdfPoissonInv cdfRayleigh cdfRayleighInv cdfTc cdfTci cdfTnc cdfTvn cdfWeibull cdfWeibullInv cdir " + "ceil ChangeDir chdir chiBarSquare chol choldn cholsol cholup chrs close code cols colsf combinate combinated " + "complex con cond conj cons ConScore contour conv convertsatostr convertstrtosa corrm corrms corrvc corrx corrxs " + "cos cosh counts countwts crossprd crout croutp csrcol csrlin csvReadM csvReadSA cumprodc cumsumc curve cvtos " + "datacreate datacreatecomplex datalist dataload dataloop dataopen datasave date datestr datestring datestrymd " + "dayinyr dayofweek dbAddDatabase dbClose dbCommit dbCreateQuery dbExecQuery dbGetConnectOptions dbGetDatabaseName " + "dbGetDriverName dbGetDrivers dbGetHostName dbGetLastErrorNum dbGetLastErrorText dbGetNumericalPrecPolicy " + "dbGetPassword dbGetPort dbGetTableHeaders dbGetTables dbGetUserName dbHasFeature dbIsDriverAvailable dbIsOpen " + "dbIsOpenError dbOpen dbQueryBindValue dbQueryClear dbQueryCols dbQueryExecPrepared dbQueryFetchAllM dbQueryFetchAllSA " + "dbQueryFetchOneM dbQueryFetchOneSA dbQueryFinish dbQueryGetBoundValue dbQueryGetBoundValues dbQueryGetField " + "dbQueryGetLastErrorNum dbQueryGetLastErrorText dbQueryGetLastInsertID dbQueryGetLastQuery dbQueryGetPosition " + "dbQueryIsActive dbQueryIsForwardOnly dbQueryIsNull dbQueryIsSelect dbQueryIsValid dbQueryPrepare dbQueryRows " + "dbQuerySeek dbQuerySeekFirst dbQuerySeekLast dbQuerySeekNext dbQuerySeekPrevious dbQuerySetForwardOnly " + "dbRemoveDatabase dbRollback dbSetConnectOptions dbSetDatabaseName dbSetHostName dbSetNumericalPrecPolicy " + "dbSetPort dbSetUserName dbTransaction DeleteFile delif delrows denseToSp denseToSpRE denToZero design det detl " + "dfft dffti diag diagrv digamma doswin DOSWinCloseall DOSWinOpen dotfeq dotfeqmt dotfge dotfgemt dotfgt dotfgtmt " + "dotfle dotflemt dotflt dotfltmt dotfne dotfnemt draw drop dsCreate dstat dstatmt dstatmtControlCreate dtdate dtday " + "dttime dttodtv dttostr dttoutc dtvnormal dtvtodt dtvtoutc dummy dummybr dummydn eig eigh eighv eigv elapsedTradingDays " + "endwind envget eof eqSolve eqSolvemt eqSolvemtControlCreate eqSolvemtOutCreate eqSolveset erf erfc erfccplx erfcplx error " + "etdays ethsec etstr EuropeanBinomCall EuropeanBinomCall_Greeks EuropeanBinomCall_ImpVol EuropeanBinomPut " + "EuropeanBinomPut_Greeks EuropeanBinomPut_ImpVol EuropeanBSCall EuropeanBSCall_Greeks EuropeanBSCall_ImpVol " + "EuropeanBSPut EuropeanBSPut_Greeks EuropeanBSPut_ImpVol exctsmpl exec execbg exp extern eye fcheckerr fclearerr feq " + "feqmt fflush fft ffti fftm fftmi fftn fge fgemt fgets fgetsa fgetsat fgetst fgt fgtmt fileinfo filesa fle flemt " + "floor flt fltmt fmod fne fnemt fonts fopen formatcv formatnv fputs fputst fseek fstrerror ftell ftocv ftos ftostrC " + "gamma gammacplx gammaii gausset gdaAppend gdaCreate gdaDStat gdaDStatMat gdaGetIndex gdaGetName gdaGetNames gdaGetOrders " + "gdaGetType gdaGetTypes gdaGetVarInfo gdaIsCplx gdaLoad gdaPack gdaRead gdaReadByIndex gdaReadSome gdaReadSparse " + "gdaReadStruct gdaReportVarInfo gdaSave gdaUpdate gdaUpdateAndPack gdaVars gdaWrite gdaWrite32 gdaWriteSome getarray " + "getdims getf getGAUSShome getmatrix getmatrix4D getname getnamef getNextTradingDay getNextWeekDay getnr getorders " + "getpath getPreviousTradingDay getPreviousWeekDay getRow getscalar3D getscalar4D getTrRow getwind glm gradcplx gradMT " + "gradMTm gradMTT gradMTTm gradp graphprt graphset hasimag header headermt hess hessMT hessMTg hessMTgw hessMTm " + "hessMTmw hessMTT hessMTTg hessMTTgw hessMTTm hessMTw hessp hist histf histp hsec imag indcv indexcat indices indices2 " + "indicesf indicesfn indnv indsav integrate1d integrateControlCreate intgrat2 intgrat3 inthp1 inthp2 inthp3 inthp4 " + "inthpControlCreate intquad1 intquad2 intquad3 intrleav intrleavsa intrsect intsimp inv invpd invswp iscplx iscplxf " + "isden isinfnanmiss ismiss key keyav keyw lag lag1 lagn lapEighb lapEighi lapEighvb lapEighvi lapgEig lapgEigh lapgEighv " + "lapgEigv lapgSchur lapgSvdcst lapgSvds lapgSvdst lapSvdcusv lapSvds lapSvdusv ldlp ldlsol linSolve listwise ln lncdfbvn " + "lncdfbvn2 lncdfmvn lncdfn lncdfn2 lncdfnc lnfact lngammacplx lnpdfmvn lnpdfmvt lnpdfn lnpdft loadd loadstruct loadwind " + "loess loessmt loessmtControlCreate log loglog logx logy lower lowmat lowmat1 ltrisol lu lusol machEpsilon make makevars " + "makewind margin matalloc matinit mattoarray maxbytes maxc maxindc maxv maxvec mbesselei mbesselei0 mbesselei1 mbesseli " + "mbesseli0 mbesseli1 meanc median mergeby mergevar minc minindc minv miss missex missrv moment momentd movingave " + "movingaveExpwgt movingaveWgt nextindex nextn nextnevn nextwind ntos null null1 numCombinations ols olsmt olsmtControlCreate " + "olsqr olsqr2 olsqrmt ones optn optnevn orth outtyp pacf packedToSp packr parse pause pdfCauchy pdfChi pdfExp pdfGenPareto " + "pdfHyperGeo pdfLaplace pdfLogistic pdfn pdfPoisson pdfRayleigh pdfWeibull pi pinv pinvmt plotAddArrow plotAddBar plotAddBox " + "plotAddHist plotAddHistF plotAddHistP plotAddPolar plotAddScatter plotAddShape plotAddTextbox plotAddTS plotAddXY plotArea " + "plotBar plotBox plotClearLayout plotContour plotCustomLayout plotGetDefaults plotHist plotHistF plotHistP plotLayout " + "plotLogLog plotLogX plotLogY plotOpenWindow plotPolar plotSave plotScatter plotSetAxesPen plotSetBar plotSetBarFill " + "plotSetBarStacked plotSetBkdColor plotSetFill plotSetGrid plotSetLegend plotSetLineColor plotSetLineStyle plotSetLineSymbol " + "plotSetLineThickness plotSetNewWindow plotSetTitle plotSetWhichYAxis plotSetXAxisShow plotSetXLabel plotSetXRange " + "plotSetXTicInterval plotSetXTicLabel plotSetYAxisShow plotSetYLabel plotSetYRange plotSetZAxisShow plotSetZLabel " + "plotSurface plotTS plotXY polar polychar polyeval polygamma polyint polymake polymat polymroot polymult polyroot " + "pqgwin previousindex princomp printfm printfmt prodc psi putarray putf putvals pvCreate pvGetIndex pvGetParNames " + "pvGetParVector pvLength pvList pvPack pvPacki pvPackm pvPackmi pvPacks pvPacksi pvPacksm pvPacksmi pvPutParVector " + "pvTest pvUnpack QNewton QNewtonmt QNewtonmtControlCreate QNewtonmtOutCreate QNewtonSet QProg QProgmt QProgmtInCreate " + "qqr qqre qqrep qr qre qrep qrsol qrtsol qtyr qtyre qtyrep quantile quantiled qyr qyre qyrep qz rank rankindx readr " + "real reclassify reclassifyCuts recode recserar recsercp recserrc rerun rescale reshape rets rev rfft rffti rfftip rfftn " + "rfftnp rfftp rndBernoulli rndBeta rndBinomial rndCauchy rndChiSquare rndCon rndCreateState rndExp rndGamma rndGeo rndGumbel " + "rndHyperGeo rndi rndKMbeta rndKMgam rndKMi rndKMn rndKMnb rndKMp rndKMu rndKMvm rndLaplace rndLCbeta rndLCgam rndLCi rndLCn " + "rndLCnb rndLCp rndLCu rndLCvm rndLogNorm rndMTu rndMVn rndMVt rndn rndnb rndNegBinomial rndp rndPoisson rndRayleigh " + "rndStateSkip rndu rndvm rndWeibull rndWishart rotater round rows rowsf rref sampleData satostrC saved saveStruct savewind " + "scale scale3d scalerr scalinfnanmiss scalmiss schtoc schur searchsourcepath seekr select selif seqa seqm setdif setdifsa " + "setvars setvwrmode setwind shell shiftr sin singleindex sinh sleep solpd sortc sortcc sortd sorthc sorthcc sortind " + "sortindc sortmc sortr sortrc spBiconjGradSol spChol spConjGradSol spCreate spDenseSubmat spDiagRvMat spEigv spEye spLDL " + "spline spLU spNumNZE spOnes spreadSheetReadM spreadSheetReadSA spreadSheetWrite spScale spSubmat spToDense spTrTDense " + "spTScalar spZeros sqpSolve sqpSolveMT sqpSolveMTControlCreate sqpSolveMTlagrangeCreate sqpSolveMToutCreate sqpSolveSet " + "sqrt statements stdc stdsc stocv stof strcombine strindx strlen strput strrindx strsect strsplit strsplitPad strtodt " + "strtof strtofcplx strtriml strtrimr strtrunc strtruncl strtruncpad strtruncr submat subscat substute subvec sumc sumr " + "surface svd svd1 svd2 svdcusv svds svdusv sysstate tab tan tanh tempname " + "time timedt timestr timeutc title tkf2eps tkf2ps tocart todaydt toeplitz token topolar trapchk " + "trigamma trimr trunc type typecv typef union unionsa uniqindx uniqindxsa unique uniquesa upmat upmat1 upper utctodt " + "utctodtv utrisol vals varCovMS varCovXS varget vargetl varmall varmares varput varputl vartypef vcm vcms vcx vcxs " + "vec vech vecr vector vget view viewxyz vlist vnamecv volume vput vread vtypecv wait waitc walkindex where window " + "writer xlabel xlsGetSheetCount xlsGetSheetSize xlsGetSheetTypes xlsMakeRange xlsReadM xlsReadSA xlsWrite xlsWriteM " + "xlsWriteSA xpnd xtics xy xyz ylabel ytics zeros zeta zlabel ztics cdfEmpirical dot h5create h5open h5read h5readAttribute " + "h5write h5writeAttribute ldl plotAddErrorBar plotAddSurface plotCDFEmpirical plotSetColormap plotSetContourLabels " + "plotSetLegendFont plotSetTextInterpreter plotSetXTicCount plotSetYTicCount plotSetZLevels powerm strjoin sylvester " + "strtrim", literal: "DB_AFTER_LAST_ROW DB_ALL_TABLES DB_BATCH_OPERATIONS DB_BEFORE_FIRST_ROW DB_BLOB DB_EVENT_NOTIFICATIONS " + "DB_FINISH_QUERY DB_HIGH_PRECISION DB_LAST_INSERT_ID DB_LOW_PRECISION_DOUBLE DB_LOW_PRECISION_INT32 " + "DB_LOW_PRECISION_INT64 DB_LOW_PRECISION_NUMBERS DB_MULTIPLE_RESULT_SETS DB_NAMED_PLACEHOLDERS " + "DB_POSITIONAL_PLACEHOLDERS DB_PREPARED_QUERIES DB_QUERY_SIZE DB_SIMPLE_LOCKING DB_SYSTEM_TABLES DB_TABLES " + "DB_TRANSACTIONS DB_UNICODE DB_VIEWS __STDIN __STDOUT __STDERR __FILE_DIR" }; - const AT_COMMENT_MODE = hljs$1.COMMENT("@", "@"); + const AT_COMMENT_MODE = hljs.COMMENT("@", "@"); const PREPROCESSOR = { className: "meta", begin: "#", @@ -152256,8 +152460,8 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "\\n" }] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, AT_COMMENT_MODE ] }; @@ -152267,7 +152471,7 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "struct", contains: [{ className: "type", - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }] }; @@ -152284,53 +152488,53 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "literal", begin: /\.\.\./ }, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, AT_COMMENT_MODE, STRUCT_TYPE ] }]; const FUNCTION_DEF = { className: "title", - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }; - const DEFINITION = function(beginKeywords$2, end, inherits) { - const mode = hljs$1.inherit({ + const DEFINITION = function(beginKeywords, end, inherits) { + const mode = hljs.inherit({ className: "function", - beginKeywords: beginKeywords$2, + beginKeywords, end, excludeEnd: true, contains: [].concat(PARSE_PARAMS) }, {}); mode.contains.push(FUNCTION_DEF); - mode.contains.push(hljs$1.C_NUMBER_MODE); - mode.contains.push(hljs$1.C_BLOCK_COMMENT_MODE); + mode.contains.push(hljs.C_NUMBER_MODE); + mode.contains.push(hljs.C_BLOCK_COMMENT_MODE); mode.contains.push(AT_COMMENT_MODE); return mode; }; const BUILT_IN_REF = { className: "built_in", - begin: "\\b(" + KEYWORDS$6.built_in.split(" ").join("|") + ")\\b" + begin: "\\b(" + KEYWORDS$2.built_in.split(" ").join("|") + ")\\b" }; const STRING_REF = { className: "string", begin: "\"", end: "\"", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], relevance: 0 }; const FUNCTION_REF = { - begin: hljs$1.UNDERSCORE_IDENT_RE + "\\s*\\(", + begin: hljs.UNDERSCORE_IDENT_RE + "\\s*\\(", returnBegin: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ - { beginKeywords: KEYWORDS$6.keyword }, + { beginKeywords: KEYWORDS$2.keyword }, BUILT_IN_REF, { className: "built_in", - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 } ] @@ -152340,12 +152544,12 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\)/, relevance: 0, keywords: { - built_in: KEYWORDS$6.built_in, - literal: KEYWORDS$6.literal + built_in: KEYWORDS$2.built_in, + literal: KEYWORDS$2.literal }, contains: [ - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, AT_COMMENT_MODE, BUILT_IN_REF, FUNCTION_REF, @@ -152358,12 +152562,12 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "GAUSS", aliases: ["gss"], case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /(\{[%#]|[%#]\}| <- )/, contains: [ - hljs$1.C_NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, AT_COMMENT_MODE, STRING_REF, PREPROCESSOR, @@ -152378,13 +152582,13 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /;/, relevance: 0, contains: [ - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, AT_COMMENT_MODE, FUNCTION_REF_PARAMS ] }, { - variants: [{ begin: hljs$1.UNDERSCORE_IDENT_RE + "\\." + hljs$1.UNDERSCORE_IDENT_RE }, { begin: hljs$1.UNDERSCORE_IDENT_RE + "\\s*=" }], + variants: [{ begin: hljs.UNDERSCORE_IDENT_RE + "\\." + hljs.UNDERSCORE_IDENT_RE }, { begin: hljs.UNDERSCORE_IDENT_RE + "\\s*=" }], relevance: 0 }, FUNCTION_REF, @@ -152398,8 +152602,8 @@ var require_gauss = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gcode.js var require_gcode = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function gcode(hljs$1) { - const regex = hljs$1.regex; + function gcode(hljs) { + const regex = hljs.regex; const GCODE_KEYWORDS = { $pattern: /[A-Z]+|%/, keyword: [ @@ -152457,7 +152661,7 @@ var require_gcode = /* @__PURE__ */ __commonJSMin(((exports, module) => { } response.ignoreMatch(); } - const NUMBER_RE$2 = /[+-]?((\.\d+)|(\d+)(\.\d*)?)/; + const NUMBER_RE = /[+-]?((\.\d+)|(\d+)(\.\d*)?)/; const GENERAL_MISC_FUNCTION_RE = /[GM]\s*\d+(\.\d+)?/; const TOOLS_RE = /T\s*\d+/; const SUBROUTINE_RE = /O\s*\d+/; @@ -152465,11 +152669,11 @@ var require_gcode = /* @__PURE__ */ __commonJSMin(((exports, module) => { const AXES_RE = /[ABCUVWXYZ]\s*/; const PARAMETERS_RE = /[FHIJKPQRS]\s*/; const GCODE_CODE = [ - hljs$1.COMMENT(/\(/, /\)/), - hljs$1.COMMENT(/;/, /$/), - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.COMMENT(/\(/, /\)/), + hljs.COMMENT(/;/, /$/), + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { scope: "title.function", variants: [ @@ -152511,15 +152715,15 @@ var require_gcode = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { scope: "property", - variants: [{ match: regex.concat(LETTER_BOUNDARY_RE, AXES_RE, NUMBER_RE$2) }, { - begin: regex.concat(AXES_RE, NUMBER_RE$2), + variants: [{ match: regex.concat(LETTER_BOUNDARY_RE, AXES_RE, NUMBER_RE) }, { + begin: regex.concat(AXES_RE, NUMBER_RE), "on:begin": LETTER_BOUNDARY_CALLBACK }] }, { scope: "params", - variants: [{ match: regex.concat(LETTER_BOUNDARY_RE, PARAMETERS_RE, NUMBER_RE$2) }, { - begin: regex.concat(PARAMETERS_RE, NUMBER_RE$2), + variants: [{ match: regex.concat(LETTER_BOUNDARY_RE, PARAMETERS_RE, NUMBER_RE) }, { + begin: regex.concat(PARAMETERS_RE, NUMBER_RE), "on:begin": LETTER_BOUNDARY_CALLBACK }] } @@ -152539,7 +152743,7 @@ var require_gcode = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gherkin.js var require_gherkin = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function gherkin(hljs$1) { + function gherkin(hljs) { return { name: "Gherkin", aliases: ["feature"], @@ -152567,13 +152771,13 @@ var require_gherkin = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "<", end: ">" }, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "string", begin: "\"\"\"", end: "\"\"\"" }, - hljs$1.QUOTE_STRING_MODE + hljs.QUOTE_STRING_MODE ] }; } @@ -152583,7 +152787,7 @@ var require_gherkin = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/glsl.js var require_glsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function glsl(hljs$1) { + function glsl(hljs) { return { name: "GLSL", keywords: { @@ -152594,9 +152798,9 @@ var require_glsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, illegal: "\"", contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, { className: "meta", begin: "#", @@ -152611,8 +152815,8 @@ var require_glsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gml.js var require_gml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function gml(hljs$1) { - const KEYWORDS$6 = [ + function gml(hljs) { + const KEYWORDS$2 = [ "#endregion", "#macro", "#region", @@ -152649,7 +152853,7 @@ var require_gml = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with", "xor" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "abs", "alarm_get", "alarm_set", @@ -155717,17 +155921,17 @@ var require_gml = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "GML", case_insensitive: false, keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6, + keyword: KEYWORDS$2, + built_in: BUILT_INS$2, symbol: SYMBOLS, "variable.language": LANGUAGE_VARIABLES }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE ] }; } @@ -155737,14 +155941,14 @@ var require_gml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/go.js var require_go = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function go(hljs$1) { - const LITERALS$6 = [ + function go(hljs) { + const LITERALS$2 = [ "true", "false", "iota", "nil" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "append", "cap", "close", @@ -155761,7 +155965,7 @@ var require_go = /* @__PURE__ */ __commonJSMin(((exports, module) => { "recover", "delete" ]; - const TYPES$6 = [ + const TYPES$2 = [ "bool", "byte", "complex64", @@ -155810,25 +156014,25 @@ var require_go = /* @__PURE__ */ __commonJSMin(((exports, module) => { "type", "var" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: KWS, - type: TYPES$6, - literal: LITERALS$6, - built_in: BUILT_INS$6 + type: TYPES$2, + literal: LITERALS$2, + built_in: BUILT_INS$2 }; return { name: "Go", aliases: ["golang"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: " { beginKeywords: "func", end: "\\s*(\\{|$)", excludeEnd: true, - contains: [hljs$1.TITLE_MODE, { + contains: [hljs.TITLE_MODE, { className: "params", begin: /\(/, end: /\)/, endsParent: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /["']/ }] } @@ -155884,8 +156088,8 @@ var require_go = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/golo.js var require_golo = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function golo(hljs$1) { - const KEYWORDS$6 = [ + function golo(hljs) { + const KEYWORDS$2 = [ "println", "readln", "print", @@ -155936,7 +156140,7 @@ var require_golo = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Golo", keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, literal: [ "true", "false", @@ -155944,9 +156148,9 @@ var require_golo = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.HASH_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { className: "meta", begin: "@[A-Za-z]+" @@ -155960,8 +156164,8 @@ var require_golo = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/gradle.js var require_gradle = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function gradle(hljs$1) { - const KEYWORDS$6 = [ + function gradle(hljs) { + const KEYWORDS$2 = [ "task", "project", "allprojects", @@ -156128,14 +156332,14 @@ var require_gradle = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Gradle", case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, - hljs$1.REGEXP_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, + hljs.REGEXP_MODE ] }; } @@ -156146,8 +156350,8 @@ var require_gradle = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/graphql.js var require_graphql = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function graphql(hljs$1) { - const regex = hljs$1.regex; + function graphql(hljs) { + const regex = hljs.regex; const GQL_NAME = /[_A-Za-z][_0-9A-Za-z]*/; return { name: "GraphQL", @@ -156177,9 +156381,9 @@ var require_graphql = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, + hljs.HASH_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, { scope: "punctuation", match: /[.]{3}/, @@ -156217,17 +156421,17 @@ var require_graphql = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/groovy.js var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function variants(variants$1, obj = {}) { - obj.variants = variants$1; + function variants(variants, obj = {}) { + obj.variants = variants; return obj; } - function groovy(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = "[A-Za-z0-9_$]+"; - const COMMENT$2 = variants([ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT("/\\*\\*", "\\*/", { + function groovy(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = "[A-Za-z0-9_$]+"; + const COMMENT = variants([ + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT("/\\*\\*", "\\*/", { relevance: 0, contains: [{ begin: /\w+@/, @@ -156241,9 +156445,9 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { const REGEXP = { className: "regexp", begin: /~?\/[^\/\n]+\//, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; - const NUMBER = variants([hljs$1.BINARY_NUMBER_MODE, hljs$1.C_NUMBER_MODE]); + const NUMBER = variants([hljs.BINARY_NUMBER_MODE, hljs.C_NUMBER_MODE]); const STRING = variants([ { begin: /"""/, @@ -156258,21 +156462,21 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "/\\$", relevance: 10 }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ], { className: "string" }); const CLASS_DEFINITION = { match: [ /(class|interface|trait|enum|record|extends|implements)/, /\s+/, - hljs$1.UNDERSCORE_IDENT_RE + hljs.UNDERSCORE_IDENT_RE ], scope: { 1: "keyword", 3: "title.class" } }; - const TYPES$6 = [ + const TYPES$2 = [ "byte", "short", "char", @@ -156283,7 +156487,7 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { "double", "void" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "def", "as", "in", @@ -156329,15 +156533,15 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: { "variable.language": "this super", literal: "true false null", - type: TYPES$6, - keyword: KEYWORDS$6 + type: TYPES$2, + keyword: KEYWORDS$2 }, contains: [ - hljs$1.SHEBANG({ + hljs.SHEBANG({ binary: "groovy", relevance: 10 }), - COMMENT$2, + COMMENT, STRING, REGEXP, NUMBER, @@ -156349,7 +156553,7 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "attr", - begin: IDENT_RE$6 + "[ ]*:", + begin: IDENT_RE$2 + "[ ]*:", relevance: 0 }, { @@ -156357,7 +156561,7 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /:/, relevance: 0, contains: [ - COMMENT$2, + COMMENT, STRING, REGEXP, NUMBER, @@ -156366,9 +156570,9 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "symbol", - begin: "^[ ]*" + regex.lookahead(IDENT_RE$6 + ":"), + begin: "^[ ]*" + regex.lookahead(IDENT_RE$2 + ":"), excludeBegin: true, - end: IDENT_RE$6 + ":", + end: IDENT_RE$2 + ":", relevance: 0 } ], @@ -156381,7 +156585,7 @@ var require_groovy = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/haml.js var require_haml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function haml(hljs$1) { + function haml(hljs) { return { name: "HAML", case_insensitive: true, @@ -156391,7 +156595,7 @@ var require_haml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "^!!!( (5|1\\.1|Strict|Frameset|Basic|Mobile|RDFa|XML\\b.*))?$", relevance: 10 }, - hljs$1.COMMENT("^\\s*(!=#|=#|-#|/).*$", null, { relevance: 0 }), + hljs.COMMENT("^\\s*(!=#|=#|-#|/).*$", null, { relevance: 0 }), { begin: "^\\s*(-|=|!=)(?!#)", end: /$/, @@ -156428,8 +156632,8 @@ var require_haml = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "attr", begin: ":\\w+" }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { begin: "\\w+", relevance: 0 @@ -156452,8 +156656,8 @@ var require_haml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\w+", relevance: 0 }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { begin: "\\w+", relevance: 0 @@ -156480,9 +156684,9 @@ var require_haml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/handlebars.js var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function handlebars(hljs$1) { - const regex = hljs$1.regex; - const BUILT_INS$6 = { + function handlebars(hljs) { + const regex = hljs.regex; + const BUILT_INS$2 = { $pattern: /[\w.\/]+/, built_in: [ "action", @@ -156516,7 +156720,7 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { "yield" ] }; - const LITERALS$6 = { + const LITERALS$2 = { $pattern: /[\w.\/]+/, literal: [ "true", @@ -156534,7 +156738,7 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { const IDENTIFIER_REGEX = regex.concat(regex.optional(/\.|\.\/|\//), ANY_ID, regex.anyNumberOfTimes(regex.concat(PATH_DELIMITER_REGEX, ANY_ID))); const HASH_PARAM_REGEX = regex.concat("(", BRACKET_QUOTED_ID_REGEX, "|", PLAIN_ID_REGEX, ")(?==)"); const HELPER_NAME_OR_PATH_EXPRESSION = { begin: IDENTIFIER_REGEX }; - const HELPER_PARAMETER = hljs$1.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { keywords: LITERALS$6 }); + const HELPER_PARAMETER = hljs.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { keywords: LITERALS$2 }); const SUB_EXPRESSION = { begin: /\(/, end: /\)/ @@ -156547,9 +156751,9 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /=/, end: /=/, starts: { contains: [ - hljs$1.NUMBER_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.NUMBER_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, HELPER_PARAMETER, SUB_EXPRESSION ] } @@ -156563,9 +156767,9 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const HELPER_PARAMETERS = { contains: [ - hljs$1.NUMBER_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.NUMBER_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, BLOCK_PARAMS, HASH, HELPER_PARAMETER, @@ -156573,25 +156777,25 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { ], returnEnd: true }; - const SUB_EXPRESSION_CONTENTS = hljs$1.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { + const SUB_EXPRESSION_CONTENTS = hljs.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { className: "name", - keywords: BUILT_INS$6, - starts: hljs$1.inherit(HELPER_PARAMETERS, { end: /\)/ }) + keywords: BUILT_INS$2, + starts: hljs.inherit(HELPER_PARAMETERS, { end: /\)/ }) }); SUB_EXPRESSION.contains = [SUB_EXPRESSION_CONTENTS]; - const OPENING_BLOCK_MUSTACHE_CONTENTS = hljs$1.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { - keywords: BUILT_INS$6, + const OPENING_BLOCK_MUSTACHE_CONTENTS = hljs.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { + keywords: BUILT_INS$2, className: "name", - starts: hljs$1.inherit(HELPER_PARAMETERS, { end: /\}\}/ }) + starts: hljs.inherit(HELPER_PARAMETERS, { end: /\}\}/ }) }); - const CLOSING_BLOCK_MUSTACHE_CONTENTS = hljs$1.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { - keywords: BUILT_INS$6, + const CLOSING_BLOCK_MUSTACHE_CONTENTS = hljs.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { + keywords: BUILT_INS$2, className: "name" }); - const BASIC_MUSTACHE_CONTENTS = hljs$1.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { + const BASIC_MUSTACHE_CONTENTS = hljs.inherit(HELPER_NAME_OR_PATH_EXPRESSION, { className: "name", - keywords: BUILT_INS$6, - starts: hljs$1.inherit(HELPER_PARAMETERS, { end: /\}\}/ }) + keywords: BUILT_INS$2, + starts: hljs.inherit(HELPER_PARAMETERS, { end: /\}\}/ }) }); const ESCAPE_MUSTACHE_WITH_PRECEEDING_BACKSLASH = { begin: /\\\{\{/, @@ -156614,8 +156818,8 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ ESCAPE_MUSTACHE_WITH_PRECEEDING_BACKSLASH, PREVENT_ESCAPE_WITH_ANOTHER_PRECEEDING_BACKSLASH, - hljs$1.COMMENT(/\{\{!--/, /--\}\}/), - hljs$1.COMMENT(/\{\{!/, /\}\}/), + hljs.COMMENT(/\{\{!--/, /--\}\}/), + hljs.COMMENT(/\{\{!/, /\}\}/), { className: "template-tag", begin: /\{\{\{\{(?!\/)/, @@ -156678,16 +156882,16 @@ var require_handlebars = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/haskell.js var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function haskell(hljs$1) { - const decimalDigits$2 = "([0-9]_*)+"; - const hexDigits$2 = "([0-9a-fA-F]_*)+"; + function haskell(hljs) { + const decimalDigits = "([0-9]_*)+"; + const hexDigits = "([0-9a-fA-F]_*)+"; const binaryDigits = "([01]_*)+"; const octalDigits = "([0-7]_*)+"; const ascSymbol = "[!#$%&*+.\\/<=>?@\\\\^~-]"; const uniSymbol = "(\\p{S}|\\p{P})"; const special = "[(),;\\[\\]`|{}]"; const symbol = `(${ascSymbol}|(?!(${special}|[_:"']))${uniSymbol})`; - const COMMENT$2 = { variants: [hljs$1.COMMENT("--+", "$"), hljs$1.COMMENT(/\{-/, /-\}/, { contains: ["self"] })] }; + const COMMENT = { variants: [hljs.COMMENT("--+", "$"), hljs.COMMENT(/\{-/, /-\}/, { contains: ["self"] })] }; const PRAGMA = { className: "meta", begin: /\{-#/, @@ -156714,8 +156918,8 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "type", begin: "\\b[A-Z][\\w]*(\\((\\.\\.|,|\\w+)\\))?" }, - hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "[_a-z][\\w']*" }), - COMMENT$2 + hljs.inherit(hljs.TITLE_MODE, { begin: "[_a-z][\\w']*" }), + COMMENT ] }; const RECORD = { @@ -156727,8 +156931,8 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "number", relevance: 0, variants: [ - { match: `\\b(${decimalDigits$2})(\\.(${decimalDigits$2}))?` + `([eE][+-]?(${decimalDigits$2}))?\\b` }, - { match: `\\b0[xX]_*(${hexDigits$2})(\\.(${hexDigits$2}))?` + `([pP][+-]?(${decimalDigits$2}))?\\b` }, + { match: `\\b(${decimalDigits})(\\.(${decimalDigits}))?` + `([eE][+-]?(${decimalDigits}))?\\b` }, + { match: `\\b0[xX]_*(${hexDigits})(\\.(${hexDigits}))?` + `([pP][+-]?(${decimalDigits}))?\\b` }, { match: `\\b0[oO](${octalDigits})\\b` }, { match: `\\b0[bB](${binaryDigits})\\b` } ] @@ -156743,14 +156947,14 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "module", end: "where", keywords: "module where", - contains: [LIST, COMMENT$2], + contains: [LIST, COMMENT], illegal: "\\W\\.|;" }, { begin: "\\bimport\\b", end: "$", keywords: "import qualified as hiding", - contains: [LIST, COMMENT$2], + contains: [LIST, COMMENT], illegal: "\\W\\.|;" }, { @@ -156761,7 +156965,7 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ CONSTRUCTOR, LIST, - COMMENT$2 + COMMENT ] }, { @@ -156774,7 +156978,7 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { CONSTRUCTOR, LIST, RECORD, - COMMENT$2 + COMMENT ] }, { @@ -156783,13 +156987,13 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ CONSTRUCTOR, LIST, - COMMENT$2 + COMMENT ] }, { beginKeywords: "infix infixl infixr", end: "$", - contains: [hljs$1.C_NUMBER_MODE, COMMENT$2] + contains: [hljs.C_NUMBER_MODE, COMMENT] }, { begin: "\\bforeign\\b", @@ -156797,8 +157001,8 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "foreign import export ccall stdcall cplusplus jvm " + "dotnet safe unsafe", contains: [ CONSTRUCTOR, - hljs$1.QUOTE_STRING_MODE, - COMMENT$2 + hljs.QUOTE_STRING_MODE, + COMMENT ] }, { @@ -156817,12 +157021,12 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: /\\./ }] }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBER, CONSTRUCTOR, - hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "^[_a-z][\\w']*" }), + hljs.inherit(hljs.TITLE_MODE, { begin: "^[_a-z][\\w']*" }), { begin: `(?!-)${symbol}--+|--+(?!-)${symbol}` }, - COMMENT$2, + COMMENT, { begin: "->|<-" } ] }; @@ -156833,8 +157037,8 @@ var require_haskell = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/haxe.js var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function haxe(hljs$1) { - const IDENT_RE$6 = "[a-zA-Z_$][a-zA-Z0-9_$]*"; + function haxe(hljs) { + const IDENT_RE$2 = "[a-zA-Z_$][a-zA-Z0-9_$]*"; const HAXE_NUMBER_RE = /(-?)(\b0[xX][a-fA-F0-9_]+|(\b\d+(\.[\d_]*)?|\.[\d_]+)(([eE][-+]?\d+)|i32|u32|i64|f64)?)/; const HAXE_BASIC_TYPES = "Int Float String Bool Dynamic Void Array "; return { @@ -156851,7 +157055,7 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "'", end: "'", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, { className: "subst", begin: /\$\{/, @@ -156864,9 +157068,9 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { } ] }, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "number", begin: HAXE_NUMBER_RE, @@ -156874,7 +157078,7 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "variable", - begin: "\\$" + IDENT_RE$6 + begin: "\\$" + IDENT_RE$2 }, { className: "meta", @@ -156914,11 +157118,11 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "title.class", beginKeywords: "enum", end: /\{/, - contains: [hljs$1.TITLE_MODE] + contains: [hljs.TITLE_MODE] }, { className: "title.class", - begin: "\\babstract\\b(?=\\s*" + hljs$1.IDENT_RE + "\\s*\\()", + begin: "\\babstract\\b(?=\\s*" + hljs.IDENT_RE + "\\s*\\()", end: /[\{$]/, contains: [ { @@ -156942,7 +157146,7 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeBegin: true, excludeEnd: true }, - hljs$1.TITLE_MODE + hljs.TITLE_MODE ], keywords: { keyword: "abstract from to" } }, @@ -156958,10 +157162,10 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "extends implements", contains: [{ className: "type", - begin: hljs$1.IDENT_RE, + begin: hljs.IDENT_RE, relevance: 0 }] - }, hljs$1.TITLE_MODE] + }, hljs.TITLE_MODE] }, { className: "title.function", @@ -156969,7 +157173,7 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\(/, excludeEnd: true, illegal: /\S/, - contains: [hljs$1.TITLE_MODE] + contains: [hljs.TITLE_MODE] } ], illegal: /<\// @@ -156981,7 +157185,7 @@ var require_haxe = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/hsp.js var require_hsp = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function hsp(hljs$1) { + function hsp(hljs) { return { name: "HSP", case_insensitive: true, @@ -156990,36 +157194,36 @@ var require_hsp = /* @__PURE__ */ __commonJSMin(((exports, module) => { keyword: "goto gosub return break repeat loop continue wait await dim sdim foreach dimtype dup dupptr end stop newmod delmod mref run exgoto on mcall assert logmes newlab resume yield onexit onerror onkey onclick oncmd exist delete mkdir chdir dirlist bload bsave bcopy memfile if else poke wpoke lpoke getstr chdpm memexpand memcpy memset notesel noteadd notedel noteload notesave randomize noteunsel noteget split strrep setease button chgdisp exec dialog mmload mmplay mmstop mci pset pget syscolor mes print title pos circle cls font sysfont objsize picload color palcolor palette redraw width gsel gcopy gzoom gmode bmpsave hsvcolor getkey listbox chkbox combox input mesbox buffer screen bgscr mouse objsel groll line clrobj boxf objprm objmode stick grect grotate gsquare gradf objimage objskip objenable celload celdiv celput newcom querycom delcom cnvstow comres axobj winobj sendmsg comevent comevarg sarrayconv callfunc cnvwtos comevdisp libptr system hspstat hspver stat cnt err strsize looplev sublev iparam wparam lparam refstr refdval int rnd strlen length length2 length3 length4 vartype gettime peek wpeek lpeek varptr varuse noteinfo instr abs limit getease str strmid strf getpath strtrim sin cos tan atan sqrt double absf expf logf limitf powf geteasef mousex mousey mousew hwnd hinstance hdc ginfo objinfo dirinfo sysinfo thismod __hspver__ __hsp30__ __date__ __time__ __line__ __file__ _debug __hspdef__ and or xor not screen_normal screen_palette screen_hide screen_fixedsize screen_tool screen_frame gmode_gdi gmode_mem gmode_rgb0 gmode_alpha gmode_rgb0alpha gmode_add gmode_sub gmode_pixela ginfo_mx ginfo_my ginfo_act ginfo_sel ginfo_wx1 ginfo_wy1 ginfo_wx2 ginfo_wy2 ginfo_vx ginfo_vy ginfo_sizex ginfo_sizey ginfo_winx ginfo_winy ginfo_mesx ginfo_mesy ginfo_r ginfo_g ginfo_b ginfo_paluse ginfo_dispx ginfo_dispy ginfo_cx ginfo_cy ginfo_intid ginfo_newid ginfo_sx ginfo_sy objinfo_mode objinfo_bmscr objinfo_hwnd notemax notesize dir_cur dir_exe dir_win dir_sys dir_cmdline dir_desktop dir_mydoc dir_tv font_normal font_bold font_italic font_underline font_strikeout font_antialias objmode_normal objmode_guifont objmode_usefont gsquare_grad msgothic msmincho do until while wend for next _break _continue switch case default swbreak swend ddim ldim alloc m_pi rad2deg deg2rad ease_linear ease_quad_in ease_quad_out ease_quad_inout ease_cubic_in ease_cubic_out ease_cubic_inout ease_quartic_in ease_quartic_out ease_quartic_inout ease_bounce_in ease_bounce_out ease_bounce_inout ease_shake_in ease_shake_out ease_shake_inout ease_loop" }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, { className: "string", begin: /\{"/, end: /"\}/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, - hljs$1.COMMENT(";", "$", { relevance: 0 }), + hljs.COMMENT(";", "$", { relevance: 0 }), { className: "meta", begin: "#", end: "$", keywords: { keyword: "addion cfunc cmd cmpopt comfunc const defcfunc deffunc define else endif enum epack func global if ifdef ifndef include modcfunc modfunc modinit modterm module pack packopt regcmd runtime undef usecom uselib" }, contains: [ - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { className: "string" }), - hljs$1.NUMBER_MODE, - hljs$1.C_NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string" }), + hljs.NUMBER_MODE, + hljs.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { className: "symbol", begin: "^\\*(\\w+|@)" }, - hljs$1.NUMBER_MODE, - hljs$1.C_NUMBER_MODE + hljs.NUMBER_MODE, + hljs.C_NUMBER_MODE ] }; } @@ -157029,8 +157233,8 @@ var require_hsp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/http.js var require_http = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function http(hljs$1) { - const regex = hljs$1.regex; + function http(hljs) { + const regex = hljs.regex; const VERSION = "HTTP/([32]|1\\.[01])"; const HEADER_NAME = /[A-Za-z][A-Za-z0-9-]*/; const HEADER = { @@ -157100,7 +157304,7 @@ var require_http = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: HEADERS_AND_BODY } }, - hljs$1.inherit(HEADER, { relevance: 0 }) + hljs.inherit(HEADER, { relevance: 0 }) ] }; } @@ -157110,10 +157314,10 @@ var require_http = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/hy.js var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function hy(hljs$1) { + function hy(hljs) { const SYMBOLSTART = "a-zA-Z_\\-!.?+*=<>&#'"; const SYMBOL_RE = "[" + SYMBOLSTART + "][" + SYMBOLSTART + "0-9/;:]*"; - const keywords$1 = { + const keywords = { $pattern: SYMBOL_RE, built_in: "!= % %= & &= * ** **= *= *map " + "+ += , --build-class-- --import-- -= . / // //= " + "/= < << <<= <= = > >= >> >>= " + "@ @= ^ ^= abs accumulate all and any ap-compose " + "ap-dotimes ap-each ap-each-while ap-filter ap-first ap-if ap-last ap-map ap-map-when ap-pipe " + "ap-reduce ap-reject apply as-> ascii assert assoc bin break butlast " + "callable calling-module-name car case cdr chain chr coll? combinations compile " + "compress cond cons cons? continue count curry cut cycle dec " + "def default-method defclass defmacro defmacro-alias defmacro/g! defmain defmethod defmulti defn " + "defn-alias defnc defnr defreader defseq del delattr delete-route dict-comp dir " + "disassemble dispatch-reader-macro distinct divmod do doto drop drop-last drop-while empty? " + "end-sequence eval eval-and-compile eval-when-compile even? every? except exec filter first " + "flatten float? fn fnc fnr for for* format fraction genexpr " + "gensym get getattr global globals group-by hasattr hash hex id " + "identity if if* if-not if-python2 import in inc input instance? " + "integer integer-char? integer? interleave interpose is is-coll is-cons is-empty is-even " + "is-every is-float is-instance is-integer is-integer-char is-iterable is-iterator is-keyword is-neg is-none " + "is-not is-numeric is-odd is-pos is-string is-symbol is-zero isinstance islice issubclass " + "iter iterable? iterate iterator? keyword keyword? lambda last len let " + "lif lif-not list* list-comp locals loop macro-error macroexpand macroexpand-1 macroexpand-all " + "map max merge-with method-decorator min multi-decorator multicombinations name neg? next " + "none? nonlocal not not-in not? nth numeric? oct odd? open " + "or ord partition permutations pos? post-route postwalk pow prewalk print " + "product profile/calls profile/cpu put-route quasiquote quote raise range read read-str " + "recursive-replace reduce remove repeat repeatedly repr require rest round route " + "route-with-methods rwm second seq set-comp setattr setv some sorted string " + "string? sum switch symbol? take take-nth take-while tee try unless " + "unquote unquote-splicing vars walk when while with with* with-decorator with-gensyms " + "xi xor yield yield-from zero? zip zip-longest | |= ~" }; @@ -157127,8 +157331,8 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: SIMPLE_NUMBER_RE, relevance: 0 }; - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }); - const COMMENT$2 = hljs$1.COMMENT(";", "$", { relevance: 0 }); + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }); + const COMMENT = hljs.COMMENT(";", "$", { relevance: 0 }); const LITERAL = { className: "literal", begin: /\b([Tt]rue|[Ff]alse|nil|None)\b/ @@ -157142,7 +157346,7 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "comment", begin: "\\^" + SYMBOL_RE }; - const HINT_COL = hljs$1.COMMENT("\\^\\{", "\\}"); + const HINT_COL = hljs.COMMENT("\\^\\{", "\\}"); const KEY = { className: "symbol", begin: "[:]{1,2}" + SYMBOL_RE @@ -157158,7 +157362,7 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { const NAME = { className: "name", relevance: 0, - keywords: keywords$1, + keywords, begin: SYMBOL_RE, starts: BODY }; @@ -157167,7 +157371,7 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { STRING, HINT, HINT_COL, - COMMENT$2, + COMMENT, KEY, COLLECTION, NUMBER, @@ -157175,7 +157379,7 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { SYMBOL ]; LIST.contains = [ - hljs$1.COMMENT("comment", ""), + hljs.COMMENT("comment", ""), NAME, BODY ]; @@ -157186,12 +157390,12 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["hylang"], illegal: /\S/, contains: [ - hljs$1.SHEBANG(), + hljs.SHEBANG(), LIST, STRING, HINT, HINT_COL, - COMMENT$2, + COMMENT, KEY, COLLECTION, NUMBER, @@ -157205,7 +157409,7 @@ var require_hy = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/inform7.js var require_inform7 = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function inform7(hljs$1) { + function inform7(hljs) { const START_BRACKET = "\\["; const END_BRACKET = "\\]"; return { @@ -157253,14 +157457,14 @@ var require_inform7 = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ini.js var require_ini = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function ini(hljs$1) { - const regex = hljs$1.regex; + function ini(hljs) { + const regex = hljs.regex; const NUMBERS = { className: "number", relevance: 0, - variants: [{ begin: /([+-]+)?[\d]+_[\d_]+/ }, { begin: hljs$1.NUMBER_RE }] + variants: [{ begin: /([+-]+)?[\d]+_[\d_]+/ }, { begin: hljs.NUMBER_RE }] }; - const COMMENTS = hljs$1.COMMENT(); + const COMMENTS = hljs.COMMENT(); COMMENTS.variants = [{ begin: /;/, end: /$/ @@ -157272,13 +157476,13 @@ var require_ini = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "variable", variants: [{ begin: /\$[\w\d"][\w\d_]*/ }, { begin: /\$\{(.*?)\}/ }] }; - const LITERALS$6 = { + const LITERALS$2 = { className: "literal", begin: /\bon|off|true|false|yes|no\b/ }; const STRINGS = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { begin: "'''", @@ -157305,7 +157509,7 @@ var require_ini = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\]/, contains: [ COMMENTS, - LITERALS$6, + LITERALS$2, VARIABLES, STRINGS, NUMBERS, @@ -157338,7 +157542,7 @@ var require_ini = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ COMMENTS, ARRAY, - LITERALS$6, + LITERALS$2, VARIABLES, STRINGS, NUMBERS @@ -157355,8 +157559,8 @@ var require_ini = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/irpf90.js var require_irpf90 = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function irpf90(hljs$1) { - const regex = hljs$1.regex; + function irpf90(hljs) { + const regex = hljs.regex; const PARAMS = { className: "params", begin: "\\(", @@ -157384,11 +157588,11 @@ var require_irpf90 = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: F_KEYWORDS, illegal: /\/\*/, contains: [ - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { + hljs.inherit(hljs.APOS_STRING_MODE, { className: "string", relevance: 0 }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { + hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string", relevance: 0 }), @@ -157396,10 +157600,10 @@ var require_irpf90 = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "subroutine function program", illegal: "[${=\\n]", - contains: [hljs$1.UNDERSCORE_TITLE_MODE, PARAMS] + contains: [hljs.UNDERSCORE_TITLE_MODE, PARAMS] }, - hljs$1.COMMENT("!", "$", { relevance: 0 }), - hljs$1.COMMENT("begin_doc", "end_doc", { relevance: 10 }), + hljs.COMMENT("!", "$", { relevance: 0 }), + hljs.COMMENT("begin_doc", "end_doc", { relevance: 10 }), NUMBER ] }; @@ -157410,8 +157614,8 @@ var require_irpf90 = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/isbl.js var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function isbl(hljs$1) { - const UNDERSCORE_IDENT_RE$2 = "[A-Za-zА-Яа-яёЁ_!][A-Za-zА-Яа-яёЁ_0-9]*"; + function isbl(hljs) { + const UNDERSCORE_IDENT_RE = "[A-Za-zА-Яа-яёЁ_!][A-Za-zА-Яа-яёЁ_0-9]*"; const FUNCTION_NAME_IDENT_RE = "[A-Za-zА-Яа-яёЁ_][A-Za-zА-Яа-яёЁ_0-9]*"; const KEYWORD = "and и else иначе endexcept endfinally endforeach конецвсе endif конецесли endwhile конецпока " + "except exitfor finally foreach все if если in в not не or или try while пока "; const sysres_constants = "SYSRES_CONST_ACCES_RIGHT_TYPE_EDIT " + "SYSRES_CONST_ACCES_RIGHT_TYPE_FULL " + "SYSRES_CONST_ACCES_RIGHT_TYPE_VIEW " + "SYSRES_CONST_ACCESS_MODE_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_NO_ACCESS_VIEW " + "SYSRES_CONST_ACCESS_NO_ACCESS_VIEW_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_ADD_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_ADD_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_CHANGE_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_CHANGE_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_DELETE_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_DELETE_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_EXECUTE_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_EXECUTE_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_NO_ACCESS_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_NO_ACCESS_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_RATIFY_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_RATIFY_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_VIEW " + "SYSRES_CONST_ACCESS_RIGHTS_VIEW_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_VIEW_REQUISITE_CODE " + "SYSRES_CONST_ACCESS_RIGHTS_VIEW_REQUISITE_YES_CODE " + "SYSRES_CONST_ACCESS_TYPE_CHANGE " + "SYSRES_CONST_ACCESS_TYPE_CHANGE_CODE " + "SYSRES_CONST_ACCESS_TYPE_EXISTS " + "SYSRES_CONST_ACCESS_TYPE_EXISTS_CODE " + "SYSRES_CONST_ACCESS_TYPE_FULL " + "SYSRES_CONST_ACCESS_TYPE_FULL_CODE " + "SYSRES_CONST_ACCESS_TYPE_VIEW " + "SYSRES_CONST_ACCESS_TYPE_VIEW_CODE " + "SYSRES_CONST_ACTION_TYPE_ABORT " + "SYSRES_CONST_ACTION_TYPE_ACCEPT " + "SYSRES_CONST_ACTION_TYPE_ACCESS_RIGHTS " + "SYSRES_CONST_ACTION_TYPE_ADD_ATTACHMENT " + "SYSRES_CONST_ACTION_TYPE_CHANGE_CARD " + "SYSRES_CONST_ACTION_TYPE_CHANGE_KIND " + "SYSRES_CONST_ACTION_TYPE_CHANGE_STORAGE " + "SYSRES_CONST_ACTION_TYPE_CONTINUE " + "SYSRES_CONST_ACTION_TYPE_COPY " + "SYSRES_CONST_ACTION_TYPE_CREATE " + "SYSRES_CONST_ACTION_TYPE_CREATE_VERSION " + "SYSRES_CONST_ACTION_TYPE_DELETE " + "SYSRES_CONST_ACTION_TYPE_DELETE_ATTACHMENT " + "SYSRES_CONST_ACTION_TYPE_DELETE_VERSION " + "SYSRES_CONST_ACTION_TYPE_DISABLE_DELEGATE_ACCESS_RIGHTS " + "SYSRES_CONST_ACTION_TYPE_ENABLE_DELEGATE_ACCESS_RIGHTS " + "SYSRES_CONST_ACTION_TYPE_ENCRYPTION_BY_CERTIFICATE " + "SYSRES_CONST_ACTION_TYPE_ENCRYPTION_BY_CERTIFICATE_AND_PASSWORD " + "SYSRES_CONST_ACTION_TYPE_ENCRYPTION_BY_PASSWORD " + "SYSRES_CONST_ACTION_TYPE_EXPORT_WITH_LOCK " + "SYSRES_CONST_ACTION_TYPE_EXPORT_WITHOUT_LOCK " + "SYSRES_CONST_ACTION_TYPE_IMPORT_WITH_UNLOCK " + "SYSRES_CONST_ACTION_TYPE_IMPORT_WITHOUT_UNLOCK " + "SYSRES_CONST_ACTION_TYPE_LIFE_CYCLE_STAGE " + "SYSRES_CONST_ACTION_TYPE_LOCK " + "SYSRES_CONST_ACTION_TYPE_LOCK_FOR_SERVER " + "SYSRES_CONST_ACTION_TYPE_LOCK_MODIFY " + "SYSRES_CONST_ACTION_TYPE_MARK_AS_READED " + "SYSRES_CONST_ACTION_TYPE_MARK_AS_UNREADED " + "SYSRES_CONST_ACTION_TYPE_MODIFY " + "SYSRES_CONST_ACTION_TYPE_MODIFY_CARD " + "SYSRES_CONST_ACTION_TYPE_MOVE_TO_ARCHIVE " + "SYSRES_CONST_ACTION_TYPE_OFF_ENCRYPTION " + "SYSRES_CONST_ACTION_TYPE_PASSWORD_CHANGE " + "SYSRES_CONST_ACTION_TYPE_PERFORM " + "SYSRES_CONST_ACTION_TYPE_RECOVER_FROM_LOCAL_COPY " + "SYSRES_CONST_ACTION_TYPE_RESTART " + "SYSRES_CONST_ACTION_TYPE_RESTORE_FROM_ARCHIVE " + "SYSRES_CONST_ACTION_TYPE_REVISION " + "SYSRES_CONST_ACTION_TYPE_SEND_BY_MAIL " + "SYSRES_CONST_ACTION_TYPE_SIGN " + "SYSRES_CONST_ACTION_TYPE_START " + "SYSRES_CONST_ACTION_TYPE_UNLOCK " + "SYSRES_CONST_ACTION_TYPE_UNLOCK_FROM_SERVER " + "SYSRES_CONST_ACTION_TYPE_VERSION_STATE " + "SYSRES_CONST_ACTION_TYPE_VERSION_VISIBILITY " + "SYSRES_CONST_ACTION_TYPE_VIEW " + "SYSRES_CONST_ACTION_TYPE_VIEW_SHADOW_COPY " + "SYSRES_CONST_ACTION_TYPE_WORKFLOW_DESCRIPTION_MODIFY " + "SYSRES_CONST_ACTION_TYPE_WRITE_HISTORY " + "SYSRES_CONST_ACTIVE_VERSION_STATE_PICK_VALUE " + "SYSRES_CONST_ADD_REFERENCE_MODE_NAME " + "SYSRES_CONST_ADDITION_REQUISITE_CODE " + "SYSRES_CONST_ADDITIONAL_PARAMS_REQUISITE_CODE " + "SYSRES_CONST_ADITIONAL_JOB_END_DATE_REQUISITE_NAME " + "SYSRES_CONST_ADITIONAL_JOB_READ_REQUISITE_NAME " + "SYSRES_CONST_ADITIONAL_JOB_START_DATE_REQUISITE_NAME " + "SYSRES_CONST_ADITIONAL_JOB_STATE_REQUISITE_NAME " + "SYSRES_CONST_ADMINISTRATION_HISTORY_ADDING_USER_TO_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_ADDING_USER_TO_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_COMP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_COMP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_USER_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_CREATION_USER_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DATABASE_USER_CREATION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DATABASE_USER_CREATION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DATABASE_USER_DELETION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DATABASE_USER_DELETION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_COMP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_COMP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_USER_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_USER_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_USER_FROM_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_DELETION_USER_FROM_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_FILTERER_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_FILTERER_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_FILTERER_RESTRICTION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_FILTERER_RESTRICTION_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_PRIVILEGE_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_PRIVILEGE_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_RIGHTS_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_GRANTING_RIGHTS_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_IS_MAIN_SERVER_CHANGED_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_IS_MAIN_SERVER_CHANGED_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_IS_PUBLIC_CHANGED_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_IS_PUBLIC_CHANGED_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_FILTERER_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_FILTERER_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_FILTERER_RESTRICTION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_FILTERER_RESTRICTION_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_PRIVILEGE_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_PRIVILEGE_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_RIGHTS_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_REMOVING_RIGHTS_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_SERVER_LOGIN_CREATION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_SERVER_LOGIN_CREATION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_SERVER_LOGIN_DELETION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_SERVER_LOGIN_DELETION_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_CATEGORY_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_CATEGORY_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_COMP_TITLE_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_COMP_TITLE_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_FULL_NAME_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_FULL_NAME_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_PARENT_GROUP_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_PARENT_GROUP_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_AUTH_TYPE_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_AUTH_TYPE_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_LOGIN_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_LOGIN_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_STATUS_ACTION " + "SYSRES_CONST_ADMINISTRATION_HISTORY_UPDATING_USER_STATUS_ACTION_CODE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_USER_PASSWORD_CHANGE " + "SYSRES_CONST_ADMINISTRATION_HISTORY_USER_PASSWORD_CHANGE_ACTION " + "SYSRES_CONST_ALL_ACCEPT_CONDITION_RUS " + "SYSRES_CONST_ALL_USERS_GROUP " + "SYSRES_CONST_ALL_USERS_GROUP_NAME " + "SYSRES_CONST_ALL_USERS_SERVER_GROUP_NAME " + "SYSRES_CONST_ALLOWED_ACCESS_TYPE_CODE " + "SYSRES_CONST_ALLOWED_ACCESS_TYPE_NAME " + "SYSRES_CONST_APP_VIEWER_TYPE_REQUISITE_CODE " + "SYSRES_CONST_APPROVING_SIGNATURE_NAME " + "SYSRES_CONST_APPROVING_SIGNATURE_REQUISITE_CODE " + "SYSRES_CONST_ASSISTANT_SUBSTITUE_TYPE " + "SYSRES_CONST_ASSISTANT_SUBSTITUE_TYPE_CODE " + "SYSRES_CONST_ATTACH_TYPE_COMPONENT_TOKEN " + "SYSRES_CONST_ATTACH_TYPE_DOC " + "SYSRES_CONST_ATTACH_TYPE_EDOC " + "SYSRES_CONST_ATTACH_TYPE_FOLDER " + "SYSRES_CONST_ATTACH_TYPE_JOB " + "SYSRES_CONST_ATTACH_TYPE_REFERENCE " + "SYSRES_CONST_ATTACH_TYPE_TASK " + "SYSRES_CONST_AUTH_ENCODED_PASSWORD " + "SYSRES_CONST_AUTH_ENCODED_PASSWORD_CODE " + "SYSRES_CONST_AUTH_NOVELL " + "SYSRES_CONST_AUTH_PASSWORD " + "SYSRES_CONST_AUTH_PASSWORD_CODE " + "SYSRES_CONST_AUTH_WINDOWS " + "SYSRES_CONST_AUTHENTICATING_SIGNATURE_NAME " + "SYSRES_CONST_AUTHENTICATING_SIGNATURE_REQUISITE_CODE " + "SYSRES_CONST_AUTO_ENUM_METHOD_FLAG " + "SYSRES_CONST_AUTO_NUMERATION_CODE " + "SYSRES_CONST_AUTO_STRONG_ENUM_METHOD_FLAG " + "SYSRES_CONST_AUTOTEXT_NAME_REQUISITE_CODE " + "SYSRES_CONST_AUTOTEXT_TEXT_REQUISITE_CODE " + "SYSRES_CONST_AUTOTEXT_USAGE_ALL " + "SYSRES_CONST_AUTOTEXT_USAGE_ALL_CODE " + "SYSRES_CONST_AUTOTEXT_USAGE_SIGN " + "SYSRES_CONST_AUTOTEXT_USAGE_SIGN_CODE " + "SYSRES_CONST_AUTOTEXT_USAGE_WORK " + "SYSRES_CONST_AUTOTEXT_USAGE_WORK_CODE " + "SYSRES_CONST_AUTOTEXT_USE_ANYWHERE_CODE " + "SYSRES_CONST_AUTOTEXT_USE_ON_SIGNING_CODE " + "SYSRES_CONST_AUTOTEXT_USE_ON_WORK_CODE " + "SYSRES_CONST_BEGIN_DATE_REQUISITE_CODE " + "SYSRES_CONST_BLACK_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_BLUE_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_BTN_PART " + "SYSRES_CONST_CALCULATED_ROLE_TYPE_CODE " + "SYSRES_CONST_CALL_TYPE_VARIABLE_BUTTON_VALUE " + "SYSRES_CONST_CALL_TYPE_VARIABLE_PROGRAM_VALUE " + "SYSRES_CONST_CANCEL_MESSAGE_FUNCTION_RESULT " + "SYSRES_CONST_CARD_PART " + "SYSRES_CONST_CARD_REFERENCE_MODE_NAME " + "SYSRES_CONST_CERTIFICATE_TYPE_REQUISITE_ENCRYPT_VALUE " + "SYSRES_CONST_CERTIFICATE_TYPE_REQUISITE_SIGN_AND_ENCRYPT_VALUE " + "SYSRES_CONST_CERTIFICATE_TYPE_REQUISITE_SIGN_VALUE " + "SYSRES_CONST_CHECK_PARAM_VALUE_DATE_PARAM_TYPE " + "SYSRES_CONST_CHECK_PARAM_VALUE_FLOAT_PARAM_TYPE " + "SYSRES_CONST_CHECK_PARAM_VALUE_INTEGER_PARAM_TYPE " + "SYSRES_CONST_CHECK_PARAM_VALUE_PICK_PARAM_TYPE " + "SYSRES_CONST_CHECK_PARAM_VALUE_REEFRENCE_PARAM_TYPE " + "SYSRES_CONST_CLOSED_RECORD_FLAG_VALUE_FEMININE " + "SYSRES_CONST_CLOSED_RECORD_FLAG_VALUE_MASCULINE " + "SYSRES_CONST_CODE_COMPONENT_TYPE_ADMIN " + "SYSRES_CONST_CODE_COMPONENT_TYPE_DEVELOPER " + "SYSRES_CONST_CODE_COMPONENT_TYPE_DOCS " + "SYSRES_CONST_CODE_COMPONENT_TYPE_EDOC_CARDS " + "SYSRES_CONST_CODE_COMPONENT_TYPE_EXTERNAL_EXECUTABLE " + "SYSRES_CONST_CODE_COMPONENT_TYPE_OTHER " + "SYSRES_CONST_CODE_COMPONENT_TYPE_REFERENCE " + "SYSRES_CONST_CODE_COMPONENT_TYPE_REPORT " + "SYSRES_CONST_CODE_COMPONENT_TYPE_SCRIPT " + "SYSRES_CONST_CODE_COMPONENT_TYPE_URL " + "SYSRES_CONST_CODE_REQUISITE_ACCESS " + "SYSRES_CONST_CODE_REQUISITE_CODE " + "SYSRES_CONST_CODE_REQUISITE_COMPONENT " + "SYSRES_CONST_CODE_REQUISITE_DESCRIPTION " + "SYSRES_CONST_CODE_REQUISITE_EXCLUDE_COMPONENT " + "SYSRES_CONST_CODE_REQUISITE_RECORD " + "SYSRES_CONST_COMMENT_REQ_CODE " + "SYSRES_CONST_COMMON_SETTINGS_REQUISITE_CODE " + "SYSRES_CONST_COMP_CODE_GRD " + "SYSRES_CONST_COMPONENT_GROUP_TYPE_REQUISITE_CODE " + "SYSRES_CONST_COMPONENT_TYPE_ADMIN_COMPONENTS " + "SYSRES_CONST_COMPONENT_TYPE_DEVELOPER_COMPONENTS " + "SYSRES_CONST_COMPONENT_TYPE_DOCS " + "SYSRES_CONST_COMPONENT_TYPE_EDOC_CARDS " + "SYSRES_CONST_COMPONENT_TYPE_EDOCS " + "SYSRES_CONST_COMPONENT_TYPE_EXTERNAL_EXECUTABLE " + "SYSRES_CONST_COMPONENT_TYPE_OTHER " + "SYSRES_CONST_COMPONENT_TYPE_REFERENCE_TYPES " + "SYSRES_CONST_COMPONENT_TYPE_REFERENCES " + "SYSRES_CONST_COMPONENT_TYPE_REPORTS " + "SYSRES_CONST_COMPONENT_TYPE_SCRIPTS " + "SYSRES_CONST_COMPONENT_TYPE_URL " + "SYSRES_CONST_COMPONENTS_REMOTE_SERVERS_VIEW_CODE " + "SYSRES_CONST_CONDITION_BLOCK_DESCRIPTION " + "SYSRES_CONST_CONST_FIRM_STATUS_COMMON " + "SYSRES_CONST_CONST_FIRM_STATUS_INDIVIDUAL " + "SYSRES_CONST_CONST_NEGATIVE_VALUE " + "SYSRES_CONST_CONST_POSITIVE_VALUE " + "SYSRES_CONST_CONST_SERVER_STATUS_DONT_REPLICATE " + "SYSRES_CONST_CONST_SERVER_STATUS_REPLICATE " + "SYSRES_CONST_CONTENTS_REQUISITE_CODE " + "SYSRES_CONST_DATA_TYPE_BOOLEAN " + "SYSRES_CONST_DATA_TYPE_DATE " + "SYSRES_CONST_DATA_TYPE_FLOAT " + "SYSRES_CONST_DATA_TYPE_INTEGER " + "SYSRES_CONST_DATA_TYPE_PICK " + "SYSRES_CONST_DATA_TYPE_REFERENCE " + "SYSRES_CONST_DATA_TYPE_STRING " + "SYSRES_CONST_DATA_TYPE_TEXT " + "SYSRES_CONST_DATA_TYPE_VARIANT " + "SYSRES_CONST_DATE_CLOSE_REQ_CODE " + "SYSRES_CONST_DATE_FORMAT_DATE_ONLY_CHAR " + "SYSRES_CONST_DATE_OPEN_REQ_CODE " + "SYSRES_CONST_DATE_REQUISITE " + "SYSRES_CONST_DATE_REQUISITE_CODE " + "SYSRES_CONST_DATE_REQUISITE_NAME " + "SYSRES_CONST_DATE_REQUISITE_TYPE " + "SYSRES_CONST_DATE_TYPE_CHAR " + "SYSRES_CONST_DATETIME_FORMAT_VALUE " + "SYSRES_CONST_DEA_ACCESS_RIGHTS_ACTION_CODE " + "SYSRES_CONST_DESCRIPTION_LOCALIZE_ID_REQUISITE_CODE " + "SYSRES_CONST_DESCRIPTION_REQUISITE_CODE " + "SYSRES_CONST_DET1_PART " + "SYSRES_CONST_DET2_PART " + "SYSRES_CONST_DET3_PART " + "SYSRES_CONST_DET4_PART " + "SYSRES_CONST_DET5_PART " + "SYSRES_CONST_DET6_PART " + "SYSRES_CONST_DETAIL_DATASET_KEY_REQUISITE_CODE " + "SYSRES_CONST_DETAIL_PICK_REQUISITE_CODE " + "SYSRES_CONST_DETAIL_REQ_CODE " + "SYSRES_CONST_DO_NOT_USE_ACCESS_TYPE_CODE " + "SYSRES_CONST_DO_NOT_USE_ACCESS_TYPE_NAME " + "SYSRES_CONST_DO_NOT_USE_ON_VIEW_ACCESS_TYPE_CODE " + "SYSRES_CONST_DO_NOT_USE_ON_VIEW_ACCESS_TYPE_NAME " + "SYSRES_CONST_DOCUMENT_STORAGES_CODE " + "SYSRES_CONST_DOCUMENT_TEMPLATES_TYPE_NAME " + "SYSRES_CONST_DOUBLE_REQUISITE_CODE " + "SYSRES_CONST_EDITOR_CLOSE_FILE_OBSERV_TYPE_CODE " + "SYSRES_CONST_EDITOR_CLOSE_PROCESS_OBSERV_TYPE_CODE " + "SYSRES_CONST_EDITOR_TYPE_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_APPLICATION_NAME_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_CREATE_SEVERAL_PROCESSES_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_EXTENSION_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_OBSERVER_BY_PROCESS_TYPE " + "SYSRES_CONST_EDITORS_REFERENCE_CODE " + "SYSRES_CONST_EDITORS_REPLACE_SPEC_CHARS_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_USE_PLUGINS_REQUISITE_CODE " + "SYSRES_CONST_EDITORS_VIEW_DOCUMENT_OPENED_TO_EDIT_CODE " + "SYSRES_CONST_EDOC_CARD_TYPE_REQUISITE_CODE " + "SYSRES_CONST_EDOC_CARD_TYPES_LINK_REQUISITE_CODE " + "SYSRES_CONST_EDOC_CERTIFICATE_AND_PASSWORD_ENCODE_CODE " + "SYSRES_CONST_EDOC_CERTIFICATE_ENCODE_CODE " + "SYSRES_CONST_EDOC_DATE_REQUISITE_CODE " + "SYSRES_CONST_EDOC_KIND_REFERENCE_CODE " + "SYSRES_CONST_EDOC_KINDS_BY_TEMPLATE_ACTION_CODE " + "SYSRES_CONST_EDOC_MANAGE_ACCESS_CODE " + "SYSRES_CONST_EDOC_NONE_ENCODE_CODE " + "SYSRES_CONST_EDOC_NUMBER_REQUISITE_CODE " + "SYSRES_CONST_EDOC_PASSWORD_ENCODE_CODE " + "SYSRES_CONST_EDOC_READONLY_ACCESS_CODE " + "SYSRES_CONST_EDOC_SHELL_LIFE_TYPE_VIEW_VALUE " + "SYSRES_CONST_EDOC_SIZE_RESTRICTION_PRIORITY_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_CHECK_ACCESS_RIGHTS_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_COMPUTER_NAME_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_DATABASE_NAME_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_EDIT_IN_STORAGE_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_LOCAL_PATH_REQUISITE_CODE " + "SYSRES_CONST_EDOC_STORAGE_SHARED_SOURCE_NAME_REQUISITE_CODE " + "SYSRES_CONST_EDOC_TEMPLATE_REQUISITE_CODE " + "SYSRES_CONST_EDOC_TYPES_REFERENCE_CODE " + "SYSRES_CONST_EDOC_VERSION_ACTIVE_STAGE_CODE " + "SYSRES_CONST_EDOC_VERSION_DESIGN_STAGE_CODE " + "SYSRES_CONST_EDOC_VERSION_OBSOLETE_STAGE_CODE " + "SYSRES_CONST_EDOC_WRITE_ACCES_CODE " + "SYSRES_CONST_EDOCUMENT_CARD_REQUISITES_REFERENCE_CODE_SELECTED_REQUISITE " + "SYSRES_CONST_ENCODE_CERTIFICATE_TYPE_CODE " + "SYSRES_CONST_END_DATE_REQUISITE_CODE " + "SYSRES_CONST_ENUMERATION_TYPE_REQUISITE_CODE " + "SYSRES_CONST_EXECUTE_ACCESS_RIGHTS_TYPE_CODE " + "SYSRES_CONST_EXECUTIVE_FILE_STORAGE_TYPE " + "SYSRES_CONST_EXIST_CONST " + "SYSRES_CONST_EXIST_VALUE " + "SYSRES_CONST_EXPORT_LOCK_TYPE_ASK " + "SYSRES_CONST_EXPORT_LOCK_TYPE_WITH_LOCK " + "SYSRES_CONST_EXPORT_LOCK_TYPE_WITHOUT_LOCK " + "SYSRES_CONST_EXPORT_VERSION_TYPE_ASK " + "SYSRES_CONST_EXPORT_VERSION_TYPE_LAST " + "SYSRES_CONST_EXPORT_VERSION_TYPE_LAST_ACTIVE " + "SYSRES_CONST_EXTENSION_REQUISITE_CODE " + "SYSRES_CONST_FILTER_NAME_REQUISITE_CODE " + "SYSRES_CONST_FILTER_REQUISITE_CODE " + "SYSRES_CONST_FILTER_TYPE_COMMON_CODE " + "SYSRES_CONST_FILTER_TYPE_COMMON_NAME " + "SYSRES_CONST_FILTER_TYPE_USER_CODE " + "SYSRES_CONST_FILTER_TYPE_USER_NAME " + "SYSRES_CONST_FILTER_VALUE_REQUISITE_NAME " + "SYSRES_CONST_FLOAT_NUMBER_FORMAT_CHAR " + "SYSRES_CONST_FLOAT_REQUISITE_TYPE " + "SYSRES_CONST_FOLDER_AUTHOR_VALUE " + "SYSRES_CONST_FOLDER_KIND_ANY_OBJECTS " + "SYSRES_CONST_FOLDER_KIND_COMPONENTS " + "SYSRES_CONST_FOLDER_KIND_EDOCS " + "SYSRES_CONST_FOLDER_KIND_JOBS " + "SYSRES_CONST_FOLDER_KIND_TASKS " + "SYSRES_CONST_FOLDER_TYPE_COMMON " + "SYSRES_CONST_FOLDER_TYPE_COMPONENT " + "SYSRES_CONST_FOLDER_TYPE_FAVORITES " + "SYSRES_CONST_FOLDER_TYPE_INBOX " + "SYSRES_CONST_FOLDER_TYPE_OUTBOX " + "SYSRES_CONST_FOLDER_TYPE_QUICK_LAUNCH " + "SYSRES_CONST_FOLDER_TYPE_SEARCH " + "SYSRES_CONST_FOLDER_TYPE_SHORTCUTS " + "SYSRES_CONST_FOLDER_TYPE_USER " + "SYSRES_CONST_FROM_DICTIONARY_ENUM_METHOD_FLAG " + "SYSRES_CONST_FULL_SUBSTITUTE_TYPE " + "SYSRES_CONST_FULL_SUBSTITUTE_TYPE_CODE " + "SYSRES_CONST_FUNCTION_CANCEL_RESULT " + "SYSRES_CONST_FUNCTION_CATEGORY_SYSTEM " + "SYSRES_CONST_FUNCTION_CATEGORY_USER " + "SYSRES_CONST_FUNCTION_FAILURE_RESULT " + "SYSRES_CONST_FUNCTION_SAVE_RESULT " + "SYSRES_CONST_GENERATED_REQUISITE " + "SYSRES_CONST_GREEN_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_GROUP_ACCOUNT_TYPE_VALUE_CODE " + "SYSRES_CONST_GROUP_CATEGORY_NORMAL_CODE " + "SYSRES_CONST_GROUP_CATEGORY_NORMAL_NAME " + "SYSRES_CONST_GROUP_CATEGORY_SERVICE_CODE " + "SYSRES_CONST_GROUP_CATEGORY_SERVICE_NAME " + "SYSRES_CONST_GROUP_COMMON_CATEGORY_FIELD_VALUE " + "SYSRES_CONST_GROUP_FULL_NAME_REQUISITE_CODE " + "SYSRES_CONST_GROUP_NAME_REQUISITE_CODE " + "SYSRES_CONST_GROUP_RIGHTS_T_REQUISITE_CODE " + "SYSRES_CONST_GROUP_SERVER_CODES_REQUISITE_CODE " + "SYSRES_CONST_GROUP_SERVER_NAME_REQUISITE_CODE " + "SYSRES_CONST_GROUP_SERVICE_CATEGORY_FIELD_VALUE " + "SYSRES_CONST_GROUP_USER_REQUISITE_CODE " + "SYSRES_CONST_GROUPS_REFERENCE_CODE " + "SYSRES_CONST_GROUPS_REQUISITE_CODE " + "SYSRES_CONST_HIDDEN_MODE_NAME " + "SYSRES_CONST_HIGH_LVL_REQUISITE_CODE " + "SYSRES_CONST_HISTORY_ACTION_CREATE_CODE " + "SYSRES_CONST_HISTORY_ACTION_DELETE_CODE " + "SYSRES_CONST_HISTORY_ACTION_EDIT_CODE " + "SYSRES_CONST_HOUR_CHAR " + "SYSRES_CONST_ID_REQUISITE_CODE " + "SYSRES_CONST_IDSPS_REQUISITE_CODE " + "SYSRES_CONST_IMAGE_MODE_COLOR " + "SYSRES_CONST_IMAGE_MODE_GREYSCALE " + "SYSRES_CONST_IMAGE_MODE_MONOCHROME " + "SYSRES_CONST_IMPORTANCE_HIGH " + "SYSRES_CONST_IMPORTANCE_LOW " + "SYSRES_CONST_IMPORTANCE_NORMAL " + "SYSRES_CONST_IN_DESIGN_VERSION_STATE_PICK_VALUE " + "SYSRES_CONST_INCOMING_WORK_RULE_TYPE_CODE " + "SYSRES_CONST_INT_REQUISITE " + "SYSRES_CONST_INT_REQUISITE_TYPE " + "SYSRES_CONST_INTEGER_NUMBER_FORMAT_CHAR " + "SYSRES_CONST_INTEGER_TYPE_CHAR " + "SYSRES_CONST_IS_GENERATED_REQUISITE_NEGATIVE_VALUE " + "SYSRES_CONST_IS_PUBLIC_ROLE_REQUISITE_CODE " + "SYSRES_CONST_IS_REMOTE_USER_NEGATIVE_VALUE " + "SYSRES_CONST_IS_REMOTE_USER_POSITIVE_VALUE " + "SYSRES_CONST_IS_STORED_REQUISITE_NEGATIVE_VALUE " + "SYSRES_CONST_IS_STORED_REQUISITE_STORED_VALUE " + "SYSRES_CONST_ITALIC_LIFE_CYCLE_STAGE_DRAW_STYLE " + "SYSRES_CONST_JOB_BLOCK_DESCRIPTION " + "SYSRES_CONST_JOB_KIND_CONTROL_JOB " + "SYSRES_CONST_JOB_KIND_JOB " + "SYSRES_CONST_JOB_KIND_NOTICE " + "SYSRES_CONST_JOB_STATE_ABORTED " + "SYSRES_CONST_JOB_STATE_COMPLETE " + "SYSRES_CONST_JOB_STATE_WORKING " + "SYSRES_CONST_KIND_REQUISITE_CODE " + "SYSRES_CONST_KIND_REQUISITE_NAME " + "SYSRES_CONST_KINDS_CREATE_SHADOW_COPIES_REQUISITE_CODE " + "SYSRES_CONST_KINDS_DEFAULT_EDOC_LIFE_STAGE_REQUISITE_CODE " + "SYSRES_CONST_KINDS_EDOC_ALL_TEPLATES_ALLOWED_REQUISITE_CODE " + "SYSRES_CONST_KINDS_EDOC_ALLOW_LIFE_CYCLE_STAGE_CHANGING_REQUISITE_CODE " + "SYSRES_CONST_KINDS_EDOC_ALLOW_MULTIPLE_ACTIVE_VERSIONS_REQUISITE_CODE " + "SYSRES_CONST_KINDS_EDOC_SHARE_ACCES_RIGHTS_BY_DEFAULT_CODE " + "SYSRES_CONST_KINDS_EDOC_TEMPLATE_REQUISITE_CODE " + "SYSRES_CONST_KINDS_EDOC_TYPE_REQUISITE_CODE " + "SYSRES_CONST_KINDS_SIGNERS_REQUISITES_CODE " + "SYSRES_CONST_KOD_INPUT_TYPE " + "SYSRES_CONST_LAST_UPDATE_DATE_REQUISITE_CODE " + "SYSRES_CONST_LIFE_CYCLE_START_STAGE_REQUISITE_CODE " + "SYSRES_CONST_LILAC_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_LINK_OBJECT_KIND_COMPONENT " + "SYSRES_CONST_LINK_OBJECT_KIND_DOCUMENT " + "SYSRES_CONST_LINK_OBJECT_KIND_EDOC " + "SYSRES_CONST_LINK_OBJECT_KIND_FOLDER " + "SYSRES_CONST_LINK_OBJECT_KIND_JOB " + "SYSRES_CONST_LINK_OBJECT_KIND_REFERENCE " + "SYSRES_CONST_LINK_OBJECT_KIND_TASK " + "SYSRES_CONST_LINK_REF_TYPE_REQUISITE_CODE " + "SYSRES_CONST_LIST_REFERENCE_MODE_NAME " + "SYSRES_CONST_LOCALIZATION_DICTIONARY_MAIN_VIEW_CODE " + "SYSRES_CONST_MAIN_VIEW_CODE " + "SYSRES_CONST_MANUAL_ENUM_METHOD_FLAG " + "SYSRES_CONST_MASTER_COMP_TYPE_REQUISITE_CODE " + "SYSRES_CONST_MASTER_TABLE_REC_ID_REQUISITE_CODE " + "SYSRES_CONST_MAXIMIZED_MODE_NAME " + "SYSRES_CONST_ME_VALUE " + "SYSRES_CONST_MESSAGE_ATTENTION_CAPTION " + "SYSRES_CONST_MESSAGE_CONFIRMATION_CAPTION " + "SYSRES_CONST_MESSAGE_ERROR_CAPTION " + "SYSRES_CONST_MESSAGE_INFORMATION_CAPTION " + "SYSRES_CONST_MINIMIZED_MODE_NAME " + "SYSRES_CONST_MINUTE_CHAR " + "SYSRES_CONST_MODULE_REQUISITE_CODE " + "SYSRES_CONST_MONITORING_BLOCK_DESCRIPTION " + "SYSRES_CONST_MONTH_FORMAT_VALUE " + "SYSRES_CONST_NAME_LOCALIZE_ID_REQUISITE_CODE " + "SYSRES_CONST_NAME_REQUISITE_CODE " + "SYSRES_CONST_NAME_SINGULAR_REQUISITE_CODE " + "SYSRES_CONST_NAMEAN_INPUT_TYPE " + "SYSRES_CONST_NEGATIVE_PICK_VALUE " + "SYSRES_CONST_NEGATIVE_VALUE " + "SYSRES_CONST_NO " + "SYSRES_CONST_NO_PICK_VALUE " + "SYSRES_CONST_NO_SIGNATURE_REQUISITE_CODE " + "SYSRES_CONST_NO_VALUE " + "SYSRES_CONST_NONE_ACCESS_RIGHTS_TYPE_CODE " + "SYSRES_CONST_NONOPERATING_RECORD_FLAG_VALUE " + "SYSRES_CONST_NONOPERATING_RECORD_FLAG_VALUE_MASCULINE " + "SYSRES_CONST_NORMAL_ACCESS_RIGHTS_TYPE_CODE " + "SYSRES_CONST_NORMAL_LIFE_CYCLE_STAGE_DRAW_STYLE " + "SYSRES_CONST_NORMAL_MODE_NAME " + "SYSRES_CONST_NOT_ALLOWED_ACCESS_TYPE_CODE " + "SYSRES_CONST_NOT_ALLOWED_ACCESS_TYPE_NAME " + "SYSRES_CONST_NOTE_REQUISITE_CODE " + "SYSRES_CONST_NOTICE_BLOCK_DESCRIPTION " + "SYSRES_CONST_NUM_REQUISITE " + "SYSRES_CONST_NUM_STR_REQUISITE_CODE " + "SYSRES_CONST_NUMERATION_AUTO_NOT_STRONG " + "SYSRES_CONST_NUMERATION_AUTO_STRONG " + "SYSRES_CONST_NUMERATION_FROM_DICTONARY " + "SYSRES_CONST_NUMERATION_MANUAL " + "SYSRES_CONST_NUMERIC_TYPE_CHAR " + "SYSRES_CONST_NUMREQ_REQUISITE_CODE " + "SYSRES_CONST_OBSOLETE_VERSION_STATE_PICK_VALUE " + "SYSRES_CONST_OPERATING_RECORD_FLAG_VALUE " + "SYSRES_CONST_OPERATING_RECORD_FLAG_VALUE_CODE " + "SYSRES_CONST_OPERATING_RECORD_FLAG_VALUE_FEMININE " + "SYSRES_CONST_OPERATING_RECORD_FLAG_VALUE_MASCULINE " + "SYSRES_CONST_OPTIONAL_FORM_COMP_REQCODE_PREFIX " + "SYSRES_CONST_ORANGE_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_ORIGINALREF_REQUISITE_CODE " + "SYSRES_CONST_OURFIRM_REF_CODE " + "SYSRES_CONST_OURFIRM_REQUISITE_CODE " + "SYSRES_CONST_OURFIRM_VAR " + "SYSRES_CONST_OUTGOING_WORK_RULE_TYPE_CODE " + "SYSRES_CONST_PICK_NEGATIVE_RESULT " + "SYSRES_CONST_PICK_POSITIVE_RESULT " + "SYSRES_CONST_PICK_REQUISITE " + "SYSRES_CONST_PICK_REQUISITE_TYPE " + "SYSRES_CONST_PICK_TYPE_CHAR " + "SYSRES_CONST_PLAN_STATUS_REQUISITE_CODE " + "SYSRES_CONST_PLATFORM_VERSION_COMMENT " + "SYSRES_CONST_PLUGINS_SETTINGS_DESCRIPTION_REQUISITE_CODE " + "SYSRES_CONST_POSITIVE_PICK_VALUE " + "SYSRES_CONST_POWER_TO_CREATE_ACTION_CODE " + "SYSRES_CONST_POWER_TO_SIGN_ACTION_CODE " + "SYSRES_CONST_PRIORITY_REQUISITE_CODE " + "SYSRES_CONST_QUALIFIED_TASK_TYPE " + "SYSRES_CONST_QUALIFIED_TASK_TYPE_CODE " + "SYSRES_CONST_RECSTAT_REQUISITE_CODE " + "SYSRES_CONST_RED_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_REF_ID_T_REF_TYPE_REQUISITE_CODE " + "SYSRES_CONST_REF_REQUISITE " + "SYSRES_CONST_REF_REQUISITE_TYPE " + "SYSRES_CONST_REF_REQUISITES_REFERENCE_CODE_SELECTED_REQUISITE " + "SYSRES_CONST_REFERENCE_RECORD_HISTORY_CREATE_ACTION_CODE " + "SYSRES_CONST_REFERENCE_RECORD_HISTORY_DELETE_ACTION_CODE " + "SYSRES_CONST_REFERENCE_RECORD_HISTORY_MODIFY_ACTION_CODE " + "SYSRES_CONST_REFERENCE_TYPE_CHAR " + "SYSRES_CONST_REFERENCE_TYPE_REQUISITE_NAME " + "SYSRES_CONST_REFERENCES_ADD_PARAMS_REQUISITE_CODE " + "SYSRES_CONST_REFERENCES_DISPLAY_REQUISITE_REQUISITE_CODE " + "SYSRES_CONST_REMOTE_SERVER_STATUS_WORKING " + "SYSRES_CONST_REMOTE_SERVER_TYPE_MAIN " + "SYSRES_CONST_REMOTE_SERVER_TYPE_SECONDARY " + "SYSRES_CONST_REMOTE_USER_FLAG_VALUE_CODE " + "SYSRES_CONST_REPORT_APP_EDITOR_INTERNAL " + "SYSRES_CONST_REPORT_BASE_REPORT_ID_REQUISITE_CODE " + "SYSRES_CONST_REPORT_BASE_REPORT_REQUISITE_CODE " + "SYSRES_CONST_REPORT_SCRIPT_REQUISITE_CODE " + "SYSRES_CONST_REPORT_TEMPLATE_REQUISITE_CODE " + "SYSRES_CONST_REPORT_VIEWER_CODE_REQUISITE_CODE " + "SYSRES_CONST_REQ_ALLOW_COMPONENT_DEFAULT_VALUE " + "SYSRES_CONST_REQ_ALLOW_RECORD_DEFAULT_VALUE " + "SYSRES_CONST_REQ_ALLOW_SERVER_COMPONENT_DEFAULT_VALUE " + "SYSRES_CONST_REQ_MODE_AVAILABLE_CODE " + "SYSRES_CONST_REQ_MODE_EDIT_CODE " + "SYSRES_CONST_REQ_MODE_HIDDEN_CODE " + "SYSRES_CONST_REQ_MODE_NOT_AVAILABLE_CODE " + "SYSRES_CONST_REQ_MODE_VIEW_CODE " + "SYSRES_CONST_REQ_NUMBER_REQUISITE_CODE " + "SYSRES_CONST_REQ_SECTION_VALUE " + "SYSRES_CONST_REQ_TYPE_VALUE " + "SYSRES_CONST_REQUISITE_FORMAT_BY_UNIT " + "SYSRES_CONST_REQUISITE_FORMAT_DATE_FULL " + "SYSRES_CONST_REQUISITE_FORMAT_DATE_TIME " + "SYSRES_CONST_REQUISITE_FORMAT_LEFT " + "SYSRES_CONST_REQUISITE_FORMAT_RIGHT " + "SYSRES_CONST_REQUISITE_FORMAT_WITHOUT_UNIT " + "SYSRES_CONST_REQUISITE_NUMBER_REQUISITE_CODE " + "SYSRES_CONST_REQUISITE_SECTION_ACTIONS " + "SYSRES_CONST_REQUISITE_SECTION_BUTTON " + "SYSRES_CONST_REQUISITE_SECTION_BUTTONS " + "SYSRES_CONST_REQUISITE_SECTION_CARD " + "SYSRES_CONST_REQUISITE_SECTION_TABLE " + "SYSRES_CONST_REQUISITE_SECTION_TABLE10 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE11 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE12 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE13 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE14 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE15 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE16 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE17 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE18 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE19 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE2 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE20 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE21 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE22 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE23 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE24 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE3 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE4 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE5 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE6 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE7 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE8 " + "SYSRES_CONST_REQUISITE_SECTION_TABLE9 " + "SYSRES_CONST_REQUISITES_PSEUDOREFERENCE_REQUISITE_NUMBER_REQUISITE_CODE " + "SYSRES_CONST_RIGHT_ALIGNMENT_CODE " + "SYSRES_CONST_ROLES_REFERENCE_CODE " + "SYSRES_CONST_ROUTE_STEP_AFTER_RUS " + "SYSRES_CONST_ROUTE_STEP_AND_CONDITION_RUS " + "SYSRES_CONST_ROUTE_STEP_OR_CONDITION_RUS " + "SYSRES_CONST_ROUTE_TYPE_COMPLEX " + "SYSRES_CONST_ROUTE_TYPE_PARALLEL " + "SYSRES_CONST_ROUTE_TYPE_SERIAL " + "SYSRES_CONST_SBDATASETDESC_NEGATIVE_VALUE " + "SYSRES_CONST_SBDATASETDESC_POSITIVE_VALUE " + "SYSRES_CONST_SBVIEWSDESC_POSITIVE_VALUE " + "SYSRES_CONST_SCRIPT_BLOCK_DESCRIPTION " + "SYSRES_CONST_SEARCH_BY_TEXT_REQUISITE_CODE " + "SYSRES_CONST_SEARCHES_COMPONENT_CONTENT " + "SYSRES_CONST_SEARCHES_CRITERIA_ACTION_NAME " + "SYSRES_CONST_SEARCHES_EDOC_CONTENT " + "SYSRES_CONST_SEARCHES_FOLDER_CONTENT " + "SYSRES_CONST_SEARCHES_JOB_CONTENT " + "SYSRES_CONST_SEARCHES_REFERENCE_CODE " + "SYSRES_CONST_SEARCHES_TASK_CONTENT " + "SYSRES_CONST_SECOND_CHAR " + "SYSRES_CONST_SECTION_REQUISITE_ACTIONS_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_CARD_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_CODE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_1_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_2_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_3_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_4_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_5_VALUE " + "SYSRES_CONST_SECTION_REQUISITE_DETAIL_6_VALUE " + "SYSRES_CONST_SELECT_REFERENCE_MODE_NAME " + "SYSRES_CONST_SELECT_TYPE_SELECTABLE " + "SYSRES_CONST_SELECT_TYPE_SELECTABLE_ONLY_CHILD " + "SYSRES_CONST_SELECT_TYPE_SELECTABLE_WITH_CHILD " + "SYSRES_CONST_SELECT_TYPE_UNSLECTABLE " + "SYSRES_CONST_SERVER_TYPE_MAIN " + "SYSRES_CONST_SERVICE_USER_CATEGORY_FIELD_VALUE " + "SYSRES_CONST_SETTINGS_USER_REQUISITE_CODE " + "SYSRES_CONST_SIGNATURE_AND_ENCODE_CERTIFICATE_TYPE_CODE " + "SYSRES_CONST_SIGNATURE_CERTIFICATE_TYPE_CODE " + "SYSRES_CONST_SINGULAR_TITLE_REQUISITE_CODE " + "SYSRES_CONST_SQL_SERVER_AUTHENTIFICATION_FLAG_VALUE_CODE " + "SYSRES_CONST_SQL_SERVER_ENCODE_AUTHENTIFICATION_FLAG_VALUE_CODE " + "SYSRES_CONST_STANDART_ROUTE_REFERENCE_CODE " + "SYSRES_CONST_STANDART_ROUTE_REFERENCE_COMMENT_REQUISITE_CODE " + "SYSRES_CONST_STANDART_ROUTES_GROUPS_REFERENCE_CODE " + "SYSRES_CONST_STATE_REQ_NAME " + "SYSRES_CONST_STATE_REQUISITE_ACTIVE_VALUE " + "SYSRES_CONST_STATE_REQUISITE_CLOSED_VALUE " + "SYSRES_CONST_STATE_REQUISITE_CODE " + "SYSRES_CONST_STATIC_ROLE_TYPE_CODE " + "SYSRES_CONST_STATUS_PLAN_DEFAULT_VALUE " + "SYSRES_CONST_STATUS_VALUE_AUTOCLEANING " + "SYSRES_CONST_STATUS_VALUE_BLUE_SQUARE " + "SYSRES_CONST_STATUS_VALUE_COMPLETE " + "SYSRES_CONST_STATUS_VALUE_GREEN_SQUARE " + "SYSRES_CONST_STATUS_VALUE_ORANGE_SQUARE " + "SYSRES_CONST_STATUS_VALUE_PURPLE_SQUARE " + "SYSRES_CONST_STATUS_VALUE_RED_SQUARE " + "SYSRES_CONST_STATUS_VALUE_SUSPEND " + "SYSRES_CONST_STATUS_VALUE_YELLOW_SQUARE " + "SYSRES_CONST_STDROUTE_SHOW_TO_USERS_REQUISITE_CODE " + "SYSRES_CONST_STORAGE_TYPE_FILE " + "SYSRES_CONST_STORAGE_TYPE_SQL_SERVER " + "SYSRES_CONST_STR_REQUISITE " + "SYSRES_CONST_STRIKEOUT_LIFE_CYCLE_STAGE_DRAW_STYLE " + "SYSRES_CONST_STRING_FORMAT_LEFT_ALIGN_CHAR " + "SYSRES_CONST_STRING_FORMAT_RIGHT_ALIGN_CHAR " + "SYSRES_CONST_STRING_REQUISITE_CODE " + "SYSRES_CONST_STRING_REQUISITE_TYPE " + "SYSRES_CONST_STRING_TYPE_CHAR " + "SYSRES_CONST_SUBSTITUTES_PSEUDOREFERENCE_CODE " + "SYSRES_CONST_SUBTASK_BLOCK_DESCRIPTION " + "SYSRES_CONST_SYSTEM_SETTING_CURRENT_USER_PARAM_VALUE " + "SYSRES_CONST_SYSTEM_SETTING_EMPTY_VALUE_PARAM_VALUE " + "SYSRES_CONST_SYSTEM_VERSION_COMMENT " + "SYSRES_CONST_TASK_ACCESS_TYPE_ALL " + "SYSRES_CONST_TASK_ACCESS_TYPE_ALL_MEMBERS " + "SYSRES_CONST_TASK_ACCESS_TYPE_MANUAL " + "SYSRES_CONST_TASK_ENCODE_TYPE_CERTIFICATION " + "SYSRES_CONST_TASK_ENCODE_TYPE_CERTIFICATION_AND_PASSWORD " + "SYSRES_CONST_TASK_ENCODE_TYPE_NONE " + "SYSRES_CONST_TASK_ENCODE_TYPE_PASSWORD " + "SYSRES_CONST_TASK_ROUTE_ALL_CONDITION " + "SYSRES_CONST_TASK_ROUTE_AND_CONDITION " + "SYSRES_CONST_TASK_ROUTE_OR_CONDITION " + "SYSRES_CONST_TASK_STATE_ABORTED " + "SYSRES_CONST_TASK_STATE_COMPLETE " + "SYSRES_CONST_TASK_STATE_CONTINUED " + "SYSRES_CONST_TASK_STATE_CONTROL " + "SYSRES_CONST_TASK_STATE_INIT " + "SYSRES_CONST_TASK_STATE_WORKING " + "SYSRES_CONST_TASK_TITLE " + "SYSRES_CONST_TASK_TYPES_GROUPS_REFERENCE_CODE " + "SYSRES_CONST_TASK_TYPES_REFERENCE_CODE " + "SYSRES_CONST_TEMPLATES_REFERENCE_CODE " + "SYSRES_CONST_TEST_DATE_REQUISITE_NAME " + "SYSRES_CONST_TEST_DEV_DATABASE_NAME " + "SYSRES_CONST_TEST_DEV_SYSTEM_CODE " + "SYSRES_CONST_TEST_EDMS_DATABASE_NAME " + "SYSRES_CONST_TEST_EDMS_MAIN_CODE " + "SYSRES_CONST_TEST_EDMS_MAIN_DB_NAME " + "SYSRES_CONST_TEST_EDMS_SECOND_CODE " + "SYSRES_CONST_TEST_EDMS_SECOND_DB_NAME " + "SYSRES_CONST_TEST_EDMS_SYSTEM_CODE " + "SYSRES_CONST_TEST_NUMERIC_REQUISITE_NAME " + "SYSRES_CONST_TEXT_REQUISITE " + "SYSRES_CONST_TEXT_REQUISITE_CODE " + "SYSRES_CONST_TEXT_REQUISITE_TYPE " + "SYSRES_CONST_TEXT_TYPE_CHAR " + "SYSRES_CONST_TYPE_CODE_REQUISITE_CODE " + "SYSRES_CONST_TYPE_REQUISITE_CODE " + "SYSRES_CONST_UNDEFINED_LIFE_CYCLE_STAGE_FONT_COLOR " + "SYSRES_CONST_UNITS_SECTION_ID_REQUISITE_CODE " + "SYSRES_CONST_UNITS_SECTION_REQUISITE_CODE " + "SYSRES_CONST_UNOPERATING_RECORD_FLAG_VALUE_CODE " + "SYSRES_CONST_UNSTORED_DATA_REQUISITE_CODE " + "SYSRES_CONST_UNSTORED_DATA_REQUISITE_NAME " + "SYSRES_CONST_USE_ACCESS_TYPE_CODE " + "SYSRES_CONST_USE_ACCESS_TYPE_NAME " + "SYSRES_CONST_USER_ACCOUNT_TYPE_VALUE_CODE " + "SYSRES_CONST_USER_ADDITIONAL_INFORMATION_REQUISITE_CODE " + "SYSRES_CONST_USER_AND_GROUP_ID_FROM_PSEUDOREFERENCE_REQUISITE_CODE " + "SYSRES_CONST_USER_CATEGORY_NORMAL " + "SYSRES_CONST_USER_CERTIFICATE_REQUISITE_CODE " + "SYSRES_CONST_USER_CERTIFICATE_STATE_REQUISITE_CODE " + "SYSRES_CONST_USER_CERTIFICATE_SUBJECT_NAME_REQUISITE_CODE " + "SYSRES_CONST_USER_CERTIFICATE_THUMBPRINT_REQUISITE_CODE " + "SYSRES_CONST_USER_COMMON_CATEGORY " + "SYSRES_CONST_USER_COMMON_CATEGORY_CODE " + "SYSRES_CONST_USER_FULL_NAME_REQUISITE_CODE " + "SYSRES_CONST_USER_GROUP_TYPE_REQUISITE_CODE " + "SYSRES_CONST_USER_LOGIN_REQUISITE_CODE " + "SYSRES_CONST_USER_REMOTE_CONTROLLER_REQUISITE_CODE " + "SYSRES_CONST_USER_REMOTE_SYSTEM_REQUISITE_CODE " + "SYSRES_CONST_USER_RIGHTS_T_REQUISITE_CODE " + "SYSRES_CONST_USER_SERVER_NAME_REQUISITE_CODE " + "SYSRES_CONST_USER_SERVICE_CATEGORY " + "SYSRES_CONST_USER_SERVICE_CATEGORY_CODE " + "SYSRES_CONST_USER_STATUS_ADMINISTRATOR_CODE " + "SYSRES_CONST_USER_STATUS_ADMINISTRATOR_NAME " + "SYSRES_CONST_USER_STATUS_DEVELOPER_CODE " + "SYSRES_CONST_USER_STATUS_DEVELOPER_NAME " + "SYSRES_CONST_USER_STATUS_DISABLED_CODE " + "SYSRES_CONST_USER_STATUS_DISABLED_NAME " + "SYSRES_CONST_USER_STATUS_SYSTEM_DEVELOPER_CODE " + "SYSRES_CONST_USER_STATUS_USER_CODE " + "SYSRES_CONST_USER_STATUS_USER_NAME " + "SYSRES_CONST_USER_STATUS_USER_NAME_DEPRECATED " + "SYSRES_CONST_USER_TYPE_FIELD_VALUE_USER " + "SYSRES_CONST_USER_TYPE_REQUISITE_CODE " + "SYSRES_CONST_USERS_CONTROLLER_REQUISITE_CODE " + "SYSRES_CONST_USERS_IS_MAIN_SERVER_REQUISITE_CODE " + "SYSRES_CONST_USERS_REFERENCE_CODE " + "SYSRES_CONST_USERS_REGISTRATION_CERTIFICATES_ACTION_NAME " + "SYSRES_CONST_USERS_REQUISITE_CODE " + "SYSRES_CONST_USERS_SYSTEM_REQUISITE_CODE " + "SYSRES_CONST_USERS_USER_ACCESS_RIGHTS_TYPR_REQUISITE_CODE " + "SYSRES_CONST_USERS_USER_AUTHENTICATION_REQUISITE_CODE " + "SYSRES_CONST_USERS_USER_COMPONENT_REQUISITE_CODE " + "SYSRES_CONST_USERS_USER_GROUP_REQUISITE_CODE " + "SYSRES_CONST_USERS_VIEW_CERTIFICATES_ACTION_NAME " + "SYSRES_CONST_VIEW_DEFAULT_CODE " + "SYSRES_CONST_VIEW_DEFAULT_NAME " + "SYSRES_CONST_VIEWER_REQUISITE_CODE " + "SYSRES_CONST_WAITING_BLOCK_DESCRIPTION " + "SYSRES_CONST_WIZARD_FORM_LABEL_TEST_STRING " + "SYSRES_CONST_WIZARD_QUERY_PARAM_HEIGHT_ETALON_STRING " + "SYSRES_CONST_WIZARD_REFERENCE_COMMENT_REQUISITE_CODE " + "SYSRES_CONST_WORK_RULES_DESCRIPTION_REQUISITE_CODE " + "SYSRES_CONST_WORK_TIME_CALENDAR_REFERENCE_CODE " + "SYSRES_CONST_WORK_WORKFLOW_HARD_ROUTE_TYPE_VALUE " + "SYSRES_CONST_WORK_WORKFLOW_HARD_ROUTE_TYPE_VALUE_CODE " + "SYSRES_CONST_WORK_WORKFLOW_HARD_ROUTE_TYPE_VALUE_CODE_RUS " + "SYSRES_CONST_WORK_WORKFLOW_SOFT_ROUTE_TYPE_VALUE_CODE_RUS " + "SYSRES_CONST_WORKFLOW_ROUTE_TYPR_HARD " + "SYSRES_CONST_WORKFLOW_ROUTE_TYPR_SOFT " + "SYSRES_CONST_XML_ENCODING " + "SYSRES_CONST_XREC_STAT_REQUISITE_CODE " + "SYSRES_CONST_XRECID_FIELD_NAME " + "SYSRES_CONST_YES " + "SYSRES_CONST_YES_NO_2_REQUISITE_CODE " + "SYSRES_CONST_YES_NO_REQUISITE_CODE " + "SYSRES_CONST_YES_NO_T_REF_TYPE_REQUISITE_CODE " + "SYSRES_CONST_YES_PICK_VALUE " + "SYSRES_CONST_YES_VALUE "; @@ -157548,7 +157752,7 @@ var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { const LITERAL = "null true false nil "; const NUMBERS = { className: "number", - begin: hljs$1.NUMBER_RE, + begin: hljs.NUMBER_RE, relevance: 0 }; const STRINGS = { @@ -157571,29 +157775,29 @@ var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "//", end: "$", relevance: 0, - contains: [hljs$1.PHRASAL_WORDS_MODE, DOCTAGS] + contains: [hljs.PHRASAL_WORDS_MODE, DOCTAGS] }; const ISBL_BLOCK_COMMENT_MODE = { className: "comment", begin: "/\\*", end: "\\*/", relevance: 0, - contains: [hljs$1.PHRASAL_WORDS_MODE, DOCTAGS] + contains: [hljs.PHRASAL_WORDS_MODE, DOCTAGS] }; const COMMENTS = { variants: [ISBL_LINE_COMMENT_MODE, ISBL_BLOCK_COMMENT_MODE] }; - const KEYWORDS$6 = { - $pattern: UNDERSCORE_IDENT_RE$2, + const KEYWORDS$2 = { + $pattern: UNDERSCORE_IDENT_RE, keyword: KEYWORD, built_in: BUILTIN, class: CLASS, literal: LITERAL }; const METHODS = { - begin: "\\.\\s*" + hljs$1.UNDERSCORE_IDENT_RE, - keywords: KEYWORDS$6, + begin: "\\.\\s*" + hljs.UNDERSCORE_IDENT_RE, + keywords: KEYWORDS$2, relevance: 0 }; - const TYPES$6 = { + const TYPES$2 = { className: "type", begin: ":[ \\t]*(" + interfaces.trim().replace(/\s/g, "|") + ")", end: "[ \\t]*=", @@ -157601,16 +157805,16 @@ var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const VARIABLES = { className: "variable", - keywords: KEYWORDS$6, - begin: UNDERSCORE_IDENT_RE$2, + keywords: KEYWORDS$2, + begin: UNDERSCORE_IDENT_RE, relevance: 0, - contains: [TYPES$6, METHODS] + contains: [TYPES$2, METHODS] }; const FUNCTION_TITLE = FUNCTION_NAME_IDENT_RE + "\\("; - const TITLE_MODE$2 = { + const TITLE_MODE = { className: "title", keywords: { - $pattern: UNDERSCORE_IDENT_RE$2, + $pattern: UNDERSCORE_IDENT_RE, built_in: system_functions }, begin: FUNCTION_TITLE, @@ -157623,10 +157827,10 @@ var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: FUNCTION_TITLE, end: "\\)$", returnBegin: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: "[\\[\\]\\|\\$\\?%,~#@]", contains: [ - TITLE_MODE$2, + TITLE_MODE, METHODS, VARIABLES, STRINGS, @@ -157637,11 +157841,11 @@ var require_isbl = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "ISBL", case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: "\\$|\\?|%|,|;$|~|#|@| { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/java.js var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { - var decimalDigits$1 = "[0-9](_*[0-9])*"; - var frac$1 = `\\.(${decimalDigits$1})`; - var hexDigits$1 = "[0-9a-fA-F](_*[0-9a-fA-F])*"; - var NUMERIC$1 = { + var decimalDigits = "[0-9](_*[0-9])*"; + var frac = `\\.(${decimalDigits})`; + var hexDigits = "[0-9a-fA-F](_*[0-9a-fA-F])*"; + var NUMERIC = { className: "number", variants: [ - { begin: `(\\b(${decimalDigits$1})((${frac$1})|\\.)?|(${frac$1}))` + `[eE][+-]?(${decimalDigits$1})[fFdD]?\\b` }, - { begin: `\\b(${decimalDigits$1})((${frac$1})[fFdD]?\\b|\\.([fFdD]\\b)?)` }, - { begin: `(${frac$1})[fFdD]?\\b` }, - { begin: `\\b(${decimalDigits$1})[fFdD]\\b` }, - { begin: `\\b0[xX]((${hexDigits$1})\\.?|(${hexDigits$1})?\\.(${hexDigits$1}))` + `[pP][+-]?(${decimalDigits$1})[fFdD]?\\b` }, + { begin: `(\\b(${decimalDigits})((${frac})|\\.)?|(${frac}))` + `[eE][+-]?(${decimalDigits})[fFdD]?\\b` }, + { begin: `\\b(${decimalDigits})((${frac})[fFdD]?\\b|\\.([fFdD]\\b)?)` }, + { begin: `(${frac})[fFdD]?\\b` }, + { begin: `\\b(${decimalDigits})[fFdD]\\b` }, + { begin: `\\b0[xX]((${hexDigits})\\.?|(${hexDigits})?\\.(${hexDigits}))` + `[pP][+-]?(${decimalDigits})[fFdD]?\\b` }, { begin: "\\b(0|[1-9](_*[0-9])*)[lL]?\\b" }, - { begin: `\\b0[xX](${hexDigits$1})[lL]?\\b` }, + { begin: `\\b0[xX](${hexDigits})[lL]?\\b` }, { begin: "\\b0(_*[0-7])*[lL]?\\b" }, { begin: "\\b0[bB][01](_*[01])*[lL]?\\b" } ], @@ -157692,8 +157896,8 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { }); } /** @type LanguageFn */ - function java(hljs$1) { - const regex = hljs$1.regex; + function java(hljs) { + const regex = hljs.regex; const JAVA_IDENT_RE = "[À-ʸa-zA-Z_$][À-ʸa-zA-Z_$0-9]*"; const GENERIC_IDENT_RE = JAVA_IDENT_RE + recurRegex("(?:<" + JAVA_IDENT_RE + "~~~(?:\\s*,\\s*" + JAVA_IDENT_RE + "~~~)*>)?", /~~~/g, 2); const MAIN_KEYWORDS = [ @@ -157742,13 +157946,13 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { "goto", "when" ]; - const BUILT_INS$6 = ["super", "this"]; - const LITERALS$6 = [ + const BUILT_INS$2 = ["super", "this"]; + const LITERALS$2 = [ "false", "true", "null" ]; - const TYPES$6 = [ + const TYPES$2 = [ "char", "boolean", "long", @@ -157758,11 +157962,11 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { "short", "double" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: MAIN_KEYWORDS, - literal: LITERALS$6, - type: TYPES$6, - built_in: BUILT_INS$6 + literal: LITERALS$2, + type: TYPES$2, + built_in: BUILT_INS$2 }; const ANNOTATION = { className: "meta", @@ -157777,18 +157981,18 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, - contains: [hljs$1.C_BLOCK_COMMENT_MODE], + contains: [hljs.C_BLOCK_COMMENT_MODE], endsParent: true }; return { name: "Java", aliases: ["jsp"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /<\/|#/, contains: [ - hljs$1.COMMENT("/\\*\\*", "\\*/", { + hljs.COMMENT("/\\*\\*", "\\*/", { relevance: 0, contains: [{ begin: /\w+@/, @@ -157803,16 +158007,16 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "import", relevance: 2 }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { begin: /"""/, end: /"""/, className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { match: [ /\b(?:class|interface|enum|extends|implements|new)/, @@ -157854,8 +158058,8 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ PARAMS, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -157865,31 +158069,31 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: [ "(?:" + GENERIC_IDENT_RE + "\\s+)", - hljs$1.UNDERSCORE_IDENT_RE, + hljs.UNDERSCORE_IDENT_RE, /\s*(?=\()/ ], className: { 2: "title.function" }, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ ANNOTATION, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - NUMERIC$1, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + NUMERIC, + hljs.C_BLOCK_COMMENT_MODE ] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, - NUMERIC$1, + NUMERIC, ANNOTATION ] }; @@ -157900,8 +158104,8 @@ var require_java = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/javascript.js var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const IDENT_RE$4 = "[A-Za-z$_][0-9A-Za-z$_]*"; - const KEYWORDS$4 = [ + const IDENT_RE = "[A-Za-z$_][0-9A-Za-z$_]*"; + const KEYWORDS = [ "as", "in", "of", @@ -157942,7 +158146,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "extends", "using" ]; - const LITERALS$4 = [ + const LITERALS = [ "true", "false", "null", @@ -157950,7 +158154,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NaN", "Infinity" ]; - const TYPES$4 = [ + const TYPES = [ "Object", "Function", "Boolean", @@ -157991,7 +158195,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Intl", "WebAssembly" ]; - const ERROR_TYPES$4 = [ + const ERROR_TYPES = [ "Error", "EvalError", "InternalError", @@ -158001,7 +158205,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "TypeError", "URIError" ]; - const BUILT_IN_GLOBALS$4 = [ + const BUILT_IN_GLOBALS = [ "setInterval", "setTimeout", "clearInterval", @@ -158020,7 +158224,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "escape", "unescape" ]; - const BUILT_IN_VARIABLES$3 = [ + const BUILT_IN_VARIABLES = [ "arguments", "this", "super", @@ -158032,10 +158236,10 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "module", "global" ]; - const BUILT_INS$4 = [].concat(BUILT_IN_GLOBALS$4, TYPES$4, ERROR_TYPES$4); + const BUILT_INS = [].concat(BUILT_IN_GLOBALS, TYPES, ERROR_TYPES); /** @type LanguageFn */ - function javascript$3(hljs$1) { - const regex = hljs$1.regex; + function javascript(hljs) { + const regex = hljs.regex; /** * Takes a string like " { const pos = match.input.indexOf(tag, after); return pos !== -1; }; - const IDENT_RE$1$1 = IDENT_RE$4; + const IDENT_RE$1$1 = IDENT_RE; const FRAGMENT = { begin: "<>", end: "" @@ -158084,20 +158288,20 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; const KEYWORDS$1$1 = { - $pattern: IDENT_RE$4, - keyword: KEYWORDS$4, - literal: LITERALS$4, - built_in: BUILT_INS$4, - "variable.language": BUILT_IN_VARIABLES$3 + $pattern: IDENT_RE, + keyword: KEYWORDS, + literal: LITERALS, + built_in: BUILT_INS, + "variable.language": BUILT_IN_VARIABLES }; - const decimalDigits$2 = "[0-9](_?[0-9])*"; - const frac$2 = `\\.(${decimalDigits$2})`; + const decimalDigits = "[0-9](_?[0-9])*"; + const frac = `\\.(${decimalDigits})`; const decimalInteger = `0|[1-9](_?[0-9])*|0[0-7]*[89][0-9]*`; const NUMBER = { className: "number", variants: [ - { begin: `(\\b(${decimalInteger})((${frac$2})|\\.)?|(${frac$2}))` + `[eE][+-]?(${decimalDigits$2})\\b` }, - { begin: `\\b(${decimalInteger})\\b((${frac$2})\\b|\\.)?|(${frac$2})\\b` }, + { begin: `(\\b(${decimalInteger})((${frac})|\\.)?|(${frac}))` + `[eE][+-]?(${decimalDigits})\\b` }, + { begin: `\\b(${decimalInteger})\\b((${frac})\\b|\\.)?|(${frac})\\b` }, { begin: `\\b(0|[1-9](_?[0-9])*)n\\b` }, { begin: "\\b0[xX][0-9a-fA-F](_?[0-9a-fA-F])*n?\\b" }, { begin: "\\b0[bB][0-1](_?[0-1])*n?\\b" }, @@ -158119,7 +158323,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "xml" } }; @@ -158129,7 +158333,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "css" } }; @@ -158139,7 +158343,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "graphql" } }; @@ -158147,9 +158351,9 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }; - const JSDOC_COMMENT = hljs$1.COMMENT(/\/\*\*(?!\/)/, "\\*/", { + const JSDOC_COMMENT = hljs.COMMENT(/\/\*\*(?!\/)/, "\\*/", { relevance: 0, contains: [{ begin: "(?=@[A-Za-z]+)", @@ -158180,17 +158384,17 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }] }); - const COMMENT$2 = { + const COMMENT = { className: "comment", variants: [ JSDOC_COMMENT, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.C_LINE_COMMENT_MODE + hljs.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE ] }; const SUBST_INTERNALS = [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, @@ -158204,7 +158408,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: KEYWORDS$1$1, contains: ["self"].concat(SUBST_INTERNALS) }); - const SUBST_AND_COMMENTS = [].concat(COMMENT$2, SUBST.contains); + const SUBST_AND_COMMENTS = [].concat(COMMENT, SUBST.contains); const PARAMS_CONTAINS = SUBST_AND_COMMENTS.concat([{ begin: /(\s*)\(/, end: /\)/, @@ -158251,7 +158455,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, match: regex.either(/\bJSON/, /\b[A-Z][a-z]+([A-Z][a-z]*|\d)*/, /\b[A-Z]{2,}([A-Z][a-z]+|\d)+([A-Z][a-z]*)*/, /\b[A-Z]{2,}[a-z]+([A-Z][a-z]+|\d)*([A-Z][a-z]*)*/), className: "title.class", - keywords: { _: [...TYPES$4, ...ERROR_TYPES$4] } + keywords: { _: [...TYPES, ...ERROR_TYPES] } }; const USE_STRICT = { label: "use_strict", @@ -158284,7 +158488,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { } const FUNCTION_CALL = { match: regex.concat(/\b/, noneOf([ - ...BUILT_IN_GLOBALS$4, + ...BUILT_IN_GLOBALS, "super", "import" ].map((x$2) => `${x$2}\\s*\\(`)), IDENT_RE$1$1, regex.lookahead(/\s*\(/)), @@ -158312,7 +158516,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [{ begin: /\(\)/ }, PARAMS] }; - const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs$1.UNDERSCORE_IDENT_RE + ")\\s*=>"; + const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs.UNDERSCORE_IDENT_RE + ")\\s*=>"; const FUNCTION_VARIABLE = { match: [ /const|var|let/, @@ -158345,19 +158549,19 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, illegal: /#(?![$_A-z])/, contains: [ - hljs$1.SHEBANG({ + hljs.SHEBANG({ label: "shebang", binary: "node", relevance: 5 }), USE_STRICT, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, TEMPLATE_STRING, - COMMENT$2, + COMMENT, { match: /\$\d+/ }, NUMBER, CLASS_REFERENCE, @@ -158368,12 +158572,12 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, FUNCTION_VARIABLE, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", keywords: "return throw case", relevance: 0, contains: [ - COMMENT$2, - hljs$1.REGEXP_MODE, + COMMENT, + hljs.REGEXP_MODE, { className: "function", begin: FUNC_LEAD_IN_RE, @@ -158383,7 +158587,7 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "params", variants: [ { - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }, { @@ -158436,10 +158640,10 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { FUNCTION_DEFINITION, { beginKeywords: "while if switch catch for" }, { - begin: "\\b(?!function)" + hljs$1.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", + begin: "\\b(?!function)" + hljs.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", returnBegin: true, label: "func.def", - contains: [PARAMS, hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [PARAMS, hljs.inherit(hljs.TITLE_MODE, { begin: IDENT_RE$1$1, className: "title.function" })] @@ -158466,13 +158670,13 @@ var require_javascript = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; } - module.exports = javascript$3; + module.exports = javascript; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/jboss-cli.js var require_jboss_cli = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function jbossCli(hljs$1) { + function jbossCli(hljs) { const PARAM = { begin: /[\w-]+ *=/, returnBegin: true, @@ -158511,8 +158715,8 @@ var require_jboss_cli = /* @__PURE__ */ __commonJSMin(((exports, module) => { literal: "true false" }, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.HASH_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, COMMAND_PARAMS, OPERATION, PATH, @@ -158526,7 +158730,7 @@ var require_jboss_cli = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/json.js var require_json = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function json$1(hljs$1) { + function json(hljs) { const ATTRIBUTE = { className: "attr", begin: /"(\\.|[^\\"\r\n])*"(?=\s*:)/, @@ -158537,38 +158741,38 @@ var require_json = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "punctuation", relevance: 0 }; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null" ]; const LITERALS_MODE = { scope: "literal", - beginKeywords: LITERALS$6.join(" ") + beginKeywords: LITERALS$2.join(" ") }; return { name: "JSON", aliases: ["jsonc"], - keywords: { literal: LITERALS$6 }, + keywords: { literal: LITERALS$2 }, contains: [ ATTRIBUTE, PUNCTUATION, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, LITERALS_MODE, - hljs$1.C_NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ], illegal: "\\S" }; } - module.exports = json$1; + module.exports = json; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/julia.js var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function julia(hljs$1) { + function julia(hljs) { const VARIABLE_NAME_RE = "[A-Za-z_\\u00A1-\\uFFFF][A-Za-z_0-9\\u00A1-\\uFFFF]*"; const KEYWORD_LIST = [ "baremodule", @@ -158833,14 +159037,14 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { "WeakKeyDict", "WeakRef" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: VARIABLE_NAME_RE, keyword: KEYWORD_LIST, literal: LITERAL_LIST, built_in: BUILT_IN_LIST }; const DEFAULT = { - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /<\// }; const NUMBER = { @@ -158856,7 +159060,7 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "subst", begin: /\$\(/, end: /\)/, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; const INTERPOLATED_VARIABLE = { className: "variable", @@ -158865,7 +159069,7 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { const STRING = { className: "string", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, INTERPOLATION, INTERPOLATED_VARIABLE ], @@ -158881,7 +159085,7 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { const COMMAND = { className: "string", contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, INTERPOLATION, INTERPOLATED_VARIABLE ], @@ -158892,7 +159096,7 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "meta", begin: "@" + VARIABLE_NAME_RE }; - const COMMENT$2 = { + const COMMENT = { className: "comment", variants: [{ begin: "#=", @@ -158910,8 +159114,8 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { STRING, COMMAND, MACROCALL, - COMMENT$2, - hljs$1.HASH_COMMENT_MODE, + COMMENT, + hljs.HASH_COMMENT_MODE, { className: "keyword", begin: "\\b(((abstract|primitive)\\s+)type|(mutable\\s+)?struct)\\b" @@ -158927,7 +159131,7 @@ var require_julia = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/julia-repl.js var require_julia_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function juliaRepl(hljs$1) { + function juliaRepl(hljs) { return { name: "Julia REPL", contains: [{ @@ -158966,8 +159170,8 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { ], relevance: 0 }; - function kotlin(hljs$1) { - const KEYWORDS$6 = { + function kotlin(hljs) { + const KEYWORDS$2 = { keyword: "abstract as val var vararg get set class object open private protected public noinline " + "crossinline dynamic final enum if else do while for when throw try catch finally " + "import package is in fun override companion reified inline lateinit init " + "interface annotation data sealed internal infix operator out by constructor super " + "tailrec where const inner suspend typealias external expect actual", built_in: "Byte Short Char Int Long Boolean Float Double Void Unit Nothing", literal: "true false null" @@ -158982,17 +159186,17 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const LABEL = { className: "symbol", - begin: hljs$1.UNDERSCORE_IDENT_RE + "@" + begin: hljs.UNDERSCORE_IDENT_RE + "@" }; const SUBST = { className: "subst", begin: /\$\{/, end: /\}/, - contains: [hljs$1.C_NUMBER_MODE] + contains: [hljs.C_NUMBER_MODE] }; const VARIABLE = { className: "variable", - begin: "\\$" + hljs$1.UNDERSCORE_IDENT_RE + begin: "\\$" + hljs.UNDERSCORE_IDENT_RE }; const STRING = { className: "string", @@ -159006,14 +159210,14 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "'", end: "'", illegal: /\n/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "\"", end: "\"", illegal: /\n/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, VARIABLE, SUBST ] @@ -159023,22 +159227,22 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { SUBST.contains.push(STRING); const ANNOTATION_USE_SITE = { className: "meta", - begin: "@(?:file|property|field|get|set|receiver|param|setparam|delegate)\\s*:(?:\\s*" + hljs$1.UNDERSCORE_IDENT_RE + ")?" + begin: "@(?:file|property|field|get|set|receiver|param|setparam|delegate)\\s*:(?:\\s*" + hljs.UNDERSCORE_IDENT_RE + ")?" }; const ANNOTATION = { className: "meta", - begin: "@" + hljs$1.UNDERSCORE_IDENT_RE, + begin: "@" + hljs.UNDERSCORE_IDENT_RE, contains: [{ begin: /\(/, end: /\)/, - contains: [hljs$1.inherit(STRING, { className: "string" }), "self"] + contains: [hljs.inherit(STRING, { className: "string" }), "self"] }] }; const KOTLIN_NUMBER_MODE = NUMERIC; - const KOTLIN_NESTED_COMMENT = hljs$1.COMMENT("/\\*", "\\*/", { contains: [hljs$1.C_BLOCK_COMMENT_MODE] }); + const KOTLIN_NESTED_COMMENT = hljs.COMMENT("/\\*", "\\*/", { contains: [hljs.C_BLOCK_COMMENT_MODE] }); const KOTLIN_PAREN_TYPE = { variants: [{ className: "type", - begin: hljs$1.UNDERSCORE_IDENT_RE + begin: hljs.UNDERSCORE_IDENT_RE }, { begin: /\(/, end: /\)/, @@ -159050,16 +159254,16 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Kotlin", aliases: ["kt", "kts"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.COMMENT("/\\*\\*", "\\*/", { + hljs.COMMENT("/\\*\\*", "\\*/", { relevance: 0, contains: [{ className: "doctag", begin: "@[A-Za-z]+" }] }), - hljs$1.C_LINE_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, KOTLIN_NESTED_COMMENT, KEYWORDS_WITH_LABEL, LABEL, @@ -159071,14 +159275,14 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "[(]|$", returnBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 5, contains: [ { - begin: hljs$1.UNDERSCORE_IDENT_RE + "\\s*\\(", + begin: hljs.UNDERSCORE_IDENT_RE + "\\s*\\(", returnBegin: true, relevance: 0, - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }, { className: "type", @@ -159092,7 +159296,7 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\(/, end: /\)/, endsParent: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, relevance: 0, contains: [ { @@ -159101,17 +159305,17 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { endsWithParent: true, contains: [ KOTLIN_PAREN_TYPE, - hljs$1.C_LINE_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, KOTLIN_NESTED_COMMENT ], relevance: 0 }, - hljs$1.C_LINE_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, KOTLIN_NESTED_COMMENT, ANNOTATION_USE_SITE, ANNOTATION, STRING, - hljs$1.C_NUMBER_MODE + hljs.C_NUMBER_MODE ] }, KOTLIN_NESTED_COMMENT @@ -159121,7 +159325,7 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /class|interface|trait/, /\s+/, - hljs$1.UNDERSCORE_IDENT_RE + hljs.UNDERSCORE_IDENT_RE ], beginScope: { 3: "title.class" }, keywords: "class interface trait", @@ -159130,7 +159334,7 @@ var require_kotlin = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "extends implements", contains: [ { beginKeywords: "public protected internal private constructor" }, - hljs$1.UNDERSCORE_TITLE_MODE, + hljs.UNDERSCORE_TITLE_MODE, { className: "type", begin: / { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/lasso.js var require_lasso = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function lasso(hljs$1) { + function lasso(hljs) { const LASSO_IDENT_RE = "[a-zA-Z_][\\w.]*"; const LASSO_ANGLE_RE = "<\\?(lasso(script)?|=)"; const LASSO_CLOSE_RE = "\\]|\\?>"; @@ -159177,7 +159381,7 @@ var require_lasso = /* @__PURE__ */ __commonJSMin(((exports, module) => { built_in: "array date decimal duration integer map pair string tag xml null " + "boolean bytes keyword list locale queue set stack staticarray " + "local var variable global data self inherited currentcapture givenblock", keyword: "cache database_names database_schemanames database_tablenames " + "define_tag define_type email_batch encode_set html_comment handle " + "handle_error header if inline iterate ljax_target link " + "link_currentaction link_currentgroup link_currentrecord link_detail " + "link_firstgroup link_firstrecord link_lastgroup link_lastrecord " + "link_nextgroup link_nextrecord link_prevgroup link_prevrecord log " + "loop namespace_using output_none portal private protect records " + "referer referrer repeating resultset rows search_args " + "search_arguments select sort_args sort_arguments thread_atomic " + "value_list while abort case else fail_if fail_ifnot fail if_empty " + "if_false if_null if_true loop_abort loop_continue loop_count params " + "params_up return return_value run_children soap_definetag " + "soap_lastrequest soap_lastresponse tag_name ascending average by " + "define descending do equals frozen group handle_failure import in " + "into join let match max min on order parent protected provide public " + "require returnhome skip split_thread sum take thread to trait type " + "where with yield yieldhome" }; - const HTML_COMMENT = hljs$1.COMMENT("", { relevance: 0 }); + const HTML_COMMENT = hljs.COMMENT("", { relevance: 0 }); const LASSO_NOPROCESS = { className: "meta", begin: "\\[noprocess\\]", @@ -159196,11 +159400,11 @@ var require_lasso = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "'" + LASSO_IDENT_RE + "'" }; const LASSO_CODE = [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.inherit(hljs$1.C_NUMBER_MODE, { begin: hljs$1.C_NUMBER_RE + "|(-?infinity|NaN)\\b" }), - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { illegal: null }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.inherit(hljs.C_NUMBER_MODE, { begin: hljs.C_NUMBER_RE + "|(-?infinity|NaN)\\b" }), + hljs.inherit(hljs.APOS_STRING_MODE, { illegal: null }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }), { className: "string", begin: "`", @@ -159234,7 +159438,7 @@ var require_lasso = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "define", returnEnd: true, end: "\\(|=>", - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: LASSO_IDENT_RE + "(=(?!>))?|[-+*/%](?!>)" })] + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: LASSO_IDENT_RE + "(=(?!>))?|[-+*/%](?!>)" })] } ]; return { @@ -159299,8 +159503,8 @@ var require_lasso = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/latex.js var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function latex(hljs$1) { - const regex = hljs$1.regex; + function latex(hljs) { + const regex = hljs.regex; const KNOWN_CONTROL_WORDS = regex.either(...[ "(?:NeedsTeXFormat|RequirePackage|GetIdInfo)", "Provides(?:Expl)?(?:Package|Class|File)", @@ -159384,14 +159588,14 @@ var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "$", relevance: 10 }; - const COMMENT$2 = hljs$1.COMMENT("%", "$", { relevance: 0 }); + const COMMENT = hljs.COMMENT("%", "$", { relevance: 0 }); const EVERYTHING_BUT_VERBATIM = [ CONTROL_SEQUENCE, MACRO_PARAM, DOUBLE_CARET_CHAR, SPECIAL_CATCODE, MAGIC_COMMENT, - COMMENT$2 + COMMENT ]; const BRACE_GROUP_NO_VERBATIM = { begin: /\{/, @@ -159399,7 +159603,7 @@ var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: ["self", ...EVERYTHING_BUT_VERBATIM] }; - const ARGUMENT_BRACES = hljs$1.inherit(BRACE_GROUP_NO_VERBATIM, { + const ARGUMENT_BRACES = hljs.inherit(BRACE_GROUP_NO_VERBATIM, { relevance: 0, endsParent: true, contains: [BRACE_GROUP_NO_VERBATIM, ...EVERYTHING_BUT_VERBATIM] @@ -159440,7 +159644,7 @@ var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; }; const BEGIN_ENV = function(envname, starts_mode) { - return hljs$1.inherit({ + return hljs.inherit({ begin: "\\\\begin(?=[ ]*(\\r?\\n[ ]*)?\\{" + envname + "\\})", keywords: { $pattern: /\\[a-zA-Z]+/, @@ -159450,7 +159654,7 @@ var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, ARGUMENT_AND_THEN(ARGUMENT_M, starts_mode)); }; const VERBATIM_DELIMITED_EQUAL = (innerName = "string") => { - return hljs$1.END_SAME_AS_BEGIN({ + return hljs.END_SAME_AS_BEGIN({ className: innerName, begin: /(.|\r?\n)/, end: /(.|\r?\n)/, @@ -159516,7 +159720,7 @@ var require_latex = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ldif.js var require_ldif = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function ldif(hljs$1) { + function ldif(hljs) { return { name: "LDIF", contains: [ @@ -159533,7 +159737,7 @@ var require_ldif = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "literal", match: "^-" }, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }; } @@ -159543,9 +159747,9 @@ var require_ldif = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/leaf.js var require_leaf = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function leaf(hljs$1) { + function leaf(hljs) { const IDENT = /([A-Za-z_][A-Za-z_0-9]*)?/; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "in" @@ -159564,7 +159768,7 @@ var require_leaf = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { scope: "keyword", - match: LITERALS$6.join("|") + match: LITERALS$2.join("|") }, { scope: "variable", @@ -159619,13 +159823,13 @@ var require_leaf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/less.js var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const MODES$4 = (hljs$1) => { + const MODES = (hljs) => { return { IMPORTANT: { scope: "meta", begin: "!important" }, - BLOCK_COMMENT: hljs$1.C_BLOCK_COMMENT_MODE, + BLOCK_COMMENT: hljs.C_BLOCK_COMMENT_MODE, HEXCOLOR: { scope: "number", begin: /#(([0-9a-fA-F]{3,4})|(([0-9a-fA-F]{2}){3,4}))\b/ @@ -159639,11 +159843,11 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[/, end: /\]/, illegal: "$", - contains: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + contains: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, CSS_NUMBER_MODE: { scope: "number", - begin: hljs$1.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", + begin: hljs.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", relevance: 0 }, CSS_VARIABLE: { @@ -159652,7 +159856,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; }; - const HTML_TAGS$3 = [ + const HTML_TAGS = [ "a", "abbr", "address", @@ -159731,7 +159935,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "var", "video" ]; - const SVG_TAGS$3 = [ + const SVG_TAGS = [ "defs", "g", "marker", @@ -159774,8 +159978,8 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "foreignObject", "clipPath" ]; - const TAGS$3 = [...HTML_TAGS$3, ...SVG_TAGS$3]; - const MEDIA_FEATURES$3 = [ + const TAGS = [...HTML_TAGS, ...SVG_TAGS]; + const MEDIA_FEATURES = [ "any-hover", "any-pointer", "aspect-ratio", @@ -159810,7 +160014,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "min-height", "max-height" ].sort().reverse(); - const PSEUDO_CLASSES$3 = [ + const PSEUDO_CLASSES = [ "active", "any-link", "blank", @@ -159871,7 +160075,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "visited", "where" ].sort().reverse(); - const PSEUDO_ELEMENTS$3 = [ + const PSEUDO_ELEMENTS = [ "after", "backdrop", "before", @@ -159887,7 +160091,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "slotted", "spelling-error" ].sort().reverse(); - const ATTRIBUTES$3 = [ + const ATTRIBUTES = [ "accent-color", "align-content", "align-items", @@ -160403,20 +160607,20 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { "z-index", "zoom" ].sort().reverse(); - const PSEUDO_SELECTORS = PSEUDO_CLASSES$3.concat(PSEUDO_ELEMENTS$3).sort().reverse(); + const PSEUDO_SELECTORS = PSEUDO_CLASSES.concat(PSEUDO_ELEMENTS).sort().reverse(); /** @type LanguageFn */ - function less(hljs$1) { - const modes = MODES$4(hljs$1); + function less(hljs) { + const modes = MODES(hljs); const PSEUDO_SELECTORS$1 = PSEUDO_SELECTORS; const AT_MODIFIERS = "and or not only"; - const IDENT_RE$6 = "[\\w-]+"; - const INTERP_IDENT_RE = "(" + IDENT_RE$6 + "|@\\{" + IDENT_RE$6 + "\\})"; + const IDENT_RE$2 = "[\\w-]+"; + const INTERP_IDENT_RE = "(" + IDENT_RE$2 + "|@\\{" + IDENT_RE$2 + "\\})"; const RULES = []; const VALUE_MODES = []; - const STRING_MODE = function(c$7) { + const STRING_MODE = function(c$6) { return { className: "string", - begin: "~?" + c$7 + ".*?" + c$7 + begin: "~?" + c$6 + ".*?" + c$6 }; }; const IDENT_MODE = function(name, begin, relevance) { @@ -160429,7 +160633,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { const AT_KEYWORDS = { $pattern: /[a-z-]+/, keyword: AT_MODIFIERS, - attribute: MEDIA_FEATURES$3.join(" ") + attribute: MEDIA_FEATURES.join(" ") }; const PARENS_MODE = { begin: "\\(", @@ -160438,16 +160642,16 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: AT_KEYWORDS, relevance: 0 }; - VALUE_MODES.push(hljs$1.C_LINE_COMMENT_MODE, hljs$1.C_BLOCK_COMMENT_MODE, STRING_MODE("'"), STRING_MODE("\""), modes.CSS_NUMBER_MODE, { + VALUE_MODES.push(hljs.C_LINE_COMMENT_MODE, hljs.C_BLOCK_COMMENT_MODE, STRING_MODE("'"), STRING_MODE("\""), modes.CSS_NUMBER_MODE, { begin: "(url|data-uri)\\(", starts: { className: "string", end: "[\\)\\n]", excludeEnd: true } - }, modes.HEXCOLOR, PARENS_MODE, IDENT_MODE("variable", "@@?" + IDENT_RE$6, 10), IDENT_MODE("variable", "@\\{" + IDENT_RE$6 + "\\}"), IDENT_MODE("built_in", "~?`[^`]*?`"), { + }, modes.HEXCOLOR, PARENS_MODE, IDENT_MODE("variable", "@@?" + IDENT_RE$2, 10), IDENT_MODE("variable", "@\\{" + IDENT_RE$2 + "\\}"), IDENT_MODE("built_in", "~?`[^`]*?`"), { className: "attribute", - begin: IDENT_RE$6 + "\\s*:", + begin: IDENT_RE$2 + "\\s*:", end: ":", returnBegin: true, excludeEnd: true @@ -160472,7 +160676,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { modes.CSS_VARIABLE, { className: "attribute", - begin: "\\b(" + ATTRIBUTES$3.join("|") + ")\\b", + begin: "\\b(" + ATTRIBUTES.join("|") + ")\\b", end: /(?=:)/, starts: { endsWithParent: true, @@ -160497,9 +160701,9 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { const VAR_RULE_MODE = { className: "variable", variants: [{ - begin: "@" + IDENT_RE$6 + "\\s*:", + begin: "@" + IDENT_RE$2 + "\\s*:", relevance: 15 - }, { begin: "@" + IDENT_RE$6 }], + }, { begin: "@" + IDENT_RE$2 }], starts: { end: "[;}]", returnEnd: true, @@ -160519,13 +160723,13 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "[<='$\"]", relevance: 0, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, MIXIN_GUARD_MODE, IDENT_MODE("keyword", "all\\b"), - IDENT_MODE("variable", "@\\{" + IDENT_RE$6 + "\\}"), + IDENT_MODE("variable", "@\\{" + IDENT_RE$2 + "\\}"), { - begin: "\\b(" + TAGS$3.join("|") + ")\\b", + begin: "\\b(" + TAGS.join("|") + ")\\b", className: "selector-tag" }, modes.CSS_NUMBER_MODE, @@ -160536,11 +160740,11 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { modes.ATTRIBUTE_SELECTOR_MODE, { className: "selector-pseudo", - begin: ":(" + PSEUDO_CLASSES$3.join("|") + ")" + begin: ":(" + PSEUDO_CLASSES.join("|") + ")" }, { className: "selector-pseudo", - begin: ":(:)?(" + PSEUDO_ELEMENTS$3.join("|") + ")" + begin: ":(:)?(" + PSEUDO_ELEMENTS.join("|") + ")" }, { begin: /\(/, @@ -160553,11 +160757,11 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; const PSEUDO_SELECTOR_MODE = { - begin: IDENT_RE$6 + ":(:)?" + `(${PSEUDO_SELECTORS$1.join("|")})`, + begin: IDENT_RE$2 + ":(:)?" + `(${PSEUDO_SELECTORS$1.join("|")})`, returnBegin: true, contains: [SELECTOR_MODE] }; - RULES.push(hljs$1.C_LINE_COMMENT_MODE, hljs$1.C_BLOCK_COMMENT_MODE, AT_RULE_MODE, VAR_RULE_MODE, PSEUDO_SELECTOR_MODE, RULE_MODE, SELECTOR_MODE, MIXIN_GUARD_MODE, modes.FUNCTION_DISPATCH); + RULES.push(hljs.C_LINE_COMMENT_MODE, hljs.C_BLOCK_COMMENT_MODE, AT_RULE_MODE, VAR_RULE_MODE, PSEUDO_SELECTOR_MODE, RULE_MODE, SELECTOR_MODE, MIXIN_GUARD_MODE, modes.FUNCTION_DISPATCH); return { name: "Less", case_insensitive: true, @@ -160571,7 +160775,7 @@ var require_less = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/lisp.js var require_lisp = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function lisp(hljs$1) { + function lisp(hljs) { const LISP_IDENT_RE = "[a-zA-Z_\\-+\\*\\/<=>&#][a-zA-Z0-9_\\-+*\\/<=>&#!]*"; const MEC_RE = "\\|[^]*?\\|"; const LISP_SIMPLE_NUMBER_RE = "(-|\\+)?\\d+(\\.\\d+|\\/\\d+)?((d|e|f|l|s|D|E|F|L|S)(\\+|-)?\\d+)?"; @@ -160595,8 +160799,8 @@ var require_lisp = /* @__PURE__ */ __commonJSMin(((exports, module) => { } ] }; - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }); - const COMMENT$2 = hljs$1.COMMENT(";", "$", { relevance: 0 }); + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }); + const COMMENT = hljs.COMMENT(";", "$", { relevance: 0 }); const VARIABLE = { begin: "\\*", end: "\\*" @@ -160666,7 +160870,7 @@ var require_lisp = /* @__PURE__ */ __commonJSMin(((exports, module) => { LITERAL, NUMBER, STRING, - COMMENT$2, + COMMENT, VARIABLE, KEYWORD, MEC, @@ -160677,10 +160881,10 @@ var require_lisp = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /\S/, contains: [ NUMBER, - hljs$1.SHEBANG(), + hljs.SHEBANG(), LITERAL, STRING, - COMMENT$2, + COMMENT, QUOTED, QUOTED_ATOM, LIST, @@ -160694,20 +160898,20 @@ var require_lisp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/livecodeserver.js var require_livecodeserver = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function livecodeserver(hljs$1) { + function livecodeserver(hljs) { const VARIABLE = { className: "variable", variants: [{ begin: "\\b([gtps][A-Z]{1}[a-zA-Z0-9]*)(\\[.+\\])?(?:\\s*?)" }, { begin: "\\$_[A-Z]+" }], relevance: 0 }; const COMMENT_MODES = [ - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.HASH_COMMENT_MODE, - hljs$1.COMMENT("--", "$"), - hljs$1.COMMENT("[^:]//", "$") + hljs.C_BLOCK_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, + hljs.COMMENT("--", "$"), + hljs.COMMENT("[^:]//", "$") ]; - const TITLE1 = hljs$1.inherit(hljs$1.TITLE_MODE, { variants: [{ begin: "\\b_*rig[A-Z][A-Za-z0-9_\\-]*" }, { begin: "\\b_[a-z0-9\\-]+" }] }); - const TITLE2 = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "\\b([A-Za-z0-9_\\-]+)\\b" }); + const TITLE1 = hljs.inherit(hljs.TITLE_MODE, { variants: [{ begin: "\\b_*rig[A-Z][A-Za-z0-9_\\-]*" }, { begin: "\\b_[a-z0-9\\-]+" }] }); + const TITLE2 = hljs.inherit(hljs.TITLE_MODE, { begin: "\\b([A-Za-z0-9_\\-]+)\\b" }); return { name: "LiveCode", case_insensitive: false, @@ -160729,10 +160933,10 @@ var require_livecodeserver = /* @__PURE__ */ __commonJSMin(((exports, module) => contains: [ VARIABLE, TITLE2, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.BINARY_NUMBER_MODE, - hljs$1.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.BINARY_NUMBER_MODE, + hljs.C_NUMBER_MODE, TITLE1 ] }, @@ -160750,10 +160954,10 @@ var require_livecodeserver = /* @__PURE__ */ __commonJSMin(((exports, module) => contains: [ VARIABLE, TITLE2, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.BINARY_NUMBER_MODE, - hljs$1.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.BINARY_NUMBER_MODE, + hljs.C_NUMBER_MODE, TITLE1 ] }, @@ -160768,10 +160972,10 @@ var require_livecodeserver = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\?>" } ] }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.BINARY_NUMBER_MODE, - hljs$1.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.BINARY_NUMBER_MODE, + hljs.C_NUMBER_MODE, TITLE1 ].concat(COMMENT_MODES), illegal: ";$|^\\[|^=|&|\\{" @@ -160783,7 +160987,7 @@ var require_livecodeserver = /* @__PURE__ */ __commonJSMin(((exports, module) => //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/livescript.js var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const KEYWORDS$3 = [ + const KEYWORDS = [ "as", "in", "of", @@ -160824,7 +161028,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "extends", "using" ]; - const LITERALS$3 = [ + const LITERALS = [ "true", "false", "null", @@ -160832,7 +161036,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NaN", "Infinity" ]; - const TYPES$3 = [ + const TYPES = [ "Object", "Function", "Boolean", @@ -160873,7 +161077,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Intl", "WebAssembly" ]; - const ERROR_TYPES$3 = [ + const ERROR_TYPES = [ "Error", "EvalError", "InternalError", @@ -160883,7 +161087,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "TypeError", "URIError" ]; - const BUILT_IN_GLOBALS$3 = [ + const BUILT_IN_GLOBALS = [ "setInterval", "setTimeout", "clearInterval", @@ -160902,8 +161106,8 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "escape", "unescape" ]; - const BUILT_INS$3 = [].concat(BUILT_IN_GLOBALS$3, TYPES$3, ERROR_TYPES$3); - function livescript(hljs$1) { + const BUILT_INS = [].concat(BUILT_IN_GLOBALS, TYPES, ERROR_TYPES); + function livescript(hljs) { const LIVESCRIPT_BUILT_INS = ["npm", "print"]; const LIVESCRIPT_LITERALS = [ "yes", @@ -160946,12 +161150,12 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "__indexOf" ]; const KEYWORDS$1$1 = { - keyword: KEYWORDS$3.concat(LIVESCRIPT_KEYWORDS), - literal: LITERALS$3.concat(LIVESCRIPT_LITERALS), - built_in: BUILT_INS$3.concat(LIVESCRIPT_BUILT_INS) + keyword: KEYWORDS.concat(LIVESCRIPT_KEYWORDS), + literal: LITERALS.concat(LIVESCRIPT_LITERALS), + built_in: BUILT_INS.concat(LIVESCRIPT_BUILT_INS) }; const JS_IDENT_RE = "[A-Za-z$_](?:-[0-9A-Za-z$_]|[0-9A-Za-z$_])*"; - const TITLE = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: JS_IDENT_RE }); + const TITLE = hljs.inherit(hljs.TITLE_MODE, { begin: JS_IDENT_RE }); const SUBST = { className: "subst", begin: /#\{/, @@ -160965,7 +161169,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: KEYWORDS$1$1 }; const EXPRESSIONS = [ - hljs$1.BINARY_NUMBER_MODE, + hljs.BINARY_NUMBER_MODE, { className: "number", begin: "(\\b0[xX][a-fA-F0-9_]+)|(\\b\\d(\\d|_\\d)*(\\.(\\d(\\d|_\\d)*)?)?(_*[eE]([-+]\\d(_\\d|\\d)*)?)?[_a-z]*)", @@ -160981,18 +161185,18 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: /'''/, end: /'''/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /'/, end: /'/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /"""/, end: /"""/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, SUBST_SIMPLE ] @@ -161001,7 +161205,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, SUBST_SIMPLE ] @@ -161018,7 +161222,7 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ begin: "//", end: "//[gim]*", - contains: [SUBST, hljs$1.HASH_COMMENT_MODE] + contains: [SUBST, hljs.HASH_COMMENT_MODE] }, { begin: /\/(?![ *])(\\.|[^\\\n])*?\/[gim]*(?=\W)/ }] }, { begin: "@" + JS_IDENT_RE }, @@ -161062,8 +161266,8 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: KEYWORDS$1$1, illegal: /\/\*/, contains: EXPRESSIONS.concat([ - hljs$1.COMMENT("\\/\\*", "\\*\\/"), - hljs$1.HASH_COMMENT_MODE, + hljs.COMMENT("\\/\\*", "\\*\\/"), + hljs.HASH_COMMENT_MODE, SYMBOLS, { className: "function", @@ -161102,9 +161306,9 @@ var require_livescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/llvm.js var require_llvm = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function llvm(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /([-a-zA-Z$._][\w$.-]*)/; + function llvm(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /([-a-zA-Z$._][\w$.-]*)/; const TYPE = { className: "type", begin: /\bi\d+(?=\s|\b)/ @@ -161132,7 +161336,7 @@ var require_llvm = /* @__PURE__ */ __commonJSMin(((exports, module) => { const VARIABLE = { className: "variable", variants: [ - { begin: regex.concat(/%/, IDENT_RE$6) }, + { begin: regex.concat(/%/, IDENT_RE$2) }, { begin: /%\d+/ }, { begin: /#\d+/ } ] @@ -161140,10 +161344,10 @@ var require_llvm = /* @__PURE__ */ __commonJSMin(((exports, module) => { const FUNCTION = { className: "title", variants: [ - { begin: regex.concat(/@/, IDENT_RE$6) }, + { begin: regex.concat(/@/, IDENT_RE$2) }, { begin: /@\d+/ }, - { begin: regex.concat(/!/, IDENT_RE$6) }, - { begin: regex.concat(/!\d+/, IDENT_RE$6) }, + { begin: regex.concat(/!/, IDENT_RE$2) }, + { begin: regex.concat(/!\d+/, IDENT_RE$2) }, { begin: /!\d+/ } ] }; @@ -161155,8 +161359,8 @@ var require_llvm = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ TYPE, - hljs$1.COMMENT(/;\s*$/, null, { relevance: 0 }), - hljs$1.COMMENT(/;/, /$/), + hljs.COMMENT(/;\s*$/, null, { relevance: 0 }), + hljs.COMMENT(/;/, /$/), { className: "string", begin: /"/, @@ -161181,7 +161385,7 @@ var require_llvm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/lsl.js var require_lsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function lsl(hljs$1) { + function lsl(hljs) { const LSL_STRING_ESCAPE_CHARS = { className: "subst", begin: /\\[tn"\\]/ @@ -161195,7 +161399,7 @@ var require_lsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { const LSL_NUMBERS = { className: "number", relevance: 0, - begin: hljs$1.C_NUMBER_RE + begin: hljs.C_NUMBER_RE }; const LSL_CONSTANTS = { className: "literal", @@ -161219,7 +161423,7 @@ var require_lsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { LSL_STRINGS, { className: "comment", - variants: [hljs$1.COMMENT("//", "$"), hljs$1.COMMENT("/\\*", "\\*/")], + variants: [hljs.COMMENT("//", "$"), hljs.COMMENT("/\\*", "\\*/")], relevance: 0 }, LSL_NUMBERS, @@ -161242,7 +161446,7 @@ var require_lsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/lua.js var require_lua = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function lua(hljs$1) { + function lua(hljs) { const OPENING_LONG_BRACKET = "\\[=*\\["; const CLOSING_LONG_BRACKET = "\\]=*\\]"; const LONG_BRACKETS = { @@ -161250,7 +161454,7 @@ var require_lua = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: CLOSING_LONG_BRACKET, contains: ["self"] }; - const COMMENTS = [hljs$1.COMMENT("--(?!" + OPENING_LONG_BRACKET + ")", "$"), hljs$1.COMMENT("--" + OPENING_LONG_BRACKET, CLOSING_LONG_BRACKET, { + const COMMENTS = [hljs.COMMENT("--(?!" + OPENING_LONG_BRACKET + ")", "$"), hljs.COMMENT("--" + OPENING_LONG_BRACKET, CLOSING_LONG_BRACKET, { contains: [LONG_BRACKETS], relevance: 10 })]; @@ -161258,7 +161462,7 @@ var require_lua = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Lua", aliases: ["pluto"], keywords: { - $pattern: hljs$1.UNDERSCORE_IDENT_RE, + $pattern: hljs.UNDERSCORE_IDENT_RE, literal: "true false nil", keyword: "and break do else elseif end for goto if in local not or repeat return then until while", built_in: "_G _ENV _VERSION __index __newindex __mode __call __metatable __tostring __len " + "__gc __add __sub __mul __div __mod __pow __concat __unm __eq __lt __le assert " + "collectgarbage dofile error getfenv getmetatable ipairs load loadfile loadstring " + "module next pairs pcall print rawequal rawget rawset require select setfenv " + "setmetatable tonumber tostring type unpack xpcall arg self " + "coroutine resume yield status wrap create running debug getupvalue " + "debug sethook getmetatable gethook setmetatable setlocal traceback setfenv getinfo setupvalue getlocal getregistry getfenv " + "io lines write close flush open output type read stderr stdin input stdout popen tmpfile " + "math log max acos huge ldexp pi cos tanh pow deg tan cosh sinh random randomseed frexp ceil floor rad abs sqrt modf asin min mod fmod log10 atan2 exp sin atan " + "os exit setlocale date getenv difftime remove time clock tmpname rename execute package preload loadlib loaded loaders cpath config path seeall " + "string sub upper len gfind rep find match char dump gmatch reverse byte format gsub lower " + "table setn insert getn foreachi maxn foreach concat sort remove" @@ -161268,16 +161472,16 @@ var require_lua = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "function", end: "\\)", - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: "([_a-zA-Z]\\w*\\.)*([_a-zA-Z]\\w*:)?[_a-zA-Z]\\w*" }), { + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: "([_a-zA-Z]\\w*\\.)*([_a-zA-Z]\\w*:)?[_a-zA-Z]\\w*" }), { className: "params", begin: "\\(", endsWithParent: true, contains: COMMENTS }].concat(COMMENTS) }, - hljs$1.C_NUMBER_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", begin: OPENING_LONG_BRACKET, @@ -161294,19 +161498,19 @@ var require_lua = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/makefile.js var require_makefile = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function makefile(hljs$1) { + function makefile(hljs) { const VARIABLE = { className: "variable", variants: [{ - begin: "\\$\\(" + hljs$1.UNDERSCORE_IDENT_RE + "\\)", - contains: [hljs$1.BACKSLASH_ESCAPE] + begin: "\\$\\(" + hljs.UNDERSCORE_IDENT_RE + "\\)", + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /\$[@% { keywords: { built_in: "subst patsubst strip findstring filter filter-out sort " + "word wordlist firstword lastword dir notdir suffix basename " + "addsuffix addprefix join wildcard realpath abspath error warning " + "shell origin flavor foreach if or and call eval file value" }, contains: [VARIABLE, QUOTE_STRING] }; - const ASSIGNMENT = { begin: "^" + hljs$1.UNDERSCORE_IDENT_RE + "\\s*(?=[:+?]?=)" }; + const ASSIGNMENT = { begin: "^" + hljs.UNDERSCORE_IDENT_RE + "\\s*(?=[:+?]?=)" }; const META = { className: "meta", begin: /^\.PHONY:/, @@ -161343,7 +161547,7 @@ var require_makefile = /* @__PURE__ */ __commonJSMin(((exports, module) => { keyword: "define endef undefine ifdef ifndef ifeq ifneq else endif " + "include -include sinclude override export unexport private vpath" }, contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, VARIABLE, QUOTE_STRING, FUNC, @@ -168595,12 +168799,12 @@ var require_mathematica = /* @__PURE__ */ __commonJSMin(((exports, module) => { "$WolframUUID" ]; /** @type LanguageFn */ - function mathematica(hljs$1) { - const regex = hljs$1.regex; + function mathematica(hljs) { + const regex = hljs.regex; const BASE_RE = /([2-9]|[1-2]\d|[3][0-5])\^\^/; const BASE_DIGITS_RE = /(\w*\.\w+|\w+\.\w*|\w+)/; - const NUMBER_RE$2 = /(\d*\.\d+|\d+\.\d*|\d+)/; - const BASE_NUMBER_RE = regex.either(regex.concat(BASE_RE, BASE_DIGITS_RE), NUMBER_RE$2); + const NUMBER_RE = /(\d*\.\d+|\d+\.\d*|\d+)/; + const BASE_NUMBER_RE = regex.either(regex.concat(BASE_RE, BASE_DIGITS_RE), NUMBER_RE); const ACCURACY_RE = /``[+-]?(\d*\.\d+|\d+\.\d*|\d+)/; const PRECISION_RE = /`([+-]?(\d*\.\d+|\d+\.\d*|\d+))?/; const APPROXIMATE_NUMBER_RE = regex.either(ACCURACY_RE, PRECISION_RE); @@ -168667,13 +168871,13 @@ var require_mathematica = /* @__PURE__ */ __commonJSMin(((exports, module) => { "message-name": "string" }, contains: [ - hljs$1.COMMENT(/\(\*/, /\*\)/, { contains: ["self"] }), + hljs.COMMENT(/\(\*/, /\*\)/, { contains: ["self"] }), PATTERNS, SLOTS, MESSAGES, SYMBOLS, NAMED_CHARACTER, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBERS, OPERATORS, BRACES @@ -168686,7 +168890,7 @@ var require_mathematica = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/matlab.js var require_matlab = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function matlab(hljs$1) { + function matlab(hljs) { const TRANSPOSE_RE = "('|\\.')+"; const TRANSPOSE = { relevance: 0, @@ -168704,7 +168908,7 @@ var require_matlab = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "function", end: "$", - contains: [hljs$1.UNDERSCORE_TITLE_MODE, { + contains: [hljs.UNDERSCORE_TITLE_MODE, { className: "params", variants: [{ begin: "\\(", @@ -168727,7 +168931,7 @@ var require_matlab = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "number", - begin: hljs$1.C_NUMBER_RE, + begin: hljs.C_NUMBER_RE, relevance: 0, starts: TRANSPOSE }, @@ -168749,8 +168953,8 @@ var require_matlab = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ begin: "\"\"" }], starts: TRANSPOSE }, - hljs$1.COMMENT("^\\s*%\\{\\s*$", "^\\s*%\\}\\s*$"), - hljs$1.COMMENT("%", "$") + hljs.COMMENT("^\\s*%\\{\\s*$", "^\\s*%\\}\\s*$"), + hljs.COMMENT("%", "$") ] }; } @@ -168760,17 +168964,17 @@ var require_matlab = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/maxima.js var require_maxima = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function maxima(hljs$1) { - const KEYWORDS$6 = "if then else elseif for thru do while unless step in and or not"; - const LITERALS$6 = "true false unknown inf minf ind und %e %i %pi %phi %gamma"; + function maxima(hljs) { + const KEYWORDS$2 = "if then else elseif for thru do while unless step in and or not"; + const LITERALS$2 = "true false unknown inf minf ind und %e %i %pi %phi %gamma"; const BUILTIN_FUNCTIONS = " abasep abs absint absolute_real_time acos acosh acot acoth acsc acsch activate" + " addcol add_edge add_edges addmatrices addrow add_vertex add_vertices adjacency_matrix" + " adjoin adjoint af agd airy airy_ai airy_bi airy_dai airy_dbi algsys alg_type" + " alias allroots alphacharp alphanumericp amortization %and annuity_fv" + " annuity_pv antid antidiff AntiDifference append appendfile apply apply1 apply2" + " applyb1 apropos args arit_amortization arithmetic arithsum array arrayapply" + " arrayinfo arraymake arraysetapply ascii asec asech asin asinh askinteger" + " asksign assoc assoc_legendre_p assoc_legendre_q assume assume_external_byte_order" + " asympa at atan atan2 atanh atensimp atom atvalue augcoefmatrix augmented_lagrangian_method" + " av average_degree backtrace bars barsplot barsplot_description base64 base64_decode" + " bashindices batch batchload bc2 bdvac belln benefit_cost bern bernpoly bernstein_approx" + " bernstein_expand bernstein_poly bessel bessel_i bessel_j bessel_k bessel_simplify" + " bessel_y beta beta_incomplete beta_incomplete_generalized beta_incomplete_regularized" + " bezout bfallroots bffac bf_find_root bf_fmin_cobyla bfhzeta bfloat bfloatp" + " bfpsi bfpsi0 bfzeta biconnected_components bimetric binomial bipartition" + " block blockmatrixp bode_gain bode_phase bothcoef box boxplot boxplot_description" + " break bug_report build_info|10 buildq build_sample burn cabs canform canten" + " cardinality carg cartan cartesian_product catch cauchy_matrix cbffac cdf_bernoulli" + " cdf_beta cdf_binomial cdf_cauchy cdf_chi2 cdf_continuous_uniform cdf_discrete_uniform" + " cdf_exp cdf_f cdf_gamma cdf_general_finite_discrete cdf_geometric cdf_gumbel" + " cdf_hypergeometric cdf_laplace cdf_logistic cdf_lognormal cdf_negative_binomial" + " cdf_noncentral_chi2 cdf_noncentral_student_t cdf_normal cdf_pareto cdf_poisson" + " cdf_rank_sum cdf_rayleigh cdf_signed_rank cdf_student_t cdf_weibull cdisplay" + " ceiling central_moment cequal cequalignore cf cfdisrep cfexpand cgeodesic" + " cgreaterp cgreaterpignore changename changevar chaosgame charat charfun charfun2" + " charlist charp charpoly chdir chebyshev_t chebyshev_u checkdiv check_overlaps" + " chinese cholesky christof chromatic_index chromatic_number cint circulant_graph" + " clear_edge_weight clear_rules clear_vertex_label clebsch_gordan clebsch_graph" + " clessp clesspignore close closefile cmetric coeff coefmatrix cograd col collapse" + " collectterms columnop columnspace columnswap columnvector combination combine" + " comp2pui compare compfile compile compile_file complement_graph complete_bipartite_graph" + " complete_graph complex_number_p components compose_functions concan concat" + " conjugate conmetderiv connected_components connect_vertices cons constant" + " constantp constituent constvalue cont2part content continuous_freq contortion" + " contour_plot contract contract_edge contragrad contrib_ode convert coord" + " copy copy_file copy_graph copylist copymatrix cor cos cosh cot coth cov cov1" + " covdiff covect covers crc24sum create_graph create_list csc csch csetup cspline" + " ctaylor ct_coordsys ctransform ctranspose cube_graph cuboctahedron_graph" + " cunlisp cv cycle_digraph cycle_graph cylindrical days360 dblint deactivate" + " declare declare_constvalue declare_dimensions declare_fundamental_dimensions" + " declare_fundamental_units declare_qty declare_translated declare_unit_conversion" + " declare_units declare_weights decsym defcon define define_alt_display define_variable" + " defint defmatch defrule defstruct deftaylor degree_sequence del delete deleten" + " delta demo demoivre denom depends derivdegree derivlist describe desolve" + " determinant dfloat dgauss_a dgauss_b dgeev dgemm dgeqrf dgesv dgesvd diag" + " diagmatrix diag_matrix diagmatrixp diameter diff digitcharp dimacs_export" + " dimacs_import dimension dimensionless dimensions dimensions_as_list direct" + " directory discrete_freq disjoin disjointp disolate disp dispcon dispform" + " dispfun dispJordan display disprule dispterms distrib divide divisors divsum" + " dkummer_m dkummer_u dlange dodecahedron_graph dotproduct dotsimp dpart" + " draw draw2d draw3d drawdf draw_file draw_graph dscalar echelon edge_coloring" + " edge_connectivity edges eigens_by_jacobi eigenvalues eigenvectors eighth" + " einstein eivals eivects elapsed_real_time elapsed_run_time ele2comp ele2polynome" + " ele2pui elem elementp elevation_grid elim elim_allbut eliminate eliminate_using" + " ellipse elliptic_e elliptic_ec elliptic_eu elliptic_f elliptic_kc elliptic_pi" + " ematrix empty_graph emptyp endcons entermatrix entertensor entier equal equalp" + " equiv_classes erf erfc erf_generalized erfi errcatch error errormsg errors" + " euler ev eval_string evenp every evolution evolution2d evundiff example exp" + " expand expandwrt expandwrt_factored expint expintegral_chi expintegral_ci" + " expintegral_e expintegral_e1 expintegral_ei expintegral_e_simplify expintegral_li" + " expintegral_shi expintegral_si explicit explose exponentialize express expt" + " exsec extdiff extract_linear_equations extremal_subset ezgcd %f f90 facsum" + " factcomb factor factorfacsum factorial factorout factorsum facts fast_central_elements" + " fast_linsolve fasttimes featurep fernfale fft fib fibtophi fifth filename_merge" + " file_search file_type fillarray findde find_root find_root_abs find_root_error" + " find_root_rel first fix flatten flength float floatnump floor flower_snark" + " flush flush1deriv flushd flushnd flush_output fmin_cobyla forget fortran" + " fourcos fourexpand fourier fourier_elim fourint fourintcos fourintsin foursimp" + " foursin fourth fposition frame_bracket freeof freshline fresnel_c fresnel_s" + " from_adjacency_matrix frucht_graph full_listify fullmap fullmapl fullratsimp" + " fullratsubst fullsetify funcsolve fundamental_dimensions fundamental_units" + " fundef funmake funp fv g0 g1 gamma gamma_greek gamma_incomplete gamma_incomplete_generalized" + " gamma_incomplete_regularized gauss gauss_a gauss_b gaussprob gcd gcdex gcdivide" + " gcfac gcfactor gd generalized_lambert_w genfact gen_laguerre genmatrix gensym" + " geo_amortization geo_annuity_fv geo_annuity_pv geomap geometric geometric_mean" + " geosum get getcurrentdirectory get_edge_weight getenv get_lu_factors get_output_stream_string" + " get_pixel get_plot_option get_tex_environment get_tex_environment_default" + " get_vertex_label gfactor gfactorsum ggf girth global_variances gn gnuplot_close" + " gnuplot_replot gnuplot_reset gnuplot_restart gnuplot_start go Gosper GosperSum" + " gr2d gr3d gradef gramschmidt graph6_decode graph6_encode graph6_export graph6_import" + " graph_center graph_charpoly graph_eigenvalues graph_flow graph_order graph_periphery" + " graph_product graph_size graph_union great_rhombicosidodecahedron_graph great_rhombicuboctahedron_graph" + " grid_graph grind grobner_basis grotzch_graph hamilton_cycle hamilton_path" + " hankel hankel_1 hankel_2 harmonic harmonic_mean hav heawood_graph hermite" + " hessian hgfred hilbertmap hilbert_matrix hipow histogram histogram_description" + " hodge horner hypergeometric i0 i1 %ibes ic1 ic2 ic_convert ichr1 ichr2 icosahedron_graph" + " icosidodecahedron_graph icurvature ident identfor identity idiff idim idummy" + " ieqn %if ifactors iframes ifs igcdex igeodesic_coords ilt image imagpart" + " imetric implicit implicit_derivative implicit_plot indexed_tensor indices" + " induced_subgraph inferencep inference_result infix info_display init_atensor" + " init_ctensor in_neighbors innerproduct inpart inprod inrt integerp integer_partitions" + " integrate intersect intersection intervalp intopois intosum invariant1 invariant2" + " inverse_fft inverse_jacobi_cd inverse_jacobi_cn inverse_jacobi_cs inverse_jacobi_dc" + " inverse_jacobi_dn inverse_jacobi_ds inverse_jacobi_nc inverse_jacobi_nd inverse_jacobi_ns" + " inverse_jacobi_sc inverse_jacobi_sd inverse_jacobi_sn invert invert_by_adjoint" + " invert_by_lu inv_mod irr is is_biconnected is_bipartite is_connected is_digraph" + " is_edge_in_graph is_graph is_graph_or_digraph ishow is_isomorphic isolate" + " isomorphism is_planar isqrt isreal_p is_sconnected is_tree is_vertex_in_graph" + " items_inference %j j0 j1 jacobi jacobian jacobi_cd jacobi_cn jacobi_cs jacobi_dc" + " jacobi_dn jacobi_ds jacobi_nc jacobi_nd jacobi_ns jacobi_p jacobi_sc jacobi_sd" + " jacobi_sn JF jn join jordan julia julia_set julia_sin %k kdels kdelta kill" + " killcontext kostka kron_delta kronecker_product kummer_m kummer_u kurtosis" + " kurtosis_bernoulli kurtosis_beta kurtosis_binomial kurtosis_chi2 kurtosis_continuous_uniform" + " kurtosis_discrete_uniform kurtosis_exp kurtosis_f kurtosis_gamma kurtosis_general_finite_discrete" + " kurtosis_geometric kurtosis_gumbel kurtosis_hypergeometric kurtosis_laplace" + " kurtosis_logistic kurtosis_lognormal kurtosis_negative_binomial kurtosis_noncentral_chi2" + " kurtosis_noncentral_student_t kurtosis_normal kurtosis_pareto kurtosis_poisson" + " kurtosis_rayleigh kurtosis_student_t kurtosis_weibull label labels lagrange" + " laguerre lambda lambert_w laplace laplacian_matrix last lbfgs lc2kdt lcharp" + " lc_l lcm lc_u ldefint ldisp ldisplay legendre_p legendre_q leinstein length" + " let letrules letsimp levi_civita lfreeof lgtreillis lhs li liediff limit" + " Lindstedt linear linearinterpol linear_program linear_regression line_graph" + " linsolve listarray list_correlations listify list_matrix_entries list_nc_monomials" + " listoftens listofvars listp lmax lmin load loadfile local locate_matrix_entry" + " log logcontract log_gamma lopow lorentz_gauge lowercasep lpart lratsubst" + " lreduce lriemann lsquares_estimates lsquares_estimates_approximate lsquares_estimates_exact" + " lsquares_mse lsquares_residual_mse lsquares_residuals lsum ltreillis lu_backsub" + " lucas lu_factor %m macroexpand macroexpand1 make_array makebox makefact makegamma" + " make_graph make_level_picture makelist makeOrders make_poly_continent make_poly_country" + " make_polygon make_random_state make_rgb_picture makeset make_string_input_stream" + " make_string_output_stream make_transform mandelbrot mandelbrot_set map mapatom" + " maplist matchdeclare matchfix mat_cond mat_fullunblocker mat_function mathml_display" + " mat_norm matrix matrixmap matrixp matrix_size mattrace mat_trace mat_unblocker" + " max max_clique max_degree max_flow maximize_lp max_independent_set max_matching" + " maybe md5sum mean mean_bernoulli mean_beta mean_binomial mean_chi2 mean_continuous_uniform" + " mean_deviation mean_discrete_uniform mean_exp mean_f mean_gamma mean_general_finite_discrete" + " mean_geometric mean_gumbel mean_hypergeometric mean_laplace mean_logistic" + " mean_lognormal mean_negative_binomial mean_noncentral_chi2 mean_noncentral_student_t" + " mean_normal mean_pareto mean_poisson mean_rayleigh mean_student_t mean_weibull" + " median median_deviation member mesh metricexpandall mgf1_sha1 min min_degree" + " min_edge_cut minfactorial minimalPoly minimize_lp minimum_spanning_tree minor" + " minpack_lsquares minpack_solve min_vertex_cover min_vertex_cut mkdir mnewton" + " mod mode_declare mode_identity ModeMatrix moebius mon2schur mono monomial_dimensions" + " multibernstein_poly multi_display_for_texinfo multi_elem multinomial multinomial_coeff" + " multi_orbit multiplot_mode multi_pui multsym multthru mycielski_graph nary" + " natural_unit nc_degree ncexpt ncharpoly negative_picture neighbors new newcontext" + " newdet new_graph newline newton new_variable next_prime nicedummies niceindices" + " ninth nofix nonarray noncentral_moment nonmetricity nonnegintegerp nonscalarp" + " nonzeroandfreeof notequal nounify nptetrad npv nroots nterms ntermst" + " nthroot nullity nullspace num numbered_boundaries numberp number_to_octets" + " num_distinct_partitions numerval numfactor num_partitions nusum nzeta nzetai" + " nzetar octets_to_number octets_to_oid odd_girth oddp ode2 ode_check odelin" + " oid_to_octets op opena opena_binary openr openr_binary openw openw_binary" + " operatorp opsubst optimize %or orbit orbits ordergreat ordergreatp orderless" + " orderlessp orthogonal_complement orthopoly_recur orthopoly_weight outermap" + " out_neighbors outofpois pade parabolic_cylinder_d parametric parametric_surface" + " parg parGosper parse_string parse_timedate part part2cont partfrac partition" + " partition_set partpol path_digraph path_graph pathname_directory pathname_name" + " pathname_type pdf_bernoulli pdf_beta pdf_binomial pdf_cauchy pdf_chi2 pdf_continuous_uniform" + " pdf_discrete_uniform pdf_exp pdf_f pdf_gamma pdf_general_finite_discrete" + " pdf_geometric pdf_gumbel pdf_hypergeometric pdf_laplace pdf_logistic pdf_lognormal" + " pdf_negative_binomial pdf_noncentral_chi2 pdf_noncentral_student_t pdf_normal" + " pdf_pareto pdf_poisson pdf_rank_sum pdf_rayleigh pdf_signed_rank pdf_student_t" + " pdf_weibull pearson_skewness permanent permut permutation permutations petersen_graph" + " petrov pickapart picture_equalp picturep piechart piechart_description planar_embedding" + " playback plog plot2d plot3d plotdf ploteq plsquares pochhammer points poisdiff" + " poisexpt poisint poismap poisplus poissimp poissubst poistimes poistrim polar" + " polarform polartorect polar_to_xy poly_add poly_buchberger poly_buchberger_criterion" + " poly_colon_ideal poly_content polydecomp poly_depends_p poly_elimination_ideal" + " poly_exact_divide poly_expand poly_expt poly_gcd polygon poly_grobner poly_grobner_equal" + " poly_grobner_member poly_grobner_subsetp poly_ideal_intersection poly_ideal_polysaturation" + " poly_ideal_polysaturation1 poly_ideal_saturation poly_ideal_saturation1 poly_lcm" + " poly_minimization polymod poly_multiply polynome2ele polynomialp poly_normal_form" + " poly_normalize poly_normalize_list poly_polysaturation_extension poly_primitive_part" + " poly_pseudo_divide poly_reduced_grobner poly_reduction poly_saturation_extension" + " poly_s_polynomial poly_subtract polytocompanion pop postfix potential power_mod" + " powerseries powerset prefix prev_prime primep primes principal_components" + " print printf printfile print_graph printpois printprops prodrac product properties" + " propvars psi psubst ptriangularize pui pui2comp pui2ele pui2polynome pui_direct" + " puireduc push put pv qput qrange qty quad_control quad_qag quad_qagi quad_qagp" + " quad_qags quad_qawc quad_qawf quad_qawo quad_qaws quadrilateral quantile" + " quantile_bernoulli quantile_beta quantile_binomial quantile_cauchy quantile_chi2" + " quantile_continuous_uniform quantile_discrete_uniform quantile_exp quantile_f" + " quantile_gamma quantile_general_finite_discrete quantile_geometric quantile_gumbel" + " quantile_hypergeometric quantile_laplace quantile_logistic quantile_lognormal" + " quantile_negative_binomial quantile_noncentral_chi2 quantile_noncentral_student_t" + " quantile_normal quantile_pareto quantile_poisson quantile_rayleigh quantile_student_t" + " quantile_weibull quartile_skewness quit qunit quotient racah_v racah_w radcan" + " radius random random_bernoulli random_beta random_binomial random_bipartite_graph" + " random_cauchy random_chi2 random_continuous_uniform random_digraph random_discrete_uniform" + " random_exp random_f random_gamma random_general_finite_discrete random_geometric" + " random_graph random_graph1 random_gumbel random_hypergeometric random_laplace" + " random_logistic random_lognormal random_negative_binomial random_network" + " random_noncentral_chi2 random_noncentral_student_t random_normal random_pareto" + " random_permutation random_poisson random_rayleigh random_regular_graph random_student_t" + " random_tournament random_tree random_weibull range rank rat ratcoef ratdenom" + " ratdiff ratdisrep ratexpand ratinterpol rational rationalize ratnumer ratnump" + " ratp ratsimp ratsubst ratvars ratweight read read_array read_binary_array" + " read_binary_list read_binary_matrix readbyte readchar read_hashed_array readline" + " read_list read_matrix read_nested_list readonly read_xpm real_imagpart_to_conjugate" + " realpart realroots rearray rectangle rectform rectform_log_if_constant recttopolar" + " rediff reduce_consts reduce_order region region_boundaries region_boundaries_plus" + " rem remainder remarray rembox remcomps remcon remcoord remfun remfunction" + " remlet remove remove_constvalue remove_dimensions remove_edge remove_fundamental_dimensions" + " remove_fundamental_units remove_plot_option remove_vertex rempart remrule" + " remsym remvalue rename rename_file reset reset_displays residue resolvante" + " resolvante_alternee1 resolvante_bipartite resolvante_diedrale resolvante_klein" + " resolvante_klein3 resolvante_produit_sym resolvante_unitaire resolvante_vierer" + " rest resultant return reveal reverse revert revert2 rgb2level rhs ricci riemann" + " rinvariant risch rk rmdir rncombine romberg room rootscontract round row" + " rowop rowswap rreduce run_testsuite %s save saving scalarp scaled_bessel_i" + " scaled_bessel_i0 scaled_bessel_i1 scalefactors scanmap scatterplot scatterplot_description" + " scene schur2comp sconcat scopy scsimp scurvature sdowncase sec sech second" + " sequal sequalignore set_alt_display setdifference set_draw_defaults set_edge_weight" + " setelmx setequalp setify setp set_partitions set_plot_option set_prompt set_random_state" + " set_tex_environment set_tex_environment_default setunits setup_autoload set_up_dot_simplifications" + " set_vertex_label seventh sexplode sf sha1sum sha256sum shortest_path shortest_weighted_path" + " show showcomps showratvars sierpinskiale sierpinskimap sign signum similaritytransform" + " simp_inequality simplify_sum simplode simpmetderiv simtran sin sinh sinsert" + " sinvertcase sixth skewness skewness_bernoulli skewness_beta skewness_binomial" + " skewness_chi2 skewness_continuous_uniform skewness_discrete_uniform skewness_exp" + " skewness_f skewness_gamma skewness_general_finite_discrete skewness_geometric" + " skewness_gumbel skewness_hypergeometric skewness_laplace skewness_logistic" + " skewness_lognormal skewness_negative_binomial skewness_noncentral_chi2 skewness_noncentral_student_t" + " skewness_normal skewness_pareto skewness_poisson skewness_rayleigh skewness_student_t" + " skewness_weibull slength smake small_rhombicosidodecahedron_graph small_rhombicuboctahedron_graph" + " smax smin smismatch snowmap snub_cube_graph snub_dodecahedron_graph solve" + " solve_rec solve_rec_rat some somrac sort sparse6_decode sparse6_encode sparse6_export" + " sparse6_import specint spherical spherical_bessel_j spherical_bessel_y spherical_hankel1" + " spherical_hankel2 spherical_harmonic spherical_to_xyz splice split sposition" + " sprint sqfr sqrt sqrtdenest sremove sremovefirst sreverse ssearch ssort sstatus" + " ssubst ssubstfirst staircase standardize standardize_inverse_trig starplot" + " starplot_description status std std1 std_bernoulli std_beta std_binomial" + " std_chi2 std_continuous_uniform std_discrete_uniform std_exp std_f std_gamma" + " std_general_finite_discrete std_geometric std_gumbel std_hypergeometric std_laplace" + " std_logistic std_lognormal std_negative_binomial std_noncentral_chi2 std_noncentral_student_t" + " std_normal std_pareto std_poisson std_rayleigh std_student_t std_weibull" + " stemplot stirling stirling1 stirling2 strim striml strimr string stringout" + " stringp strong_components struve_h struve_l sublis sublist sublist_indices" + " submatrix subsample subset subsetp subst substinpart subst_parallel substpart" + " substring subvar subvarp sum sumcontract summand_to_rec supcase supcontext" + " symbolp symmdifference symmetricp system take_channel take_inference tan" + " tanh taylor taylorinfo taylorp taylor_simplifier taytorat tcl_output tcontract" + " tellrat tellsimp tellsimpafter tentex tenth test_mean test_means_difference" + " test_normality test_proportion test_proportions_difference test_rank_sum" + " test_sign test_signed_rank test_variance test_variance_ratio tex tex1 tex_display" + " texput %th third throw time timedate timer timer_info tldefint tlimit todd_coxeter" + " toeplitz tokens to_lisp topological_sort to_poly to_poly_solve totaldisrep" + " totalfourier totient tpartpol trace tracematrix trace_options transform_sample" + " translate translate_file transpose treefale tree_reduce treillis treinat" + " triangle triangularize trigexpand trigrat trigreduce trigsimp trunc truncate" + " truncated_cube_graph truncated_dodecahedron_graph truncated_icosahedron_graph" + " truncated_tetrahedron_graph tr_warnings_get tube tutte_graph ueivects uforget" + " ultraspherical underlying_graph undiff union unique uniteigenvectors unitp" + " units unit_step unitvector unorder unsum untellrat untimer" + " untrace uppercasep uricci uriemann uvect vandermonde_matrix var var1 var_bernoulli" + " var_beta var_binomial var_chi2 var_continuous_uniform var_discrete_uniform" + " var_exp var_f var_gamma var_general_finite_discrete var_geometric var_gumbel" + " var_hypergeometric var_laplace var_logistic var_lognormal var_negative_binomial" + " var_noncentral_chi2 var_noncentral_student_t var_normal var_pareto var_poisson" + " var_rayleigh var_student_t var_weibull vector vectorpotential vectorsimp" + " verbify vers vertex_coloring vertex_connectivity vertex_degree vertex_distance" + " vertex_eccentricity vertex_in_degree vertex_out_degree vertices vertices_to_cycle" + " vertices_to_path %w weyl wheel_graph wiener_index wigner_3j wigner_6j" + " wigner_9j with_stdout write_binary_data writebyte write_data writefile wronskian" + " xreduce xthru %y Zeilberger zeroequiv zerofor zeromatrix zeromatrixp zeta" + " zgeev zheev zlange zn_add_table zn_carmichael_lambda zn_characteristic_factors" + " zn_determinant zn_factor_generators zn_invert_by_lu zn_log zn_mult_table" + " absboxchar activecontexts adapt_depth additive adim aform algebraic" + " algepsilon algexact aliases allbut all_dotsimp_denoms allocation allsym alphabetic" + " animation antisymmetric arrays askexp assume_pos assume_pos_pred assumescalar" + " asymbol atomgrad atrig1 axes axis_3d axis_bottom axis_left axis_right axis_top" + " azimuth background background_color backsubst berlefact bernstein_explicit" + " besselexpand beta_args_sum_to_integer beta_expand bftorat bftrunc bindtest" + " border boundaries_array box boxchar breakup %c capping cauchysum cbrange" + " cbtics center cflength cframe_flag cnonmet_flag color color_bar color_bar_tics" + " colorbox columns commutative complex cone context contexts contour contour_levels" + " cosnpiflag ctaypov ctaypt ctayswitch ctayvar ct_coords ctorsion_flag ctrgsimp" + " cube current_let_rule_package cylinder data_file_name debugmode decreasing" + " default_let_rule_package delay dependencies derivabbrev derivsubst detout" + " diagmetric diff dim dimensions dispflag display2d|10 display_format_internal" + " distribute_over doallmxops domain domxexpt domxmxops domxnctimes dontfactor" + " doscmxops doscmxplus dot0nscsimp dot0simp dot1simp dotassoc dotconstrules" + " dotdistrib dotexptsimp dotident dotscrules draw_graph_program draw_realpart" + " edge_color edge_coloring edge_partition edge_type edge_width %edispflag" + " elevation %emode endphi endtheta engineering_format_floats enhanced3d %enumer" + " epsilon_lp erfflag erf_representation errormsg error_size error_syms error_type" + " %e_to_numlog eval even evenfun evflag evfun ev_point expandwrt_denom expintexpand" + " expintrep expon expop exptdispflag exptisolate exptsubst facexpand facsum_combine" + " factlim factorflag factorial_expand factors_only fb feature features" + " file_name file_output_append file_search_demo file_search_lisp file_search_maxima|10" + " file_search_tests file_search_usage file_type_lisp file_type_maxima|10 fill_color" + " fill_density filled_func fixed_vertices flipflag float2bf font font_size" + " fortindent fortspaces fpprec fpprintprec functions gamma_expand gammalim" + " gdet genindex gensumnum GGFCFMAX GGFINFINITY globalsolve gnuplot_command" + " gnuplot_curve_styles gnuplot_curve_titles gnuplot_default_term_command gnuplot_dumb_term_command" + " gnuplot_file_args gnuplot_file_name gnuplot_out_file gnuplot_pdf_term_command" + " gnuplot_pm3d gnuplot_png_term_command gnuplot_postamble gnuplot_preamble" + " gnuplot_ps_term_command gnuplot_svg_term_command gnuplot_term gnuplot_view_args" + " Gosper_in_Zeilberger gradefs grid grid2d grind halfangles head_angle head_both" + " head_length head_type height hypergeometric_representation %iargs ibase" + " icc1 icc2 icounter idummyx ieqnprint ifb ifc1 ifc2 ifg ifgi ifr iframe_bracket_form" + " ifri igeowedge_flag ikt1 ikt2 imaginary inchar increasing infeval" + " infinity inflag infolists inm inmc1 inmc2 intanalysis integer integervalued" + " integrate_use_rootsof integration_constant integration_constant_counter interpolate_color" + " intfaclim ip_grid ip_grid_in irrational isolate_wrt_times iterations itr" + " julia_parameter %k1 %k2 keepfloat key key_pos kinvariant kt label label_alignment" + " label_orientation labels lassociative lbfgs_ncorrections lbfgs_nfeval_max" + " leftjust legend letrat let_rule_packages lfg lg lhospitallim limsubst linear" + " linear_solver linechar linel|10 linenum line_type linewidth line_width linsolve_params" + " linsolvewarn lispdisp listarith listconstvars listdummyvars lmxchar load_pathname" + " loadprint logabs logarc logcb logconcoeffp logexpand lognegint logsimp logx" + " logx_secondary logy logy_secondary logz lriem m1pbranch macroexpansion macros" + " mainvar manual_demo maperror mapprint matrix_element_add matrix_element_mult" + " matrix_element_transpose maxapplydepth maxapplyheight maxima_tempdir|10 maxima_userdir|10" + " maxnegex MAX_ORD maxposex maxpsifracdenom maxpsifracnum maxpsinegint maxpsiposint" + " maxtayorder mesh_lines_color method mod_big_prime mode_check_errorp" + " mode_checkp mode_check_warnp mod_test mod_threshold modular_linear_solver" + " modulus multiplicative multiplicities myoptions nary negdistrib negsumdispflag" + " newline newtonepsilon newtonmaxiter nextlayerfactor niceindicespref nm nmc" + " noeval nolabels nonegative_lp noninteger nonscalar noun noundisp nouns np" + " npi nticks ntrig numer numer_pbranch obase odd oddfun opacity opproperties" + " opsubst optimprefix optionset orientation origin orthopoly_returns_intervals" + " outative outchar packagefile palette partswitch pdf_file pfeformat phiresolution" + " %piargs piece pivot_count_sx pivot_max_sx plot_format plot_options plot_realpart" + " png_file pochhammer_max_index points pointsize point_size points_joined point_type" + " poislim poisson poly_coefficient_ring poly_elimination_order polyfactor poly_grobner_algorithm" + " poly_grobner_debug poly_monomial_order poly_primary_elimination_order poly_return_term_list" + " poly_secondary_elimination_order poly_top_reduction_only posfun position" + " powerdisp pred prederror primep_number_of_tests product_use_gamma program" + " programmode promote_float_to_bigfloat prompt proportional_axes props psexpand" + " ps_file radexpand radius radsubstflag rassociative ratalgdenom ratchristof" + " ratdenomdivide rateinstein ratepsilon ratfac rational ratmx ratprint ratriemann" + " ratsimpexpons ratvarswitch ratweights ratweyl ratwtlvl real realonly redraw" + " refcheck resolution restart resultant ric riem rmxchar %rnum_list rombergabs" + " rombergit rombergmin rombergtol rootsconmode rootsepsilon run_viewer same_xy" + " same_xyz savedef savefactors scalar scalarmatrixp scale scale_lp setcheck" + " setcheckbreak setval show_edge_color show_edges show_edge_type show_edge_width" + " show_id show_label showtime show_vertex_color show_vertex_size show_vertex_type" + " show_vertices show_weight simp simplified_output simplify_products simpproduct" + " simpsum sinnpiflag solvedecomposes solveexplicit solvefactors solvenullwarn" + " solveradcan solvetrigwarn space sparse sphere spring_embedding_depth sqrtdispflag" + " stardisp startphi starttheta stats_numer stringdisp structures style sublis_apply_lambda" + " subnumsimp sumexpand sumsplitfact surface surface_hide svg_file symmetric" + " tab taylordepth taylor_logexpand taylor_order_coefficients taylor_truncate_polynomials" + " tensorkill terminal testsuite_files thetaresolution timer_devalue title tlimswitch" + " tr track transcompile transform transform_xy translate_fast_arrays transparent" + " transrun tr_array_as_ref tr_bound_function_applyp tr_file_tty_messagesp tr_float_can_branch_complex" + " tr_function_call_default trigexpandplus trigexpandtimes triginverses trigsign" + " trivial_solutions tr_numer tr_optimize_max_loop tr_semicompile tr_state_vars" + " tr_warn_bad_function_calls tr_warn_fexpr tr_warn_meval tr_warn_mode" + " tr_warn_undeclared tr_warn_undefined_variable tstep ttyoff tube_extremes" + " ufg ug %unitexpand unit_vectors uric uriem use_fast_arrays user_preamble" + " usersetunits values vect_cross verbose vertex_color vertex_coloring vertex_partition" + " vertex_size vertex_type view warnings weyl width windowname windowtitle wired_surface" + " wireframe xaxis xaxis_color xaxis_secondary xaxis_type xaxis_width xlabel" + " xlabel_secondary xlength xrange xrange_secondary xtics xtics_axis xtics_rotate" + " xtics_rotate_secondary xtics_secondary xtics_secondary_axis xu_grid x_voxel" + " xy_file xyplane xy_scale yaxis yaxis_color yaxis_secondary yaxis_type yaxis_width" + " ylabel ylabel_secondary ylength yrange yrange_secondary ytics ytics_axis" + " ytics_rotate ytics_rotate_secondary ytics_secondary ytics_secondary_axis" + " yv_grid y_voxel yx_ratio zaxis zaxis_color zaxis_type zaxis_width zeroa zerob" + " zerobern zeta%pi zlabel zlabel_rotate zlength zmin zn_primroot_limit zn_primroot_pretest"; const SYMBOLS = "_ __ %|0 %%|0"; return { name: "Maxima", keywords: { $pattern: "[A-Za-z_%][0-9A-Za-z_%]*", - keyword: KEYWORDS$6, - literal: LITERALS$6, + keyword: KEYWORDS$2, + literal: LITERALS$2, built_in: BUILTIN_FUNCTIONS, symbol: SYMBOLS }, @@ -168781,7 +168985,7 @@ var require_maxima = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\\*/", contains: ["self"] }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "number", relevance: 0, @@ -168805,24 +169009,24 @@ var require_maxima = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/mel.js var require_mel = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function mel(hljs$1) { + function mel(hljs) { return { name: "MEL", keywords: "int float string vector matrix if else switch case default while do for in break " + "continue global proc return about abs addAttr addAttributeEditorNodeHelp addDynamic " + "addNewShelfTab addPP addPanelCategory addPrefixToName advanceToNextDrivenKey " + "affectedNet affects aimConstraint air alias aliasAttr align alignCtx alignCurve " + "alignSurface allViewFit ambientLight angle angleBetween animCone animCurveEditor " + "animDisplay animView annotate appendStringArray applicationName applyAttrPreset " + "applyTake arcLenDimContext arcLengthDimension arclen arrayMapper art3dPaintCtx " + "artAttrCtx artAttrPaintVertexCtx artAttrSkinPaintCtx artAttrTool artBuildPaintMenu " + "artFluidAttrCtx artPuttyCtx artSelectCtx artSetPaintCtx artUserPaintCtx assignCommand " + "assignInputDevice assignViewportFactories attachCurve attachDeviceAttr attachSurface " + "attrColorSliderGrp attrCompatibility attrControlGrp attrEnumOptionMenu " + "attrEnumOptionMenuGrp attrFieldGrp attrFieldSliderGrp attrNavigationControlGrp " + "attrPresetEditWin attributeExists attributeInfo attributeMenu attributeQuery " + "autoKeyframe autoPlace bakeClip bakeFluidShading bakePartialHistory bakeResults " + "bakeSimulation basename basenameEx batchRender bessel bevel bevelPlus binMembership " + "bindSkin blend2 blendShape blendShapeEditor blendShapePanel blendTwoAttr blindDataType " + "boneLattice boundary boxDollyCtx boxZoomCtx bufferCurve buildBookmarkMenu " + "buildKeyframeMenu button buttonManip CBG cacheFile cacheFileCombine cacheFileMerge " + "cacheFileTrack camera cameraView canCreateManip canvas capitalizeString catch " + "catchQuiet ceil changeSubdivComponentDisplayLevel changeSubdivRegion channelBox " + "character characterMap characterOutlineEditor characterize chdir checkBox checkBoxGrp " + "checkDefaultRenderGlobals choice circle circularFillet clamp clear clearCache clip " + "clipEditor clipEditorCurrentTimeCtx clipSchedule clipSchedulerOutliner clipTrimBefore " + "closeCurve closeSurface cluster cmdFileOutput cmdScrollFieldExecuter " + "cmdScrollFieldReporter cmdShell coarsenSubdivSelectionList collision color " + "colorAtPoint colorEditor colorIndex colorIndexSliderGrp colorSliderButtonGrp " + "colorSliderGrp columnLayout commandEcho commandLine commandPort compactHairSystem " + "componentEditor compositingInterop computePolysetVolume condition cone confirmDialog " + "connectAttr connectControl connectDynamic connectJoint connectionInfo constrain " + "constrainValue constructionHistory container containsMultibyte contextInfo control " + "convertFromOldLayers convertIffToPsd convertLightmap convertSolidTx convertTessellation " + "convertUnit copyArray copyFlexor copyKey copySkinWeights cos cpButton cpCache " + "cpClothSet cpCollision cpConstraint cpConvClothToMesh cpForces cpGetSolverAttr cpPanel " + "cpProperty cpRigidCollisionFilter cpSeam cpSetEdit cpSetSolverAttr cpSolver " + "cpSolverTypes cpTool cpUpdateClothUVs createDisplayLayer createDrawCtx createEditor " + "createLayeredPsdFile createMotionField createNewShelf createNode createRenderLayer " + "createSubdivRegion cross crossProduct ctxAbort ctxCompletion ctxEditMode ctxTraverse " + "currentCtx currentTime currentTimeCtx currentUnit curve curveAddPtCtx " + "curveCVCtx curveEPCtx curveEditorCtx curveIntersect curveMoveEPCtx curveOnSurface " + "curveSketchCtx cutKey cycleCheck cylinder dagPose date defaultLightListCheckBox " + "defaultNavigation defineDataServer defineVirtualDevice deformer deg_to_rad delete " + "deleteAttr deleteShadingGroupsAndMaterials deleteShelfTab deleteUI deleteUnusedBrushes " + "delrandstr detachCurve detachDeviceAttr detachSurface deviceEditor devicePanel dgInfo " + "dgdirty dgeval dgtimer dimWhen directKeyCtx directionalLight dirmap dirname disable " + "disconnectAttr disconnectJoint diskCache displacementToPoly displayAffected " + "displayColor displayCull displayLevelOfDetail displayPref displayRGBColor " + "displaySmoothness displayStats displayString displaySurface distanceDimContext " + "distanceDimension doBlur dolly dollyCtx dopeSheetEditor dot dotProduct " + "doubleProfileBirailSurface drag dragAttrContext draggerContext dropoffLocator " + "duplicate duplicateCurve duplicateSurface dynCache dynControl dynExport dynExpression " + "dynGlobals dynPaintEditor dynParticleCtx dynPref dynRelEdPanel dynRelEditor " + "dynamicLoad editAttrLimits editDisplayLayerGlobals editDisplayLayerMembers " + "editRenderLayerAdjustment editRenderLayerGlobals editRenderLayerMembers editor " + "editorTemplate effector emit emitter enableDevice encodeString endString endsWith env " + "equivalent equivalentTol erf error eval evalDeferred evalEcho event " + "exactWorldBoundingBox exclusiveLightCheckBox exec executeForEachObject exists exp " + "expression expressionEditorListen extendCurve extendSurface extrude fcheck fclose feof " + "fflush fgetline fgetword file fileBrowserDialog fileDialog fileExtension fileInfo " + "filetest filletCurve filter filterCurve filterExpand filterStudioImport " + "findAllIntersections findAnimCurves findKeyframe findMenuItem findRelatedSkinCluster " + "finder firstParentOf fitBspline flexor floatEq floatField floatFieldGrp floatScrollBar " + "floatSlider floatSlider2 floatSliderButtonGrp floatSliderGrp floor flow fluidCacheInfo " + "fluidEmitter fluidVoxelInfo flushUndo fmod fontDialog fopen formLayout format fprint " + "frameLayout fread freeFormFillet frewind fromNativePath fwrite gamma gauss " + "geometryConstraint getApplicationVersionAsFloat getAttr getClassification " + "getDefaultBrush getFileList getFluidAttr getInputDeviceRange getMayaPanelTypes " + "getModifiers getPanel getParticleAttr getPluginResource getenv getpid glRender " + "glRenderEditor globalStitch gmatch goal gotoBindPose grabColor gradientControl " + "gradientControlNoAttr graphDollyCtx graphSelectContext graphTrackCtx gravity grid " + "gridLayout group groupObjectsByName HfAddAttractorToAS HfAssignAS HfBuildEqualMap " + "HfBuildFurFiles HfBuildFurImages HfCancelAFR HfConnectASToHF HfCreateAttractor " + "HfDeleteAS HfEditAS HfPerformCreateAS HfRemoveAttractorFromAS HfSelectAttached " + "HfSelectAttractors HfUnAssignAS hardenPointCurve hardware hardwareRenderPanel " + "headsUpDisplay headsUpMessage help helpLine hermite hide hilite hitTest hotBox hotkey " + "hotkeyCheck hsv_to_rgb hudButton hudSlider hudSliderButton hwReflectionMap hwRender " + "hwRenderLoad hyperGraph hyperPanel hyperShade hypot iconTextButton iconTextCheckBox " + "iconTextRadioButton iconTextRadioCollection iconTextScrollList iconTextStaticLabel " + "ikHandle ikHandleCtx ikHandleDisplayScale ikSolver ikSplineHandleCtx ikSystem " + "ikSystemInfo ikfkDisplayMethod illustratorCurves image imfPlugins inheritTransform " + "insertJoint insertJointCtx insertKeyCtx insertKnotCurve insertKnotSurface instance " + "instanceable instancer intField intFieldGrp intScrollBar intSlider intSliderGrp " + "interToUI internalVar intersect iprEngine isAnimCurve isConnected isDirty isParentOf " + "isSameObject isTrue isValidObjectName isValidString isValidUiName isolateSelect " + "itemFilter itemFilterAttr itemFilterRender itemFilterType joint jointCluster jointCtx " + "jointDisplayScale jointLattice keyTangent keyframe keyframeOutliner " + "keyframeRegionCurrentTimeCtx keyframeRegionDirectKeyCtx keyframeRegionDollyCtx " + "keyframeRegionInsertKeyCtx keyframeRegionMoveKeyCtx keyframeRegionScaleKeyCtx " + "keyframeRegionSelectKeyCtx keyframeRegionSetKeyCtx keyframeRegionTrackCtx " + "keyframeStats lassoContext lattice latticeDeformKeyCtx launch launchImageEditor " + "layerButton layeredShaderPort layeredTexturePort layout layoutDialog lightList " + "lightListEditor lightListPanel lightlink lineIntersection linearPrecision linstep " + "listAnimatable listAttr listCameras listConnections listDeviceAttachments listHistory " + "listInputDeviceAxes listInputDeviceButtons listInputDevices listMenuAnnotation " + "listNodeTypes listPanelCategories listRelatives listSets listTransforms " + "listUnselected listerEditor loadFluid loadNewShelf loadPlugin " + "loadPluginLanguageResources loadPrefObjects localizedPanelLabel lockNode loft log " + "longNameOf lookThru ls lsThroughFilter lsType lsUI Mayatomr mag makeIdentity makeLive " + "makePaintable makeRoll makeSingleSurface makeTubeOn makebot manipMoveContext " + "manipMoveLimitsCtx manipOptions manipRotateContext manipRotateLimitsCtx " + "manipScaleContext manipScaleLimitsCtx marker match max memory menu menuBarLayout " + "menuEditor menuItem menuItemToShelf menuSet menuSetPref messageLine min minimizeApp " + "mirrorJoint modelCurrentTimeCtx modelEditor modelPanel mouse movIn movOut move " + "moveIKtoFK moveKeyCtx moveVertexAlongDirection multiProfileBirailSurface mute " + "nParticle nameCommand nameField namespace namespaceInfo newPanelItems newton nodeCast " + "nodeIconButton nodeOutliner nodePreset nodeType noise nonLinear normalConstraint " + "normalize nurbsBoolean nurbsCopyUVSet nurbsCube nurbsEditUV nurbsPlane nurbsSelect " + "nurbsSquare nurbsToPoly nurbsToPolygonsPref nurbsToSubdiv nurbsToSubdivPref " + "nurbsUVSet nurbsViewDirectionVector objExists objectCenter objectLayer objectType " + "objectTypeUI obsoleteProc oceanNurbsPreviewPlane offsetCurve offsetCurveOnSurface " + "offsetSurface openGLExtension openMayaPref optionMenu optionMenuGrp optionVar orbit " + "orbitCtx orientConstraint outlinerEditor outlinerPanel overrideModifier " + "paintEffectsDisplay pairBlend palettePort paneLayout panel panelConfiguration " + "panelHistory paramDimContext paramDimension paramLocator parent parentConstraint " + "particle particleExists particleInstancer particleRenderInfo partition pasteKey " + "pathAnimation pause pclose percent performanceOptions pfxstrokes pickWalk picture " + "pixelMove planarSrf plane play playbackOptions playblast plugAttr plugNode pluginInfo " + "pluginResourceUtil pointConstraint pointCurveConstraint pointLight pointMatrixMult " + "pointOnCurve pointOnSurface pointPosition poleVectorConstraint polyAppend " + "polyAppendFacetCtx polyAppendVertex polyAutoProjection polyAverageNormal " + "polyAverageVertex polyBevel polyBlendColor polyBlindData polyBoolOp polyBridgeEdge " + "polyCacheMonitor polyCheck polyChipOff polyClipboard polyCloseBorder polyCollapseEdge " + "polyCollapseFacet polyColorBlindData polyColorDel polyColorPerVertex polyColorSet " + "polyCompare polyCone polyCopyUV polyCrease polyCreaseCtx polyCreateFacet " + "polyCreateFacetCtx polyCube polyCut polyCutCtx polyCylinder polyCylindricalProjection " + "polyDelEdge polyDelFacet polyDelVertex polyDuplicateAndConnect polyDuplicateEdge " + "polyEditUV polyEditUVShell polyEvaluate polyExtrudeEdge polyExtrudeFacet " + "polyExtrudeVertex polyFlipEdge polyFlipUV polyForceUV polyGeoSampler polyHelix " + "polyInfo polyInstallAction polyLayoutUV polyListComponentConversion polyMapCut " + "polyMapDel polyMapSew polyMapSewMove polyMergeEdge polyMergeEdgeCtx polyMergeFacet " + "polyMergeFacetCtx polyMergeUV polyMergeVertex polyMirrorFace polyMoveEdge " + "polyMoveFacet polyMoveFacetUV polyMoveUV polyMoveVertex polyNormal polyNormalPerVertex " + "polyNormalizeUV polyOptUvs polyOptions polyOutput polyPipe polyPlanarProjection " + "polyPlane polyPlatonicSolid polyPoke polyPrimitive polyPrism polyProjection " + "polyPyramid polyQuad polyQueryBlindData polyReduce polySelect polySelectConstraint " + "polySelectConstraintMonitor polySelectCtx polySelectEditCtx polySeparate " + "polySetToFaceNormal polySewEdge polyShortestPathCtx polySmooth polySoftEdge " + "polySphere polySphericalProjection polySplit polySplitCtx polySplitEdge polySplitRing " + "polySplitVertex polyStraightenUVBorder polySubdivideEdge polySubdivideFacet " + "polyToSubdiv polyTorus polyTransfer polyTriangulate polyUVSet polyUnite polyWedgeFace " + "popen popupMenu pose pow preloadRefEd print progressBar progressWindow projFileViewer " + "projectCurve projectTangent projectionContext projectionManip promptDialog propModCtx " + "propMove psdChannelOutliner psdEditTextureFile psdExport psdTextureFile putenv pwd " + "python querySubdiv quit rad_to_deg radial radioButton radioButtonGrp radioCollection " + "radioMenuItemCollection rampColorPort rand randomizeFollicles randstate rangeControl " + "readTake rebuildCurve rebuildSurface recordAttr recordDevice redo reference " + "referenceEdit referenceQuery refineSubdivSelectionList refresh refreshAE " + "registerPluginResource rehash reloadImage removeJoint removeMultiInstance " + "removePanelCategory rename renameAttr renameSelectionList renameUI render " + "renderGlobalsNode renderInfo renderLayerButton renderLayerParent " + "renderLayerPostProcess renderLayerUnparent renderManip renderPartition " + "renderQualityNode renderSettings renderThumbnailUpdate renderWindowEditor " + "renderWindowSelectContext renderer reorder reorderDeformers requires reroot " + "resampleFluid resetAE resetPfxToPolyCamera resetTool resolutionNode retarget " + "reverseCurve reverseSurface revolve rgb_to_hsv rigidBody rigidSolver roll rollCtx " + "rootOf rot rotate rotationInterpolation roundConstantRadius rowColumnLayout rowLayout " + "runTimeCommand runup sampleImage saveAllShelves saveAttrPreset saveFluid saveImage " + "saveInitialState saveMenu savePrefObjects savePrefs saveShelf saveToolSettings scale " + "scaleBrushBrightness scaleComponents scaleConstraint scaleKey scaleKeyCtx sceneEditor " + "sceneUIReplacement scmh scriptCtx scriptEditorInfo scriptJob scriptNode scriptTable " + "scriptToShelf scriptedPanel scriptedPanelType scrollField scrollLayout sculpt " + "searchPathArray seed selLoadSettings select selectContext selectCurveCV selectKey " + "selectKeyCtx selectKeyframeRegionCtx selectMode selectPref selectPriority selectType " + "selectedNodes selectionConnection separator setAttr setAttrEnumResource " + "setAttrMapping setAttrNiceNameResource setConstraintRestPosition " + "setDefaultShadingGroup setDrivenKeyframe setDynamic setEditCtx setEditor setFluidAttr " + "setFocus setInfinity setInputDeviceMapping setKeyCtx setKeyPath setKeyframe " + "setKeyframeBlendshapeTargetWts setMenuMode setNodeNiceNameResource setNodeTypeFlag " + "setParent setParticleAttr setPfxToPolyCamera setPluginResource setProject " + "setStampDensity setStartupMessage setState setToolTo setUITemplate setXformManip sets " + "shadingConnection shadingGeometryRelCtx shadingLightRelCtx shadingNetworkCompare " + "shadingNode shapeCompare shelfButton shelfLayout shelfTabLayout shellField " + "shortNameOf showHelp showHidden showManipCtx showSelectionInTitle " + "showShadingGroupAttrEditor showWindow sign simplify sin singleProfileBirailSurface " + "size sizeBytes skinCluster skinPercent smoothCurve smoothTangentSurface smoothstep " + "snap2to2 snapKey snapMode snapTogetherCtx snapshot soft softMod softModCtx sort sound " + "soundControl source spaceLocator sphere sphrand spotLight spotLightPreviewPort " + "spreadSheetEditor spring sqrt squareSurface srtContext stackTrace startString " + "startsWith stitchAndExplodeShell stitchSurface stitchSurfacePoints strcmp " + "stringArrayCatenate stringArrayContains stringArrayCount stringArrayInsertAtIndex " + "stringArrayIntersector stringArrayRemove stringArrayRemoveAtIndex " + "stringArrayRemoveDuplicates stringArrayRemoveExact stringArrayToString " + "stringToStringArray strip stripPrefixFromName stroke subdAutoProjection " + "subdCleanTopology subdCollapse subdDuplicateAndConnect subdEditUV " + "subdListComponentConversion subdMapCut subdMapSewMove subdMatchTopology subdMirror " + "subdToBlind subdToPoly subdTransferUVsToCache subdiv subdivCrease " + "subdivDisplaySmoothness substitute substituteAllString substituteGeometry substring " + "surface surfaceSampler surfaceShaderList swatchDisplayPort switchTable symbolButton " + "symbolCheckBox sysFile system tabLayout tan tangentConstraint texLatticeDeformContext " + "texManipContext texMoveContext texMoveUVShellContext texRotateContext texScaleContext " + "texSelectContext texSelectShortestPathCtx texSmudgeUVContext texWinToolCtx text " + "textCurves textField textFieldButtonGrp textFieldGrp textManip textScrollList " + "textToShelf textureDisplacePlane textureHairColor texturePlacementContext " + "textureWindow threadCount threePointArcCtx timeControl timePort timerX toNativePath " + "toggle toggleAxis toggleWindowVisibility tokenize tokenizeList tolerance tolower " + "toolButton toolCollection toolDropped toolHasOptions toolPropertyWindow torus toupper " + "trace track trackCtx transferAttributes transformCompare transformLimits translator " + "trim trunc truncateFluidCache truncateHairCache tumble tumbleCtx turbulence " + "twoPointArcCtx uiRes uiTemplate unassignInputDevice undo undoInfo ungroup uniform unit " + "unloadPlugin untangleUV untitledFileName untrim upAxis updateAE userCtx uvLink " + "uvSnapshot validateShelfName vectorize view2dToolCtx viewCamera viewClipPlane " + "viewFit viewHeadOn viewLookAt viewManip viewPlace viewSet visor volumeAxis vortex " + "waitCursor warning webBrowser webBrowserPrefs whatIs window windowPref wire " + "wireContext workspace wrinkle wrinkleContext writeTake xbmLangPathList xform", illegal: " { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/mercury.js var require_mercury = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function mercury(hljs$1) { - const KEYWORDS$6 = { + function mercury(hljs) { + const KEYWORDS$2 = { keyword: "module use_module import_module include_module end_module initialise " + "mutable initialize finalize finalise interface implementation pred " + "mode func type inst solver any_pred any_func is semidet det nondet " + "multi erroneous failure cc_nondet cc_multi typeclass instance where " + "pragma promise external trace atomic or_else require_complete_switch " + "require_det require_semidet require_multi require_nondet " + "require_cc_multi require_cc_nondet require_erroneous require_failure", meta: "inline no_inline type_spec source_file fact_table obsolete memo " + "loop_check minimal_model terminates does_not_terminate " + "check_termination promise_equivalent_clauses " + "foreign_proc foreign_decl foreign_code foreign_type " + "foreign_import_module foreign_export_enum foreign_export " + "foreign_enum may_call_mercury will_not_call_mercury thread_safe " + "not_thread_safe maybe_thread_safe promise_pure promise_semipure " + "tabled_for_io local untrailed trailed attach_to_io_state " + "can_pass_as_mercury_type stable will_not_throw_exception " + "may_modify_trail will_not_modify_trail may_duplicate " + "may_not_duplicate affects_liveness does_not_affect_liveness " + "doesnt_affect_liveness no_sharing unknown_sharing sharing", built_in: "some all not if then else true fail false try catch catch_any " + "semidet_true semidet_false semidet_fail impure_true impure semipure" }; - const COMMENT$2 = hljs$1.COMMENT("%", "$"); + const COMMENT = hljs.COMMENT("%", "$"); const NUMCODE = { className: "number", begin: "0'.\\|0[box][0-9a-fA-F]*" }; - const ATOM = hljs$1.inherit(hljs$1.APOS_STRING_MODE, { relevance: 0 }); - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { relevance: 0 }); + const ATOM = hljs.inherit(hljs.APOS_STRING_MODE, { relevance: 0 }); + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { relevance: 0 }); const STRING_FMT = { className: "subst", begin: "\\\\[abfnrtv]\\|\\\\x[0-9a-fA-F]*\\\\\\|%[-+# *.0-9]*[dioxXucsfeEgGp]", @@ -168878,14 +169082,14 @@ var require_mercury = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Mercury", aliases: ["m", "moo"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ IMPLICATION, HEAD_BODY_CONJUNCTION, - COMMENT$2, - hljs$1.C_BLOCK_COMMENT_MODE, + COMMENT, + hljs.C_BLOCK_COMMENT_MODE, NUMCODE, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, ATOM, STRING, { begin: /:-/ }, @@ -168899,13 +169103,13 @@ var require_mercury = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/mipsasm.js var require_mipsasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function mipsasm(hljs$1) { + function mipsasm(hljs) { return { name: "MIPS Assembly", case_insensitive: true, aliases: ["mips"], keywords: { - $pattern: "\\.?" + hljs$1.IDENT_RE, + $pattern: "\\.?" + hljs.IDENT_RE, meta: ".2byte .4byte .align .ascii .asciz .balign .byte .code .data .else .end .endif .endm .endr .equ .err .exitm .extern .global .hword .if .ifdef .ifndef .include .irp .long .macro .rept .req .section .set .skip .space .text .word .ltorg ", built_in: "$0 $1 $2 $3 $4 $5 $6 $7 $8 $9 $10 $11 $12 $13 $14 $15 " + "$16 $17 $18 $19 $20 $21 $22 $23 $24 $25 $26 $27 $28 $29 $30 $31 " + "zero at v0 v1 a0 a1 a2 a3 a4 a5 a6 a7 " + "t0 t1 t2 t3 t4 t5 t6 t7 t8 t9 s0 s1 s2 s3 s4 s5 s6 s7 s8 " + "k0 k1 gp sp fp ra " + "$f0 $f1 $f2 $f2 $f4 $f5 $f6 $f7 $f8 $f9 $f10 $f11 $f12 $f13 $f14 $f15 " + "$f16 $f17 $f18 $f19 $f20 $f21 $f22 $f23 $f24 $f25 $f26 $f27 $f28 $f29 $f30 $f31 " + "Context Random EntryLo0 EntryLo1 Context PageMask Wired EntryHi " + "HWREna BadVAddr Count Compare SR IntCtl SRSCtl SRSMap Cause EPC PRId " + "EBase Config Config1 Config2 Config3 LLAddr Debug DEPC DESAVE CacheErr " + "ECC ErrorEPC TagLo DataLo TagHi DataHi WatchLo WatchHi PerfCtl PerfCnt " }, @@ -168915,9 +169119,9 @@ var require_mipsasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\b(" + "addi?u?|andi?|b(al)?|beql?|bgez(al)?l?|bgtzl?|blezl?|bltz(al)?l?|" + "bnel?|cl[oz]|divu?|ext|ins|j(al)?|jalr(\\.hb)?|jr(\\.hb)?|lbu?|lhu?|" + "ll|lui|lw[lr]?|maddu?|mfhi|mflo|movn|movz|move|msubu?|mthi|mtlo|mul|" + "multu?|nop|nor|ori?|rotrv?|sb|sc|se[bh]|sh|sllv?|slti?u?|srav?|" + "srlv?|subu?|sw[lr]?|xori?|wsbh|" + "abs\\.[sd]|add\\.[sd]|alnv.ps|bc1[ft]l?|" + "c\\.(s?f|un|u?eq|[ou]lt|[ou]le|ngle?|seq|l[et]|ng[et])\\.[sd]|" + "(ceil|floor|round|trunc)\\.[lw]\\.[sd]|cfc1|cvt\\.d\\.[lsw]|" + "cvt\\.l\\.[dsw]|cvt\\.ps\\.s|cvt\\.s\\.[dlw]|cvt\\.s\\.p[lu]|cvt\\.w\\.[dls]|" + "div\\.[ds]|ldx?c1|luxc1|lwx?c1|madd\\.[sd]|mfc1|mov[fntz]?\\.[ds]|" + "msub\\.[sd]|mth?c1|mul\\.[ds]|neg\\.[ds]|nmadd\\.[ds]|nmsub\\.[ds]|" + "p[lu][lu]\\.ps|recip\\.fmt|r?sqrt\\.[ds]|sdx?c1|sub\\.[ds]|suxc1|" + "swx?c1|" + "break|cache|d?eret|[de]i|ehb|mfc0|mtc0|pause|prefx?|rdhwr|" + "rdpgpr|sdbbp|ssnop|synci?|syscall|teqi?|tgei?u?|tlb(p|r|w[ir])|" + "tlti?u?|tnei?|wait|wrpgpr" + ")", end: "\\s" }, - hljs$1.COMMENT("[;#](?!\\s*$)", "$"), - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.COMMENT("[;#](?!\\s*$)", "$"), + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", begin: "'", @@ -168955,11 +169159,11 @@ var require_mipsasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/mizar.js var require_mizar = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function mizar(hljs$1) { + function mizar(hljs) { return { name: "Mizar", keywords: "environ vocabularies notations constructors definitions " + "registrations theorems schemes requirements begin end definition " + "registration cluster existence pred func defpred deffunc theorem " + "proof let take assume then thus hence ex for st holds consider " + "reconsider such that and in provided of as from be being by means " + "equals implies iff redefine define now not or attr is mode " + "suppose per cases set thesis contradiction scheme reserve struct " + "correctness compatibility coherence symmetry assymetry " + "reflexivity irreflexivity connectedness uniqueness commutativity " + "idempotence involutiveness projectivity", - contains: [hljs$1.COMMENT("::", "$")] + contains: [hljs.COMMENT("::", "$")] }; } module.exports = mizar; @@ -168969,9 +169173,9 @@ var require_mizar = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/perl.js var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function perl(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = [ + function perl(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = [ "abs", "accept", "alarm", @@ -169209,7 +169413,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { const REGEX_MODIFIERS = /[dualxmsipngr]{0,12}/; const PERL_KEYWORDS = { $pattern: /[\w.]+/, - keyword: KEYWORDS$6.join(" ") + keyword: KEYWORDS$2.join(" ") }; const SUBST = { className: "subst", @@ -169249,7 +169453,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const STRING_CONTAINS = [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, SUBST, VAR ]; @@ -169281,8 +169485,8 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const PERL_DEFAULT_CONTAINS = [ VAR, - hljs$1.HASH_COMMENT_MODE, - hljs$1.COMMENT(/^=\w/, /=cut/, { endsWithParent: true }), + hljs.HASH_COMMENT_MODE, + hljs.COMMENT(/^=\w/, /=cut/, { endsWithParent: true }), METHOD, { className: "string", @@ -169321,7 +169525,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "'", end: "'", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "\"", @@ -169330,7 +169534,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /\{\w+\}/, @@ -169344,11 +169548,11 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, NUMBER, { - begin: "(\\/\\/|" + hljs$1.RE_STARTERS_RE + "|\\b(split|return|print|reverse|grep)\\b)\\s*", + begin: "(\\/\\/|" + hljs.RE_STARTERS_RE + "|\\b(split|return|print|reverse|grep)\\b)\\s*", keywords: "split return print reverse grep", relevance: 0, contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "regexp", variants: [ @@ -169381,7 +169585,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "(\\s*\\(.*?\\))?[;{]", excludeEnd: true, relevance: 5, - contains: [hljs$1.TITLE_MODE, ATTR] + contains: [hljs.TITLE_MODE, ATTR] }, { className: "class", @@ -169390,7 +169594,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, relevance: 5, contains: [ - hljs$1.TITLE_MODE, + hljs.TITLE_MODE, ATTR, NUMBER ] @@ -169425,7 +169629,7 @@ var require_perl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/mojolicious.js var require_mojolicious = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function mojolicious(hljs$1) { + function mojolicious(hljs) { return { name: "Mojolicious", subLanguage: "xml", @@ -169455,17 +169659,17 @@ var require_mojolicious = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/monkey.js var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function monkey(hljs$1) { + function monkey(hljs) { const NUMBER = { className: "number", relevance: 0, - variants: [{ begin: "[$][a-fA-F0-9]+" }, hljs$1.NUMBER_MODE] + variants: [{ begin: "[$][a-fA-F0-9]+" }, hljs.NUMBER_MODE] }; const FUNC_DEFINITION = { variants: [{ match: [ /(function|method)/, /\s+/, - hljs$1.UNDERSCORE_IDENT_RE + hljs.UNDERSCORE_IDENT_RE ] }], scope: { 1: "keyword", @@ -169476,14 +169680,14 @@ var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ match: [ /(class|interface|extends|implements)/, /\s+/, - hljs$1.UNDERSCORE_IDENT_RE + hljs.UNDERSCORE_IDENT_RE ] }], scope: { 1: "keyword", 3: "title.class" } }; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "DebugLog", "DebugStop", "Error", @@ -169523,12 +169727,12 @@ var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { "HALFPI", "TWOPI" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "public", "private", "property", @@ -169579,14 +169783,14 @@ var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Monkey", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + built_in: BUILT_INS$2, + literal: LITERALS$2 }, illegal: /\/\*/, contains: [ - hljs$1.COMMENT("#rem", "#end"), - hljs$1.COMMENT("'", "$", { relevance: 0 }), + hljs.COMMENT("#rem", "#end"), + hljs.COMMENT("'", "$", { relevance: 0 }), FUNC_DEFINITION, CLASS_DEFINITION, { @@ -169606,9 +169810,9 @@ var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { { beginKeywords: "alias", end: "=", - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, NUMBER ] }; @@ -169619,8 +169823,8 @@ var require_monkey = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/moonscript.js var require_moonscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function moonscript(hljs$1) { - const KEYWORDS$6 = { + function moonscript(hljs) { + const KEYWORDS$2 = { keyword: "if then not for in while do return else elseif break continue switch and or " + "unless when class extends super local import export from using", literal: "true false nil", built_in: "_G _VERSION assert collectgarbage dofile error getfenv getmetatable ipairs load " + "loadfile loadstring module next pairs pcall print rawequal rawget rawset require " + "select setfenv setmetatable tonumber tostring type unpack xpcall coroutine debug " + "io math os package string table" @@ -169630,10 +169834,10 @@ var require_moonscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "subst", begin: /#\{/, end: /\}/, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; const EXPRESSIONS = [ - hljs$1.inherit(hljs$1.C_NUMBER_MODE, { starts: { + hljs.inherit(hljs.C_NUMBER_MODE, { starts: { end: "(\\s*/)?", relevance: 0 } }), @@ -169642,22 +169846,22 @@ var require_moonscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ begin: /'/, end: /'/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /"/, end: /"/, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }] }, { className: "built_in", - begin: "@__" + hljs$1.IDENT_RE + begin: "@__" + hljs.IDENT_RE }, - { begin: "@" + hljs$1.IDENT_RE }, - { begin: hljs$1.IDENT_RE + "\\\\" + hljs$1.IDENT_RE } + { begin: "@" + hljs.IDENT_RE }, + { begin: hljs.IDENT_RE + "\\\\" + hljs.IDENT_RE } ]; SUBST.contains = EXPRESSIONS; - const TITLE = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: JS_IDENT_RE }); + const TITLE = hljs.inherit(hljs.TITLE_MODE, { begin: JS_IDENT_RE }); const POSSIBLE_PARAMS_RE = "(\\(.*\\)\\s*)?\\B[-=]>"; const PARAMS = { className: "params", @@ -169666,17 +169870,17 @@ var require_moonscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: ["self"].concat(EXPRESSIONS) }] }; return { name: "MoonScript", aliases: ["moon"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /\/\*/, contains: EXPRESSIONS.concat([ - hljs$1.COMMENT("--", "$"), + hljs.COMMENT("--", "$"), { className: "function", begin: "^\\s*" + JS_IDENT_RE + "\\s*=\\s*" + POSSIBLE_PARAMS_RE, @@ -169724,8 +169928,8 @@ var require_moonscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/n1ql.js var require_n1ql = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function n1ql(hljs$1) { - const KEYWORDS$6 = [ + function n1ql(hljs) { + const KEYWORDS$2 = [ "all", "alter", "analyze", @@ -169894,13 +170098,13 @@ var require_n1ql = /* @__PURE__ */ __commonJSMin(((exports, module) => { "work", "xor" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null", "missing|5" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "array_agg", "array_append", "array_concat", @@ -170041,33 +170245,33 @@ var require_n1ql = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "build create index delete drop explain infer|10 insert merge prepare select update upsert|10", end: /;/, keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6, - built_in: BUILT_INS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2, + built_in: BUILT_INS$2 }, contains: [ { className: "string", begin: "'", end: "'", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { className: "string", begin: "\"", end: "\"", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { className: "symbol", begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE ] - }, hljs$1.C_BLOCK_COMMENT_MODE] + }, hljs.C_BLOCK_COMMENT_MODE] }; } module.exports = n1ql; @@ -170077,7 +170281,7 @@ var require_n1ql = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/nestedtext.js var require_nestedtext = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function nestedtext(hljs$1) { + function nestedtext(hljs) { const NESTED = { match: [ /^\s*(?=\S)/, @@ -170132,7 +170336,7 @@ var require_nestedtext = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Nested Text", aliases: ["nt"], contains: [ - hljs$1.inherit(hljs$1.HASH_COMMENT_MODE, { + hljs.inherit(hljs.HASH_COMMENT_MODE, { begin: /^\s*(?=#)/, excludeBegin: true }), @@ -170150,17 +170354,17 @@ var require_nestedtext = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/nginx.js var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function nginx(hljs$1) { - const regex = hljs$1.regex; + function nginx(hljs) { + const regex = hljs.regex; const VAR = { className: "variable", variants: [ { begin: /\$\d+/ }, { begin: /\$\{\w+\}/ }, - { begin: regex.concat(/[$@]/, hljs$1.UNDERSCORE_IDENT_RE) } + { begin: regex.concat(/[$@]/, hljs.UNDERSCORE_IDENT_RE) } ] }; - const LITERALS$6 = [ + const LITERALS$2 = [ "on", "off", "yes", @@ -170190,15 +170394,15 @@ var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { endsWithParent: true, keywords: { $pattern: /[a-z_]{2,}|\/dev\/poll/, - literal: LITERALS$6 + literal: LITERALS$2 }, relevance: 0, illegal: "=>", contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE, VAR], + contains: [hljs.BACKSLASH_ESCAPE, VAR], variants: [{ begin: /"/, end: /"/ @@ -170216,7 +170420,7 @@ var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "regexp", - contains: [hljs$1.BACKSLASH_ESCAPE, VAR], + contains: [hljs.BACKSLASH_ESCAPE, VAR], variants: [ { begin: "\\s\\^", @@ -170248,7 +170452,7 @@ var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Nginx config", aliases: ["nginxconf"], contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { beginKeywords: "upstream location", end: /;|\{/, @@ -170257,15 +170461,15 @@ var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "section", - begin: regex.concat(hljs$1.UNDERSCORE_IDENT_RE + regex.lookahead(/\s+\{/)), + begin: regex.concat(hljs.UNDERSCORE_IDENT_RE + regex.lookahead(/\s+\{/)), relevance: 0 }, { - begin: regex.lookahead(hljs$1.UNDERSCORE_IDENT_RE + "\\s"), + begin: regex.lookahead(hljs.UNDERSCORE_IDENT_RE + "\\s"), end: ";|\\{", contains: [{ className: "attribute", - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, starts: DEFAULT }], relevance: 0 @@ -170280,8 +170484,8 @@ var require_nginx = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/nim.js var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function nim(hljs$1) { - const TYPES$6 = [ + function nim(hljs) { + const TYPES$2 = [ "int", "int8", "int16", @@ -170329,7 +170533,7 @@ var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { "cstringarray", "semistatic" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "addr", "and", "as", @@ -170402,20 +170606,20 @@ var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { "xor", "yield" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "stdin", "stdout", "stderr", "result" ]; - const LITERALS$6 = ["true", "false"]; + const LITERALS$2 = ["true", "false"]; return { name: "Nim", keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6, - type: TYPES$6, - built_in: BUILT_INS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2, + type: TYPES$2, + built_in: BUILT_INS$2 }, contains: [ { @@ -170435,7 +170639,7 @@ var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /([a-zA-Z]\w*)?"""/, end: /"""/ }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "type", begin: /\b[A-Z]\w+\b/, @@ -170451,7 +170655,7 @@ var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: /\b(\d[_\d]*)('?[iIuUfF](8|16|32|64))?/ } ] }, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }; } @@ -170462,9 +170666,9 @@ var require_nim = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/nix.js var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function nix(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = { + function nix(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = { keyword: [ "assert", "else", @@ -170666,7 +170870,7 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const NUMBER = { scope: "number", - match: new RegExp(`${hljs$1.NUMBER_RE}(?!-)`), + match: new RegExp(`${hljs.NUMBER_RE}(?!-)`), relevance: 0 }; const MINUS_OPERATOR = { @@ -170678,7 +170882,7 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { begin: [ - new RegExp(`${hljs$1.NUMBER_RE}`), + new RegExp(`${hljs.NUMBER_RE}`), /-/, /(?!>)/ ], @@ -170724,7 +170928,7 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { scope: "subst", begin: /\$\{/, end: /\}/, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; const ESCAPED_DOUBLEQUOTE = { scope: "char.escape", @@ -170761,9 +170965,9 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const EXPRESSIONS = [ NUMBER, - hljs$1.HASH_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT(/\/\*\*(?!\/)/, /\*\//, { + hljs.HASH_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT(/\/\*\*(?!\/)/, /\*\//, { subLanguage: "markdown", relevance: 0 }), @@ -170789,7 +170993,7 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Nix", aliases: ["nixos"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: EXPRESSIONS.concat(REPL) }; } @@ -170800,7 +171004,7 @@ var require_nix = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/node-repl.js var require_node_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function nodeRepl(hljs$1) { + function nodeRepl(hljs) { return { name: "Node REPL", contains: [{ @@ -170822,8 +171026,8 @@ var require_node_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/nsis.js var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function nsis(hljs$1) { - const regex = hljs$1.regex; + function nsis(hljs) { + const regex = hljs.regex; const LANGUAGE_CONSTANTS = [ "ADMINTOOLS", "APPDATA", @@ -171017,7 +171221,7 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { LANGUAGES ] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "Abort", "AddBrandingImage", "AddSize", @@ -171231,7 +171435,7 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { "WriteUninstaller", "XPStyle" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "admin", "all", "auto", @@ -171290,7 +171494,7 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /Function/, /\s+/, - regex.concat(/(\.)?/, hljs$1.IDENT_RE) + regex.concat(/(\.)?/, hljs.IDENT_RE) ], scope: { 1: "keyword", @@ -171315,13 +171519,13 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "NSIS", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2 }, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT(";", "$", { relevance: 0 }), + hljs.HASH_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT(";", "$", { relevance: 0 }), VARIABLE_DEFINITION, FUNCTION_DEFINITION, { beginKeywords: "Function PageEx Section SectionGroup FunctionEnd SectionEnd" }, @@ -171332,7 +171536,7 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { LANGUAGES, PARAMETERS, PLUGINS, - hljs$1.NUMBER_MODE + hljs.NUMBER_MODE ] }; } @@ -171342,13 +171546,13 @@ var require_nsis = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/objectivec.js var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function objectivec(hljs$1) { + function objectivec(hljs) { const API_CLASS = { className: "built_in", begin: "\\b(AV|CA|CF|CG|CI|CL|CM|CN|CT|MK|MP|MTK|MTL|NS|SCN|SK|UI|WK|XC)\\w+" }; const IDENTIFIER_RE = /[a-zA-Z@][a-zA-Z0-9_]*/; - const TYPES$6 = [ + const TYPES$2 = [ "int", "float", "char", @@ -171481,7 +171685,7 @@ var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NS_VALUERETURN", "NS_VOIDRETURN" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "false", "true", "FALSE", @@ -171491,20 +171695,20 @@ var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NO", "NULL" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "dispatch_once_t", "dispatch_queue_t", "dispatch_sync", "dispatch_async", "dispatch_once" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { "variable.language": ["this", "super"], $pattern: IDENTIFIER_RE, keyword: KWS, - literal: LITERALS$6, - built_in: BUILT_INS$6, - type: TYPES$6 + literal: LITERALS$2, + built_in: BUILT_INS$2, + type: TYPES$2 }; const CLASS_KEYWORDS = { $pattern: IDENTIFIER_RE, @@ -171524,22 +171728,22 @@ var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { "obj-c++", "objective-c++" ], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: " { begin: /\\\n/, relevance: 0 }, - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { className: "string" }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string" }), { className: "string", begin: /<.*?>/, end: /$/, illegal: "\\n" }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -171569,10 +171773,10 @@ var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /(\{|$)/, excludeEnd: true, keywords: CLASS_KEYWORDS, - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }, { - begin: "\\." + hljs$1.UNDERSCORE_IDENT_RE, + begin: "\\." + hljs.UNDERSCORE_IDENT_RE, relevance: 0 } ] @@ -171584,7 +171788,7 @@ var require_objectivec = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ocaml.js var require_ocaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function ocaml(hljs$1) { + function ocaml(hljs) { return { name: "OCaml", aliases: ["ml"], @@ -171601,7 +171805,7 @@ var require_ocaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\[(\\|\\|)?\\]|\\(\\)", relevance: 0 }, - hljs$1.COMMENT("\\(\\*", "\\*\\)", { contains: ["self"] }), + hljs.COMMENT("\\(\\*", "\\*\\)", { contains: ["self"] }), { className: "symbol", begin: "'[A-Za-z_](?!')[\\w']*" @@ -171619,11 +171823,11 @@ var require_ocaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "[a-z_]\\w*'[\\w']*", relevance: 0 }, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { + hljs.inherit(hljs.APOS_STRING_MODE, { className: "string", relevance: 0 }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }), { className: "number", begin: "\\b(0[xX][a-fA-F0-9_]+[Lln]?|" + "0[oO][0-7_]+[Lln]?|" + "0[bB][01_]+[Lln]?|" + "[0-9][0-9_]*([Lln]|(\\.[0-9_]*)?([eE][-+]?[0-9_]+)?)?)", @@ -171639,12 +171843,12 @@ var require_ocaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/openscad.js var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function openscad(hljs$1) { + function openscad(hljs) { const SPECIAL_VARS = { className: "keyword", begin: "\\$(f[asn]|t|vp[rtd]|children)" }; - const LITERALS$6 = { + const LITERALS$2 = { className: "literal", begin: "false|true|PI|undef" }; @@ -171653,7 +171857,7 @@ var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\b\\d+(\\.\\d+)?(e-?\\d+)?", relevance: 0 }; - const STRING = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }); + const STRING = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }); const PREPRO = { className: "meta", keywords: { keyword: "include use" }, @@ -171669,7 +171873,7 @@ var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { NUMBERS, STRING, SPECIAL_VARS, - LITERALS$6 + LITERALS$2 ] }; const MODIFIERS = { @@ -171680,7 +171884,7 @@ var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "module function", end: /=|\{/, - contains: [PARAMS, hljs$1.UNDERSCORE_TITLE_MODE] + contains: [PARAMS, hljs.UNDERSCORE_TITLE_MODE] }; return { name: "OpenSCAD", @@ -171691,8 +171895,8 @@ var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { built_in: "circle square polygon text sphere cube cylinder polyhedron translate rotate scale resize mirror multmatrix color offset hull minkowski union difference intersection abs sign sin cos tan acos asin atan atan2 floor round ceil ln log pow sqrt exp rands min max concat lookup str chr search version version_num norm cross parent_module echo import import_dxf dxf_linear_extrude linear_extrude rotate_extrude surface projection render children dxf_cross dxf_dim let assign" }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, NUMBERS, PREPRO, STRING, @@ -171708,13 +171912,13 @@ var require_openscad = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/oxygene.js var require_oxygene = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function oxygene(hljs$1) { + function oxygene(hljs) { const OXYGENE_KEYWORDS = { $pattern: /\.?\w+/, keyword: "abstract add and array as asc aspect assembly async begin break block by case class concat const copy constructor continue " + "create default delegate desc distinct div do downto dynamic each else empty end ensure enum equals event except exit extension external false " + "final finalize finalizer finally flags for forward from function future global group has if implementation implements implies in index inherited " + "inline interface into invariants is iterator join locked locking loop matching method mod module namespace nested new nil not notify nullable of " + "old on operator or order out override parallel params partial pinned private procedure property protected public queryable raise read readonly " + "record reintroduce remove repeat require result reverse sealed select self sequence set shl shr skip static step soft take then to true try tuple " + "type union unit unsafe until uses using var virtual raises volatile where while with write xor yield await mapped deprecated stdcall cdecl pascal " + "register safecall overload library platform reference packed strict published autoreleasepool selector strong weak unretained" }; - const CURLY_COMMENT = hljs$1.COMMENT(/\{/, /\}/, { relevance: 0 }); - const PAREN_COMMENT = hljs$1.COMMENT("\\(\\*", "\\*\\)", { relevance: 10 }); + const CURLY_COMMENT = hljs.COMMENT(/\{/, /\}/, { relevance: 0 }); + const PAREN_COMMENT = hljs.COMMENT("\\(\\*", "\\*\\)", { relevance: 10 }); const STRING = { className: "string", begin: "'", @@ -171730,7 +171934,7 @@ var require_oxygene = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "[:;]", keywords: "function constructor|10 destructor|10 procedure|10 method|10", contains: [ - hljs$1.inherit(hljs$1.TITLE_MODE, { scope: "title.function" }), + hljs.inherit(hljs.TITLE_MODE, { scope: "title.function" }), { className: "params", begin: "\\(", @@ -171755,10 +171959,10 @@ var require_oxygene = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ CURLY_COMMENT, PAREN_COMMENT, - hljs$1.C_LINE_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, STRING, CHAR_STRING, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, FUNCTION, SEMICOLON ] @@ -171770,15 +171974,15 @@ var require_oxygene = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/parser3.js var require_parser3 = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function parser3(hljs$1) { - const CURLY_SUBCOMMENT = hljs$1.COMMENT(/\{/, /\}/, { contains: ["self"] }); + function parser3(hljs) { + const CURLY_SUBCOMMENT = hljs.COMMENT(/\{/, /\}/, { contains: ["self"] }); return { name: "Parser3", subLanguage: "xml", relevance: 0, contains: [ - hljs$1.COMMENT("^#", "$"), - hljs$1.COMMENT(/\^rem\{/, /\}/, { + hljs.COMMENT("^#", "$"), + hljs.COMMENT(/\^rem\{/, /\}/, { relevance: 10, contains: [CURLY_SUBCOMMENT] }), @@ -171803,7 +172007,7 @@ var require_parser3 = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "number", begin: "\\^#[0-9a-fA-F]+" }, - hljs$1.C_NUMBER_MODE + hljs.C_NUMBER_MODE ] }; } @@ -171813,7 +172017,7 @@ var require_parser3 = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/pf.js var require_pf = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function pf(hljs$1) { + function pf(hljs) { const MACRO = { className: "variable", begin: /\$[\w\d#@][\w\d_]*/, @@ -171834,9 +172038,9 @@ var require_pf = /* @__PURE__ */ __commonJSMin(((exports, module) => { literal: "all any no-route self urpf-failed egress|5 unknown" }, contains: [ - hljs$1.HASH_COMMENT_MODE, - hljs$1.NUMBER_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.HASH_COMMENT_MODE, + hljs.NUMBER_MODE, + hljs.QUOTE_STRING_MODE, MACRO, TABLE ] @@ -171848,16 +172052,16 @@ var require_pf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/pgsql.js var require_pgsql = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function pgsql(hljs$1) { - const COMMENT_MODE = hljs$1.COMMENT("--", "$"); + function pgsql(hljs) { + const COMMENT_MODE = hljs.COMMENT("--", "$"); const UNQUOTED_IDENT = "[a-zA-Z_][a-zA-Z_0-9$]*"; const DOLLAR_STRING = "\\$([a-zA-Z_]?|[a-zA-Z_][a-zA-Z_0-9]*)\\$"; const LABEL = "<<\\s*" + UNQUOTED_IDENT + "\\s*>>"; const SQL_KW = "ABORT ALTER ANALYZE BEGIN CALL CHECKPOINT|10 CLOSE CLUSTER COMMENT COMMIT COPY CREATE DEALLOCATE DECLARE " + "DELETE DISCARD DO DROP END EXECUTE EXPLAIN FETCH GRANT IMPORT INSERT LISTEN LOAD LOCK MOVE NOTIFY " + "PREPARE REASSIGN|10 REFRESH REINDEX RELEASE RESET REVOKE ROLLBACK SAVEPOINT SECURITY SELECT SET SHOW " + "START TRUNCATE UNLISTEN|10 UPDATE VACUUM|10 VALUES " + "AGGREGATE COLLATION CONVERSION|10 DATABASE DEFAULT PRIVILEGES DOMAIN TRIGGER EXTENSION FOREIGN " + "WRAPPER|10 TABLE FUNCTION GROUP LANGUAGE LARGE OBJECT MATERIALIZED VIEW OPERATOR CLASS " + "FAMILY POLICY PUBLICATION|10 ROLE RULE SCHEMA SEQUENCE SERVER STATISTICS SUBSCRIPTION SYSTEM " + "TABLESPACE CONFIGURATION DICTIONARY PARSER TEMPLATE TYPE USER MAPPING PREPARED ACCESS " + "METHOD CAST AS TRANSFORM TRANSACTION OWNED TO INTO SESSION AUTHORIZATION " + "INDEX PROCEDURE ASSERTION " + "ALL ANALYSE AND ANY ARRAY ASC ASYMMETRIC|10 BOTH CASE CHECK " + "COLLATE COLUMN CONCURRENTLY|10 CONSTRAINT CROSS " + "DEFERRABLE RANGE " + "DESC DISTINCT ELSE EXCEPT FOR FREEZE|10 FROM FULL HAVING " + "ILIKE IN INITIALLY INNER INTERSECT IS ISNULL JOIN LATERAL LEADING LIKE LIMIT " + "NATURAL NOT NOTNULL NULL OFFSET ON ONLY OR ORDER OUTER OVERLAPS PLACING PRIMARY " + "REFERENCES RETURNING SIMILAR SOME SYMMETRIC TABLESAMPLE THEN " + "TRAILING UNION UNIQUE USING VARIADIC|10 VERBOSE WHEN WHERE WINDOW WITH " + "BY RETURNS INOUT OUT SETOF|10 IF STRICT CURRENT CONTINUE OWNER LOCATION OVER PARTITION WITHIN " + "BETWEEN ESCAPE EXTERNAL INVOKER DEFINER WORK RENAME VERSION CONNECTION CONNECT " + "TABLES TEMP TEMPORARY FUNCTIONS SEQUENCES TYPES SCHEMAS OPTION CASCADE RESTRICT ADD ADMIN " + "EXISTS VALID VALIDATE ENABLE DISABLE REPLICA|10 ALWAYS PASSING COLUMNS PATH " + "REF VALUE OVERRIDING IMMUTABLE STABLE VOLATILE BEFORE AFTER EACH ROW PROCEDURAL " + "ROUTINE NO HANDLER VALIDATOR OPTIONS STORAGE OIDS|10 WITHOUT INHERIT DEPENDS CALLED " + "INPUT LEAKPROOF|10 COST ROWS NOWAIT SEARCH UNTIL ENCRYPTED|10 PASSWORD CONFLICT|10 " + "INSTEAD INHERITS CHARACTERISTICS WRITE CURSOR ALSO STATEMENT SHARE EXCLUSIVE INLINE " + "ISOLATION REPEATABLE READ COMMITTED SERIALIZABLE UNCOMMITTED LOCAL GLOBAL SQL PROCEDURES " + "RECURSIVE SNAPSHOT ROLLUP CUBE TRUSTED|10 INCLUDE FOLLOWING PRECEDING UNBOUNDED RANGE GROUPS " + "UNENCRYPTED|10 SYSID FORMAT DELIMITER HEADER QUOTE ENCODING FILTER OFF " + "FORCE_QUOTE FORCE_NOT_NULL FORCE_NULL COSTS BUFFERS TIMING SUMMARY DISABLE_PAGE_SKIPPING " + "RESTART CYCLE GENERATED IDENTITY DEFERRED IMMEDIATE LEVEL LOGGED UNLOGGED " + "OF NOTHING NONE EXCLUDE ATTRIBUTE " + "USAGE ROUTINES " + "TRUE FALSE NAN INFINITY "; const ROLE_ATTRS = "SUPERUSER NOSUPERUSER CREATEDB NOCREATEDB CREATEROLE NOCREATEROLE INHERIT NOINHERIT " + "LOGIN NOLOGIN REPLICATION NOREPLICATION BYPASSRLS NOBYPASSRLS "; const PLPGSQL_KW = "ALIAS BEGIN CONSTANT DECLARE END EXCEPTION RETURN PERFORM|10 RAISE GET DIAGNOSTICS " + "STACKED|10 FOREACH LOOP ELSIF EXIT WHILE REVERSE SLICE DEBUG LOG INFO NOTICE WARNING ASSERT " + "OPEN "; - const TYPES$6 = "BIGINT INT8 BIGSERIAL SERIAL8 BIT VARYING VARBIT BOOLEAN BOOL BOX BYTEA CHARACTER CHAR VARCHAR " + "CIDR CIRCLE DATE DOUBLE PRECISION FLOAT8 FLOAT INET INTEGER INT INT4 INTERVAL JSON JSONB LINE LSEG|10 " + "MACADDR MACADDR8 MONEY NUMERIC DEC DECIMAL PATH POINT POLYGON REAL FLOAT4 SMALLINT INT2 " + "SMALLSERIAL|10 SERIAL2|10 SERIAL|10 SERIAL4|10 TEXT TIME ZONE TIMETZ|10 TIMESTAMP TIMESTAMPTZ|10 TSQUERY|10 TSVECTOR|10 " + "TXID_SNAPSHOT|10 UUID XML NATIONAL NCHAR " + "INT4RANGE|10 INT8RANGE|10 NUMRANGE|10 TSRANGE|10 TSTZRANGE|10 DATERANGE|10 " + "ANYELEMENT ANYARRAY ANYNONARRAY ANYENUM ANYRANGE CSTRING INTERNAL " + "RECORD PG_DDL_COMMAND VOID UNKNOWN OPAQUE REFCURSOR " + "NAME " + "OID REGPROC|10 REGPROCEDURE|10 REGOPER|10 REGOPERATOR|10 REGCLASS|10 REGTYPE|10 REGROLE|10 " + "REGNAMESPACE|10 REGCONFIG|10 REGDICTIONARY|10 "; - const TYPES_RE = TYPES$6.trim().split(" ").map(function(val$1) { + const TYPES$2 = "BIGINT INT8 BIGSERIAL SERIAL8 BIT VARYING VARBIT BOOLEAN BOOL BOX BYTEA CHARACTER CHAR VARCHAR " + "CIDR CIRCLE DATE DOUBLE PRECISION FLOAT8 FLOAT INET INTEGER INT INT4 INTERVAL JSON JSONB LINE LSEG|10 " + "MACADDR MACADDR8 MONEY NUMERIC DEC DECIMAL PATH POINT POLYGON REAL FLOAT4 SMALLINT INT2 " + "SMALLSERIAL|10 SERIAL2|10 SERIAL|10 SERIAL4|10 TEXT TIME ZONE TIMETZ|10 TIMESTAMP TIMESTAMPTZ|10 TSQUERY|10 TSVECTOR|10 " + "TXID_SNAPSHOT|10 UUID XML NATIONAL NCHAR " + "INT4RANGE|10 INT8RANGE|10 NUMRANGE|10 TSRANGE|10 TSTZRANGE|10 DATERANGE|10 " + "ANYELEMENT ANYARRAY ANYNONARRAY ANYENUM ANYRANGE CSTRING INTERNAL " + "RECORD PG_DDL_COMMAND VOID UNKNOWN OPAQUE REFCURSOR " + "NAME " + "OID REGPROC|10 REGPROCEDURE|10 REGOPER|10 REGOPERATOR|10 REGCLASS|10 REGTYPE|10 REGROLE|10 " + "REGNAMESPACE|10 REGCONFIG|10 REGDICTIONARY|10 "; + const TYPES_RE = TYPES$2.trim().split(" ").map(function(val$1) { return val$1.split("|")[0]; }).join("|"); const SQL_BI = "CURRENT_TIME CURRENT_TIMESTAMP CURRENT_USER CURRENT_CATALOG|10 CURRENT_DATE LOCALTIME LOCALTIMESTAMP " + "CURRENT_ROLE|10 CURRENT_SCHEMA|10 SESSION_USER PUBLIC "; @@ -171952,7 +172156,7 @@ var require_pgsql = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { beginKeywords: "CACHE INCREMENT MAXVALUE MINVALUE", - end: hljs$1.C_NUMBER_RE, + end: hljs.C_NUMBER_RE, returnEnd: true, keywords: "BY CACHE INCREMENT MAXVALUE MINVALUE" }, @@ -171977,7 +172181,7 @@ var require_pgsql = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\b(" + TYPES_RE + ")\\s+PATH\\b", keywords: { keyword: "PATH", - type: TYPES$6.replace("PATH ", "") + type: TYPES$2.replace("PATH ", "") } }, { @@ -171997,7 +172201,7 @@ var require_pgsql = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ begin: "\\\\." }], relevance: 10 }, - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: DOLLAR_STRING, end: DOLLAR_STRING, contains: [{ @@ -172024,8 +172228,8 @@ var require_pgsql = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"", contains: [{ begin: "\"\"" }] }, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, COMMENT_MODE, { className: "meta", @@ -172059,15 +172263,15 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {HLJSApi} hljs * @returns {LanguageDetail} * */ - function php(hljs$1) { - const regex = hljs$1.regex; + function php(hljs) { + const regex = hljs.regex; const NOT_PERL_ETC = /(?![A-Za-z0-9])(?![$])/; - const IDENT_RE$6 = regex.concat(/[a-zA-Z_\x7f-\xff][a-zA-Z0-9_\x7f-\xff]*/, NOT_PERL_ETC); + const IDENT_RE$2 = regex.concat(/[a-zA-Z_\x7f-\xff][a-zA-Z0-9_\x7f-\xff]*/, NOT_PERL_ETC); const PASCAL_CASE_CLASS_NAME_RE = regex.concat(/(\\?[A-Z][a-z0-9_\x7f-\xff]+|\\?[A-Z]+(?=[A-Z][a-z0-9_\x7f-\xff])){1,}/, NOT_PERL_ETC); const UPCASE_NAME_RE = regex.concat(/[A-Z]+/, NOT_PERL_ETC); const VARIABLE = { scope: "variable", - match: "\\$+" + IDENT_RE$6 + match: "\\$+" + IDENT_RE$2 }; const PREPROCESSOR = { scope: "meta", @@ -172091,15 +172295,15 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\}/ }] }; - const SINGLE_QUOTED = hljs$1.inherit(hljs$1.APOS_STRING_MODE, { illegal: null }); - const DOUBLE_QUOTED = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { + const SINGLE_QUOTED = hljs.inherit(hljs.APOS_STRING_MODE, { illegal: null }); + const DOUBLE_QUOTED = hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null, - contains: hljs$1.QUOTE_STRING_MODE.contains.concat(SUBST) + contains: hljs.QUOTE_STRING_MODE.contains.concat(SUBST) }); const HEREDOC = { begin: /<<<[ \t]*(?:(\w+)|"(\w+)")\n/, end: /[ \t]*(\w+)\b/, - contains: hljs$1.QUOTE_STRING_MODE.contains.concat(SUBST), + contains: hljs.QUOTE_STRING_MODE.contains.concat(SUBST), "on:begin": (m$3, resp) => { resp.data._beginMatch = m$3[1] || m$3[2]; }, @@ -172107,7 +172311,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (resp.data._beginMatch !== m$3[1]) resp.ignoreMatch(); } }; - const NOWDOC = hljs$1.END_SAME_AS_BEGIN({ + const NOWDOC = hljs.END_SAME_AS_BEGIN({ begin: /<<<[ \t]*'(\w+)'\n/, end: /[ \t]*(\w+)\b/ }); @@ -172131,7 +172335,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { ], relevance: 0 }; - const LITERALS$6 = [ + const LITERALS$2 = [ "false", "null", "true" @@ -172228,7 +172432,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { "xor", "yield" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "Error|0", "AppendIterator", "ArgumentCountError", @@ -172337,10 +172541,10 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { }); return result; }; - const KEYWORDS$6 = { + const KEYWORDS$2 = { keyword: KWS, - literal: dualCase(LITERALS$6), - built_in: BUILT_INS$6 + literal: dualCase(LITERALS$2), + built_in: BUILT_INS$2 }; /** * @param {string[]} items */ @@ -172353,7 +172557,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /new/, regex.concat(WHITESPACE, "+"), - regex.concat("(?!", normalizeKeywords(BUILT_INS$6).join("\\b|"), "\\b)"), + regex.concat("(?!", normalizeKeywords(BUILT_INS$2).join("\\b|"), "\\b)"), PASCAL_CASE_CLASS_NAME_RE ], scope: { @@ -172361,7 +172565,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { 4: "title.class" } }] }; - const CONSTANT_REFERENCE = regex.concat(IDENT_RE$6, "\\b(?!\\()"); + const CONSTANT_REFERENCE = regex.concat(IDENT_RE$2, "\\b(?!\\()"); const LEFT_AND_RIGHT_SIDE_OF_DOUBLE_COLON = { variants: [ { match: [regex.concat(/::/, regex.lookahead(/(?!class\b)/)), CONSTANT_REFERENCE], @@ -172400,18 +172604,18 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; const NAMED_ARGUMENT = { scope: "attr", - match: regex.concat(IDENT_RE$6, regex.lookahead(":"), regex.lookahead(/(?!::)/)) + match: regex.concat(IDENT_RE$2, regex.lookahead(":"), regex.lookahead(/(?!::)/)) }; const PARAMS_MODE = { relevance: 0, begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ NAMED_ARGUMENT, VARIABLE, LEFT_AND_RIGHT_SIDE_OF_DOUBLE_COLON, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRING, NUMBER, CONSTRUCTOR_CALL @@ -172421,8 +172625,8 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, match: [ /\b/, - regex.concat("(?!fn\\b|function\\b|", normalizeKeywords(KWS).join("\\b|"), "|", normalizeKeywords(BUILT_INS$6).join("\\b|"), "\\b)"), - IDENT_RE$6, + regex.concat("(?!fn\\b|function\\b|", normalizeKeywords(KWS).join("\\b|"), "|", normalizeKeywords(BUILT_INS$2).join("\\b|"), "\\b)"), + IDENT_RE$2, regex.concat(WHITESPACE, "*"), regex.lookahead(/(?=\()/) ], @@ -172433,18 +172637,18 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { const ATTRIBUTE_CONTAINS = [ NAMED_ARGUMENT, LEFT_AND_RIGHT_SIDE_OF_DOUBLE_COLON, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRING, NUMBER, CONSTRUCTOR_CALL ]; - const ATTRIBUTES$5 = { + const ATTRIBUTES$1 = { begin: regex.concat(/#\[\s*\\?/, regex.either(PASCAL_CASE_CLASS_NAME_RE, UPCASE_NAME_RE)), beginScope: "meta", end: /]/, endScope: "meta", keywords: { - literal: LITERALS$6, + literal: LITERALS$2, keyword: ["new", "array"] }, contains: [ @@ -172452,7 +172656,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[/, end: /]/, keywords: { - literal: LITERALS$6, + literal: LITERALS$2, keyword: ["new", "array"] }, contains: ["self", ...ATTRIBUTE_CONTAINS] @@ -172466,12 +172670,12 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; return { case_insensitive: false, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - ATTRIBUTES$5, - hljs$1.HASH_COMMENT_MODE, - hljs$1.COMMENT("//", "$"), - hljs$1.COMMENT("/\\*", "\\*/", { contains: [{ + ATTRIBUTES$1, + hljs.HASH_COMMENT_MODE, + hljs.COMMENT("//", "$"), + hljs.COMMENT("/\\*", "\\*/", { contains: [{ scope: "doctag", match: "@[A-Za-z]+" }] }), @@ -172480,7 +172684,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "__halt_compiler", starts: { scope: "comment", - end: hljs$1.MATCH_NOTHING_RE, + end: hljs.MATCH_NOTHING_RE, contains: [{ match: /\?>/, scope: "meta", @@ -172500,7 +172704,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /const/, /\s/, - IDENT_RE$6 + IDENT_RE$2 ], scope: { 1: "keyword", @@ -172517,7 +172721,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "[$%\\[]", contains: [ { beginKeywords: "use" }, - hljs$1.UNDERSCORE_TITLE_MODE, + hljs.UNDERSCORE_TITLE_MODE, { begin: "=>", endsParent: true @@ -172528,13 +172732,13 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\\)", excludeBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ "self", - ATTRIBUTES$5, + ATTRIBUTES$1, VARIABLE, LEFT_AND_RIGHT_SIDE_OF_DOUBLE_COLON, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRING, NUMBER ] @@ -172553,14 +172757,14 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, end: /\{/, excludeEnd: true, - contains: [{ beginKeywords: "extends implements" }, hljs$1.UNDERSCORE_TITLE_MODE] + contains: [{ beginKeywords: "extends implements" }, hljs.UNDERSCORE_TITLE_MODE] }, { beginKeywords: "namespace", relevance: 0, end: ";", illegal: /[.']/, - contains: [hljs$1.inherit(hljs$1.UNDERSCORE_TITLE_MODE, { scope: "title.class" })] + contains: [hljs.inherit(hljs.UNDERSCORE_TITLE_MODE, { scope: "title.class" })] }, { beginKeywords: "use", @@ -172569,7 +172773,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ match: /\b(as|const|function)\b/, scope: "keyword" - }, hljs$1.UNDERSCORE_TITLE_MODE] + }, hljs.UNDERSCORE_TITLE_MODE] }, STRING, NUMBER @@ -172582,7 +172786,7 @@ var require_php = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/php-template.js var require_php_template = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function phpTemplate(hljs$1) { + function phpTemplate(hljs) { return { name: "PHP template", subLanguage: "xml", @@ -172606,13 +172810,13 @@ var require_php_template = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "'", skip: true }, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { + hljs.inherit(hljs.APOS_STRING_MODE, { illegal: null, className: null, contains: null, skip: true }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null, className: null, contains: null, @@ -172628,7 +172832,7 @@ var require_php_template = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/plaintext.js var require_plaintext = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function plaintext(hljs$1) { + function plaintext(hljs) { return { name: "Plain text", aliases: ["text", "txt"], @@ -172641,8 +172845,8 @@ var require_plaintext = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/pony.js var require_pony = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function pony(hljs$1) { - const KEYWORDS$6 = { + function pony(hljs) { + const KEYWORDS$2 = { keyword: "actor addressof and as be break class compile_error compile_intrinsic " + "consume continue delegate digestof do else elseif embed end error " + "for fun if ifdef in interface is isnt lambda let match new not object " + "or primitive recover repeat return struct then trait try type until " + "use var where while with xor", meta: "iso val tag trn box ref", literal: "this false true" @@ -172653,17 +172857,17 @@ var require_pony = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"\"\"", relevance: 10 }; - const QUOTE_STRING_MODE$2 = { + const QUOTE_STRING_MODE = { className: "string", begin: "\"", end: "\"", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; const SINGLE_QUOTE_CHAR_MODE = { className: "string", begin: "'", end: "'", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], relevance: 0 }; const TYPE_NAME = { @@ -172672,10 +172876,10 @@ var require_pony = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }; const PRIMED_NAME = { - begin: hljs$1.IDENT_RE + "'", + begin: hljs.IDENT_RE + "'", relevance: 0 }; - const NUMBER_MODE$2 = { + const NUMBER_MODE = { className: "number", begin: "(-?)(\\b0[xX][a-fA-F0-9]+|\\b0[bB][01]+|(\\b\\d+(_\\d+)?(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)", relevance: 0 @@ -172692,16 +172896,16 @@ var require_pony = /* @__PURE__ */ __commonJSMin(((exports, module) => { */ return { name: "Pony", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ TYPE_NAME, TRIPLE_QUOTE_STRING_MODE, - QUOTE_STRING_MODE$2, + QUOTE_STRING_MODE, SINGLE_QUOTE_CHAR_MODE, PRIMED_NAME, - NUMBER_MODE$2, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; } @@ -172711,8 +172915,8 @@ var require_pony = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/powershell.js var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function powershell(hljs$1) { - const TYPES$6 = [ + function powershell(hljs) { + const TYPES$2 = [ "string", "char", "byte", @@ -172730,7 +172934,7 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; const VALID_VERBS = "Add|Clear|Close|Copy|Enter|Exit|Find|Format|Get|Hide|Join|Lock|" + "Move|New|Open|Optimize|Pop|Push|Redo|Remove|Rename|Reset|Resize|" + "Search|Select|Set|Show|Skip|Split|Step|Switch|Undo|Unlock|" + "Watch|Backup|Checkpoint|Compare|Compress|Convert|ConvertFrom|" + "ConvertTo|Dismount|Edit|Expand|Export|Group|Import|Initialize|" + "Limit|Merge|Mount|Out|Publish|Restore|Save|Sync|Unpublish|Update|" + "Approve|Assert|Build|Complete|Confirm|Deny|Deploy|Disable|Enable|Install|Invoke|" + "Register|Request|Restart|Resume|Start|Stop|Submit|Suspend|Uninstall|" + "Unregister|Wait|Debug|Measure|Ping|Repair|Resolve|Test|Trace|Connect|" + "Disconnect|Read|Receive|Send|Write|Block|Grant|Protect|Revoke|Unblock|" + "Unprotect|Use|ForEach|Sort|Tee|Where"; const COMPARISON_OPERATORS = "-and|-as|-band|-bnot|-bor|-bxor|-casesensitive|-ccontains|-ceq|-cge|-cgt|" + "-cle|-clike|-clt|-cmatch|-cne|-cnotcontains|-cnotlike|-cnotmatch|-contains|" + "-creplace|-csplit|-eq|-exact|-f|-file|-ge|-gt|-icontains|-ieq|-ige|-igt|" + "-ile|-ilike|-ilt|-imatch|-in|-ine|-inotcontains|-inotlike|-inotmatch|" + "-ireplace|-is|-isnot|-isplit|-join|-le|-like|-lt|-match|-ne|-not|" + "-notcontains|-notin|-notlike|-notmatch|-or|-regex|-replace|-shl|-shr|" + "-split|-wildcard|-xor"; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: /-?[A-z\.\-]+\b/, keyword: "if else foreach return do while until elseif begin for trap data dynamicparam " + "end break throw param continue finally in switch exit filter try process catch " + "hidden static parameter", built_in: "ac asnp cat cd CFS chdir clc clear clhy cli clp cls clv cnsn compare copy cp " + "cpi cpp curl cvpa dbp del diff dir dnsn ebp echo|0 epal epcsv epsn erase etsn exsn fc fhx " + "fl ft fw gal gbp gc gcb gci gcm gcs gdr gerr ghy gi gin gjb gl gm gmo gp gps gpv group " + "gsn gsnp gsv gtz gu gv gwmi h history icm iex ihy ii ipal ipcsv ipmo ipsn irm ise iwmi " + "iwr kill lp ls man md measure mi mount move mp mv nal ndr ni nmo npssc nsn nv ogv oh " + "popd ps pushd pwd r rbp rcjb rcsn rd rdr ren ri rjb rm rmdir rmo rni rnp rp rsn rsnp " + "rujb rv rvpa rwmi sajb sal saps sasv sbp sc scb select set shcm si sl sleep sls sort sp " + "spjb spps spsv start stz sujb sv swmi tee trcm type wget where wjb write" @@ -172788,7 +172992,7 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "doctag", variants: [{ begin: /\.(synopsis|description|example|inputs|outputs|notes|link|component|role|functionality)/ }, { begin: /\.(parameter|forwardhelptargetname|forwardhelpcategory|remotehelprunspace|externalhelp)\s+\S+/ }] }; - const PS_COMMENT = hljs$1.inherit(hljs$1.COMMENT(null, null), { + const PS_COMMENT = hljs.inherit(hljs.COMMENT(null, null), { variants: [{ begin: /#/, end: /$/ @@ -172808,7 +173012,7 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\s*[{]/, excludeEnd: true, relevance: 0, - contains: [hljs$1.TITLE_MODE] + contains: [hljs.TITLE_MODE] }; const PS_FUNCTION = { className: "function", @@ -172871,16 +173075,16 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [{ className: "keyword", - begin: "(".concat(KEYWORDS$6.keyword.toString().replace(/\s/g, "|"), ")\\b"), + begin: "(".concat(KEYWORDS$2.keyword.toString().replace(/\s/g, "|"), ")\\b"), endsParent: true, relevance: 0 - }, hljs$1.inherit(hljs$1.TITLE_MODE, { endsParent: true })] + }, hljs.inherit(hljs.TITLE_MODE, { endsParent: true })] }; const GENTLEMANS_SET = [ PS_METHODS, PS_COMMENT, BACKTICK_ESCAPE, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, QUOTE_STRING, APOS_STRING, CMDLETS, @@ -172895,7 +173099,7 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, relevance: 0, contains: [].concat("self", GENTLEMANS_SET, { - begin: "(" + TYPES$6.join("|") + ")", + begin: "(" + TYPES$2.join("|") + ")", className: "built_in", relevance: 0 }, { @@ -172913,7 +173117,7 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { "ps1" ], case_insensitive: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: GENTLEMANS_SET.concat(PS_CLASS, PS_FUNCTION, PS_USING, PS_ARGUMENTS, PS_TYPE) }; } @@ -172923,9 +173127,9 @@ var require_powershell = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/processing.js var require_processing = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function processing(hljs$1) { - const regex = hljs$1.regex; - const BUILT_INS$6 = [ + function processing(hljs) { + const regex = hljs.regex; + const BUILT_INS$2 = [ "displayHeight", "displayWidth", "mouseY", @@ -173188,9 +173392,9 @@ var require_processing = /* @__PURE__ */ __commonJSMin(((exports, module) => { "randomGaussian", "randomSeed" ]; - const IDENT = hljs$1.IDENT_RE; + const IDENT = hljs.IDENT_RE; const FUNC_NAME = { variants: [{ - match: regex.concat(regex.either(...BUILT_INS$6), regex.lookahead(/\s*\(/)), + match: regex.concat(regex.either(...BUILT_INS$2), regex.lookahead(/\s*\(/)), className: "built_in" }, { relevance: 0, @@ -173230,7 +173434,7 @@ var require_processing = /* @__PURE__ */ __commonJSMin(((exports, module) => { 7: "title.class.inherited" } }; - const TYPES$6 = [ + const TYPES$2 = [ "boolean", "byte", "char", @@ -173312,19 +173516,19 @@ var require_processing = /* @__PURE__ */ __commonJSMin(((exports, module) => { literal: "P2D P3D HALF_PI PI QUARTER_PI TAU TWO_PI null true false", title: "setup draw", variable: "super this", - built_in: [...BUILT_INS$6, ...CLASSES], - type: TYPES$6 + built_in: [...BUILT_INS$2, ...CLASSES], + type: TYPES$2 }, contains: [ CLASS, NEW_CLASS, FUNC_NAME, PROPERTY, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE ] }; } @@ -173334,11 +173538,11 @@ var require_processing = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/profile.js var require_profile = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function profile(hljs$1) { + function profile(hljs) { return { name: "Python profiler", contains: [ - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, { begin: "[a-zA-Z_][\\da-zA-Z_]+\\.[\\da-zA-Z_]{1,3}", end: ":", @@ -173353,11 +173557,11 @@ var require_profile = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "function calls", end: "$", - contains: [hljs$1.C_NUMBER_MODE], + contains: [hljs.C_NUMBER_MODE], relevance: 10 }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", begin: "\\(", @@ -173375,7 +173579,7 @@ var require_profile = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/prolog.js var require_prolog = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function prolog(hljs$1) { + function prolog(hljs) { const ATOM = { begin: /[a-z][A-Za-z0-9_]*/, relevance: 0 @@ -173398,13 +173602,13 @@ var require_prolog = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "comment", begin: /%/, end: /$/, - contains: [hljs$1.PHRASAL_WORDS_MODE] + contains: [hljs.PHRASAL_WORDS_MODE] }; const BACKTICK_STRING = { className: "string", begin: /`/, end: /`/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; const CHAR_CODE = { className: "string", @@ -173422,13 +173626,13 @@ var require_prolog = /* @__PURE__ */ __commonJSMin(((exports, module) => { PRED_OP, LIST, LINE_COMMENT, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, BACKTICK_STRING, CHAR_CODE, SPACE_CODE, - hljs$1.C_NUMBER_MODE + hljs.C_NUMBER_MODE ]; PARENTED.contains = inner$1; LIST.contains = inner$1; @@ -173444,7 +173648,7 @@ var require_prolog = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/properties.js var require_properties = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function properties(hljs$1) { + function properties(hljs) { const WS0 = "[ \\t\\f]*"; const WS1 = "[ \\t\\f]+"; const EQUAL_DELIM = WS0 + "[:=]" + WS0; @@ -173467,7 +173671,7 @@ var require_properties = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, illegal: /\S/, contains: [ - hljs$1.COMMENT("^\\s*[!#]", "$"), + hljs.COMMENT("^\\s*[!#]", "$"), { returnBegin: true, variants: [{ begin: KEY + EQUAL_DELIM }, { begin: KEY + WS_DELIM }], @@ -173491,8 +173695,8 @@ var require_properties = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/protobuf.js var require_protobuf = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function protobuf(hljs$1) { - const KEYWORDS$6 = [ + function protobuf(hljs) { + const KEYWORDS$2 = [ "package", "import", "option", @@ -173502,7 +173706,7 @@ var require_protobuf = /* @__PURE__ */ __commonJSMin(((exports, module) => { "group", "oneof" ]; - const TYPES$6 = [ + const TYPES$2 = [ "double", "float", "int32", @@ -173520,7 +173724,7 @@ var require_protobuf = /* @__PURE__ */ __commonJSMin(((exports, module) => { "bytes" ]; const CLASS_DEFINITION = { - match: [/(message|enum|service)\s+/, hljs$1.IDENT_RE], + match: [/(message|enum|service)\s+/, hljs.IDENT_RE], scope: { 1: "keyword", 2: "title.class" @@ -173530,15 +173734,15 @@ var require_protobuf = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Protocol Buffers", aliases: ["proto"], keywords: { - keyword: KEYWORDS$6, - type: TYPES$6, + keyword: KEYWORDS$2, + type: TYPES$2, literal: ["true", "false"] }, contains: [ - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, CLASS_DEFINITION, { className: "function", @@ -173557,22 +173761,22 @@ var require_protobuf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/puppet.js var require_puppet = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function puppet(hljs$1) { + function puppet(hljs) { const PUPPET_KEYWORDS = { keyword: "and case default else elsif false if in import enherits node or true undef unless main settings $string ", literal: "alias audit before loglevel noop require subscribe tag " + "owner ensure group mode name|0 changes context force incl lens load_path onlyif provider returns root show_diff type_check " + "en_address ip_address realname command environment hour monute month monthday special target weekday " + "creates cwd ogoutput refresh refreshonly tries try_sleep umask backup checksum content ctime force ignore " + "links mtime purge recurse recurselimit replace selinux_ignore_defaults selrange selrole seltype seluser source " + "souirce_permissions sourceselect validate_cmd validate_replacement allowdupe attribute_membership auth_membership forcelocal gid " + "ia_load_module members system host_aliases ip allowed_trunk_vlans description device_url duplex encapsulation etherchannel " + "native_vlan speed principals allow_root auth_class auth_type authenticate_user k_of_n mechanisms rule session_owner shared options " + "device fstype enable hasrestart directory present absent link atboot blockdevice device dump pass remounts poller_tag use " + "message withpath adminfile allow_virtual allowcdrom category configfiles flavor install_options instance package_settings platform " + "responsefile status uninstall_options vendor unless_system_user unless_uid binary control flags hasstatus manifest pattern restart running " + "start stop allowdupe auths expiry gid groups home iterations key_membership keys managehome membership password password_max_age " + "password_min_age profile_membership profiles project purge_ssh_keys role_membership roles salt shell uid baseurl cost descr enabled " + "enablegroups exclude failovermethod gpgcheck gpgkey http_caching include includepkgs keepalive metadata_expire metalink mirrorlist " + "priority protect proxy proxy_password proxy_username repo_gpgcheck s3_enabled skip_if_unavailable sslcacert sslclientcert sslclientkey " + "sslverify mounted", built_in: "architecture augeasversion blockdevices boardmanufacturer boardproductname boardserialnumber cfkey dhcp_servers " + "domain ec2_ ec2_userdata facterversion filesystems ldom fqdn gid hardwareisa hardwaremodel hostname id|0 interfaces " + "ipaddress ipaddress_ ipaddress6 ipaddress6_ iphostnumber is_virtual kernel kernelmajversion kernelrelease kernelversion " + "kernelrelease kernelversion lsbdistcodename lsbdistdescription lsbdistid lsbdistrelease lsbmajdistrelease lsbminordistrelease " + "lsbrelease macaddress macaddress_ macosx_buildversion macosx_productname macosx_productversion macosx_productverson_major " + "macosx_productversion_minor manufacturer memoryfree memorysize netmask metmask_ network_ operatingsystem operatingsystemmajrelease " + "operatingsystemrelease osfamily partitions path physicalprocessorcount processor processorcount productname ps puppetversion " + "rubysitedir rubyversion selinux selinux_config_mode selinux_config_policy selinux_current_mode selinux_current_mode selinux_enforced " + "selinux_policyversion serialnumber sp_ sshdsakey sshecdsakey sshrsakey swapencrypted swapfree swapsize timezone type uniqueid uptime " + "uptime_days uptime_hours uptime_seconds uuid virtual vlans xendomains zfs_version zonenae zones zpool_version" }; - const COMMENT$2 = hljs$1.COMMENT("#", "$"); - const IDENT_RE$6 = "([A-Za-z_]|::)(\\w|::)*"; - const TITLE = hljs$1.inherit(hljs$1.TITLE_MODE, { begin: IDENT_RE$6 }); + const COMMENT = hljs.COMMENT("#", "$"); + const IDENT_RE$2 = "([A-Za-z_]|::)(\\w|::)*"; + const TITLE = hljs.inherit(hljs.TITLE_MODE, { begin: IDENT_RE$2 }); const VARIABLE = { className: "variable", - begin: "\\$" + IDENT_RE$6 + begin: "\\$" + IDENT_RE$2 }; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE, VARIABLE], + contains: [hljs.BACKSLASH_ESCAPE, VARIABLE], variants: [{ begin: /'/, end: /'/ @@ -173585,31 +173789,31 @@ var require_puppet = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Puppet", aliases: ["pp"], contains: [ - COMMENT$2, + COMMENT, VARIABLE, STRING, { beginKeywords: "class", end: "\\{|;", illegal: /=/, - contains: [TITLE, COMMENT$2] + contains: [TITLE, COMMENT] }, { beginKeywords: "define", end: /\{/, contains: [{ className: "section", - begin: hljs$1.IDENT_RE, + begin: hljs.IDENT_RE, endsParent: true }] }, { - begin: hljs$1.IDENT_RE + "\\s+\\{", + begin: hljs.IDENT_RE + "\\s+\\{", returnBegin: true, end: /\S/, contains: [{ className: "keyword", - begin: hljs$1.IDENT_RE, + begin: hljs.IDENT_RE, relevance: .2 }, { begin: /\{/, @@ -173618,14 +173822,14 @@ var require_puppet = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [ STRING, - COMMENT$2, + COMMENT, { begin: "[a-zA-Z_]+\\s*=>", returnBegin: true, end: "=>", contains: [{ className: "attr", - begin: hljs$1.IDENT_RE + begin: hljs.IDENT_RE }] }, { @@ -173647,7 +173851,7 @@ var require_puppet = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/purebasic.js var require_purebasic = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function purebasic(hljs$1) { + function purebasic(hljs) { const STRINGS = { className: "string", begin: "(~)?\"", @@ -173663,7 +173867,7 @@ var require_purebasic = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["pb", "pbi"], keywords: "Align And Array As Break CallDebugger Case CompilerCase CompilerDefault " + "CompilerElse CompilerElseIf CompilerEndIf CompilerEndSelect CompilerError " + "CompilerIf CompilerSelect CompilerWarning Continue Data DataSection Debug " + "DebugLevel Declare DeclareC DeclareCDLL DeclareDLL DeclareModule Default " + "Define Dim DisableASM DisableDebugger DisableExplicit Else ElseIf EnableASM " + "EnableDebugger EnableExplicit End EndDataSection EndDeclareModule EndEnumeration " + "EndIf EndImport EndInterface EndMacro EndModule EndProcedure EndSelect " + "EndStructure EndStructureUnion EndWith Enumeration EnumerationBinary Extends " + "FakeReturn For ForEach ForEver Global Gosub Goto If Import ImportC " + "IncludeBinary IncludeFile IncludePath Interface List Macro MacroExpandedCount " + "Map Module NewList NewMap Next Not Or Procedure ProcedureC " + "ProcedureCDLL ProcedureDLL ProcedureReturn Protected Prototype PrototypeC ReDim " + "Read Repeat Restore Return Runtime Select Shared Static Step Structure " + "StructureUnion Swap Threaded To UndefineMacro Until Until UnuseModule " + "UseModule Wend While With XIncludeFile XOr", contains: [ - hljs$1.COMMENT(";", "$", { relevance: 0 }), + hljs.COMMENT(";", "$", { relevance: 0 }), { className: "function", begin: "\\b(Procedure|Declare)(C|CDLL|DLL)?\\b", @@ -173680,7 +173884,7 @@ var require_purebasic = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "type", begin: "\\.\\w*" }, - hljs$1.UNDERSCORE_TITLE_MODE + hljs.UNDERSCORE_TITLE_MODE ] }, STRINGS, @@ -173694,9 +173898,9 @@ var require_purebasic = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/python.js var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function python$1(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /[\p{XID_Start}_]\p{XID_Continue}*/u; + function python(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /[\p{XID_Start}_]\p{XID_Continue}*/u; const RESERVED_WORDS = [ "and", "as", @@ -173733,7 +173937,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with", "yield" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "__import__", "abs", "all", @@ -173804,7 +174008,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { "vars", "zip" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "__debug__", "Ellipsis", "False", @@ -173812,7 +174016,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NotImplemented", "True" ]; - const TYPES$6 = [ + const TYPES$2 = [ "Any", "Callable", "Coroutine", @@ -173827,12 +174031,12 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Type", "Union" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: /[A-Za-z]\w+|__\w+__/, keyword: RESERVED_WORDS, - built_in: BUILT_INS$6, - literal: LITERALS$6, - type: TYPES$6 + built_in: BUILT_INS$2, + literal: LITERALS$2, + type: TYPES$2 }; const PROMPT = { className: "meta", @@ -173842,7 +174046,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "subst", begin: /\{/, end: /\}/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /#/ }; const LITERAL_BRACKET = { @@ -173851,25 +174055,25 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { begin: /([uU]|[bB]|[rR]|[bB][rR]|[rR][bB])?'''/, end: /'''/, - contains: [hljs$1.BACKSLASH_ESCAPE, PROMPT], + contains: [hljs.BACKSLASH_ESCAPE, PROMPT], relevance: 10 }, { begin: /([uU]|[bB]|[rR]|[bB][rR]|[rR][bB])?"""/, end: /"""/, - contains: [hljs$1.BACKSLASH_ESCAPE, PROMPT], + contains: [hljs.BACKSLASH_ESCAPE, PROMPT], relevance: 10 }, { begin: /([fF][rR]|[rR][fF]|[fF])'''/, end: /'''/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, PROMPT, LITERAL_BRACKET, SUBST @@ -173879,7 +174083,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /([fF][rR]|[rR][fF]|[fF])"""/, end: /"""/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, PROMPT, LITERAL_BRACKET, SUBST @@ -173907,7 +174111,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /([fF][rR]|[rR][fF]|[fF])'/, end: /'/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, LITERAL_BRACKET, SUBST ] @@ -173916,36 +174120,36 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /([fF][rR]|[rR][fF]|[fF])"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, LITERAL_BRACKET, SUBST ] }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ] }; const digitpart = "[0-9](_?[0-9])*"; const pointfloat = `(\\b(${digitpart}))?\\.(${digitpart})|\\b(${digitpart})\\.`; - const lookahead$4 = `\\b|${RESERVED_WORDS.join("|")}`; + const lookahead = `\\b|${RESERVED_WORDS.join("|")}`; const NUMBER = { className: "number", relevance: 0, variants: [ - { begin: `(\\b(${digitpart})|(${pointfloat}))[eE][+-]?(${digitpart})[jJ]?(?=${lookahead$4})` }, + { begin: `(\\b(${digitpart})|(${pointfloat}))[eE][+-]?(${digitpart})[jJ]?(?=${lookahead})` }, { begin: `(${pointfloat})[jJ]?` }, - { begin: `\\b([1-9](_?[0-9])*|0+(_?0)*)[lLjJ]?(?=${lookahead$4})` }, - { begin: `\\b0[bB](_?[01])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b0[oO](_?[0-7])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b0[xX](_?[0-9a-fA-F])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b(${digitpart})[jJ](?=${lookahead$4})` } + { begin: `\\b([1-9](_?[0-9])*|0+(_?0)*)[lLjJ]?(?=${lookahead})` }, + { begin: `\\b0[bB](_?[01])+[lL]?(?=${lookahead})` }, + { begin: `\\b0[oO](_?[0-7])+[lL]?(?=${lookahead})` }, + { begin: `\\b0[xX](_?[0-9a-fA-F])+[lL]?(?=${lookahead})` }, + { begin: `\\b(${digitpart})[jJ](?=${lookahead})` } ] }; const COMMENT_TYPE = { className: "comment", begin: regex.lookahead(/# type:/), end: /$/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [{ begin: /# type:/ }, { begin: /#/, end: /\b\B/, @@ -173963,13 +174167,13 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\)/, excludeBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ "self", PROMPT, NUMBER, STRING, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }] }; @@ -173986,7 +174190,7 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { "ipython" ], unicodeRegex: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /(<\/|\?)|=>/, contains: [ PROMPT, @@ -174005,12 +174209,12 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, STRING, COMMENT_TYPE, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { match: [ /\bdef/, /\s+/, - IDENT_RE$6 + IDENT_RE$2 ], scope: { 1: "keyword", @@ -174022,15 +174226,15 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ match: [ /\bclass/, /\s+/, - IDENT_RE$6, + IDENT_RE$2, /\s*/, /\(\s*/, - IDENT_RE$6, + IDENT_RE$2, /\s*\)/ ] }, { match: [ /\bclass/, /\s+/, - IDENT_RE$6 + IDENT_RE$2 ] }], scope: { 1: "keyword", @@ -174051,13 +174255,13 @@ var require_python = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; } - module.exports = python$1; + module.exports = python; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/python-repl.js var require_python_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function pythonRepl(hljs$1) { + function pythonRepl(hljs) { return { aliases: ["pycon"], contains: [{ @@ -174079,8 +174283,8 @@ var require_python_repl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/q.js var require_q = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function q(hljs$1) { - const KEYWORDS$6 = { + function q(hljs) { + const KEYWORDS$2 = { $pattern: /(`?)[A-Za-z0-9_]+\b/, keyword: "do while select delete by update from", literal: "0b 1b", @@ -174090,11 +174294,11 @@ var require_q = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Q", aliases: ["k", "kdb"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE ] }; } @@ -174104,9 +174308,9 @@ var require_q = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/qml.js var require_qml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function qml(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = { + function qml(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = { keyword: "in of on if for while finally var new function do return void else break catch " + "instanceof with throw case default try this switch continue typeof delete " + "let yield const export super debugger as async await import", literal: "true false null undefined NaN Infinity", built_in: "eval isFinite isNaN parseFloat parseInt decodeURI decodeURIComponent " + "encodeURI encodeURIComponent escape unescape Object Function Boolean Error " + "EvalError InternalError RangeError ReferenceError StopIteration SyntaxError " + "TypeError URIError Number Math Date String RegExp Array Float32Array " + "Float64Array Int16Array Int32Array Int8Array Uint16Array Uint32Array " + "Uint8Array Uint8ClampedArray ArrayBuffer DataView JSON Intl arguments require " + "module console window document Symbol Set Map WeakSet WeakMap Proxy Reflect " + "Behavior bool color coordinate date double enumeration font geocircle georectangle " + "geoshape int list matrix4x4 parent point quaternion real rect " + "size string url variant vector2d vector3d vector4d " + "Promise" @@ -174156,48 +174360,48 @@ var require_qml = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\{/, returnBegin: true, relevance: 0, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: QML_IDENT_RE })] + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: QML_IDENT_RE })] }; return { name: "QML", aliases: ["qt"], case_insensitive: false, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ { className: "meta", begin: /^\s*['"]use (strict|asm)['"]/ }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE, { + contains: [hljs.BACKSLASH_ESCAPE, { className: "subst", begin: "\\$\\{", end: "\\}" }] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "number", variants: [ { begin: "\\b(0[bB][01]+)" }, { begin: "\\b(0[oO][0-7]+)" }, - { begin: hljs$1.C_NUMBER_RE } + { begin: hljs.C_NUMBER_RE } ], relevance: 0 }, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", keywords: "return throw case", contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.REGEXP_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.REGEXP_MODE, { begin: /\s*[);\]]/, @@ -174214,18 +174418,18 @@ var require_qml = /* @__PURE__ */ __commonJSMin(((exports, module) => { beginKeywords: "function", end: /\{/, excludeEnd: true, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: /[A-Za-z$_][0-9A-Za-z$_]*/ }), { + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: /[A-Za-z$_][0-9A-Za-z$_]*/ }), { className: "params", begin: /\(/, end: /\)/, excludeBegin: true, excludeEnd: true, - contains: [hljs$1.C_LINE_COMMENT_MODE, hljs$1.C_BLOCK_COMMENT_MODE] + contains: [hljs.C_LINE_COMMENT_MODE, hljs.C_BLOCK_COMMENT_MODE] }], illegal: /\[|%/ }, { - begin: "\\." + hljs$1.IDENT_RE, + begin: "\\." + hljs.IDENT_RE, relevance: 0 }, ID_ID, @@ -174242,22 +174446,22 @@ var require_qml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/r.js var require_r = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function r$1(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /(?:(?:[a-zA-Z]|\.[._a-zA-Z])[._a-zA-Z0-9]*)|\.(?!\d)/; + function r(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /(?:(?:[a-zA-Z]|\.[._a-zA-Z])[._a-zA-Z0-9]*)|\.(?!\d)/; const NUMBER_TYPES_RE = regex.either(/0[xX][0-9a-fA-F]+\.[0-9a-fA-F]*[pP][+-]?\d+i?/, /0[xX][0-9a-fA-F]+(?:[pP][+-]?\d+)?[Li]?/, /(?:\d+(?:\.\d*)?|\.\d+)(?:[eE][+-]?\d+)?[Li]?/); const OPERATORS_RE = /[=!<>:]=|\|\||&&|:::?|<-|<<-|->>|->|\|>|[-+*\/?!$&|:<=>@^~]|\*\*/; const PUNCTUATION_RE = regex.either(/[()]/, /[{}]/, /\[\[/, /[[\]]/, /\\/, /,/); return { name: "R", keywords: { - $pattern: IDENT_RE$6, + $pattern: IDENT_RE$2, keyword: "function if in break next repeat else for while", literal: "NULL NA TRUE FALSE Inf NaN NA_integer_|10 NA_real_|10 " + "NA_character_|10 NA_complex_|10", built_in: "LETTERS letters month.abb month.name pi T F " + "abs acos acosh all any anyNA Arg as.call as.character " + "as.complex as.double as.environment as.integer as.logical " + "as.null.default as.numeric as.raw asin asinh atan atanh attr " + "attributes baseenv browser c call ceiling class Conj cos cosh " + "cospi cummax cummin cumprod cumsum digamma dim dimnames " + "emptyenv exp expression floor forceAndCall gamma gc.time " + "globalenv Im interactive invisible is.array is.atomic is.call " + "is.character is.complex is.double is.environment is.expression " + "is.finite is.function is.infinite is.integer is.language " + "is.list is.logical is.matrix is.na is.name is.nan is.null " + "is.numeric is.object is.pairlist is.raw is.recursive is.single " + "is.symbol lazyLoadDBfetch length lgamma list log max min " + "missing Mod names nargs nzchar oldClass on.exit pos.to.env " + "proc.time prod quote range Re rep retracemem return round " + "seq_along seq_len seq.int sign signif sin sinh sinpi sqrt " + "standardGeneric substitute sum switch tan tanh tanpi tracemem " + "trigamma trunc unclass untracemem UseMethod xtfrm" }, contains: [ - hljs$1.COMMENT(/#'/, /$/, { contains: [ + hljs.COMMENT(/#'/, /$/, { contains: [ { scope: "doctag", match: /@examples/, @@ -174272,7 +174476,7 @@ var require_r = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /$/, contains: [{ scope: "variable", - variants: [{ match: IDENT_RE$6 }, { match: /`(?:\\.|[^`\\])+`/ }], + variants: [{ match: IDENT_RE$2 }, { match: /`(?:\\.|[^`\\])+`/ }], endsParent: true }] }, @@ -174285,32 +174489,32 @@ var require_r = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: /\\[a-zA-Z]+/ } ] }), - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { scope: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]"(-*)\(/, end: /\)(-*)"/ }), - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]"(-*)\{/, end: /\}(-*)"/ }), - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]"(-*)\[/, end: /\](-*)"/ }), - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]'(-*)\(/, end: /\)(-*)'/ }), - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]'(-*)\{/, end: /\}(-*)'/ }), - hljs$1.END_SAME_AS_BEGIN({ + hljs.END_SAME_AS_BEGIN({ begin: /[rR]'(-*)\[/, end: /\](-*)'/ }), @@ -174359,7 +174563,7 @@ var require_r = /* @__PURE__ */ __commonJSMin(((exports, module) => { { scope: { 3: "operator" }, match: [ - IDENT_RE$6, + IDENT_RE$2, /\s+/, /<-/, /\s+/ @@ -174383,13 +174587,13 @@ var require_r = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }; } - module.exports = r$1; + module.exports = r; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/reasonml.js var require_reasonml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function reasonml(hljs$1) { + function reasonml(hljs) { const BUILT_IN_TYPES = [ "array", "bool", @@ -174479,8 +174683,8 @@ var require_reasonml = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: /\[(\|\|)?\]|\(\)/, relevance: 0 }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.COMMENT(/\/\*/, /\*\//, { illegal: /^(#,\/\/)/ }), + hljs.C_LINE_COMMENT_MODE, + hljs.COMMENT(/\/\*/, /\*\//, { illegal: /^(#,\/\/)/ }), { scope: "symbol", match: /\'[A-Za-z_](?!\')[\w\']*/ @@ -174503,11 +174707,11 @@ var require_reasonml = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: /\s+(\|\||\+[\+\.]?|\*[\*\/\.]?|\/[\.]?|\.\.\.|\|>|&&|===?)\s+/, relevance: 0 }, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { + hljs.inherit(hljs.APOS_STRING_MODE, { scope: "string", relevance: 0 }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }), { scope: "number", variants: [ @@ -174527,16 +174731,16 @@ var require_reasonml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/rib.js var require_rib = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function rib(hljs$1) { + function rib(hljs) { return { name: "RenderMan RIB", keywords: "ArchiveRecord AreaLightSource Atmosphere Attribute AttributeBegin AttributeEnd Basis " + "Begin Blobby Bound Clipping ClippingPlane Color ColorSamples ConcatTransform Cone " + "CoordinateSystem CoordSysTransform CropWindow Curves Cylinder DepthOfField Detail " + "DetailRange Disk Displacement Display End ErrorHandler Exposure Exterior Format " + "FrameAspectRatio FrameBegin FrameEnd GeneralPolygon GeometricApproximation Geometry " + "Hider Hyperboloid Identity Illuminate Imager Interior LightSource " + "MakeCubeFaceEnvironment MakeLatLongEnvironment MakeShadow MakeTexture Matte " + "MotionBegin MotionEnd NuPatch ObjectBegin ObjectEnd ObjectInstance Opacity Option " + "Orientation Paraboloid Patch PatchMesh Perspective PixelFilter PixelSamples " + "PixelVariance Points PointsGeneralPolygons PointsPolygons Polygon Procedural Projection " + "Quantize ReadArchive RelativeDetail ReverseOrientation Rotate Scale ScreenWindow " + "ShadingInterpolation ShadingRate Shutter Sides Skew SolidBegin SolidEnd Sphere " + "SubdivisionMesh Surface TextureCoordinates Torus Transform TransformBegin TransformEnd " + "TransformPoints Translate TrimCurve WorldBegin WorldEnd", illegal: " { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/roboconf.js var require_roboconf = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function roboconf(hljs$1) { + function roboconf(hljs) { const IDENTIFIER = "[a-zA-Z-_][^\\n{]+\\{"; const PROPERTY = { className: "attribute", @@ -174575,7 +174779,7 @@ var require_roboconf = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "^facet " + IDENTIFIER, end: /\}/, keywords: "facet", - contains: [PROPERTY, hljs$1.HASH_COMMENT_MODE] + contains: [PROPERTY, hljs.HASH_COMMENT_MODE] }, { begin: "^\\s*instance of " + IDENTIFIER, @@ -174585,15 +174789,15 @@ var require_roboconf = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ "self", PROPERTY, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }, { begin: "^" + IDENTIFIER, end: /\}/, - contains: [PROPERTY, hljs$1.HASH_COMMENT_MODE] + contains: [PROPERTY, hljs.HASH_COMMENT_MODE] }, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }; } @@ -174603,11 +174807,11 @@ var require_roboconf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/routeros.js var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function routeros(hljs$1) { + function routeros(hljs) { const STATEMENTS = "foreach do while for if from to step else on-error and or not in"; const GLOBAL_COMMANDS = "global local beep delay put len typeof pick log time set find environment terminal error execute parse resolve toarray tobool toid toip toip6 tonum tostr totime"; const COMMON_COMMANDS = "add remove enable disable set get print export edit find run debug error info warning"; - const LITERALS$6 = "true false yes no nothing nil null"; + const LITERALS$2 = "true false yes no nothing nil null"; const OBJECTS = "traffic-flow traffic-generator firewall scheduler aaa accounting address-list address align area bandwidth-server bfd bgp bridge client clock community config connection console customer default dhcp-client dhcp-server discovery dns e-mail ethernet filter firmware gps graphing group hardware health hotspot identity igmp-proxy incoming instance interface ip ipsec ipv6 irq l2tp-server lcd ldp logging mac-server mac-winbox mangle manual mirror mme mpls nat nd neighbor network note ntp ospf ospf-v3 ovpn-server page peer pim ping policy pool port ppp pppoe-client pptp-server prefix profile proposal proxy queue radius resource rip ripng route routing screen script security-profiles server service service-port settings shares smb sms sniffer snmp snooper socks sstp-server system tool tracking type upgrade upnp user-manager users user vlan secret vrrp watchdog web-access wireless pptp pppoe lan wan layer7-protocol lease simple raw"; const VAR = { className: "variable", @@ -174618,13 +174822,13 @@ var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, VAR, { className: "variable", begin: /\$\(/, end: /\)/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] } ] }; @@ -174639,7 +174843,7 @@ var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, keywords: { $pattern: /:?[\w-]+/, - literal: LITERALS$6, + literal: LITERALS$2, keyword: STATEMENTS + " :" + STATEMENTS.split(" ").join(" :") + " :" + GLOBAL_COMMANDS.split(" ").join(" :") }, contains: [ @@ -174660,7 +174864,7 @@ var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { ], illegal: /./ }, - hljs$1.COMMENT("^#", "$"), + hljs.COMMENT("^#", "$"), QUOTE_STRING, APOS_STRING, VAR, @@ -174681,7 +174885,7 @@ var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { VAR, { className: "literal", - begin: "\\b(" + LITERALS$6.split(" ").join("|") + ")\\b" + begin: "\\b(" + LITERALS$2.split(" ").join("|") + ")\\b" }, { begin: /("[^"]*"|[^\s{}[\]]+)/ } ] @@ -174715,8 +174919,8 @@ var require_routeros = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/rsl.js var require_rsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function rsl(hljs$1) { - const BUILT_INS$6 = [ + function rsl(hljs) { + const BUILT_INS$2 = [ "abs", "acos", "ambient", @@ -174793,7 +174997,7 @@ var require_rsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "ycomp", "zcomp" ]; - const TYPES$6 = [ + const TYPES$2 = [ "matrix", "float", "color", @@ -174801,7 +175005,7 @@ var require_rsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "normal", "vector" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "while", "for", "if", @@ -174816,7 +175020,7 @@ var require_rsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /(surface|displacement|light|volume|imager)/, /\s+/, - hljs$1.IDENT_RE + hljs.IDENT_RE ], scope: { 1: "keyword", @@ -174826,17 +175030,17 @@ var require_rsl = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "RenderMan RSL", keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6, - type: TYPES$6 + keyword: KEYWORDS$2, + built_in: BUILT_INS$2, + type: TYPES$2 }, illegal: " { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/ruleslanguage.js var require_ruleslanguage = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function ruleslanguage(hljs$1) { + function ruleslanguage(hljs) { return { name: "Oracle Rules Language", keywords: { @@ -174864,11 +175068,11 @@ var require_ruleslanguage = /* @__PURE__ */ __commonJSMin(((exports, module) => built_in: "IDENTIFIER OPTIONS XML_ELEMENT XML_OP XML_ELEMENT_OF DOMDOCCREATE DOMDOCLOADFILE DOMDOCLOADXML " + "DOMDOCSAVEFILE DOMDOCGETROOT DOMDOCADDPI DOMNODEGETNAME DOMNODEGETTYPE DOMNODEGETVALUE DOMNODEGETCHILDCT " + "DOMNODEGETFIRSTCHILD DOMNODEGETSIBLING DOMNODECREATECHILDELEMENT DOMNODESETATTRIBUTE " + "DOMNODEGETCHILDELEMENTCT DOMNODEGETFIRSTCHILDELEMENT DOMNODEGETSIBLINGELEMENT DOMNODEGETATTRIBUTECT " + "DOMNODEGETATTRIBUTEI DOMNODEGETATTRIBUTEBYNAME DOMNODEGETBYNAME" }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { className: "literal", variants: [{ @@ -174886,18 +175090,18 @@ var require_ruleslanguage = /* @__PURE__ */ __commonJSMin(((exports, module) => //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/rust.js var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function rust(hljs$1) { - const regex = hljs$1.regex; + function rust(hljs) { + const regex = hljs.regex; const RAW_IDENTIFIER = /(r#)?/; - const UNDERSCORE_IDENT_RE$2 = regex.concat(RAW_IDENTIFIER, hljs$1.UNDERSCORE_IDENT_RE); - const IDENT_RE$6 = regex.concat(RAW_IDENTIFIER, hljs$1.IDENT_RE); + const UNDERSCORE_IDENT_RE = regex.concat(RAW_IDENTIFIER, hljs.UNDERSCORE_IDENT_RE); + const IDENT_RE$2 = regex.concat(RAW_IDENTIFIER, hljs.IDENT_RE); const FUNCTION_INVOKE = { className: "title.function.invoke", relevance: 0, - begin: regex.concat(/\b/, /(?!let|for|while|if|else|match\b)/, IDENT_RE$6, regex.lookahead(/\s*\(/)) + begin: regex.concat(/\b/, /(?!let|for|while|if|else|match\b)/, IDENT_RE$2, regex.lookahead(/\s*\(/)) }; const NUMBER_SUFFIX = "([ui](8|16|32|64|128|size)|f(32|64))?"; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "abstract", "as", "async", @@ -174951,7 +175155,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { "while", "yield" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "Some", @@ -175024,7 +175228,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { "assert_ne!", "debug_assert_ne!" ]; - const TYPES$6 = [ + const TYPES$2 = [ "i8", "i16", "i32", @@ -175052,17 +175256,17 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Rust", aliases: ["rs"], keywords: { - $pattern: hljs$1.IDENT_RE + "!?", - type: TYPES$6, - keyword: KEYWORDS$6, - literal: LITERALS$6, + $pattern: hljs.IDENT_RE + "!?", + type: TYPES$2, + keyword: KEYWORDS$2, + literal: LITERALS$2, built_in: BUILTINS }, illegal: " { begin: [ /fn/, /\s+/, - UNDERSCORE_IDENT_RE$2 + UNDERSCORE_IDENT_RE ], className: { 1: "keyword", @@ -175110,7 +175314,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: /"/, end: /"/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }] }, { @@ -175118,7 +175322,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { /let/, /\s+/, /(?:mut\s+)?/, - UNDERSCORE_IDENT_RE$2 + UNDERSCORE_IDENT_RE ], className: { 1: "keyword", @@ -175130,7 +175334,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /for/, /\s+/, - UNDERSCORE_IDENT_RE$2, + UNDERSCORE_IDENT_RE, /\s+/, /in/ ], @@ -175144,7 +175348,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /type/, /\s+/, - UNDERSCORE_IDENT_RE$2 + UNDERSCORE_IDENT_RE ], className: { 1: "keyword", @@ -175155,7 +175359,7 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /(?:trait|enum|struct|union|impl|for)/, /\s+/, - UNDERSCORE_IDENT_RE$2 + UNDERSCORE_IDENT_RE ], className: { 1: "keyword", @@ -175163,11 +175367,11 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }, { - begin: hljs$1.IDENT_RE + "::", + begin: hljs.IDENT_RE + "::", keywords: { keyword: "Self", built_in: BUILTINS, - type: TYPES$6 + type: TYPES$2 } }, { @@ -175185,8 +175389,8 @@ var require_rust = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/sas.js var require_sas = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function sas(hljs$1) { - const regex = hljs$1.regex; + function sas(hljs) { + const regex = hljs.regex; const SAS_KEYWORDS = [ "do", "if", @@ -175642,7 +175846,7 @@ var require_sas = /* @__PURE__ */ __commonJSMin(((exports, module) => { "while", "window" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "null", "missing", "_all_", @@ -175660,7 +175864,7 @@ var require_sas = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "SAS", case_insensitive: true, keywords: { - literal: LITERALS$6, + literal: LITERALS$2, keyword: SAS_KEYWORDS }, contains: [ @@ -175709,10 +175913,10 @@ var require_sas = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "string", - variants: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + variants: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, - hljs$1.COMMENT("\\*", ";"), - hljs$1.C_BLOCK_COMMENT_MODE + hljs.COMMENT("\\*", ";"), + hljs.C_BLOCK_COMMENT_MODE ] }; } @@ -175722,8 +175926,8 @@ var require_sas = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/scala.js var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function scala(hljs$1) { - const regex = hljs$1.regex; + function scala(hljs) { + const regex = hljs.regex; const ANNOTATION = { className: "meta", begin: "@[A-Za-z]+" @@ -175746,13 +175950,13 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: "[a-z]+\"", end: "\"", illegal: "\\n", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }, { className: "string", @@ -175779,8 +175983,8 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[:={\[\n;]/, excludeEnd: true, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { beginKeywords: "extends with", relevance: 10 @@ -175793,8 +175997,8 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [ TYPE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, { @@ -175806,8 +176010,8 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: [ TYPE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }, NAME @@ -175879,13 +176083,13 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [ USING_DIRECTIVE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRING, TYPE, METHOD, CLASS, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, EXTENSION, END, ...INLINE_MODES, @@ -175900,11 +176104,11 @@ var require_scala = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/scheme.js var require_scheme = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function scheme(hljs$1) { + function scheme(hljs) { const SCHEME_IDENT_RE = "[^\\(\\)\\[\\]\\{\\}\",'`;#|\\\\\\s]+"; const SCHEME_SIMPLE_NUMBER_RE = "(-|\\+)?\\d+([./]\\d+)?"; const SCHEME_COMPLEX_NUMBER_RE = SCHEME_SIMPLE_NUMBER_RE + "[+\\-]" + SCHEME_SIMPLE_NUMBER_RE + "i"; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: SCHEME_IDENT_RE, built_in: "case-lambda call/cc class define-class exit-handler field import " + "inherit init-field interface let*-values let-values let/ec mixin " + "opt-lambda override protect provide public rename require " + "require-for-syntax syntax syntax-case syntax-error unit/sig unless " + "when with-syntax and begin call-with-current-continuation " + "call-with-input-file call-with-output-file case cond define " + "define-syntax delay do dynamic-wind else for-each if lambda let let* " + "let-syntax letrec letrec-syntax map or syntax-rules ' * + , ,@ - ... / " + "; < <= = => > >= ` abs acos angle append apply asin assoc assq assv atan " + "boolean? caar cadr call-with-input-file call-with-output-file " + "call-with-values car cdddar cddddr cdr ceiling char->integer " + "char-alphabetic? char-ci<=? char-ci=? char-ci>? " + "char-downcase char-lower-case? char-numeric? char-ready? char-upcase " + "char-upper-case? char-whitespace? char<=? char=? char>? " + "char? close-input-port close-output-port complex? cons cos " + "current-input-port current-output-port denominator display eof-object? " + "eq? equal? eqv? eval even? exact->inexact exact? exp expt floor " + "force gcd imag-part inexact->exact inexact? input-port? integer->char " + "integer? interaction-environment lcm length list list->string " + "list->vector list-ref list-tail list? load log magnitude make-polar " + "make-rectangular make-string make-vector max member memq memv min " + "modulo negative? newline not null-environment null? number->string " + "number? numerator odd? open-input-file open-output-file output-port? " + "pair? peek-char port? positive? procedure? quasiquote quote quotient " + "rational? rationalize read read-char real-part real? remainder reverse " + "round scheme-report-environment set! set-car! set-cdr! sin sqrt string " + "string->list string->number string->symbol string-append string-ci<=? " + "string-ci=? string-ci>? string-copy " + "string-fill! string-length string-ref string-set! string<=? string=? string>? string? substring symbol->string symbol? " + "tan transcript-off transcript-on truncate values vector " + "vector->list vector-fill! vector-length vector-ref vector-set! " + "with-input-from-file with-output-to-file write write-char zero?" }; @@ -175928,8 +176132,8 @@ var require_scheme = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "#x[0-9a-f]+(/[0-9a-f]+)?" } ] }; - const STRING = hljs$1.QUOTE_STRING_MODE; - const COMMENT_MODES = [hljs$1.COMMENT(";", "$", { relevance: 0 }), hljs$1.COMMENT("#\\|", "\\|#")]; + const STRING = hljs.QUOTE_STRING_MODE; + const COMMENT_MODES = [hljs.COMMENT(";", "$", { relevance: 0 }), hljs.COMMENT("#\\|", "\\|#")]; const IDENT = { begin: SCHEME_IDENT_RE, relevance: 0 @@ -175961,7 +176165,7 @@ var require_scheme = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "name", relevance: 0, begin: SCHEME_IDENT_RE, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; const LAMBDA = { begin: /lambda/, @@ -176007,7 +176211,7 @@ var require_scheme = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["scm"], illegal: /\S/, contains: [ - hljs$1.SHEBANG(), + hljs.SHEBANG(), NUMBER, STRING, QUOTED_IDENT, @@ -176022,12 +176226,12 @@ var require_scheme = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/scilab.js var require_scilab = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function scilab(hljs$1) { - const COMMON_CONTAINS = [hljs$1.C_NUMBER_MODE, { + function scilab(hljs) { + const COMMON_CONTAINS = [hljs.C_NUMBER_MODE, { className: "string", begin: "'|\"", end: "'|\"", - contains: [hljs$1.BACKSLASH_ESCAPE, { begin: "''" }] + contains: [hljs.BACKSLASH_ESCAPE, { begin: "''" }] }]; return { name: "Scilab", @@ -176044,7 +176248,7 @@ var require_scilab = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "function", beginKeywords: "function", end: "$", - contains: [hljs$1.UNDERSCORE_TITLE_MODE, { + contains: [hljs.UNDERSCORE_TITLE_MODE, { className: "params", begin: "\\(", end: "\\)" @@ -176060,7 +176264,7 @@ var require_scilab = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, contains: COMMON_CONTAINS }, - hljs$1.COMMENT("//", "$") + hljs.COMMENT("//", "$") ].concat(COMMON_CONTAINS) }; } @@ -176070,13 +176274,13 @@ var require_scilab = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/scss.js var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const MODES$3 = (hljs$1) => { + const MODES = (hljs) => { return { IMPORTANT: { scope: "meta", begin: "!important" }, - BLOCK_COMMENT: hljs$1.C_BLOCK_COMMENT_MODE, + BLOCK_COMMENT: hljs.C_BLOCK_COMMENT_MODE, HEXCOLOR: { scope: "number", begin: /#(([0-9a-fA-F]{3,4})|(([0-9a-fA-F]{2}){3,4}))\b/ @@ -176090,11 +176294,11 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[/, end: /\]/, illegal: "$", - contains: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + contains: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, CSS_NUMBER_MODE: { scope: "number", - begin: hljs$1.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", + begin: hljs.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", relevance: 0 }, CSS_VARIABLE: { @@ -176103,7 +176307,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; }; - const HTML_TAGS$2 = [ + const HTML_TAGS = [ "a", "abbr", "address", @@ -176182,7 +176386,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "var", "video" ]; - const SVG_TAGS$2 = [ + const SVG_TAGS = [ "defs", "g", "marker", @@ -176225,8 +176429,8 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "foreignObject", "clipPath" ]; - const TAGS$2 = [...HTML_TAGS$2, ...SVG_TAGS$2]; - const MEDIA_FEATURES$2 = [ + const TAGS = [...HTML_TAGS, ...SVG_TAGS]; + const MEDIA_FEATURES = [ "any-hover", "any-pointer", "aspect-ratio", @@ -176261,7 +176465,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "min-height", "max-height" ].sort().reverse(); - const PSEUDO_CLASSES$2 = [ + const PSEUDO_CLASSES = [ "active", "any-link", "blank", @@ -176322,7 +176526,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "visited", "where" ].sort().reverse(); - const PSEUDO_ELEMENTS$2 = [ + const PSEUDO_ELEMENTS = [ "after", "backdrop", "before", @@ -176338,7 +176542,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "slotted", "spelling-error" ].sort().reverse(); - const ATTRIBUTES$2 = [ + const ATTRIBUTES = [ "accent-color", "align-content", "align-items", @@ -176855,16 +177059,16 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { "zoom" ].sort().reverse(); /** @type LanguageFn */ - function scss(hljs$1) { - const modes = MODES$3(hljs$1); - const PSEUDO_ELEMENTS$1$1 = PSEUDO_ELEMENTS$2; - const PSEUDO_CLASSES$1$1 = PSEUDO_CLASSES$2; + function scss(hljs) { + const modes = MODES(hljs); + const PSEUDO_ELEMENTS$1 = PSEUDO_ELEMENTS; + const PSEUDO_CLASSES$1 = PSEUDO_CLASSES; const AT_IDENTIFIER = "@[a-z-]+"; const AT_MODIFIERS = "and or not only"; - const IDENT_RE$6 = "[a-zA-Z-][a-zA-Z0-9_-]*"; + const IDENT_RE$2 = "[a-zA-Z-][a-zA-Z0-9_-]*"; const VARIABLE = { className: "variable", - begin: "(\\$" + IDENT_RE$6 + ")\\b", + begin: "(\\$" + IDENT_RE$2 + ")\\b", relevance: 0 }; return { @@ -176872,8 +177076,8 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, illegal: "[=/|']", contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, modes.CSS_NUMBER_MODE, { className: "selector-id", @@ -176888,16 +177092,16 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { modes.ATTRIBUTE_SELECTOR_MODE, { className: "selector-tag", - begin: "\\b(" + TAGS$2.join("|") + ")\\b", + begin: "\\b(" + TAGS.join("|") + ")\\b", relevance: 0 }, { className: "selector-pseudo", - begin: ":(" + PSEUDO_CLASSES$1$1.join("|") + ")" + begin: ":(" + PSEUDO_CLASSES$1.join("|") + ")" }, { className: "selector-pseudo", - begin: ":(:)?(" + PSEUDO_ELEMENTS$1$1.join("|") + ")" + begin: ":(:)?(" + PSEUDO_ELEMENTS$1.join("|") + ")" }, VARIABLE, { @@ -176908,7 +177112,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { modes.CSS_VARIABLE, { className: "attribute", - begin: "\\b(" + ATTRIBUTES$2.join("|") + ")\\b" + begin: "\\b(" + ATTRIBUTES.join("|") + ")\\b" }, { begin: "\\b(whitespace|wait|w-resize|visible|vertical-text|vertical-ideographic|uppercase|upper-roman|upper-alpha|underline|transparent|top|thin|thick|text|text-top|text-bottom|tb-rl|table-header-group|table-footer-group|sw-resize|super|strict|static|square|solid|small-caps|separate|se-resize|scroll|s-resize|rtl|row-resize|ridge|right|repeat|repeat-y|repeat-x|relative|progress|pointer|overline|outside|outset|oblique|nowrap|not-allowed|normal|none|nw-resize|no-repeat|no-drop|newspaper|ne-resize|n-resize|move|middle|medium|ltr|lr-tb|lowercase|lower-roman|lower-alpha|loose|list-item|line|line-through|line-edge|lighter|left|keep-all|justify|italic|inter-word|inter-ideograph|inside|inset|inline|inline-block|inherit|inactive|ideograph-space|ideograph-parenthesis|ideograph-numeric|ideograph-alpha|horizontal|hidden|help|hand|groove|fixed|ellipsis|e-resize|double|dotted|distribute|distribute-space|distribute-letter|distribute-all-lines|disc|disabled|default|decimal|dashed|crosshair|collapse|col-resize|circle|char|center|capitalize|break-word|break-all|bottom|both|bolder|bold|block|bidi-override|below|baseline|auto|always|all-scroll|absolute|table|table-cell)\\b" }, { @@ -176920,8 +177124,8 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { VARIABLE, modes.HEXCOLOR, modes.CSS_NUMBER_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, modes.IMPORTANT, modes.FUNCTION_DISPATCH ] @@ -176940,7 +177144,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: { $pattern: /[a-z-]+/, keyword: AT_MODIFIERS, - attribute: MEDIA_FEATURES$2.join(" ") + attribute: MEDIA_FEATURES.join(" ") }, contains: [ { @@ -176952,8 +177156,8 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "attribute" }, VARIABLE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, modes.HEXCOLOR, modes.CSS_NUMBER_MODE ] @@ -176969,7 +177173,7 @@ var require_scss = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/shell.js var require_shell = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function shell(hljs$1) { + function shell(hljs) { return { name: "Shell Session", aliases: ["console", "shellsession"], @@ -176989,7 +177193,7 @@ var require_shell = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/smali.js var require_smali = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function smali(hljs$1) { + function smali(hljs) { const smali_instr_low_prio = [ "add", "and", @@ -177062,7 +177266,7 @@ var require_smali = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: "\"", relevance: 0 }, - hljs$1.COMMENT("#", "$", { relevance: 0 }), + hljs.COMMENT("#", "$", { relevance: 0 }), { className: "keyword", variants: [ @@ -177107,7 +177311,7 @@ var require_smali = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/smalltalk.js var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function smalltalk(hljs$1) { + function smalltalk(hljs) { const VAR_IDENT_RE = "[a-z][a-zA-Z0-9_]*"; const CHAR = { className: "string", @@ -177115,7 +177319,7 @@ var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const SYMBOL = { className: "symbol", - begin: "#" + hljs$1.UNDERSCORE_IDENT_RE + begin: "#" + hljs.UNDERSCORE_IDENT_RE }; return { name: "Smalltalk", @@ -177129,8 +177333,8 @@ var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { "thisContext" ], contains: [ - hljs$1.COMMENT("\"", "\""), - hljs$1.APOS_STRING_MODE, + hljs.COMMENT("\"", "\""), + hljs.APOS_STRING_MODE, { className: "type", begin: "\\b[A-Z][A-Za-z0-9_]*", @@ -177140,7 +177344,7 @@ var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: VAR_IDENT_RE + ":", relevance: 0 }, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, SYMBOL, CHAR, { @@ -177154,9 +177358,9 @@ var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "#\\(", end: "\\)", contains: [ - hljs$1.APOS_STRING_MODE, + hljs.APOS_STRING_MODE, CHAR, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, SYMBOL ] } @@ -177169,7 +177373,7 @@ var require_smalltalk = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/sml.js var require_sml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function sml(hljs$1) { + function sml(hljs) { return { name: "SML (Standard ML)", aliases: ["ml"], @@ -177186,7 +177390,7 @@ var require_sml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[(\|\|)?\]|\(\)/, relevance: 0 }, - hljs$1.COMMENT("\\(\\*", "\\*\\)", { contains: ["self"] }), + hljs.COMMENT("\\(\\*", "\\*\\)", { contains: ["self"] }), { className: "symbol", begin: "'[A-Za-z_](?!')[\\w']*" @@ -177201,11 +177405,11 @@ var require_sml = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }, { begin: "[a-z_]\\w*'[\\w']*" }, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { + hljs.inherit(hljs.APOS_STRING_MODE, { className: "string", relevance: 0 }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }), { className: "number", begin: "\\b(0[xX][a-fA-F0-9_]+[Lln]?|" + "0[oO][0-7_]+[Lln]?|" + "0[bB][01_]+[Lln]?|" + "[0-9][0-9_]*([Lln]|(\\.[0-9_]*)?([eE][-+]?[0-9_]+)?)?)", @@ -177221,7 +177425,7 @@ var require_sml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/sqf.js var require_sqf = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function sqf(hljs$1) { + function sqf(hljs) { const VARIABLE = { className: "variable", begin: /\b_+[a-zA-Z]\w*/ @@ -177248,7 +177452,7 @@ var require_sqf = /* @__PURE__ */ __commonJSMin(((exports, module) => { }] }] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "break", "breakWith", "breakOut", @@ -179778,28 +179982,28 @@ var require_sqf = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\\\n/, relevance: 0 }, - hljs$1.inherit(STRINGS, { className: "string" }), + hljs.inherit(STRINGS, { className: "string" }), { begin: /<[^\n>]*>/, end: /$/, illegal: "\\n" }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; return { name: "SQF", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, built_in: BUILT_IN, literal: LITERAL }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.NUMBER_MODE, VARIABLE, FUNCTION, STRINGS, @@ -179823,9 +180027,9 @@ var require_sqf = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/sql.js var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function sql$1(hljs$1) { - const regex = hljs$1.regex; - const COMMENT_MODE = hljs$1.COMMENT("--", "$"); + function sql(hljs) { + const regex = hljs.regex; + const COMMENT_MODE = hljs.COMMENT("--", "$"); const STRING = { scope: "string", variants: [{ @@ -179839,7 +180043,7 @@ var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /"/, contains: [{ match: /""/ }] }; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "unknown" @@ -179850,7 +180054,7 @@ var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { "with timezone", "without timezone" ]; - const TYPES$6 = [ + const TYPES$2 = [ "bigint", "binary", "blob", @@ -180380,7 +180584,7 @@ var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { "breadth first" ]; const FUNCTIONS = RESERVED_FUNCTIONS; - const KEYWORDS$6 = [...RESERVED_WORDS, ...NON_RESERVED_WORDS].filter((keyword) => { + const KEYWORDS$2 = [...RESERVED_WORDS, ...NON_RESERVED_WORDS].filter((keyword) => { return !RESERVED_FUNCTIONS.includes(keyword); }); const VARIABLE = { @@ -180426,9 +180630,9 @@ var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /[{}]|<\//, keywords: { $pattern: /\b[\w\.]+/, - keyword: reduceRelevancy(KEYWORDS$6, { when: (x$2) => x$2.length < 3 }), - literal: LITERALS$6, - type: TYPES$6, + keyword: reduceRelevancy(KEYWORDS$2, { when: (x$2) => x$2.length < 3 }), + literal: LITERALS$2, + type: TYPES$2, built_in: POSSIBLE_WITHOUT_PARENS }, contains: [ @@ -180441,21 +180645,21 @@ var require_sql = /* @__PURE__ */ __commonJSMin(((exports, module) => { VARIABLE, STRING, QUOTED_IDENTIFIER, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, COMMENT_MODE, OPERATOR ] }; } - module.exports = sql$1; + module.exports = sql; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/stan.js var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function stan(hljs$1) { - const regex = hljs$1.regex; + function stan(hljs) { + const regex = hljs.regex; const BLOCKS = [ "functions", "model", @@ -180475,7 +180679,7 @@ var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { "continue", "return" ]; - const TYPES$6 = [ + const TYPES$2 = [ "array", "tuple", "complex", @@ -180822,7 +181026,7 @@ var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { "wishart", "wishart_cholesky" ]; - const BLOCK_COMMENT = hljs$1.COMMENT(/\/\*/, /\*\//, { + const BLOCK_COMMENT = hljs.COMMENT(/\/\*/, /\*\//, { relevance: 0, contains: [{ scope: "doctag", @@ -180836,7 +181040,7 @@ var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ match: /[a-z][a-z-._]+/, scope: "string" - }, hljs$1.C_LINE_COMMENT_MODE] + }, hljs.C_LINE_COMMENT_MODE] }; const RANGE_CONSTRAINTS = [ "lower", @@ -180848,16 +181052,16 @@ var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "Stan", aliases: ["stanfuncs"], keywords: { - $pattern: hljs$1.IDENT_RE, + $pattern: hljs.IDENT_RE, title: BLOCKS, - type: TYPES$6, + type: TYPES$2, keyword: STATEMENTS, built_in: FUNCTIONS }, contains: [ - hljs$1.C_LINE_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, INCLUDE, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, BLOCK_COMMENT, { scope: "built_in", @@ -180928,7 +181132,7 @@ var require_stan = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/stata.js var require_stata = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function stata(hljs$1) { + function stata(hljs) { return { name: "Stata", aliases: ["do", "ado"], @@ -180952,9 +181156,9 @@ var require_stata = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "built_in", variants: [{ begin: "\\b(abs|acos|asin|atan|atan2|atanh|ceil|cloglog|comb|cos|digamma|exp|floor|invcloglog|invlogit|ln|lnfact|lnfactorial|lngamma|log|log10|max|min|mod|reldif|round|sign|sin|sqrt|sum|tan|tanh|trigamma|trunc|betaden|Binomial|binorm|binormal|chi2|chi2tail|dgammapda|dgammapdada|dgammapdadx|dgammapdx|dgammapdxdx|F|Fden|Ftail|gammaden|gammap|ibeta|invbinomial|invchi2|invchi2tail|invF|invFtail|invgammap|invibeta|invnchi2|invnFtail|invnibeta|invnorm|invnormal|invttail|nbetaden|nchi2|nFden|nFtail|nibeta|norm|normal|normalden|normd|npnchi2|tden|ttail|uniform|abbrev|char|index|indexnot|length|lower|ltrim|match|plural|proper|real|regexm|regexr|regexs|reverse|rtrim|string|strlen|strlower|strltrim|strmatch|strofreal|strpos|strproper|strreverse|strrtrim|strtrim|strupper|subinstr|subinword|substr|trim|upper|word|wordcount|_caller|autocode|byteorder|chop|clip|cond|e|epsdouble|epsfloat|group|inlist|inrange|irecode|matrix|maxbyte|maxdouble|maxfloat|maxint|maxlong|mi|minbyte|mindouble|minfloat|minint|minlong|missing|r|recode|replay|return|s|scalar|d|date|day|dow|doy|halfyear|mdy|month|quarter|week|year|d|daily|dofd|dofh|dofm|dofq|dofw|dofy|h|halfyearly|hofd|m|mofd|monthly|q|qofd|quarterly|tin|twithin|w|weekly|wofd|y|yearly|yh|ym|yofd|yq|yw|cholesky|colnumb|colsof|corr|det|diag|diag0cnt|el|get|hadamard|I|inv|invsym|issym|issymmetric|J|matmissing|matuniform|mreldif|nullmat|rownumb|rowsof|sweep|syminv|trace|vec|vecdiag)(?=\\()" }] }, - hljs$1.COMMENT("^[ ]*\\*.*$", false), - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.COMMENT("^[ ]*\\*.*$", false), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ] }; } @@ -180964,7 +181168,7 @@ var require_stata = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/step21.js var require_step21 = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function step21(hljs$1) { + function step21(hljs) { const STEP21_IDENT_RE = "[A-Z_][A-Z0-9_.]*"; const STEP21_KEYWORDS = { $pattern: STEP21_IDENT_RE, @@ -180996,12 +181200,12 @@ var require_step21 = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ STEP21_START, STEP21_CLOSE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT("/\\*\\*!", "\\*/"), - hljs$1.C_NUMBER_MODE, - hljs$1.inherit(hljs$1.APOS_STRING_MODE, { illegal: null }), - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null }), + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT("/\\*\\*!", "\\*/"), + hljs.C_NUMBER_MODE, + hljs.inherit(hljs.APOS_STRING_MODE, { illegal: null }), + hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null }), { className: "string", begin: "'", @@ -181024,13 +181228,13 @@ var require_step21 = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/stylus.js var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const MODES$2 = (hljs$1) => { + const MODES = (hljs) => { return { IMPORTANT: { scope: "meta", begin: "!important" }, - BLOCK_COMMENT: hljs$1.C_BLOCK_COMMENT_MODE, + BLOCK_COMMENT: hljs.C_BLOCK_COMMENT_MODE, HEXCOLOR: { scope: "number", begin: /#(([0-9a-fA-F]{3,4})|(([0-9a-fA-F]{2}){3,4}))\b/ @@ -181044,11 +181248,11 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\[/, end: /\]/, illegal: "$", - contains: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + contains: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, CSS_NUMBER_MODE: { scope: "number", - begin: hljs$1.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", + begin: hljs.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", relevance: 0 }, CSS_VARIABLE: { @@ -181057,7 +181261,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; }; - const HTML_TAGS$1 = [ + const HTML_TAGS = [ "a", "abbr", "address", @@ -181136,7 +181340,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "var", "video" ]; - const SVG_TAGS$1 = [ + const SVG_TAGS = [ "defs", "g", "marker", @@ -181179,8 +181383,8 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "foreignObject", "clipPath" ]; - const TAGS$1 = [...HTML_TAGS$1, ...SVG_TAGS$1]; - const MEDIA_FEATURES$1 = [ + const TAGS = [...HTML_TAGS, ...SVG_TAGS]; + const MEDIA_FEATURES = [ "any-hover", "any-pointer", "aspect-ratio", @@ -181215,7 +181419,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "min-height", "max-height" ].sort().reverse(); - const PSEUDO_CLASSES$1 = [ + const PSEUDO_CLASSES = [ "active", "any-link", "blank", @@ -181276,7 +181480,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "visited", "where" ].sort().reverse(); - const PSEUDO_ELEMENTS$1 = [ + const PSEUDO_ELEMENTS = [ "after", "backdrop", "before", @@ -181292,7 +181496,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "slotted", "spelling-error" ].sort().reverse(); - const ATTRIBUTES$1 = [ + const ATTRIBUTES = [ "accent-color", "align-content", "align-items", @@ -181809,12 +182013,12 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { "zoom" ].sort().reverse(); /** @type LanguageFn */ - function stylus(hljs$1) { - const modes = MODES$2(hljs$1); + function stylus(hljs) { + const modes = MODES(hljs); const AT_MODIFIERS = "and or not only"; const VARIABLE = { className: "variable", - begin: "\\$" + hljs$1.IDENT_RE + begin: "\\$" + hljs.IDENT_RE }; const AT_KEYWORDS = [ "charset", @@ -181853,10 +182057,10 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: "if else for in", illegal: "(" + ILLEGAL.join("|") + ")", contains: [ - hljs$1.QUOTE_STRING_MODE, - hljs$1.APOS_STRING_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, modes.HEXCOLOR, { begin: "\\.[a-zA-Z][a-zA-Z0-9_-]*" + LOOKAHEAD_TAG_END, @@ -181867,16 +182071,16 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "selector-id" }, { - begin: "\\b(" + TAGS$1.join("|") + ")" + LOOKAHEAD_TAG_END, + begin: "\\b(" + TAGS.join("|") + ")" + LOOKAHEAD_TAG_END, className: "selector-tag" }, { className: "selector-pseudo", - begin: "&?:(" + PSEUDO_CLASSES$1.join("|") + ")" + LOOKAHEAD_TAG_END + begin: "&?:(" + PSEUDO_CLASSES.join("|") + ")" + LOOKAHEAD_TAG_END }, { className: "selector-pseudo", - begin: "&?:(:)?(" + PSEUDO_ELEMENTS$1.join("|") + ")" + LOOKAHEAD_TAG_END + begin: "&?:(:)?(" + PSEUDO_ELEMENTS.join("|") + ")" + LOOKAHEAD_TAG_END }, modes.ATTRIBUTE_SELECTOR_MODE, { @@ -181887,7 +182091,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: { $pattern: /[a-z-]+/, keyword: AT_MODIFIERS, - attribute: MEDIA_FEATURES$1.join(" ") + attribute: MEDIA_FEATURES.join(" ") }, contains: [modes.CSS_NUMBER_MODE] } @@ -181913,25 +182117,25 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ modes.HEXCOLOR, VARIABLE, - hljs$1.APOS_STRING_MODE, + hljs.APOS_STRING_MODE, modes.CSS_NUMBER_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.QUOTE_STRING_MODE ] }] }, modes.CSS_VARIABLE, { className: "attribute", - begin: "\\b(" + ATTRIBUTES$1.join("|") + ")\\b", + begin: "\\b(" + ATTRIBUTES.join("|") + ")\\b", starts: { end: /;|$/, contains: [ modes.HEXCOLOR, VARIABLE, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, modes.CSS_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, modes.IMPORTANT, modes.FUNCTION_DISPATCH ], @@ -181949,7 +182153,7 @@ var require_stylus = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/subunit.js var require_subunit = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function subunit(hljs$1) { + function subunit(hljs) { const DETAILS = { className: "string", begin: "\\[\n(multipart)?", @@ -181963,7 +182167,7 @@ var require_subunit = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: "(\\+|-)\\d+" }; - const KEYWORDS$6 = { + const KEYWORDS$2 = { className: "keyword", relevance: 10, variants: [ @@ -181980,7 +182184,7 @@ var require_subunit = /* @__PURE__ */ __commonJSMin(((exports, module) => { DETAILS, TIME, PROGRESSVALUE, - KEYWORDS$6 + KEYWORDS$2 ] }; } @@ -181998,7 +182202,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp | string } re * @returns {string} */ - function source$1(re$1) { + function source(re$1) { if (!re$1) return null; if (typeof re$1 === "string") return re$1; return re$1.source; @@ -182007,22 +182211,22 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {RegExp | string } re * @returns {string} */ - function lookahead$1(re$1) { - return concat$1("(?=", re$1, ")"); + function lookahead(re$1) { + return concat("(?=", re$1, ")"); } /** * @param {...(RegExp | string) } args * @returns {string} */ - function concat$1(...args) { - const joined = args.map((x$2) => source$1(x$2)).join(""); + function concat(...args) { + const joined = args.map((x$2) => source(x$2)).join(""); return joined; } /** * @param { Array } args * @returns {object} */ - function stripOptionsFromArgs$1(args) { + function stripOptionsFromArgs(args) { const opts = args[args.length - 1]; if (typeof opts === "object" && opts.constructor === Object) { args.splice(args.length - 1, 1); @@ -182039,13 +182243,13 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {(RegExp | string)[] | [...(RegExp | string)[], RegexEitherOptions]} args * @returns {string} */ - function either$1(...args) { + function either(...args) { /** @type { object & {capture?: boolean} } */ - const opts = stripOptionsFromArgs$1(args); - const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source$1(x$2)).join("|") + ")"; + const opts = stripOptionsFromArgs(args); + const joined = "(" + (opts.capture ? "" : "?:") + args.map((x$2) => source(x$2)).join("|") + ")"; return joined; } - const keywordWrapper = (keyword) => concat$1(/\b/, keyword, /\w$/.test(keyword) ? /\b/ : /\B/); + const keywordWrapper = (keyword) => concat(/\b/, keyword, /\w$/.test(keyword) ? /\b/ : /\B/); const dotKeywords = ["Protocol", "Type"].map(keywordWrapper); const optionalDotKeywords = ["init", "self"].map(keywordWrapper); const keywordTypes = ["Any", "Self"]; @@ -182216,17 +182420,17 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { "withoutActuallyEscaping", "zip" ]; - const operatorHead = either$1(/[/=\-+!*%<>&|^~?]/, /[\u00A1-\u00A7]/, /[\u00A9\u00AB]/, /[\u00AC\u00AE]/, /[\u00B0\u00B1]/, /[\u00B6\u00BB\u00BF\u00D7\u00F7]/, /[\u2016-\u2017]/, /[\u2020-\u2027]/, /[\u2030-\u203E]/, /[\u2041-\u2053]/, /[\u2055-\u205E]/, /[\u2190-\u23FF]/, /[\u2500-\u2775]/, /[\u2794-\u2BFF]/, /[\u2E00-\u2E7F]/, /[\u3001-\u3003]/, /[\u3008-\u3020]/, /[\u3030]/); - const operatorCharacter = either$1(operatorHead, /[\u0300-\u036F]/, /[\u1DC0-\u1DFF]/, /[\u20D0-\u20FF]/, /[\uFE00-\uFE0F]/, /[\uFE20-\uFE2F]/); - const operator = concat$1(operatorHead, operatorCharacter, "*"); - const identifierHead = either$1(/[a-zA-Z_]/, /[\u00A8\u00AA\u00AD\u00AF\u00B2-\u00B5\u00B7-\u00BA]/, /[\u00BC-\u00BE\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u00FF]/, /[\u0100-\u02FF\u0370-\u167F\u1681-\u180D\u180F-\u1DBF]/, /[\u1E00-\u1FFF]/, /[\u200B-\u200D\u202A-\u202E\u203F-\u2040\u2054\u2060-\u206F]/, /[\u2070-\u20CF\u2100-\u218F\u2460-\u24FF\u2776-\u2793]/, /[\u2C00-\u2DFF\u2E80-\u2FFF]/, /[\u3004-\u3007\u3021-\u302F\u3031-\u303F\u3040-\uD7FF]/, /[\uF900-\uFD3D\uFD40-\uFDCF\uFDF0-\uFE1F\uFE30-\uFE44]/, /[\uFE47-\uFEFE\uFF00-\uFFFD]/); - const identifierCharacter = either$1(identifierHead, /\d/, /[\u0300-\u036F\u1DC0-\u1DFF\u20D0-\u20FF\uFE20-\uFE2F]/); - const identifier = concat$1(identifierHead, identifierCharacter, "*"); - const typeIdentifier = concat$1(/[A-Z]/, identifierCharacter, "*"); + const operatorHead = either(/[/=\-+!*%<>&|^~?]/, /[\u00A1-\u00A7]/, /[\u00A9\u00AB]/, /[\u00AC\u00AE]/, /[\u00B0\u00B1]/, /[\u00B6\u00BB\u00BF\u00D7\u00F7]/, /[\u2016-\u2017]/, /[\u2020-\u2027]/, /[\u2030-\u203E]/, /[\u2041-\u2053]/, /[\u2055-\u205E]/, /[\u2190-\u23FF]/, /[\u2500-\u2775]/, /[\u2794-\u2BFF]/, /[\u2E00-\u2E7F]/, /[\u3001-\u3003]/, /[\u3008-\u3020]/, /[\u3030]/); + const operatorCharacter = either(operatorHead, /[\u0300-\u036F]/, /[\u1DC0-\u1DFF]/, /[\u20D0-\u20FF]/, /[\uFE00-\uFE0F]/, /[\uFE20-\uFE2F]/); + const operator = concat(operatorHead, operatorCharacter, "*"); + const identifierHead = either(/[a-zA-Z_]/, /[\u00A8\u00AA\u00AD\u00AF\u00B2-\u00B5\u00B7-\u00BA]/, /[\u00BC-\u00BE\u00C0-\u00D6\u00D8-\u00F6\u00F8-\u00FF]/, /[\u0100-\u02FF\u0370-\u167F\u1681-\u180D\u180F-\u1DBF]/, /[\u1E00-\u1FFF]/, /[\u200B-\u200D\u202A-\u202E\u203F-\u2040\u2054\u2060-\u206F]/, /[\u2070-\u20CF\u2100-\u218F\u2460-\u24FF\u2776-\u2793]/, /[\u2C00-\u2DFF\u2E80-\u2FFF]/, /[\u3004-\u3007\u3021-\u302F\u3031-\u303F\u3040-\uD7FF]/, /[\uF900-\uFD3D\uFD40-\uFDCF\uFDF0-\uFE1F\uFE30-\uFE44]/, /[\uFE47-\uFEFE\uFF00-\uFFFD]/); + const identifierCharacter = either(identifierHead, /\d/, /[\u0300-\u036F\u1DC0-\u1DFF\u20D0-\u20FF\uFE20-\uFE2F]/); + const identifier = concat(identifierHead, identifierCharacter, "*"); + const typeIdentifier = concat(/[A-Z]/, identifierCharacter, "*"); const keywordAttributes = [ "attached", "autoclosure", - concat$1(/convention\(/, either$1("swift", "block", "c"), /\)/), + concat(/convention\(/, either("swift", "block", "c"), /\)/), "discardableResult", "dynamicCallable", "dynamicMemberLookup", @@ -182245,7 +182449,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NSApplicationMain", "NSCopying", "NSManaged", - concat$1(/objc\(/, identifier, /\)/), + concat(/objc\(/, identifier, /\)/), "objc", "objcMembers", "propertyWrapper", @@ -182273,29 +182477,29 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { "swift" ]; /** @type LanguageFn */ - function swift(hljs$1) { + function swift(hljs) { const WHITESPACE = { match: /\s+/, relevance: 0 }; - const BLOCK_COMMENT = hljs$1.COMMENT("/\\*", "\\*/", { contains: ["self"] }); - const COMMENTS = [hljs$1.C_LINE_COMMENT_MODE, BLOCK_COMMENT]; + const BLOCK_COMMENT = hljs.COMMENT("/\\*", "\\*/", { contains: ["self"] }); + const COMMENTS = [hljs.C_LINE_COMMENT_MODE, BLOCK_COMMENT]; const DOT_KEYWORD = { - match: [/\./, either$1(...dotKeywords, ...optionalDotKeywords)], + match: [/\./, either(...dotKeywords, ...optionalDotKeywords)], className: { 2: "keyword" } }; const KEYWORD_GUARD = { - match: concat$1(/\./, either$1(...keywords)), + match: concat(/\./, either(...keywords)), relevance: 0 }; const PLAIN_KEYWORDS = keywords.filter((kw) => typeof kw === "string").concat(["_|0"]); const REGEX_KEYWORDS = keywords.filter((kw) => typeof kw !== "string").concat(keywordTypes).map(keywordWrapper); const KEYWORD = { variants: [{ className: "keyword", - match: either$1(...REGEX_KEYWORDS, ...optionalDotKeywords) + match: either(...REGEX_KEYWORDS, ...optionalDotKeywords) }] }; - const KEYWORDS$6 = { - $pattern: either$1(/\b\w+/, /#\w+/), + const KEYWORDS$2 = { + $pattern: either(/\b\w+/, /#\w+/), keyword: PLAIN_KEYWORDS.concat(numberSignKeywords), literal: literals }; @@ -182305,14 +182509,14 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { KEYWORD ]; const BUILT_IN_GUARD = { - match: concat$1(/\./, either$1(...builtIns)), + match: concat(/\./, either(...builtIns)), relevance: 0 }; const BUILT_IN = { className: "built_in", - match: concat$1(/\b/, either$1(...builtIns), /(?=\()/) + match: concat(/\b/, either(...builtIns), /(?=\()/) }; - const BUILT_INS$6 = [BUILT_IN_GUARD, BUILT_IN]; + const BUILT_INS$2 = [BUILT_IN_GUARD, BUILT_IN]; const OPERATOR_GUARD = { match: /->/, relevance: 0 @@ -182323,35 +182527,35 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ match: operator }, { match: `\\.(\\.|${operatorCharacter})+` }] }; const OPERATORS = [OPERATOR_GUARD, OPERATOR]; - const decimalDigits$2 = "([0-9]_*)+"; - const hexDigits$2 = "([0-9a-fA-F]_*)+"; + const decimalDigits = "([0-9]_*)+"; + const hexDigits = "([0-9a-fA-F]_*)+"; const NUMBER = { className: "number", relevance: 0, variants: [ - { match: `\\b(${decimalDigits$2})(\\.(${decimalDigits$2}))?` + `([eE][+-]?(${decimalDigits$2}))?\\b` }, - { match: `\\b0x(${hexDigits$2})(\\.(${hexDigits$2}))?` + `([pP][+-]?(${decimalDigits$2}))?\\b` }, + { match: `\\b(${decimalDigits})(\\.(${decimalDigits}))?` + `([eE][+-]?(${decimalDigits}))?\\b` }, + { match: `\\b0x(${hexDigits})(\\.(${hexDigits}))?` + `([pP][+-]?(${decimalDigits}))?\\b` }, { match: /\b0o([0-7]_*)+\b/ }, { match: /\b0b([01]_*)+\b/ } ] }; const ESCAPED_CHARACTER = (rawDelimiter = "") => ({ className: "subst", - variants: [{ match: concat$1(/\\/, rawDelimiter, /[0\\tnr"']/) }, { match: concat$1(/\\/, rawDelimiter, /u\{[0-9a-fA-F]{1,8}\}/) }] + variants: [{ match: concat(/\\/, rawDelimiter, /[0\\tnr"']/) }, { match: concat(/\\/, rawDelimiter, /u\{[0-9a-fA-F]{1,8}\}/) }] }); const ESCAPED_NEWLINE = (rawDelimiter = "") => ({ className: "subst", - match: concat$1(/\\/, rawDelimiter, /[\t ]*(?:[\r\n]|\r\n)/) + match: concat(/\\/, rawDelimiter, /[\t ]*(?:[\r\n]|\r\n)/) }); const INTERPOLATION = (rawDelimiter = "") => ({ className: "subst", label: "interpol", - begin: concat$1(/\\/, rawDelimiter, /\(/), + begin: concat(/\\/, rawDelimiter, /\(/), end: /\)/ }); const MULTILINE_STRING = (rawDelimiter = "") => ({ - begin: concat$1(rawDelimiter, /"""/), - end: concat$1(/"""/, rawDelimiter), + begin: concat(rawDelimiter, /"""/), + end: concat(/"""/, rawDelimiter), contains: [ ESCAPED_CHARACTER(rawDelimiter), ESCAPED_NEWLINE(rawDelimiter), @@ -182359,8 +182563,8 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }); const SINGLE_LINE_STRING = (rawDelimiter = "") => ({ - begin: concat$1(rawDelimiter, /"/), - end: concat$1(/"/, rawDelimiter), + begin: concat(rawDelimiter, /"/), + end: concat(/"/, rawDelimiter), contains: [ESCAPED_CHARACTER(rawDelimiter), INTERPOLATION(rawDelimiter)] }); const STRING = { @@ -182376,11 +182580,11 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { SINGLE_LINE_STRING("###") ] }; - const REGEXP_CONTENTS = [hljs$1.BACKSLASH_ESCAPE, { + const REGEXP_CONTENTS = [hljs.BACKSLASH_ESCAPE, { begin: /\[/, end: /\]/, relevance: 0, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }]; const BARE_REGEXP_LITERAL = { begin: /\/[^\s](?=[^/\n]*\/)/, @@ -182388,8 +182592,8 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: REGEXP_CONTENTS }; const EXTENDED_REGEXP_LITERAL = (rawDelimiter) => { - const begin = concat$1(rawDelimiter, /\//); - const end = concat$1(/\//, rawDelimiter); + const begin = concat(rawDelimiter, /\//); + const end = concat(/\//, rawDelimiter); return { begin, end, @@ -182409,7 +182613,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { BARE_REGEXP_LITERAL ] }; - const QUOTED_IDENTIFIER = { match: concat$1(/`/, identifier, /`/) }; + const QUOTED_IDENTIFIER = { match: concat(/`/, identifier, /`/) }; const IMPLICIT_PARAMETER = { className: "variable", match: /\$\d+/ @@ -182439,24 +182643,24 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const KEYWORD_ATTRIBUTE = { scope: "keyword", - match: concat$1(/@/, either$1(...keywordAttributes), lookahead$1(either$1(/\(/, /\s+/))) + match: concat(/@/, either(...keywordAttributes), lookahead(either(/\(/, /\s+/))) }; const USER_DEFINED_ATTRIBUTE = { scope: "meta", - match: concat$1(/@/, identifier) + match: concat(/@/, identifier) }; - const ATTRIBUTES$5 = [ + const ATTRIBUTES$1 = [ AVAILABLE_ATTRIBUTE, KEYWORD_ATTRIBUTE, USER_DEFINED_ATTRIBUTE ]; const TYPE = { - match: lookahead$1(/\b[A-Z]/), + match: lookahead(/\b[A-Z]/), relevance: 0, contains: [ { className: "type", - match: concat$1(/(AV|CA|CF|CG|CI|CL|CM|CN|CT|MK|MP|MTK|MTL|NS|SCN|SK|UI|WK|XC)/, identifierCharacter, "+") + match: concat(/(AV|CA|CF|CG|CI|CL|CM|CN|CT|MK|MP|MTK|MTL|NS|SCN|SK|UI|WK|XC)/, identifierCharacter, "+") }, { className: "type", @@ -182472,7 +182676,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0 }, { - match: concat$1(/\s+&\s+/, lookahead$1(typeIdentifier)), + match: concat(/\s+&\s+/, lookahead(typeIdentifier)), relevance: 0 } ] @@ -182480,18 +182684,18 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { const GENERIC_ARGUMENTS = { begin: //, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ ...COMMENTS, ...KEYWORD_MODES, - ...ATTRIBUTES$5, + ...ATTRIBUTES$1, OPERATOR_GUARD, TYPE ] }; TYPE.contains.push(GENERIC_ARGUMENTS); const TUPLE_ELEMENT_NAME = { - match: concat$1(identifier, /\s*:/), + match: concat(identifier, /\s*:/), keywords: "_|0", relevance: 0 }; @@ -182499,19 +182703,19 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /\(/, end: /\)/, relevance: 0, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ "self", TUPLE_ELEMENT_NAME, ...COMMENTS, REGEXP, ...KEYWORD_MODES, - ...BUILT_INS$6, + ...BUILT_INS$2, ...OPERATORS, NUMBER, STRING, ...IDENTIFIERS, - ...ATTRIBUTES$5, + ...ATTRIBUTES$1, TYPE ] }; @@ -182522,7 +182726,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [...COMMENTS, TYPE] }; const FUNCTION_PARAMETER_NAME = { - begin: either$1(lookahead$1(concat$1(identifier, /\s*:/)), lookahead$1(concat$1(identifier, /\s+/, identifier, /\s*:/))), + begin: either(lookahead(concat(identifier, /\s*:/)), lookahead(concat(identifier, /\s+/, identifier, /\s*:/))), end: /:/, relevance: 0, contains: [{ @@ -182536,7 +182740,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { const FUNCTION_PARAMETERS = { begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ FUNCTION_PARAMETER_NAME, ...COMMENTS, @@ -182544,7 +182748,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { ...OPERATORS, NUMBER, STRING, - ...ATTRIBUTES$5, + ...ATTRIBUTES$1, TYPE, TUPLE ], @@ -182555,7 +182759,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { match: [ /(func|macro)/, /\s+/, - either$1(QUOTED_IDENTIFIER.match, identifier, operator) + either(QUOTED_IDENTIFIER.match, identifier, operator) ], className: { 1: "keyword", @@ -182639,14 +182843,14 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { 1: "keyword", 3: "title.class" }, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ GENERIC_PARAMETERS, ...KEYWORD_MODES, { begin: /:/, end: /\{/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [{ scope: "title.class.inherited", match: typeIdentifier @@ -182657,10 +182861,10 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; for (const variant of STRING.variants) { const interpolation = variant.contains.find((mode) => mode.label === "interpol"); - interpolation.keywords = KEYWORDS$6; + interpolation.keywords = KEYWORDS$2; const submodes = [ ...KEYWORD_MODES, - ...BUILT_INS$6, + ...BUILT_INS$2, ...OPERATORS, NUMBER, STRING, @@ -182674,7 +182878,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { } return { name: "Swift", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ ...COMMENTS, FUNCTION_OR_MACRO, @@ -182692,12 +182896,12 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, REGEXP, ...KEYWORD_MODES, - ...BUILT_INS$6, + ...BUILT_INS$2, ...OPERATORS, NUMBER, STRING, ...IDENTIFIERS, - ...ATTRIBUTES$5, + ...ATTRIBUTES$1, TYPE, TUPLE ] @@ -182709,7 +182913,7 @@ var require_swift = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/taggerscript.js var require_taggerscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function taggerscript(hljs$1) { + function taggerscript(hljs) { const NOOP = { className: "comment", begin: /\$noop\(/, @@ -182754,8 +182958,8 @@ var require_taggerscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/yaml.js var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function yaml(hljs$1) { - const LITERALS$6 = "true false yes no null"; + function yaml(hljs) { + const LITERALS$2 = "true false yes no null"; const URI_CHARACTERS = "[\\w#;/?:@&=+$,.~*'()[\\]]+"; const KEY = { className: "attr", @@ -182793,9 +182997,9 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /"/, end: /"/ }, { begin: /\S+/ }], - contains: [hljs$1.BACKSLASH_ESCAPE, TEMPLATE_VARIABLES] + contains: [hljs.BACKSLASH_ESCAPE, TEMPLATE_VARIABLES] }; - const CONTAINER_STRING = hljs$1.inherit(STRING, { variants: [ + const CONTAINER_STRING = hljs.inherit(STRING, { variants: [ { begin: /'/, end: /'/, @@ -182822,7 +183026,7 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: ",", endsWithParent: true, excludeEnd: true, - keywords: LITERALS$6, + keywords: LITERALS$2, relevance: 0 }; const OBJECT = { @@ -182839,7 +183043,7 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: "\\n", relevance: 0 }; - const MODES$7 = [ + const MODES$1 = [ KEY, { className: "meta", @@ -182876,26 +183080,26 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "meta", - begin: "&" + hljs$1.UNDERSCORE_IDENT_RE + "$" + begin: "&" + hljs.UNDERSCORE_IDENT_RE + "$" }, { className: "meta", - begin: "\\*" + hljs$1.UNDERSCORE_IDENT_RE + "$" + begin: "\\*" + hljs.UNDERSCORE_IDENT_RE + "$" }, { className: "bullet", begin: "-(?=[ ]|$)", relevance: 0 }, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { - beginKeywords: LITERALS$6, - keywords: { literal: LITERALS$6 } + beginKeywords: LITERALS$2, + keywords: { literal: LITERALS$2 } }, TIMESTAMP, { className: "number", - begin: hljs$1.C_NUMBER_RE + "\\b", + begin: hljs.C_NUMBER_RE + "\\b", relevance: 0 }, OBJECT, @@ -182903,7 +183107,7 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { SINGLE_QUOTE_STRING, STRING ]; - const VALUE_MODES = [...MODES$7]; + const VALUE_MODES = [...MODES$1]; VALUE_MODES.pop(); VALUE_MODES.push(CONTAINER_STRING); VALUE_CONTAINER.contains = VALUE_MODES; @@ -182911,7 +183115,7 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "YAML", case_insensitive: true, aliases: ["yml"], - contains: MODES$7 + contains: MODES$1 }; } module.exports = yaml; @@ -182920,12 +183124,12 @@ var require_yaml = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/tap.js var require_tap = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function tap(hljs$1) { + function tap(hljs) { return { name: "Test Anything Protocol", case_insensitive: true, contains: [ - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { className: "meta", variants: [{ begin: "^TAP version (\\d+)$" }, { begin: "^1\\.\\.(\\d+)$" }] @@ -182953,14 +183157,14 @@ var require_tap = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/tcl.js var require_tcl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function tcl(hljs$1) { - const regex = hljs$1.regex; + function tcl(hljs) { + const regex = hljs.regex; const TCL_IDENT = /[a-zA-Z_][a-zA-Z0-9_]*/; const NUMBER = { className: "number", - variants: [hljs$1.BINARY_NUMBER_MODE, hljs$1.C_NUMBER_MODE] + variants: [hljs.BINARY_NUMBER_MODE, hljs.C_NUMBER_MODE] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "after", "append", "apply", @@ -183083,10 +183287,10 @@ var require_tcl = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Tcl", aliases: ["tk"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.COMMENT(";[ \\t]*#", "$"), - hljs$1.COMMENT("^[ \\t]*#", "$"), + hljs.COMMENT(";[ \\t]*#", "$"), + hljs.COMMENT("^[ \\t]*#", "$"), { beginKeywords: "proc", end: "[\\{]", @@ -183109,8 +183313,8 @@ var require_tcl = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], - variants: [hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null })] + contains: [hljs.BACKSLASH_ESCAPE], + variants: [hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null })] }, NUMBER ] @@ -183122,8 +183326,8 @@ var require_tcl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/thrift.js var require_thrift = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function thrift(hljs$1) { - const TYPES$6 = [ + function thrift(hljs) { + const TYPES$2 = [ "bool", "byte", "i16", @@ -183133,7 +183337,7 @@ var require_thrift = /* @__PURE__ */ __commonJSMin(((exports, module) => { "string", "binary" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "namespace", "const", "typedef", @@ -183152,21 +183356,21 @@ var require_thrift = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Thrift", keywords: { - keyword: KEYWORDS$6, - type: TYPES$6, + keyword: KEYWORDS$2, + type: TYPES$2, literal: "true false" }, contains: [ - hljs$1.QUOTE_STRING_MODE, - hljs$1.NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, + hljs.NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "class", beginKeywords: "struct enum service exception", end: /\{/, illegal: /\n/, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { starts: { + contains: [hljs.inherit(hljs.TITLE_MODE, { starts: { endsWithParent: true, excludeEnd: true } })] @@ -183174,7 +183378,7 @@ var require_thrift = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "\\b(set|list|map)\\s*<", keywords: { type: [ - ...TYPES$6, + ...TYPES$2, "set", "list", "map" @@ -183191,7 +183395,7 @@ var require_thrift = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/tp.js var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function tp(hljs$1) { + function tp(hljs) { const TPID = { className: "number", begin: "[1-9][0-9]*", @@ -183218,11 +183422,11 @@ var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [ "self", TPID, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, TPLABEL ] }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "ABORT", "ACC", "ADJUST", @@ -183292,7 +183496,7 @@ var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { "MN", "POS" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "ON", "OFF", "max_speed", @@ -183307,8 +183511,8 @@ var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "TP", keywords: { - keyword: KEYWORDS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + literal: LITERALS$2 }, contains: [ TPDATA, @@ -183330,16 +183534,16 @@ var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: "\\d+(sec|msec|mm/sec|cm/min|inch/min|deg/sec|mm|in|cm)?\\b", relevance: 0 }, - hljs$1.COMMENT("//", "[;$]"), - hljs$1.COMMENT("!", "[;$]"), - hljs$1.COMMENT("--eg:", "$"), - hljs$1.QUOTE_STRING_MODE, + hljs.COMMENT("//", "[;$]"), + hljs.COMMENT("!", "[;$]"), + hljs.COMMENT("--eg:", "$"), + hljs.QUOTE_STRING_MODE, { className: "string", begin: "'", end: "'" }, - hljs$1.C_NUMBER_MODE, + hljs.C_NUMBER_MODE, { className: "variable", begin: "\\$[A-Za-z0-9_]+" @@ -183353,8 +183557,8 @@ var require_tp = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/twig.js var require_twig = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function twig(hljs$1) { - const regex = hljs$1.regex; + function twig(hljs) { + const regex = hljs.regex; const FUNCTION_NAMES = [ "absolute_url", "asset|0", @@ -183564,7 +183768,7 @@ var require_twig = /* @__PURE__ */ __commonJSMin(((exports, module) => { case_insensitive: true, subLanguage: "xml", contains: [ - hljs$1.COMMENT(/\{#/, /#\}/), + hljs.COMMENT(/\{#/, /#\}/), TAG, CUSTOM_TAG, { @@ -183588,8 +183792,8 @@ var require_twig = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/typescript.js var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { - const IDENT_RE$3 = "[A-Za-z$_][0-9A-Za-z$_]*"; - const KEYWORDS$2 = [ + const IDENT_RE = "[A-Za-z$_][0-9A-Za-z$_]*"; + const KEYWORDS = [ "as", "in", "of", @@ -183630,7 +183834,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "extends", "using" ]; - const LITERALS$2 = [ + const LITERALS = [ "true", "false", "null", @@ -183638,7 +183842,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "NaN", "Infinity" ]; - const TYPES$2 = [ + const TYPES = [ "Object", "Function", "Boolean", @@ -183679,7 +183883,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Intl", "WebAssembly" ]; - const ERROR_TYPES$2 = [ + const ERROR_TYPES = [ "Error", "EvalError", "InternalError", @@ -183689,7 +183893,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "TypeError", "URIError" ]; - const BUILT_IN_GLOBALS$2 = [ + const BUILT_IN_GLOBALS = [ "setInterval", "setTimeout", "clearInterval", @@ -183708,7 +183912,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "escape", "unescape" ]; - const BUILT_IN_VARIABLES$2 = [ + const BUILT_IN_VARIABLES = [ "arguments", "this", "super", @@ -183720,10 +183924,10 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "module", "global" ]; - const BUILT_INS$2 = [].concat(BUILT_IN_GLOBALS$2, TYPES$2, ERROR_TYPES$2); + const BUILT_INS = [].concat(BUILT_IN_GLOBALS, TYPES, ERROR_TYPES); /** @type LanguageFn */ - function javascript$2(hljs$1) { - const regex = hljs$1.regex; + function javascript(hljs) { + const regex = hljs.regex; /** * Takes a string like " { const pos = match.input.indexOf(tag, after); return pos !== -1; }; - const IDENT_RE$1$1 = IDENT_RE$3; + const IDENT_RE$1$1 = IDENT_RE; const FRAGMENT = { begin: "<>", end: "" @@ -183772,20 +183976,20 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }; const KEYWORDS$1$1 = { - $pattern: IDENT_RE$3, - keyword: KEYWORDS$2, - literal: LITERALS$2, - built_in: BUILT_INS$2, - "variable.language": BUILT_IN_VARIABLES$2 + $pattern: IDENT_RE, + keyword: KEYWORDS, + literal: LITERALS, + built_in: BUILT_INS, + "variable.language": BUILT_IN_VARIABLES }; - const decimalDigits$2 = "[0-9](_?[0-9])*"; - const frac$2 = `\\.(${decimalDigits$2})`; + const decimalDigits = "[0-9](_?[0-9])*"; + const frac = `\\.(${decimalDigits})`; const decimalInteger = `0|[1-9](_?[0-9])*|0[0-7]*[89][0-9]*`; const NUMBER = { className: "number", variants: [ - { begin: `(\\b(${decimalInteger})((${frac$2})|\\.)?|(${frac$2}))` + `[eE][+-]?(${decimalDigits$2})\\b` }, - { begin: `\\b(${decimalInteger})\\b((${frac$2})\\b|\\.)?|(${frac$2})\\b` }, + { begin: `(\\b(${decimalInteger})((${frac})|\\.)?|(${frac}))` + `[eE][+-]?(${decimalDigits})\\b` }, + { begin: `\\b(${decimalInteger})\\b((${frac})\\b|\\.)?|(${frac})\\b` }, { begin: `\\b(0|[1-9](_?[0-9])*)n\\b` }, { begin: "\\b0[xX][0-9a-fA-F](_?[0-9a-fA-F])*n?\\b" }, { begin: "\\b0[bB][0-1](_?[0-1])*n?\\b" }, @@ -183807,7 +184011,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "xml" } }; @@ -183817,7 +184021,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "css" } }; @@ -183827,7 +184031,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { starts: { end: "`", returnEnd: false, - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST], + contains: [hljs.BACKSLASH_ESCAPE, SUBST], subLanguage: "graphql" } }; @@ -183835,9 +184039,9 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: "`", end: "`", - contains: [hljs$1.BACKSLASH_ESCAPE, SUBST] + contains: [hljs.BACKSLASH_ESCAPE, SUBST] }; - const JSDOC_COMMENT = hljs$1.COMMENT(/\/\*\*(?!\/)/, "\\*/", { + const JSDOC_COMMENT = hljs.COMMENT(/\/\*\*(?!\/)/, "\\*/", { relevance: 0, contains: [{ begin: "(?=@[A-Za-z]+)", @@ -183868,17 +184072,17 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { ] }] }); - const COMMENT$2 = { + const COMMENT = { className: "comment", variants: [ JSDOC_COMMENT, - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.C_LINE_COMMENT_MODE + hljs.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE ] }; const SUBST_INTERNALS = [ - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, @@ -183892,7 +184096,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { keywords: KEYWORDS$1$1, contains: ["self"].concat(SUBST_INTERNALS) }); - const SUBST_AND_COMMENTS = [].concat(COMMENT$2, SUBST.contains); + const SUBST_AND_COMMENTS = [].concat(COMMENT, SUBST.contains); const PARAMS_CONTAINS = SUBST_AND_COMMENTS.concat([{ begin: /(\s*)\(/, end: /\)/, @@ -183939,7 +184143,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, match: regex.either(/\bJSON/, /\b[A-Z][a-z]+([A-Z][a-z]*|\d)*/, /\b[A-Z]{2,}([A-Z][a-z]+|\d)+([A-Z][a-z]*)*/, /\b[A-Z]{2,}[a-z]+([A-Z][a-z]+|\d)*([A-Z][a-z]*)*/), className: "title.class", - keywords: { _: [...TYPES$2, ...ERROR_TYPES$2] } + keywords: { _: [...TYPES, ...ERROR_TYPES] } }; const USE_STRICT = { label: "use_strict", @@ -183972,7 +184176,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { } const FUNCTION_CALL = { match: regex.concat(/\b/, noneOf([ - ...BUILT_IN_GLOBALS$2, + ...BUILT_IN_GLOBALS, "super", "import" ].map((x$2) => `${x$2}\\s*\\(`)), IDENT_RE$1$1, regex.lookahead(/\s*\(/)), @@ -184000,7 +184204,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, contains: [{ begin: /\(\)/ }, PARAMS] }; - const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs$1.UNDERSCORE_IDENT_RE + ")\\s*=>"; + const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs.UNDERSCORE_IDENT_RE + ")\\s*=>"; const FUNCTION_VARIABLE = { match: [ /const|var|let/, @@ -184033,19 +184237,19 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, illegal: /#(?![$_A-z])/, contains: [ - hljs$1.SHEBANG({ + hljs.SHEBANG({ label: "shebang", binary: "node", relevance: 5 }), USE_STRICT, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, TEMPLATE_STRING, - COMMENT$2, + COMMENT, { match: /\$\d+/ }, NUMBER, CLASS_REFERENCE, @@ -184056,12 +184260,12 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, FUNCTION_VARIABLE, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", keywords: "return throw case", relevance: 0, contains: [ - COMMENT$2, - hljs$1.REGEXP_MODE, + COMMENT, + hljs.REGEXP_MODE, { className: "function", begin: FUNC_LEAD_IN_RE, @@ -184071,7 +184275,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "params", variants: [ { - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }, { @@ -184124,10 +184328,10 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { FUNCTION_DEFINITION, { beginKeywords: "while if switch catch for" }, { - begin: "\\b(?!function)" + hljs$1.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", + begin: "\\b(?!function)" + hljs.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", returnBegin: true, label: "func.def", - contains: [PARAMS, hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [PARAMS, hljs.inherit(hljs.TITLE_MODE, { begin: IDENT_RE$1$1, className: "title.function" })] @@ -184155,11 +184359,11 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; } /** @type LanguageFn */ - function typescript$1(hljs$1) { - const regex = hljs$1.regex; - const tsLanguage = javascript$2(hljs$1); - const IDENT_RE$1$1 = IDENT_RE$3; - const TYPES$6 = [ + function typescript(hljs) { + const regex = hljs.regex; + const tsLanguage = javascript(hljs); + const IDENT_RE$1$1 = IDENT_RE; + const TYPES$2 = [ "any", "void", "number", @@ -184175,7 +184379,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /namespace/, /\s+/, - hljs$1.IDENT_RE + hljs.IDENT_RE ], beginScope: { 1: "keyword", @@ -184188,7 +184392,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { excludeEnd: true, keywords: { keyword: "interface extends", - built_in: TYPES$6 + built_in: TYPES$2 }, contains: [tsLanguage.exports.CLASS_REFERENCE] }; @@ -184212,11 +184416,11 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { "satisfies" ]; const KEYWORDS$1$1 = { - $pattern: IDENT_RE$3, - keyword: KEYWORDS$2.concat(TS_SPECIFIC_KEYWORDS), - literal: LITERALS$2, - built_in: BUILT_INS$2.concat(TYPES$6), - "variable.language": BUILT_IN_VARIABLES$2 + $pattern: IDENT_RE, + keyword: KEYWORDS.concat(TS_SPECIFIC_KEYWORDS), + literal: LITERALS, + built_in: BUILT_INS.concat(TYPES$2), + "variable.language": BUILT_IN_VARIABLES }; const DECORATOR = { className: "meta", @@ -184231,7 +184435,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; Object.assign(tsLanguage.keywords, KEYWORDS$1$1); tsLanguage.exports.PARAMS_CONTAINS.push(DECORATOR); - const ATTRIBUTE_HIGHLIGHT = tsLanguage.contains.find((c$7) => c$7.scope === "attr"); + const ATTRIBUTE_HIGHLIGHT = tsLanguage.contains.find((c$6) => c$6.scope === "attr"); const OPTIONAL_KEY_OR_ARGUMENT = Object.assign({}, ATTRIBUTE_HIGHLIGHT, { match: regex.concat(IDENT_RE$1$1, regex.lookahead(/\s*\?:/)) }); tsLanguage.exports.PARAMS_CONTAINS.push([ tsLanguage.exports.CLASS_REFERENCE, @@ -184244,7 +184448,7 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { INTERFACE, OPTIONAL_KEY_OR_ARGUMENT ]); - swapMode(tsLanguage, "shebang", hljs$1.SHEBANG()); + swapMode(tsLanguage, "shebang", hljs.SHEBANG()); swapMode(tsLanguage, "use_strict", USE_STRICT); const functionDeclaration = tsLanguage.contains.find((m$3) => m$3.label === "func.def"); functionDeclaration.relevance = 0; @@ -184259,13 +184463,13 @@ var require_typescript = /* @__PURE__ */ __commonJSMin(((exports, module) => { }); return tsLanguage; } - module.exports = typescript$1; + module.exports = typescript; })); //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vala.js var require_vala = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function vala(hljs$1) { + function vala(hljs) { return { name: "Vala", keywords: { @@ -184280,19 +184484,19 @@ var require_vala = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\{/, excludeEnd: true, illegal: "[^,:\\n\\s\\.]", - contains: [hljs$1.UNDERSCORE_TITLE_MODE] + contains: [hljs.UNDERSCORE_TITLE_MODE] }, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, { className: "string", begin: "\"\"\"", end: "\"\"\"", relevance: 5 }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, - hljs$1.C_NUMBER_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, + hljs.C_NUMBER_MODE, { className: "meta", begin: "^#", @@ -184308,8 +184512,8 @@ var require_vala = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vbnet.js var require_vbnet = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function vbnet(hljs$1) { - const regex = hljs$1.regex; + function vbnet(hljs) { + const regex = hljs.regex; /** * Character Literal * Either a single character ("a"C) or an escaped double quote (""""C). @@ -184354,18 +184558,18 @@ var require_vbnet = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "label", begin: /^\w+:/ }; - const DOC_COMMENT = hljs$1.COMMENT(/'''/, /$/, { contains: [{ + const DOC_COMMENT = hljs.COMMENT(/'''/, /$/, { contains: [{ className: "doctag", begin: /<\/?/, end: />/ }] }); - const COMMENT$2 = hljs$1.COMMENT(null, /$/, { variants: [{ begin: /'/ }, { begin: /([\t ]|^)REM(?=\s)/ }] }); + const COMMENT = hljs.COMMENT(null, /$/, { variants: [{ begin: /'/ }, { begin: /([\t ]|^)REM(?=\s)/ }] }); const DIRECTIVES = { className: "meta", begin: /[\t ]*#(const|disable|else|elseif|enable|end|externalsource|if|region)\b/, end: /$/, keywords: { keyword: "const disable else elseif enable end externalsource if region then" }, - contains: [COMMENT$2] + contains: [COMMENT] }; return { name: "Visual Basic .NET", @@ -184386,7 +184590,7 @@ var require_vbnet = /* @__PURE__ */ __commonJSMin(((exports, module) => { NUMBER, LABEL, DOC_COMMENT, - COMMENT$2, + COMMENT, DIRECTIVES ] }; @@ -184398,8 +184602,8 @@ var require_vbnet = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vbscript.js var require_vbscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function vbscript(hljs$1) { - const regex = hljs$1.regex; + function vbscript(hljs) { + const regex = hljs.regex; const BUILT_IN_FUNCTIONS = [ "lcase", "month", @@ -184512,14 +184716,14 @@ var require_vbscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { relevance: 0, keywords: { built_in: BUILT_IN_FUNCTIONS } }; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null", "nothing", "empty" ]; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "call", "class", "const", @@ -184583,16 +184787,16 @@ var require_vbscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { aliases: ["vbs"], case_insensitive: true, keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, built_in: BUILT_IN_OBJECTS, - literal: LITERALS$6 + literal: LITERALS$2 }, illegal: "//", contains: [ BUILT_IN_CALL, - hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { contains: [{ begin: "\"\"" }] }), - hljs$1.COMMENT(/'/, /$/, { relevance: 0 }), - hljs$1.C_NUMBER_MODE + hljs.inherit(hljs.QUOTE_STRING_MODE, { contains: [{ begin: "\"\"" }] }), + hljs.COMMENT(/'/, /$/, { relevance: 0 }), + hljs.C_NUMBER_MODE ] }; } @@ -184602,7 +184806,7 @@ var require_vbscript = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vbscript-html.js var require_vbscript_html = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function vbscriptHtml(hljs$1) { + function vbscriptHtml(hljs) { return { name: "VBScript in HTML", subLanguage: "xml", @@ -184619,9 +184823,9 @@ var require_vbscript_html = /* @__PURE__ */ __commonJSMin(((exports, module) => //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/verilog.js var require_verilog = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function verilog(hljs$1) { - const regex = hljs$1.regex; - const KEYWORDS$6 = { + function verilog(hljs) { + const regex = hljs.regex; + const KEYWORDS$2 = { $pattern: /\$?[\w]+(\$[\w]+)*/, keyword: [ "accept_on", @@ -185112,14 +185316,14 @@ var require_verilog = /* @__PURE__ */ __commonJSMin(((exports, module) => { "svh" ], case_insensitive: false, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.QUOTE_STRING_MODE, { scope: "number", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { begin: /\b((\d+'([bhodBHOD]))[0-9xzXZa-fA-F_]+)/ }, { begin: /\B(('([bhodBHOD]))[0-9xzXZa-fA-F_]+)/ }, @@ -185156,14 +185360,14 @@ var require_verilog = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vhdl.js var require_vhdl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function vhdl(hljs$1) { + function vhdl(hljs) { const INTEGER_RE = "\\d(_|\\d)*"; const EXPONENT_RE = "[eE][-+]?" + INTEGER_RE; const DECIMAL_LITERAL_RE = INTEGER_RE + "(\\." + INTEGER_RE + ")?" + "(" + EXPONENT_RE + ")?"; const BASED_INTEGER_RE = "\\w+"; const BASED_LITERAL_RE = INTEGER_RE + "#" + BASED_INTEGER_RE + "(\\." + BASED_INTEGER_RE + ")?" + "#" + "(" + EXPONENT_RE + ")?"; - const NUMBER_RE$2 = "\\b(" + BASED_LITERAL_RE + "|" + DECIMAL_LITERAL_RE + ")"; - const KEYWORDS$6 = [ + const NUMBER_RE = "\\b(" + BASED_LITERAL_RE + "|" + DECIMAL_LITERAL_RE + ")"; + const KEYWORDS$2 = [ "abs", "access", "after", @@ -185281,7 +185485,7 @@ var require_vhdl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "xnor", "xor" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "boolean", "bit", "character", @@ -185309,7 +185513,7 @@ var require_vhdl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "real_vector", "time_vector" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "false", "true", "note", @@ -185325,29 +185529,29 @@ var require_vhdl = /* @__PURE__ */ __commonJSMin(((exports, module) => { name: "VHDL", case_insensitive: true, keywords: { - keyword: KEYWORDS$6, - built_in: BUILT_INS$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + built_in: BUILT_INS$2, + literal: LITERALS$2 }, illegal: /\{/, contains: [ - hljs$1.C_BLOCK_COMMENT_MODE, - hljs$1.COMMENT("--", "$"), - hljs$1.QUOTE_STRING_MODE, + hljs.C_BLOCK_COMMENT_MODE, + hljs.COMMENT("--", "$"), + hljs.QUOTE_STRING_MODE, { className: "number", - begin: NUMBER_RE$2, + begin: NUMBER_RE, relevance: 0 }, { className: "string", begin: "'(U|X|0|1|Z|W|L|H|-)'", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { className: "symbol", begin: "'[A-Za-z](_?[A-Za-z0-9])*", - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] } ] }; @@ -185358,7 +185562,7 @@ var require_vhdl = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/vim.js var require_vim = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function vim(hljs$1) { + function vim(hljs) { return { name: "Vim Script", keywords: { @@ -185368,7 +185572,7 @@ var require_vim = /* @__PURE__ */ __commonJSMin(((exports, module) => { }, illegal: /;/, contains: [ - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, { className: "string", begin: "'", @@ -185379,7 +185583,7 @@ var require_vim = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: /"(\\"|\n\\|[^"\n])*"/ }, - hljs$1.COMMENT("\"", "$"), + hljs.COMMENT("\"", "$"), { className: "variable", begin: /[bwtglsav]:[\w\d_]+/ @@ -185388,7 +185592,7 @@ var require_vim = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: [ /\b(?:function|function!)/, /\s+/, - hljs$1.IDENT_RE + hljs.IDENT_RE ], className: { 1: "keyword", @@ -185416,11 +185620,11 @@ var require_vim = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/wasm.js var require_wasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function wasm(hljs$1) { - hljs$1.regex; - const BLOCK_COMMENT = hljs$1.COMMENT(/\(;/, /;\)/); + function wasm(hljs) { + hljs.regex; + const BLOCK_COMMENT = hljs.COMMENT(/\(;/, /;\)/); BLOCK_COMMENT.contains.push("self"); - const LINE_COMMENT = hljs$1.COMMENT(/;;/, /$/); + const LINE_COMMENT = hljs.COMMENT(/;;/, /$/); const KWS = [ "anyfunc", "block", @@ -185525,7 +185729,7 @@ var require_wasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { ARGUMENT, PARENS, FUNCTION_REFERENCE, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, TYPE, MATH_OPERATIONS, NUMBER @@ -185539,10 +185743,10 @@ var require_wasm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/wren.js var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function wren(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /[a-zA-Z]\w*/; - const KEYWORDS$6 = [ + function wren(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /[a-zA-Z]\w*/; + const KEYWORDS$2 = [ "as", "break", "class", @@ -185560,7 +185764,7 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { "var", "while" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null" @@ -185609,11 +185813,11 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { ]; const FUNCTION = { relevance: 0, - match: regex.concat(/\b(?!(if|while|for|else|super)\b)/, IDENT_RE$6, /(?=\s*[({])/), + match: regex.concat(/\b(?!(if|while|for|else|super)\b)/, IDENT_RE$2, /(?=\s*[({])/), className: "title.function" }; const FUNCTION_DEFINITION = { - match: regex.concat(regex.either(regex.concat(/\b(?!(if|while|for|else|super)\b)/, IDENT_RE$6), regex.either(...OPERATORS)), /(?=\s*\([^)]+\)\s*\{)/), + match: regex.concat(regex.either(regex.concat(/\b(?!(if|while|for|else|super)\b)/, IDENT_RE$2), regex.either(...OPERATORS)), /(?=\s*\([^)]+\)\s*\{)/), className: "title.function", starts: { contains: [{ begin: /\(/, @@ -185621,22 +185825,22 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { contains: [{ relevance: 0, scope: "params", - match: IDENT_RE$6 + match: IDENT_RE$2 }] }] } }; const CLASS_DEFINITION = { variants: [{ match: [ /class\s+/, - IDENT_RE$6, + IDENT_RE$2, /\s+is\s+/, - IDENT_RE$6 - ] }, { match: [/class\s+/, IDENT_RE$6] }], + IDENT_RE$2 + ] }, { match: [/class\s+/, IDENT_RE$2] }], scope: { 2: "title.class", 4: "title.class.inherited" }, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 }; const OPERATOR = { relevance: 0, @@ -185650,14 +185854,14 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const PROPERTY = { className: "property", - begin: regex.concat(/\./, regex.lookahead(IDENT_RE$6)), - end: IDENT_RE$6, + begin: regex.concat(/\./, regex.lookahead(IDENT_RE$2)), + end: IDENT_RE$2, excludeBegin: true, relevance: 0 }; const FIELD = { relevance: 0, - match: regex.concat(/\b_/, IDENT_RE$6), + match: regex.concat(/\b_/, IDENT_RE$2), scope: "variable" }; const CLASS_REFERENCE = { @@ -185666,15 +185870,15 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { scope: "title.class", keywords: { _: CORE_CLASSES } }; - const NUMBER = hljs$1.C_NUMBER_MODE; + const NUMBER = hljs.C_NUMBER_MODE; const SETTER = { match: [ - IDENT_RE$6, + IDENT_RE$2, /\s*/, /=/, /\s*/, /\(/, - IDENT_RE$6, + IDENT_RE$2, /\)\s*\{/ ], scope: { @@ -185683,7 +185887,7 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { 6: "params" } }; - const COMMENT_DOCS = hljs$1.COMMENT(/\/\*\*/, /\*\//, { contains: [{ + const COMMENT_DOCS = hljs.COMMENT(/\/\*\*/, /\*\//, { contains: [{ match: /@[a-z]+/, scope: "doctag" }, "self"] }); @@ -185715,9 +185919,9 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; SUBST.contains.push(STRING); const ALL_KWS = [ - ...KEYWORDS$6, + ...KEYWORDS$2, ...LANGUAGE_VARS, - ...LITERALS$6 + ...LITERALS$2 ]; const VARIABLE = { relevance: 0, @@ -185729,7 +185933,7 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { variants: [{ begin: [/#!?/, /[A-Za-z_]+(?=\()/], beginScope: {}, - keywords: { literal: LITERALS$6 }, + keywords: { literal: LITERALS$2 }, contains: [], end: /\)/ }, { @@ -185741,9 +185945,9 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { return { name: "Wren", keywords: { - keyword: KEYWORDS$6, + keyword: KEYWORDS$2, "variable.language": LANGUAGE_VARS, - literal: LITERALS$6 + literal: LITERALS$2 }, contains: [ ATTRIBUTE, @@ -185751,8 +185955,8 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { STRING, TRIPLE_STRING, COMMENT_DOCS, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, CLASS_REFERENCE, CLASS_DEFINITION, SETTER, @@ -185771,18 +185975,18 @@ var require_wren = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/x86asm.js var require_x86asm = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function x86asm(hljs$1) { + function x86asm(hljs) { return { name: "Intel x86 Assembly", case_insensitive: true, keywords: { - $pattern: "[.%]?" + hljs$1.IDENT_RE, + $pattern: "[.%]?" + hljs.IDENT_RE, keyword: "lock rep repe repz repne repnz xaquire xrelease bnd nobnd " + "aaa aad aam aas adc add and arpl bb0_reset bb1_reset bound bsf bsr bswap bt btc btr bts call cbw cdq cdqe clc cld cli clts cmc cmp cmpsb cmpsd cmpsq cmpsw cmpxchg cmpxchg486 cmpxchg8b cmpxchg16b cpuid cpu_read cpu_write cqo cwd cwde daa das dec div dmint emms enter equ f2xm1 fabs fadd faddp fbld fbstp fchs fclex fcmovb fcmovbe fcmove fcmovnb fcmovnbe fcmovne fcmovnu fcmovu fcom fcomi fcomip fcomp fcompp fcos fdecstp fdisi fdiv fdivp fdivr fdivrp femms feni ffree ffreep fiadd ficom ficomp fidiv fidivr fild fimul fincstp finit fist fistp fisttp fisub fisubr fld fld1 fldcw fldenv fldl2e fldl2t fldlg2 fldln2 fldpi fldz fmul fmulp fnclex fndisi fneni fninit fnop fnsave fnstcw fnstenv fnstsw fpatan fprem fprem1 fptan frndint frstor fsave fscale fsetpm fsin fsincos fsqrt fst fstcw fstenv fstp fstsw fsub fsubp fsubr fsubrp ftst fucom fucomi fucomip fucomp fucompp fxam fxch fxtract fyl2x fyl2xp1 hlt ibts icebp idiv imul in inc incbin insb insd insw int int01 int1 int03 int3 into invd invpcid invlpg invlpga iret iretd iretq iretw jcxz jecxz jrcxz jmp jmpe lahf lar lds lea leave les lfence lfs lgdt lgs lidt lldt lmsw loadall loadall286 lodsb lodsd lodsq lodsw loop loope loopne loopnz loopz lsl lss ltr mfence monitor mov movd movq movsb movsd movsq movsw movsx movsxd movzx mul mwait neg nop not or out outsb outsd outsw packssdw packsswb packuswb paddb paddd paddsb paddsiw paddsw paddusb paddusw paddw pand pandn pause paveb pavgusb pcmpeqb pcmpeqd pcmpeqw pcmpgtb pcmpgtd pcmpgtw pdistib pf2id pfacc pfadd pfcmpeq pfcmpge pfcmpgt pfmax pfmin pfmul pfrcp pfrcpit1 pfrcpit2 pfrsqit1 pfrsqrt pfsub pfsubr pi2fd pmachriw pmaddwd pmagw pmulhriw pmulhrwa pmulhrwc pmulhw pmullw pmvgezb pmvlzb pmvnzb pmvzb pop popa popad popaw popf popfd popfq popfw por prefetch prefetchw pslld psllq psllw psrad psraw psrld psrlq psrlw psubb psubd psubsb psubsiw psubsw psubusb psubusw psubw punpckhbw punpckhdq punpckhwd punpcklbw punpckldq punpcklwd push pusha pushad pushaw pushf pushfd pushfq pushfw pxor rcl rcr rdshr rdmsr rdpmc rdtsc rdtscp ret retf retn rol ror rdm rsdc rsldt rsm rsts sahf sal salc sar sbb scasb scasd scasq scasw sfence sgdt shl shld shr shrd sidt sldt skinit smi smint smintold smsw stc std sti stosb stosd stosq stosw str sub svdc svldt svts swapgs syscall sysenter sysexit sysret test ud0 ud1 ud2b ud2 ud2a umov verr verw fwait wbinvd wrshr wrmsr xadd xbts xchg xlatb xlat xor cmove cmovz cmovne cmovnz cmova cmovnbe cmovae cmovnb cmovb cmovnae cmovbe cmovna cmovg cmovnle cmovge cmovnl cmovl cmovnge cmovle cmovng cmovc cmovnc cmovo cmovno cmovs cmovns cmovp cmovpe cmovnp cmovpo je jz jne jnz ja jnbe jae jnb jb jnae jbe jna jg jnle jge jnl jl jnge jle jng jc jnc jo jno js jns jpo jnp jpe jp sete setz setne setnz seta setnbe setae setnb setnc setb setnae setcset setbe setna setg setnle setge setnl setl setnge setle setng sets setns seto setno setpe setp setpo setnp addps addss andnps andps cmpeqps cmpeqss cmpleps cmpless cmpltps cmpltss cmpneqps cmpneqss cmpnleps cmpnless cmpnltps cmpnltss cmpordps cmpordss cmpunordps cmpunordss cmpps cmpss comiss cvtpi2ps cvtps2pi cvtsi2ss cvtss2si cvttps2pi cvttss2si divps divss ldmxcsr maxps maxss minps minss movaps movhps movlhps movlps movhlps movmskps movntps movss movups mulps mulss orps rcpps rcpss rsqrtps rsqrtss shufps sqrtps sqrtss stmxcsr subps subss ucomiss unpckhps unpcklps xorps fxrstor fxrstor64 fxsave fxsave64 xgetbv xsetbv xsave xsave64 xsaveopt xsaveopt64 xrstor xrstor64 prefetchnta prefetcht0 prefetcht1 prefetcht2 maskmovq movntq pavgb pavgw pextrw pinsrw pmaxsw pmaxub pminsw pminub pmovmskb pmulhuw psadbw pshufw pf2iw pfnacc pfpnacc pi2fw pswapd maskmovdqu clflush movntdq movnti movntpd movdqa movdqu movdq2q movq2dq paddq pmuludq pshufd pshufhw pshuflw pslldq psrldq psubq punpckhqdq punpcklqdq addpd addsd andnpd andpd cmpeqpd cmpeqsd cmplepd cmplesd cmpltpd cmpltsd cmpneqpd cmpneqsd cmpnlepd cmpnlesd cmpnltpd cmpnltsd cmpordpd cmpordsd cmpunordpd cmpunordsd cmppd comisd cvtdq2pd cvtdq2ps cvtpd2dq cvtpd2pi cvtpd2ps cvtpi2pd cvtps2dq cvtps2pd cvtsd2si cvtsd2ss cvtsi2sd cvtss2sd cvttpd2pi cvttpd2dq cvttps2dq cvttsd2si divpd divsd maxpd maxsd minpd minsd movapd movhpd movlpd movmskpd movupd mulpd mulsd orpd shufpd sqrtpd sqrtsd subpd subsd ucomisd unpckhpd unpcklpd xorpd addsubpd addsubps haddpd haddps hsubpd hsubps lddqu movddup movshdup movsldup clgi stgi vmcall vmclear vmfunc vmlaunch vmload vmmcall vmptrld vmptrst vmread vmresume vmrun vmsave vmwrite vmxoff vmxon invept invvpid pabsb pabsw pabsd palignr phaddw phaddd phaddsw phsubw phsubd phsubsw pmaddubsw pmulhrsw pshufb psignb psignw psignd extrq insertq movntsd movntss lzcnt blendpd blendps blendvpd blendvps dppd dpps extractps insertps movntdqa mpsadbw packusdw pblendvb pblendw pcmpeqq pextrb pextrd pextrq phminposuw pinsrb pinsrd pinsrq pmaxsb pmaxsd pmaxud pmaxuw pminsb pminsd pminud pminuw pmovsxbw pmovsxbd pmovsxbq pmovsxwd pmovsxwq pmovsxdq pmovzxbw pmovzxbd pmovzxbq pmovzxwd pmovzxwq pmovzxdq pmuldq pmulld ptest roundpd roundps roundsd roundss crc32 pcmpestri pcmpestrm pcmpistri pcmpistrm pcmpgtq popcnt getsec pfrcpv pfrsqrtv movbe aesenc aesenclast aesdec aesdeclast aesimc aeskeygenassist vaesenc vaesenclast vaesdec vaesdeclast vaesimc vaeskeygenassist vaddpd vaddps vaddsd vaddss vaddsubpd vaddsubps vandpd vandps vandnpd vandnps vblendpd vblendps vblendvpd vblendvps vbroadcastss vbroadcastsd vbroadcastf128 vcmpeq_ospd vcmpeqpd vcmplt_ospd vcmpltpd vcmple_ospd vcmplepd vcmpunord_qpd vcmpunordpd vcmpneq_uqpd vcmpneqpd vcmpnlt_uspd vcmpnltpd vcmpnle_uspd vcmpnlepd vcmpord_qpd vcmpordpd vcmpeq_uqpd vcmpnge_uspd vcmpngepd vcmpngt_uspd vcmpngtpd vcmpfalse_oqpd vcmpfalsepd vcmpneq_oqpd vcmpge_ospd vcmpgepd vcmpgt_ospd vcmpgtpd vcmptrue_uqpd vcmptruepd vcmplt_oqpd vcmple_oqpd vcmpunord_spd vcmpneq_uspd vcmpnlt_uqpd vcmpnle_uqpd vcmpord_spd vcmpeq_uspd vcmpnge_uqpd vcmpngt_uqpd vcmpfalse_ospd vcmpneq_ospd vcmpge_oqpd vcmpgt_oqpd vcmptrue_uspd vcmppd vcmpeq_osps vcmpeqps vcmplt_osps vcmpltps vcmple_osps vcmpleps vcmpunord_qps vcmpunordps vcmpneq_uqps vcmpneqps vcmpnlt_usps vcmpnltps vcmpnle_usps vcmpnleps vcmpord_qps vcmpordps vcmpeq_uqps vcmpnge_usps vcmpngeps vcmpngt_usps vcmpngtps vcmpfalse_oqps vcmpfalseps vcmpneq_oqps vcmpge_osps vcmpgeps vcmpgt_osps vcmpgtps vcmptrue_uqps vcmptrueps vcmplt_oqps vcmple_oqps vcmpunord_sps vcmpneq_usps vcmpnlt_uqps vcmpnle_uqps vcmpord_sps vcmpeq_usps vcmpnge_uqps vcmpngt_uqps vcmpfalse_osps vcmpneq_osps vcmpge_oqps vcmpgt_oqps vcmptrue_usps vcmpps vcmpeq_ossd vcmpeqsd vcmplt_ossd vcmpltsd vcmple_ossd vcmplesd vcmpunord_qsd vcmpunordsd vcmpneq_uqsd vcmpneqsd vcmpnlt_ussd vcmpnltsd vcmpnle_ussd vcmpnlesd vcmpord_qsd vcmpordsd vcmpeq_uqsd vcmpnge_ussd vcmpngesd vcmpngt_ussd vcmpngtsd vcmpfalse_oqsd vcmpfalsesd vcmpneq_oqsd vcmpge_ossd vcmpgesd vcmpgt_ossd vcmpgtsd vcmptrue_uqsd vcmptruesd vcmplt_oqsd vcmple_oqsd vcmpunord_ssd vcmpneq_ussd vcmpnlt_uqsd vcmpnle_uqsd vcmpord_ssd vcmpeq_ussd vcmpnge_uqsd vcmpngt_uqsd vcmpfalse_ossd vcmpneq_ossd vcmpge_oqsd vcmpgt_oqsd vcmptrue_ussd vcmpsd vcmpeq_osss vcmpeqss vcmplt_osss vcmpltss vcmple_osss vcmpless vcmpunord_qss vcmpunordss vcmpneq_uqss vcmpneqss vcmpnlt_usss vcmpnltss vcmpnle_usss vcmpnless vcmpord_qss vcmpordss vcmpeq_uqss vcmpnge_usss vcmpngess vcmpngt_usss vcmpngtss vcmpfalse_oqss vcmpfalsess vcmpneq_oqss vcmpge_osss vcmpgess vcmpgt_osss vcmpgtss vcmptrue_uqss vcmptruess vcmplt_oqss vcmple_oqss vcmpunord_sss vcmpneq_usss vcmpnlt_uqss vcmpnle_uqss vcmpord_sss vcmpeq_usss vcmpnge_uqss vcmpngt_uqss vcmpfalse_osss vcmpneq_osss vcmpge_oqss vcmpgt_oqss vcmptrue_usss vcmpss vcomisd vcomiss vcvtdq2pd vcvtdq2ps vcvtpd2dq vcvtpd2ps vcvtps2dq vcvtps2pd vcvtsd2si vcvtsd2ss vcvtsi2sd vcvtsi2ss vcvtss2sd vcvtss2si vcvttpd2dq vcvttps2dq vcvttsd2si vcvttss2si vdivpd vdivps vdivsd vdivss vdppd vdpps vextractf128 vextractps vhaddpd vhaddps vhsubpd vhsubps vinsertf128 vinsertps vlddqu vldqqu vldmxcsr vmaskmovdqu vmaskmovps vmaskmovpd vmaxpd vmaxps vmaxsd vmaxss vminpd vminps vminsd vminss vmovapd vmovaps vmovd vmovq vmovddup vmovdqa vmovqqa vmovdqu vmovqqu vmovhlps vmovhpd vmovhps vmovlhps vmovlpd vmovlps vmovmskpd vmovmskps vmovntdq vmovntqq vmovntdqa vmovntpd vmovntps vmovsd vmovshdup vmovsldup vmovss vmovupd vmovups vmpsadbw vmulpd vmulps vmulsd vmulss vorpd vorps vpabsb vpabsw vpabsd vpacksswb vpackssdw vpackuswb vpackusdw vpaddb vpaddw vpaddd vpaddq vpaddsb vpaddsw vpaddusb vpaddusw vpalignr vpand vpandn vpavgb vpavgw vpblendvb vpblendw vpcmpestri vpcmpestrm vpcmpistri vpcmpistrm vpcmpeqb vpcmpeqw vpcmpeqd vpcmpeqq vpcmpgtb vpcmpgtw vpcmpgtd vpcmpgtq vpermilpd vpermilps vperm2f128 vpextrb vpextrw vpextrd vpextrq vphaddw vphaddd vphaddsw vphminposuw vphsubw vphsubd vphsubsw vpinsrb vpinsrw vpinsrd vpinsrq vpmaddwd vpmaddubsw vpmaxsb vpmaxsw vpmaxsd vpmaxub vpmaxuw vpmaxud vpminsb vpminsw vpminsd vpminub vpminuw vpminud vpmovmskb vpmovsxbw vpmovsxbd vpmovsxbq vpmovsxwd vpmovsxwq vpmovsxdq vpmovzxbw vpmovzxbd vpmovzxbq vpmovzxwd vpmovzxwq vpmovzxdq vpmulhuw vpmulhrsw vpmulhw vpmullw vpmulld vpmuludq vpmuldq vpor vpsadbw vpshufb vpshufd vpshufhw vpshuflw vpsignb vpsignw vpsignd vpslldq vpsrldq vpsllw vpslld vpsllq vpsraw vpsrad vpsrlw vpsrld vpsrlq vptest vpsubb vpsubw vpsubd vpsubq vpsubsb vpsubsw vpsubusb vpsubusw vpunpckhbw vpunpckhwd vpunpckhdq vpunpckhqdq vpunpcklbw vpunpcklwd vpunpckldq vpunpcklqdq vpxor vrcpps vrcpss vrsqrtps vrsqrtss vroundpd vroundps vroundsd vroundss vshufpd vshufps vsqrtpd vsqrtps vsqrtsd vsqrtss vstmxcsr vsubpd vsubps vsubsd vsubss vtestps vtestpd vucomisd vucomiss vunpckhpd vunpckhps vunpcklpd vunpcklps vxorpd vxorps vzeroall vzeroupper pclmullqlqdq pclmulhqlqdq pclmullqhqdq pclmulhqhqdq pclmulqdq vpclmullqlqdq vpclmulhqlqdq vpclmullqhqdq vpclmulhqhqdq vpclmulqdq vfmadd132ps vfmadd132pd vfmadd312ps vfmadd312pd vfmadd213ps vfmadd213pd vfmadd123ps vfmadd123pd vfmadd231ps vfmadd231pd vfmadd321ps vfmadd321pd vfmaddsub132ps vfmaddsub132pd vfmaddsub312ps vfmaddsub312pd vfmaddsub213ps vfmaddsub213pd vfmaddsub123ps vfmaddsub123pd vfmaddsub231ps vfmaddsub231pd vfmaddsub321ps vfmaddsub321pd vfmsub132ps vfmsub132pd vfmsub312ps vfmsub312pd vfmsub213ps vfmsub213pd vfmsub123ps vfmsub123pd vfmsub231ps vfmsub231pd vfmsub321ps vfmsub321pd vfmsubadd132ps vfmsubadd132pd vfmsubadd312ps vfmsubadd312pd vfmsubadd213ps vfmsubadd213pd vfmsubadd123ps vfmsubadd123pd vfmsubadd231ps vfmsubadd231pd vfmsubadd321ps vfmsubadd321pd vfnmadd132ps vfnmadd132pd vfnmadd312ps vfnmadd312pd vfnmadd213ps vfnmadd213pd vfnmadd123ps vfnmadd123pd vfnmadd231ps vfnmadd231pd vfnmadd321ps vfnmadd321pd vfnmsub132ps vfnmsub132pd vfnmsub312ps vfnmsub312pd vfnmsub213ps vfnmsub213pd vfnmsub123ps vfnmsub123pd vfnmsub231ps vfnmsub231pd vfnmsub321ps vfnmsub321pd vfmadd132ss vfmadd132sd vfmadd312ss vfmadd312sd vfmadd213ss vfmadd213sd vfmadd123ss vfmadd123sd vfmadd231ss vfmadd231sd vfmadd321ss vfmadd321sd vfmsub132ss vfmsub132sd vfmsub312ss vfmsub312sd vfmsub213ss vfmsub213sd vfmsub123ss vfmsub123sd vfmsub231ss vfmsub231sd vfmsub321ss vfmsub321sd vfnmadd132ss vfnmadd132sd vfnmadd312ss vfnmadd312sd vfnmadd213ss vfnmadd213sd vfnmadd123ss vfnmadd123sd vfnmadd231ss vfnmadd231sd vfnmadd321ss vfnmadd321sd vfnmsub132ss vfnmsub132sd vfnmsub312ss vfnmsub312sd vfnmsub213ss vfnmsub213sd vfnmsub123ss vfnmsub123sd vfnmsub231ss vfnmsub231sd vfnmsub321ss vfnmsub321sd rdfsbase rdgsbase rdrand wrfsbase wrgsbase vcvtph2ps vcvtps2ph adcx adox rdseed clac stac xstore xcryptecb xcryptcbc xcryptctr xcryptcfb xcryptofb montmul xsha1 xsha256 llwpcb slwpcb lwpval lwpins vfmaddpd vfmaddps vfmaddsd vfmaddss vfmaddsubpd vfmaddsubps vfmsubaddpd vfmsubaddps vfmsubpd vfmsubps vfmsubsd vfmsubss vfnmaddpd vfnmaddps vfnmaddsd vfnmaddss vfnmsubpd vfnmsubps vfnmsubsd vfnmsubss vfrczpd vfrczps vfrczsd vfrczss vpcmov vpcomb vpcomd vpcomq vpcomub vpcomud vpcomuq vpcomuw vpcomw vphaddbd vphaddbq vphaddbw vphadddq vphaddubd vphaddubq vphaddubw vphaddudq vphadduwd vphadduwq vphaddwd vphaddwq vphsubbw vphsubdq vphsubwd vpmacsdd vpmacsdqh vpmacsdql vpmacssdd vpmacssdqh vpmacssdql vpmacsswd vpmacssww vpmacswd vpmacsww vpmadcsswd vpmadcswd vpperm vprotb vprotd vprotq vprotw vpshab vpshad vpshaq vpshaw vpshlb vpshld vpshlq vpshlw vbroadcasti128 vpblendd vpbroadcastb vpbroadcastw vpbroadcastd vpbroadcastq vpermd vpermpd vpermps vpermq vperm2i128 vextracti128 vinserti128 vpmaskmovd vpmaskmovq vpsllvd vpsllvq vpsravd vpsrlvd vpsrlvq vgatherdpd vgatherqpd vgatherdps vgatherqps vpgatherdd vpgatherqd vpgatherdq vpgatherqq xabort xbegin xend xtest andn bextr blci blcic blsi blsic blcfill blsfill blcmsk blsmsk blsr blcs bzhi mulx pdep pext rorx sarx shlx shrx tzcnt tzmsk t1mskc valignd valignq vblendmpd vblendmps vbroadcastf32x4 vbroadcastf64x4 vbroadcasti32x4 vbroadcasti64x4 vcompresspd vcompressps vcvtpd2udq vcvtps2udq vcvtsd2usi vcvtss2usi vcvttpd2udq vcvttps2udq vcvttsd2usi vcvttss2usi vcvtudq2pd vcvtudq2ps vcvtusi2sd vcvtusi2ss vexpandpd vexpandps vextractf32x4 vextractf64x4 vextracti32x4 vextracti64x4 vfixupimmpd vfixupimmps vfixupimmsd vfixupimmss vgetexppd vgetexpps vgetexpsd vgetexpss vgetmantpd vgetmantps vgetmantsd vgetmantss vinsertf32x4 vinsertf64x4 vinserti32x4 vinserti64x4 vmovdqa32 vmovdqa64 vmovdqu32 vmovdqu64 vpabsq vpandd vpandnd vpandnq vpandq vpblendmd vpblendmq vpcmpltd vpcmpled vpcmpneqd vpcmpnltd vpcmpnled vpcmpd vpcmpltq vpcmpleq vpcmpneqq vpcmpnltq vpcmpnleq vpcmpq vpcmpequd vpcmpltud vpcmpleud vpcmpnequd vpcmpnltud vpcmpnleud vpcmpud vpcmpequq vpcmpltuq vpcmpleuq vpcmpnequq vpcmpnltuq vpcmpnleuq vpcmpuq vpcompressd vpcompressq vpermi2d vpermi2pd vpermi2ps vpermi2q vpermt2d vpermt2pd vpermt2ps vpermt2q vpexpandd vpexpandq vpmaxsq vpmaxuq vpminsq vpminuq vpmovdb vpmovdw vpmovqb vpmovqd vpmovqw vpmovsdb vpmovsdw vpmovsqb vpmovsqd vpmovsqw vpmovusdb vpmovusdw vpmovusqb vpmovusqd vpmovusqw vpord vporq vprold vprolq vprolvd vprolvq vprord vprorq vprorvd vprorvq vpscatterdd vpscatterdq vpscatterqd vpscatterqq vpsraq vpsravq vpternlogd vpternlogq vptestmd vptestmq vptestnmd vptestnmq vpxord vpxorq vrcp14pd vrcp14ps vrcp14sd vrcp14ss vrndscalepd vrndscaleps vrndscalesd vrndscaless vrsqrt14pd vrsqrt14ps vrsqrt14sd vrsqrt14ss vscalefpd vscalefps vscalefsd vscalefss vscatterdpd vscatterdps vscatterqpd vscatterqps vshuff32x4 vshuff64x2 vshufi32x4 vshufi64x2 kandnw kandw kmovw knotw kortestw korw kshiftlw kshiftrw kunpckbw kxnorw kxorw vpbroadcastmb2q vpbroadcastmw2d vpconflictd vpconflictq vplzcntd vplzcntq vexp2pd vexp2ps vrcp28pd vrcp28ps vrcp28sd vrcp28ss vrsqrt28pd vrsqrt28ps vrsqrt28sd vrsqrt28ss vgatherpf0dpd vgatherpf0dps vgatherpf0qpd vgatherpf0qps vgatherpf1dpd vgatherpf1dps vgatherpf1qpd vgatherpf1qps vscatterpf0dpd vscatterpf0dps vscatterpf0qpd vscatterpf0qps vscatterpf1dpd vscatterpf1dps vscatterpf1qpd vscatterpf1qps prefetchwt1 bndmk bndcl bndcu bndcn bndmov bndldx bndstx sha1rnds4 sha1nexte sha1msg1 sha1msg2 sha256rnds2 sha256msg1 sha256msg2 hint_nop0 hint_nop1 hint_nop2 hint_nop3 hint_nop4 hint_nop5 hint_nop6 hint_nop7 hint_nop8 hint_nop9 hint_nop10 hint_nop11 hint_nop12 hint_nop13 hint_nop14 hint_nop15 hint_nop16 hint_nop17 hint_nop18 hint_nop19 hint_nop20 hint_nop21 hint_nop22 hint_nop23 hint_nop24 hint_nop25 hint_nop26 hint_nop27 hint_nop28 hint_nop29 hint_nop30 hint_nop31 hint_nop32 hint_nop33 hint_nop34 hint_nop35 hint_nop36 hint_nop37 hint_nop38 hint_nop39 hint_nop40 hint_nop41 hint_nop42 hint_nop43 hint_nop44 hint_nop45 hint_nop46 hint_nop47 hint_nop48 hint_nop49 hint_nop50 hint_nop51 hint_nop52 hint_nop53 hint_nop54 hint_nop55 hint_nop56 hint_nop57 hint_nop58 hint_nop59 hint_nop60 hint_nop61 hint_nop62 hint_nop63", built_in: "ip eip rip " + "al ah bl bh cl ch dl dh sil dil bpl spl r8b r9b r10b r11b r12b r13b r14b r15b " + "ax bx cx dx si di bp sp r8w r9w r10w r11w r12w r13w r14w r15w " + "eax ebx ecx edx esi edi ebp esp eip r8d r9d r10d r11d r12d r13d r14d r15d " + "rax rbx rcx rdx rsi rdi rbp rsp r8 r9 r10 r11 r12 r13 r14 r15 " + "cs ds es fs gs ss " + "st st0 st1 st2 st3 st4 st5 st6 st7 " + "mm0 mm1 mm2 mm3 mm4 mm5 mm6 mm7 " + "xmm0 xmm1 xmm2 xmm3 xmm4 xmm5 xmm6 xmm7 xmm8 xmm9 xmm10 xmm11 xmm12 xmm13 xmm14 xmm15 " + "xmm16 xmm17 xmm18 xmm19 xmm20 xmm21 xmm22 xmm23 xmm24 xmm25 xmm26 xmm27 xmm28 xmm29 xmm30 xmm31 " + "ymm0 ymm1 ymm2 ymm3 ymm4 ymm5 ymm6 ymm7 ymm8 ymm9 ymm10 ymm11 ymm12 ymm13 ymm14 ymm15 " + "ymm16 ymm17 ymm18 ymm19 ymm20 ymm21 ymm22 ymm23 ymm24 ymm25 ymm26 ymm27 ymm28 ymm29 ymm30 ymm31 " + "zmm0 zmm1 zmm2 zmm3 zmm4 zmm5 zmm6 zmm7 zmm8 zmm9 zmm10 zmm11 zmm12 zmm13 zmm14 zmm15 " + "zmm16 zmm17 zmm18 zmm19 zmm20 zmm21 zmm22 zmm23 zmm24 zmm25 zmm26 zmm27 zmm28 zmm29 zmm30 zmm31 " + "k0 k1 k2 k3 k4 k5 k6 k7 " + "bnd0 bnd1 bnd2 bnd3 " + "cr0 cr1 cr2 cr3 cr4 cr8 dr0 dr1 dr2 dr3 dr8 tr3 tr4 tr5 tr6 tr7 " + "r0 r1 r2 r3 r4 r5 r6 r7 r0b r1b r2b r3b r4b r5b r6b r7b " + "r0w r1w r2w r3w r4w r5w r6w r7w r0d r1d r2d r3d r4d r5d r6d r7d " + "r0h r1h r2h r3h " + "r0l r1l r2l r3l r4l r5l r6l r7l r8l r9l r10l r11l r12l r13l r14l r15l " + "db dw dd dq dt ddq do dy dz " + "resb resw resd resq rest resdq reso resy resz " + "incbin equ times " + "byte word dword qword nosplit rel abs seg wrt strict near far a32 ptr", meta: "%define %xdefine %+ %undef %defstr %deftok %assign %strcat %strlen %substr %rotate %elif %else %endif " + "%if %ifmacro %ifctx %ifidn %ifidni %ifid %ifnum %ifstr %iftoken %ifempty %ifenv %error %warning %fatal %rep " + "%endrep %include %push %pop %repl %pathsearch %depend %use %arg %stacksize %local %line %comment %endcomment " + ".nolist " + "__FILE__ __LINE__ __SECT__ __BITS__ __OUTPUT_FORMAT__ __DATE__ __TIME__ __DATE_NUM__ __TIME_NUM__ " + "__UTC_DATE__ __UTC_TIME__ __UTC_DATE_NUM__ __UTC_TIME_NUM__ __PASS__ struc endstruc istruc at iend " + "align alignb sectalign daz nodaz up down zero default option assume public " + "bits use16 use32 use64 default section segment absolute extern global common cpu float " + "__utf16__ __utf16le__ __utf16be__ __utf32__ __utf32le__ __utf32be__ " + "__float8__ __float16__ __float32__ __float64__ __float80m__ __float80e__ __float128l__ __float128h__ " + "__Infinity__ __QNaN__ __SNaN__ Inf NaN QNaN SNaN float8 float16 float32 float64 float80m float80e " + "float128l float128h __FLOAT_DAZ__ __FLOAT_ROUND__ __FLOAT__" }, contains: [ - hljs$1.COMMENT(";", "$", { relevance: 0 }), + hljs.COMMENT(";", "$", { relevance: 0 }), { className: "number", variants: [ @@ -185798,7 +186002,7 @@ var require_x86asm = /* @__PURE__ */ __commonJSMin(((exports, module) => { { begin: "\\b(?:0[Xx][0-9A-Fa-f_]+|0[DdTt][0-9_]+|0[QqOo][0-7_]+|0[BbYy][0-1_]+)\\b" } ] }, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, { className: "string", variants: [{ @@ -185838,7 +186042,7 @@ var require_x86asm = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#endregion //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/xl.js var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { - function xl(hljs$1) { + function xl(hljs) { const KWS = [ "if", "then", @@ -185869,7 +186073,7 @@ var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "block", "tree" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "in", "mod", "rem", @@ -185966,16 +186170,16 @@ var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { "Speech", "Charts" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "nil" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: /[a-zA-Z][a-zA-Z0-9_?]*/, keyword: KWS, - literal: LITERALS$6, - built_in: BUILT_INS$6.concat(BUILTIN_MODULES) + literal: LITERALS$2, + built_in: BUILT_INS$2.concat(BUILTIN_MODULES) }; const DOUBLE_QUOTE_TEXT = { className: "string", @@ -186001,7 +186205,7 @@ var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { const IMPORT = { beginKeywords: "import", end: "$", - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [DOUBLE_QUOTE_TEXT] }; const FUNCTION_DEFINITION = { @@ -186009,25 +186213,25 @@ var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { begin: /[a-z][^\n]*->/, returnBegin: true, end: /->/, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { starts: { + contains: [hljs.inherit(hljs.TITLE_MODE, { starts: { endsWithParent: true, - keywords: KEYWORDS$6 + keywords: KEYWORDS$2 } })] }; return { name: "XL", aliases: ["tao"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, DOUBLE_QUOTE_TEXT, SINGLE_QUOTE_TEXT, LONG_TEXT, FUNCTION_DEFINITION, IMPORT, BASED_NUMBER, - hljs$1.NUMBER_MODE + hljs.NUMBER_MODE ] }; } @@ -186039,7 +186243,7 @@ var require_xl = /* @__PURE__ */ __commonJSMin(((exports, module) => { var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ function xquery(_hljs) { - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "module", "schema", "namespace", @@ -186136,7 +186340,7 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { "modify", "update" ]; - const TYPES$6 = [ + const TYPES$2 = [ "item", "document-node", "node", @@ -186196,7 +186400,7 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { "xs:yearMonthDuration", "xs:dayTimeDuration" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "eq", "ne", "lt", @@ -186296,7 +186500,7 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "meta", begin: /%[\w\-:]+/ }; - const COMMENT$2 = { + const COMMENT = { className: "comment", begin: /\(:/, end: /:\)/, @@ -186326,7 +186530,7 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { BUILT_IN, STRING, NUMBER, - COMMENT$2, + COMMENT, ANNOTATION, TITLE, COMPUTED, @@ -186343,9 +186547,9 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { illegal: /(proc)|(abstract)|(extends)|(until)|(#)/, keywords: { $pattern: /[a-zA-Z$][a-zA-Z0-9_:-]*/, - keyword: KEYWORDS$6, - type: TYPES$6, - literal: LITERALS$6 + keyword: KEYWORDS$2, + type: TYPES$2, + literal: LITERALS$2 }, contains: CONTAINS }; @@ -186357,22 +186561,22 @@ var require_xquery = /* @__PURE__ */ __commonJSMin(((exports, module) => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/vendor/highlight.js/lib/languages/zephir.js var require_zephir = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @type LanguageFn */ - function zephir(hljs$1) { + function zephir(hljs) { const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], - variants: [hljs$1.inherit(hljs$1.APOS_STRING_MODE, { illegal: null }), hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { illegal: null })] + contains: [hljs.BACKSLASH_ESCAPE], + variants: [hljs.inherit(hljs.APOS_STRING_MODE, { illegal: null }), hljs.inherit(hljs.QUOTE_STRING_MODE, { illegal: null })] }; - const TITLE_MODE$2 = hljs$1.UNDERSCORE_TITLE_MODE; - const NUMBER = { variants: [hljs$1.BINARY_NUMBER_MODE, hljs$1.C_NUMBER_MODE] }; - const KEYWORDS$6 = "namespace class interface use extends " + "function return " + "abstract final public protected private static deprecated " + "throw try catch Exception " + "echo empty isset instanceof unset " + "let var new const self " + "require " + "if else elseif switch case default " + "do while loop for continue break " + "likely unlikely " + "__LINE__ __FILE__ __DIR__ __FUNCTION__ __CLASS__ __TRAIT__ __METHOD__ __NAMESPACE__ " + "array boolean float double integer object resource string " + "char long unsigned bool int uint ulong uchar " + "true false null undefined"; + const TITLE_MODE = hljs.UNDERSCORE_TITLE_MODE; + const NUMBER = { variants: [hljs.BINARY_NUMBER_MODE, hljs.C_NUMBER_MODE] }; + const KEYWORDS$2 = "namespace class interface use extends " + "function return " + "abstract final public protected private static deprecated " + "throw try catch Exception " + "echo empty isset instanceof unset " + "let var new const self " + "require " + "if else elseif switch case default " + "do while loop for continue break " + "likely unlikely " + "__LINE__ __FILE__ __DIR__ __FUNCTION__ __CLASS__ __TRAIT__ __METHOD__ __NAMESPACE__ " + "array boolean float double integer object resource string " + "char long unsigned bool int uint ulong uchar " + "true false null undefined"; return { name: "Zephir", aliases: ["zep"], - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.COMMENT(/\/\*/, /\*\//, { contains: [{ + hljs.C_LINE_COMMENT_MODE, + hljs.COMMENT(/\/\*/, /\*\//, { contains: [{ className: "doctag", begin: /@[A-Za-z]+/ }] }), @@ -186380,7 +186584,7 @@ var require_zephir = /* @__PURE__ */ __commonJSMin(((exports, module) => { className: "string", begin: /<<<['"]?\w+['"]?$/, end: /^\w+;/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }, { begin: /(::|->)+[a-zA-Z_\x7f-\xff][a-zA-Z0-9_\x7f-\xff]*/ }, { @@ -186389,14 +186593,14 @@ var require_zephir = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /[;{]/, excludeEnd: true, illegal: /\$|\[|%/, - contains: [TITLE_MODE$2, { + contains: [TITLE_MODE, { className: "params", begin: /\(/, end: /\)/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ "self", - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE, STRING, NUMBER ] @@ -186408,18 +186612,18 @@ var require_zephir = /* @__PURE__ */ __commonJSMin(((exports, module) => { end: /\{/, excludeEnd: true, illegal: /[:($"]/, - contains: [{ beginKeywords: "extends implements" }, TITLE_MODE$2] + contains: [{ beginKeywords: "extends implements" }, TITLE_MODE] }, { beginKeywords: "namespace", end: /;/, illegal: /[.']/, - contains: [TITLE_MODE$2] + contains: [TITLE_MODE] }, { beginKeywords: "use", end: /;/, - contains: [TITLE_MODE$2] + contains: [TITLE_MODE] }, { begin: /=>/ }, STRING, @@ -186650,10 +186854,10 @@ var init_CopyButton = __esmMin((() => { init_i18n$1(); init_icons(); __decorate$12 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; CopyButton = class CopyButton$1 extends i { constructor() { @@ -186713,10 +186917,10 @@ var init_Console = __esmMin((() => { init_lucide(); init_i18n(); __decorate$11 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; Console = class Console$1 extends i { constructor() { @@ -186794,10 +186998,10 @@ var init_PreviewCodeToggle = __esmMin((() => { init_i18n$1(); init_icons(); __decorate$10 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; PreviewCodeToggle = class PreviewCodeToggle$1 extends i { constructor() { @@ -186863,10 +187067,10 @@ var init_HtmlArtifact = __esmMin((() => { init_DownloadButton(); init_PreviewCodeToggle(); __decorate$9 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; HtmlArtifact = class HtmlArtifact$1 extends ArtifactElement { constructor() { @@ -187015,10 +187219,10 @@ var init_ImageArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$8 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ImageArtifact = class ImageArtifact$1 extends ArtifactElement { constructor() { @@ -187124,10 +187328,10 @@ var init_MarkdownArtifact = __esmMin((() => { init_PreviewCodeToggle(); init_ArtifactElement(); __decorate$7 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; MarkdownArtifact = class MarkdownArtifact$1 extends ArtifactElement { constructor() { @@ -187201,10 +187405,10 @@ var init_PdfArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$6 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; GlobalWorkerOptions.workerSrc = new URL("pdfjs-dist/build/pdf.worker.min.mjs", import.meta.url).toString(); PdfArtifact = class PdfArtifact$1 extends ArtifactElement { @@ -187331,9 +187535,9 @@ var init_PdfArtifact = __esmMin((() => { } wrapper.appendChild(pageContainer); } - } catch (error$2) { - console.error("Error rendering PDF:", error$2); - this.error = error$2?.message || i18n("Failed to load PDF"); + } catch (error) { + console.error("Error rendering PDF:", error); + this.error = error?.message || i18n("Failed to load PDF"); } finally { if (pdf) { pdf.destroy(); @@ -187377,10 +187581,10 @@ var init_SvgArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$5 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; SvgArtifact = class SvgArtifact$1 extends ArtifactElement { constructor() { @@ -187458,10 +187662,10 @@ var init_TextArtifact = __esmMin((() => { init_i18n(); init_ArtifactElement(); __decorate$4 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; CODE_EXTENSIONS = [ "js", @@ -187611,10 +187815,10 @@ var init_artifacts$1 = __esmMin((() => { init_SvgArtifact(); init_TextArtifact(); __decorate$3 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; artifactsParamsSchema = Type.Object({ command: StringEnum([ @@ -188146,7 +188350,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @typedef {import('highlight.js').CallbackResponse} CallbackResponse */ /** @typedef {import('highlight.js').CompiledMode} CompiledMode */ /** @implements CallbackResponse */ - var Response$1 = class { + var Response = class { /** * @param {CompiledMode} mode */ @@ -188163,7 +188367,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} value * @returns {string} */ - function escapeHTML$1(value) { + function escapeHTML(value) { return value.replace(/&/g, "&").replace(//g, ">").replace(/"/g, """).replace(/'/g, "'"); } /** @@ -188238,7 +188442,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { * * @param {string} text */ addText(text$2) { - this.buffer += escapeHTML$1(text$2); + this.buffer += escapeHTML(text$2); } /** * Adds a node open to the output stream (if needed) @@ -188534,7 +188738,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { /** @typedef {import('highlight.js').Mode} Mode */ /** @typedef {import('highlight.js').ModeCallback} ModeCallback */ const MATCH_NOTHING_RE = /\b\B/; - const IDENT_RE$2 = "[a-zA-Z]\\w*"; + const IDENT_RE = "[a-zA-Z]\\w*"; const UNDERSCORE_IDENT_RE = "[a-zA-Z_]\\w*"; const NUMBER_RE = "\\b\\d+(\\.\\d+)?"; const C_NUMBER_RE = "(-?)(\\b0[xX][a-fA-F0-9]+|(\\b\\d+(\\.\\d*)?|\\.\\d+)([eE][-+]?\\d+)?)"; @@ -188634,7 +188838,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { }; const TITLE_MODE = { scope: "title", - begin: IDENT_RE$2, + begin: IDENT_RE, relevance: 0 }; const UNDERSCORE_TITLE_MODE = { @@ -188663,7 +188867,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { } }); }; - var MODES$1 = /* @__PURE__ */ Object.freeze({ + var MODES = /* @__PURE__ */ Object.freeze({ __proto__: null, APOS_STRING_MODE, BACKSLASH_ESCAPE, @@ -188676,7 +188880,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { C_NUMBER_RE, END_SAME_AS_BEGIN, HASH_COMMENT_MODE, - IDENT_RE: IDENT_RE$2, + IDENT_RE, MATCH_NOTHING_RE, METHOD_GUARD, NUMBER_MODE, @@ -188866,10 +189070,10 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {string} version * @param {string} message */ - const deprecated = (version$6, message) => { - if (seenDeprecations[`${version$6}/${message}`]) return; - console.log(`Deprecated as of ${version$6}. ${message}`); - seenDeprecations[`${version$6}/${message}`] = true; + const deprecated = (version$4, message) => { + if (seenDeprecations[`${version$4}/${message}`]) return; + console.log(`Deprecated as of ${version$4}. ${message}`); + seenDeprecations[`${version$4}/${message}`] = true; }; /** @typedef {import('highlight.js').CompiledMode} CompiledMode @@ -189204,13 +189408,13 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { mode.illegal ); if (!mode.contains) mode.contains = []; - mode.contains = [].concat(...mode.contains.map(function(c$7) { - return expandOrCloneMode(c$7 === "self" ? mode : c$7); + mode.contains = [].concat(...mode.contains.map(function(c$6) { + return expandOrCloneMode(c$6 === "self" ? mode : c$6); })); - mode.contains.forEach(function(c$7) { + mode.contains.forEach(function(c$6) { compileMode( /** @type Mode */ - c$7, + c$6, cmode ); }); @@ -189300,7 +189504,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { @typedef {import('highlight.js').HighlightOptions} HighlightOptions @typedef {import('highlight.js').HighlightResult} HighlightResult */ - const escape$1 = escapeHTML$1; + const escape = escapeHTML; const inherit = inherit$1; const NO_MATCH = Symbol("nomatch"); const MAX_KEYWORD_HITS = 7; @@ -189308,7 +189512,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @param {any} hljs - object that is extended (legacy) * @returns {HLJSApi} */ - const HLJS = function(hljs$1) { + const HLJS = function(hljs) { /** @type {Record} */ const languages = Object.create(null); /** @type {Record} */ @@ -189379,7 +189583,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { * @property {CompiledMode} top - top of the current mode stack * @property {boolean} illegal - indicates whether any illegal matches were found */ - function highlight$2(codeOrLanguageName, optionsOrCode, ignoreIllegals) { + function highlight(codeOrLanguageName, optionsOrCode, ignoreIllegals) { let code = ""; let languageName = ""; if (typeof optionsOrCode === "object") { @@ -189551,7 +189755,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { let matched = startsWith(mode.endRe, matchPlusRemainder); if (matched) { if (mode["on:end"]) { - const resp = new Response$1(mode); + const resp = new Response(mode); mode["on:end"](match, resp); if (resp.isMatchIgnored) matched = false; } @@ -189589,7 +189793,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { function doBeginMatch(match) { const lexeme = match[0]; const newMode = match.rule; - const resp = new Response$1(newMode); + const resp = new Response(newMode); const beforeCallbacks = [newMode.__beforeBegin, newMode["on:begin"]]; for (const cb of beforeCallbacks) { if (!cb) continue; @@ -189767,7 +189971,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { if (err.message && err.message.includes("Illegal")) { return { language: languageName, - value: escape$1(codeToHighlight), + value: escape(codeToHighlight), illegal: true, relevance: 0, _illegalBy: { @@ -189782,7 +189986,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { } else if (SAFE_MODE) { return { language: languageName, - value: escape$1(codeToHighlight), + value: escape(codeToHighlight), illegal: false, relevance: 0, errorRaised: err, @@ -189803,7 +190007,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { */ function justTextHighlightResult(code) { const result = { - value: escape$1(code), + value: escape(code), illegal: false, relevance: 0, _top: PLAINTEXT_LANGUAGE, @@ -189828,9 +190032,9 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { */ function highlightAuto(code, languageSubset) { languageSubset = languageSubset || options.languages || Object.keys(languages); - const plaintext$1 = justTextHighlightResult(code); + const plaintext = justTextHighlightResult(code); const results = languageSubset.filter(getLanguage).filter(autoDetection).map((name) => _highlight(name, code, false)); - results.unshift(plaintext$1); + results.unshift(plaintext); const sorted = results.sort((a$2, b$3) => { if (a$2.relevance !== b$3.relevance) return b$3.relevance - a$2.relevance; if (a$2.language && b$3.language) { @@ -189892,7 +190096,7 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { } node = element; const text$2 = node.textContent; - const result = language ? highlight$2(text$2, { + const result = language ? highlight(text$2, { language, ignoreIllegals: true }) : highlightAuto(text$2); @@ -189959,19 +190163,19 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { function registerLanguage(languageName, languageDefinition) { let lang = null; try { - lang = languageDefinition(hljs$1); - } catch (error$1$1) { + lang = languageDefinition(hljs); + } catch (error$1) { error("Language definition for '{}' could not be registered.".replace("{}", languageName)); if (!SAFE_MODE) { - throw error$1$1; + throw error$1; } else { - error(error$1$1); + error(error$1); } lang = PLAINTEXT_LANGUAGE; } if (!lang.name) lang.name = languageName; languages[languageName] = lang; - lang.rawDefinition = languageDefinition.bind(null, hljs$1); + lang.rawDefinition = languageDefinition.bind(null, hljs); if (lang.aliases) { registerAliases(lang.aliases, { languageName }); } @@ -190079,8 +190283,8 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { deprecated("10.7.0", "Please use highlightElement now."); return highlightElement(el); } - Object.assign(hljs$1, { - highlight: highlight$2, + Object.assign(hljs, { + highlight, highlightAuto, highlightAll, highlightElement, @@ -190098,27 +190302,27 @@ var require_core = /* @__PURE__ */ __commonJSMin(((exports, module) => { addPlugin, removePlugin }); - hljs$1.debugMode = function() { + hljs.debugMode = function() { SAFE_MODE = false; }; - hljs$1.safeMode = function() { + hljs.safeMode = function() { SAFE_MODE = true; }; - hljs$1.versionString = version; - hljs$1.regex = { + hljs.versionString = version; + hljs.regex = { concat, lookahead, either, optional, anyNumberOfTimes }; - for (const key in MODES$1) { - if (typeof MODES$1[key] === "object") { - deepFreeze(MODES$1[key]); + for (const key in MODES) { + if (typeof MODES[key] === "object") { + deepFreeze(MODES[key]); } } - Object.assign(hljs$1, MODES$1); - return hljs$1; + Object.assign(hljs, MODES); + return hljs; }; const highlight = HLJS({}); highlight.newInstance = () => HLJS({}); @@ -190138,8 +190342,8 @@ var init_core = __esmMin((() => { //#endregion //#region node_modules/highlight.js/es/languages/bash.js /** @type LanguageFn */ -function bash(hljs$1) { - const regex = hljs$1.regex; +function bash(hljs) { + const regex = hljs.regex; const VAR = {}; const BRACED_VAR = { begin: /\$\{/, @@ -190157,15 +190361,15 @@ function bash(hljs$1) { className: "subst", begin: /\$\(/, end: /\)/, - contains: [hljs$1.BACKSLASH_ESCAPE] + contains: [hljs.BACKSLASH_ESCAPE] }; - const COMMENT$2 = hljs$1.inherit(hljs$1.COMMENT(), { + const COMMENT = hljs.inherit(hljs.COMMENT(), { match: [/(^|\s)/, /#.*$/], scope: { 2: "comment" } }); const HERE_DOC = { begin: /<<-?\s*(?=\w+)/, - starts: { contains: [hljs$1.END_SAME_AS_BEGIN({ + starts: { contains: [hljs.END_SAME_AS_BEGIN({ begin: /(\w+)/, end: /(\w+)/, className: "string" @@ -190176,7 +190380,7 @@ function bash(hljs$1) { begin: /"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, VAR, SUBST ] @@ -190197,7 +190401,7 @@ function bash(hljs$1) { begin: /\d+#[0-9a-f]+/, className: "number" }, - hljs$1.NUMBER_MODE, + hljs.NUMBER_MODE, VAR ] }; @@ -190212,7 +190416,7 @@ function bash(hljs$1) { "dash", "scsh" ]; - const KNOWN_SHEBANG = hljs$1.SHEBANG({ + const KNOWN_SHEBANG = hljs.SHEBANG({ binary: `(${SH_LIKE_SHELLS.join("|")})`, relevance: 10 }); @@ -190220,10 +190424,10 @@ function bash(hljs$1) { className: "function", begin: /\w[\w\d_]*\s*\(\s*\)\s*\{/, returnBegin: true, - contains: [hljs$1.inherit(hljs$1.TITLE_MODE, { begin: /\w[\w\d_]*/ })], + contains: [hljs.inherit(hljs.TITLE_MODE, { begin: /\w[\w\d_]*/ })], relevance: 0 }; - const KEYWORDS$6 = [ + const KEYWORDS$2 = [ "if", "then", "else", @@ -190242,7 +190446,7 @@ function bash(hljs$1) { "function", "select" ]; - const LITERALS$6 = ["true", "false"]; + const LITERALS$2 = ["true", "false"]; const PATH_MODE = { match: /(\/[a-z._-]+)+/ }; const SHELL_BUILT_INS = [ "break", @@ -190466,8 +190670,8 @@ function bash(hljs$1) { aliases: ["sh", "zsh"], keywords: { $pattern: /\b[a-z][a-z0-9._-]+\b/, - keyword: KEYWORDS$6, - literal: LITERALS$6, + keyword: KEYWORDS$2, + literal: LITERALS$2, built_in: [ ...SHELL_BUILT_INS, ...BASH_BUILT_INS, @@ -190479,10 +190683,10 @@ function bash(hljs$1) { }, contains: [ KNOWN_SHEBANG, - hljs$1.SHEBANG(), + hljs.SHEBANG(), FUNCTION, ARITHMETIC, - COMMENT$2, + COMMENT, HERE_DOC, PATH_MODE, QUOTE_STRING, @@ -190498,14 +190702,14 @@ var init_bash = __esmMin((() => {})); //#endregion //#region node_modules/highlight.js/es/languages/css.js /** @type LanguageFn */ -function css(hljs$1) { - const regex = hljs$1.regex; - const modes = MODES(hljs$1); +function css(hljs) { + const regex = hljs.regex; + const modes = MODES(hljs); const VENDOR_PREFIX = { begin: /-(webkit|moz|ms|o)-(?=[a-z])/ }; const AT_MODIFIERS = "and or not only"; const AT_PROPERTY_RE = /@-?\w[\w]*(-\w+)*/; - const IDENT_RE$6 = "[a-zA-Z-][a-zA-Z0-9_-]*"; - const STRINGS = [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE]; + const IDENT_RE$2 = "[a-zA-Z-][a-zA-Z0-9_-]*"; + const STRINGS = [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE]; return { name: "CSS", case_insensitive: true, @@ -190523,7 +190727,7 @@ function css(hljs$1) { }, { className: "selector-class", - begin: "\\." + IDENT_RE$6, + begin: "\\." + IDENT_RE$2, relevance: 0 }, modes.ATTRIBUTE_SELECTOR_MODE, @@ -190597,13 +190801,13 @@ function css(hljs$1) { } var MODES, HTML_TAGS, SVG_TAGS, TAGS, MEDIA_FEATURES, PSEUDO_CLASSES, PSEUDO_ELEMENTS, ATTRIBUTES; var init_css$1 = __esmMin((() => { - MODES = (hljs$1) => { + MODES = (hljs) => { return { IMPORTANT: { scope: "meta", begin: "!important" }, - BLOCK_COMMENT: hljs$1.C_BLOCK_COMMENT_MODE, + BLOCK_COMMENT: hljs.C_BLOCK_COMMENT_MODE, HEXCOLOR: { scope: "number", begin: /#(([0-9a-fA-F]{3,4})|(([0-9a-fA-F]{2}){3,4}))\b/ @@ -190617,11 +190821,11 @@ var init_css$1 = __esmMin((() => { begin: /\[/, end: /\]/, illegal: "$", - contains: [hljs$1.APOS_STRING_MODE, hljs$1.QUOTE_STRING_MODE] + contains: [hljs.APOS_STRING_MODE, hljs.QUOTE_STRING_MODE] }, CSS_NUMBER_MODE: { scope: "number", - begin: hljs$1.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", + begin: hljs.NUMBER_RE + "(" + "%|em|ex|ch|rem" + "|vw|vh|vmin|vmax" + "|cm|mm|in|pt|pc|px" + "|deg|grad|rad|turn" + "|s|ms" + "|Hz|kHz" + "|dpi|dpcm|dppx" + ")?", relevance: 0 }, CSS_VARIABLE: { @@ -191386,8 +191590,8 @@ var init_css$1 = __esmMin((() => { //#endregion //#region node_modules/highlight.js/es/languages/javascript.js /** @type LanguageFn */ -function javascript(hljs$1) { - const regex = hljs$1.regex; +function javascript(hljs) { + const regex = hljs.regex; /** * Takes a string like ""; + const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs.UNDERSCORE_IDENT_RE + ")\\s*=>"; const FUNCTION_VARIABLE = { match: [ /const|var|let/, @@ -191697,19 +191901,19 @@ function javascript(hljs$1) { }, illegal: /#(?![$_A-z])/, contains: [ - hljs$1.SHEBANG({ + hljs.SHEBANG({ label: "shebang", binary: "node", relevance: 5 }), USE_STRICT, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, TEMPLATE_STRING, - COMMENT$2, + COMMENT, { match: /\$\d+/ }, NUMBER, CLASS_REFERENCE, @@ -191720,12 +191924,12 @@ function javascript(hljs$1) { }, FUNCTION_VARIABLE, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", keywords: "return throw case", relevance: 0, contains: [ - COMMENT$2, - hljs$1.REGEXP_MODE, + COMMENT, + hljs.REGEXP_MODE, { className: "function", begin: FUNC_LEAD_IN_RE, @@ -191735,7 +191939,7 @@ function javascript(hljs$1) { className: "params", variants: [ { - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }, { @@ -191788,10 +191992,10 @@ function javascript(hljs$1) { FUNCTION_DEFINITION, { beginKeywords: "while if switch catch for" }, { - begin: "\\b(?!function)" + hljs$1.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", + begin: "\\b(?!function)" + hljs.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", returnBegin: true, label: "func.def", - contains: [PARAMS, hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [PARAMS, hljs.inherit(hljs.TITLE_MODE, { begin: IDENT_RE$1$1, className: "title.function" })] @@ -191957,7 +192161,7 @@ var init_javascript = __esmMin((() => { //#endregion //#region node_modules/highlight.js/es/languages/json.js -function json(hljs$1) { +function json(hljs) { const ATTRIBUTE = { className: "attr", begin: /"(\\.|[^\\"\r\n])*"(?=\s*:)/, @@ -191968,27 +192172,27 @@ function json(hljs$1) { className: "punctuation", relevance: 0 }; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "null" ]; const LITERALS_MODE = { scope: "literal", - beginKeywords: LITERALS$6.join(" ") + beginKeywords: LITERALS$2.join(" ") }; return { name: "JSON", aliases: ["jsonc"], - keywords: { literal: LITERALS$6 }, + keywords: { literal: LITERALS$2 }, contains: [ ATTRIBUTE, PUNCTUATION, - hljs$1.QUOTE_STRING_MODE, + hljs.QUOTE_STRING_MODE, LITERALS_MODE, - hljs$1.C_NUMBER_MODE, - hljs$1.C_LINE_COMMENT_MODE, - hljs$1.C_BLOCK_COMMENT_MODE + hljs.C_NUMBER_MODE, + hljs.C_LINE_COMMENT_MODE, + hljs.C_BLOCK_COMMENT_MODE ], illegal: "\\S" }; @@ -191997,9 +192201,9 @@ var init_json$1 = __esmMin((() => {})); //#endregion //#region node_modules/highlight.js/es/languages/python.js -function python(hljs$1) { - const regex = hljs$1.regex; - const IDENT_RE$6 = /[\p{XID_Start}_]\p{XID_Continue}*/u; +function python(hljs) { + const regex = hljs.regex; + const IDENT_RE$2 = /[\p{XID_Start}_]\p{XID_Continue}*/u; const RESERVED_WORDS = [ "and", "as", @@ -192036,7 +192240,7 @@ function python(hljs$1) { "with", "yield" ]; - const BUILT_INS$6 = [ + const BUILT_INS$2 = [ "__import__", "abs", "all", @@ -192107,7 +192311,7 @@ function python(hljs$1) { "vars", "zip" ]; - const LITERALS$6 = [ + const LITERALS$2 = [ "__debug__", "Ellipsis", "False", @@ -192115,7 +192319,7 @@ function python(hljs$1) { "NotImplemented", "True" ]; - const TYPES$6 = [ + const TYPES$2 = [ "Any", "Callable", "Coroutine", @@ -192130,12 +192334,12 @@ function python(hljs$1) { "Type", "Union" ]; - const KEYWORDS$6 = { + const KEYWORDS$2 = { $pattern: /[A-Za-z]\w+|__\w+__/, keyword: RESERVED_WORDS, - built_in: BUILT_INS$6, - literal: LITERALS$6, - type: TYPES$6 + built_in: BUILT_INS$2, + literal: LITERALS$2, + type: TYPES$2 }; const PROMPT = { className: "meta", @@ -192145,7 +192349,7 @@ function python(hljs$1) { className: "subst", begin: /\{/, end: /\}/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /#/ }; const LITERAL_BRACKET = { @@ -192154,25 +192358,25 @@ function python(hljs$1) { }; const STRING = { className: "string", - contains: [hljs$1.BACKSLASH_ESCAPE], + contains: [hljs.BACKSLASH_ESCAPE], variants: [ { begin: /([uU]|[bB]|[rR]|[bB][rR]|[rR][bB])?'''/, end: /'''/, - contains: [hljs$1.BACKSLASH_ESCAPE, PROMPT], + contains: [hljs.BACKSLASH_ESCAPE, PROMPT], relevance: 10 }, { begin: /([uU]|[bB]|[rR]|[bB][rR]|[rR][bB])?"""/, end: /"""/, - contains: [hljs$1.BACKSLASH_ESCAPE, PROMPT], + contains: [hljs.BACKSLASH_ESCAPE, PROMPT], relevance: 10 }, { begin: /([fF][rR]|[rR][fF]|[fF])'''/, end: /'''/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, PROMPT, LITERAL_BRACKET, SUBST @@ -192182,7 +192386,7 @@ function python(hljs$1) { begin: /([fF][rR]|[rR][fF]|[fF])"""/, end: /"""/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, PROMPT, LITERAL_BRACKET, SUBST @@ -192210,7 +192414,7 @@ function python(hljs$1) { begin: /([fF][rR]|[rR][fF]|[fF])'/, end: /'/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, LITERAL_BRACKET, SUBST ] @@ -192219,36 +192423,36 @@ function python(hljs$1) { begin: /([fF][rR]|[rR][fF]|[fF])"/, end: /"/, contains: [ - hljs$1.BACKSLASH_ESCAPE, + hljs.BACKSLASH_ESCAPE, LITERAL_BRACKET, SUBST ] }, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE ] }; const digitpart = "[0-9](_?[0-9])*"; const pointfloat = `(\\b(${digitpart}))?\\.(${digitpart})|\\b(${digitpart})\\.`; - const lookahead$4 = `\\b|${RESERVED_WORDS.join("|")}`; + const lookahead = `\\b|${RESERVED_WORDS.join("|")}`; const NUMBER = { className: "number", relevance: 0, variants: [ - { begin: `(\\b(${digitpart})|(${pointfloat}))[eE][+-]?(${digitpart})[jJ]?(?=${lookahead$4})` }, + { begin: `(\\b(${digitpart})|(${pointfloat}))[eE][+-]?(${digitpart})[jJ]?(?=${lookahead})` }, { begin: `(${pointfloat})[jJ]?` }, - { begin: `\\b([1-9](_?[0-9])*|0+(_?0)*)[lLjJ]?(?=${lookahead$4})` }, - { begin: `\\b0[bB](_?[01])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b0[oO](_?[0-7])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b0[xX](_?[0-9a-fA-F])+[lL]?(?=${lookahead$4})` }, - { begin: `\\b(${digitpart})[jJ](?=${lookahead$4})` } + { begin: `\\b([1-9](_?[0-9])*|0+(_?0)*)[lLjJ]?(?=${lookahead})` }, + { begin: `\\b0[bB](_?[01])+[lL]?(?=${lookahead})` }, + { begin: `\\b0[oO](_?[0-7])+[lL]?(?=${lookahead})` }, + { begin: `\\b0[xX](_?[0-9a-fA-F])+[lL]?(?=${lookahead})` }, + { begin: `\\b(${digitpart})[jJ](?=${lookahead})` } ] }; const COMMENT_TYPE = { className: "comment", begin: regex.lookahead(/# type:/), end: /$/, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [{ begin: /# type:/ }, { begin: /#/, end: /\b\B/, @@ -192266,13 +192470,13 @@ function python(hljs$1) { end: /\)/, excludeBegin: true, excludeEnd: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, contains: [ "self", PROMPT, NUMBER, STRING, - hljs$1.HASH_COMMENT_MODE + hljs.HASH_COMMENT_MODE ] }] }; @@ -192289,7 +192493,7 @@ function python(hljs$1) { "ipython" ], unicodeRegex: true, - keywords: KEYWORDS$6, + keywords: KEYWORDS$2, illegal: /(<\/|\?)|=>/, contains: [ PROMPT, @@ -192308,12 +192512,12 @@ function python(hljs$1) { }, STRING, COMMENT_TYPE, - hljs$1.HASH_COMMENT_MODE, + hljs.HASH_COMMENT_MODE, { match: [ /\bdef/, /\s+/, - IDENT_RE$6 + IDENT_RE$2 ], scope: { 1: "keyword", @@ -192325,15 +192529,15 @@ function python(hljs$1) { variants: [{ match: [ /\bclass/, /\s+/, - IDENT_RE$6, + IDENT_RE$2, /\s*/, /\(\s*/, - IDENT_RE$6, + IDENT_RE$2, /\s*\)/ ] }, { match: [ /\bclass/, /\s+/, - IDENT_RE$6 + IDENT_RE$2 ] }], scope: { 1: "keyword", @@ -192358,9 +192562,9 @@ var init_python = __esmMin((() => {})); //#endregion //#region node_modules/highlight.js/es/languages/sql.js -function sql(hljs$1) { - const regex = hljs$1.regex; - const COMMENT_MODE = hljs$1.COMMENT("--", "$"); +function sql(hljs) { + const regex = hljs.regex; + const COMMENT_MODE = hljs.COMMENT("--", "$"); const STRING = { scope: "string", variants: [{ @@ -192374,7 +192578,7 @@ function sql(hljs$1) { end: /"/, contains: [{ match: /""/ }] }; - const LITERALS$6 = [ + const LITERALS$2 = [ "true", "false", "unknown" @@ -192385,7 +192589,7 @@ function sql(hljs$1) { "with timezone", "without timezone" ]; - const TYPES$6 = [ + const TYPES$2 = [ "bigint", "binary", "blob", @@ -192915,7 +193119,7 @@ function sql(hljs$1) { "breadth first" ]; const FUNCTIONS = RESERVED_FUNCTIONS; - const KEYWORDS$6 = [...RESERVED_WORDS, ...NON_RESERVED_WORDS].filter((keyword) => { + const KEYWORDS$2 = [...RESERVED_WORDS, ...NON_RESERVED_WORDS].filter((keyword) => { return !RESERVED_FUNCTIONS.includes(keyword); }); const VARIABLE = { @@ -192961,9 +193165,9 @@ function sql(hljs$1) { illegal: /[{}]|<\//, keywords: { $pattern: /\b[\w\.]+/, - keyword: reduceRelevancy(KEYWORDS$6, { when: (x$2) => x$2.length < 3 }), - literal: LITERALS$6, - type: TYPES$6, + keyword: reduceRelevancy(KEYWORDS$2, { when: (x$2) => x$2.length < 3 }), + literal: LITERALS$2, + type: TYPES$2, built_in: POSSIBLE_WITHOUT_PARENS }, contains: [ @@ -192976,8 +193180,8 @@ function sql(hljs$1) { VARIABLE, STRING, QUOTED_IDENTIFIER, - hljs$1.C_NUMBER_MODE, - hljs$1.C_BLOCK_COMMENT_MODE, + hljs.C_NUMBER_MODE, + hljs.C_BLOCK_COMMENT_MODE, COMMENT_MODE, OPERATOR ] @@ -192988,8 +193192,8 @@ var init_sql = __esmMin((() => {})); //#endregion //#region node_modules/highlight.js/es/languages/typescript.js /** @type LanguageFn */ -function javascript$1(hljs$1) { - const regex = hljs$1.regex; +function javascript$1(hljs) { + const regex = hljs.regex; /** * Takes a string like ""; + const FUNC_LEAD_IN_RE = "(\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)|" + hljs.UNDERSCORE_IDENT_RE + ")\\s*=>"; const FUNCTION_VARIABLE = { match: [ /const|var|let/, @@ -193299,19 +193503,19 @@ function javascript$1(hljs$1) { }, illegal: /#(?![$_A-z])/, contains: [ - hljs$1.SHEBANG({ + hljs.SHEBANG({ label: "shebang", binary: "node", relevance: 5 }), USE_STRICT, - hljs$1.APOS_STRING_MODE, - hljs$1.QUOTE_STRING_MODE, + hljs.APOS_STRING_MODE, + hljs.QUOTE_STRING_MODE, HTML_TEMPLATE, CSS_TEMPLATE, GRAPHQL_TEMPLATE, TEMPLATE_STRING, - COMMENT$2, + COMMENT, { match: /\$\d+/ }, NUMBER, CLASS_REFERENCE, @@ -193322,12 +193526,12 @@ function javascript$1(hljs$1) { }, FUNCTION_VARIABLE, { - begin: "(" + hljs$1.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", + begin: "(" + hljs.RE_STARTERS_RE + "|\\b(case|return|throw)\\b)\\s*", keywords: "return throw case", relevance: 0, contains: [ - COMMENT$2, - hljs$1.REGEXP_MODE, + COMMENT, + hljs.REGEXP_MODE, { className: "function", begin: FUNC_LEAD_IN_RE, @@ -193337,7 +193541,7 @@ function javascript$1(hljs$1) { className: "params", variants: [ { - begin: hljs$1.UNDERSCORE_IDENT_RE, + begin: hljs.UNDERSCORE_IDENT_RE, relevance: 0 }, { @@ -193390,10 +193594,10 @@ function javascript$1(hljs$1) { FUNCTION_DEFINITION, { beginKeywords: "while if switch catch for" }, { - begin: "\\b(?!function)" + hljs$1.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", + begin: "\\b(?!function)" + hljs.UNDERSCORE_IDENT_RE + "\\(" + "[^()]*(\\(" + "[^()]*(\\(" + "[^()]*" + "\\)[^()]*)*" + "\\)[^()]*)*" + "\\)\\s*\\{", returnBegin: true, label: "func.def", - contains: [PARAMS, hljs$1.inherit(hljs$1.TITLE_MODE, { + contains: [PARAMS, hljs.inherit(hljs.TITLE_MODE, { begin: IDENT_RE$1$1, className: "title.function" })] @@ -193421,11 +193625,11 @@ function javascript$1(hljs$1) { }; } /** @type LanguageFn */ -function typescript(hljs$1) { - const regex = hljs$1.regex; - const tsLanguage = javascript$1(hljs$1); +function typescript(hljs) { + const regex = hljs.regex; + const tsLanguage = javascript$1(hljs); const IDENT_RE$1$1 = IDENT_RE; - const TYPES$6 = [ + const TYPES$2 = [ "any", "void", "number", @@ -193441,7 +193645,7 @@ function typescript(hljs$1) { begin: [ /namespace/, /\s+/, - hljs$1.IDENT_RE + hljs.IDENT_RE ], beginScope: { 1: "keyword", @@ -193454,7 +193658,7 @@ function typescript(hljs$1) { excludeEnd: true, keywords: { keyword: "interface extends", - built_in: TYPES$6 + built_in: TYPES$2 }, contains: [tsLanguage.exports.CLASS_REFERENCE] }; @@ -193481,7 +193685,7 @@ function typescript(hljs$1) { $pattern: IDENT_RE, keyword: KEYWORDS.concat(TS_SPECIFIC_KEYWORDS), literal: LITERALS, - built_in: BUILT_INS.concat(TYPES$6), + built_in: BUILT_INS.concat(TYPES$2), "variable.language": BUILT_IN_VARIABLES }; const DECORATOR = { @@ -193497,7 +193701,7 @@ function typescript(hljs$1) { }; Object.assign(tsLanguage.keywords, KEYWORDS$1$1); tsLanguage.exports.PARAMS_CONTAINS.push(DECORATOR); - const ATTRIBUTE_HIGHLIGHT = tsLanguage.contains.find((c$7) => c$7.scope === "attr"); + const ATTRIBUTE_HIGHLIGHT = tsLanguage.contains.find((c$6) => c$6.scope === "attr"); const OPTIONAL_KEY_OR_ARGUMENT = Object.assign({}, ATTRIBUTE_HIGHLIGHT, { match: regex.concat(IDENT_RE$1$1, regex.lookahead(/\s*\?:/)) }); tsLanguage.exports.PARAMS_CONTAINS.push([ tsLanguage.exports.CLASS_REFERENCE, @@ -193510,7 +193714,7 @@ function typescript(hljs$1) { INTERFACE, OPTIONAL_KEY_OR_ARGUMENT ]); - swapMode(tsLanguage, "shebang", hljs$1.SHEBANG()); + swapMode(tsLanguage, "shebang", hljs.SHEBANG()); swapMode(tsLanguage, "use_strict", USE_STRICT); const functionDeclaration = tsLanguage.contains.find((m$3) => m$3.label === "func.def"); functionDeclaration.relevance = 0; @@ -193665,8 +193869,8 @@ var init_typescript = __esmMin((() => { //#endregion //#region node_modules/highlight.js/es/languages/xml.js /** @type LanguageFn */ -function xml(hljs$1) { - const regex = hljs$1.regex; +function xml(hljs) { + const regex = hljs.regex; const TAG_NAME_RE = regex.concat(/[\p{L}_]/u, regex.optional(/[\p{L}0-9_.-]*:/u), /[\p{L}0-9_.-]*/u); const XML_IDENT_RE = /[\p{L}0-9._:-]+/u; const XML_ENTITIES = { @@ -193681,12 +193885,12 @@ function xml(hljs$1) { illegal: /\n/ }] }; - const XML_META_PAR_KEYWORDS = hljs$1.inherit(XML_META_KEYWORDS, { + const XML_META_PAR_KEYWORDS = hljs.inherit(XML_META_KEYWORDS, { begin: /\(/, end: /\)/ }); - const APOS_META_STRING_MODE = hljs$1.inherit(hljs$1.APOS_STRING_MODE, { className: "string" }); - const QUOTE_META_STRING_MODE = hljs$1.inherit(hljs$1.QUOTE_STRING_MODE, { className: "string" }); + const APOS_META_STRING_MODE = hljs.inherit(hljs.APOS_STRING_MODE, { className: "string" }); + const QUOTE_META_STRING_MODE = hljs.inherit(hljs.QUOTE_STRING_MODE, { className: "string" }); const TAG_INTERNALS = { endsWithParent: true, illegal: //, { relevance: 10 }), + hljs.COMMENT(//, { relevance: 10 }), { begin: //, @@ -193857,10 +194061,10 @@ var init_CodeBlock = __esmMin((() => { init_i18n$1(); init_CopyButton(); __decorate$2 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; core_default.registerLanguage("javascript", javascript); core_default.registerLanguage("typescript", typescript); @@ -193928,10 +194132,10 @@ var init_ConsoleBlock = __esmMin((() => { init_lucide(); init_i18n(); __decorate$1 = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; ConsoleBlock = class extends i { constructor() { @@ -194934,7 +195138,7 @@ var init_distance_iterator = __esmMin((() => {})); * * @param patch a string diff or the output from the `parsePatch` or `structuredPatch` methods. */ -function applyPatch(source$4, patch, options = {}) { +function applyPatch(source, patch, options = {}) { let patches; if (typeof patch === "string") { patches = parsePatch(patch); @@ -194946,23 +195150,23 @@ function applyPatch(source$4, patch, options = {}) { if (patches.length > 1) { throw new Error("applyPatch only works with a single input."); } - return applyStructuredPatch(source$4, patches[0], options); + return applyStructuredPatch(source, patches[0], options); } -function applyStructuredPatch(source$4, patch, options = {}) { +function applyStructuredPatch(source, patch, options = {}) { if (options.autoConvertLineEndings || options.autoConvertLineEndings == null) { - if (hasOnlyWinLineEndings(source$4) && isUnix(patch)) { + if (hasOnlyWinLineEndings(source) && isUnix(patch)) { patch = unixToWin(patch); - } else if (hasOnlyUnixLineEndings(source$4) && isWin(patch)) { + } else if (hasOnlyUnixLineEndings(source) && isWin(patch)) { patch = winToUnix(patch); } } - const lines = source$4.split("\n"), hunks = patch.hunks, compareLine = options.compareLine || ((lineNumber, line, operation, patchContent) => line === patchContent), fuzzFactor = options.fuzzFactor || 0; + const lines = source.split("\n"), hunks = patch.hunks, compareLine = options.compareLine || ((lineNumber, line, operation, patchContent) => line === patchContent), fuzzFactor = options.fuzzFactor || 0; let minLine = 0; if (fuzzFactor < 0 || !Number.isInteger(fuzzFactor)) { throw new Error("fuzzFactor must be a non-negative integer"); } if (!hunks.length) { - return source$4; + return source; } let prevLine = "", removeEOFNL = false, addEOFNL = false; for (let i$7 = 0; i$7 < hunks[hunks.length - 1].lines.length; i$7++) { @@ -195189,16 +195393,16 @@ function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, ne return diffLinesResultToPatch(diffLines(oldStr, newStr, optionsObj)); } else { const { callback } = optionsObj; - diffLines(oldStr, newStr, Object.assign(Object.assign({}, optionsObj), { callback: (diff$1) => { - const patch = diffLinesResultToPatch(diff$1); + diffLines(oldStr, newStr, Object.assign(Object.assign({}, optionsObj), { callback: (diff) => { + const patch = diffLinesResultToPatch(diff); callback(patch); } })); } - function diffLinesResultToPatch(diff$1) { - if (!diff$1) { + function diffLinesResultToPatch(diff) { + if (!diff) { return; } - diff$1.push({ + diff.push({ value: "", lines: [] }); @@ -195209,12 +195413,12 @@ function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, ne } const hunks = []; let oldRangeStart = 0, newRangeStart = 0, curRange = [], oldLine = 1, newLine = 1; - for (let i$7 = 0; i$7 < diff$1.length; i$7++) { - const current = diff$1[i$7], lines = current.lines || splitLines(current.value); + for (let i$7 = 0; i$7 < diff.length; i$7++) { + const current = diff[i$7], lines = current.lines || splitLines(current.value); current.lines = lines; if (current.added || current.removed) { if (!oldRangeStart) { - const prev = diff$1[i$7 - 1]; + const prev = diff[i$7 - 1]; oldRangeStart = oldLine; newRangeStart = newLine; if (prev) { @@ -195233,7 +195437,7 @@ function structuredPatch(oldFileName, newFileName, oldStr, newStr, oldHeader, ne } } else { if (oldRangeStart) { - if (lines.length <= context * 2 && i$7 < diff$1.length - 2) { + if (lines.length <= context * 2 && i$7 < diff.length - 2) { for (const line of contextLines(lines)) { curRange.push(line); } @@ -195497,7 +195701,7 @@ var init_ArtifactPill = __esmMin((() => { //#region apps/macos/Sources/Clawdis/Resources/WebChat/tools/artifacts/artifacts-tool-renderer.js function getTextOutput(result) { if (!result) return ""; - return result.content?.filter((c$7) => c$7.type === "text").map((c$7) => c$7.text).join("\n") || ""; + return result.content?.filter((c$6) => c$6.type === "text").map((c$6) => c$6.text).join("\n") || ""; } function getLanguageFromFilename(filename) { if (!filename) return "text"; @@ -195803,10 +196007,10 @@ var init_ChatPanel = __esmMin((() => { init_renderer_registry(); init_i18n(); __decorate = void 0 && (void 0).__decorate || function(decorators, target, key, desc) { - var c$7 = arguments.length, r$10 = c$7 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$5; - if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$10 = Reflect.decorate(decorators, target, key, desc); - else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$5 = decorators[i$7]) r$10 = (c$7 < 3 ? d$5(r$10) : c$7 > 3 ? d$5(target, key, r$10) : d$5(target, key)) || r$10; - return c$7 > 3 && r$10 && Object.defineProperty(target, key, r$10), r$10; + var c$6 = arguments.length, r$9 = c$6 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key) : desc, d$4; + if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r$9 = Reflect.decorate(decorators, target, key, desc); + else for (var i$7 = decorators.length - 1; i$7 >= 0; i$7--) if (d$4 = decorators[i$7]) r$9 = (c$6 < 3 ? d$4(r$9) : c$6 > 3 ? d$4(target, key, r$9) : d$4(target, key)) || r$9; + return c$6 > 3 && r$9 && Object.defineProperty(target, key, r$9), r$9; }; BREAKPOINT = 800; ChatPanel = class ChatPanel$1 extends i {